diff --git a/python/PSI-MOD.obo.xml b/python/PSI-MOD.obo.xml new file mode 100644 index 0000000..cc32133 --- /dev/null +++ b/python/PSI-MOD.obo.xml @@ -0,0 +1,149703 @@ + + + + file + PSI-MOD.obo + +
+ 1.2 + 30:05:2014 00:48 + John S. Garavelli + FormulaOBO.PL + + PSI-MOD-slim + subset of protein modifications + + + DeltaMass-label + Label from MS DeltaMass + + + OMSSA-label + Short label from OMSSA + + + PSI-MOD-alternate + Alternate name curated by PSI-MOD + + + PSI-MOD-label + Short label curated by PSI-MOD + + + PSI-MS-label + Agreed label from MS community + + + RESID-alternate + Alternate name from RESID + + + RESID-misnomer + Misnomer tagged alternate name from RESID + + + RESID-name + Name from RESID + + + RESID-systematic + Systematic name from RESID + + + UniMod-alternate + Alternate name from UniMod + + + UniMod-description + Description (full_name) from UniMod + + + UniMod-interim + Interim label from UniMod + + + UniProt-feature + Protein feature description from UniProtKB + + PSI-MOD + PSI-MOD version: 1.013.0 + RESID release: 75.00 + ISO-8601 date: 2014-01-28 14:22Z + Annotation note 1 - "[PSI-MOD:ref]" has been replaced by PubMed:18688235. + Annotation note 2 - When an entry in the RESID Database is annotated with different sources because the same modification can arise from different encoded amino acids, then the PSI-MOD definition for each different source instance carries the RESID cross-reference followed by a hash symbol "#" and a 3 or 4 character label. When an entry in the RESID Database is annotated as a general modification with the same enzymatic activity producing different chemical structures depending on natural variation in the nonproteinaceous substrate, on secondary modifications that do not change the nature of the primary modification, or on a combination of a primary and one or more secondary modifications on the same residue, then the PSI-MOD definition for each different instance carries the RESID cross-reference followed by the special tag "#var". + Annotation note 3 - When an entry in the UniMod database is annotated as a general modification, and one or more instance sites are listed, then the PSI-MOD definition for each different site instance carries the UniMod cross-reference followed by a hash symbol and an amino acid code, "N-term" or "C-term". + Annotation note 4 - The elemental formulas are in strict alphabetical order, not in CAS ("C" and "H" first) order. Isotope numbers are in parentheses before the element symbol, and an element should not occur in a formula both with and without an isotope number. In difference formulas, counts can be zero or negative. + Annotation note 5 - In entries with an isotope indicator in the formula, average masses are meaningless and are assigned the value equal to the monoisotopic mass, but rounded to a lower precision; monoisotopic masses are calculated by using the masses for the indicated isotopes and the most common isotopes for other elements without isotope indicators in the formulas. + Annotation note 6 - For cross-link modifications, the number following "Cross-link" in the comment record indicates the number of amino acid residues that appear in the origin record, used to check the difference formula and masses. This usage differs from RESID, where the cross-link number indicates the maximum number of peptide chains that can be cross-linked. + Annotation note 7 - The synonym cross-reference "MOD:old name" has been replaced by "MOD:alternate name". + Annotation note 8 - The DeltaMass listings for free amino acids have been removed. Most UniMod entries that have not been "approved" have by general agreement not been incorporated unless there has been a request for a specific term by a PRIDE submitter. + Annotation note 9 - The Open Mass Spectrometry Search Algorithm, OMSSA, enumerated list of modifications are being incorporated. The string values are synonyms with the synonymtypedef "OMSSA-label", and their integer values (which are supposed to be stable) are definition cross-references. +
+ + MOD:00000 + protein modification + + Covalent modification of, or a change resulting in an alteration of the measured molecular mass of, a peptide or protein amino acid residue. + + 18688235 + PubMed + + + PSI-MOD-slim + + ModRes + PSI-MOD-label + + PSI-MOD + 1 + + + MOD:00001 + alkylated residue + + A protein modification that effectively replaces a hydrogen atom with an alkyl group. + + 18688235 + PubMed + + + PSI-MOD-slim + + AlkylRes + PSI-MOD-label + + + + Source + none + + MOD:01156 + PSI-MOD + + + MOD:00002 + O-glycosyl-L-serine + + A protein modification that effectively converts an L-serine residue to O3-glycosylserine. + + 18688235 + PubMed + + + PSI-MOD-slim + + OGlycoSer + PSI-MOD-label + + + + Origin + S + + + + Source + natural + + + + TermSpec + none + + MOD:00396 + MOD:00916 + PSI-MOD + + + MOD:00003 + UniMod + + Entry from UniMod. + + 18688235 + PubMed + + + This term is for organizational use only and should not be assigned. [JSG] + + + Source + none + + MOD:00032 + PSI-MOD + + + MOD:00004 + artifact + + Artifact entry from UniMod - OBSOLETE because organizational use is no longer required. + + 18688235 + PubMed + + + 1 + PSI-MOD + + + MOD:00005 + O-glycosyl-L-threonine + + A protein modification that effectively converts an L-threonine residue to O3-glycosylthreonine. + + 18688235 + PubMed + + + PSI-MOD-slim + + OGlycoThr + PSI-MOD-label + + + + Origin + T + + + + Source + natural + + + + TermSpec + none + + MOD:00396 + MOD:00917 + PSI-MOD + + + MOD:00006 + N-glycosylated residue + + A protein modification that effectively replaces a residue hydrogen atom on a nitrogen with a carbohydrate-like group through a glycosidic bond. + + 18688235 + PubMed + + + PSI-MOD-slim + + NGlycoRes + PSI-MOD-label + + + + Source + none + + MOD:00693 + PSI-MOD + + + MOD:00007 + selenium substitution for sulfur + + A protein modification that effectively substitutes a selenium atom for a sulfur atom. + + 12148805 + PubMed + + + 162 + UniMod + + + + Delta:S(-1)Se(1) + PSI-MS-label + + + Se(S)Res + PSI-MOD-label + + + Selenium replaces sulphur + UniMod-description + + + + DiffAvg + 46.91 + + + + DiffFormula + C 0 H 0 N 0 O 0 S -1 Se 1 + + + + DiffMono + 47.944450 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00745 + PSI-MOD + + + MOD:00008 + common + + Entry from UniMod representing one or more entries in RESID. OBSOLETE because organizational use is no longer required. + + 18688235 + PubMed + + + 1 + PSI-MOD + + + MOD:00009 + natural residue + + A protein modification that removes a residue, or inserts or replaces a residue with a natural, standard or nonstandard, encoded residue. + + 6692818 + PubMed + + + AA0000 + RESID + + + PSI-MOD-slim + + alpha-amino acid + RESID-name + + + Res + PSI-MOD-label + + + + Origin + X + + + + Source + natural + + MOD:01157 + PSI-MOD + + + MOD:00010 + L-alanine residue + + A protein modification that effectively converts a source amino acid residue to an L-alanine. + + 29948 + ChEBI + + + 0 + DeltaMass + + + 6692818 + PubMed + + + AA0001 + RESID + + + PSI-MOD-slim + + (2S)-2-aminopropanoic acid + RESID-systematic + + + 2-aminopropionic acid + RESID-alternate + + + 2-azanylpropanoic acid + RESID-alternate + + + Ala + PSI-MOD-label + + + alpha-alanine + RESID-alternate + + + alpha-aminopropionic acid + RESID-alternate + + + L-alanine + RESID-name + + + + DiffAvg + 0.00 + + + + DiffFormula + C 0 H 0 N 0 O 0 + + + + DiffMono + 0.000000 + + + + Formula + C 3 H 5 N 1 O 1 + + + + MassAvg + 71.08 + + + + MassMono + 71.037114 + + + + Origin + A + + + + Source + natural + + + + TermSpec + none + + MOD:00570 + MOD:00859 + MOD:01441 + PSI-MOD + + + MOD:00011 + L-arginine residue + + A protein modification that effectively converts a source amino acid residue to an L-arginine. + + 29952 + ChEBI + + + 0 + DeltaMass + + + 518876 + PubMed + + + 6692818 + PubMed + + + AA0002 + RESID + + + PSI-MOD-slim + + (2S)-2-amino-5-[(diaminomethylidene)amino]pentanoic acid + RESID-systematic + + + 2-amino-5-(carbamimidamido)pentanoic acid [tautomer] + RESID-alternate + + + 2-amino-5-[(aminoiminomethyl)amino]pentanoic acid [tautomer] + RESID-alternate + + + 2-amino-5-guanidinopentanoic acid + RESID-alternate + + + 2-amino-5-guanidinovaleric acid + RESID-alternate + + + 2-azanyl-5-[bis(azanyl)methylideneazanyl]pentanoic acid + RESID-alternate + + + alpha-amino-delta-guanidinovaleric acid + RESID-alternate + + + Arg + PSI-MOD-label + + + L-arginine + RESID-name + + + + DiffAvg + 0.00 + + + + DiffFormula + C 0 H 0 N 0 O 0 + + + + DiffMono + 0.000000 + + + + Formula + C 6 H 12 N 4 O 1 + + + + MassAvg + 156.19 + + + + MassMono + 156.101111 + + + + Origin + R + + + + Source + natural + + + + TermSpec + none + + MOD:01441 + PSI-MOD + + + MOD:00012 + L-asparagine residue + + A protein modification that effectively converts a source amino acid residue to an L-asparagine. + + 29956 + ChEBI + + + 0 + DeltaMass + + + 15736973 + PubMed + + + 5681232 + PubMed + + + 6692818 + PubMed + + + 9789001 + PubMed + + + AA0003 + RESID + + + PSI-MOD-slim + + (2S)-2-amino-4-butanediamic acid + RESID-systematic + + + 2,4-bis(azanyl)-4-oxobutanoic acid + RESID-alternate + + + 2,4-diamino-4-oxobutanoic acid + RESID-alternate + + + 2-amino-3-carbamoylpropanoic acid + RESID-alternate + + + 2-amino-4-butanediamic acid + RESID-alternate + + + 2-aminosuccinamic acid + RESID-alternate + + + 2-aminosuccinic acid 4-amide + RESID-alternate + + + alpha-amino-beta-carbamylpropionic acid + RESID-alternate + + + alpha-aminosuccinamic acid + RESID-alternate + + + Asn + PSI-MOD-label + + + aspartic acid 4-amide + RESID-alternate + + + aspartic acid beta-amide + RESID-alternate + + + beta-asparagine + RESID-alternate + + + L-asparagine + RESID-name + + + + DiffAvg + 0.00 + + + + DiffFormula + C 0 H 0 N 0 O 0 + + + + DiffMono + 0.000000 + + + + Formula + C 4 H 6 N 2 O 2 + + + + MassAvg + 114.10 + + + + MassMono + 114.042927 + + + + Origin + N + + + + Source + natural + + + + TermSpec + none + + MOD:00859 + MOD:01441 + PSI-MOD + + + MOD:00013 + L-aspartic acid residue + + A protein modification that effectively converts a source amino acid residue to an L-aspartic acid. + + 29958 + ChEBI + + + 0 + DeltaMass + + + 1097438 + PubMed + + + 339692 + PubMed + + + 4399050 + PubMed + + + 5764436 + PubMed + + + 6692818 + PubMed + + + 8089117 + PubMed + + + 9521123 + PubMed + + + 9582379 + PubMed + + + AA0004 + RESID + + + PSI-MOD-slim + + (2S)-2-aminobutanedioic acid + RESID-systematic + + + 2-azanylbutanedioic acid + RESID-alternate + + + aminosuccinic acid + RESID-alternate + + + Asp + PSI-MOD-label + + + L-aspartic acid + RESID-name + + + + DiffAvg + 0.00 + + + + DiffFormula + C 0 H 0 N 0 O 0 + + + + DiffMono + 0.000000 + + + + Formula + C 4 H 5 N 1 O 3 + + + + MassAvg + 115.09 + + + + MassMono + 115.026943 + + + + Origin + D + + + + Source + natural + + + + TermSpec + none + + MOD:00859 + MOD:01441 + PSI-MOD + + + MOD:00014 + L-cysteine residue + + A protein modification that effectively converts a source amino acid residue to an L-cysteine. + + 29950 + ChEBI + + + 0 + DeltaMass + + + 1310545 + PubMed + + + 15790858 + PubMed + + + 3447159 + PubMed + + + 6692818 + PubMed + + + 7338899 + PubMed + + + AA0005 + RESID + + + From DeltaMass: Average Mass: 121. + PSI-MOD-slim + + (2R)-2-amino-3-sulfanylpropanoic acid + RESID-systematic + + + (R)-cysteine + RESID-alternate + + + 2-amino-3-mercaptopropanoic acid + RESID-alternate + + + 2-amino-3-mercaptopropionic acid + RESID-alternate + + + 2-azanyl-3-sulfanylpropanoic acid + RESID-alternate + + + 3-mercapto-L-alanine + RESID-alternate + + + alpha-amino-beta-mercaptopropanoic acid + RESID-alternate + + + alpha-amino-beta-mercaptopropionic acid + RESID-alternate + + + alpha-amino-beta-thiolpropionic acid + RESID-alternate + + + beta-mercaptoalanine + RESID-alternate + + + Cys + PSI-MOD-label + + + Cysteine (C, Cys) + DeltaMass-label + + + half-cystine + RESID-alternate + + + L-(+)-cysteine + RESID-alternate + + + L-cysteine + RESID-name + + + thioserine + RESID-alternate + + + + DiffAvg + 0.00 + + + + DiffFormula + C 0 H 0 N 0 O 0 S 0 + + + + DiffMono + 0.000000 + + + + Formula + C 3 H 5 N 1 O 1 S 1 + + + + MassAvg + 103.14 + + + + MassMono + 103.009185 + + + + Origin + C + + + + Source + natural + + + + TermSpec + none + + MOD:00859 + MOD:01441 + PSI-MOD + + + MOD:00015 + L-glutamic acid residue + + A protein modification that effectively converts a source amino acid residue to an L-glutamic acid. + + 29972 + ChEBI + + + 0 + DeltaMass + + + 1881881 + PubMed + + + 4565668 + PubMed + + + 4922541 + PubMed + + + 6692818 + PubMed + + + 9326660 + PubMed + + + 957425 + PubMed + + + AA0006 + RESID + + + PSI-MOD-slim + + (2S)-2-aminopentanedioic acid + RESID-systematic + + + 1-aminopropane-1,3-dicarboxylic acid + RESID-alternate + + + 2-aminoglutaric acid + RESID-alternate + + + 2-azanylpentanedioic acid + RESID-alternate + + + alpha-aminoglutaric acid + RESID-alternate + + + Glu + PSI-MOD-label + + + glutaminic acid + RESID-alternate + + + L-glutamic acid + RESID-name + + + + DiffAvg + 0.00 + + + + DiffFormula + C 0 H 0 N 0 O 0 + + + + DiffMono + 0.000000 + + + + Formula + C 5 H 7 N 1 O 3 + + + + MassAvg + 129.12 + + + + MassMono + 129.042593 + + + + Origin + E + + + + Source + natural + + + + TermSpec + none + + MOD:00859 + MOD:01441 + PSI-MOD + + + MOD:00016 + L-glutamine residue + + A protein modification that effectively converts a source amino acid residue to an L-glutamine. + + 30011 + ChEBI + + + 0 + DeltaMass + + + 3340166 + PubMed + + + 6692818 + PubMed + + + 9342308 + PubMed + + + AA0007 + RESID + + + PSI-MOD-slim + + (2S)-2-amino-5-pentanediamic acid + RESID-systematic + + + 2,5-bis(azanyl)-5-oxopentanoic acid + RESID-alternate + + + 2,5-diamino-5-oxopentanoic acid + RESID-alternate + + + 2-amino-4-carbamoylbutanoic acid + RESID-alternate + + + 2-aminoglutaramic acid + RESID-alternate + + + alpha-amino-gamma-carbamylbutyric acid + RESID-alternate + + + Gln + PSI-MOD-label + + + glutamic acid 5-amide + RESID-alternate + + + glutamic acid gamma-amide + RESID-alternate + + + glutamide + RESID-alternate + + + L-glutamine + RESID-name + + + + DiffAvg + 0.00 + + + + DiffFormula + C 0 H 0 N 0 O 0 + + + + DiffMono + 0.000000 + + + + Formula + C 5 H 8 N 2 O 2 + + + + MassAvg + 128.13 + + + + MassMono + 128.058578 + + + + Origin + Q + + + + Source + natural + + + + TermSpec + none + + MOD:00894 + MOD:01441 + PSI-MOD + + + MOD:00017 + glycine residue + + A protein modification that effectively converts a source amino acid residue to a glycine. + + 29947 + ChEBI + + + 0 + DeltaMass + + + 1310545 + PubMed + + + 6692818 + PubMed + + + AA0008 + RESID + + + PSI-MOD-slim + + aminoacetic acid + RESID-alternate + + + aminoethanoic acid + RESID-systematic + + + azanylethanoic acid + RESID-alternate + + + Gly + PSI-MOD-label + + + glycine + RESID-name + + + glycocoll + RESID-alternate + + + + DiffAvg + 0.00 + + + + DiffFormula + C 0 H 0 N 0 O 0 + + + + DiffMono + 0.000000 + + + + Formula + C 2 H 3 N 1 O 1 + + + + MassAvg + 57.05 + + + + MassMono + 57.021464 + + + + Origin + G + + + + Source + natural + + + + TermSpec + none + + MOD:01441 + PSI-MOD + + + MOD:00018 + L-histidine residue + + A protein modification that effectively converts a source amino acid residue to an L-histidine. + + 29979 + ChEBI + + + 0 + DeltaMass + + + 14342316 + PubMed + + + 2722967 + PubMed + + + 512 + PubMed + + + 5460889 + PubMed + + + 6129252 + PubMed + + + 6692818 + PubMed + + + 6876174 + PubMed + + + AA0009 + RESID + + + PSI-MOD-slim + + (2S)-2-amino-3-(1H-imidazol-4-yl)propanoic acid + RESID-systematic + + + (2S)-2-amino-3-(1H-imidazol-5-yl)propanoic acid [tautomer] + RESID-alternate + + + 2-azanyl-3-(1H-imidazol-4-yl)propanoic acid + RESID-alternate + + + 2-azanyl-3-(1H-imidazol-5-yl)propanoic acid [tautomer] + RESID-alternate + + + 4-(2-amino-2-carboxyethyl)imidazole + RESID-alternate + + + alpha-amino-beta-(4-imidazole)propionic acid + RESID-alternate + + + glyoxaline-5-alanine + RESID-alternate + + + His + PSI-MOD-label + + + L-histidine + RESID-name + + + + DiffAvg + 0.00 + + + + DiffFormula + C 0 H 0 N 0 O 0 + + + + DiffMono + 0.000000 + + + + Formula + C 6 H 7 N 3 O 1 + + + + MassAvg + 137.14 + + + + MassMono + 137.058912 + + + + Origin + H + + + + Source + natural + + + + TermSpec + none + + MOD:01441 + PSI-MOD + + + MOD:00019 + L-isoleucine residue + + A protein modification that effectively converts a source amino acid residue to an L-isoleucine. + + 30009 + ChEBI + + + 0 + DeltaMass + + + 6692818 + PubMed + + + AA0010 + RESID + + + PSI-MOD-slim + + (2S,3S)-2-amino-3-methylpentanoic acid + RESID-systematic + + + 2-azanyl-3-methylpentanoic acid + RESID-alternate + + + 3-methyl-norvaline + RESID-alternate + + + alpha-amino-beta-methylvaleric acid + RESID-alternate + + + Ile + PSI-MOD-label + + + Isoleucyl + DeltaMass-label + + + L-erythro-isoleucine + RESID-alternate + + + L-isoleucine + RESID-name + + + + DiffAvg + 0.00 + + + + DiffFormula + C 0 H 0 N 0 O 0 + + + + DiffMono + 0.000000 + + + + Formula + C 6 H 11 N 1 O 1 + + + + MassAvg + 113.16 + + + + MassMono + 113.084064 + + + + Origin + I + + + + Source + natural + + + + TermSpec + none + + MOD:00306 + MOD:01441 + PSI-MOD + + + MOD:00020 + L-leucine residue + + A protein modification that effectively converts a source amino acid residue to an L-leucine. + + 30006 + ChEBI + + + 0 + DeltaMass + + + 11478885 + PubMed + + + 6692818 + PubMed + + + AA0011 + RESID + + + PSI-MOD-slim + + (2S)-2-amino-4-methylpentanoic acid + RESID-systematic + + + 2-azanyl-4-methylpentanoic acid + RESID-alternate + + + 4-methyl-norvaline + RESID-alternate + + + alpha-amino-gamma-methylvaleric acid + RESID-alternate + + + alpha-aminoisocaproic acid + RESID-alternate + + + L-leucine + RESID-name + + + Leu + PSI-MOD-label + + + + DiffAvg + 0.00 + + + + DiffFormula + C 0 H 0 N 0 O 0 + + + + DiffMono + 0.000000 + + + + Formula + C 6 H 11 N 1 O 1 + + + + MassAvg + 113.16 + + + + MassMono + 113.084064 + + + + Origin + L + + + + Source + natural + + + + TermSpec + none + + MOD:00306 + MOD:01441 + PSI-MOD + + + MOD:00021 + L-lysine residue + + A protein modification that effectively converts a source amino acid residue to L-lysine. + + 29967 + ChEBI + + + 0 + DeltaMass + + + 3106962 + PubMed + + + 6120171 + PubMed + + + 6692818 + PubMed + + + AA0012 + RESID + + + PSI-MOD-slim + + (2S)-2,6-diaminohexanoic acid + RESID-systematic + + + 2,6-bis(azanyl)hexanoic acid + RESID-alternate + + + 6-amino-L-norleucine + RESID-alternate + + + ACT_SITE Schiff-base intermediate with substrate + UniProt-feature + + + alpha,epsilon-diaminocaproic acid + RESID-alternate + + + L-lysine + RESID-name + + + Lys + PSI-MOD-label + + + + DiffAvg + 0.00 + + + + DiffFormula + C 0 H 0 N 0 O 0 + + + + DiffMono + 0.000000 + + + + Formula + C 6 H 12 N 2 O 1 + + + + MassAvg + 128.18 + + + + MassMono + 128.094963 + + + + Origin + K + + + + Source + natural + + + + TermSpec + none + + MOD:00893 + MOD:01441 + PSI-MOD + + + MOD:00022 + L-methionine residue + + A protein modification that effectively converts a source amino acid residue to L-methionine. + + 29983 + ChEBI + + + 0 + DeltaMass + + + 6411710 + PubMed + + + 6692818 + PubMed + + + AA0013 + RESID + + + From DeltaMass: Average Mass: 149 + PSI-MOD-slim + + (2S)-2-amino-4-(methylsulfanyl)butanoic acid + RESID-systematic + + + 2-amino-4-(methylthio)butanoic acid + RESID-alternate + + + 2-amino-4-(methylthio)butyric acid + RESID-alternate + + + 2-azanyl-4-(methylsulfanyl)butanoic acid + RESID-alternate + + + alpha-amino-gamma-methylmercaptobutyric acid + RESID-alternate + + + alpha-amino-gamma-methylthiobutyric acid + RESID-alternate + + + gamma-methylthio-alpha-aminobutyric acid + RESID-alternate + + + L-(-)-methionine + RESID-alternate + + + L-methionine + RESID-name + + + Met + PSI-MOD-label + + + S-methyl-L-homocysteine + RESID-alternate + + + + DiffAvg + 0.00 + + + + DiffFormula + C 0 H 0 N 0 O 0 S 0 + + + + DiffMono + 0.000000 + + + + Formula + C 5 H 9 N 1 O 1 S 1 + + + + MassAvg + 131.19 + + + + MassMono + 131.040485 + + + + Origin + M + + + + Source + natural + + + + TermSpec + none + + MOD:01441 + PSI-MOD + + + MOD:00023 + L-phenylalanine residue + + A protein modification that effectively converts a source amino acid residue to L-phenylalanine. + + 29997 + ChEBI + + + 0 + DeltaMass + + + 6692818 + PubMed + + + AA0014 + RESID + + + PSI-MOD-slim + + (2S)-2-amino-3-phenylpropanoic acid + RESID-systematic + + + 2-azanyl-3-phenylpropanoic acid + RESID-alternate + + + alpha-amino-beta-phenylpropionic acid + RESID-alternate + + + L-phenylalanine + RESID-name + + + Phe + PSI-MOD-label + + + + DiffAvg + 0.00 + + + + DiffFormula + C 0 H 0 N 0 O 0 + + + + DiffMono + 0.000000 + + + + Formula + C 9 H 9 N 1 O 1 + + + + MassAvg + 147.18 + + + + MassMono + 147.068414 + + + + Origin + F + + + + Source + natural + + + + TermSpec + none + + MOD:01441 + PSI-MOD + + + MOD:00024 + L-proline residue + + A protein modification that effectively converts a source amino acid residue to L-proline. + + 30017 + ChEBI + + + 0 + DeltaMass + + + 6692818 + PubMed + + + 8547259 + PubMed + + + AA0015 + RESID + + + PSI-MOD-slim + + (2S)-2-pyrrolidinecarboxylic acid + RESID-systematic + + + L-proline + RESID-name + + + Pro + PSI-MOD-label + + + pyrrolidine-2-carboxylic acid + RESID-alternate + + + + DiffAvg + 0.00 + + + + DiffFormula + C 0 H 0 N 0 O 0 + + + + DiffMono + 0.000000 + + + + Formula + C 5 H 7 N 1 O 1 + + + + MassAvg + 97.12 + + + + MassMono + 97.052764 + + + + Origin + P + + + + Source + natural + + + + TermSpec + none + + MOD:01441 + PSI-MOD + + + MOD:00025 + L-serine residue + + A protein modification that effectively converts a source amino acid residue to L-serine. + + 29999 + ChEBI + + + 0 + DeltaMass + + + 4399050 + PubMed + + + 6692818 + PubMed + + + AA0016 + RESID + + + PSI-MOD-slim + + (2S)-2-amino-3-hydroxypropanoic acid + RESID-systematic + + + 2-azanyl-3-hydroxypropanoic acid + RESID-alternate + + + 3-hydroxy-L-alanine + RESID-alternate + + + alpha-amino-beta-hydroxypropionic acid + RESID-alternate + + + beta-hydroxyalanine + RESID-alternate + + + L-serine + RESID-name + + + Ser + PSI-MOD-label + + + + DiffAvg + 0.00 + + + + DiffFormula + C 0 H 0 N 0 O 0 + + + + DiffMono + 0.000000 + + + + Formula + C 3 H 5 N 1 O 2 + + + + MassAvg + 87.08 + + + + MassMono + 87.032028 + + + + Origin + S + + + + Source + natural + + + + TermSpec + none + + MOD:01441 + PSI-MOD + + + MOD:00026 + L-threonine residue + + A protein modification that effectively converts a source amino acid residue to L-threonine. + + 30013 + ChEBI + + + 0 + DeltaMass + + + 2989287 + PubMed + + + 6692818 + PubMed + + + AA0017 + RESID + + + PSI-MOD-slim + + (2S,3R)-2-amino-3-hydroxybutanoic acid + RESID-systematic + + + 2-azanyl-3-hydroxybutanoic acid + RESID-alternate + + + alpha-amino-beta-hydroxybutyric acid + RESID-alternate + + + beta-methylserine + RESID-alternate + + + L-threo-threonine + RESID-alternate + + + L-threonine + RESID-name + + + Thr + PSI-MOD-label + + + + DiffAvg + 0.00 + + + + DiffFormula + C 0 H 0 N 0 O 0 + + + + DiffMono + 0.000000 + + + + Formula + C 4 H 7 N 1 O 2 + + + + MassAvg + 101.10 + + + + MassMono + 101.047678 + + + + Origin + T + + + + Source + natural + + + + TermSpec + none + + MOD:01441 + PSI-MOD + + + MOD:00027 + L-tryptophan residue + + A protein modification that effectively converts a source amino acid residue to L-tryptophan. + + 29954 + ChEBI + + + 0 + DeltaMass + + + 2059637 + PubMed + + + 6692818 + PubMed + + + 9324768 + PubMed + + + AA0018 + RESID + + + PSI-MOD-slim + + (2S)-2-amino-3-(1H-indol-3-yl)propanoic acid + RESID-systematic + + + 2-azanyl-3-(1H-indol-3-yl)propanoic acid + RESID-alternate + + + alpha-amino-beta-(3-indolyl)propionoic acid + RESID-alternate + + + beta(3-indolyl)alanine + RESID-alternate + + + L-tryptophan + RESID-name + + + Trp + PSI-MOD-label + + + + DiffAvg + 0.00 + + + + DiffFormula + C 0 H 0 N 0 O 0 + + + + DiffMono + 0.000000 + + + + Formula + C 11 H 10 N 2 O 1 + + + + MassAvg + 186.21 + + + + MassMono + 186.079313 + + + + Origin + W + + + + Source + natural + + + + TermSpec + none + + MOD:01441 + PSI-MOD + + + MOD:00028 + L-tyrosine residue + + A protein modification that effectively converts a source amino acid residue to L-tyrosine. + + 29975 + ChEBI + + + 0 + DeltaMass + + + 2190093 + PubMed + + + 2542938 + PubMed + + + 5550972 + PubMed + + + 6061414 + PubMed + + + 6120171 + PubMed + + + 6692818 + PubMed + + + AA0019 + RESID + + + PSI-MOD-slim + + (2S)-2-amino-3-(4-hydoxyphenyl)propanoic acid + RESID-systematic + + + 2-azanyl-3-(4-hydoxyphenyl)propanoic acid + RESID-alternate + + + alpha-amino-beta-(para-hydroxyphenyl)propionic acid + RESID-alternate + + + L-tyrosine + RESID-name + + + p-tyrosine + RESID-alternate + + + para-hydroxyphenylalanine + RESID-alternate + + + Tyr + PSI-MOD-label + + + + DiffAvg + 0.00 + + + + DiffFormula + C 0 H 0 N 0 O 0 + + + + DiffMono + 0.000000 + + + + Formula + C 9 H 9 N 1 O 2 + + + + MassAvg + 163.18 + + + + MassMono + 163.063329 + + + + Origin + Y + + + + Source + natural + + + + TermSpec + none + + MOD:01441 + PSI-MOD + + + MOD:00029 + L-valine residue + + A protein modification that effectively converts a source amino acid residue to an L-valine. + + 30015 + ChEBI + + + 0 + DeltaMass + + + 6692818 + PubMed + + + AA0020 + RESID + + + PSI-MOD-slim + + (2S)-2-amino-3-methylbutanoic acid + RESID-systematic + + + 2-azanyl-3-methylbutanoic acid + RESID-alternate + + + alpha-amino-beta-methylbutyric acid + RESID-alternate + + + alpha-aminoisovaleric acid + RESID-alternate + + + L-valine + RESID-name + + + Val + PSI-MOD-label + + + + DiffAvg + 0.00 + + + + DiffFormula + C 0 H 0 N 0 O 0 + + + + DiffMono + 0.000000 + + + + Formula + C 5 H 9 N 1 O 1 + + + + MassAvg + 99.13 + + + + MassMono + 99.068414 + + + + Origin + V + + + + Source + natural + + + + TermSpec + none + + MOD:01441 + PSI-MOD + + + MOD:00030 + N-formyl-L-methionine residue + + A protein modification that effectively converts a source amino acid residue to an N-formyl-L-methionine, a natural pretranslational modification. + + 33718 + ChEBI + + + 10825024 + PubMed + + + 11152118 + PubMed + + + 2165784 + PubMed + + + 3042771 + PubMed + + + 8758896 + PubMed + + + AA0021#FMET + RESID + + + 107#N-term + UniMod + + + PSI-MOD-slim + + (2S)-2-formylamino-4-(methylsulfanyl)butanoic acid + RESID-systematic + + + 2-formamido-4-(methylsulfanyl)butanoic acid + RESID-alternate + + + 2-formylamino-4-(methylthio)butanoic acid + RESID-alternate + + + 2-formylazanyl-4-(methylsulfanyl)butanoic acid + RESID-alternate + + + Addition of N-formyl met + UniMod-description + + + fMet + PSI-MOD-label + + + FormylMet + PSI-MS-label + + + MOD_RES N-formylmethionine + UniProt-feature + + + N-formyl-L-methionine + RESID-name + + + N-formylated L-methionine + PSI-MOD-alternate + + + nformylmet + OMSSA-label + + + + DiffAvg + 0.00 + + + + DiffFormula + C 0 H 0 N 0 O 0 S 0 + + + + DiffMono + 0.000000 + + + + Formula + C 6 H 10 N 1 O 2 S 1 + + + + MassAvg + 160.21 + + + + MassMono + 160.043225 + + + + Origin + M + + + + Source + natural + + + + TermSpec + N-term + + MOD:00409 + MOD:00868 + MOD:01696 + PSI-MOD + + + MOD:00031 + L-selenocysteine residue + + A protein modification that effectively converts a source amino acid residue to an L-selenocysteine, a natural pretranslational modification. + + 30000 + ChEBI + + + 10523135 + PubMed + + + 1066676 + PubMed + + + 2037562 + PubMed + + + 2963330 + PubMed + + + 4734725 + PubMed + + + 6076213 + PubMed + + + 6217842 + PubMed + + + 6714945 + PubMed + + + AA0022 + RESID + + + PSI-MOD-slim + + (2R)-2-amino-3-selanylpropanoic acid + RESID-systematic + + + 2-azanyl-3-selanylpropanoic acid + RESID-alternate + + + 3-selenylalanine + RESID-alternate + + + L-selenocysteine + RESID-name + + + NON_STD Selenocysteine + UniProt-feature + + + Sec + PSI-MOD-label + + + SeCys + RESID-alternate + + + selenium cysteine + RESID-alternate + + + + DiffAvg + 0.00 + + + + DiffFormula + C 0 H 0 N 0 O 0 Se 0 + + + + DiffMono + 0.000000 + + + + Formula + C 3 H 5 N 1 O 1 Se 1 + + + + MassAvg + 150.05 + + + + MassMono + 150.953635 + + + + Origin + U + + + + Source + natural + + + + TermSpec + none + + MOD:00745 + MOD:00859 + MOD:00868 + PSI-MOD + + + MOD:00032 + uncategorized protein modification + + A protein modification that is not chemically categorized. + + 18688235 + PubMed + + + This term is for organizational use only and should not be assigned. [JSG] + + + Source + none + + MOD:00000 + PSI-MOD + + + MOD:00033 + crosslinked residues + + A protein modification that crosslinks two or more amino acid residues with covalent bonds. + + 18688235 + PubMed + + + The covalent bond is formed directly between sidechain atoms. If non-aminoacid atoms are involved in connecting two or more peptide chain residues peptide chain, the connection is classified as a multivalent binding site. + PSI-MOD-slim + + XLNK-Res-Res + PSI-MOD-label + + + + Source + none + + MOD:01156 + PSI-MOD + + + MOD:00034 + L-cystine (cross-link) + + A protein modification that effectively cross-links two L-cysteine residues to form L-cystine. + + 16283 + ChEBI + + + 0 + DeltaMass + + + 1988019 + PubMed + + + 2001356 + PubMed + + + 2076469 + PubMed + + + 3083866 + PubMed + + + 366603 + PubMed + + + 7918467 + PubMed + + + 8344916 + PubMed + + + AA0025#CYS2 + RESID + + + Cross-link 2; for formation of a disulfide bond between a peptide cysteine and a free cysteine, see MOD:00765. + PSI-MOD-slim + + (2R,2'R)-3,3'-disulfane-1,2-diylbis(2-aminopropanoic acid) + RESID-systematic + + + 2-amino-3-(2-amino-2-carboxy-ethyl)disulfanyl-propanoic acid + RESID-misnomer + + + 3,3'-disulfane-1,2-diylbis(2-azanylpropanoic acid) + RESID-alternate + + + 3,3'-dithiobis(2-aminopropanoic acid) + RESID-alternate + + + 3,3'-dithiobisalanine + RESID-alternate + + + 3,3'-dithiodialanine + RESID-alternate + + + beta,beta'-diamino-beta,beta'-dicarboxydiethyldisulfide + RESID-alternate + + + beta,beta'-dithiodialanine + RESID-alternate + + + bis(alpha-aminopropionic acid)-beta-disulfide + RESID-alternate + + + bis(beta-amino-beta-carboxyethyl)disulfide + RESID-alternate + + + Cys2 + PSI-MOD-label + + + Cystine ((Cys)2) + DeltaMass-label + + + dicysteine + RESID-alternate + + + DISULFID + UniProt-feature + + + DISULFID Interchain + UniProt-feature + + + L-cystine + RESID-name + + + XLNK-SCys-SCys + PSI-MOD-label + + + + DiffAvg + -2.02 + + + + DiffFormula + C 0 H -2 N 0 O 0 S 0 + + + + DiffMono + -2.015650 + + + + Formula + C 6 H 8 N 2 O 2 S 2 + + + + MassAvg + 204.26 + + + + MassMono + 204.002720 + + + + Origin + C, C + + + + Source + natural + + + + TermSpec + none + + MOD:00689 + PSI-MOD + + + MOD:00035 + (2S,3R)-3-hydroxyasparagine + + A protein modification that effectively converts an L-asparagine residue to (2S,3R)-3-hydroxyasparagine. + + 11823643 + PubMed + + + 2820791 + PubMed + + + AA0026 + RESID + + + PSI-MOD-slim + + (2S,3R)-2,4-diamino-3-hydroxy-4-oxobutanoic acid + RESID-alternate + + + (2S,3R)-2-amino-3-hydroxy-4-butanediamic acid + RESID-systematic + + + (2S,3R)-3-hydroxyasparagine + RESID-name + + + (3R)3HyAsn + PSI-MOD-label + + + 2-azanyl-3-hydroxy-4-butanediamic acid + RESID-alternate + + + erythro-beta-hydroxylated L-asparagine + PSI-MOD-alternate + + + L-erythro-beta-hydroxyasparagine + RESID-alternate + + + MOD_RES (3R)-3-hydroxyasparagine + UniProt-feature + + + + DiffAvg + 16.00 + + + + DiffFormula + C 0 H 0 N 0 O 1 + + + + DiffMono + 15.994915 + + + + Formula + C 4 H 6 N 2 O 3 + + + + MassAvg + 130.10 + + + + MassMono + 130.037842 + + + + Origin + N + + + + Source + natural + + + + TermSpec + none + + MOD:01688 + PSI-MOD + + + MOD:00036 + (2S,3R)-3-hydroxyaspartic acid + + A protein modification that effectively converts an L-aspartic acid residue to (2S,3R)-3-hydroxyaspartic acid. + + 6572939 + PubMed + + + 6871167 + PubMed + + + 8355279 + PubMed + + + AA0027 + RESID + + + 35#D + UniMod + + + PSI-MOD-slim + + (2S,3R)-2-amino-3-hydroxybutanedioic acid + RESID-systematic + + + (2S,3R)-3-hydroxyaspartic acid + RESID-name + + + (3R)3HyAsp + PSI-MOD-label + + + 2-amino-3-hydroxysuccinic acid + RESID-alternate + + + 2-azanyl-3-hydroxybutanedioic acid + RESID-alternate + + + 3-hydroxyaspartic acid + RESID-alternate + + + erythro-beta-hydroxylated L-aspartic acid + PSI-MOD-alternate + + + hydroxylationd + OMSSA-label + + + L-erythro-beta-hydroxyaspartic acid + RESID-alternate + + + MOD_RES (3R)-3-hydroxyaspartate + UniProt-feature + + + Oxidation + PSI-MS-label + + + + DiffAvg + 16.00 + + + + DiffFormula + C 0 H 0 N 0 O 1 + + + + DiffMono + 15.994915 + + + + Formula + C 4 H 5 N 1 O 4 + + + + MassAvg + 131.09 + + + + MassMono + 131.021858 + + + + Origin + D + + + + Source + natural + + + + TermSpec + none + + MOD:01926 + PSI-MOD + + + MOD:00037 + 5-hydroxy-L-lysine + + A protein modification that effectively converts an L-lysine residue to one of the diastereomeric 5-hydroxy-L-lysine residues. + + 60175 + ChEBI + + + 18688235 + PubMed + + + PSI-MOD-slim + + 5-hydroxylated L-lysine + PSI-MOD-alternate + + + 5HyLys + PSI-MOD-label + + + + DiffAvg + 16.00 + + + + DiffFormula + C 0 H 0 N 0 O 1 + + + + DiffMono + 15.994915 + + + + Formula + C 6 H 12 N 2 O 2 + + + + MassAvg + 144.17 + + + + MassMono + 144.089878 + + + + Origin + K + + + + Source + natural + + + + TermSpec + none + + MOD:01047 + PSI-MOD + + + MOD:00038 + 3-hydroxy-L-proline + + A protein modification that effectively converts an L-proline residue to 3-hydroxy-L-proline. + + 16889 + ChEBI + + + 2400108 + PubMed + + + 3734192 + PubMed + + + 4343807 + PubMed + + + AA0029 + RESID + + + PSI-MOD-slim + + (2S,3S)-3-hydroxypyrrolidine-2-carboxylic acid + RESID-systematic + + + 3-hydroxy-L-proline + RESID-name + + + 3-hydroxylated L-proline + PSI-MOD-alternate + + + 3-trans-hydroxy-L-proline + RESID-alternate + + + 3HyPro + PSI-MOD-label + + + beta-hydroxypyrrolidine-alpha-carboxylic acid + RESID-alternate + + + L-threo-3-hydroxyproline + RESID-alternate + + + MOD_RES 3-hydroxyproline + UniProt-feature + + + + DiffAvg + 16.00 + + + + DiffFormula + C 0 H 0 N 0 O 1 + + + + DiffMono + 15.994915 + + + + Formula + C 5 H 7 N 1 O 2 + + + + MassAvg + 113.12 + + + + MassMono + 113.047678 + + + + Origin + P + + + + Source + natural + + + + TermSpec + none + + MOD:01024 + PSI-MOD + + + MOD:00039 + 4-hydroxy-L-proline + + A protein modification that effectively converts an L-proline residue to 4-hydroxy-L-proline + + 18095 + ChEBI + + + 11292863 + PubMed + + + 2400108 + PubMed + + + 3734192 + PubMed + + + AA0030 + RESID + + + PSI-MOD-slim + + (2S,4R)-4-hydroxypyrrolidine-2-carboxylic acid + RESID-systematic + + + 4-hydroxy-L-proline + RESID-name + + + 4-hydroxylated L-proline + PSI-MOD-alternate + + + 4-hydroxyproline + RESID-alternate + + + 4-trans-hydroxy-L-proline + RESID-alternate + + + 4HyPro + PSI-MOD-label + + + gamma-hydroxypyrrolidine-alpha-carboxylic acid + RESID-alternate + + + L-threo-4-hydroxyproline + RESID-alternate + + + MOD_RES 4-hydroxyproline + UniProt-feature + + + + DiffAvg + 16.00 + + + + DiffFormula + C 0 H 0 N 0 O 1 + + + + DiffMono + 15.994915 + + + + Formula + C 5 H 7 N 1 O 2 + + + + MassAvg + 113.12 + + + + MassMono + 113.047678 + + + + Origin + P + + + + Source + natural + + + + TermSpec + none + + MOD:01024 + PSI-MOD + + + MOD:00040 + 2-pyrrolidone-5-carboxylic acid (Gln) + + A protein modification that effectively converts an L-glutamine residue to 2-pyrrolidone-5-carboxylic acid. + + 30652 + ChEBI + + + 123 + DeltaMass + + + 10214721 + PubMed + + + 1836357 + PubMed + + + 26343 + PubMed + + + 3473473 + PubMed + + + AA0031#GLN + RESID + + + 28#Q + UniMod + + + DeltaMass gives a formula C 5 H 5 N 1 O 2 with mass 111.1 + PSI-MOD-slim + + (2S)-5-oxo-2-pyrrolidinecarboxylic acid + RESID-systematic + + + 2-oxopyrrolidine-5-carboxylic acid + RESID-alternate + + + 2-pyrrolidone-5-carboxylic acid + RESID-name + + + 5-oxoproline + RESID-alternate + + + 5-oxopyrrolidine-2-carboxylic acid + RESID-alternate + + + 5-pyrrolidone-2-carboxylic acid + RESID-alternate + + + Gln->pyro-Glu + PSI-MS-label + + + MOD_RES Pyrrolidone carboxylic acid + UniProt-feature + + + N-pyrrolidone carboxyl (N terminus) + DeltaMass-label + + + ntermpeppyroq + OMSSA-label + + + PCA + RESID-alternate + + + PyrGlu(Gln) + PSI-MOD-label + + + Pyro-glu from Q + UniMod-description + + + pyroglutamic acid + RESID-alternate + + + Pyroglutamic Acid formed from Gln + DeltaMass-label + + + Pyroglutamyl + DeltaMass-label + + + + DiffAvg + -17.03 + + + + DiffFormula + C 0 H -3 N -1 O 0 + + + + DiffMono + -17.026549 + + + + Formula + C 5 H 6 N 1 O 2 + + + + MassAvg + 112.11 + + + + MassMono + 112.039853 + + + + Origin + Q + + + + Source + natural + + + + TermSpec + N-term + + MOD:00907 + MOD:01048 + MOD:01160 + PSI-MOD + + + MOD:00041 + L-gamma-carboxyglutamic acid + + A protein modification that effectively converts an L-glutamic acid residue to L-gamma-carboxyglutamic acid. + + 217 + DeltaMass + + + 10517147 + PubMed + + + 1807167 + PubMed + + + 3263814 + PubMed + + + 4528109 + PubMed + + + 7457858 + PubMed + + + 8135347 + PubMed + + + 8868490 + PubMed + + + 9188685 + PubMed + + + AA0032 + RESID + + + 299#E + UniMod + + + DeltaMass has an incorrect formula C 6 H 7 N 5 O 1 (N and O reversed) with mass 173. + PSI-MOD-slim + + (3S)-3-aminopropane-1,1,3-tricarboxylic acid + RESID-systematic + + + (3S)-3-azanylpropane-1,1,3-tricarboxylic acid + RESID-alternate + + + 1-carboxyglutamic acid + RESID-misnomer + + + 3-amino-1,1,3-propanetricarboxylic acid + RESID-alternate + + + 3-azanylpropane-1,1,3-tricarboxylic acid + RESID-alternate + + + 4-carboxyglutamic acid + RESID-alternate + + + 4CbxGlu + PSI-MOD-label + + + Carboxy + PSI-MS-label + + + Carboxy + UniMod-interim + + + Carboxy Glutamyl + DeltaMass-label + + + Carboxylation + UniMod-description + + + gamma-carboxylated L-glutamic acid + PSI-MOD-alternate + + + gammacarboxyle + OMSSA-label + + + L-gamma-carboxyglutamic acid + RESID-name + + + MOD_RES 4-carboxyglutamate + UniProt-feature + + + + DiffAvg + 44.01 + + + + DiffFormula + C 1 H 0 N 0 O 2 + + + + DiffMono + 43.989829 + + + + Formula + C 6 H 7 N 1 O 5 + + + + MassAvg + 173.12 + + + + MassMono + 173.032422 + + + + Origin + E + + + + Source + natural + + + + TermSpec + none + + MOD:00906 + MOD:01152 + PSI-MOD + + + MOD:00042 + L-aspartic 4-phosphoric anhydride + + A protein modification that effectively converts an L-aspartic acid residue to L-aspartic 4-phosphoric anhydride. + + 15836 + ChEBI + + + 4357737 + PubMed + + + AA0033 + RESID + + + 21#D + UniMod + + + + (2S)-2-amino-4-oxo-4-(phosphonooxy)butanoic acid + RESID-systematic + + + 2-aminobutanedioic 4-phosphoric anhydride + RESID-alternate + + + 2-azanyl-4-oxo-4-(phosphonooxy)butanoic acid + RESID-alternate + + + 4-oxo-O-phosphono-L-homoserine + RESID-alternate + + + 4-phosphoaspartic acid + RESID-alternate + + + 4-phosphorylated L-aspartatic acid + PSI-MOD-alternate + + + ACT_SITE 4-aspartylphosphate intermediate + UniProt-feature + + + beta-aspartyl phosphate + RESID-alternate + + + L-aspartic 4-phosphoric anhydride + RESID-name + + + MOD_RES 4-aspartylphosphate + UniProt-feature + + + PAsp + PSI-MOD-label + + + Phospho + PSI-MS-label + + + Phosphorylation + UniMod-description + + + + DiffAvg + 79.98 + + + + DiffFormula + C 0 H 1 N 0 O 3 P 1 + + + + DiffMono + 79.966331 + + + + Formula + C 4 H 6 N 1 O 6 P 1 + + + + MassAvg + 195.07 + + + + MassMono + 194.993274 + + + + Origin + D + + + + Source + natural + + + + TermSpec + none + + MOD:00904 + MOD:01455 + PSI-MOD + + + MOD:00043 + S-phospho-L-cysteine + + A protein modification that effectively converts an L-cysteine residue to S-phospho-L-cysteine. + + 3142516 + PubMed + + + 7961745 + PubMed + + + 8128219 + PubMed + + + AA0034 + RESID + + + 21#C + UniMod + + + + (2R)-2-amino-3-(phosphonosulfanyl)propanoic acid + RESID-systematic + + + 2-azanyl-3-(phosphonosulfanyl)propanoic acid + RESID-alternate + + + ACT_SITE Phosphocysteine intermediate + UniProt-feature + + + cysteine phosphate thioester + RESID-alternate + + + MOD_RES Phosphocysteine + UniProt-feature + + + PCys + PSI-MOD-label + + + Phospho + PSI-MS-label + + + Phosphorylation + UniMod-description + + + S-phospho-L-cysteine + RESID-name + + + S-phosphonocysteine + RESID-alternate + + + S-phosphorylated L-cysteine + PSI-MOD-alternate + + + S3-phosphocysteine + RESID-alternate + + + + DiffAvg + 79.98 + + + + DiffFormula + C 0 H 1 N 0 O 3 P 1 S 0 + + + + DiffMono + 79.966331 + + + + Formula + C 3 H 6 N 1 O 4 P 1 S 1 + + + + MassAvg + 183.12 + + + + MassMono + 182.975515 + + + + Origin + C + + + + Source + natural + + + + TermSpec + none + + MOD:00696 + MOD:00777 + MOD:00905 + PSI-MOD + + + MOD:00044 + 1'-phospho-L-histidine + + A protein modification that effectively converts an L-histidine residue to tele-phospho-L-histidine (N-tau-phospho-L-histidine, 1'-phospho-L-histidine). + + 11038361 + PubMed + + + 5642389 + PubMed + + + 6692818 + PubMed + + + AA0035 + RESID + + + PSI-MOD-slim + + (2S)-2-amino-3-(1-phosphono-1H-imidazol-4-yl)propanoic acid + RESID-systematic + + + 1'-phospho-L-histidine + RESID-name + + + 2-azanyl-3-(1-phosphono-1H-imidazol-4-yl)propanoic acid + RESID-alternate + + + ACT_SITE Tele-phosphohistidine intermediate + UniProt-feature + + + histidine-3-phosphate + RESID-misnomer + + + histidine-N(epsilon)-phosphate + RESID-alternate + + + histidine-N1'-phosphate + RESID-alternate + + + MOD_RES Tele-phosphohistidine + UniProt-feature + + + N(tau)-phosphohistidine + RESID-alternate + + + N1-phosphonohistidine + RESID-alternate + + + NE2-phosphonohistidine + RESID-alternate + + + Ntau-phosphorylated L-histidine + PSI-MOD-alternate + + + NtPHis + PSI-MOD-label + + + Phospho + PSI-MS-label + + + Phosphorylation + UniMod-description + + + tele-phosphohistidine + RESID-alternate + + + + DiffAvg + 79.98 + + + + DiffFormula + C 0 H 1 N 0 O 3 P 1 + + + + DiffMono + 79.966331 + + + + Formula + C 6 H 8 N 3 O 4 P 1 + + + + MassAvg + 217.12 + + + + MassMono + 217.025242 + + + + Origin + H + + + + Source + natural + + + + TermSpec + none + + MOD:00890 + PSI-MOD + + + MOD:00045 + 3'-phospho-L-histidine + + A protein modification that effectively converts an L-histidine residue to pros-phospho-L-histidine (N-pi-phospho-L-histidine, 3'-phospho-L-histidine). + + 1549615 + PubMed + + + 5642389 + PubMed + + + 6692818 + PubMed + + + 7669763 + PubMed + + + 7803390 + PubMed + + + AA0036 + RESID + + + PSI-MOD-slim + + (2S)-2-amino-3-(3-phosphono-3H-imidazol-4-yl)propanoic acid + RESID-systematic + + + 2-azanyl-3-(3-phosphono-3H-imidazol-4-yl)propanoic acid + RESID-alternate + + + 3'-phospho-L-histidine + RESID-name + + + ACT_SITE Pros-phosphohistidine intermediate + UniProt-feature + + + histidine-1-phosphate + RESID-misnomer + + + histidine-N(delta)-phosphate + RESID-alternate + + + histidine-N3'-phosphate + RESID-alternate + + + MOD_RES Pros-phosphohistidine + UniProt-feature + + + N(pi)-phosphohistidine + RESID-alternate + + + N3-phosphonohistidine + RESID-alternate + + + ND1-phosphonohistidine + RESID-alternate + + + Npi-phosphorylated L-histidine + PSI-MOD-alternate + + + NpPHis + PSI-MOD-label + + + Phospho + PSI-MS-label + + + Phosphorylation + UniMod-description + + + pros-phosphohistidine + RESID-alternate + + + + DiffAvg + 79.98 + + + + DiffFormula + C 0 H 1 N 0 O 3 P 1 + + + + DiffMono + 79.966331 + + + + Formula + C 6 H 8 N 3 O 4 P 1 + + + + MassAvg + 217.12 + + + + MassMono + 217.025242 + + + + Origin + H + + + + Source + natural + + + + TermSpec + none + + MOD:00890 + PSI-MOD + + + MOD:00046 + O-phospho-L-serine + + A protein modification that effectively converts an L-serine residue to O-phospho-L-serine. + + 15811 + ChEBI + + + 0 + DeltaMass + + + 12923550 + PubMed + + + 4065410 + PubMed + + + 8061611 + PubMed + + + AA0037 + RESID + + + 21#S + UniMod + + + PSI-MOD-slim + + (2S)-2-amino-3-(phosphonooxy)propanoic acid + RESID-systematic + + + 2-amino-3-hydroxypropanoic acid 3-phosphate + RESID-alternate + + + 2-azanyl-3-(phosphonooxy)propanoic acid + RESID-alternate + + + ACT_SITE Phosphoserine intermediate + UniProt-feature + + + MOD_RES Phosphoserine + UniProt-feature + + + O-phospho-L-serine + RESID-name + + + O-phosphonoserine + RESID-alternate + + + O-phosphorylated L-serine + PSI-MOD-alternate + + + O3-phosphoserine + RESID-alternate + + + OPSer + PSI-MOD-label + + + Phospho + PSI-MS-label + + + Phospho Seryl + DeltaMass-label + + + Phosphorylation + UniMod-description + + + phosphorylations + OMSSA-label + + + serine phosphate ester + RESID-alternate + + + + DiffAvg + 79.98 + + + + DiffFormula + C 0 H 1 N 0 O 3 P 1 + + + + DiffMono + 79.966331 + + + + Formula + C 3 H 6 N 1 O 5 P 1 + + + + MassAvg + 167.06 + + + + MassMono + 166.998359 + + + + Origin + S + + + + Source + natural + + + + TermSpec + none + + MOD:00771 + MOD:00916 + MOD:01455 + PSI-MOD + + + MOD:00047 + O-phospho-L-threonine + + A protein modification that effectively converts an L-threonine residue to O-phospho-L-threonine. + + 21967 + ChEBI + + + 0 + DeltaMass + + + 12923550 + PubMed + + + 7678926 + PubMed + + + AA0038 + RESID + + + 21#T + UniMod + + + PSI-MOD-slim + + (2S,3R)-2-amino-3-(phosphonooxy)butanoic acid + RESID-systematic + + + 2-amino-3-hydroxybutanoic acid 3-phosphate + RESID-alternate + + + 2-azanyl-3-(phosphonooxy)butanoic acid + RESID-alternate + + + MOD_RES Phosphothreonine + UniProt-feature + + + O-phospho-L-threonine + RESID-name + + + O-phosphorylated L-threonine + PSI-MOD-alternate + + + O3-phosphothreonine + RESID-alternate + + + OPThr + PSI-MOD-label + + + Phospho + PSI-MS-label + + + Phospho Threonyl + DeltaMass-label + + + Phosphorylation + UniMod-description + + + phosphorylationt + OMSSA-label + + + threonine phosphate ester + RESID-alternate + + + + DiffAvg + 79.98 + + + + DiffFormula + C 0 H 1 N 0 O 3 P 1 + + + + DiffMono + 79.966331 + + + + Formula + C 4 H 8 N 1 O 5 P 1 + + + + MassAvg + 181.08 + + + + MassMono + 181.014009 + + + + Origin + T + + + + Source + natural + + + + TermSpec + none + + MOD:00773 + MOD:00917 + MOD:01455 + PSI-MOD + + + MOD:00048 + O4'-phospho-L-tyrosine + + A protein modification that effectively converts an L-tyrosine residue to O4'-phospho-L-tyrosine. + + 0 + DeltaMass + + + 10226369 + PubMed + + + 1725475 + PubMed + + + AA0039 + RESID + + + 21#Y + UniMod + + + PSI-MOD-slim + + (2S)-2-amino-3-(4-phosphonooxyphenyl)propanoic acid + RESID-systematic + + + 2-amino-3-(4-hydroxyphenyl)propanoic acid 4'-phosphate + RESID-alternate + + + 2-azanyl-3-(4-phosphonooxyphenyl)propanoic acid + RESID-alternate + + + MOD_RES Phosphotyrosine + UniProt-feature + + + O4'-phospho-L-tyrosine + RESID-name + + + O4'-phosphorylated L-tyrosine + PSI-MOD-alternate + + + O4-phosphotyrosine + RESID-alternate + + + OPTyr + PSI-MOD-label + + + Phospho + PSI-MS-label + + + Phospho Tyrosinyl + DeltaMass-label + + + Phosphorylation + UniMod-description + + + phosphorylationy + OMSSA-label + + + tyrosine phosphate + RESID-alternate + + + + DiffAvg + 79.98 + + + + DiffFormula + C 0 H 1 N 0 O 3 P 1 + + + + DiffMono + 79.966331 + + + + Formula + C 9 H 10 N 1 O 5 P 1 + + + + MassAvg + 243.15 + + + + MassMono + 243.029659 + + + + Origin + Y + + + + Source + natural + + + + TermSpec + none + + MOD:00774 + MOD:00919 + MOD:01455 + PSI-MOD + + + MOD:00049 + 2'-[3-carboxamido-3-(trimethylammonio)propyl]-L-histidine + + A protein modification that effectively converts an L-histidine residue to diphthamide. + + 16692 + ChEBI + + + 122 + DeltaMass + + + 15316019 + PubMed + + + 7430147 + PubMed + + + AA0040 + RESID + + + 375#H + UniMod + + + + (2R)-1-amino-4-(4-[(2S)-2-amino-2-carboxyethyl]-1H-imidazol-2-yl)-N,N,N-trimethyl-1-oxobutan-2-aminium + RESID-systematic + + + (3-[4-(2-amino-2-carboxy-ethyl)-1H-imidazol-2-yl]-1-carbamoyl-propyl)-trimethylammonium + RESID-alternate + + + 1-azanyl-4-(4-[2-azanyl-2-carboxyethyl]-1H-imidazol-2-yl)-N,N,N-trimethyl-1-oxobutan-2-azanium + RESID-alternate + + + 2'-[3-carboxamido-3-(trimethylammonio)propyl]-L-histidine + RESID-name + + + 2-[(R)-3-carboxamido-3-(trimethylammonio)propyl]-4-((S)-2-amino-2-carboxyethyl)-1H-imidazole + RESID-alternate + + + 2-[3-carboxamido-3-(trimethylammonio)propyl]histidine + RESID-alternate + + + 2-amino-3-[[2-(3-amino-3-carbamoyl-prop-1-enyl)-1,1,3-trimethyl-2,3-dihydroimidazol-5-yl]]propanoic acid + RESID-alternate + + + 2-amino-4-[[5-(2-amino-2-carboxylato-ethyl)-1,1,3-trimethyl-2,3-dihydroimidazol-2-yl]]but-3-enamide + RESID-alternate + + + alpha-(aminocarbonyl)-4-(2-amino-2-carboxyethyl)-N,N,N-trimethyl-1H-imidazole-2-propanaminium + RESID-alternate + + + Diphth + PSI-MOD-label + + + Diphthamide + PSI-MS-label + + + Diphthamide + UniMod-description + + + diphthamide + RESID-alternate + + + diphthamide (from histidine) + DeltaMass-label + + + MOD_RES Diphthamide + UniProt-feature + + + + DiffAvg + 143.21 + + + + DiffFormula + C 7 H 15 N 2 O 1 + + + + DiffMono + 143.117890 + + + + FormalCharge + 1+ + + + + Formula + C 13 H 22 N 5 O 2 + + + + MassAvg + 280.35 + + + + MassMono + 280.176801 + + + + Origin + H + + + + Source + natural + + + + TermSpec + none + + MOD:00909 + PSI-MOD + + + MOD:00050 + N-acetyl-L-alanine + + A protein modification that effectively converts an L-alanine residue to N-acetyl-L-alanine. + + 363452 + PubMed + + + 4700463 + PubMed + + + AA0041 + RESID + + + PSI-MOD-slim + + (2S)-2-(acetamido)propanoic acid + RESID-systematic + + + 2-(acetylamino)propanoic acid + RESID-alternate + + + 2-(acetylazanyl)propanoic acid + RESID-alternate + + + AcAla + PSI-MOD-label + + + acetylalanine + RESID-alternate + + + MOD_RES N-acetylalanine + UniProt-feature + + + N-acetyl-L-alanine + RESID-name + + + N-acetylated L-alanine + PSI-MOD-alternate + + + + DiffAvg + 42.04 + + + + DiffFormula + C 2 H 2 N 0 O 1 + + + + DiffMono + 42.010565 + + + + Formula + C 5 H 8 N 1 O 2 + + + + MassAvg + 114.12 + + + + MassMono + 114.055504 + + + + Origin + A + + + + Source + natural + + + + TermSpec + N-term + + MOD:00901 + MOD:01458 + PSI-MOD + + + MOD:00051 + N-acetyl-L-aspartic acid + + A protein modification that effectively converts an L-aspartic acid residue to N-acetyl-L-aspartic acid. + + 21547 + ChEBI + + + 1560020 + PubMed + + + 2395459 + PubMed + + + AA0042 + RESID + + + PSI-MOD-slim + + (2S)-2-(acetamido)butanedioic acid + RESID-systematic + + + 2-(acetylamino)butanedioic acid + RESID-alternate + + + 2-(acetylazanyl)butanedioic acid + RESID-alternate + + + AcAsp + PSI-MOD-label + + + acetylaspartic acid + RESID-alternate + + + MOD_RES N-acetylaspartate + UniProt-feature + + + N-acetyl-L-aspartic acid + RESID-name + + + N-acetylated L-aspartic acid + PSI-MOD-alternate + + + + DiffAvg + 42.04 + + + + DiffFormula + C 2 H 2 N 0 O 1 + + + + DiffMono + 42.010565 + + + + Formula + C 6 H 8 N 1 O 4 + + + + MassAvg + 158.13 + + + + MassMono + 158.045333 + + + + Origin + D + + + + Source + natural + + + + TermSpec + N-term + + MOD:00904 + MOD:01458 + PSI-MOD + + + MOD:00052 + N-acetyl-L-cysteine + + A protein modification that effectively converts an L-cysteine residue to N-acetyl-L-cysteine. + + 28939 + ChEBI + + + 11857757 + PubMed + + + 11999733 + PubMed + + + 12175151 + PubMed + + + 14730666 + PubMed + + + 1500421 + PubMed + + + 15350136 + PubMed + + + 6725286 + PubMed + + + AA0043 + RESID + + + incidental to RESID:AA0223 + PSI-MOD-slim + + (2R)-2-acetamido-3-sulfanylpropanoic acid + RESID-systematic + + + 2-acetylamino-3-mercaptopropanoic acid + RESID-alternate + + + 2-acetylamino-3-sulfanylpropanoic acid + RESID-alternate + + + 2-acetylazanyl-3-sulfanylpropanoic acid + RESID-alternate + + + Acetyl + PSI-MS-label + + + MOD_RES N-acetylcysteine + UniProt-feature + + + N-acetyl-L-cysteine + RESID-name + + + N-acetylated cysteine + PSI-MOD-alternate + + + N-acetylcysteine + RESID-alternate + + + NAcCys + PSI-MOD-label + + + + DiffAvg + 42.04 + + + + DiffFormula + C 2 H 2 N 0 O 1 S 0 + + + + DiffMono + 42.010565 + + + + Formula + C 5 H 8 N 1 O 2 S 1 + + + + MassAvg + 146.18 + + + + MassMono + 146.027574 + + + + Origin + C + + + + Source + natural + + + + TermSpec + N-term + + MOD:00646 + MOD:01458 + PSI-MOD + + + MOD:00053 + N-acetyl-L-glutamic acid + + A protein modification that effectively converts an L-glutamic acid residue to N-acetyl-L-glutamic acid. + + 17533 + ChEBI + + + 6725286 + PubMed + + + AA0044 + RESID + + + PSI-MOD-slim + + (2S)-2-(acetamido)pentanedioic acid + RESID-systematic + + + 2-(acetylamino)pentanedioic acid + RESID-alternate + + + 2-(acetylazanyl)pentanedioic acid + RESID-alternate + + + acetylglutamic acid + RESID-alternate + + + AcGlu + PSI-MOD-label + + + MOD_RES N-acetylglutamate + UniProt-feature + + + N-acetyl-L-glutamic acid + RESID-name + + + N-acetylated L-glutamic acid + PSI-MOD-alternate + + + + DiffAvg + 42.04 + + + + DiffFormula + C 2 H 2 N 0 O 1 + + + + DiffMono + 42.010565 + + + + Formula + C 7 H 10 N 1 O 4 + + + + MassAvg + 172.16 + + + + MassMono + 172.060983 + + + + Origin + E + + + + Source + natural + + + + TermSpec + N-term + + MOD:00906 + MOD:01458 + PSI-MOD + + + MOD:00054 + N-acetyl-L-glutamine + + A protein modification that effectively converts an L-glutamine residue to N-acetyl-L-glutamine. + + AA0045 + RESID + + + This is a deprecated entry in RESID. It probably does not occur naturally [JSG]. + + (2S)-2-acetamido-5-pentanediamic acid + RESID-systematic + + + 2-acetylamino-5-amino-5-oxopentanoic acid + RESID-alternate + + + 2-acetylamino-5-pentanediamic acid + RESID-alternate + + + 2-acetylazanyl-5-azanyl-5-oxopentanoic acid + RESID-alternate + + + acetylglutamine + RESID-alternate + + + AcGln + PSI-MOD-label + + + N-acetyl-L-glutamine + RESID-name + + + N-acetylated L-glutamine + PSI-MOD-alternate + + + + DiffAvg + 42.04 + + + + DiffFormula + C 2 H 2 N 0 O 1 + + + + DiffMono + 42.010565 + + + + Formula + C 7 H 11 N 2 O 3 + + + + MassAvg + 171.18 + + + + MassMono + 171.076967 + + + + Origin + Q + + + + Source + artifact + + + + TermSpec + N-term + + MOD:00907 + MOD:01458 + PSI-MOD + + + MOD:00055 + N-acetylglycine + + A protein modification that effectively converts a glycine residue to N-acetylglycine. + + 272676 + PubMed + + + 5545094 + PubMed + + + 6754709 + PubMed + + + AA0046 + RESID + + + PSI-MOD-slim + + (acetylamino)acetic acid + RESID-alternate + + + (acetylazanyl)ethanoic acid + RESID-alternate + + + 2-(acetamido)ethanoic acid + RESID-systematic + + + 2-(acetylamino)ethanoic acid + RESID-alternate + + + aceturic acid + RESID-alternate + + + AcGly + PSI-MOD-label + + + MOD_RES N-acetylglycine + UniProt-feature + + + N-acetylated glycine + PSI-MOD-alternate + + + N-acetylglycine + RESID-name + + + + DiffAvg + 42.04 + + + + DiffFormula + C 2 H 2 N 0 O 1 + + + + DiffMono + 42.010565 + + + + Formula + C 4 H 6 N 1 O 2 + + + + MassAvg + 100.10 + + + + MassMono + 100.039853 + + + + Origin + G + + + + Source + natural + + + + TermSpec + N-term + + MOD:00908 + MOD:01458 + PSI-MOD + + + MOD:00056 + N-acetyl-L-isoleucine + + A protein modification that effectively converts an L-isoleucine residue to N-acetyl-L-isoleucine. + + 8034631 + PubMed + + + AA0047 + RESID + + + This is a deprecated entry in RESID. It probably does not occur naturally [JSG]. + + (2S,3S)-2-acetamido-3-methylpentanoic acid + RESID-systematic + + + 2-acetylamino-3-methylpentanoic acid + RESID-alternate + + + 2-acetylazanyl-3-methylpentanoic acid + RESID-alternate + + + acetylisoleucine + RESID-alternate + + + AcIle + PSI-MOD-label + + + N-acetyl-L-isoleucine + RESID-name + + + N-acetylated L-isoleucine + PSI-MOD-alternate + + + + DiffAvg + 42.04 + + + + DiffFormula + C 2 H 2 N 0 O 1 + + + + DiffMono + 42.010565 + + + + Formula + C 8 H 14 N 1 O 2 + + + + MassAvg + 156.20 + + + + MassMono + 156.102454 + + + + Origin + I + + + + Source + artifact + + + + TermSpec + N-term + + MOD:00910 + MOD:01458 + PSI-MOD + + + MOD:00057 + N2-acetyl-L-lysine + + A protein modification that effectively converts an L-lysine residue to N2-acetyl-L-lysine. + + 11857757 + PubMed + + + 11999733 + PubMed + + + 12175151 + PubMed + + + 14730666 + PubMed + + + 15350136 + PubMed + + + AA0048 + RESID + + + This is a deprecated entry in RESID. It probably does not occur naturally [JSG]. + + (2S)-2-acetamido-6-aminohexanoic acid + RESID-systematic + + + 2-acetylamino-6-aminohexanoic acid + RESID-alternate + + + 2-acetylazanyl-6-azanylhexanoic acid + RESID-alternate + + + Acetyl + PSI-MS-label + + + N2-acetyl-L-lysine + RESID-name + + + N2-acetylated L-lysine + PSI-MOD-alternate + + + N2-acetyllysine + RESID-alternate + + + N2AcLys + PSI-MOD-label + + + + DiffAvg + 42.04 + + + + DiffFormula + C 2 H 2 N 0 O 1 + + + + DiffMono + 42.010565 + + + + Formula + C 8 H 15 N 2 O 2 + + + + MassAvg + 171.22 + + + + MassMono + 171.113353 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + N-term + + MOD:00723 + MOD:01458 + PSI-MOD + + + MOD:00058 + N-acetyl-L-methionine + + A protein modification that effectively converts an L-methionine to N-acetyl-L-methionine. + + 7944406 + PubMed + + + AA0049 + RESID + + + PSI-MOD-slim + + (2S)-2-acetamido-4-(methylsulfanyl)butanoic acid + RESID-systematic + + + 2-acetylamino-4-(methylsulfanyl)butanoic acid + RESID-alternate + + + 2-acetylamino-4-(methylthio)butanoic acid + RESID-alternate + + + 2-acetylazanyl-4-(methylsulfanyl)butanoic acid + RESID-alternate + + + acetylmethionine + RESID-alternate + + + AcMet + PSI-MOD-label + + + methionamine + RESID-alternate + + + MOD_RES N-acetylmethionine + UniProt-feature + + + N-acetyl-L-methionine + RESID-name + + + N-acetylated L-methionine + PSI-MOD-alternate + + + + DiffAvg + 42.04 + + + + DiffFormula + C 2 H 2 N 0 O 1 S 0 + + + + DiffMono + 42.010565 + + + + Formula + C 7 H 12 N 1 O 2 S 1 + + + + MassAvg + 174.24 + + + + MassMono + 174.058875 + + + + Origin + M + + + + Source + natural + + + + TermSpec + N-term + + MOD:00913 + MOD:01458 + PSI-MOD + + + MOD:00059 + N-acetyl-L-proline + + A protein modification that effectively converts an L-proline residue to N-acetyl-L-proline. + + 2928307 + PubMed + + + AA0050 + RESID + + + PSI-MOD-slim + + (2S)-1-acetyl-2-pyrrolidinecarboxylic acid + RESID-systematic + + + 1-acetylproline + RESID-alternate + + + acetylproline + RESID-alternate + + + MOD_RES N-acetylproline + UniProt-feature + + + N-acetyl-L-proline + RESID-name + + + N-acetylated L-proline + PSI-MOD-alternate + + + N-acetylproline + RESID-alternate + + + NAcPro + PSI-MOD-label + + + + DiffAvg + 42.04 + + + + DiffFormula + C 2 H 2 N 0 O 1 + + + + DiffMono + 42.010565 + + + + Formula + C 7 H 10 N 1 O 2 + + + + MassAvg + 140.16 + + + + MassMono + 140.071154 + + + + Origin + P + + + + Source + natural + + + + TermSpec + N-term + + MOD:00915 + MOD:01458 + PSI-MOD + + + MOD:00060 + N-acetyl-L-serine + + A protein modification that effectively converts an L-serine residue to N-acetyl-L-serine. + + 11857757 + PubMed + + + 11999733 + PubMed + + + 12175151 + PubMed + + + 14730666 + PubMed + + + 15350136 + PubMed + + + 1880797 + PubMed + + + 2106685 + PubMed + + + 6997045 + PubMed + + + AA0051 + RESID + + + PSI-MOD-slim + + (2S)-2-acetamido-3-hydroxypropanoic acid + RESID-systematic + + + 2-acetylamino-3-hydroxypropanoic acid + RESID-alternate + + + 2-acetylazanyl-3-hydroxypropanoic acid + RESID-alternate + + + Acetyl + PSI-MS-label + + + MOD_RES N-acetylserine + UniProt-feature + + + N-acetyl-L-serine + RESID-name + + + N-acetylated L-serine + PSI-MOD-alternate + + + N-acetylserine + RESID-alternate + + + NAcSer + PSI-MOD-label + + + + DiffAvg + 42.04 + + + + DiffFormula + C 2 H 2 N 0 O 1 + + + + DiffMono + 42.010565 + + + + Formula + C 5 H 8 N 1 O 3 + + + + MassAvg + 130.12 + + + + MassMono + 130.050418 + + + + Origin + S + + + + Source + natural + + + + TermSpec + N-term + + MOD:00647 + MOD:01458 + PSI-MOD + + + MOD:00061 + N-acetyl-L-threonine + + A protein modification that effectively converts an L-threonine residue to N-acetyl-L-threonine. + + 11857757 + PubMed + + + 11999733 + PubMed + + + 12175151 + PubMed + + + 14730666 + PubMed + + + 15350136 + PubMed + + + 2106685 + PubMed + + + 6997045 + PubMed + + + AA0052 + RESID + + + PSI-MOD-slim + + (2S,3R)-2-acetamido-3-hydroxybutanoic acid + RESID-systematic + + + 2-acetylamino-3-hydroxybutanoic acid + RESID-alternate + + + 2-acetylazanyl-3-hydroxybutanoic acid + RESID-alternate + + + Acetyl + PSI-MS-label + + + Acetylation + UniMod-description + + + MOD_RES N-acetylthreonine + UniProt-feature + + + N-acetyl-L-threonine + RESID-name + + + N-acetylated L-threonine + PSI-MOD-alternate + + + N-acetylthreonine + RESID-alternate + + + N-methylcarbonylthreonine + RESID-alternate + + + NAcThr + PSI-MOD-label + + + + DiffAvg + 42.04 + + + + DiffFormula + C 2 H 2 N 0 O 1 + + + + DiffMono + 42.010565 + + + + Formula + C 6 H 10 N 1 O 3 + + + + MassAvg + 144.15 + + + + MassMono + 144.066068 + + + + Origin + T + + + + Source + natural + + + + TermSpec + N-term + + MOD:01186 + MOD:01458 + PSI-MOD + + + MOD:00062 + N-acetyl-L-tyrosine + + A protein modification that effectively converts an L-tyrosine residue to N-acetyl-L-tyrosine. + + 11857757 + PubMed + + + 11999733 + PubMed + + + 12175151 + PubMed + + + 14730666 + PubMed + + + 15350136 + PubMed + + + 2506074 + PubMed + + + 475783 + PubMed + + + AA0053 + RESID + + + + (2S)-2-acetamido-3-(4-hydoxyphenyl)propanoic acid + RESID-systematic + + + 2-acetylamino-3-(4-hydoxyphenyl)propanoic acid + RESID-alternate + + + 2-acetylazanyl-3-(4-hydoxyphenyl)propanoic acid + RESID-alternate + + + Acetyl + PSI-MS-label + + + AcTyr + PSI-MOD-label + + + MOD_RES N-acetyltyrosine + UniProt-feature + + + N-acetyl-L-tyrosine + RESID-name + + + N-acetylated L-tyrosine + PSI-MOD-alternate + + + N-acetyltyrosine + RESID-alternate + + + + DiffAvg + 42.04 + + + + DiffFormula + C 2 H 2 N 0 O 1 + + + + DiffMono + 42.010565 + + + + Formula + C 11 H 12 N 1 O 3 + + + + MassAvg + 206.22 + + + + MassMono + 206.081718 + + + + Origin + Y + + + + Source + natural + + + + TermSpec + N-term + + MOD:00919 + MOD:01458 + PSI-MOD + + + MOD:00063 + N-acetyl-L-valine + + A protein modification that effectively converts an L-valine residue to N-acetyl-L-valine. + + 1735421 + PubMed + + + AA0054 + RESID + + + PSI-MOD-slim + + (2S)-2-acetamido-3-methylbutanoic acid + RESID-systematic + + + 2-acetylamino-3-methylbutanoic acid + RESID-alternate + + + 2-acetylazanyl-3-methylbutanoic acid + RESID-alternate + + + AcVal + PSI-MOD-label + + + MOD_RES N-acetylvaline + UniProt-feature + + + N-acetyl-L-valine + RESID-name + + + N-acetylated L-valine + PSI-MOD-alternate + + + N-acetylvaline + RESID-alternate + + + + DiffAvg + 42.04 + + + + DiffFormula + C 2 H 2 N 0 O 1 + + + + DiffMono + 42.010565 + + + + Formula + C 7 H 12 N 1 O 2 + + + + MassAvg + 142.18 + + + + MassMono + 142.086804 + + + + Origin + V + + + + Source + natural + + + + TermSpec + N-term + + MOD:00920 + MOD:01458 + PSI-MOD + + + MOD:00064 + N6-acetyl-L-lysine + + A protein modification that effectively converts an L-lysine residue to N6-acetyl-L-lysine. + + 17752 + ChEBI + + + 214 + DeltaMass + + + 11369851 + PubMed + + + 11857757 + PubMed + + + 11999733 + PubMed + + + 12175151 + PubMed + + + 14730666 + PubMed + + + 15350136 + PubMed + + + 1680872 + PubMed + + + 670159 + PubMed + + + AA0055 + RESID + + + 1#K + UniMod + + + PSI-MOD-slim + + (2S)-6-acetamido-2-aminohexanoic acid + RESID-systematic + + + 6-acetylamino-2-aminohexanoic acid + RESID-alternate + + + 6-acetylazanyl-2-aminohexanoic acid + RESID-alternate + + + Acetyl + PSI-MS-label + + + Acetylation + UniMod-description + + + acetylk + OMSSA-label + + + epsilon-acetyllysine + RESID-alternate + + + MOD_RES N6-acetyllysine + UniProt-feature + + + N(zeta)-acetyllysine + RESID-alternate + + + N6-acetyl-L-lysine + RESID-name + + + N6-acetylated L-lysine + PSI-MOD-alternate + + + N6AcLys + PSI-MOD-label + + + + DiffAvg + 42.04 + + + + DiffFormula + C 2 H 2 N 0 O 1 + + + + DiffMono + 42.010565 + + + + Formula + C 8 H 14 N 2 O 2 + + + + MassAvg + 170.21 + + + + MassMono + 170.105528 + + + + Origin + K + + + + Source + natural + + + + TermSpec + none + + MOD:00723 + MOD:01875 + PSI-MOD + + + MOD:00065 + S-acetyl-L-cysteine + + A protein modification that effectively converts an L-cysteine residue to S-acetyl-L-cysteine. + + 11857757 + PubMed + + + 11999733 + PubMed + + + 12175151 + PubMed + + + 1310545 + PubMed + + + 14730666 + PubMed + + + 15350136 + PubMed + + + AA0056 + RESID + + + 1#C + UniMod + + + PSI-MOD-slim + + (2R)-3-acetylsulfanyl-2-aminopropanoic acid + RESID-systematic + + + 2-amino-3-(acetylthio)propanoic acid + RESID-alternate + + + 2-azanyl-3-(acetylsulfanyl)propanoic acid + RESID-alternate + + + Acetyl + PSI-MS-label + + + Acetylation + UniMod-description + + + ACT_SITE S-acetylcysteine intermediate + UniProt-feature + + + cysteine acetate thioester + RESID-alternate + + + S-acetyl-L-cysteine + RESID-name + + + S-acetylcysteine + RESID-alternate + + + SAcCys + PSI-MOD-label + + + + DiffAvg + 42.04 + + + + DiffFormula + C 2 H 2 N 0 O 1 S 0 + + + + DiffMono + 42.010565 + + + + Formula + C 5 H 7 N 1 O 2 S 1 + + + + MassAvg + 145.18 + + + + MassMono + 145.019749 + + + + Origin + C + + + + Source + natural + + + + TermSpec + none + + MOD:00645 + MOD:00646 + PSI-MOD + + + MOD:00066 + N-formylglycine + + A protein modification that effectively converts a glycine residue to N-formylglycine. + + 5139483 + PubMed + + + AA0057 + RESID + + + + (formylamino)acetic acid + RESID-alternate + + + (formylamino)ethanoic acid + RESID-systematic + + + (formylazanyl)ethanoic acid + RESID-alternate + + + 2-formamidoacetic acid + RESID-alternate + + + 2-formamidoethanoic acid + RESID-alternate + + + MOD_RES N-formylglycine + UniProt-feature + + + N(alpha)-formylglycine + RESID-alternate + + + N-formylated glycine + PSI-MOD-alternate + + + N-formylglycine + RESID-name + + + NFoGly + PSI-MOD-label + + + + DiffAvg + 28.01 + + + + DiffFormula + C 1 H 0 N 0 O 1 + + + + DiffMono + 27.994915 + + + + Formula + C 3 H 4 N 1 O 2 + + + + MassAvg + 86.07 + + + + MassMono + 86.024203 + + + + Origin + G + + + + Source + natural + + + + TermSpec + N-term + + MOD:00409 + MOD:00908 + MOD:01696 + PSI-MOD + + + MOD:00067 + N-D-glucuronoylglycine + + A protein modification that effectively converts a glycine residue to N-D-glucuronoylglycine. + + 10858503 + PubMed + + + 12716131 + PubMed + + + 6493057 + PubMed + + + 7398618 + PubMed + + + AA0058 + RESID + + + + 2-(glucuronoylamino)ethanoic acid + RESID-systematic + + + Glucuronyl + PSI-MS-label + + + MOD_RES N-D-glucuronoyl glycine + UniProt-feature + + + N-D-glucuronoyl-glycine + RESID-name + + + N-D-glucuronyl-glycine + RESID-alternate + + + NGlcAGly + PSI-MOD-label + + + ntermpepglucuronylg + OMSSA-label + + + + DiffAvg + 176.12 + + + + DiffFormula + C 6 H 8 N 0 O 6 + + + + DiffMono + 176.032088 + + + + Formula + C 8 H 12 N 1 O 7 + + + + MassAvg + 234.18 + + + + MassMono + 234.061377 + + + + Origin + G + + + + Source + natural + + + + TermSpec + N-term + + MOD:00447 + MOD:00908 + PSI-MOD + + + MOD:00068 + N-myristoylglycine + + A protein modification that effectively converts a glycine residue to N-myristoylglycine. + + 11955007 + PubMed + + + 11955008 + PubMed + + + 1326520 + PubMed + + + 1386601 + PubMed + + + 6436247 + PubMed + + + 7543369 + PubMed + + + AA0059 + RESID + + + 45#G + UniMod + + + PSI-MOD-slim + + (tetradecanoylamino)ethanoic acid + RESID-systematic + + + LIPID N-myristoyl glycine + UniProt-feature + + + Myristoyl + PSI-MS-label + + + Myristoylation + UniMod-description + + + N-(1-oxotetradecyl)glycine + RESID-alternate + + + N-(C14:0 aliphatic acyl)glycine + PSI-MOD-alternate + + + N-myristoyl-glycine + RESID-name + + + N-myristoylated glycine + PSI-MOD-alternate + + + N-myristylglycine + RESID-alternate + + + N-tetradecanoylglycine + RESID-alternate + + + NMyrGly + PSI-MOD-label + + + ntermpepmyristoylationg + OMSSA-label + + + + DiffAvg + 210.36 + + + + DiffFormula + C 14 H 26 N 0 O 1 + + + + DiffMono + 210.198365 + + + + Formula + C 16 H 30 N 1 O 2 + + + + MassAvg + 268.42 + + + + MassMono + 268.227654 + + + + Origin + G + + + + Source + natural + + + + TermSpec + N-term + + MOD:00650 + MOD:00908 + MOD:01696 + PSI-MOD + + + MOD:00069 + N-palmitoyl-L-cysteine + + A protein modification that effectively converts an L-cysteine residue to N-palmitoyl-L-cysteine. + + 10896212 + PubMed + + + 4575979 + PubMed + + + 9056182 + PubMed + + + 9593755 + PubMed + + + AA0060 + RESID + + + incidental to RESID:AA0107 incidental to RESID:AA0309 + PSI-MOD-slim + + (2R)-2-hexadecanoylamino-3-sulfanylpropanoic acid + RESID-systematic + + + 2-hexadecanamido-3-sulfanylpropanoic acid + RESID-alternate + + + 2-hexadecanoylamino-3-mercaptopropanoic acid + RESID-alternate + + + LIPID N-palmitoyl cysteine + UniProt-feature + + + N-(1-oxahexadecyl)-L-cysteine + RESID-alternate + + + N-palmitoyl-L-cysteine + RESID-name + + + N-palmitoylated L-cysteine + PSI-MOD-alternate + + + NPamCys + PSI-MOD-label + + + Palmitoyl + PSI-MS-label + + + Palmitoylation + UniMod-description + + + + DiffAvg + 238.41 + + + + DiffFormula + C 16 H 30 N 0 O 1 S 0 + + + + DiffMono + 238.229666 + + + + Formula + C 19 H 36 N 1 O 2 S 1 + + + + MassAvg + 342.56 + + + + MassMono + 342.246675 + + + + Origin + C + + + + Source + natural + + + + TermSpec + N-term + + MOD:01684 + MOD:01685 + PSI-MOD + + + MOD:00070 + N-methyl-L-alanine + + A protein modification that effectively converts an L-alanine residue to N-methyl-L-alanine. + + 17519 + ChEBI + + + 323502 + PubMed + + + 337304 + PubMed + + + 7007074 + PubMed + + + AA0061 + RESID + + + Polypeptides with monomethylated amino terminals can undergo premature cleavage during the coupling step of an Edman degradation. This can result in "preview" with both a residue and the following residue being seen from the first step on through a sequence [JSG]. + PSI-MOD-slim + + (2S)-2-methylaminopropanoic acid + RESID-systematic + + + 2-methylazanylpropanoic acid + RESID-alternate + + + Methyl + PSI-MS-label + + + Methylation + UniMod-description + + + MOD_RES N-methylalanine + UniProt-feature + + + N-methyl-L-alanine + RESID-name + + + N-methylalanine + RESID-alternate + + + N-methylated L-alanine + PSI-MOD-alternate + + + NMe1Ala + PSI-MOD-label + + + + DiffAvg + 14.03 + + + + DiffFormula + C 1 H 2 N 0 O 0 + + + + DiffMono + 14.015650 + + + + Formula + C 4 H 7 N 1 O 1 + + + + MassAvg + 85.11 + + + + MassMono + 85.052764 + + + + Origin + A + + + + Source + natural + + + + TermSpec + none + + MOD:01461 + MOD:01680 + PSI-MOD + + + MOD:00071 + N,N,N-trimethyl-L-alanine + + A protein modification that effectively converts an L-alanine residue to N,N,N-trimethyl-L-alanine. + + 12590383 + PubMed + + + 332162 + PubMed + + + 3979397 + PubMed + + + 6778808 + PubMed + + + 7715456 + PubMed + + + AA0062 + RESID + + + PSI-MOD-slim + + (1S)-1-carboxy-N,N,N-trimethylethanaminium + RESID-systematic + + + (1S)-1-carboxy-N,N,N-trimethylethanazanium + RESID-alternate + + + (2S)-2-(trimethylammonio)propanoic acid + RESID-alternate + + + MOD_RES N,N,N-trimethylalanine + UniProt-feature + + + N,N,N-trimethyl-L-alanine + RESID-name + + + N,N,N-trimethylalanine cation + RESID-alternate + + + N,N,N-trimethylalaninium + RESID-alternate + + + N,N,N-trimethylated L-alanine + PSI-MOD-alternate + + + N2Me3+Ala + PSI-MOD-label + + + NMe3Ala + PSI-MOD-label + + + tri-Methylation + UniMod-description + + + Trimethyl + PSI-MS-label + + + + DiffAvg + 43.09 + + + + DiffFormula + C 3 H 7 N 0 O 0 + + + + DiffMono + 43.054227 + + + + FormalCharge + 1+ + + + + Formula + C 6 H 13 N 1 O 1 + + + + MassAvg + 115.18 + + + + MassMono + 115.099165 + + + + Origin + A + + + + Source + natural + + + + TermSpec + N-term + + MOD:01461 + MOD:01698 + PSI-MOD + + + MOD:00072 + N-methylglycine + + A protein modification that effectively converts a glycine residue to N-methylglycine. + + 15611 + ChEBI + + + 0 + DeltaMass + + + 1593629 + PubMed + + + AA0063 + RESID + + + DeltaMass also has an entry for the free amino acid. Polypeptides with monomethylated amino terminals can undergo premature cleavage during the coupling step of an Edman degradation. This can result in "preview" with both a residue and the following residue being seen from the first step on through a sequence [JSG]. + + L-sarcosine + RESID-alternate + + + Methyl + PSI-MS-label + + + methylaminoacetic acid + RESID-alternate + + + methylaminoethanoic acid + RESID-systematic + + + Methylation + UniMod-description + + + N-methylated glycine + PSI-MOD-alternate + + + N-methylglycine + RESID-name + + + NMe1Gly + PSI-MOD-label + + + Sar + DeltaMass-label + + + Sarcosine + DeltaMass-label + + + Sarcosyl + DeltaMass-label + + + + DiffAvg + 14.03 + + + + DiffFormula + C 1 H 2 N 0 O 0 + + + + DiffMono + 14.015650 + + + + Formula + C 3 H 5 N 1 O 1 + + + + MassAvg + 71.08 + + + + MassMono + 71.037114 + + + + Origin + G + + + + Source + natural + + + + TermSpec + none + + MOD:00570 + MOD:00714 + MOD:01680 + PSI-MOD + + + MOD:00073 + N-methyl-L-methionine + + A protein modification that effectively converts an L-methionine residue to N-methyl-L-methionine. + + 169 + DeltaMass + + + 323502 + PubMed + + + 3298225 + PubMed + + + AA0064 + RESID + + + Polypeptides with monomethylated amino terminals can undergo premature cleavage during the coupling step of an Edman degradation. This can result in "preview" with both a residue and the following residue being seen from the first step on through a sequence [JSG]. + PSI-MOD-slim + + (2S)-2-methylamino-4-(methylsulfanyl)butanoic acid + RESID-systematic + + + 2-methylamino-4-(methylthio)butanoic acid + RESID-alternate + + + Methyl + PSI-MS-label + + + Methyl Methionyl + DeltaMass-label + + + Methylation + UniMod-description + + + MOD_RES N-methylmethionine + UniProt-feature + + + N-methyl-L-methionine + RESID-name + + + N-methylated L-methionine + PSI-MOD-alternate + + + N-methylmethionine + RESID-alternate + + + NMe1Met + PSI-MOD-label + + + + DiffAvg + 14.03 + + + + DiffFormula + C 1 H 2 N 0 O 0 S 0 + + + + DiffMono + 14.015650 + + + + Formula + C 6 H 11 N 1 O 1 S 1 + + + + MassAvg + 145.22 + + + + MassMono + 145.056135 + + + + Origin + M + + + + Source + natural + + + + TermSpec + none + + MOD:01463 + MOD:01680 + PSI-MOD + + + MOD:00074 + N-methyl-L-phenylalanine + + A protein modification that effectively converts an L-phenylalanine residue to N-methyl-L-phenylalanine. + + 2577730 + PubMed + + + 413571 + PubMed + + + AA0065 + RESID + + + Polypeptides with monomethylated amino terminals can undergo premature cleavage during the coupling step of an Edman degradation. This can result in "preview" with both a residue and the following residue being seen from the first step on through a sequence [JSG]. + PSI-MOD-slim + + (2S)-2-methylamino-3-phenylpropanoic acid + RESID-systematic + + + Methyl + PSI-MS-label + + + Methylation + UniMod-description + + + MOD_RES N-methylphenylalanine + UniProt-feature + + + N-methyl-L-phenylalanine + RESID-name + + + N-methylated L-phenylalanine + PSI-MOD-alternate + + + N-methylphenylalanine + RESID-alternate + + + NMe1Phe + PSI-MOD-label + + + + DiffAvg + 14.03 + + + + DiffFormula + C 1 H 2 N 0 O 0 + + + + DiffMono + 14.015650 + + + + Formula + C 10 H 11 N 1 O 1 + + + + MassAvg + 161.20 + + + + MassMono + 161.084064 + + + + Origin + F + + + + Source + natural + + + + TermSpec + none + + MOD:01063 + MOD:01680 + PSI-MOD + + + MOD:00075 + N,N-dimethyl-L-proline + + A protein modification that effectively converts an L-proline residue to N,N-dimethyl-L-proline. + + 21451 + ChEBI + + + 12964758 + PubMed + + + 14570711 + PubMed + + + 193025 + PubMed + + + 3882426 + PubMed + + + 6254758 + PubMed + + + AA0066 + RESID + + + 529 + UniMod + + + UniMod terminal specification corrected [JSG]. + PSI-MOD-slim + + (2S)-2-carboxy-1,1-dimethylpyrrolidinium + RESID-systematic + + + 1,1-dimethyl-L-prolinium + RESID-alternate + + + Delta:H(5)C(2) + UniMod-interim + + + Dimethyl + PSI-MS-label + + + Dimethylation of proline residue + UniMod-description + + + MOD_RES N,N-dimethylproline + UniProt-feature + + + N,N-dimethyl-L-proline + RESID-name + + + N,N-dimethyl-L-prolinium + RESID-alternate + + + N,N-dimethylated L-proline + PSI-MOD-alternate + + + NMe2Pro + PSI-MOD-label + + + stachydrin + RESID-alternate + + + + DiffAvg + 29.06 + + + + DiffFormula + C 2 H 5 N 0 O 0 + + + + DiffMono + 29.038577 + + + + FormalCharge + 1+ + + + + Formula + C 7 H 13 N 1 O 1 + + + + MassAvg + 127.19 + + + + MassMono + 127.099165 + + + + Origin + P + + + + Source + natural + + + + TermSpec + N-term + + MOD:00710 + MOD:01462 + PSI-MOD + + + MOD:00076 + symmetric dimethyl-L-arginine + + A protein modification that effectively converts an L-arginine residue to symmetric dimethylarginine, N(omega),N'(omega)-dimethyl-L-arginine. + + 12964758 + PubMed + + + 14570711 + PubMed + + + 15835918 + PubMed + + + 2426402 + PubMed + + + 5128665 + PubMed + + + AA0067 + RESID + + + 36#R + UniMod + + + PSI-MOD-slim + + (2S)-2-amino-5-[((methylamino)(methylimino)methyl)amino]pentanoic acid + RESID-systematic + + + di-Methylation + UniMod-description + + + Dimethyl + PSI-MS-label + + + MOD_RES Omega-N-methylated arginine + UniProt-feature + + + MOD_RES Symmetric dimethylarginine + UniProt-feature + + + N3,N4-dimethylarginine + RESID-alternate + + + N5-[(methylamino)(methylimino)methyl]ornithine + RESID-alternate + + + NG,N'G-dimethylarginine + RESID-alternate + + + NoNo'Me2Arg + PSI-MOD-label + + + omega-N,omega-N'-dimethyl-L-arginine + RESID-name + + + omega-N,omega-N'-dimethylated L-arginine + PSI-MOD-alternate + + + symmetric dimethylarginine + RESID-alternate + + + + DiffAvg + 28.05 + + + + DiffFormula + C 2 H 4 N 0 O 0 + + + + DiffMono + 28.031300 + + + + Formula + C 8 H 16 N 4 O 1 + + + + MassAvg + 184.24 + + + + MassMono + 184.132411 + + + + Origin + R + + + + Source + natural + + + + TermSpec + none + + MOD:00602 + MOD:00783 + PSI-MOD + + + MOD:00077 + asymmetric dimethyl-L-arginine + + A protein modification that effectively converts an L-arginine residue to asymmetric dimethylarginine, N(omega),N(omega)-dimethyl-L-arginine. + + 17929 + ChEBI + + + 11152131 + PubMed + + + 12964758 + PubMed + + + 14570711 + PubMed + + + 15835918 + PubMed + + + 3032834 + PubMed + + + AA0068 + RESID + + + 36#R + UniMod + + + PSI-MOD-slim + + (2S)-2-amino-5-([(dimethylamino)(imino)methyl]amino)pentanoic acid + RESID-systematic + + + asymmetric dimethylarginine + RESID-alternate + + + di-Methylation + UniMod-description + + + Dimethyl + PSI-MS-label + + + MOD_RES Asymmetric dimethylarginine + UniProt-feature + + + MOD_RES Omega-N-methylated arginine + UniProt-feature + + + N5-[(dimethylamino)(imino)methyl]ornithine + RESID-alternate + + + NG,NG-dimethylarginine + RESID-alternate + + + NoNoMe2Arg + PSI-MOD-label + + + omega-N,omega-N-dimethlyated L-arginine + PSI-MOD-alternate + + + omega-N,omega-N-dimethyl-L-arginine + RESID-name + + + + DiffAvg + 28.05 + + + + DiffFormula + C 2 H 4 N 0 O 0 + + + + DiffMono + 28.031300 + + + + Formula + C 8 H 16 N 4 O 1 + + + + MassAvg + 184.24 + + + + MassMono + 184.132411 + + + + Origin + R + + + + Source + natural + + + + TermSpec + none + + MOD:00602 + MOD:00783 + PSI-MOD + + + MOD:00078 + omega-N-methyl-L-arginine + + A protein modification that effectively converts an L-arginine residue to N(omega)-methyl-L-arginine. + + 11875433 + PubMed + + + 15835918 + PubMed + + + 2426402 + PubMed + + + 5128665 + PubMed + + + AA0069 + RESID + + + PSI-MOD-slim + + (2S)-2-amino-5-[(imino(methylamino)methyl)amino]pentanoic acid + RESID-systematic + + + Methyl + PSI-MS-label + + + Methylation + UniMod-description + + + MOD_RES Omega-N-methylarginine + UniProt-feature + + + MOD_RES Omega-N-methylated arginine + UniProt-feature + + + NG-methylarginine + RESID-alternate + + + NoMeArg + PSI-MOD-label + + + omega-N-methyl-L-arginine + RESID-name + + + omega-N-methylated L-arginine + PSI-MOD-alternate + + + + DiffAvg + 14.03 + + + + DiffFormula + C 1 H 2 N 0 O 0 + + + + DiffMono + 14.015650 + + + + Formula + C 7 H 14 N 4 O 1 + + + + MassAvg + 170.22 + + + + MassMono + 170.116761 + + + + Origin + R + + + + Source + natural + + + + TermSpec + none + + MOD:00414 + MOD:00602 + PSI-MOD + + + MOD:00079 + N4-methyl-L-asparagine + + A protein modification that effectively converts an L-asparagine residue to N4-methyl-L-asparagine. + + 11875433 + PubMed + + + 2356973 + PubMed + + + 3782095 + PubMed + + + AA0070 + RESID + + + 34#N + UniMod + + + PSI-MOD-slim + + (2S)-2-amino-N4-methylbutanediamic acid + RESID-systematic + + + beta-aspartyl methylamide + RESID-alternate + + + beta-methylasparagine + RESID-misnomer + + + Methyl + PSI-MS-label + + + Methylation + UniMod-description + + + methyln + OMSSA-label + + + MOD_RES N4-methylasparagine + UniProt-feature + + + N(gamma)-methylasparagine + RESID-alternate + + + N-methylasparagine + RESID-alternate + + + N4-methyl-L-asparagine + RESID-name + + + N4-methylated L-asparagine + PSI-MOD-alternate + + + N4Me1Asn + PSI-MOD-label + + + + DiffAvg + 14.03 + + + + DiffFormula + C 1 H 2 N 0 O 0 + + + + DiffMono + 14.015650 + + + + Formula + C 5 H 8 N 2 O 2 + + + + MassAvg + 128.13 + + + + MassMono + 128.058578 + + + + Origin + N + + + + Source + natural + + + + TermSpec + none + + MOD:00599 + MOD:00602 + MOD:00673 + MOD:00894 + PSI-MOD + + + MOD:00080 + N5-methyl-L-glutamine + + A protein modification that effectively converts an L-glutamine residue to N5-methyl-L-glutamine. + + 17592 + ChEBI + + + 166 + DeltaMass + + + 11118225 + PubMed + + + 11875433 + PubMed + + + 365579 + PubMed + + + AA0071 + RESID + + + PSI-MOD-slim + + (2S)-2-amino-5-methylamino-5-oxopentanoic acid + RESID-systematic + + + 2-amino-N5-methylpentanediamic acid + RESID-alternate + + + gamma-methylglutamine + RESID-alternate + + + Methyl + PSI-MS-label + + + Methylation + UniMod-description + + + MOD_RES N5-methylglutamine + UniProt-feature + + + N(delta)-methylglutamine + RESID-alternate + + + N-methylglutamine + RESID-alternate + + + N5-methyl-L-glutamine + RESID-name + + + N5-methylated L-glutamine + PSI-MOD-alternate + + + N5Me1Gln + PSI-MOD-label + + + + DiffAvg + 14.03 + + + + DiffFormula + C 1 H 2 N 0 O 0 + + + + DiffMono + 14.015650 + + + + Formula + C 6 H 10 N 2 O 2 + + + + MassAvg + 142.16 + + + + MassMono + 142.074228 + + + + Origin + Q + + + + Source + natural + + + + TermSpec + none + + MOD:00602 + MOD:00722 + PSI-MOD + + + MOD:00081 + L-glutamic acid 5-methyl ester (Glu) + + A protein modification that effectively converts an L-glutamic acid residue to L-glutamate 5-methyl ester. + + 167 + DeltaMass + + + 16888 + PubMed + + + 6300110 + PubMed + + + AA0072#GLU + RESID + + + 34#E + UniMod + + + DeltaMass gives the formula "C 6 H 9 O 1 N 3" with mass 143 (formula incorrect, N and O reversed) [JSG]. + PSI-MOD-slim + + (2S)-2-amino-5-methoxy-5-oxopentanoic acid + RESID-systematic + + + (5)-methyl L-hydrogen glutamate + RESID-alternate + + + 2-aminopentanedioic acid 5-methyl ester + RESID-alternate + + + 5-methyl esterified L-glutamic acid + PSI-MOD-alternate + + + 5-methyl L-2-aminoglutarate + RESID-alternate + + + 5-methyl L-glutamate + RESID-alternate + + + glutamic acid 5-methyl ester + RESID-alternate + + + glutamic acid gamma-methyl ester + RESID-alternate + + + L-glutamic acid 5-methyl ester + RESID-name + + + meestere + OMSSA-label + + + Methyl + PSI-MS-label + + + methyl ester + UniMod-alternate + + + Methylation + UniMod-description + + + methyle + OMSSA-label + + + MOD_RES Glutamate methyl ester (Glu) + UniProt-feature + + + O-methyl Glutamyl + DeltaMass-label + + + O5MeGlu + PSI-MOD-label + + + + DiffAvg + 14.03 + + + + DiffFormula + C 1 H 2 N 0 O 0 + + + + DiffMono + 14.015650 + + + + Formula + C 6 H 9 N 1 O 3 + + + + MassAvg + 143.14 + + + + MassMono + 143.058243 + + + + Origin + E + + + + Source + natural + + + + TermSpec + none + + MOD:01453 + PSI-MOD + + + MOD:00082 + 3'-methyl-L-histidine + + A protein modification that effectively converts an L-histidine residue to pros-methyl-L-histidine (N-pi-methyl-L-histidine, 3'-methyl-L-histidine). + + 10660523 + PubMed + + + 11875433 + PubMed + + + 3467365 + PubMed + + + 6692818 + PubMed + + + 8076 + PubMed + + + 8645219 + PubMed + + + AA0073 + RESID + + + PSI-MOD-slim + + (2S)-2-amino-3-(3-methyl-3H-imidazol-4-yl)propanoic acid + RESID-systematic + + + 1-methylhistidine + RESID-misnomer + + + 3'-methyl-L-histidine + RESID-name + + + Methyl + PSI-MS-label + + + Methylation + UniMod-description + + + MOD_RES Pros-methylhistidine + UniProt-feature + + + N(delta)-methylhistidine + RESID-alternate + + + N(pi)-methylhistidine + RESID-alternate + + + NpMeHis + PSI-MOD-label + + + pros-methylated L-histidine + PSI-MOD-alternate + + + pros-methylhistidine + RESID-alternate + + + + DiffAvg + 14.03 + + + + DiffFormula + C 1 H 2 N 0 O 0 + + + + DiffMono + 14.015650 + + + + Formula + C 7 H 9 N 3 O 1 + + + + MassAvg + 151.17 + + + + MassMono + 151.074562 + + + + Origin + H + + + + Source + natural + + + + TermSpec + none + + MOD:00724 + PSI-MOD + + + MOD:00083 + N6,N6,N6-trimethyl-L-lysine + + A protein modification that effectively converts an L-lysine residue to N6,N6,N6-trimethyl-L-lysine. + + 17311 + ChEBI + + + 12590383 + PubMed + + + 3145979 + PubMed + + + 4304194 + PubMed + + + 6778808 + PubMed + + + 7093227 + PubMed + + + 8453381 + PubMed + + + AA0074 + RESID + + + DeltaMass calculates the mass difference from protonated lysine rather than neutral lysine; for trimethylated lysine starting from protonated lysine see MOD:00855 + PSI-MOD-slim + + (5S)-5-amino-5-carboxy-N,N,N-trimethylpentan-1-aminium + RESID-systematic + + + 2-amino-6-(trimethylammonio)hexanoic acid + RESID-alternate + + + 5-azanyl-5-carboxy-N,N,N-trimethylpentanazanium + RESID-alternate + + + epsilon-trimethyllysine + RESID-alternate + + + MOD_RES N6,N6,N6-trimethyllysine + UniProt-feature + + + N(zeta)-trimethyllysine + RESID-alternate + + + N-trimethylation (of lysine) + DeltaMass-label + + + N6,N6,N6-trimethyl-L-lysine + RESID-name + + + N6,N6,N6-trimethylated L-lysine + PSI-MOD-alternate + + + N6,N6,N6-trimethyllysin-N6-ium + RESID-alternate + + + N6,N6,N6-trimethyllysine cation + RESID-alternate + + + N6Me3+Lys + PSI-MOD-label + + + tri-Methylation + UniMod-description + + + Trimethyl + PSI-MS-label + + + + DiffAvg + 43.09 + + + + DiffFormula + C 3 H 7 N 0 O 0 + + + + DiffMono + 43.054227 + + + + FormalCharge + 1+ + + + + Formula + C 9 H 19 N 2 O 1 + + + + MassAvg + 171.26 + + + + MassMono + 171.149190 + + + + Origin + K + + + + Source + natural + + + + TermSpec + none + + MOD:00602 + MOD:00663 + MOD:00711 + PSI-MOD + + + MOD:00084 + N6,N6-dimethyl-L-lysine + + A protein modification that effectively converts an L-lysine residue to N6,N6-dimethyl-L-lysine. + + 10550045 + PubMed + + + 12964758 + PubMed + + + 14570711 + PubMed + + + 3100523 + PubMed + + + 8453381 + PubMed + + + AA0075 + RESID + + + 36#K + UniMod + + + PSI-MOD-slim + + (2S)-2-amino-6-(dimethylamino)hexanoic acid + RESID-systematic + + + di-Methylation + UniMod-description + + + Dimethyl + PSI-MS-label + + + dimethylk + OMSSA-label + + + epsilon-dimethyllysine + RESID-alternate + + + lysine derivative Lys(y) + RESID-alternate + + + MOD_RES N6,N6-dimethyllysine + UniProt-feature + + + N(zeta)-dimethyllysine + RESID-alternate + + + N6,N6-dimethyl-L-lysine + RESID-name + + + N6,N6-dimethylated L-lysine + PSI-MOD-alternate + + + N6Me2Lys + PSI-MOD-label + + + + DiffAvg + 28.05 + + + + DiffFormula + C 2 H 4 N 0 O 0 + + + + DiffMono + 28.031300 + + + + Formula + C 8 H 16 N 2 O 1 + + + + MassAvg + 156.23 + + + + MassMono + 156.126263 + + + + Origin + K + + + + Source + natural + + + + TermSpec + none + + MOD:00429 + MOD:00602 + MOD:00663 + PSI-MOD + + + MOD:00085 + N6-methyl-L-lysine + + A protein modification that effectively converts an L-lysine residue to N6-methyl-L-lysine. + + 17604 + ChEBI + + + 165 + DeltaMass + + + 11875433 + PubMed + + + 3926756 + PubMed + + + AA0076 + RESID + + + 34#K + UniMod + + + PSI-MOD-slim + + (2S)-2-amino-6-methylaminohexanoic acid + RESID-systematic + + + epsilon-methyllysine + RESID-alternate + + + Methyl + PSI-MS-label + + + Methylation + UniMod-description + + + MOD_RES N6-methyllysine + UniProt-feature + + + N(zeta)-methyllysine + RESID-alternate + + + N-methyl Lysyl + DeltaMass-label + + + N6-methyl-L-lysine + RESID-name + + + N6-methylated L-lysine + PSI-MOD-alternate + + + N6Me1Lys + PSI-MOD-label + + + + DiffAvg + 14.03 + + + + DiffFormula + C 1 H 2 N 0 O 0 + + + + DiffMono + 14.015650 + + + + Formula + C 7 H 14 N 2 O 1 + + + + MassAvg + 142.20 + + + + MassMono + 142.110613 + + + + Origin + K + + + + Source + natural + + + + TermSpec + none + + MOD:00602 + MOD:01683 + PSI-MOD + + + MOD:00086 + N6-palmitoyl-L-lysine + + A protein modification that effectively converts an L-lysine residue to N6-palmitoyl-L-lysine. + + 2498336 + PubMed + + + 7801126 + PubMed + + + 7939682 + PubMed + + + AA0077 + RESID + + + 47#K + UniMod + + + PSI-MOD-slim + + (2S)-2-amino-6-(hexadecanoylamino)hexanoic acid + RESID-systematic + + + 2-amino-6-(hexadecanamido)hexanoic acid + RESID-alternate + + + epsilon-palmitoyllysine + RESID-alternate + + + LIPID N6-palmitoyl lysine + UniProt-feature + + + N(zeta)-palmitoyllysine + RESID-alternate + + + N6-(1-oxohexadecyl)-L-lysine + RESID-alternate + + + N6-palmitoyl-L-lysine + RESID-name + + + N6-palmitoylated L-lysine + PSI-MOD-alternate + + + N6PamLys + PSI-MOD-label + + + Palmitoyl + PSI-MS-label + + + Palmitoylation + UniMod-description + + + palmitoylationk + OMSSA-label + + + + DiffAvg + 238.41 + + + + DiffFormula + C 16 H 30 N 0 O 1 + + + + DiffMono + 238.229666 + + + + Formula + C 22 H 42 N 2 O 2 + + + + MassAvg + 366.59 + + + + MassMono + 366.324629 + + + + Origin + K + + + + Source + natural + + + + TermSpec + none + + MOD:00651 + MOD:01875 + PSI-MOD + + + MOD:00087 + N6-myristoyl-L-lysine + + A protein modification that effectively converts an L-lysine residue to N6-myristoyl-L-lysine. + + 1402651 + PubMed + + + 8346241 + PubMed + + + AA0078 + RESID + + + 45#K + UniMod + + + PSI-MOD-slim + + (2S)-2-amino-6-(tetradecanoylamino)hexanoic acid + RESID-systematic + + + 2-amino-6-(tetradecanamido)hexanoic acid + RESID-alternate + + + epsilon-myristoyllysine + RESID-alternate + + + LIPID N6-myristoyl lysine + UniProt-feature + + + Myristoyl + PSI-MS-label + + + Myristoylation + UniMod-description + + + myristoylationk + OMSSA-label + + + N(zeta)-myristoyllysine + RESID-alternate + + + N6-(1-oxotetradecyl)-L-lysine + RESID-alternate + + + N6-(C14:0 aliphatic acyl)lysine + PSI-MOD-alternate + + + N6-myristoyl-L-lysine + RESID-name + + + N6-myristoylated L-lysine + PSI-MOD-alternate + + + N6MyrLys + PSI-MOD-label + + + + DiffAvg + 210.36 + + + + DiffFormula + C 14 H 26 N 0 O 1 + + + + DiffMono + 210.198365 + + + + Formula + C 20 H 38 N 2 O 2 + + + + MassAvg + 338.54 + + + + MassMono + 338.293328 + + + + Origin + K + + + + Source + natural + + + + TermSpec + none + + MOD:00650 + MOD:01875 + PSI-MOD + + + MOD:00088 + O-palmitoyl-L-threonine + + A protein modification that effectively converts an L-threonine residue to O-palmitoyl-L-threonine. + + 6642431 + PubMed + + + 8413602 + PubMed + + + AA0079 + RESID + + + 47#T + UniMod + + + PSI-MOD-slim + + (2S,3R)-2-amino-3-(hexadecanoyloxy)butanoic acid + RESID-systematic + + + L-threonine hexadecanoate ester + RESID-alternate + + + LIPID O-palmitoyl threonine + UniProt-feature + + + O-palmitoyl-L-threonine + RESID-name + + + O-palmitoylated L-threonine + PSI-MOD-alternate + + + O3-palmitoyl-threonine + RESID-alternate + + + OPamThr + PSI-MOD-label + + + Palmitoyl + PSI-MS-label + + + Palmitoylation + UniMod-description + + + palmitoylationt + OMSSA-label + + + threonine palmitate ester + RESID-alternate + + + + DiffAvg + 238.41 + + + + DiffFormula + C 16 H 30 N 0 O 1 + + + + DiffMono + 238.229666 + + + + Formula + C 20 H 37 N 1 O 3 + + + + MassAvg + 339.52 + + + + MassMono + 339.277344 + + + + Origin + T + + + + Source + natural + + + + TermSpec + none + + MOD:00652 + MOD:00917 + PSI-MOD + + + MOD:00089 + O-palmitoyl-L-serine + + A protein modification that effectively converts an L-serine residue to O-palmitoyl-L-serine. + + 3467339 + PubMed + + + AA0080 + RESID + + + 47#S + UniMod + + + PSI-MOD-slim + + (2S)-2-amino-3-(hexadecanoyloxy)propanoic acid + RESID-systematic + + + ACT_SITE O-palmitoyl serine intermediate + UniProt-feature + + + L-serine hexadecanoate ester + RESID-alternate + + + LIPID O-palmitoyl serine + UniProt-feature + + + O-palmitoyl-L-serine + RESID-name + + + O-palmitoylated L-serine + PSI-MOD-alternate + + + O3-palmitoyl-serine + RESID-alternate + + + OPamSer + PSI-MOD-label + + + Palmitoyl + PSI-MS-label + + + Palmitoylation + UniMod-description + + + palmitoylations + OMSSA-label + + + serine palmitate ester + RESID-alternate + + + + DiffAvg + 238.41 + + + + DiffFormula + C 16 H 30 N 0 O 1 + + + + DiffMono + 238.229666 + + + + Formula + C 19 H 35 N 1 O 3 + + + + MassAvg + 325.49 + + + + MassMono + 325.261694 + + + + Origin + S + + + + Source + natural + + + + TermSpec + none + + MOD:00652 + MOD:00916 + PSI-MOD + + + MOD:00090 + L-alanine amide + + A protein modification that effectively converts an L-alanine residue to L-alanine amide. + + 1377792 + PubMed + + + 2069951 + PubMed + + + 8472537 + PubMed + + + 952951 + PubMed + + + AA0081 + RESID + + + PSI-MOD-slim + + (2S)-2-aminopropanamide + RESID-systematic + + + AlaN + PSI-MOD-label + + + alaninamide + RESID-alternate + + + amidated L-alanine + PSI-MOD-alternate + + + L-alanine amide + RESID-name + + + MOD_RES Alanine amide + UniProt-feature + + + + DiffAvg + -0.98 + + + + DiffFormula + C 0 H 1 N 1 O -1 + + + + DiffMono + -0.984016 + + + + Formula + C 3 H 7 N 2 O 1 + + + + MassAvg + 87.10 + + + + MassMono + 87.055838 + + + + Origin + A + + + + Source + natural + + + + TermSpec + C-term + + MOD:00883 + MOD:00901 + PSI-MOD + + + MOD:00091 + L-arginine amide + + A protein modification that effectively converts an L-arginine residue to L-arginine amide. + + 2229025 + PubMed + + + 2753890 + PubMed + + + 743209 + PubMed + + + AA0082 + RESID + + + PSI-MOD-slim + + (2S)-2-amino-5-[(diaminomethylidene)amino]pentanamide + RESID-systematic + + + 2-amino-5-carbamimidamidopentanamide + RESID-alternate + + + 2-amino-5-guanidinopentanamide + RESID-alternate + + + amidated L-arginine + PSI-MOD-alternate + + + argininamide + RESID-alternate + + + ArgN + PSI-MOD-label + + + L-arginine amide + RESID-name + + + MOD_RES Arginine amide + UniProt-feature + + + + DiffAvg + -0.98 + + + + DiffFormula + C 0 H 1 N 1 O -1 + + + + DiffMono + -0.984016 + + + + Formula + C 6 H 14 N 5 O 1 + + + + MassAvg + 172.21 + + + + MassMono + 172.119835 + + + + Origin + R + + + + Source + natural + + + + TermSpec + C-term + + MOD:00883 + MOD:00902 + PSI-MOD + + + MOD:00092 + L-asparagine amide + + A protein modification that effectively converts an L-asparagine residue to L-asparagine amide. + + 2753132 + PubMed + + + 279902 + PubMed + + + 3415690 + PubMed + + + AA0083 + RESID + + + PSI-MOD-slim + + (2S)-2-aminobutanediamide + RESID-systematic + + + amidated L-asparagine + PSI-MOD-alternate + + + AsnN + PSI-MOD-label + + + asparaginamide + RESID-alternate + + + L-asparagine amide + RESID-name + + + MOD_RES Asparagine amide + UniProt-feature + + + + DiffAvg + -0.98 + + + + DiffFormula + C 0 H 1 N 1 O -1 + + + + DiffMono + -0.984016 + + + + Formula + C 4 H 8 N 3 O 2 + + + + MassAvg + 130.13 + + + + MassMono + 130.061652 + + + + Origin + N + + + + Source + natural + + + + TermSpec + C-term + + MOD:00883 + MOD:00903 + PSI-MOD + + + MOD:00093 + L-aspartic acid 1-amide + + A protein modification that effectively converts an L-aspartic acid residue to L-aspartic acid 1-amide. + + 2542051 + PubMed + + + AA0084 + RESID + + + PSI-MOD-slim + + (2S)-2-amino-1-butanediamic acid + RESID-systematic + + + 1-amidated L-aspartic acid + PSI-MOD-alternate + + + 3,4-diamino-4-oxobutanoic acid + RESID-alternate + + + 3-amino-succinamic acid + RESID-alternate + + + alpha-asparagine + RESID-alternate + + + AspN + PSI-MOD-label + + + isoasparagine + RESID-alternate + + + L-aspartic acid 1-amide + RESID-name + + + MOD_RES Aspartic acid 1-amide + UniProt-feature + + + + DiffAvg + -0.98 + + + + DiffFormula + C 0 H 1 N 1 O -1 + + + + DiffMono + -0.984016 + + + + Formula + C 4 H 7 N 2 O 3 + + + + MassAvg + 131.11 + + + + MassMono + 131.045667 + + + + Origin + D + + + + Source + natural + + + + TermSpec + C-term + + MOD:00883 + MOD:00904 + PSI-MOD + + + MOD:00094 + L-cysteine amide + + A protein modification that effectively converts an L-cysteine residue to L-cysteine amide. + + 1892838 + PubMed + + + 7149738 + PubMed + + + AA0085 + RESID + + + PSI-MOD-slim + + (2R)-2-amino-3-sulfanylpropanamide + RESID-systematic + + + 2-amino-3-mercaptopropanamide + RESID-alternate + + + amidated L-cysteine + PSI-MOD-alternate + + + CysN + PSI-MOD-label + + + cysteinamide + RESID-alternate + + + L-cysteine amide + RESID-name + + + MOD_RES Cysteine amide + UniProt-feature + + + + DiffAvg + -0.98 + + + + DiffFormula + C 0 H 1 N 1 O -1 S 0 + + + + DiffMono + -0.984016 + + + + Formula + C 3 H 7 N 2 O 1 S 1 + + + + MassAvg + 119.16 + + + + MassMono + 119.027909 + + + + Origin + C + + + + Source + natural + + + + TermSpec + C-term + + MOD:00883 + MOD:00905 + PSI-MOD + + + MOD:00095 + L-glutamine amide + + A protein modification that effectively converts an L-glutamine residue to L-glutamine amide. + + 7673220 + PubMed + + + 9048550 + PubMed + + + AA0086 + RESID + + + PSI-MOD-slim + + (2S)-2-aminopentanediamide + RESID-systematic + + + amidated L-glutamine + PSI-MOD-alternate + + + GlnN + PSI-MOD-label + + + glutaminamide + RESID-alternate + + + L-glutamine amide + RESID-name + + + MOD_RES Glutamine amide + UniProt-feature + + + + DiffAvg + -0.98 + + + + DiffFormula + C 0 H 1 N 1 O -1 + + + + DiffMono + -0.984016 + + + + Formula + C 5 H 10 N 3 O 2 + + + + MassAvg + 144.15 + + + + MassMono + 144.077302 + + + + Origin + Q + + + + Source + natural + + + + TermSpec + C-term + + MOD:00883 + MOD:00907 + PSI-MOD + + + MOD:00096 + L-glutamic acid 1-amide + + A protein modification that effectively converts an L-glutamic acid residue to L-glutamic acid 1-amide. + + 1093875 + PubMed + + + 14550575 + PubMed + + + AA0087 + RESID + + + PSI-MOD-slim + + (2S)-2-amino-1-pentanediamic acid + RESID-systematic + + + 1-amidated L-glutamic acid + PSI-MOD-alternate + + + 4,5-diamino-5-oxopentanoic acid + RESID-alternate + + + GluN + PSI-MOD-label + + + isoglutamine + RESID-alternate + + + L-glutamic acid 1-amide + RESID-name + + + MOD_RES Glutamic acid 1-amide + UniProt-feature + + + + DiffAvg + -0.98 + + + + DiffFormula + C 0 H 1 N 1 O -1 + + + + DiffMono + -0.984016 + + + + Formula + C 5 H 9 N 2 O 3 + + + + MassAvg + 145.14 + + + + MassMono + 145.061317 + + + + Origin + E + + + + Source + natural + + + + TermSpec + C-term + + MOD:00883 + MOD:00906 + PSI-MOD + + + MOD:00097 + glycine amide + + A protein modification that effectively converts a glycine residue to glycine amide. + + 13591312 + PubMed + + + AA0088 + RESID + + + PSI-MOD-slim + + 2-aminoacetamide + RESID-alternate + + + 2-aminoethanamide + RESID-systematic + + + 2-azanylethanamide + RESID-alternate + + + amidated glycine + PSI-MOD-alternate + + + glycinamide + RESID-alternate + + + glycine amide + RESID-name + + + GlyN + PSI-MOD-label + + + MOD_RES Glycine amide + UniProt-feature + + + + DiffAvg + -0.98 + + + + DiffFormula + C 0 H 1 N 1 O -1 + + + + DiffMono + -0.984016 + + + + Formula + C 2 H 5 N 2 O 1 + + + + MassAvg + 73.07 + + + + MassMono + 73.040188 + + + + Origin + G + + + + Source + natural + + + + TermSpec + C-term + + MOD:00883 + MOD:00908 + PSI-MOD + + + MOD:00098 + L-histidine amide + + A protein modification that effectively converts an L-histidine residue to L-histidine amide. + + 2153586 + PubMed + + + 2307683 + PubMed + + + 2839478 + PubMed + + + AA0089 + RESID + + + PSI-MOD-slim + + (2S)-2-amino-3-(1H-imidazol-4-yl)propanamide + RESID-systematic + + + amidated L-histidine + PSI-MOD-alternate + + + HisN + PSI-MOD-label + + + histidinamide + RESID-alternate + + + L-histidine amide + RESID-name + + + MOD_RES Histidine amide + UniProt-feature + + + + DiffAvg + -0.98 + + + + DiffFormula + C 0 H 1 N 1 O -1 + + + + DiffMono + -0.984016 + + + + Formula + C 6 H 9 N 4 O 1 + + + + MassAvg + 153.16 + + + + MassMono + 153.077636 + + + + Origin + H + + + + Source + natural + + + + TermSpec + C-term + + MOD:00883 + MOD:00909 + PSI-MOD + + + MOD:00099 + L-isoleucine amide + + A protein modification that effectively converts an L-isoleucine residue to L-isoleucine amide. + + AA0090 + RESID + + + PSI-MOD-slim + + (2S,3S)-2-amino-3-methylpentanamide + RESID-systematic + + + amidated L-isoleucine + PSI-MOD-alternate + + + IleN + PSI-MOD-label + + + isoleucinamide + RESID-alternate + + + L-isoleucine amide + RESID-name + + + MOD_RES Isoleucine amide + UniProt-feature + + + + DiffAvg + -0.98 + + + + DiffFormula + C 0 H 1 N 1 O -1 + + + + DiffMono + -0.984016 + + + + Formula + C 6 H 13 N 2 O 1 + + + + MassAvg + 129.18 + + + + MassMono + 129.102788 + + + + Origin + I + + + + Source + natural + + + + TermSpec + C-term + + MOD:00883 + MOD:00910 + PSI-MOD + + + MOD:00100 + L-leucine amide + + A protein modification that effectively converts an L-leucine residue to L-leucine amide. + + 2578459 + PubMed + + + AA0091 + RESID + + + PSI-MOD-slim + + (2S)-2-amino-4-methylpentanamide + RESID-systematic + + + 2-amino-4-methylvaleramide + RESID-alternate + + + 2-azanyl-4-methylpentanamide + RESID-alternate + + + alpha-aminoisocaproamide + RESID-alternate + + + amidated L-leucine + PSI-MOD-alternate + + + L-leucine amide + RESID-name + + + leucinamide + RESID-alternate + + + LeuN + PSI-MOD-label + + + MOD_RES Leucine amide + UniProt-feature + + + + DiffAvg + -0.98 + + + + DiffFormula + C 0 H 1 N 1 O -1 + + + + DiffMono + -0.984016 + + + + Formula + C 6 H 13 N 2 O 1 + + + + MassAvg + 129.18 + + + + MassMono + 129.102788 + + + + Origin + L + + + + Source + natural + + + + TermSpec + C-term + + MOD:00883 + MOD:00911 + PSI-MOD + + + MOD:00101 + L-lysine amide + + A protein modification that effectively converts an L-lysine residue to L-lysine amide. + + 6579533 + PubMed + + + AA0092 + RESID + + + PSI-MOD-slim + + (2S)-2,6-diaminohexanamide + RESID-systematic + + + amidated L-lysine + PSI-MOD-alternate + + + L-lysine amide + RESID-name + + + lysinamide + RESID-alternate + + + LysN + PSI-MOD-label + + + MOD_RES Lysine amide + UniProt-feature + + + + DiffAvg + -0.98 + + + + DiffFormula + C 0 H 1 N 1 O -1 + + + + DiffMono + -0.984016 + + + + Formula + C 6 H 14 N 3 O 1 + + + + MassAvg + 144.20 + + + + MassMono + 144.113687 + + + + Origin + K + + + + Source + natural + + + + TermSpec + C-term + + MOD:00883 + MOD:00912 + PSI-MOD + + + MOD:00102 + L-methionine amide + + A protein modification that effectively converts an L-methionine residue to L-methionine amide. + + 4375977 + PubMed + + + AA0093 + RESID + + + PSI-MOD-slim + + (2S)-2-amino-4-(methylsulfanyl)butanamide + RESID-systematic + + + 2-amino-4-(methylthio)butanamide + RESID-alternate + + + amidated L-methionine + PSI-MOD-alternate + + + L-methionine amide + RESID-name + + + methioninamide + RESID-alternate + + + MetN + PSI-MOD-label + + + MOD_RES Methionine amide + UniProt-feature + + + + DiffAvg + -0.98 + + + + DiffFormula + C 0 H 1 N 1 O -1 S 0 + + + + DiffMono + -0.984016 + + + + Formula + C 5 H 11 N 2 O 1 S 1 + + + + MassAvg + 147.22 + + + + MassMono + 147.059209 + + + + Origin + M + + + + Source + natural + + + + TermSpec + C-term + + MOD:00883 + MOD:00913 + PSI-MOD + + + MOD:00103 + L-phenylalanine amide + + A protein modification that effectively converts an L-phenylalanine residue to L-phenylalanine amide. + + 2905621 + PubMed + + + 8868490 + PubMed + + + AA0094 + RESID + + + PSI-MOD-slim + + (2S)-2-amino-3-phenylpropanamide + RESID-systematic + + + amidated L-phenylalanine + PSI-MOD-alternate + + + L-phenylalanine amide + RESID-name + + + MOD_RES Phenylalanine amide + UniProt-feature + + + PheN + PSI-MOD-label + + + phenylalaninamide + RESID-alternate + + + + DiffAvg + -0.98 + + + + DiffFormula + C 0 H 1 N 1 O -1 + + + + DiffMono + -0.984016 + + + + Formula + C 9 H 11 N 2 O 1 + + + + MassAvg + 163.20 + + + + MassMono + 163.087138 + + + + Origin + F + + + + Source + natural + + + + TermSpec + C-term + + MOD:00883 + MOD:00914 + PSI-MOD + + + MOD:00104 + L-proline amide + + A protein modification that effectively converts an L-proline residue to L-proline amide. + + 4982117 + PubMed + + + 5760861 + PubMed + + + AA0095 + RESID + + + PSI-MOD-slim + + (2S)-pyrrolidine-2-carboxamide + RESID-systematic + + + amidated L-proline + PSI-MOD-alternate + + + L-proline amide + RESID-name + + + MOD_RES Proline amide + UniProt-feature + + + prolinamide + RESID-alternate + + + ProN + PSI-MOD-label + + + + DiffAvg + -0.98 + + + + DiffFormula + C 0 H 1 N 1 O -1 + + + + DiffMono + -0.984016 + + + + Formula + C 5 H 9 N 2 O 1 + + + + MassAvg + 113.14 + + + + MassMono + 113.071488 + + + + Origin + P + + + + Source + natural + + + + TermSpec + C-term + + MOD:00883 + MOD:00915 + PSI-MOD + + + MOD:00105 + L-serine amide + + A protein modification that effectively converts an L-serine residue to L-serine amide. + + 743209 + PubMed + + + AA0096 + RESID + + + PSI-MOD-slim + + (2S)-2-amino-3-hydroxypropanamide + RESID-systematic + + + amidated L-serine + PSI-MOD-alternate + + + L-serine amide + RESID-name + + + MOD_RES Serine amide + UniProt-feature + + + serinamide + RESID-alternate + + + SerN + PSI-MOD-label + + + + DiffAvg + -0.98 + + + + DiffFormula + C 0 H 1 N 1 O -1 + + + + DiffMono + -0.984016 + + + + Formula + C 3 H 7 N 2 O 2 + + + + MassAvg + 103.10 + + + + MassMono + 103.050752 + + + + Origin + S + + + + Source + natural + + + + TermSpec + C-term + + MOD:00883 + MOD:00916 + PSI-MOD + + + MOD:00106 + L-threonine amide + + A protein modification that effectively converts an L-threonine residue to L-threonine amide. + + 1390774 + PubMed + + + AA0097 + RESID + + + PSI-MOD-slim + + (2S,3R)-2-amino-3-hydroxybutanamide + RESID-systematic + + + amidated L-threonine + PSI-MOD-alternate + + + L-threonine amide + RESID-name + + + MOD_RES Threonine amide + UniProt-feature + + + threoninamide + RESID-alternate + + + ThrN + PSI-MOD-label + + + + DiffAvg + -0.98 + + + + DiffFormula + C 0 H 1 N 1 O -1 + + + + DiffMono + -0.984016 + + + + Formula + C 4 H 9 N 2 O 2 + + + + MassAvg + 117.13 + + + + MassMono + 117.066403 + + + + Origin + T + + + + Source + natural + + + + TermSpec + C-term + + MOD:00883 + MOD:00917 + PSI-MOD + + + MOD:00107 + L-tryptophan amide + + A protein modification that effectively converts an L-tryptophan residue to L-tryptophan amide. + + 3947348 + PubMed + + + AA0098 + RESID + + + PSI-MOD-slim + + (2S)-2-amino-3-(1H-indol-3-yl)propanamide + RESID-systematic + + + amidated L-tryptophan + PSI-MOD-alternate + + + L-tryptophan amide + RESID-name + + + MOD_RES Tryptophan amide + UniProt-feature + + + TrpN + PSI-MOD-label + + + tryptophanamide + RESID-alternate + + + + DiffAvg + -0.98 + + + + DiffFormula + C 0 H 1 N 1 O -1 + + + + DiffMono + -0.984016 + + + + Formula + C 11 H 12 N 3 O 1 + + + + MassAvg + 202.24 + + + + MassMono + 202.098037 + + + + Origin + W + + + + Source + natural + + + + TermSpec + C-term + + MOD:00883 + MOD:00918 + PSI-MOD + + + MOD:00108 + L-tyrosine amide + + A protein modification that effectively converts an L-tyrosine residue to L-tyrosine amide. + + 1377792 + PubMed + + + 3562898 + PubMed + + + 6509012 + PubMed + + + AA0099 + RESID + + + PSI-MOD-slim + + (2S)-2-amino-3-(4-hydoxyphenyl)propanamide + RESID-systematic + + + amidated L-tyrosine + PSI-MOD-alternate + + + L-tyrosine amide + RESID-name + + + MOD_RES Tyrosine amide + UniProt-feature + + + TyrN + PSI-MOD-label + + + tyrosinamide + RESID-alternate + + + + DiffAvg + -0.98 + + + + DiffFormula + C 0 H 1 N 1 O -1 + + + + DiffMono + -0.984016 + + + + Formula + C 9 H 11 N 2 O 2 + + + + MassAvg + 179.20 + + + + MassMono + 179.082053 + + + + Origin + Y + + + + Source + natural + + + + TermSpec + C-term + + MOD:00883 + MOD:00919 + PSI-MOD + + + MOD:00109 + L-valine amide + + A protein modification that effectively converts an L-valine residue to L-valine amide. + + 2578459 + PubMed + + + 5465996 + PubMed + + + AA0100 + RESID + + + PSI-MOD-slim + + (2S)-2-amino-3-methylbutanamide + RESID-systematic + + + L-valine amide + RESID-name + + + MOD_RES Valine amide + UniProt-feature + + + valinamide + RESID-alternate + + + ValN + PSI-MOD-label + + + + DiffAvg + -0.98 + + + + DiffFormula + C 0 H 1 N 1 O -1 + + + + DiffMono + -0.984016 + + + + Formula + C 5 H 11 N 2 O 1 + + + + MassAvg + 115.16 + + + + MassMono + 115.087138 + + + + Origin + V + + + + Source + natural + + + + TermSpec + C-term + + MOD:00883 + MOD:00920 + PSI-MOD + + + MOD:00110 + L-cysteine methyl disulfide + + A protein modification that effectively converts an L-cysteine residue to L-cysteine methyl disulfide. + + 10555576 + PubMed + + + 163643 + PubMed + + + 2056535 + PubMed + + + 6381494 + PubMed + + + AA0101 + RESID + + + 39#C + UniMod + + + Produced artifactually by reaction of cysteine residues with methyl methanethiosulfonate (MMTS) [JSG]. + + (2R)-2-amino-3-(methyldisulfanediyl)propanoic acid + RESID-systematic + + + 2-amino-3-(methyldisulfanediyl)propanoic acid + RESID-alternate + + + 2-amino-3-(methyldithio)propanoic acid + RESID-alternate + + + 2-amino-3-methyldisulfanylpropanoic acid + RESID-alternate + + + 2-azanyl-3-(methyldisulfanediyl)-propanoic acid + RESID-alternate + + + Beta-methylthiolation + UniMod-description + + + L-3-(methyldithio)alanine + RESID-alternate + + + L-cysteine methyl disulfide + RESID-name + + + methyl methanethiolsulfonate derivatized cysteine + PSI-MOD-alternate + + + methyl methanethiosulfonate derivatized cysteine + PSI-MOD-alternate + + + Methylthio + PSI-MS-label + + + Methylthio + UniMod-interim + + + mmts + OMSSA-label + + + MOD_RES Cysteine methyl disulfide + UniProt-feature + + + S-methylthio-L-cysteine + RESID-alternate + + + S-methylthiocysteine + RESID-alternate + + + + DiffAvg + 46.09 + + + + DiffFormula + C 1 H 2 N 0 O 0 S 1 + + + + DiffMono + 45.987721 + + + + Formula + C 4 H 7 N 1 O 1 S 2 + + + + MassAvg + 149.23 + + + + MassMono + 148.996906 + + + + Origin + C + + + + Source + hypothetical + + + + TermSpec + none + + MOD:00848 + MOD:00905 + MOD:01153 + MOD:01862 + PSI-MOD + + + MOD:00111 + S-farnesyl-L-cysteine + + A protein modification that effectively converts an L-cysteine residue to S-farnesyl-L-cysteine. + + 293 + DeltaMass + + + 1409665 + PubMed + + + 15609361 + PubMed + + + 1872463 + PubMed + + + 2684976 + PubMed + + + AA0102 + RESID + + + 44#C + UniMod + + + From DeltaMass: (name misspelled "S-farnesyl cystenyl") + PSI-MOD-slim + + (2R)-2-amino-3-([(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-yl]sulfanyl)propanoic acid + RESID-systematic + + + 2-amino-3-(3,7,11-trimethyl-2,6,10-dodecatrienylthio)propanoic acid + RESID-alternate + + + Farnesyl + PSI-MS-label + + + Farnesylation + UniMod-description + + + farnesylationc + OMSSA-label + + + LIPID S-farnesyl cysteine + UniProt-feature + + + S-farnesyl Cystenyl + DeltaMass-label + + + S-farnesyl-L-cysteine + RESID-name + + + SFarnCys + PSI-MOD-label + + + + DiffAvg + 204.36 + + + + DiffFormula + C 15 H 24 N 0 O 0 S 0 + + + + DiffMono + 204.187801 + + + + Formula + C 18 H 29 N 1 O 1 S 1 + + + + MassAvg + 307.50 + + + + MassMono + 307.196986 + + + + Origin + C + + + + Source + natural + + + + TermSpec + none + + MOD:00437 + MOD:01110 + PSI-MOD + + + MOD:00112 + S-12-hydroxyfarnesyl-L-cysteine + + A protein modification that effectively converts an L-cysteine residue to S-12-hydroxyfarnesyl-L-cysteine. + + 17790543 + PubMed + + + AA0103 + RESID + + + 376 + UniMod + + + + (2R)-2-amino-3-([(2E,6E,10Z)-12-hydroxy-3,7,11-trimethyldodeca-2,6,10-trien-1-yl]sulfanyl)propanoic acid + RESID-systematic + + + 2-amino-3-(12-hydroxy-3,7,11-trimethyl-3,6,10-dodecatrienylthio)propanoic acid + RESID-alternate + + + Hydroxyfarnesyl + PSI-MS-label + + + hydroxyfarnesyl + UniMod-description + + + LIPID S-12-hydroxyfarnesyl cysteine + UniProt-feature + + + S-12-hydroxyfarnesyl-L-cysteine + RESID-name + + + S12HyFarnCys + PSI-MOD-label + + + + DiffAvg + 220.36 + + + + DiffFormula + C 15 H 24 N 0 O 1 S 0 + + + + DiffMono + 220.182715 + + + + Formula + C 18 H 29 N 1 O 2 S 1 + + + + MassAvg + 323.50 + + + + MassMono + 323.191900 + + + + Origin + C + + + + Source + natural + + + + TermSpec + none + + MOD:01110 + PSI-MOD + + + MOD:00113 + S-geranylgeranyl-L-cysteine + + A protein modification that effectively converts an L-cysteine residue to S-geranylgeranyl-L-cysteine. + + 0 + DeltaMass + + + 1483450 + PubMed + + + 15609361 + PubMed + + + AA0104 + RESID + + + 48#C + UniMod + + + DeltaMass calculates the mass with two double bonds rather than four + PSI-MOD-slim + + (2R)-2-amino-3-([(2E,6E,10Z)-12-hydroxy-3,7,11-trimethyldodeca-2,6,10-trien-1-yl]sulfanyl)propanoic acid + RESID-systematic + + + 2-amino-3-(3,7,11,15-tetramethyl-2,6,10,14-hexadecatetraenylthio)propanoic acid + RESID-alternate + + + Geranyl-geranyl + UniMod-description + + + GeranylGeranyl + PSI-MS-label + + + geranylgeranylc + OMSSA-label + + + LIPID S-geranylgeranyl cysteine + UniProt-feature + + + S-geranylgeranyl + DeltaMass-label + + + S-geranylgeranyl-L-cysteine + RESID-name + + + SGergerCys + PSI-MOD-label + + + + DiffAvg + 272.48 + + + + DiffFormula + C 20 H 32 N 0 O 0 S 0 + + + + DiffMono + 272.250401 + + + + Formula + C 23 H 37 N 1 O 1 S 1 + + + + MassAvg + 375.62 + + + + MassMono + 375.259586 + + + + Origin + C + + + + Source + natural + + + + TermSpec + none + + MOD:00441 + MOD:01110 + PSI-MOD + + + MOD:00114 + L-cysteine methyl ester + + A protein modification that effectively converts an L-cysteine residue to L-cysteine methyl ester. + + 11875433 + PubMed + + + 1872463 + PubMed + + + AA0105 + RESID + + + 34#C-term + UniMod + + + Secondary to RESID:AA0102; secondary to RESID:AA0103; secondary to RESID:AA0104. + PSI-MOD-slim + + 2-amino-3-mercaptopropanoic methyl ester + RESID-alternate + + + 2-amino-3-sulfanylpropanoic methyl ester + RESID-alternate + + + L-cysteine methyl ester + RESID-name + + + mecysteine + RESID-alternate + + + Methyl + PSI-MS-label + + + methyl (2R)-2-amino-3-sulfanylpropanoate + RESID-systematic + + + methyl esterified L-cysteine + PSI-MOD-alternate + + + methyl L-cysteinate + RESID-alternate + + + Methylation + UniMod-description + + + MOD_RES Cysteine methyl ester + UniProt-feature + + + OMeCys + PSI-MOD-label + + + + DiffAvg + 14.03 + + + + DiffFormula + C 1 H 2 N 0 O 0 S 0 + + + + DiffMono + 14.015650 + + + + Formula + C 4 H 8 N 1 O 2 S 1 + + + + MassAvg + 134.17 + + + + MassMono + 134.027574 + + + + Origin + C + + + + Source + natural + + + + TermSpec + C-term + + MOD:01682 + MOD:01689 + PSI-MOD + + + MOD:00115 + S-palmitoyl-L-cysteine + + A protein modification that effectively converts an L-cysteine residue to S-palmitoyl-L-cysteine. + + 303 + DeltaMass + + + 1872406 + PubMed + + + 3166978 + PubMed + + + 8180229 + PubMed + + + 8824274 + PubMed + + + AA0106 + RESID + + + 47#C + UniMod + + + From DeltaMass: (name misspelled "S-palmityl Cystenyl" and formula incorrect, N and O reversed) Formula: C19H35O1N2S1 Monoisotopic Mass Change: 341.239 Average Mass Change: 341.556 + PSI-MOD-slim + + (2R)-2-amino-3-(hexadecanoylsulfanyl)propanoic acid + RESID-systematic + + + 2-amino-3-(hexadecanoylthio)propanoic acid + RESID-alternate + + + ACT_SITE S-palmitoyl cysteine intermediate + UniProt-feature + + + cysteine hexadecanoate thioester + RESID-alternate + + + cysteine palmitate thioester + RESID-alternate + + + LIPID S-palmitoyl cysteine + UniProt-feature + + + Palmitoyl + PSI-MS-label + + + Palmitoylation + UniMod-description + + + S-palmitoyl-L-cysteine + RESID-name + + + S-palmitoylated L-cysteine + PSI-MOD-alternate + + + S-palmityl Cystenyl + DeltaMass-label + + + SPamCys + PSI-MOD-label + + + + DiffAvg + 238.41 + + + + DiffFormula + C 16 H 30 N 0 O 1 S 0 + + + + DiffMono + 238.229666 + + + + Formula + C 19 H 35 N 1 O 2 S 1 + + + + MassAvg + 341.55 + + + + MassMono + 341.238850 + + + + Origin + C + + + + Source + natural + + + + TermSpec + none + + MOD:00653 + MOD:01684 + PSI-MOD + + + MOD:00116 + S-diacylglycerol-L-cysteine + + A protein modification that effectively converts an L-cysteine residue to S-diacylglycerol-L-cysteine. + + 10896212 + PubMed + + + 4575979 + PubMed + + + 9056182 + PubMed + + + AA0107 + RESID + + + 377#C + UniMod + + + Incidental to RESID:AA0060. + PSI-MOD-slim + + (2R)-2-amino-3-[(2S)-2-((9Z)-9-octadecenoyloxy)-3-(hexadecanoyloxy)propyl]sulfanylpropanoic acid + RESID-systematic + + + 2-amino-3-[(S)-2-((Z)-9-octadecenoyloxy)-3-(hexadecanoyloxy)propyl]thiopropanoic acid + RESID-alternate + + + Diacylglycerol + PSI-MS-label + + + diacylglycerol + UniMod-description + + + LIPID S-diacylglycerol cysteine + UniProt-feature + + + S-(1-2'-oleoyl-3'-palmitoyl-glycerol)cysteine + RESID-alternate + + + S-(2',3'-diacylglycerol)-L-cysteine + PSI-MOD-alternate + + + S-diacylglycerol-L-cysteine + RESID-name + + + SAcyl2GlyceroCys + PSI-MOD-label + + + + Origin + C + + + + Source + natural + + + + TermSpec + none + + MOD:00905 + MOD:01155 + PSI-MOD + + + MOD:00117 + S-(L-isoglutamyl)-L-cysteine + + A protein modification that effectively crosslinks an L-cysteine residue and an L-glutamine residue by a thioester bond with the formation of S-(L-isoglutamyl)-L-cysteine and the release of ammonia. + + 22021 + ChEBI + + + 0 + DeltaMass + + + 6838833 + PubMed + + + AA0108 + RESID + + + Cross-link 2; DeltaMass calculates the mass difference from glutamic acid rather than glutamine. + PSI-MOD-slim + + (2S)-2-amino-5-[(2R)-2-amino-2-carboxyethyl]sulfanyl-5-oxopentanoic acid + RESID-systematic + + + (S,R)-2-amino-4-[S-(2-amino-2-carboxyethyl)thiocarboxy]butanoic acid + RESID-alternate + + + 2-amino-5-(2-amino-2-carboxyethyl)thio-5-oxopentanoic acid + RESID-alternate + + + CROSSLNK Isoglutamyl cysteine thioester (Cys-Gln) + UniProt-feature + + + gamma-(S-cysteinyl)glutamic acid + RESID-alternate + + + S-(L-isoglutamyl)-L-cysteine + RESID-name + + + S-gamma-glutamyl (crosslinked to cysteine) + DeltaMass-label + + + XLNK-SCys-5Glu(Gln) + PSI-MOD-label + + + + DiffAvg + -17.03 + + + + DiffFormula + C 0 H -3 N -1 O 0 S 0 + + + + DiffMono + -17.026549 + + + + Formula + C 8 H 10 N 2 O 3 S 1 + + + + MassAvg + 214.24 + + + + MassMono + 214.041213 + + + + Origin + C, Q + + + + Source + natural + + + + TermSpec + none + + MOD:00395 + MOD:00907 + MOD:00946 + PSI-MOD + + + MOD:00118 + 2'-(S-L-cysteinyl)-L-histidine + + A protein modification that effectively cross-links an L-cysteine residue and an L-histidine residue by a thioether bond to form 2'-(S-L-cysteinyl)-L-histidine. + + 0 + DeltaMass + + + 6210696 + PubMed + + + AA0109 + RESID + + + Cross-link 2. + + (2R)-2-amino-3-[(4-[(2S)-2-amino-2-carboxyethyl]-1H-imidazol-2-yl)sulfanyl]propanoic acid + RESID-systematic + + + (2S)-2-amino-3-[2-([(2R)-2-amino-2-carboxyethyl]sulfanyl)-1H-imidazol-4-yl]propanoic acid + RESID-alternate + + + 2'-(L-cystein-S-yl)-L-histidine + RESID-name + + + CROSSLNK 2'-(S-cysteinyl)-histidine (Cys-His) + UniProt-feature + + + S-(2'-histidyl)cysteine + RESID-alternate + + + S-(2-histidyl)- (crosslinked to cysteine) + DeltaMass-label + + + XLNK-SCys-2'His + PSI-MOD-label + + + + DiffAvg + -2.02 + + + + DiffFormula + C 0 H -2 N 0 O 0 S 0 + + + + DiffMono + -2.015650 + + + + Formula + C 9 H 10 N 4 O 2 S 1 + + + + MassAvg + 238.26 + + + + MassMono + 238.052447 + + + + Origin + C, H + + + + Source + natural + + + + TermSpec + none + + MOD:00687 + MOD:00909 + PSI-MOD + + + MOD:00119 + L-lanthionine (Cys-Ser) + + A protein modification that effectively cross-links an L-cysteine residue and an L-serine residue by a thioether bond to form L-lanthionine. + + 21347 + ChEBI + + + 7 + DeltaMass + + + AA0110#CSX + RESID + + + Cross-link 2. The natural occurrence of this modification is rare. For the more common modification see MOD:00120 meso-lanthionine [JSG]. + + (2R,2'R)-3,3'-sulfanediylbis(2-aminopropanoic acid) + RESID-systematic + + + (R)-S-(2-amino-2-carboxyethyl)-L-cysteine + RESID-alternate + + + (R,R)-2,6-diamino-4-thiaheptanedioic acid + RESID-alternate + + + (R,R)-3,3'-thiobis-(2-aminopropanoic acid) + RESID-alternate + + + (R,R)-bis(2-amino-2-carboxyethyl)sulfide + RESID-alternate + + + 2-amino-3-(2-amino-2-carboxyethyl)sulfanylpropanoic acid + RESID-alternate + + + 3,3'-thiobis-L-alanine + RESID-alternate + + + L-lanthionine + RESID-name + + + XLNK-SCys-(L)3Dha + PSI-MOD-label + + + + DiffAvg + -18.02 + + + + DiffFormula + C 0 H -2 N 0 O -1 S 0 + + + + DiffMono + -18.010565 + + + + Formula + C 6 H 8 N 2 O 2 S 1 + + + + MassAvg + 172.20 + + + + MassMono + 172.030649 + + + + Origin + C, S + + + + Source + artifact + + + + TermSpec + none + + MOD:00916 + MOD:00954 + MOD:01839 + PSI-MOD + + + MOD:00120 + meso-lanthionine + + A protein modification that effectively cross-links an L-cysteine residue and an L-serine residue by a thioether bond to form meso-lanthionine. + + 15023056 + PubMed + + + 3769923 + PubMed + + + AA0111 + RESID + + + Cross-link 2. + + (2R,2'S)-3,3'-sulfanediylbis(2-aminopropanoic acid) + RESID-systematic + + + (2R,2'S)-3,3'-thiobis-(2-aminopropanoic acid) + RESID-alternate + + + (2R,6S)-2,6-diamino-4-thiaheptanedioic acid + RESID-alternate + + + (2R,6S)-meso-lanthionine + RESID-alternate + + + (2S)-2-amino-3-[[(2R)-2-amino-2-carboxyethyl]sulfanyl]propanoic acid + RESID-alternate + + + (2S,6R)-meso-lanthionine + RESID-misnomer + + + (R)-S-(2-amino-2-carboxyethyl)-D-cysteine + RESID-alternate + + + (R,S)-bis(2-amino-2-carboxyethyl)sulfide + RESID-alternate + + + 3,3'-thiobis-meso-alanine + RESID-alternate + + + CROSSLNK Lanthionine (Cys-Ser) + UniProt-feature + + + CROSSLNK Lanthionine (Ser-Cys) + UniProt-feature + + + cysteine-3-D-alanine thioether + RESID-alternate + + + meso-lanthionine + RESID-name + + + XLNK-SCys-(D)3Dha + PSI-MOD-label + + + + DiffAvg + -18.02 + + + + DiffFormula + C 0 H -2 N 0 O -1 S 0 + + + + DiffMono + -18.010565 + + + + Formula + C 6 H 8 N 2 O 2 S 1 + + + + MassAvg + 172.20 + + + + MassMono + 172.030649 + + + + Origin + C, S + + + + Source + natural + + + + TermSpec + none + + MOD:00916 + MOD:00954 + MOD:01841 + PSI-MOD + + + MOD:00121 + (2S,3S,2'R)-3-methyllanthionine + + A protein modification that effectively cross-links an L-cysteine residue and an L-threonine residue by a thioether bond to form (2S,3S,2'R)-3-methyllanthionine. + + 3769923 + PubMed + + + AA0112 + RESID + + + Cross-link 2. + + (2S,3S)-2-amino-3-([(2R)-2-amino-2-carboxyethyl]sulfanyl)butanoic acid + RESID-systematic + + + (2S,3S,2'R)-2-amino-3-[(2-amino-2-carboxyethyl)thio]butanoic acid + RESID-alternate + + + (2S,3S,2'R)-3-methyllanthionine + RESID-name + + + (2S,3S,6R)-2,6-diamino-3-methyl-4-thiaheptanedioic acid + RESID-alternate + + + (2S,3S,6R)-3-methyllanthionine + RESID-alternate + + + (2S-[2R*,3R*(S*)])-2-amino-3-[(2-amino-2-carboxyethyl)thio]butanoic acid + RESID-alternate + + + 3-methyl-D,L-lanthionine + RESID-alternate + + + CROSSLNK Beta-methyllanthionine (Cys-Thr) + UniProt-feature + + + CROSSLNK Beta-methyllanthionine (Thr-Cys) + UniProt-feature + + + cysteine-3-D-butyrine thioether + RESID-alternate + + + XLNK-SCys-3Dhb + PSI-MOD-label + + + + DiffAvg + -18.02 + + + + DiffFormula + C 0 H -2 N 0 O -1 S 0 + + + + DiffMono + -18.010565 + + + + Formula + C 7 H 10 N 2 O 2 S 1 + + + + MassAvg + 186.23 + + + + MassMono + 186.046299 + + + + Origin + C, T + + + + Source + natural + + + + TermSpec + none + + MOD:01981 + PSI-MOD + + + MOD:00122 + 3'-(S-L-cysteinyl)-L-tyrosine + + A protein modification that effectively cross-links an L-cysteine residue and an L-tyrosine residue by a thioether bond to form 2-(S-L-cysteinyl)-L-tyrosine. + + 0 + DeltaMass + + + 15917234 + PubMed + + + 2002850 + PubMed + + + AA0113 + RESID + + + Cross-link 2. + + (2S)-2-amino-3-(3-[(2R)2-amino-2-carboxyethylsulfanyl]-4-hydroxyphenyl)propanoic acid + RESID-systematic + + + 2-amino-3-[3-(2-amino-2-carboxyethylthio)-4-hydroxyphenyl]propanoic acid + RESID-alternate + + + 3'-(cystein-S-yl)tyrosine + RESID-alternate + + + 3'-(L-cystein-S-yl)-L-tyrosine + RESID-name + + + CROSSLNK 3'-(S-cysteinyl)-tyrosine (Cys-Tyr) + UniProt-feature + + + CROSSLNK 3'-(S-cysteinyl)-tyrosine (Tyr-Cys) + UniProt-feature + + + S-(3-Tyr) (Crosslinked to Cysteine) + DeltaMass-label + + + S-(tyros-3'-yl)cysteine + RESID-alternate + + + XLNK-SCys-3'Tyr + PSI-MOD-label + + + + DiffAvg + -2.02 + + + + DiffFormula + C 0 H -2 N 0 O 0 S 0 + + + + DiffMono + -2.015650 + + + + Formula + C 12 H 12 N 2 O 3 S 1 + + + + MassAvg + 264.30 + + + + MassMono + 264.056863 + + + + Origin + C, Y + + + + Source + natural + + + + TermSpec + none + + MOD:00687 + MOD:00919 + PSI-MOD + + + MOD:00123 + N6-carboxy-L-lysine + + A protein modification that effectively converts an L-lysine residue to N6-carboxy-L-lysine. + + 11369851 + PubMed + + + 4436319 + PubMed + + + 637859 + PubMed + + + 7754395 + PubMed + + + AA0114 + RESID + + + 299#K + UniMod + + + PSI-MOD-slim + + (2S)-2-amino-6-(carboxyamino)hexanoic acid + RESID-systematic + + + 2-amino-6-carbamic hexanoic acid + RESID-alternate + + + Carboxy + UniMod-interim + + + Carboxylation + UniMod-description + + + lysine NZ-carboxylic acid + RESID-alternate + + + MOD_RES N6-carboxylysine + UniProt-feature + + + N6-carbamyllysine + RESID-misnomer + + + N6-carboxy-L-lysine + RESID-name + + + N6-carboxylysine + RESID-alternate + + + N6CbxLys + PSI-MOD-label + + + + DiffAvg + 44.01 + + + + DiffFormula + C 1 H 0 N 0 O 2 + + + + DiffMono + 43.989829 + + + + Formula + C 7 H 12 N 2 O 3 + + + + MassAvg + 172.18 + + + + MassMono + 172.084792 + + + + Origin + K + + + + Source + natural + + + + TermSpec + none + + MOD:00912 + MOD:01152 + PSI-MOD + + + MOD:00124 + N6-1-carboxyethyl-L-lysine + + A protein modification that effectively converts an L-lysine residue to N6-1-carboxyethyl-L-lysine. + + 3123486 + PubMed + + + 8253186 + PubMed + + + 8421682 + PubMed + + + AA0115 + RESID + + + 378#K + UniMod + + + PSI-MOD-slim + + (2S)-2-amino-6-([(1S)-1-carboxyethyl]amino)hexanoic acid + RESID-systematic + + + Carboxyethyl + PSI-MS-label + + + carboxyethyl + UniMod-description + + + MOD_RES N6-1-carboxyethyl lysine + UniProt-feature + + + N6-(1-carboxyethyl)-L-lysine + RESID-name + + + N6-(1-carboxyethyl)lysine + RESID-alternate + + + N6CbzEtLys + PSI-MOD-label + + + NZ-(1-carboxyethyl)lysine + RESID-alternate + + + + DiffAvg + 72.06 + + + + DiffFormula + C 3 H 4 N 0 O 2 + + + + DiffMono + 72.021129 + + + + Formula + C 9 H 16 N 2 O 3 + + + + MassAvg + 200.24 + + + + MassMono + 200.116092 + + + + Origin + K + + + + Source + natural + + + + TermSpec + none + + MOD:00912 + PSI-MOD + + + MOD:00125 + hypusine + + A protein modification that effectively converts an L-lysine residue to hypusine, N6-(4-amino-2-hydroxybutyl)-L-lysine. + + 0 + DeltaMass + + + 6806267 + PubMed + + + 8108861 + PubMed + + + AA0116 + RESID + + + 379#K + UniMod + + + This modification occurs uniquely in translation initiation factor eIF-5A [JSG]. + PSI-MOD-slim + + (2S)-2-amino-6-([(2R)-4-amino-2-hydroxybutyl]amino)hexanoic acid + RESID-systematic + + + (2S,9R)-2,11-diazanyl-9-hydroxy-7-azaundecanoic acid + RESID-alternate + + + (2S,9R)-hypusine + RESID-alternate + + + 2-azanyl-6-[(4-azanyl-2-hydroxybutyl)azanyl]hexanoic acid + RESID-alternate + + + Hypu + PSI-MOD-label + + + Hypusine + PSI-MS-label + + + hypusine + UniMod-description + + + L-hypusine + RESID-name + + + MOD_RES Hypusine + UniProt-feature + + + N-(4-NH2-2-OH-butyl)- (of Lysine) + DeltaMass-label + + + N6-(4-amino-2-hydroxybutyl)-L-lysine + RESID-alternate + + + + DiffAvg + 87.12 + + + + DiffFormula + C 4 H 9 N 1 O 1 + + + + DiffMono + 87.068414 + + + + Formula + C 10 H 21 N 3 O 2 + + + + MassAvg + 215.30 + + + + MassMono + 215.163377 + + + + Origin + K + + + + Source + natural + + + + TermSpec + none + + MOD:00912 + MOD:01884 + + derives_from + MOD:018800 + + PSI-MOD + + + MOD:00126 + N6-biotinyl-L-lysine + + A protein modification that effectively converts an L-lysine residue to N6-biotinyl-L-lysine. + + 305 + DeltaMass + + + 16109483 + PubMed + + + 3178228 + PubMed + + + 7948875 + PubMed + + + 8747466 + PubMed + + + AA0117 + RESID + + + 3#K + UniMod + + + From DeltaMass: Average Mass: 354 Formula:C 16 H 26 O 4 N 3 S 1 (formula incorrect, N and O reversed) Monoisotopic Mass Change:354.172 Average Mass Change:354.471 References:PE Sciex. + PSI-MOD-slim + + (2S)-2-amino-6-(5-[(3aS,4S,6aR)-2-oxohexahydro-1H-thieno[3,4-d]imidazol-4-yl]pentanoylamino)hexanoic acid + RESID-systematic + + + (3aS-(3aalpha,4beta,6aalpha))-N6-(5-(hexahydro-2-oxo-1H-thieno(3,4-d)imidazol-4-yl)-1-oxopentyl)-L-lysine + RESID-alternate + + + biocytin + RESID-alternate + + + Biotin + PSI-MS-label + + + biotinyl lysyl + DeltaMass-label + + + Biotinylation + UniMod-description + + + epsilon-N-biotinyllysine + RESID-alternate + + + MOD_RES N6-biotinyllysine + UniProt-feature + + + N6-[5-((3aS,4S,6aR)-hexahydro-2-oxo-1H-thieno[3,4-d]imidazol-4-yl)-1-oxopentyl]-L-lysine + RESID-alternate + + + N6-biotinyl-L-lysine + RESID-name + + + N6-biotinyllysine + RESID-alternate + + + N6BtnLys + PSI-MOD-label + + + + DiffAvg + 226.29 + + + + DiffFormula + C 10 H 14 N 2 O 2 S 1 + + + + DiffMono + 226.077599 + + + + Formula + C 16 H 26 N 4 O 3 S 1 + + + + MassAvg + 354.47 + + + + MassMono + 354.172562 + + + + Origin + K + + + + Source + natural + + + + TermSpec + none + + MOD:01875 + MOD:01885 + PSI-MOD + + + MOD:00127 + N6-lipoyl-L-lysine + + A protein modification that effectively converts an L-lysine residue to N6-lipoyl-L-lysine. + + 0 + DeltaMass + + + 3421911 + PubMed + + + 3522581 + PubMed + + + 7719855 + PubMed + + + AA0118 + RESID + + + 42#K + UniMod + + + PSI-MOD-slim + + (2S)-2-amino-6-(5-[(3R)-1,2-dithiolan-3-yl]pentanamido)hexanoic acid + RESID-alternate + + + (2S)-2-amino-6-[(5-[(3R)-1,2-dithiolan-3-yl]pentanoyl)amino]hexanoic acid + RESID-systematic + + + (2S,6'R)-2-amino-6-(6,8-dithiooctanamido)hexanoic acid + RESID-alternate + + + 2-amino-6-(5-[1,2-dithiolan-3-yl]-1-oxopentyl)aminohexanoic acid + RESID-alternate + + + Lipoyl + PSI-MS-label + + + Lipoyl + UniMod-description + + + lipoylk + OMSSA-label + + + MOD_RES N6-lipoyllysine + UniProt-feature + + + N-Lipoyl- (on Lysine) + DeltaMass-label + + + N6-6,8-dithiooctanoyllysine + RESID-alternate + + + N6-lipoyl-L-lysine + RESID-name + + + N6-lipoyllysine + RESID-alternate + + + N6LipLys + PSI-MOD-label + + + + DiffAvg + 188.30 + + + + DiffFormula + C 8 H 12 N 0 O 1 S 2 + + + + DiffMono + 188.032957 + + + + Formula + C 14 H 24 N 2 O 2 S 2 + + + + MassAvg + 316.48 + + + + MassMono + 316.127920 + + + + Origin + K + + + + Source + natural + + + + TermSpec + none + + MOD:01875 + PSI-MOD + + + MOD:00128 + N6-pyridoxal phosphate-L-lysine + + A protein modification that effectively converts an L-lysine residue to N6-pyridoxal phosphate-L-lysine. + + 0 + DeltaMass + + + 1544460 + PubMed + + + AA0119 + RESID + + + 46#K + UniMod + + + From DeltaMass: Average Mass: 231 + PSI-MOD-slim + + (2S)-2-amino-6-[([3-hydroxy-2-methyl-5-phosphonooxymethylpyridin-4-yl]methylidene)amino]hexanoic acid + RESID-systematic + + + MOD_RES N6-(pyridoxal phosphate)lysine + UniProt-feature + + + N6-pyridoxal phosphate-L-lysine + RESID-name + + + N6PydoxLys + PSI-MOD-label + + + Pyridoxal phosphate + UniMod-description + + + Pyridoxal phosphate (Schiff Base formed to lysine) + DeltaMass-label + + + PyridoxalPhosphate + PSI-MS-label + + + + DiffAvg + 229.13 + + + + DiffFormula + C 8 H 8 N 1 O 5 P 1 + + + + DiffMono + 229.014009 + + + + Formula + C 14 H 20 N 3 O 6 P 1 + + + + MassAvg + 357.30 + + + + MassMono + 357.108972 + + + + Origin + K + + + + Source + natural + + + + TermSpec + none + + MOD:00912 + PSI-MOD + + + MOD:00129 + N6-retinylidene-L-lysine + + A protein modification that effectively converts an L-lysine residue to N6-retinylidene-L-lysine, the adduct of retinal. + + 6794028 + PubMed + + + 6870827 + PubMed + + + AA0120 + RESID + + + 380#K + UniMod + + + PSI-MOD-slim + + (2S)-2-amino-6-[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohex-1-en-1-yl)-2,4,6,8-nonatetraenylidene]aminohexanoic acid + RESID-systematic + + + MOD_RES N6-(retinylidene)lysine + UniProt-feature + + + N6-retinal-L-lysine + RESID-alternate + + + N6-retinyl-lysine + RESID-alternate + + + N6-retinylidene-L-lysine + RESID-name + + + N6RetalLys + PSI-MOD-label + + + retinal + UniMod-description + + + Retinylidene + PSI-MS-label + + + + DiffAvg + 266.43 + + + + DiffFormula + C 20 H 26 N 0 O 0 + + + + DiffMono + 266.203451 + + + + Formula + C 26 H 38 N 2 O 1 + + + + MassAvg + 394.60 + + + + MassMono + 394.298414 + + + + Origin + K + + + + Source + natural + + + + TermSpec + none + + MOD:00912 + PSI-MOD + + + MOD:00130 + L-allysine + + A protein modification that effectively converts an L-lysine residue to L-allysine. + + 17917 + ChEBI + + + 0 + DeltaMass + + + 11120890 + PubMed + + + 11332453 + PubMed + + + 358196 + PubMed + + + 5337886 + PubMed + + + 5529814 + PubMed + + + AA0121 + RESID + + + 352#K + UniMod + + + From DeltaMass: Average Mass: -1 + PSI-MOD-slim + + (2S)-2-amino-6-oxohexanoic acid + RESID-systematic + + + 2-amino-5-formylvaleric acid + RESID-alternate + + + 2-amino-adipic acid semialdahyde + RESID-alternate + + + 2-aminoadipate 6-semialdehyde + RESID-alternate + + + 5-formyl-norvaline + RESID-alternate + + + 6-oxonorleucine + RESID-alternate + + + AASA + RESID-alternate + + + Allysine (from Lysine) + DeltaMass-label + + + alpha-amino-adipic acid delta-semialdahyde + RESID-alternate + + + L-allysine + RESID-name + + + Lys->Allysine + PSI-MS-label + + + Lysal + PSI-MOD-label + + + Lysine oxidation to aminoadipic semialdehyde + UniMod-description + + + MOD_RES Allysine + UniProt-feature + + + Oxidation of lysine (to aminoadipic semialdehyde) + DeltaMass-label + + + + DiffAvg + -1.03 + + + + DiffFormula + C 0 H -3 N -1 O 1 + + + + DiffMono + -1.031634 + + + + Formula + C 6 H 9 N 1 O 2 + + + + MassAvg + 127.14 + + + + MassMono + 127.063329 + + + + Origin + K + + + + Source + natural + + + + TermSpec + none + + MOD:00912 + PSI-MOD + + + MOD:00131 + L-2-aminoadipic acid + + A protein modification that effectively converts an L-lysine residue to L-2-aminoadipic acid. + + 353 + DeltaMass + + + 336041 + PubMed + + + 358196 + PubMed + + + 7419498 + PubMed + + + AA0122 + RESID + + + 381#K + UniMod + + + From DeltaMass: References:Amici A, Levine, RL, Tsai, L, and Stadtman, ER: Conversion of amino acid residues in proteins and amino acid homopolymers to carbonyl derivatives by metal-catalyzed oxidation reactions. Journal of Biological Chemistry 264: 3341-3346 1989.Requena JR, Chao CC, Levine RL, and Stadtman ER: Glutamic and aminoadipic semialdehydes are the main carbonyl products of metal-catalyzed oxidation of proteins. Proceedings of the National Academy of Sciences USA 98: 69-74 2001. Notes:Expected reaction following oxidation of lysine to aminoadipic semialdehyde. Not proven experimentally but deduced by reference to the similar known reaction of oxidation of Arg to Glu via the semialdehyde. [This has been observed as a natural modification, see RESID:AA0122. JSG] + PSI-MOD-slim + + (2S)-2-aminohexanedioic acid + RESID-systematic + + + 2-amino-1,4-butanedicarboxylic acid + RESID-alternate + + + alpha-amino adipic acid + UniMod-description + + + L-2-aminoadipic acid + RESID-name + + + L-alpha-aminoadipic acid + RESID-alternate + + + Lys->AminoadipicAcid + PSI-MS-label + + + Lysoic + PSI-MOD-label + + + Oxidation of lysine (to aminoadipic acid) + DeltaMass-label + + + + DiffAvg + 14.97 + + + + DiffFormula + C 0 H -3 N -1 O 2 + + + + DiffMono + 14.963280 + + + + Formula + C 6 H 9 N 1 O 3 + + + + MassAvg + 143.14 + + + + MassMono + 143.058243 + + + + Origin + K + + + + Source + natural + + + + TermSpec + none + + MOD:00912 + PSI-MOD + + + MOD:00132 + L-lysinoalanine (Lys-Ser) + + A protein modification that effectively crosslinks an L-serine residue and an L-lysine residue to release water and form 2-amino-6-(2-amino-2-carboxyethylamino)hexanoic acid. + + 0 + DeltaMass + + + 2544544 + PubMed + + + AA0123#KSX + RESID + + + Cross-link 2. This entry is for the crosslink of peptidyl serine and peptidyl lysine. For the modification of peptidyl lysine by a free serine see MOD:01838. From DeltaMass: Average Mass: -34. + + (2R,9S)-lysinoalanine + RESID-alternate + + + (2S)-2-amino-6-([(2R)-2-amino-2-carboxyethyl]amino)hexanoic acid + RESID-systematic + + + alaninolysine + RESID-alternate + + + CROSSLNK Lysinoalanine (Ser-Lys) + UniProt-feature + + + L-lysinoalanine + RESID-name + + + LAL + RESID-alternate + + + Lysinoalanine (from Cysteine) + DeltaMass-label + + + N-epsilon-(2-amino-2-carboxyethyl)-L-lysine + RESID-alternate + + + N6-(2-amino-2-carboxyethyl)-L-lysine + RESID-alternate + + + XLNK-N6Lys-3Dha(Ser) + PSI-MOD-label + + + + DiffAvg + -18.02 + + + + DiffFormula + C 0 H -2 N 0 O -1 + + + + DiffMono + -18.010565 + + + + Formula + C 9 H 15 N 3 O 2 + + + + MassAvg + 197.24 + + + + MassMono + 197.116427 + + + + Origin + K, S + + + + Source + natural + + + + TermSpec + none + + MOD:00916 + MOD:00954 + MOD:01853 + PSI-MOD + + + MOD:00133 + N6-(L-isoglutamyl)-L-lysine (Gln) + + A protein modification that effectively crosslinks an L-glutamine residue and an L-lysine residue by an isopeptide bond with the formation of N6-(L-isoglutamyl)-L-lysine and the release of ammonia. + + 21863 + ChEBI + + + 0 + DeltaMass + + + 2461365 + PubMed + + + 5637041 + PubMed + + + 5656070 + PubMed + + + 8598899 + PubMed + + + AA0124#GLN + RESID + + + Cross-link 2. + PSI-MOD-slim + + (2S)-2-amino-6-([(4S)-4-amino-4-carboxybutanoyl]amino)hexanoic acid + RESID-systematic + + + 2-azanyl-6-([4-azanyl-4-carboxybutanoyl]azanyl)hexanoic acid + RESID-alternate + + + 5-glutamyl N6-lysine + RESID-alternate + + + CROSSLNK Isoglutamyl lysine isopeptide (Lys-Gln) + UniProt-feature + + + N alpha -(gamma-Glutamyl)-lysine + DeltaMass-label + + + N(epsilon)-(gamma-glutamyl)lysine + RESID-alternate + + + N6-(L-isoglutamyl)-L-lysine + RESID-name + + + XLNK-N6Lys-5Glu(Gln) + PSI-MOD-label + + + + DiffAvg + -17.03 + + + + DiffFormula + C 0 H -3 N -1 O 0 + + + + DiffMono + -17.026549 + + + + Formula + C 11 H 17 N 3 O 3 + + + + MassAvg + 239.27 + + + + MassMono + 239.126991 + + + + Origin + K, Q + + + + Source + natural + + + + TermSpec + none + + MOD:00907 + MOD:00946 + MOD:01630 + PSI-MOD + + + MOD:00134 + N6-glycyl-L-lysine + + A protein modification that effectively crosslinks an L-lysine residue and a glycine residue by an isopeptide bond to form N6-glycyl-L-lysine. + + 21885 + ChEBI + + + AA0125 + RESID + + + Cross-link 2; this is the common crosslink structure formed by ubiquitin, SUMO, and similar proteins. + PSI-MOD-slim + + (2S)-2-amino-6-[(aminoacetyl)amino]hexanoic acid + RESID-systematic + + + N6-(glycyl)-L-lysine + RESID-name + + + N6-glycyllysine + RESID-alternate + + + XLNK-N6Lys-1Gly + PSI-MOD-label + + + + DiffAvg + -18.02 + + + + DiffFormula + C 0 H -2 N 0 O -1 + + + + DiffMono + -18.010565 + + + + Formula + C 8 H 14 N 3 O 2 + + + + MassAvg + 184.22 + + + + MassMono + 184.108602 + + + + Origin + G, K + + + + Source + natural + + + + TermSpec + C-term + + MOD:00688 + MOD:00908 + MOD:00954 + MOD:01875 + PSI-MOD + + + MOD:00135 + N-(L-isoaspartyl)-glycine (Asn) + + A protein modification that effectively crosslinks an L-asparagine residue and a glycine residue by an isopeptide bond with formation of N-(L-isoaspartyl)glycine and the release of ammonia. + + 21479 + ChEBI + + + 1826288 + PubMed + + + AA0126 + RESID + + + Cross-link 2. + + (2S)-2-amino-4-(carboxymethyl)amino-4-oxobutanoic acid + RESID-systematic + + + 2-amino-N4-(carboxymethyl)-butanediamic acid + RESID-alternate + + + CROSSLNK Isoaspartyl glycine isopeptide (Asn-Gly) + UniProt-feature + + + CROSSLNK Isoaspartyl glycine isopeptide (Gly-Asn) + UniProt-feature + + + isoaspartyl glycine + RESID-alternate + + + N-(L-isoaspartyl)-glycine + RESID-name + + + N-beta-aspartylglycine + RESID-alternate + + + N4-(carboxymethyl)-asparagine + RESID-alternate + + + XLNK-4Asp-NGly(Asn) + PSI-MOD-label + + + + DiffAvg + -17.03 + + + + DiffFormula + C 0 H -3 N -1 O 0 + + + + DiffMono + -17.026549 + + + + Formula + C 6 H 7 N 2 O 3 + + + + MassAvg + 155.13 + + + + MassMono + 155.045667 + + + + Origin + G, N + + + + Source + natural + + + + TermSpec + N-term + + MOD:00903 + MOD:00946 + MOD:01928 + PSI-MOD + + + MOD:00136 + pyruvic acid (Cys) + + A protein modification that effectively converts an L-cysteine residue to pyruvic acid. + + 10085076 + PubMed + + + 3042771 + PubMed + + + 8464063 + PubMed + + + AA0127#CYS + RESID + + + 382 + UniMod + + + PSI-MOD-slim + + 2-oxopropanoic acid + RESID-systematic + + + MOD_RES Pyruvic acid (Cys) + UniProt-feature + + + Pyruv(Cys) + PSI-MOD-label + + + pyruvic acid + RESID-name + + + + DiffAvg + -33.09 + + + + DiffFormula + C 0 H -3 N -1 O 1 S -1 + + + + DiffMono + -33.003705 + + + + Formula + C 3 H 3 O 2 + + + + MassAvg + 71.06 + + + + MassMono + 71.013304 + + + + Origin + C + + + + Source + natural + + + + TermSpec + N-term + + MOD:00905 + MOD:01154 + PSI-MOD + + + MOD:00137 + L-3-phenyllactic acid + + A protein modification that effectively converts an L-phenylalanine residue into L-3-phenyllactic acid. + + 1973541 + PubMed + + + AA0128 + RESID + + + 7#F + UniMod + + + This modification is not the result of deamidation, instead the alpha amino group is replaced with an hydroxyl group. + + (2S)-2-hydroxy-3-phenylpropanoic acid + RESID-systematic + + + Deamidated + UniMod-interim + + + Deamidation + UniMod-description + + + L-3-phenyllactic acid + RESID-name + + + MOD_RES 3-phenyllactic acid + UniProt-feature + + + + DiffAvg + 0.98 + + + + DiffFormula + C 0 H -1 N -1 O 1 + + + + DiffMono + 0.984016 + + + + Formula + C 9 H 9 O 2 + + + + MassAvg + 149.17 + + + + MassMono + 149.060255 + + + + Origin + F + + + + TermSpec + N-term + + MOD:00914 + PSI-MOD + + + MOD:00138 + 2-oxobutanoic acid + + A protein modification that effectively converts an L-threonine residue into 2-oxobutanoic acid. + + 15023056 + PubMed + + + 1680314 + PubMed + + + 2253617 + PubMed + + + 2764678 + PubMed + + + AA0129 + RESID + + + 385#T + UniMod + + + + 2-ketobutyric acid + RESID-alternate + + + 2-oxobutanoic acid + RESID-name + + + 2-oxobutanoic acid + RESID-systematic + + + 2-oxobutyric acid + RESID-alternate + + + Ammonia-loss + UniMod-interim + + + Loss of ammonia + UniMod-description + + + MOD_RES 2-oxobutanoic acid + UniProt-feature + + + + DiffAvg + -17.03 + + + + DiffFormula + C 0 H -3 N -1 O 0 + + + + DiffMono + -17.026549 + + + + Formula + C 4 H 5 O 2 + + + + MassAvg + 85.08 + + + + MassMono + 85.028954 + + + + Origin + T + + + + TermSpec + N-term + + MOD:00917 + MOD:01160 + PSI-MOD + + + MOD:00139 + N2-succinyl-L-tryptophan + + A protein modification that effectively converts an L-tryptophan residue to N2-succinyl-L-tryptophan. + + 11857757 + PubMed + + + 12175151 + PubMed + + + 8471040 + PubMed + + + AA0130 + RESID + + + 64#N-term + UniMod + + + + (2S)-2-(3-carboxypropanoyl)amino-3-(1H-indol-3-yl)propanoic acid + RESID-systematic + + + (2S)-2-amino-(6,7-dihydro-6,7-dioxo-1H-indole)-3-propanoic acid + RESID-alternate + + + MOD_RES N2-succinyltryptophan + UniProt-feature + + + N2-succinyl-L-tryptophan + RESID-name + + + Succinic anhydride labeling reagent light form (N-term) + UniMod-description + + + Succinyl + PSI-MS-label + + + + DiffAvg + 100.07 + + + + DiffFormula + C 4 H 4 N 0 O 3 + + + + DiffMono + 100.016044 + + + + Formula + C 15 H 15 N 2 O 4 + + + + MassAvg + 287.29 + + + + MassMono + 287.103182 + + + + Origin + W + + + + TermSpec + N-term + + MOD:00457 + MOD:00918 + PSI-MOD + + + MOD:00140 + S-phycocyanobilin-L-cysteine + + A protein modification that effectively results from forming an adduct between a cysteine residue and the tetrapyrrole compound phycocyanobilin. + + 15617 + ChEBI + + + 0 + DeltaMass + + + 16644722 + PubMed + + + 3208761 + PubMed + + + 3838747 + PubMed + + + 7918400 + PubMed + + + AA0131 + RESID + + + 387#C + UniMod + + + From DeltaMass: Average Mass: 587. + + (2R,3R)-3-[(1R)-1-(((2R)-2-amino-2-carboxy)ethylsulfanyl)ethyl]-18-ethyl-1,2,3,19,21,22,24-heptahydro-2,7,13,17-tetramethyl-1,19-dioxo-(21H,22H,24H)-bilin-8,12-dipropanoic acid + RESID-alternate + + + (2R,3R)-3-[(1R)-1-(((2R)-2-amino-2-carboxy)ethylsulfanyl)ethyl]-8,12-bis(2-carboxyethyl)-18-ethyl-2,7,13,17-tetramethyl-1,2,3,19,21,22,24-heptahydrobilin-1,19(21H,22H,24H)-dione + RESID-systematic + + + BINDING Phycocyanobilin chromophore (covalent; via 1 link) + UniProt-feature + + + PCB + RESID-alternate + + + phycobilin cysteine + RESID-alternate + + + Phycocyanobilin + PSI-MS-label + + + phycocyanobilin + UniMod-description + + + phycocyanobilin cysteine adduct + RESID-alternate + + + S-Phycocyanobilin (on Cysteine) + DeltaMass-label + + + S-phycocyanobilin-L-cysteine + RESID-name + + + + DiffAvg + 586.69 + + + + DiffFormula + C 33 H 38 N 4 O 6 S 0 + + + + DiffMono + 586.279135 + + + + Formula + C 36 H 43 N 5 O 7 S 1 + + + + MassAvg + 689.83 + + + + MassMono + 689.288320 + + + + Origin + C + + + + Source + natural + + + + TermSpec + none + + MOD:00700 + MOD:00905 + PSI-MOD + + + MOD:00141 + S-phycoerythrobilin-L-cysteine + + A protein modification that effectively results from forming an adduct between a cysteine residue and the tetrapyrrole compound phycoerythrobilin. + + 15618 + ChEBI + + + 14588022 + PubMed + + + 3208761 + PubMed + + + 3838747 + PubMed + + + 8876649 + PubMed + + + AA0132 + RESID + + + 388#C + UniMod + + + + (2S,3R,16R)-18-ethenyl-3-[(1R)-1-(((2R)-2-amino-2-carboxy)ethylsulfanyl)ethyl]-8,12-bis(2-carboxyethyl)-2,7,13,17-tetramethyl-2,3,15,16-tetrahydrobilin-1,19(21H,22H,24H)-dione + RESID-systematic + + + 18-ethenyl-3-[1-((2-amino-2-carboxy)ethylsulfanyl)ethyl]-2,3,15,16-tetrahydro-2,7,13,17-tetramethyl-1,19-dioxo-(21H,22H,24H)-bilin-8,12-dipropanoic acid + RESID-alternate + + + BINDING Phycoerythrobilin chromophore (covalent; via 1 link) + UniProt-feature + + + PEB + RESID-alternate + + + Phycoerythrobilin + PSI-MS-label + + + phycoerythrobilin + UniMod-description + + + phycoerythrobilin cysteine adduct + RESID-alternate + + + S-phycoerythrobilin-L-cysteine + RESID-name + + + + DiffAvg + 588.70 + + + + DiffFormula + C 33 H 40 N 4 O 6 S 0 + + + + DiffMono + 588.294785 + + + + Formula + C 36 H 45 N 5 O 7 S 1 + + + + MassAvg + 691.84 + + + + MassMono + 691.303970 + + + + Origin + C + + + + Source + natural + + + + TermSpec + none + + MOD:00700 + MOD:00905 + PSI-MOD + + + MOD:00142 + S-phytochromobilin-L-cysteine + + A protein modification that effectively results from forming an adduct between a cysteine residue and the tetrapyrrole compound phytochromobilin. + + 15619 + ChEBI + + + 1634523 + PubMed + + + 16593380 + PubMed + + + 3208761 + PubMed + + + 7918400 + PubMed + + + AA0133 + RESID + + + 389#C + UniMod + + + + (2R,3R)-3-[(1R)-1-(((2R)-2-amino-2-carboxy)ethylsulfanyl)ethyl]-8,12-bis(2-carboxyethyl)-18-ethyl-2,7,13,17-tetramethyl-1,2,3,19,21,22,24-heptahydrobilin-1,19(21H,22H,24H)-dione + RESID-systematic + + + 18-ethenyl-3-[1-((2-amino-2-carboxy)ethylsulfanyl)ethyl]-1,2,3,19,22,24-hexahydro-2,7,13,17-tetramethyl-1,19-dioxo-21H-biline-8,12-dipropanoic acid + RESID-alternate + + + BINDING Phytochromobilin chromophore (covalent; via 1 link) + UniProt-feature + + + phytochrome chromophore + RESID-alternate + + + Phytochromobilin + PSI-MS-label + + + phytochromobilin + UniMod-description + + + phytochromobilin cysteine adduct + RESID-alternate + + + S-phytochromobilin-L-cysteine + RESID-name + + + + DiffAvg + 584.67 + + + + DiffFormula + C 33 H 36 N 4 O 6 S 0 + + + + DiffMono + 584.263485 + + + + Formula + C 36 H 41 N 5 O 7 S 1 + + + + MassAvg + 687.81 + + + + MassMono + 687.272670 + + + + Origin + C + + + + Source + natural + + + + TermSpec + none + + MOD:00700 + MOD:00905 + PSI-MOD + + + MOD:00143 + heme-bis-L-cysteine + + A protein modification that effectively results from forming an adduct between two cysteine residues and the porphyrin compound heme b, (7,12-diethenyl-3,8,13,17-tetramethylporphyrin-2,18-dipropanoato)iron. + + 17627 + ChEBI + + + 5545094 + PubMed + + + 8827449 + PubMed + + + AA0134 + RESID + + + Cross-link 2. + PSI-MOD-slim + + (7,12-bis[(1S)-1-([(2R)-2-amino-2-carboxyethyl]sulfanyl)ethyl]-3,8,13,17-tetramethyl-21H,23H-porphine-2,18-bis[2-carboxyethyl]-N21,N22,N23,N24)-ferrate + RESID-systematic + + + 2,4-bis[1-(S-cysteinyl)ethyl]protoporphyrin IX + RESID-alternate + + + BINDING Heme (covalent) + UniProt-feature + + + biscysteinyl heme + RESID-alternate + + + heme-bis-L-cysteine + RESID-name + + + HemeCys2 + PSI-MOD-label + + + + DiffAvg + 616.50 + + + + DiffFormula + C 34 Fe 1 H 32 N 4 O 4 S 0 + + + + DiffMono + 616.177293 + + + + Formula + C 40 Fe 1 H 42 N 6 O 6 S 2 + + + + MassAvg + 822.78 + + + + MassMono + 822.195663 + + + + Origin + C, C + + + + Source + natural + + + + TermSpec + none + + MOD:00699 + MOD:00905 + PSI-MOD + + + MOD:00144 + heme-L-cysteine + + A protein modification that effectively results from forming an adduct between a cysteine residue and the porphyrin compound heme b, (7,12-diethenyl-3,8,13,17-tetramethylporphyrin-2,18-dipropanoato)iron. + + 17627 + ChEBI + + + 0 + DeltaMass + + + 170910 + PubMed + + + 192772 + PubMed + + + 2536325 + PubMed + + + 9535866 + PubMed + + + AA0135 + RESID + + + 390#C + UniMod + + + From DeltaMass: Average Mass: 617. + PSI-MOD-slim + + (12-ethenyl-7-[(1S)-1-([(2R)-2-amino-2-carboxyethyl]sulfanyl)ethyl]-3,8,13,17-tetramethyl-21H,23H-porphine-2,18-bis[2-carboxyethyl]-N21,N22,N23,N24)-ferrate + RESID-systematic + + + 4-[1-(S-cysteinyl)ethyl]protoporphyrin IX + RESID-alternate + + + BINDING Heme (covalent; via 1 link) + UniProt-feature + + + cysteinyl heme + RESID-alternate + + + Heme + PSI-MS-label + + + heme + UniMod-description + + + heme-L-cysteine + RESID-name + + + HemeCys1 + PSI-MOD-label + + + S-Heme (on Cysteine) + DeltaMass-label + + + + DiffAvg + 616.50 + + + + DiffFormula + C 34 Fe 1 H 32 N 4 O 4 S 0 + + + + DiffMono + 616.177293 + + + + Formula + C 37 Fe 1 H 37 N 5 O 5 S 1 + + + + MassAvg + 719.64 + + + + MassMono + 719.186478 + + + + Origin + C + + + + Source + natural + + + + TermSpec + none + + MOD:00699 + MOD:00905 + PSI-MOD + + + MOD:00145 + tetrakis-L-cysteinyl iron + + A protein modification that effectively converts four L-cysteine residues iron atom to tetrakis-L-cysteinyl iron. + + 1303768 + PubMed + + + 2244884 + PubMed + + + AA0136 + RESID + + + Cross-link 4. + + METAL Iron + UniProt-feature + + + tetrakis(cysteinato-kappaS)-iron + RESID-systematic + + + tetrakis-L-cysteinyl iron + RESID-name + + + + DiffAvg + 51.81 + + + + DiffFormula + C 0 Fe 1 H -4 N 0 O 0 S 0 + + + + DiffMono + 51.904735 + + + + FormalCharge + 2- + + + + Formula + C 12 Fe 1 H 16 N 4 O 4 S 4 + + + + MassAvg + 464.37 + + + + MassMono + 463.941474 + + + + Origin + C, C, C, C + + + + Source + natural + + + + TermSpec + none + + MOD:00738 + MOD:00905 + PSI-MOD + + + MOD:00146 + tetrakis-L-cysteinyl diiron disulfide + + A protein modification that effectively converts four L-cysteine residues and a two-iron two-sulfur cluster to tetrakis-L-cysteinyl diiron disulfide. + + 2123937 + PubMed + + + 6801028 + PubMed + + + 7763242 + PubMed + + + 8688437 + PubMed + + + AA0137 + RESID + + + Cross-link 4. + + METAL Iron-sulfur (2Fe-2S) + UniProt-feature + + + METAL Iron-sulfur (2Fe-2S); shared with dimeric partner + UniProt-feature + + + tetrakis-L-cysteinyl diiron disulfide + RESID-name + + + tetrakiscysteinato-1kappa(2)S,2kappa(2)S-di-mu-sulfido-diiron + RESID-systematic + + + + DiffAvg + 171.78 + + + + DiffFormula + C 0 Fe 2 H -4 N 0 O 0 S 2 + + + + DiffMono + 171.783814 + + + + FormalCharge + 2- + + + + Formula + C 12 Fe 2 H 16 N 4 O 4 S 6 + + + + MassAvg + 584.34 + + + + MassMono + 583.820553 + + + + Origin + C, C, C, C + + + + Source + natural + + + + TermSpec + none + + MOD:00739 + MOD:00905 + PSI-MOD + + + MOD:00147 + hexakis-L-cysteinyl triiron trisulfide + + A protein modification that effectively converts six L-cysteine residues and a three-iron three-sulfur cluster to hexakis-L-cysteinyl triiron trisulfide. + + 3379067 + PubMed + + + 3932661 + PubMed + + + 7354058 + PubMed + + + AA0138 + RESID + + + Cross-link 6. This is a deprecated entry in RESID. It probably does not occur naturally [JSG]. + + hexakis-L-cysteinyl triiron trisulfide + RESID-name + + + tri-mu-sulfido-hexakiscysteinato-1kappa(2)S,2kappa(2)S,3kappa(2)S-triiron + RESID-systematic + + + tri-mu-sulfidotris(biscysteinato-kappaS-iron) + RESID-alternate + + + + DiffAvg + 257.67 + + + + DiffFormula + C 0 Fe 3 H -6 N 0 O 0 S 3 + + + + DiffMono + 257.675721 + + + + FormalCharge + 3- + + + + Formula + C 18 Fe 3 H 24 N 6 O 6 S 9 + + + + MassAvg + 876.50 + + + + MassMono + 875.730830 + + + + Origin + C, C, C, C, C, C + + + + Source + hypothetical + + + + TermSpec + none + + MOD:00739 + MOD:00905 + PSI-MOD + + + MOD:00148 + tris-L-cysteinyl triiron tetrasulfide + + A protein modification that effectively converts three L-cysteine residues and a three-iron four-sulfur cluster to tris-L-cysteinyl triiron tetrasulfide. + + 10555576 + PubMed + + + 2056535 + PubMed + + + 3422475 + PubMed + + + 6848518 + PubMed + + + 7819255 + PubMed + + + 9063899 + PubMed + + + AA0139 + RESID + + + Cross-link 3. + + METAL Iron-sulfur (3Fe-4S) + UniProt-feature + + + mu3-sulfido tri-mu-sulfido tris-S-L-cysteinyl triiron + RESID-alternate + + + mu3-sulfido-tri-mu-sulfido-triscysteinato-1kappaS,2kappaS,3kappaS-triiron + RESID-systematic + + + tris-L-cysteinyl triiron tetrasulfide + RESID-name + + + tris-L-cysteinyl triiron tetrasulfide C3 cluster + RESID-alternate + + + tris-L-cysteinyl triiron tetrasulfide cubane form + RESID-alternate + + + tris-L-cysteinyl triiron tetrasulfide cuboid cluster + RESID-alternate + + + tris-L-cysteinyl triiron tetrasulfide trigonal cluster + RESID-alternate + + + + DiffAvg + 292.75 + + + + DiffFormula + C 0 Fe 3 H -3 N 0 O 0 S 4 + + + + DiffMono + 292.671267 + + + + FormalCharge + 3- + + + + Formula + C 9 Fe 3 H 12 N 3 O 3 S 7 + + + + MassAvg + 602.17 + + + + MassMono + 601.698821 + + + + Origin + C, C, C + + + + Source + natural + + + + TermSpec + none + + MOD:00739 + MOD:00905 + PSI-MOD + + + MOD:00149 + tetrakis-L-cysteinyl tetrairon tetrasulfide + + A protein modification that effectively converts four L-cysteine residues and a four-iron four-sulfur cluster to tetrakis-L-cysteinyl tetrairon tetrasulfide. + + 3351918 + PubMed + + + 7803404 + PubMed + + + 7819196 + PubMed + + + 932007 + PubMed + + + AA0140 + RESID + + + Cross-link 4. + + METAL Iron-sulfur (4Fe-4S) + UniProt-feature + + + METAL Iron-sulfur (4Fe-4S); shared with dimeric partner + UniProt-feature + + + tetra-mu3-sulfido-tetrakis(cysteinato)-1kappaS,2kappaS,3kappaS,4kappaS-tetrahedro-tetrairon + RESID-systematic + + + tetra-mu3-sulfidotetrakis(S-cysteinyliron) + RESID-alternate + + + tetrakis-L-cysteinyl tetrairon tetrasulfide + RESID-name + + + + DiffAvg + 347.59 + + + + DiffFormula + C 0 Fe 4 H -4 N 0 O 0 S 4 + + + + DiffMono + 347.597831 + + + + FormalCharge + 2- + + + + Formula + C 12 Fe 4 H 16 N 4 O 4 S 8 + + + + MassAvg + 760.15 + + + + MassMono + 759.634570 + + + + Origin + C, C, C, C + + + + Source + natural + + + + TermSpec + none + + MOD:00739 + MOD:00905 + PSI-MOD + + + MOD:00150 + L-cysteinyl-L-histidino-homocitryl molybdenum heptairon nonasulfide + + A protein modification that effectively converts an L-cysteine residue, an L-histidine residue, homocitric acid and a one-molybdenum seven-iron nine-sulfur cluster to L-cysteinyl-L-histidino-homocitryl molybdenum heptairon nonasulfide. + + 10525412 + PubMed + + + 12215645 + PubMed + + + 12733878 + PubMed + + + 1529354 + PubMed + + + 8027059 + PubMed + + + AA0141 + RESID + + + Cross-link 2; incidental to RESID:AA0300. + + cysteinato-8kappaS-histidino-1kappaN(tau)-[(2R)-4-carboxy-2-(carboxymethyl)-2-oxidobutanoate-1kappaO(1),1kappaO(2)]-mu6-carbido-2:3:4:5:6:7kappa(6)C-hexa-mu3-sulfido-1:2:3kappa(3)S;1:2:4kappa(3)S;1:3:4kappa(3)S;5:6:8kappa(3)S;5:7:8kappa(3)S;6:7:8kappa(3)S-tri-mu2-sulfido-2:5kappa(2)S;3:6kappa(2)S;4:7kappa(2)S molybdenum heptairon + RESID-systematic + + + L-cysteinyl-L-histidino-homocitryl molybdenum heptairon nonasulfide carbide + RESID-name + + + nitrogenase iron-molybdenum cofactor + RESID-alternate + + + + DiffAvg + 991.53 + + + + DiffFormula + C 7 Fe 7 H 6 Mo 1 N 1 O 7 S 9 + + + + DiffMono + 993.213036 + + + + Formula + C 16 Fe 7 H 18 Mo 1 N 5 O 9 S 10 + + + + MassAvg + 1231.81 + + + + MassMono + 1233.281133 + + + + Origin + C, H + + + + Source + natural + + + + TermSpec + none + + MOD:00739 + MOD:00743 + MOD:00905 + MOD:00909 + PSI-MOD + + + MOD:00151 + L-cysteinyl molybdopterin + + A protein modification that effectively converts an L-cysteine residue to L-cysteinyl molybdopterin. + + 14527393 + PubMed + + + 7878465 + PubMed + + + 9428520 + PubMed + + + AA0142 + RESID + + + 391#C + UniMod + + + PSI-MOD-slim + + (4R,5aR,11aR)-8-amino-2-[(2R)-2-amino-2-carboxyethyl]sulfanyl-4,5a,6,9,10,11,11a-heptahydro-4-(phosphoric acid)methyl-2,2,10-trioxo-pteridino[6,7-5,6]pyrano[3,4-4,3][1,2,5]molybdadithiolene + RESID-systematic + + + cysteinyl Mo-molybdopterin + RESID-alternate + + + cysteinyl Mo-pterin + RESID-alternate + + + L-cysteinyl molybdopterin + RESID-name + + + METAL Molybdenum-pterin + UniProt-feature + + + molybdoenzyme molybdenum cofactor + RESID-alternate + + + Molybdopterin + PSI-MS-label + + + molybdopterin + UniMod-description + + + MoPterCys + PSI-MOD-label + + + + DiffAvg + 520.27 + + + + DiffFormula + C 10 H 11 Mo 1 N 5 O 8 P 1 S 2 + + + + DiffMono + 521.884074 + + + + Formula + C 13 H 16 Mo 1 N 6 O 9 P 1 S 3 + + + + MassAvg + 623.41 + + + + MassMono + 624.893259 + + + + Origin + C + + + + Source + natural + + + + TermSpec + none + + MOD:00744 + MOD:00861 + MOD:00905 + PSI-MOD + + + MOD:00152 + S-(8alpha-FAD)-L-cysteine + + A protein modification that effectively converts an L-cysteine residue to S'-(8alpha-FAD)-L-cystine. + + 10220347 + PubMed + + + AA0143 + RESID + + + 50#C + UniMod + + + PSI-MOD-slim + + (2R)-2-amino-3-[8alpha-riboflavin 5'-(trihydrogen diphosphate) 5'->5'-ester with adenosine]sulfanylpropanoic acid + RESID-systematic + + + 8alpha-(S-cysteinyl)FAD + RESID-alternate + + + FAD + PSI-MS-label + + + Flavin adenine dinucleotide + UniMod-description + + + MOD_RES S-8alpha-FAD cysteine + UniProt-feature + + + S-(8alpha-FAD)-L-cysteine + RESID-name + + + S8aFADCys + PSI-MOD-label + + + + DiffAvg + 783.54 + + + + DiffFormula + C 27 H 31 N 9 O 15 P 2 S 0 + + + + DiffMono + 783.141485 + + + + Formula + C 30 H 36 N 10 O 16 P 2 S 1 + + + + MassAvg + 886.68 + + + + MassMono + 886.150669 + + + + Origin + C + + + + Source + natural + + + + TermSpec + none + + MOD:00895 + MOD:00905 + PSI-MOD + + + MOD:00153 + 3'-(8alpha-FAD)-L-histidine + + A protein modification that effectively converts an L-histidine residue to 3'-(8alpha-FAD)-L-histidine. + + 241294 + PubMed + + + 8076 + PubMed + + + AA0144 + RESID + + + 50#H + UniMod + + + PSI-MOD-slim + + (2S)-2-amino-3-(3-[8alpha-riboflavin 5'-(trihydrogen diphosphate) 5'->5'-ester with adenosine]imidazol-4-yl)propanoic acid + RESID-systematic + + + 3'-(8alpha-FAD)-L-histidine + RESID-name + + + 8alpha-(N(delta)-histidyl)FAD + RESID-alternate + + + 8alpha-(N3'-histidyl)FAD + RESID-alternate + + + 8alpha-N1-histidyl FAD + RESID-misnomer + + + FAD + PSI-MS-label + + + Flavin adenine dinucleotide + UniMod-description + + + MOD_RES Pros-8alpha-FAD histidine + UniProt-feature + + + N(pi)-(8alpha-FAD)-histidine + RESID-alternate + + + Np8aFADHis + PSI-MOD-label + + + pros-(8alpha-FAD)-histidine + RESID-alternate + + + + DiffAvg + 783.54 + + + + DiffFormula + C 27 H 31 N 9 O 15 P 2 + + + + DiffMono + 783.141485 + + + + Formula + C 33 H 38 N 12 O 16 P 2 + + + + MassAvg + 920.68 + + + + MassMono + 920.200396 + + + + Origin + H + + + + Source + natural + + + + TermSpec + none + + MOD:00895 + MOD:00909 + PSI-MOD + + + MOD:00154 + O4'-(8alpha-FAD)-L-tyrosine + + A protein modification that effectively converts an L-tyrosine residue to O4'-(8alpha-FAD)-L-tyrosine. + + 0 + DeltaMass + + + 7391034 + PubMed + + + AA0145 + RESID + + + 50#Y + UniMod + + + From DeltaMass: Average Mass: 783 + PSI-MOD-slim + + (2S)-2-amino-3-(4-[8alpha-riboflavin 5'-(trihydrogen diphosphate) 5'->5'-ester with adenosine]oxyphenyl)propanoic acid + RESID-systematic + + + 8alpha-(O4'-tyrosyl)FAD + RESID-alternate + + + FAD + PSI-MS-label + + + Flavin adenine dinucleotide + UniMod-description + + + MOD_RES O-8alpha-FAD tyrosine + UniProt-feature + + + O-8 alpha-Flavin [FAD])- (of Tyrosine) + DeltaMass-label + + + O4'-(8alpha-FAD)-L-tyrosine + RESID-name + + + O8aFADTyr + PSI-MOD-label + + + + DiffAvg + 783.54 + + + + DiffFormula + C 27 H 31 N 9 O 15 P 2 + + + + DiffMono + 783.141485 + + + + Formula + C 36 H 40 N 10 O 17 P 2 + + + + MassAvg + 946.72 + + + + MassMono + 946.204813 + + + + Origin + Y + + + + Source + natural + + + + TermSpec + none + + MOD:00895 + MOD:00919 + PSI-MOD + + + MOD:00155 + 3'-hydroxylation of L-tyrosine to L-3',4'-dihydroxyphenylalanine + + A protein modification that effectively converts an L-tyrosine residue to L-3',4'-dihydroxyphenylalanine. + + 0 + DeltaMass + + + 1610822 + PubMed + + + 1903612 + PubMed + + + 3734192 + PubMed + + + AA0146 + RESID + + + 35#Y + UniMod + + + incidental to RESID:AA0368 From DeltaMass: Average Mass: 16 + PSI-MOD-slim + + (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoic acid + RESID-systematic + + + 3,4-Dihydroxy-Phenylalanine (from Tyrosine) (DOPA) + DeltaMass-label + + + 3HyTyr + PSI-MOD-label + + + hydroxylationy + OMSSA-label + + + L-3',4'-dihydroxyphenylalanine + RESID-name + + + L-3'-hydroxytyrosine + RESID-alternate + + + L-DOPA + RESID-alternate + + + levodopa + RESID-alternate + + + mod194 + OMSSA-label + + + MOD_RES 3',4'-dihydroxyphenylalanine + UniProt-feature + + + + DiffAvg + 16.00 + + + + DiffFormula + C 0 H 0 N 0 O 1 + + + + DiffMono + 15.994915 + + + + Formula + C 9 H 9 N 1 O 3 + + + + MassAvg + 179.18 + + + + MassMono + 179.058243 + + + + Origin + Y + + + + Source + natural + + + + TermSpec + none + + MOD:00425 + MOD:00707 + PSI-MOD + + + MOD:00156 + oxidation of tyrosine to L-2',4',5'-topaquinone + + A protein modification that effectively converts an L-tyrosine residue to an L-2',4',5'-topaquinone. + + 21187 + ChEBI + + + 10387067 + PubMed + + + 1457410 + PubMed + + + 1569055 + PubMed + + + 2111581 + PubMed + + + AA0147 + RESID + + + 392#Y + UniMod + + + PSI-MOD-slim + + (2S)-2-amino-3-(5-hydroxy-2,5-cyclohexadien-1,4-dion-2-yl)propanoic acid + RESID-systematic + + + 2,4,5-trihydroxyphenylalanine quinone + RESID-alternate + + + 5-(2-carboxy-2-aminoethyl)-2-hydroxy-1,4-benzoquinone + RESID-alternate + + + L-2',4',5'-topaquinone + RESID-name + + + L-2,4,5-TOPAquinone + RESID-alternate + + + MOD_RES 2',4',5'-topaquinone + UniProt-feature + + + Quinone + PSI-MS-label + + + quinone + UniMod-description + + + TopaQ + PSI-MOD-label + + + TPQ + RESID-alternate + + + + DiffAvg + 29.98 + + + + DiffFormula + C 0 H -2 N 0 O 2 + + + + DiffMono + 29.974179 + + + + Formula + C 9 H 7 N 1 O 4 + + + + MassAvg + 193.16 + + + + MassMono + 193.037508 + + + + Origin + Y + + + + Source + natural + + + + TermSpec + none + + MOD:00679 + MOD:00919 + PSI-MOD + + + MOD:00157 + oxidation of tryptophan to L-tryptophyl quinone + + A protein modification that effectively converts an L-tryptophan residue to an L-tryptophan quinone. + + 0 + DeltaMass + + + 2028257 + PubMed + + + AA0148 + RESID + + + 392#W + UniMod + + + incidental to RESID:AA0149; incidental to RESID:AA0313; From DeltaMass: Average Mass: 30. + PSI-MOD-slim + + (2S)-2-amino-3-(6,7-dioxo-1H-indol-3-yl)propanoic acid + RESID-systematic + + + 2-amino-3-(6,7-dioxo-6,7-dihydro-1H-indol-3-yl)-propionic acid + RESID-alternate + + + 3-[(2S)-2-amino-2-carboxyethyl]-6,7-indolinedione + RESID-alternate + + + 6,7 Dione (from Tryptophan) + DeltaMass-label + + + L-tryptophyl quinone + RESID-name + + + MOD_RES Tryptophylquinone + UniProt-feature + + + N-(3-carboxy-1-oxopropyl)-L-tryptophan + RESID-alternate + + + Quinone + PSI-MS-label + + + quinone + UniMod-description + + + TrpQ + PSI-MOD-label + + + + DiffAvg + 29.98 + + + + DiffFormula + C 0 H -2 N 0 O 2 + + + + DiffMono + 29.974179 + + + + Formula + C 11 H 8 N 2 O 3 + + + + MassAvg + 216.20 + + + + MassMono + 216.053492 + + + + Origin + W + + + + Source + natural + + + + TermSpec + none + + MOD:00679 + MOD:00918 + PSI-MOD + + + MOD:00158 + 4'-(L-tryptophan)-L-tryptophyl quinone + + A protein modification that effectively cross-links two L-tryptophan residues by a carbon-carbon bond to form 4'-(L-tryptophan)-L-tryptophyl quinone. + + 20251 + ChEBI + + + 0 + DeltaMass + + + 2028257 + PubMed + + + AA0149 + RESID + + + Cross-link 2; secondary to RESID:AA0148; From DeltaMass: Average Mass: 28. + PSI-MOD-slim + + 2,4-BisTrp-6,7-dione (from Tryptophan) + DeltaMass-label + + + 2-amino-3-[2-[2-amino-3-(2-carboxyethyl)-6,7-dioxo-1H-indol-4-yl]-1H-indol-3-yl]propanoic acid + RESID-alternate + + + 3-[(2S)-2-amino-2-carboxyethyl]-4-(3-[(2S)-2-amino-2-carboxyethyl]-1H-indol-2-yl)-6,7-indolinedione + RESID-systematic + + + 4'-tryptophan-tryptophylquinone + RESID-alternate + + + 4-(2'-tryptophyl)tryptophan-6,7-dione + RESID-alternate + + + 4-(L-tryptophan-2-yl)-L-tryptophyl quinone + RESID-name + + + alpha,alpha'-diamino-6',7'-dihydro-6',7'-dioxo-(2,4'-bi-1H-indole)-3,3'-dipropanoic acid + RESID-alternate + + + CROSSLNK Tryptophan tryptophylquinone (Trp-Trp) + UniProt-feature + + + TTQ + RESID-alternate + + + XLNK-4'Trp-TrpQ + PSI-MOD-label + + + + DiffAvg + 27.97 + + + + DiffFormula + C 0 H -4 N 0 O 2 + + + + DiffMono + 27.958529 + + + + Formula + C 22 H 16 N 4 O 4 + + + + MassAvg + 400.39 + + + + MassMono + 400.117155 + + + + Origin + W, W + + + + Source + natural + + + + TermSpec + none + + MOD:00692 + MOD:00918 + PSI-MOD + + + MOD:00159 + O-phosphopantetheine-L-serine + + A protein modification that effectively converts an L-serine residue to O-phosphopantetheine-L-serine. + + 0 + DeltaMass + + + 10320345 + PubMed + + + 10997907 + PubMed + + + 12057197 + PubMed + + + 12869567 + PubMed + + + 4568609 + PubMed + + + AA0150 + RESID + + + 49#S + UniMod + + + UniMod has DiffFormula C 11 H 20 N 2 O 6 P 1 S 1 From DeltaMass: Average Mass: 339 + PSI-MOD-slim + + (2R)-2-hydroxy-3,3-dimethyl-4-[(2S)-2-amino-2-carboxyethyl]phosphonato-N-(3-oxo-3-[(2-sulfanylethyl)amino]propyl)butanamide + RESID-systematic + + + 4'-Phosphopantetheine + DeltaMass-label + + + MOD_RES O-(pantetheine 4'-phosphoryl)serine + UniProt-feature + + + O-phosphopantetheine-L-serine + RESID-name + + + OPpantSer + PSI-MOD-label + + + Phosphopantetheine + PSI-MS-label + + + Phosphopantetheine + UniMod-description + + + + DiffAvg + 340.33 + + + + DiffFormula + C 11 H 21 N 2 O 6 P 1 S 1 + + + + DiffMono + 340.085794 + + + + Formula + C 14 H 26 N 3 O 8 P 1 S 1 + + + + MassAvg + 427.41 + + + + MassMono + 427.117822 + + + + Origin + S + + + + Source + natural + + + + TermSpec + none + + MOD:00861 + MOD:00916 + PSI-MOD + + + MOD:00160 + N4-glycosyl-L-asparagine + + A protein modification that effectively converts an L-asparagine residue to an N4-glycosyl-L-asparagine. + + 111247 + PubMed + + + 1694179 + PubMed + + + 5490222 + PubMed + + + AA0151#var + RESID + + + PSI-MOD-slim + + N4GlycoAsn + PSI-MOD-label + + + + Origin + N + + + + Source + natural + + + + TermSpec + none + + MOD:00006 + MOD:00903 + PSI-MOD + + + MOD:00161 + S-glucosyl-L-cysteine + + A protein modification that effectively converts an L-cysteine residue to S-glucosylated L-cysteine. + + 1145128 + PubMed + + + 15279557 + PubMed + + + 5286858 + PubMed + + + AA0152 + RESID + + + 41#C + UniMod + + + + (2R)-2-amino-3-[(beta-D-glucopyranosyl)sulfanyl]propanoic acid + RESID-systematic + + + CARBOHYD S-linked (Glc) + UniProt-feature + + + Hex + PSI-MS-label + + + Hexose + UniMod-description + + + S-(beta-D-glucopyranosyl)cysteine + RESID-alternate + + + S-glucosyl-L-cysteine + RESID-name + + + S-glycosyl-cysteine + RESID-alternate + + + SGlcCys + PSI-MOD-label + + + + DiffAvg + 162.14 + + + + DiffFormula + C 6 H 10 N 0 O 5 S 0 + + + + DiffMono + 162.052823 + + + + Formula + C 9 H 15 N 1 O 6 S 1 + + + + MassAvg + 265.28 + + + + MassMono + 265.062008 + + + + Origin + C + + + + Source + natural + + + + TermSpec + none + + MOD:00426 + MOD:00433 + MOD:00761 + MOD:00905 + PSI-MOD + + + MOD:00162 + O5-glucosylgalactosyl-L-hydroxylysine + + A protein modification that effectively converts an L-lysine residue to O5-glucosylgalactosyl-L-hydroxylysine. + + 15149698 + PubMed + + + 4288358 + PubMed + + + 4319110 + PubMed + + + AA0153 + RESID + + + 393 + UniMod + + + Secondary to RESID:AA0028. + PSI-MOD-slim + + (2S,5R)-2,6-diamino-5-[2-O-(alpha-D-glucopyranosyl)-beta-D-galactopyranosyloxy]hexanoic acid + RESID-systematic + + + 5-(2-O-alpha-D-glucopyranosyl-beta-D-galactopyranosyl)oxy-L-lysine + RESID-alternate + + + Glucosylgalactosyl + PSI-MS-label + + + glucosylgalactosyl hydroxylysine + UniMod-description + + + O5-glucosylgalactosyl-L-hydroxylysine + RESID-name + + + OGlcGal5HyLys + PSI-MOD-label + + + + DiffAvg + 340.28 + + + + DiffFormula + C 12 H 20 N 0 O 11 + + + + DiffMono + 340.100561 + + + + Formula + C 18 H 32 N 2 O 12 + + + + MassAvg + 468.46 + + + + MassMono + 468.195524 + + + + Origin + K + + + + Source + natural + + + + TermSpec + none + + MOD:00037 + MOD:00396 + MOD:00476 + MOD:00726 + PSI-MOD + + + MOD:00163 + O-(N-acetylamino)galactosyl-L-serine + + A protein modification that effectively converts an L-serine residue to O-(N-acetylaminogalactosyl)-L-serine. + + 115869 + PubMed + + + 16005634 + PubMed + + + 3086323 + PubMed + + + 8948436 + PubMed + + + 9092502 + PubMed + + + AA0154 + RESID + + + PSI-MOD-slim + + (2S)-2-amino-3-(2-acetamido-2-deoxy-alpha-D-galactopyranosyloxy)propanoic acid + RESID-systematic + + + CARBOHYD O-linked (GalNAc) + UniProt-feature + + + HexNAc + PSI-MS-label + + + mucin type O-glycosylserine + RESID-alternate + + + O-(N-acetylamino)galactosyl-L-serine + RESID-name + + + O3-(N-acetylgalactosaminyl)serine + RESID-alternate + + + OGalNAcSer + PSI-MOD-label + + + + DiffAvg + 203.19 + + + + DiffFormula + C 8 H 13 N 1 O 5 + + + + DiffMono + 203.079373 + + + + Formula + C 11 H 18 N 2 O 7 + + + + MassAvg + 290.27 + + + + MassMono + 290.111401 + + + + Origin + S + + + + Source + natural + + + + TermSpec + none + + MOD:00563 + MOD:01675 + PSI-MOD + + + MOD:00164 + O-(N-acetylamino)galactosyl-L-threonine + + A protein modification that effectively converts an L-asparagine residue to O-(N-acetylaminogalactosyl)-L-threonine. + + 16005634 + PubMed + + + 1997327 + PubMed + + + 3086323 + PubMed + + + 8948436 + PubMed + + + 9092502 + PubMed + + + AA0155 + RESID + + + PSI-MOD-slim + + (2S,3R)-2-amino-3-(2-acetamido-2-deoxy-alpha-D-galactopyranosyloxy)butanoic acid + RESID-systematic + + + CARBOHYD O-linked (GalNAc) + UniProt-feature + + + CARBOHYD O-linked (HexNAc) + UniProt-feature + + + HexNAc + PSI-MS-label + + + mucin type O-glycosylthreonine + RESID-alternate + + + O-(N-acetylamino)galactosyl-L-threonine + RESID-name + + + O3-(N-acetylgalactosaminyl)threonine + RESID-alternate + + + OGalNAcThr + PSI-MOD-label + + + + DiffAvg + 203.19 + + + + DiffFormula + C 8 H 13 N 1 O 5 + + + + DiffMono + 203.079373 + + + + Formula + C 12 H 20 N 2 O 7 + + + + MassAvg + 304.30 + + + + MassMono + 304.127051 + + + + Origin + T + + + + Source + natural + + + + TermSpec + none + + MOD:00563 + MOD:01676 + PSI-MOD + + + MOD:00165 + 1'-mannosyl-L-tryptophan + + A protein modification that effectively converts an L-tryptophan residue to 1'-mannosyl-L-tryptophan. + + 1482345 + PubMed + + + 16150691 + PubMed + + + AA0156 + RESID + + + PSI-MOD-slim + + (2S)-2-amino-3-(1-D-mannopyranosyloxy-1H-indol-3-yl)propanoic acid + RESID-systematic + + + 1'-glycosyl-L-tryptophan + RESID-alternate + + + 1'-mannosyl-L-tryptophan + RESID-name + + + CARBOHYD N-linked (Man) + UniProt-feature + + + N-mannosyl-tryptophan + RESID-alternate + + + N1'ManTrp + PSI-MOD-label + + + N1-mannosyl-tryptophan + RESID-alternate + + + + DiffAvg + 162.14 + + + + DiffFormula + C 6 H 10 N 0 O 5 + + + + DiffMono + 162.052823 + + + + Formula + C 17 H 20 N 2 O 6 + + + + MassAvg + 348.36 + + + + MassMono + 348.132136 + + + + Origin + W + + + + Source + natural + + + + TermSpec + none + + MOD:00006 + MOD:00595 + MOD:00761 + MOD:00918 + PSI-MOD + + + MOD:00166 + O4'-glucosyl-L-tyrosine + + A protein modification that effectively converts an L-tyrosine residue to O4'-glucosyl-tyrosine. + + 15279557 + PubMed + + + 3181138 + PubMed + + + AA0157 + RESID + + + 41#Y + UniMod + + + + (2S)-2-amino-3-(4-alpha-D-glucopyranosyloxy)phenylpropanoic acid + RESID-systematic + + + Hex + PSI-MS-label + + + Hexose + UniMod-description + + + O4'-glucosyl-L-tyrosine + RESID-name + + + O4'-glycosyl-L-tyrosine + RESID-alternate + + + O4GlcTyr + PSI-MOD-label + + + + DiffAvg + 162.14 + + + + DiffFormula + C 6 H 10 N 0 O 5 + + + + DiffMono + 162.052823 + + + + Formula + C 15 H 19 N 1 O 7 + + + + MassAvg + 325.32 + + + + MassMono + 325.116152 + + + + Origin + Y + + + + Source + natural + + + + TermSpec + none + + MOD:00433 + MOD:00761 + MOD:01927 + PSI-MOD + + + MOD:00167 + N-asparaginyl-glycosylphosphatidylinositolethanolamine + + A protein modification that effectively converts an L-asparagine residue to N-asparaginyl-glycosylphosphatidylinositolethanolamine. + + 1824714 + PubMed + + + 8276756 + PubMed + + + AA0158 + RESID + + + + GPIAsn + PSI-MOD-label + + + LIPID GPI-anchor amidated asparagine + UniProt-feature + + + N-asparaginyl-glycosylphosphatidylinositolethanolamine + RESID-name + + + + DiffAvg + 123.05 + + + + DiffFormula + C 2 H 6 N 1 O 3 P 1 + + + + DiffMono + 123.008530 + + + + Formula + C 6 H 13 N 3 O 6 P 1 + + + + MassAvg + 254.16 + + + + MassMono + 254.054197 + + + + Origin + N + + + + Source + natural + + + + TermSpec + C-term + + MOD:00818 + MOD:00903 + PSI-MOD + + + MOD:00168 + N-aspartyl-glycosylphosphatidylinositolethanolamine + + A protein modification that effectively converts an L-aspartic acid residue to N-(aspart-1-yl)-glycosylphosphatidylinositolethanolamine. + + 7120400 + PubMed + + + AA0159 + RESID + + + + GPIAsp + PSI-MOD-label + + + LIPID GPI-anchor amidated aspartate + UniProt-feature + + + N-aspartyl-glycosylphosphatidylinositolethanolamine + RESID-name + + + + DiffAvg + 123.05 + + + + DiffFormula + C 2 H 6 N 1 O 3 P 1 + + + + DiffMono + 123.008530 + + + + Formula + C 6 H 12 N 2 O 7 P 1 + + + + MassAvg + 255.14 + + + + MassMono + 255.038212 + + + + Origin + D + + + + Source + natural + + + + TermSpec + C-term + + MOD:00818 + MOD:00904 + PSI-MOD + + + MOD:00169 + N-cysteinyl-glycosylphosphatidylinositolethanolamine + + A protein modification that effectively converts an L-cysteine residue to N-cysteinyl-glycosylphosphatidylinositolethanolamine. + + 2897081 + PubMed + + + AA0160 + RESID + + + + GPICys + PSI-MOD-label + + + LIPID GPI-anchor amidated cysteine + UniProt-feature + + + N-cysteinyl-glycosylphosphatidylinositolethanolamine + RESID-name + + + + DiffAvg + 123.05 + + + + DiffFormula + C 2 H 6 N 1 O 3 P 1 S 0 + + + + DiffMono + 123.008530 + + + + Formula + C 5 H 12 N 2 O 5 P 1 S 1 + + + + MassAvg + 243.19 + + + + MassMono + 243.020454 + + + + Origin + C + + + + Source + natural + + + + TermSpec + C-term + + MOD:00818 + MOD:00905 + PSI-MOD + + + MOD:00170 + N-glycyl-glycosylphosphatidylinositolethanolamine + + A protein modification that effectively converts a glycine residue to N-glycyl-glycosylphosphatidylinositolethanolamine. + + 2341397 + PubMed + + + AA0161 + RESID + + + + GPIGly + PSI-MOD-label + + + LIPID GPI-anchor amidated glycine + UniProt-feature + + + N-glycyl-glycosylphosphatidylinositolethanolamine + RESID-name + + + + DiffAvg + 123.05 + + + + DiffFormula + C 2 H 6 N 1 O 3 P 1 + + + + DiffMono + 123.008530 + + + + Formula + C 4 H 10 N 2 O 5 P 1 + + + + MassAvg + 197.11 + + + + MassMono + 197.032733 + + + + Origin + G + + + + Source + natural + + + + TermSpec + C-term + + MOD:00818 + MOD:00908 + PSI-MOD + + + MOD:00171 + N-seryl-glycosylphosphatidylinositolethanolamine + + A protein modification that effectively converts an L-serine residue to N-seryl-glycosylphosphatidylinositolethanolamine. + + 2111324 + PubMed + + + 8448158 + PubMed + + + AA0162 + RESID + + + + GPISer + PSI-MOD-label + + + LIPID GPI-anchor amidated serine + UniProt-feature + + + N-seryl-glycosylphosphatidylinositolethanolamine + RESID-name + + + + DiffAvg + 123.05 + + + + DiffFormula + C 2 H 6 N 1 O 3 P 1 + + + + DiffMono + 123.008530 + + + + Formula + C 5 H 12 N 2 O 6 P 1 + + + + MassAvg + 227.13 + + + + MassMono + 227.043298 + + + + Origin + S + + + + Source + natural + + + + TermSpec + C-term + + MOD:00818 + MOD:00916 + PSI-MOD + + + MOD:00172 + N-alanyl-glycosylphosphatidylinositolethanolamine + + A protein modification that effectively converts an L-alanine residue to N-alanyl-glycosylphosphatidylinositolethanolamine. + + 7682556 + PubMed + + + 7744038 + PubMed + + + AA0163 + RESID + + + + GPIAla + PSI-MOD-label + + + LIPID GPI-anchor amidated alanine + UniProt-feature + + + N-alanyl-glycosylphosphatidylinositolethanolamine + RESID-name + + + + DiffAvg + 123.05 + + + + DiffFormula + C 2 H 6 N 1 O 3 P 1 + + + + DiffMono + 123.008530 + + + + Formula + C 5 H 12 N 2 O 5 P 1 + + + + MassAvg + 211.13 + + + + MassMono + 211.048383 + + + + Origin + A + + + + Source + natural + + + + TermSpec + C-term + + MOD:00818 + MOD:00901 + PSI-MOD + + + MOD:00173 + N-threonyl-glycosylphosphatidylinositolethanolamine + + A protein modification that effectively converts an L-threonine residue to N-threonyl-glycosylphosphatidylinositolethanolamine. + + AA0164 + RESID + + + + GPIThr + PSI-MOD-label + + + LIPID GPI-anchor amidated threonine + UniProt-feature + + + N-threonyl-glycosylphosphatidylinositolethanolamine + RESID-name + + + + DiffAvg + 123.05 + + + + DiffFormula + C 2 H 6 N 1 O 3 P 1 + + + + DiffMono + 123.008530 + + + + Formula + C 6 H 14 N 2 O 6 P 1 + + + + MassAvg + 241.16 + + + + MassMono + 241.058948 + + + + Origin + T + + + + Source + hypothetical + + + + TermSpec + C-term + + MOD:00818 + MOD:00917 + PSI-MOD + + + MOD:00174 + N-glycyl-glycosylsphingolipidinositolethanolamine + + A protein modification that effectively converts a glycine residue to N-glycyl-glycosylsphingolipidinositolethanolamine. + + 12626404 + PubMed + + + 8404891 + PubMed + + + AA0165 + RESID + + + + GSIGly + PSI-MOD-label + + + LIPID GPI-like-anchor amidated glycine + UniProt-feature + + + N-glycyl-glycosylsphingolipidinositolethanolamine + RESID-name + + + + DiffAvg + 123.05 + + + + DiffFormula + C 2 H 6 N 1 O 3 P 1 + + + + DiffMono + 123.008530 + + + + Formula + C 4 H 10 N 2 O 5 P 1 + + + + MassAvg + 197.11 + + + + MassMono + 197.032733 + + + + Origin + G + + + + Source + hypothetical + + + + TermSpec + C-term + + MOD:00466 + MOD:00908 + PSI-MOD + + + MOD:00175 + N-seryl-glycosylsphingolipidinositolethanolamine + + A protein modification that effectively converts an L-serine residue to N-seryl-glycosylsphingolipidinositolethanolamine. + + 12626404 + PubMed + + + 2721485 + PubMed + + + 8269952 + PubMed + + + AA0166 + RESID + + + + GSISer + PSI-MOD-label + + + LIPID GPI-like-anchor amidated serine + UniProt-feature + + + N-seryl-glycosylsphingolipidinositolethanolamine + RESID-name + + + + DiffAvg + 123.05 + + + + DiffFormula + C 2 H 6 N 1 O 3 P 1 + + + + DiffMono + 123.008530 + + + + Formula + C 5 H 12 N 2 O 6 P 1 + + + + MassAvg + 227.13 + + + + MassMono + 227.043298 + + + + Origin + S + + + + Source + natural + + + + TermSpec + C-term + + MOD:00466 + MOD:00916 + PSI-MOD + + + MOD:00176 + O-(phosphoribosyl dephospho-coenzyme A)-L-serine + + A protein modification that effectively converts an L-serine residue to O-(phosphoribosyl dephospho-coenzyme A)-L-serine. + + 10924139 + PubMed + + + 11052675 + PubMed + + + 179809 + PubMed + + + 180526 + PubMed + + + 368065 + PubMed + + + AA0167 + RESID + + + 395#S + UniMod + + + pRibodePcoA + PSI-MOD-slim + + MOD_RES O-(phosphoribosyl dephospho-coenzyme A)serine + UniProt-feature + + + O-(phosphoribosyl dephospho-coenzyme A)-L-serine + RESID-name + + + O3-(phosphate-5-ribosyl-alpha-2-adenosine-5-diphosphate pantetheine)-L-serine + RESID-alternate + + + O3-(phosphoribosyl dephospho-coenzyme A)-L-serine + RESID-alternate + + + O3-2'-(5''-phosphoribosyl-3'-dephosphocoenzyme A)-L-serine + RESID-alternate + + + OPRibdPCoASer + PSI-MOD-label + + + phosphoribosyl dephospho-coenzyme A + UniMod-description + + + PhosphoribosyldephosphoCoA + PSI-MS-label + + + + DiffAvg + 881.63 + + + + DiffFormula + C 26 H 42 N 7 O 19 P 3 S 1 + + + + DiffMono + 881.146903 + + + + Formula + C 29 H 47 N 8 O 21 P 3 S 1 + + + + MassAvg + 968.71 + + + + MassMono + 968.178931 + + + + Origin + S + + + + Source + natural + + + + TermSpec + none + + MOD:00860 + MOD:00861 + MOD:00916 + PSI-MOD + + + MOD:00177 + omega-N-(ADP-ribosyl)-L-arginine + + A protein modification that effectively converts an L-argininine residue to omega-N-(ADP-ribosyl)-L-arginine. + + 0 + DeltaMass + + + 15842200 + PubMed + + + 209022 + PubMed + + + 3090031 + PubMed + + + 3923473 + PubMed + + + 6582062 + PubMed + + + AA0168 + RESID + + + 213#R + UniMod + + + From DeltaMass: Average Mass: 541. + PSI-MOD-slim + + (S)-2-amino-5-([imino([adenosine 5'-(trihydrogen diphosphate) 5'->5'-ester with alpha-D-ribofuranosyl]amino)methyl]amino)pentanoic acid + RESID-systematic + + + ADP Ribose addition + UniMod-description + + + ADP-Ribosyl + PSI-MS-label + + + ADPRibArg + PSI-MOD-label + + + MOD_RES ADP-ribosylarginine + UniProt-feature + + + N(omega)-[alpha-D-ribofuranoside 5'->5'-ester with adenosine 5'-(trihydrogen diphosphate)]-L-arginine + RESID-alternate + + + N(omega)-alpha-D-ribofuranosyl-L-arginine 5'->5'-ester with adenosine 5'-(trihydrogen diphosphate) + RESID-alternate + + + N-(ADP-ribosyl)- (on Arginine) + DeltaMass-label + + + omega-N-(ADP-ribosyl)-L-arginine + RESID-name + + + + DiffAvg + 541.30 + + + + DiffFormula + C 15 H 21 N 5 O 13 P 2 + + + + DiffMono + 541.061109 + + + + Formula + C 21 H 33 N 9 O 14 P 2 + + + + MassAvg + 697.49 + + + + MassMono + 697.162220 + + + + Origin + R + + + + Source + natural + + + + TermSpec + none + + MOD:00752 + MOD:00902 + PSI-MOD + + + MOD:00178 + S-(ADP-ribosyl)-L-cysteine + + A protein modification that effectively converts an L-cysteine residue to S-(ADP-ribosyl)-L-cysteine. + + 0 + DeltaMass + + + 15842200 + PubMed + + + 3863818 + PubMed + + + AA0169 + RESID + + + 213#C + UniMod + + + From DeltaMass: Average Mass: 541. + PSI-MOD-slim + + (R)-2-amino-3-([adenosine 5'-(trihydrogen diphosphate) 5'->5'-ester with alpha-D-ribofuranosyl]sulfanyl)propanoic acid + RESID-systematic + + + ADP Ribose addition + UniMod-description + + + ADP-Ribosyl + PSI-MS-label + + + ADPRibCys + PSI-MOD-label + + + MOD_RES ADP-ribosylcysteine + UniProt-feature + + + S-(ADP-ribosyl)- (on Cysteine) + DeltaMass-label + + + S-(ADP-ribosyl)-L-cysteine + RESID-name + + + S-alpha-D-ribofuranosyl-L-cysteine 5'->5'-ester with adenosine 5'-(trihydrogen diphosphate) + RESID-alternate + + + S-L-cysteine alpha-D-ribofuranoside 5'->5'-ester with adenosine 5'-(trihydrogen diphosphate) + RESID-alternate + + + + DiffAvg + 541.30 + + + + DiffFormula + C 15 H 21 N 5 O 13 P 2 S 0 + + + + DiffMono + 541.061109 + + + + Formula + C 18 H 26 N 6 O 14 P 2 S 1 + + + + MassAvg + 644.44 + + + + MassMono + 644.070294 + + + + Origin + C + + + + Source + natural + + + + TermSpec + none + + MOD:00752 + MOD:00905 + PSI-MOD + + + MOD:00179 + L-glutamyl 5-glycerylphosphorylethanolamine + + A protein modification that effectively converts an L-glutamic acid residue to L-glutamyl 5-glycerylphosphorylethanolamine. + + 2511205 + PubMed + + + 2569467 + PubMed + + + 9662537 + PubMed + + + AA0170 + RESID + + + 396#E + UniMod + + + glycerylPE + PSI-MOD-slim + + (S)-2-amino-5-[2-([([2,3-dihydroxypropyl]oxy)(hydroxy)phosphoryl]oxy)ethyl]amino-5-oxopentanoic acid + RESID-systematic + + + 5-L-glutamyl glycerylphosphorylethanolamine + RESID-name + + + 5GlyceroPEtAGlu + PSI-MOD-label + + + GlycerylPE + PSI-MS-label + + + glycerylphosphorylethanolamine + UniMod-description + + + L-glutamyl 5-glycerophosphoethanolamine + RESID-alternate + + + L-glutamyl 5-glycerophosphorylethanolamine + RESID-alternate + + + L-glutamyl 5-glycerylphosphorylethanolamine + RESID-alternate + + + MOD_RES 5-glutamyl glycerylphosphorylethanolamine + UniProt-feature + + + + DiffAvg + 197.13 + + + + DiffFormula + C 5 H 12 N 1 O 5 P 1 + + + + DiffMono + 197.045309 + + + + Formula + C 10 H 19 N 2 O 8 P 1 + + + + MassAvg + 326.24 + + + + MassMono + 326.087902 + + + + Origin + E + + + + Source + natural + + + + TermSpec + none + + MOD:00906 + PSI-MOD + + + MOD:00180 + S-sulfo-L-cysteine + + A protein modification that effectively converts an L-cysteine residue to S-sulfo-L-cysteine. + + 12876326 + PubMed + + + 14752058 + PubMed + + + 643076 + PubMed + + + AA0171 + RESID + + + 40#C + UniMod + + + + (2R)-2-amino-3-(sulfosulfanyl)propanoic acid + RESID-systematic + + + 2-amino-3-(sulfothio)propanoic acid + RESID-alternate + + + 3-(sulfosulfanyl)-L-alanine + RESID-alternate + + + cysteine sulfate thioester + RESID-alternate + + + cysteine-S-sulfonic acid + RESID-alternate + + + O-Sulfonation + UniMod-description + + + S-sulfo-L-cysteine + RESID-name + + + S-sulfocysteine + PSI-MOD-alternate + + + S-sulfocysteine + RESID-alternate + + + SSulfCys + PSI-MOD-label + + + Sulfo + PSI-MS-label + + + + DiffAvg + 80.06 + + + + DiffFormula + C 0 H 0 N 0 O 3 S 1 + + + + DiffMono + 79.956815 + + + + Formula + C 3 H 5 N 1 O 4 S 2 + + + + MassAvg + 183.20 + + + + MassMono + 182.966000 + + + + Origin + C + + + + Source + natural + + + + TermSpec + none + + MOD:00695 + MOD:00777 + MOD:00905 + PSI-MOD + + + MOD:00181 + O4'-sulfo-L-tyrosine + + A protein modification that effectively converts an L-tyrosine residue to O4'-sulfo-L-tyrosine. + + 88 + DeltaMass + + + 10226369 + PubMed + + + 14752058 + PubMed + + + 2303439 + PubMed + + + 3778455 + PubMed + + + 3801003 + PubMed + + + AA0172 + RESID + + + 40#Y + UniMod + + + From DeltaMass: Average Mass: 80 Average Mass Change:80 PubMed:9624161. + PSI-MOD-slim + + (S)-2-amino-3-(4-sulfooxyphenyl)propanoic acid + RESID-systematic + + + 2-amino-3-(4-hydroxyphenyl)propanoic acid 4'-sulfate + RESID-alternate + + + MOD_RES Sulfotyrosine + UniProt-feature + + + O-Sulfonation + UniMod-description + + + O4'-sulfo-L-tyrosine + RESID-name + + + O4-sulfotyrosine + RESID-alternate + + + OSulfTyr + PSI-MOD-label + + + sulfationy + OMSSA-label + + + Sulfo + PSI-MS-label + + + Sulphation (of O of Tyrosine) + DeltaMass-label + + + tyrosine sulfate + RESID-alternate + + + tyrosine-O-sulfonic acid + RESID-alternate + + + tyrosine-O-sulphonic acid + RESID-alternate + + + Tyrosinyl Sulphate + DeltaMass-label + + + + DiffAvg + 80.06 + + + + DiffFormula + C 0 H 0 N 0 O 3 S 1 + + + + DiffMono + 79.956815 + + + + Formula + C 9 H 9 N 1 O 5 S 1 + + + + MassAvg + 243.23 + + + + MassMono + 243.020143 + + + + Origin + Y + + + + Source + natural + + + + TermSpec + none + + MOD:00695 + MOD:00774 + MOD:00919 + PSI-MOD + + + MOD:00182 + L-bromohistidine + + A protein modification that effectively converts an L-histidine residue to L-bromohistidine. + + 2076468 + PubMed + + + 9033387 + PubMed + + + AA0173 + RESID + + + 340#H + UniMod + + + + Br1His + PSI-MOD-label + + + bromination + UniMod-description + + + Bromo + PSI-MS-label + + + L-bromohistidine + RESID-name + + + MOD_RES Bromohistidine + UniProt-feature + + + + DiffAvg + 78.90 + + + + DiffFormula + Br 1 C 0 H -1 N 0 O 0 + + + + DiffMono + 77.910512 + + + + Formula + Br 1 C 6 H 6 N 3 O 1 + + + + MassAvg + 216.04 + + + + MassMono + 214.969424 + + + + Origin + H + + + + Source + natural + + + + TermSpec + none + + MOD:01049 + MOD:01912 + PSI-MOD + + + MOD:00183 + L-2'-bromophenylalanine + + A protein modification that effectively converts an L-phenylalanine residue to L-2'-bromophenylalanine. + + 83 + DeltaMass + + + 2059627 + PubMed + + + 2076468 + PubMed + + + 9033387 + PubMed + + + AA0174 + RESID + + + From DeltaMass: Average Mass: 78 Average Mass Change:78 References:Yoshino,K et.al. Biochemistry Vol. 30 pg 6203-9 (1991) Identifidation of a novel amino acid, o-bromo-L-phenylananine, in egg-associated peptides that activate spermatozoa. + + (S)-2-amino-3-(2-bromophenyl)propanoic acid + RESID-systematic + + + 2'BrPhe + PSI-MOD-label + + + bromination + UniMod-description + + + Bromo + PSI-MS-label + + + L-2'-bromophenylalanine + RESID-name + + + L-o-bromination of Phe with 79Br + DeltaMass-label + + + o-bromophenylalanine + RESID-alternate + + + ortho-bromophenylalanine + RESID-alternate + + + + DiffAvg + 78.90 + + + + DiffFormula + Br 1 C 0 H -1 N 0 O 0 + + + + DiffMono + 77.910512 + + + + Formula + Br 1 C 9 H 8 N 1 O 1 + + + + MassAvg + 226.07 + + + + MassMono + 224.978926 + + + + Origin + F + + + + Source + natural + + + + TermSpec + none + + MOD:00972 + PSI-MOD + + + MOD:00184 + L-3'-bromophenylalanine + + A protein modification that effectively converts an L-phenylalanine residue to L-3'-bromophenylalanine. + + 2076468 + PubMed + + + 9033387 + PubMed + + + AA0175 + RESID + + + + (S)-2-amino-3-(3-bromophenyl)propanoic acid + RESID-systematic + + + 3'BrPhe + PSI-MOD-label + + + bromination + UniMod-description + + + Bromo + PSI-MS-label + + + L-3'-bromophenylalanine + RESID-name + + + m-bromophenylalanine + RESID-alternate + + + meta-bromophenylalanine + RESID-alternate + + + + DiffAvg + 78.90 + + + + DiffFormula + Br 1 C 0 H -1 N 0 O 0 + + + + DiffMono + 77.910512 + + + + Formula + Br 1 C 9 H 8 N 1 O 1 + + + + MassAvg + 226.07 + + + + MassMono + 224.978926 + + + + Origin + F + + + + Source + natural + + + + TermSpec + none + + MOD:00972 + PSI-MOD + + + MOD:00185 + L-4'-bromophenylalanine + + A protein modification that effectively converts an L-phenylalanine residue to L-4'-bromophenylalanine. + + 2076468 + PubMed + + + 9033387 + PubMed + + + AA0176 + RESID + + + + (2S)-2-amino-3-(4-bromophenyl)propanoic acid + RESID-systematic + + + 4'BrPhe + PSI-MOD-label + + + bromination + UniMod-description + + + Bromo + PSI-MS-label + + + L-4'-bromophenylalanine + RESID-name + + + p-bromophenylalanine + RESID-alternate + + + para-bromophenylalanine + RESID-alternate + + + + DiffAvg + 78.90 + + + + DiffFormula + Br 1 C 0 H -1 N 0 O 0 + + + + DiffMono + 77.910512 + + + + Formula + Br 1 C 9 H 8 N 1 O 1 + + + + MassAvg + 226.07 + + + + MassMono + 224.978926 + + + + Origin + F + + + + Source + natural + + + + TermSpec + none + + MOD:00972 + PSI-MOD + + + MOD:00186 + 3',3'',5'-triiodo-L-thyronine + + A protein modification that effectively substitutes an L-tyrosine residue with 3',3'',5'-triiodo-L-thyronine. + + 18258 + ChEBI + + + 0 + DeltaMass + + + AA0177 + RESID + + + 397 + UniMod + + + From DeltaMass: Average Mass: 470. + PSI-MOD-slim + + (S)-2-amino-3-[4-(4-hydroxy-3-iodophenoxy)-3,5-diiodophenyl]propanoic acid + RESID-systematic + + + 3',3'',5'-triiodo-L-thyronine + RESID-name + + + 3,3',5-triiodo-L-thyronine + RESID-alternate + + + 3,5,3'-triiodo-L-thyronine + RESID-alternate + + + 3,5,3'-Triiodothyronine (from Tyrosine) + DeltaMass-label + + + 4-(4-hydroxy-3-iodophenoxy)-3,5-diiodo-L-phenylalanine + RESID-alternate + + + I3Thy + PSI-MOD-label + + + liothyronine + RESID-alternate + + + MOD_RES Triiodothyronine + UniProt-feature + + + O-(4-hydroxy-3-iodophenyl)-3,5-diiodo-L-tyrosine + RESID-alternate + + + T3 + RESID-alternate + + + triiodo + UniMod-description + + + Triiodothyronine + PSI-MS-label + + + + DiffAvg + 469.79 + + + + DiffFormula + C 6 H 1 I 3 N 0 O 1 + + + + DiffMono + 469.716158 + + + + Formula + C 15 H 10 I 3 N 1 O 3 + + + + MassAvg + 632.96 + + + + MassMono + 632.779486 + + + + Origin + Y + + + + Source + natural + + + + TermSpec + none + + MOD:00502 + MOD:00998 + PSI-MOD + + + MOD:00187 + L-thyroxine + + A protein modification that effectively substitutes an L-tyrosine residue with L-thyroxine. + + 18332 + ChEBI + + + 6704086 + PubMed + + + AA0178 + RESID + + + 398 + UniMod + + + PSI-MOD-slim + + (S)-2-amino-3-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]propanoic acid + RESID-systematic + + + 3',3'',5',5''-tetraiodo-L-thyronine + RESID-alternate + + + 3,3',5,5'-tetraiodo-L-thyronine + RESID-alternate + + + 3,5,3',5'-tetraiodo-L-thyronine + RESID-alternate + + + 4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodo-L-phenylalanine + RESID-alternate + + + I4Thy + PSI-MOD-label + + + L-thyroxine + RESID-name + + + MOD_RES Thyroxine + UniProt-feature + + + O-(4-hydroxy-3,5-diiodophenyl)-3,5-diiodo-L-tyrosine + RESID-alternate + + + T4 + RESID-alternate + + + tetraiodo + UniMod-description + + + Thyroxine + PSI-MS-label + + + + DiffAvg + 595.68 + + + + DiffFormula + C 6 H 0 I 4 N 0 O 1 + + + + DiffMono + 595.612805 + + + + Formula + C 15 H 9 I 4 N 1 O 3 + + + + MassAvg + 758.86 + + + + MassMono + 758.676134 + + + + Origin + Y + + + + Source + natural + + + + TermSpec + none + + MOD:00998 + PSI-MOD + + + MOD:00188 + 6'-bromo-L-tryptophan + + A protein modification that effectively converts an L-tryptophan residue to 6'-bromo-L-tryptophan. + + 12118011 + PubMed + + + 9030520 + PubMed + + + 9033387 + PubMed + + + 9434739 + PubMed + + + AA0179 + RESID + + + 340#W + UniMod + + + + (2S)-2-amino-3-(6-bromo-1H-indol-3-yl)propanoic acid + RESID-systematic + + + 6'-bromo-L-tryptophan + RESID-name + + + 6'-BrTrp + PSI-MOD-label + + + bromination + UniMod-description + + + Bromo + PSI-MS-label + + + MOD_RES 6'-bromotryptophan + UniProt-feature + + + + DiffAvg + 78.90 + + + + DiffFormula + Br 1 C 0 H -1 N 0 O 0 + + + + DiffMono + 77.910512 + + + + Formula + Br 1 C 11 H 9 N 2 O 1 + + + + MassAvg + 265.11 + + + + MassMono + 263.989825 + + + + Origin + W + + + + Source + natural + + + + TermSpec + none + + MOD:01068 + MOD:01912 + PSI-MOD + + + MOD:00189 + dehydroalanine (Ser) + + A protein modification that effectively converts an L-serine residue to dehydroalanine. + + 0 + DeltaMass + + + 10220322 + PubMed + + + 1547888 + PubMed + + + 1815586 + PubMed + + + 2914619 + PubMed + + + 7947813 + PubMed + + + 8239649 + PubMed + + + AA0181#SER + RESID + + + 23#S + UniMod + + + PSI-MOD-slim + + 2,3-didehydroalanine + RESID-alternate + + + 2-aminoacrylic acid + RESID-alternate + + + 2-aminopropenoic acid + RESID-systematic + + + 4-methylidene-imidazole-5-one (MIO) active site + RESID-alternate + + + anhydroserine + RESID-alternate + + + beta-elim-s + OMSSA-label + + + Dehydrated + PSI-MS-label + + + dehydro + OMSSA-label + + + dehydroalanine + RESID-name + + + Dha + RESID-alternate + + + Dha(Ser) + PSI-MOD-label + + + MOD_RES 2,3-didehydroalanine (Ser) + UniProt-feature + + + phospholosss + OMSSA-label + + + + DiffAvg + -18.02 + + + + DiffFormula + C 0 H -2 N 0 O -1 + + + + DiffMono + -18.010565 + + + + Formula + C 3 H 3 N 1 O 1 + + + + MassAvg + 69.06 + + + + MassMono + 69.021464 + + + + Origin + S + + + + Source + natural + + + + TermSpec + none + + MOD:00416 + MOD:00916 + MOD:01168 + PSI-MOD + + + MOD:00190 + dehydrobutyrine (Thr) + + A protein modification that effectively converts an L-threonine residue to dehydrobutyrine. + + 0 + DeltaMass + + + 1547888 + PubMed + + + 3769923 + PubMed + + + AA0182 + RESID + + + 23#T + UniMod + + + PSI-MOD-slim + + (2Z)-2-aminobut-2-enoic acid + RESID-systematic + + + (Z)-2-amino-2-butenoic acid + RESID-alternate + + + (Z)-2-aminobutenoic acid + RESID-alternate + + + (Z)-dehydrobutyrine + RESID-name + + + 2,3-didehydrobutyrine + RESID-alternate + + + 3-methyldehydroalanine + RESID-alternate + + + alpha,beta-dehydroaminobutyric acid + RESID-alternate + + + anhydrothreonine + RESID-alternate + + + beta-elim-t + OMSSA-label + + + Dehydrated + PSI-MS-label + + + Dehydrated + UniMod-interim + + + Dehydration + UniMod-description + + + dehydro + OMSSA-label + + + Dehydroamino butyric acid + DeltaMass-label + + + Dhb + RESID-alternate + + + Dhb(Thr) + PSI-MOD-label + + + methyl-dehydroalanine + RESID-alternate + + + MOD_RES (Z)-2,3-didehydrobutyrine + UniProt-feature + + + phospholosst + OMSSA-label + + + + DiffAvg + -18.02 + + + + DiffFormula + C 0 H -2 N 0 O -1 + + + + DiffMono + -18.010565 + + + + Formula + C 4 H 5 N 1 O 1 + + + + MassAvg + 83.09 + + + + MassMono + 83.037114 + + + + Origin + T + + + + Source + natural + + + + TermSpec + none + + MOD:00416 + MOD:00917 + MOD:01703 + PSI-MOD + + + MOD:00191 + (Z)-2,3-didehydrotyrosine + + A protein modification that effectively converts L-tyrosine to (Z)-2,3-didehydrotyrosine. + + 1347277 + PubMed + + + 9631087 + PubMed + + + AA0183 + RESID + + + incidental to RESID:AA0184; incidental to RESID:AA0187; incidental to RESID:AA0188; incidental to RESID:AA0189; incidental to RESID:AA0378; incidental to RESID:AA0379; incidental to RESID:AA0380; incidental to RESID:AA0381 + PSI-MOD-slim + + (2Z)-2-amino-3-(4-hydroxyphenyl)prop-2-enoic acid + RESID-systematic + + + (Z)-2,3-didehydrogenated tyrosine + PSI-MOD-alternate + + + (Z)-2,3-didehydrotyrosine + RESID-name + + + 2-amino-3-oxo-butanoic_acid + UniMod-description + + + amino-(para-hydroxybenzylidenyl)acetic acid + RESID-alternate + + + cis-dehydrotyrosine + RESID-alternate + + + Didehydro + PSI-MS-label + + + green fluorescent protein chromophore + RESID-alternate + + + MOD_RES (Z)-2,3-didehydrotyrosine + UniProt-feature + + + para-hydroxybenzylidene-imidazolidinone chromophore + RESID-alternate + + + red fluorescent protein chromophore + RESID-alternate + + + Z-dHTyr + PSI-MOD-label + + + + DiffAvg + -2.02 + + + + DiffFormula + C 0 H -2 N 0 O 0 + + + + DiffMono + -2.015650 + + + + Formula + C 9 H 7 N 1 O 2 + + + + MassAvg + 161.16 + + + + MassMono + 161.047678 + + + + Origin + Y + + + + Source + natural + + + + TermSpec + none + + MOD:00706 + PSI-MOD + + + MOD:00192 + L-serine 5-imidazolinone glycine + + A protein modification that effectively crosslinks an L-serine residue and a glycine residue to form L-serine 5-imidazolinone glycine. + + 21393 + ChEBI + + + 1347277 + PubMed + + + 9631087 + PubMed + + + AA0184 + RESID + + + Cross-link 2; carboxamidine; incidental to RESID:AA0183; incidental to RESID:AA0365. + + (2-[(1R)-1-amino-2-hydroxyethyl]-5-oxo-4,5-dihydro-1H-imidazol-1-yl)acetic acid + RESID-systematic + + + 2-[1-amino-2-hydroxyethyl]-1-carboxymethyl-1-imidazolin-5-one + RESID-alternate + + + 4-methylidene-imidazole-5-one (MIO) active site + RESID-alternate + + + CROSSLNK 5-imidazolinone (Ser-Gly) + UniProt-feature + + + green fluorescent protein chromophore + RESID-alternate + + + L-serine 5-imidazolinone glycine + RESID-name + + + para-hydroxybenzylidene-imidazolidinone chromophore + RESID-alternate + + + seryl-5-imidazolinone glycine + RESID-alternate + + + + DiffAvg + -18.02 + + + + DiffFormula + C 0 H -2 N 0 O -1 + + + + DiffMono + -18.010565 + + + + Formula + C 5 H 6 N 2 O 2 + + + + MassAvg + 126.11 + + + + MassMono + 126.042927 + + + + Origin + G, S + + + + Source + natural + + + + TermSpec + none + + MOD:00908 + MOD:00916 + MOD:01882 + PSI-MOD + + + MOD:00193 + L-3-oxoalanine (Cys) + + A protein modification that effectively converts an L-cysteine residue to L-oxoalanine. + + 350 + DeltaMass + + + 14563551 + PubMed + + + 7628016 + PubMed + + + 8681943 + PubMed + + + 9478923 + PubMed + + + AA0185#CYS + RESID + + + 402#C + UniMod + + + PSI-MOD-slim + + (S)-2-amino-3-oxopropanoic acid + RESID-systematic + + + 2-amino-3-oxopropionic acid + RESID-alternate + + + C(alpha)-formylglycine + RESID-misnomer + + + L-3-oxoalanine + RESID-name + + + L-amino-malonic acid semialdehyde + RESID-alternate + + + L-aminomalonaldehydic acid + RESID-alternate + + + L-serinesemialdehyde + RESID-misnomer + + + MOD_RES 3-oxoalanine (Cys) + UniProt-feature + + + Oxala(Cys) + PSI-MOD-label + + + + DiffAvg + -18.08 + + + + DiffFormula + C 0 H -2 N 0 O 1 S -1 + + + + DiffMono + -17.992806 + + + + Formula + C 3 H 3 N 1 O 2 + + + + MassAvg + 85.06 + + + + MassMono + 85.016378 + + + + Origin + C + + + + Source + natural + + + + TermSpec + none + + MOD:01169 + PSI-MOD + + + MOD:00194 + lactic acid + + A protein modification that effectively converts an L-serine residue to an amino-terminal lactic acid. + + 7607233 + PubMed + + + AA0186 + RESID + + + 403#S + UniMod + + + + (2R)-2-hydroxypropanoic acid + RESID-systematic + + + 2-hydroxypropionic acid + RESID-alternate + + + alpha-hydroxypropionic acid + RESID-alternate + + + Lac(Ser) + PSI-MOD-label + + + lactic acid + RESID-name + + + lactic acid from N-term Ser + UniMod-description + + + MOD_RES Lactic acid + UniProt-feature + + + Ser->LacticAcid + PSI-MS-label + + + + DiffAvg + -15.02 + + + + DiffFormula + C 0 H -1 N -1 O 0 + + + + DiffMono + -15.010899 + + + + Formula + C 3 H 5 O 2 + + + + MassAvg + 73.07 + + + + MassMono + 73.028954 + + + + Origin + S + + + + TermSpec + N-term + + MOD:00916 + PSI-MOD + + + MOD:00195 + L-alanine 5-imidazolinone glycine + + A protein modification that effectively crosslinks an L-alanine residue and a glycine residue to form L-alanine 5-imidazolinone glycine. + + 10220322 + PubMed + + + AA0187 + RESID + + + Cross-link 2; carboxamidine; incidental to RESID:AA0181; incidental to RESID:AA0183; incidental to RESID:AA0365. + + (2-[(1S)-1-aminoethyl]-5-oxo-4,5-dihydro-1H-imidazol-1-yl)acetic acid + RESID-systematic + + + 2-[1-aminoethyl]-1-carboxymethyl-1-imidazolin-5-one + RESID-alternate + + + 4-methylidene-imidazole-5-one active site + RESID-alternate + + + alanyl-5-imidazolinone glycine + RESID-alternate + + + CROSSLNK 5-imidazolinone (Ala-Gly) + UniProt-feature + + + L-alanine 5-imidazolinone glycine + RESID-name + + + para-hydroxybenzylidene-imidazolidinone chromophore + RESID-alternate + + + XLNK-1Ala-NGly(Imidazole) + PSI-MOD-label + + + + DiffAvg + -18.02 + + + + DiffFormula + C 0 H -2 N 0 O -1 + + + + DiffMono + -18.010565 + + + + Formula + C 5 H 6 N 2 O 1 + + + + MassAvg + 110.12 + + + + MassMono + 110.048013 + + + + Origin + A, G + + + + Source + natural + + + + TermSpec + none + + MOD:00901 + MOD:00908 + MOD:01882 + PSI-MOD + + + MOD:00196 + L-cysteine 5-imidazolinone glycine + + A protein modification that effectively crosslinks an L-cysteine residue and a glycine residue to form L-cysteine 5-imidazolinone glycine. + + 1537807 + PubMed + + + AA0188 + RESID + + + Cross-link 2; carboxamidine; incidental to RESID:AA0181; incidental to RESID:AA0183; incidental to RESID:AA0365. + + (2-[(1R)-1-amino-2-sulfanylethyl]-5-oxo-4,5-dihydro-1H-imidazol-1-yl)acetic acid + RESID-systematic + + + 2-[1-amino-2-sulfanylethyl]-1-carboxymethyl-1-imidazolin-5-one + RESID-alternate + + + 4-methylidene-imidazole-5-one (MIO) active site + RESID-alternate + + + CROSSLNK 5-imidazolinone (Cys-Gly) + UniProt-feature + + + cysteinyl-5-imidazolinone glycine + RESID-alternate + + + L-cysteine 5-imidazolinone glycine + RESID-name + + + para-hydroxybenzylidene-imidazolidinone chromophore + RESID-alternate + + + XLNK-1Cys-NGly(Imidazole) + PSI-MOD-label + + + + DiffAvg + -18.02 + + + + DiffFormula + C 0 H -2 N 0 O -1 S 0 + + + + DiffMono + -18.010565 + + + + Formula + C 5 H 6 N 2 O 1 S 1 + + + + MassAvg + 142.18 + + + + MassMono + 142.020084 + + + + Origin + C, G + + + + Source + natural + + + + TermSpec + none + + MOD:00905 + MOD:00908 + MOD:01882 + PSI-MOD + + + MOD:00197 + 2-imino-glutamine 5-imidazolinone glycine + + A protein modification that effectively crosslinks an L-glutamine residue and a glycine residue to form 2-imino-glutamine 5-imidazolinone glycine. + + 11050230 + PubMed + + + 11209050 + PubMed + + + AA0189 + RESID + + + Cross-link 2; carboxamidine; incidental to RESID:AA0183; incidental to RESID:AA0365. + + 2,N-didehydroglutaminyl-5-imidazolinone glycine + RESID-alternate + + + 2-(3-carbamoyl-1-imino-propyl)-1-carboxymethyl-1-imidazolin-5-one + RESID-alternate + + + 2-imino-glutamine 5-imidazolinone glycine + RESID-name + + + [2-(3-carbamoyl-1-imino-propyl)-5-oxo-4,5-dihydro-imidazol-1-yl]-acetic acid + RESID-alternate + + + [2-(4-amino-4-oxobutanimidoyl)-5-oxo-4,5-dihydro-1H-imidazol-1-yl]acetic acid + RESID-systematic + + + CROSSLNK 2-iminomethyl-5-imidazolinone (Gln-Gly) + UniProt-feature + + + fluorescent protein FP583 chromophore + RESID-alternate + + + para-hydroxybenzylidene-imidazolidinone chromophore + RESID-alternate + + + red fluorescent protein chromophore + RESID-alternate + + + + DiffAvg + -20.03 + + + + DiffFormula + C 0 H -4 N 0 O -1 + + + + DiffMono + -20.026215 + + + + Formula + C 7 H 7 N 3 O 2 + + + + MassAvg + 165.15 + + + + MassMono + 165.053826 + + + + Origin + G, Q + + + + Source + natural + + + + TermSpec + none + + MOD:00907 + MOD:00908 + MOD:01882 + PSI-MOD + + + MOD:00198 + D-alanine (Ala) + + A protein modification that effectively converts an L-alanine residue to D-alanine. + + 15023056 + PubMed + + + 7287302 + PubMed + + + 7961627 + PubMed + + + AA0191#ALA + RESID + + + + (R)-2-aminopropanoic acid + RESID-systematic + + + D-Ala(Ala) + PSI-MOD-label + + + D-alanine + RESID-name + + + MOD_RES D-alanine (Ala) + UniProt-feature + + + + DiffAvg + 0.00 + + + + DiffFormula + C 0 H 0 N 0 O 0 + + + + DiffMono + 0.000000 + + + + Formula + C 3 H 5 N 1 O 1 + + + + MassAvg + 71.08 + + + + MassMono + 71.037114 + + + + Origin + A + + + + Source + natural + + + + TermSpec + none + + MOD:00570 + MOD:00862 + MOD:00901 + PSI-MOD + + + MOD:00199 + D-allo-isoleucine + + A protein modification that effectively converts an L-isoleucine residue to a D-allo-isoleucine. + + 30007 + ChEBI + + + 8223491 + PubMed + + + AA0192 + RESID + + + + (2R,3S)-2-amino-3-methylpentanoic acid + RESID-systematic + + + 2-azanyl-3-methylpentanoic acid + RESID-alternate + + + 3-methyl-norvaline + RESID-alternate + + + allo-D-isoleucine + RESID-alternate + + + alpha-amino-beta-methylvaleric acid + RESID-alternate + + + D-allo-isoleucine + RESID-name + + + D-Ile + PSI-MOD-label + + + D-threo-isoleucine + RESID-alternate + + + MOD_RES D-allo-isoleucine + UniProt-feature + + + + DiffAvg + 0.00 + + + + DiffFormula + C 0 H 0 N 0 O 0 + + + + DiffMono + 0.000000 + + + + Formula + C 6 H 11 N 1 O 1 + + + + MassAvg + 113.16 + + + + MassMono + 113.084064 + + + + Origin + I + + + + Source + natural + + + + TermSpec + none + + MOD:00306 + MOD:00664 + MOD:00910 + PSI-MOD + + + MOD:00200 + D-methionine + + A protein modification that effectively converts an L-methionine residue to D-methionine. + + 29984 + ChEBI + + + 16033333 + PubMed + + + 2542051 + PubMed + + + AA0193 + RESID + + + + (2R)-2-amino-4-(methylsulfanyl)butanoic acid + RESID-systematic + + + 2-amino-4-(methylthio)butanoic acid + RESID-alternate + + + 2-amino-4-(methylthio)butyric acid + RESID-alternate + + + D-Met + PSI-MOD-label + + + D-methionine + RESID-name + + + MOD_RES D-methionine + UniProt-feature + + + + DiffAvg + 0.00 + + + + DiffFormula + C 0 H 0 N 0 O 0 S 0 + + + + DiffMono + 0.000000 + + + + Formula + C 5 H 9 N 1 O 1 S 1 + + + + MassAvg + 131.19 + + + + MassMono + 131.040485 + + + + Origin + M + + + + Source + natural + + + + TermSpec + none + + MOD:00664 + MOD:00913 + PSI-MOD + + + MOD:00201 + D-phenylalanine + + A protein modification that effectively converts an L-phenylalanine residue to D-phenylalanine. + + 29996 + ChEBI + + + 1548227 + PubMed + + + 1644179 + PubMed + + + 2597281 + PubMed + + + AA0194 + RESID + + + + (R)-2-amino-3-phenylpropanoic acid + RESID-systematic + + + D-Phe + PSI-MOD-label + + + D-phenylalanine + RESID-name + + + MOD_RES D-phenylalanine + UniProt-feature + + + + DiffAvg + 0.00 + + + + DiffFormula + C 0 H 0 N 0 O 0 + + + + DiffMono + 0.000000 + + + + Formula + C 9 H 9 N 1 O 1 + + + + MassAvg + 147.18 + + + + MassMono + 147.068414 + + + + Origin + F + + + + Source + natural + + + + TermSpec + none + + MOD:00664 + MOD:00914 + PSI-MOD + + + MOD:00202 + D-serine (Ser) + + A protein modification that effectively converts an L-serine residue to D-serine. + + 7973665 + PubMed + + + AA0195#SER + RESID + + + + (R)-2-amino-3-hydroxypropanoic acid + RESID-systematic + + + D-Ser(Ser) + PSI-MOD-label + + + D-serine + RESID-name + + + + DiffAvg + 0.00 + + + + DiffFormula + C 0 H 0 N 0 O 0 + + + + DiffMono + 0.000000 + + + + Formula + C 3 H 5 N 1 O 2 + + + + MassAvg + 87.08 + + + + MassMono + 87.032028 + + + + Origin + S + + + + Source + natural + + + + TermSpec + none + + MOD:00891 + MOD:00916 + PSI-MOD + + + MOD:00203 + D-asparagine + + A protein modification that effectively converts an L-asparagine residue to D-asparagine. + + 29957 + ChEBI + + + 1859408 + PubMed + + + AA0196 + RESID + + + + (R)-2-amino-4-butanediamic acid + RESID-systematic + + + D-alpha-aminosuccinamic acid + RESID-alternate + + + D-Asn + PSI-MOD-label + + + D-asparagine + RESID-name + + + D-aspartic acid beta-amide + RESID-alternate + + + MOD_RES D-asparagine + UniProt-feature + + + + DiffAvg + 0.00 + + + + DiffFormula + C 0 H 0 N 0 O 0 + + + + DiffMono + 0.000000 + + + + Formula + C 4 H 6 N 2 O 2 + + + + MassAvg + 114.10 + + + + MassMono + 114.042927 + + + + Origin + N + + + + Source + natural + + + + TermSpec + none + + MOD:00664 + MOD:00903 + PSI-MOD + + + MOD:00204 + D-leucine + + A protein modification that effectively converts an L-leucine residue to D-leucine. + + 30005 + ChEBI + + + 10461743 + PubMed + + + 12135762 + PubMed + + + 1358533 + PubMed + + + 1548227 + PubMed + + + AA0197 + RESID + + + + (2R)-2-amino-4-methylpentanoic acid + RESID-systematic + + + alpha-aminoisocaproic acid + RESID-alternate + + + D-Leu + PSI-MOD-label + + + D-leucine + RESID-name + + + MOD_RES D-leucine + UniProt-feature + + + + DiffAvg + 0.00 + + + + DiffFormula + C 0 H 0 N 0 O 0 + + + + DiffMono + 0.000000 + + + + Formula + C 6 H 11 N 1 O 1 + + + + MassAvg + 113.16 + + + + MassMono + 113.084064 + + + + Origin + L + + + + Source + natural + + + + TermSpec + none + + MOD:00306 + MOD:00664 + MOD:00911 + PSI-MOD + + + MOD:00205 + D-tryptophan + + A protein modification that effectively converts an L-tryptophan residue to D-tryptophan. + + 29955 + ChEBI + + + 8910408 + PubMed + + + AA0198 + RESID + + + + (R)-2-amino-3-(1H-indol-3-yl)propanoic acid + RESID-systematic + + + alpha-amino-beta-(3-indolyl)propionoic acid + RESID-alternate + + + D-Trp + PSI-MOD-label + + + D-tryptophan + RESID-name + + + MOD_RES D-tryptophan + UniProt-feature + + + + DiffAvg + 0.00 + + + + DiffFormula + C 0 H 0 N 0 O 0 + + + + DiffMono + 0.000000 + + + + Formula + C 11 H 10 N 2 O 1 + + + + MassAvg + 186.21 + + + + MassMono + 186.079313 + + + + Origin + W + + + + Source + natural + + + + TermSpec + none + + MOD:00664 + MOD:00918 + PSI-MOD + + + MOD:00206 + L-isoglutamyl-polyglycine + + A protein modification that effectively converts an L-glutamic acid residue to L-isoglutamyl-polyglycine. + + 21343 + ChEBI + + + 10074368 + PubMed + + + 16368691 + PubMed + + + 7992051 + PubMed + + + AA0201 + RESID + + + + gamma-glutamylpolyglycine + RESID-alternate + + + L-isoglutamyl-polyglycine + RESID-name + + + MOD_RES 5-glutamyl polyglycine + UniProt-feature + + + + DiffAvg + 57.05 + + + + DiffFormula + C 2 H 3 N 1 O 1 + + + + DiffMono + 57.021464 + + + + Formula + C 7 H 10 N 2 O 4 + + + + MassAvg + 186.17 + + + + MassMono + 186.064057 + + + + Origin + E + + + + Source + natural + + + + TermSpec + none + + MOD:00906 + PSI-MOD + + + MOD:00207 + L-isoglutamyl-polyglutamic acid + + A protein modification that effectively converts an L-glutamic acid residue to isoglutamyl-polyglutamic acid, forming an isopeptide bond with a polyglutamic acid. + + 10747868 + PubMed + + + 1680872 + PubMed + + + AA0202 + RESID + + + + gamma-glutamylpolyglutamic acid + RESID-alternate + + + L-isoglutamyl-polyglutamic acid + RESID-name + + + + DiffAvg + 129.12 + + + + DiffFormula + C 5 H 7 N 1 O 3 + + + + DiffMono + 129.042593 + + + + Formula + C 10 H 14 N 2 O 6 + + + + MassAvg + 258.23 + + + + MassMono + 258.085186 + + + + Origin + E + + + + Source + natural + + + + TermSpec + none + + MOD:00674 + MOD:00906 + PSI-MOD + + + MOD:00208 + O4'-(phospho-5'-adenosine)-L-tyrosine + + A protein modification that effectively crosslinks an L-tyrosine residue and 5'-phosphoadenosine through a phosphodiester bond to form O4'-(phospho-5'-adenosine)-L-tyrosine. + + 0 + DeltaMass + + + 5543675 + PubMed + + + AA0203 + RESID + + + 405#Y + UniMod + + + From DeltaMass: Average Mass: 329. + PSI-MOD-slim + + (2S)-2-amino-3-[4-(5'-adenosine phosphonoxy)phenyl]propanoic acid + RESID-systematic + + + 5'-adenylic-O-tyrosine + RESID-alternate + + + AMP binding site + UniMod-description + + + hydrogen 5'-adenylate tyrosine ester + RESID-alternate + + + MOD_RES O-AMP-tyrosine + UniProt-feature + + + O-5'-Adenosylation ( of Tyrosine) + DeltaMass-label + + + O4'-(phospho-5'-adenosine)-L-tyrosine + RESID-name + + + O4'-L-tyrosine 5'-adenosine phosphodiester + RESID-alternate + + + OAMPTyr + PSI-MOD-label + + + Phosphoadenosine + PSI-MS-label + + + + DiffAvg + 329.21 + + + + DiffFormula + C 10 H 12 N 5 O 6 P 1 + + + + DiffMono + 329.052520 + + + + Formula + C 19 H 21 N 6 O 8 P 1 + + + + MassAvg + 492.38 + + + + MassMono + 492.115848 + + + + Origin + Y + + + + Source + natural + + + + TermSpec + none + + MOD:00919 + MOD:01165 + PSI-MOD + + + MOD:00209 + S-(2-aminovinyl)-D-cysteine (Cys-Ser) + + A protein modification that effectively cross-links an L-cysteine residue and an L-serine residue by a thioether bond to form S-(2-aminovinyl)-D-cysteine. + + 3181159 + PubMed + + + 3769923 + PubMed + + + AA0204#SER + RESID + + + Cross-link 2. + + (2S)-2-amino-3-([(Z)-2-aminoethenyl]sulfanyl)propanoic acid + RESID-systematic + + + (S,Z)-S-(2-aminovinyl)cysteine + RESID-alternate + + + CROSSLNK S-(2-aminovinyl)-D-cysteine (Ser-Cys) + UniProt-feature + + + S-(2-aminovinyl)-D-cysteine + RESID-name + + + XLNK-(D)SCys-VinAm + PSI-MOD-label + + + + DiffAvg + -64.04 + + + + DiffFormula + C -1 H -4 N 0 O -3 S 0 + + + + DiffMono + -64.016044 + + + + Formula + C 5 H 7 N 2 O 1 S 1 + + + + MassAvg + 143.18 + + + + MassMono + 143.027909 + + + + Origin + C, S + + + + TermSpec + C-term + + MOD:00916 + MOD:01850 + PSI-MOD + + + MOD:00210 + L-cysteine sulfenic acid + + A protein modification that effectively monooxygenates an L-cysteine residue to L-cysteine sulfenic acid. + + 41 + DeltaMass + + + 10964927 + PubMed + + + 2501303 + PubMed + + + 8756456 + PubMed + + + 9214307 + PubMed + + + 9586994 + PubMed + + + 9587003 + PubMed + + + AA0205 + RESID + + + 35#C + UniMod + + + From DeltaMass: Average Mass: 16 Average Mass Change:16 Notes:Green et al. in J. B. C. 270, 18209-18211 (1995) quote Kim and Raines in Eur. J. Biochem. 224, 109-114 (1994). Kim and Raines using ESI-MS and sulfhydryl group titration found that bovine seminal ribonuclease contains a single oxidized sulfhydryl group, which cannot participate in a disulfide bond. This form of cysteine is called sulfenic acid (-SOH). + PSI-MOD-slim + + (2R)-2-amino-3-(hydroxysulfanyl)propanoic acid + RESID-systematic + + + (2R)-2-amino-3-(oxido-lambda(4)-sulfanyl)propanoic acid [tautomer] + RESID-alternate + + + 2-amino-2-carboxyethanesulfenic acid + RESID-alternate + + + 2-amino-3-sulfinylpropanoic acid [tautomer] + RESID-alternate + + + 3-sulfenoalanine + RESID-alternate + + + ACT_SITE Cysteine sulfenic acid (-SOH) intermediate + UniProt-feature + + + CysOH + PSI-MOD-label + + + cysteine S-oxide [tautomer] + RESID-alternate + + + cysteine sulfoxide [tautomer] + RESID-alternate + + + cysteine sulphenic acid + RESID-alternate + + + L-cysteine sulfenic acid + RESID-name + + + mod193 + OMSSA-label + + + MOD_RES Cysteine sulfenic acid (-SOH) + UniProt-feature + + + Oxidation + PSI-MS-label + + + S-hydroxycysteine + RESID-alternate + + + S-oxocysteine [tautomer] + RESID-alternate + + + S-oxycysteine [tautomer] + RESID-alternate + + + Sulfenic Acid (from Cysteine) + DeltaMass-label + + + + DiffAvg + 16.00 + + + + DiffFormula + C 0 H 0 N 0 O 1 S 0 + + + + DiffMono + 15.994915 + + + + Formula + C 3 H 5 N 1 O 2 S 1 + + + + MassAvg + 119.14 + + + + MassMono + 119.004099 + + + + Origin + C + + + + Source + natural + + + + TermSpec + none + + MOD:00708 + MOD:01854 + PSI-MOD + + + MOD:00211 + S-(glycyl)-L-cysteine (Cys-Gly) + + A protein modification that effectively crosslinks an L-cysteine residue and a glycine residue by a thioester bond to form S-glycyl-L-cysteine. + + 22050 + ChEBI + + + 3306404 + PubMed + + + AA0206 + RESID + + + Cross-link 2. For the modification of a C-terminal glycine by formation of a thioester bond with free L-cycteine see MOD:01777 [JSG]. + PSI-MOD-slim + + (2R)-2-amino-3-[(aminoacetyl)sulfanyl]propanoic acid + RESID-systematic + + + 1-(cystein-S-yl)-glycinate + RESID-alternate + + + ACT_SITE Glycyl thioester intermediate + UniProt-feature + + + glycine cysteine thioester + RESID-alternate + + + S-(2-amino-1-oxoethyl)cysteine + RESID-alternate + + + S-(glycyl)-L-cysteine + RESID-name + + + XLNK-SCys-1Gly + PSI-MOD-label + + + + DiffAvg + -18.02 + + + + DiffFormula + C 0 H -2 N 0 O -1 S 0 + + + + DiffMono + -18.010565 + + + + Formula + C 5 H 7 N 2 O 2 S 1 + + + + MassAvg + 159.18 + + + + MassMono + 159.022823 + + + + Origin + C, G + + + + TermSpec + C-term + + MOD:00395 + MOD:00908 + MOD:00954 + PSI-MOD + + + MOD:00212 + S-4-hydroxycinnamyl-L-cysteine + + A protein modification that effectively converts an L-cysteine residue to S-4-hydroxycinnamyl-L-cysteine. + + 7947803 + PubMed + + + 7981196 + PubMed + + + AA0207 + RESID + + + 407 + UniMod + + + + (2R)-2-amino-3-([(2E)-3-(4-hydroxyphenyl)prop-2-enoyl]sulfanyl)propanoic acid + RESID-systematic + + + cinnamate cysteine thioester + RESID-alternate + + + Hydroxycinnamyl + PSI-MS-label + + + hydroxycinnamyl + UniMod-description + + + MOD_RES S-(4-hydroxycinnamyl)cysteine + UniProt-feature + + + S-4-hydroxycinnamyl-L-cysteine + RESID-name + + + S-para-coumaryl-L-cysteine + RESID-alternate + + + + DiffAvg + 146.14 + + + + DiffFormula + C 9 H 6 N 0 O 2 S 0 + + + + DiffMono + 146.036779 + + + + Formula + C 12 H 11 N 1 O 3 S 1 + + + + MassAvg + 249.28 + + + + MassMono + 249.045964 + + + + Origin + C + + + + Source + natural + + + + TermSpec + none + + MOD:00905 + PSI-MOD + + + MOD:00213 + chondroitin sulfate D-glucuronosyl-D-galactosyl-D-galactosyl-D-xylosyl-L-serine + + A protein modification that effectively cross-links an L-serine residue to the polymer chondroitin sulfate by a D-glucuronosyl-D-galactosyl-D-galactosyl-D-xylosyl tetrasaccharide. + + 1794445 + PubMed + + + 1898736 + PubMed + + + 3472204 + PubMed + + + AA0208 + RESID + + + + chondroitin 4-sulfate (chondroitin sulfate A) + RESID-alternate + + + chondroitin 6-sulfate (chondroitin sulfate C) + RESID-alternate + + + chondroitin sulfate D-glucuronosyl-D-galactosyl-D-galactosyl-D-xylosyl-L-serine + RESID-name + + + poly[beta-1,4-D-glucopyranuronosyl-beta-1,3-(2-acetamido-2-deoxy-4-sulfate-D-galactosyl)]-beta-1,4-D-glucopyranuronosyl-beta-1,3-D-galactosyl-beta-1,3-D-galactosyl-beta-1,4-D-xylosyl-beta-1,3-L-serine; poly[beta-1,4-D-glucopyranuronosyl-beta-1,3-(2-acetamido-2-deoxy-6-sulfate D-galactosyl)]-beta-1,4-D-glucopyranuronosyl-beta-1,3-D-galactosyl-beta-1,3-D-galactosyl-beta-1,4-D-xylosyl-beta-1,3-L-serine + RESID-systematic + + + + DiffAvg + -1.01 + + + + DiffFormula + C 0 H -1 N 0 O 0 + + + + DiffMono + -1.007825 + + + + Formula + C 3 H 4 N 1 O 2 + + + + MassAvg + 86.07 + + + + MassMono + 86.024203 + + + + Origin + S + + + + Source + natural + + + + TermSpec + none + + MOD:00002 + PSI-MOD + + + MOD:00214 + dermatan 4-sulfate D-glucuronosyl-D-galactosyl-D-galactosyl-D-xylosyl-L-serine + + A protein modification that effectively cross-links an L-serine residue to the polymer dermatan 4-sulfate by a D-glucuronosyl-D-galactosyl-D-galactosyl-D-xylosyl tetrasaccharide. + + 2914936 + PubMed + + + 3472204 + PubMed + + + AA0209 + RESID + + + + beta-heparin + RESID-alternate + + + chondroitin sulfate B + RESID-alternate + + + dermatan 4-sulfate D-glucuronosyl-D-galactosyl-D-galactosyl-D-xylosyl-L-serine + RESID-name + + + poly[beta-1,4-L-idopyranuronosyl-alpha-1,3-(2-acetamido-2-deoxy-4-sulfate D-galactosyl)]-beta-1,4-D-glucopyranuronosyl-beta-1,3-D-galactosyl-beta-1,3-D-galactosyl-beta-1,4-D-xylosyl-beta-1,3-L-serine + RESID-systematic + + + + DiffAvg + -1.01 + + + + DiffFormula + C 0 H -1 N 0 O 0 + + + + DiffMono + -1.007825 + + + + Formula + C 3 H 4 N 1 O 2 + + + + MassAvg + 86.07 + + + + MassMono + 86.024203 + + + + Origin + S + + + + Source + natural + + + + TermSpec + none + + MOD:00002 + PSI-MOD + + + MOD:00215 + heparan sulfate D-glucuronosyl-D-galactosyl-D-galactosyl-D-xylosyl-L-serine + + A protein modification that effectively cross-links an L-serine residue to the polymer heparan sulfate by a D-glucuronosyl-D-galactosyl-D-galactosyl-D-xylosyl tetrasaccharide. + + 3472204 + PubMed + + + AA0210 + RESID + + + + heparan sulfate D-glucuronosyl-D-galactosyl-D-galactosyl-D-xylosyl-L-serine + RESID-name + + + heparin + RESID-alternate + + + heparitin sulfate + RESID-alternate + + + poly[alpha-1,4-(2-sulfate D-glucopyranuronosyl)-beta-1,4-(2-sulfamino-2-deoxy-6-sulfate D-glucosyl)]-beta-1,4-D-glucopyranuronosyl-beta-1,3-D-galactosyl-beta-1,3-D-galactosyl-beta-1,4-D-xylosyl-beta-1,3-L-serine + RESID-systematic + + + + DiffAvg + -1.01 + + + + DiffFormula + C 0 H -1 N 0 O 0 + + + + DiffMono + -1.007825 + + + + Formula + C 3 H 4 N 1 O 2 + + + + MassAvg + 86.07 + + + + MassMono + 86.024203 + + + + Origin + S + + + + Source + natural + + + + TermSpec + none + + MOD:00002 + PSI-MOD + + + MOD:00216 + N6-formyl-L-lysine + + A protein modification that effectively converts an L-lysine residue to N6-formyl-L-lysine. + + 15799070 + PubMed + + + AA0211 + RESID + + + 122#K + UniMod + + + PSI-MOD-slim + + (2S)-2-amino-6-(formylamino)hexanoic acid + RESID-systematic + + + epsilon-formyllysine + RESID-alternate + + + Formyl + PSI-MS-label + + + Formylation + UniMod-description + + + formylk + OMSSA-label + + + MOD_RES N6-formyllysine + UniProt-feature + + + N(zeta)-formyllysine + RESID-alternate + + + N6-formyl-L-lysine + RESID-name + + + N6-formylated L-lysine + PSI-MOD-alternate + + + N6FoLys + PSI-MOD-label + + + + DiffAvg + 28.01 + + + + DiffFormula + C 1 H 0 N 0 O 1 + + + + DiffMono + 27.994915 + + + + Formula + C 7 H 12 N 2 O 2 + + + + MassAvg + 156.19 + + + + MassMono + 156.089878 + + + + Origin + K + + + + Source + natural + + + + TermSpec + none + + MOD:00409 + MOD:01875 + PSI-MOD + + + MOD:00217 + O4-arabinosyl-L-hydroxyproline + + A protein modification that effectively converts an L-proline residue to O4-arabinosyl-L-hydroxyproline. + + 0 + DeltaMass + + + 666730 + PubMed + + + 7852316 + PubMed + + + AA0212 + RESID + + + 408 + UniMod + + + secondary to RESID:AA0030; From DeltaMass: Average Mass: 147. + PSI-MOD-slim + + (2S,4R)-4-(beta-L-arabinofuranosyloxy)pyrrolidine-2-carboxylic acid + RESID-systematic + + + 4-(beta-L-arabinofuranosyloxy)proline + RESID-alternate + + + 4-Glycosyloxy- (pentosyl,C5) (of Proline) + DeltaMass-label + + + beta-arabinofuranosyl-4-hydroxyproline + RESID-alternate + + + Glycosyl + PSI-MS-label + + + glycosyl-L-hydroxyproline + UniMod-description + + + O4-arabinosyl-L-hydroxyproline + RESID-name + + + O4-glycosyl-hydroxyproline + RESID-alternate + + + OAra4HyPro + PSI-MOD-label + + + + DiffAvg + 148.11 + + + + DiffFormula + C 5 H 8 N 0 O 5 + + + + DiffMono + 148.037173 + + + + Formula + C 10 H 15 N 1 O 6 + + + + MassAvg + 245.23 + + + + MassMono + 245.089937 + + + + Origin + P + + + + Source + natural + + + + TermSpec + none + + MOD:00396 + MOD:00915 + PSI-MOD + + + MOD:00218 + O-(phospho-5'-RNA)-L-serine + + A protein modification that effectively crosslinks an L-serine residue and the 5'-end of RNA through a phosphodiester to form O4'-(phospho-5'-RNA)-L-serine. + + 1705009 + PubMed + + + AA0213 + RESID + + + + (S)-2-amino-3-(5'-ribonucleic acid phosphonoxy)propanoic acid + RESID-systematic + + + MOD_RES O-(5'-phospho-RNA)-serine + UniProt-feature + + + O-(phospho-5'-RNA)-L-serine + RESID-name + + + O3-(phospho-5'-RNA)-L-serine + RESID-alternate + + + O3-L-serine 5'-RNA phosphodiester + RESID-alternate + + + + DiffAvg + 78.97 + + + + DiffFormula + C 0 H 0 N 0 O 3 P 1 + + + + DiffMono + 78.958505 + + + + Formula + C 3 H 5 N 1 O 5 P 1 + + + + MassAvg + 166.05 + + + + MassMono + 165.990534 + + + + Origin + S + + + + Source + natural + + + + TermSpec + none + + MOD:00751 + MOD:00916 + PSI-MOD + + + MOD:00219 + L-citrulline + + A protein modification that effectively converts an L-arginine residue to L-citrulline. + + 0 + DeltaMass + + + 2466844 + PubMed + + + AA0214 + RESID + + + 7#R + UniMod + + + This modification is not the result of deamidation, instead the guanidino group is replaced with an ureido group. + PSI-MOD-slim + + (S)-2-amino-5-(carbamoylamino)pentanoic acid + RESID-systematic + + + 2-amino-5-(aminocarbonyl)aminopentanoic acid + RESID-alternate + + + alpha-amino-delta-ureidovaleric acid + RESID-alternate + + + Cit + PSI-MOD-label + + + citrullinationr + OMSSA-label + + + Citrulline + DeltaMass-label + + + Deamidated + PSI-MS-label + + + Deamidated + UniMod-interim + + + Deamidation + UniMod-description + + + delta-ureidonorvaline + RESID-alternate + + + L-citrulline + RESID-name + + + MOD_RES Citrulline + UniProt-feature + + + N5-(aminocarbonyl)ornithine + RESID-alternate + + + N5-carbamoylornithine + RESID-alternate + + + N5-carbamylornithine + RESID-alternate + + + + DiffAvg + 0.98 + + + + DiffFormula + C 0 H -1 N -1 O 1 + + + + DiffMono + 0.984016 + + + + Formula + C 6 H 11 N 3 O 2 + + + + MassAvg + 157.17 + + + + MassMono + 157.085127 + + + + Origin + R + + + + Source + natural + + + + TermSpec + none + + MOD:00902 + PSI-MOD + + + MOD:00220 + 4-hydroxy-L-arginine + + A protein modification that effectively converts an L-arginine residue to a 4-hydroxy-L-arginine. + + 10966817 + PubMed + + + 7650037 + PubMed + + + AA0215 + RESID + + + + (2S,4Xi)-2-amino-5-[(diaminomethylidene)amino]-4-hydroxypentanoic acid + RESID-systematic + + + 2-amino-5-(carbamimidamido)-4-hydroxypentanoic acid [tautomer] + RESID-alternate + + + 2-amino-5-[(aminoiminomethyl)amino]-4-hydroxypentanoic acid [tautomer] + RESID-alternate + + + 2-amino-5-guanidino-4-hydroxypentanoic acid + RESID-alternate + + + 4-hydroxy-L-arginine + RESID-name + + + 4-hydroxylated L-arginine + PSI-MOD-alternate + + + 4HyArg + PSI-MOD-label + + + C(gamma)-hydroxyarginine + RESID-alternate + + + gamma-hydroxyarginine + RESID-alternate + + + MOD_RES 4-hydroxyarginine + UniProt-feature + + + + DiffAvg + 16.00 + + + + DiffFormula + C 0 H 0 N 0 O 1 + + + + DiffMono + 15.994915 + + + + Formula + C 6 H 12 N 4 O 2 + + + + MassAvg + 172.19 + + + + MassMono + 172.096026 + + + + Origin + R + + + + Source + natural + + + + TermSpec + none + + MOD:00425 + MOD:00682 + PSI-MOD + + + MOD:00221 + N-(L-isoaspartyl)-L-cysteine + + A protein modification that effectively crosslinks L-aspartic acid and L-cysteine residues via an isopeptide bond to form N-(L-isoaspartyl)-L-cysteine. + + 8286361 + PubMed + + + AA0216 + RESID + + + Cross-link 2. + + (S)-2-amino-4-((R)-1-carboxy-2-sulfanylethyl)amino-4-oxobutanoic acid + RESID-systematic + + + 2-(3-amino-3-carboxypropanoyl)amino-3-mercaptopropanoic acid + RESID-alternate + + + 2-amino-N4-(1-carboxy-2-mercaptoethyl)butanediamic acid + RESID-alternate + + + CROSSLNK Isoaspartyl cysteine isopeptide (Cys-Asn) + UniProt-feature + + + N-(L-isoaspartyl)-L-cysteine + RESID-name + + + N-beta-aspartylcysteine + RESID-alternate + + + N-isoaspartyl cysteine + RESID-alternate + + + + DiffAvg + -17.03 + + + + DiffFormula + C 0 H -3 N -1 O 0 S 0 + + + + DiffMono + -17.026549 + + + + Formula + C 7 H 9 N 2 O 3 S 1 + + + + MassAvg + 201.22 + + + + MassMono + 201.033388 + + + + Origin + C, N + + + + Source + natural + + + + TermSpec + N-term + + MOD:00903 + MOD:00905 + PSI-MOD + + + MOD:00222 + 2'-alpha-mannosyl-L-tryptophan + + A protein modification that effectively converts an L-tryptophan residue to 2'-alpha-mannosyl-L-tryptophan. + + 15279557 + PubMed + + + 7547911 + PubMed + + + 7947762 + PubMed + + + AA0217 + RESID + + + 41#W + UniMod + + + + (2S)-2-amino-3-(2-beta-D-mannopyranosyl-1H-indol-3-yl)propanoic acid + RESID-systematic + + + 2'-mannosyl-L-tryptophan + RESID-name + + + 2'-tryptophan C-mannoside + RESID-alternate + + + C2'ManTrp + PSI-MOD-label + + + CARBOHYD C-linked (Man) + UniProt-feature + + + Hex + PSI-MS-label + + + Hexose + UniMod-description + + + + DiffAvg + 162.14 + + + + DiffFormula + C 6 H 10 N 0 O 5 + + + + DiffMono + 162.052823 + + + + Formula + C 17 H 20 N 2 O 6 + + + + MassAvg + 348.36 + + + + MassMono + 348.132136 + + + + Origin + W + + + + Source + natural + + + + TermSpec + none + + MOD:00421 + MOD:00595 + MOD:00761 + MOD:00918 + PSI-MOD + + + MOD:00223 + N6-mureinyl-L-lysine + + A protein modification that effectively converts an L-lysine residue to N6-mureinyl-L-lysine. + + 4261992 + PubMed + + + AA0218 + RESID + + + + MOD_RES N6-murein peptidoglycan lysine + UniProt-feature + + + N6-[(2R,6S)-2-(N-(N-mureinyl-(R)-alanyl)-(S)-glutamyl)amino-6-amino-6-carboxy-1-oxohex-1-yl]lysine + RESID-alternate + + + N6-mureinyl-L-lysine + RESID-name + + + + DiffAvg + -1.01 + + + + DiffFormula + C 0 H -1 N 0 O 0 + + + + DiffMono + -1.007825 + + + + Formula + C 6 H 11 N 2 O 1 + + + + MassAvg + 127.17 + + + + MassMono + 127.087138 + + + + Origin + K + + + + Source + natural + + + + TermSpec + none + + MOD:01159 + MOD:01875 + PSI-MOD + + + MOD:00224 + 1-chondroitin sulfate-L-aspartic acid ester + + A protein modification that effectively converts an L-aspartic acid residue to 1-chondroitin sulfate-L-aspartic acid ester + + 1898736 + PubMed + + + AA0219 + RESID + + + + 1-aspartic acid ester with 6-chondroitin 4-sulfate + RESID-alternate + + + 1-chondroitin sulfate-L-aspartic acid ester + RESID-name + + + MOD_RES Aspartate 1-(chondroitin 4-sulfate)-ester + UniProt-feature + + + poly[beta-1,4-D-glucopyranuronosyl-beta-1,3-(2-acetamido-2-deoxy-4-sulfate D-galactosyl)]beta-1,4-D-glucopyranuronosyl-beta-1,3-(2-acetamido-2-deoxy-4-sulfate-6-(1-L-aspartyl)-D-galactose) + RESID-alternate + + + protein-glycosaminoglycan-protein cross-link + RESID-alternate + + + + DiffAvg + 441.36 + + + + DiffFormula + C 14 H 19 N 1 O 13 S 1 + + + + DiffMono + 441.057711 + + + + Formula + C 18 H 25 N 2 O 17 S 1 + + + + MassAvg + 573.45 + + + + MassMono + 573.087393 + + + + Origin + D + + + + TermSpec + C-term + + MOD:00904 + PSI-MOD + + + MOD:00225 + S-(6-FMN)-L-cysteine + + A protein modification that effectively converts an L-cysteine residue to S-(6-FMN)-L-cysteine. + + 10869173 + PubMed + + + 1551870 + PubMed + + + 620783 + PubMed + + + AA0220 + RESID + + + 409#C + UniMod + + + PSI-MOD-slim + + (R)-2-amino-3-[6-riboflavin 5'-dihydrogen phosphate]sulfanylpropanoic acid + RESID-systematic + + + 6-[S-cysteinyl]flavin mononucleotide + RESID-alternate + + + 6-[S-cysteinyl]FMN + RESID-alternate + + + flavin mononucleotide + UniMod-description + + + FMNH + PSI-MS-label + + + MOD_RES S-6-FMN cysteine + UniProt-feature + + + S-(6-FMN)-L-cysteine + RESID-name + + + S6FMNCys + PSI-MOD-label + + + + DiffAvg + 454.33 + + + + DiffFormula + C 17 H 19 N 4 O 9 P 1 S 0 + + + + DiffMono + 454.088965 + + + + Formula + C 20 H 24 N 5 O 10 P 1 S 1 + + + + MassAvg + 557.47 + + + + MassMono + 557.098150 + + + + Origin + C + + + + Source + natural + + + + TermSpec + none + + MOD:00896 + MOD:00905 + PSI-MOD + + + MOD:00226 + 1'-(8alpha-FAD)-L-histidine + + A protein modification that effectively converts an L-histidine residue to 1'-(8alpha-FAD)-L-histidine. + + 0 + DeltaMass + + + 10585424 + PubMed + + + 1396672 + PubMed + + + 4339951 + PubMed + + + 9261083 + PubMed + + + AA0221 + RESID + + + 50#H + UniMod + + + From DeltaMass: Average Mass: 784 + PSI-MOD-slim + + (S)-2-amino-3-(1-[8alpha riboflavin 5'-(trihydrogen diphosphate) 5'->5'-ester with adenosine]imidazol-4-yl)propanoic acid + RESID-systematic + + + 1'-(8alpha-FAD)-L-histidine + RESID-name + + + 8alpha-(N(epsilon)-histidyl)FAD + RESID-alternate + + + 8alpha-(N1'-histidyl)FAD + RESID-alternate + + + 8alpha-N3-histidyl FAD + RESID-misnomer + + + FAD + PSI-MS-label + + + Flavin adenine dinucleotide + UniMod-description + + + MOD_RES Tele-8alpha-FAD histidine + UniProt-feature + + + N theta and N pi-(8alpha-Flavin) (on Histidine) + DeltaMass-label + + + N(tau)-(8alpha-FAD)-histidine + RESID-alternate + + + Nt8aFADHis + PSI-MOD-label + + + tele-(8alpha-FAD)-histidine + RESID-alternate + + + + DiffAvg + 783.54 + + + + DiffFormula + C 27 H 31 N 9 O 15 P 2 + + + + DiffMono + 783.141485 + + + + Formula + C 33 H 38 N 12 O 16 P 2 + + + + MassAvg + 920.68 + + + + MassMono + 920.200396 + + + + Origin + H + + + + Source + natural + + + + TermSpec + none + + MOD:00895 + MOD:00909 + PSI-MOD + + + MOD:00227 + omega-N-phospho-L-arginine + + A protein modification that effectively converts an L-arginine residue to omega-N-phospho-L-arginine. + + 8300603 + PubMed + + + AA0222 + RESID + + + 21#R + UniMod + + + PSI-MOD-slim + + (2S)-2-amino-5-([amino(phosphonoamino)methylidene]amino)pentanoic acid + RESID-systematic + + + (2S)-2-amino-5-(N'-phosphonocarbamimidamido)pentanoic acid + RESID-alternate + + + alpha-amino-delta-phosphonoguanidinovaleric acid + RESID-alternate + + + MOD_RES Phosphoarginine + UniProt-feature + + + N(gamma)-phosphoarginine + RESID-alternate + + + N(omega)-phosphono-L-arginine + RESID-alternate + + + N5-[imino(phosphonoamino)methyl]-L-ornithine + RESID-alternate + + + omega-N-phospho-L-arginine + RESID-name + + + PArg + PSI-MOD-label + + + Phospho + PSI-MS-label + + + phosphoarginine + RESID-alternate + + + Phosphorylation + UniMod-description + + + + DiffAvg + 79.98 + + + + DiffFormula + C 0 H 1 N 0 O 3 P 1 + + + + DiffMono + 79.966331 + + + + Formula + C 6 H 13 N 4 O 4 P 1 + + + + MassAvg + 236.17 + + + + MassMono + 236.067442 + + + + Origin + R + + + + Source + natural + + + + TermSpec + none + + MOD:00902 + MOD:01456 + PSI-MOD + + + MOD:00228 + S-diphytanylglycerol diether-L-cysteine + + A protein modification that effectively converts an L-cysteine residue to S-diphytanylglycerol diether-L-cysteine. + + 7797461 + PubMed + + + 8195126 + PubMed + + + AA0223 + RESID + + + 410 + UniMod + + + incidental to RESID:AA0043. + PSI-MOD-slim + + (2R)-2-amino-3-([(2S)-2,3-bis(3,7,11,15-tetramethylhexadecanyloxy)propyl]sulfanyl)propanoic acid + RESID-systematic + + + Archaeol + PSI-MS-label + + + LIPID S-archaeol cysteine + UniProt-feature + + + S-(diphytanylglyceryl)-L-cysteine + RESID-name + + + S-[2',3'-bis(phytanyloxy)propyl]cysteine + RESID-alternate + + + S-archaeol cysteine + RESID-alternate + + + S-diphytanylglycerol diether + UniMod-description + + + SPhyt2GlyceroCys + PSI-MOD-label + + + + DiffAvg + 635.16 + + + + DiffFormula + C 43 H 86 N 0 O 2 S 0 + + + + DiffMono + 634.662782 + + + + Formula + C 46 H 91 N 1 O 3 S 1 + + + + MassAvg + 738.30 + + + + MassMono + 737.671967 + + + + Origin + C + + + + Source + natural + + + + TermSpec + none + + MOD:00905 + MOD:01155 + PSI-MOD + + + MOD:00229 + alpha-1-microglobulin-Ig alpha complex chromophore + + A protein modification that effectively converts two L-cysteine residues to form alpha-1-microglobulin-Ig alpha complex chromophore. + + 11058759 + PubMed + + + 11877257 + PubMed + + + 7506257 + PubMed + + + 7535251 + PubMed + + + AA0224 + RESID + + + Cross-link 2. + + alpha-1-microglobulin-Ig alpha complex chromophore + RESID-name + + + BINDING Multimeric 3-hydroxykynurenine chromophore (covalent) + UniProt-feature + + + + DiffAvg + -2.02 + + + + DiffFormula + C 0 H -2 N 0 O 0 S 0 + + + + DiffMono + -2.015650 + + + + Formula + C 6 H 8 N 2 O 2 S 2 + + + + MassAvg + 204.26 + + + + MassMono + 204.002720 + + + + Origin + C, C + + + + Source + natural + + + + TermSpec + none + + MOD:00905 + PSI-MOD + + + MOD:00230 + bis-L-cysteinyl bis-L-histidino diiron disulfide + + A protein modification that effectively converts two L-cysteine residues, two L-histidine residues and a two-iron two-sulfur cluster to bis-L-cysteinyl bis-L-histidino diiron disulfide. + + 2765515 + PubMed + + + 9651245 + PubMed + + + AA0225 + RESID + + + Cross-link 4. + + bis-L-cysteinyl bis-L-histidino diiron disulfide + RESID-name + + + di-mu-sulfido(bis-S-cysteinyliron)(bis-N3'-histidinoiron) + RESID-systematic + + + METAL Iron-sulfur (2Fe-2S) + UniProt-feature + + + METAL Iron-sulfur (2Fe-2S); via pros nitrogen + UniProt-feature + + + Rieske iron-sulfur cofactor + RESID-alternate + + + + DiffAvg + 171.78 + + + + DiffFormula + C 0 Fe 2 H -4 N 0 O 0 S 2 + + + + DiffMono + 171.783814 + + + + FormalCharge + 2- + + + + Formula + C 18 Fe 2 H 20 N 8 O 4 S 4 + + + + MassAvg + 652.34 + + + + MassMono + 651.920007 + + + + Origin + C, C, H, H + + + + Source + natural + + + + TermSpec + none + + MOD:00739 + MOD:00905 + MOD:00909 + PSI-MOD + + + MOD:00231 + hexakis-L-cysteinyl hexairon hexasulfide + + A protein modification that effectively converts six L-cysteine residues and a six-iron six-sulfur cluster to hexakis-L-cysteinyl hexairon hexasulfide. + + 1311311 + PubMed + + + 1318833 + PubMed + + + AA0226 + RESID + + + Cross-link 6. This is a deprecated entry in RESID. It probably does not occur naturally [JSG]. + + hexa-mu3-sulfido-hexakis(cysteinato-kappaS)-hexairon + RESID-systematic + + + hexa-mu3-sulfido-hexakis(S-cysteinyliron) + RESID-alternate + + + hexakis-L-cysteinyl hexairon hexasulfide + RESID-name + + + prismane iron-sulfur cofactor + RESID-alternate + + + + DiffAvg + 521.38 + + + + DiffFormula + C 0 Fe 6 H -6 N 0 O 0 S 6 + + + + DiffMono + 521.395649 + + + + FormalCharge + 1- + + + + Formula + C 18 Fe 6 H 24 N 6 O 6 S 12 + + + + MassAvg + 1140.22 + + + + MassMono + 1139.450758 + + + + Origin + C, C, C, C, C, C + + + + Source + hypothetical + + + + TermSpec + none + + MOD:00739 + MOD:00905 + PSI-MOD + + + MOD:00232 + N6-(phospho-5'-adenosine)-L-lysine + + A protein modification that effectively crosslinks an L-lysine residue and 5'-phosphoadenosine through a phosphoramide ester bond to form N6-(phospho-5'-adenosine)-L-lysine. + + 316 + DeltaMass + + + 3882425 + PubMed + + + 4944632 + PubMed + + + AA0227 + RESID + + + 405#K + UniMod + + + PSI-MOD-slim + + (2S)-2-amino-6-(5'-adenosine phosphonamino)hexanoic acid + RESID-systematic + + + 5'-adenylic-N6-L-lysine + RESID-alternate + + + ACT_SITE N6-AMP-lysine intermediate + UniProt-feature + + + AMP binding site + UniMod-description + + + AMP Lysyl + DeltaMass-label + + + epsilon-5'-adenylic-L-lysine + RESID-alternate + + + L-lysine monoanhydride with 5'-adenylic acid + RESID-alternate + + + N(zeta)-5'-adenylic-L-lysine + RESID-alternate + + + N6-(phospho-5'-adenosine)-L-lysine + RESID-name + + + N6-L-lysine 5'-adenosine phosphoramidester + RESID-alternate + + + N6AMPLys + PSI-MOD-label + + + Phosphoadenosine + PSI-MS-label + + + + DiffAvg + 329.21 + + + + DiffFormula + C 10 H 12 N 5 O 6 P 1 + + + + DiffMono + 329.052520 + + + + Formula + C 16 H 24 N 7 O 7 P 1 + + + + MassAvg + 457.38 + + + + MassMono + 457.147483 + + + + Origin + K + + + + Source + natural + + + + TermSpec + none + + MOD:00912 + MOD:01165 + PSI-MOD + + + MOD:00233 + N6-(phospho-5'-guanosine)-L-lysine + + A protein modification that effectively crosslinks an L-lysine residue and 5'-phosphoguanosine through a phosphoramide ester bond to form N6-(phospho-5'-guanosine)-L-lysine. + + 304 + DeltaMass + + + 6092377 + PubMed + + + 6264433 + PubMed + + + AA0228 + RESID + + + 413#K + UniMod + + + From DeltaMass: Average Mass: 345 Formula:C10H12O5N7P1 Monoisotopic Mass Change:345.047 Average Mass Change:345.209 References:PE Sciex + PSI-MOD-slim + + (2S)-2-amino-6-(5'-guanosine phosphonamino)hexanoic acid + RESID-systematic + + + 5'-guanylic-N6-L-lysine + RESID-alternate + + + 5'phos Guanosyl + DeltaMass-label + + + ACT_SITE N6-GMP-lysine intermediate + UniProt-feature + + + epsilon-5'-guanylic-L-lysine + RESID-alternate + + + L-lysine monoanhydride with 5'-guanylic acid + RESID-alternate + + + lysine guanosine-5'-monophosphate + RESID-alternate + + + N(zeta)-5'-guanylic-lysine + RESID-alternate + + + N6-(5'-guanylyl)-lysine + RESID-alternate + + + N6-(phospho-5'-guanosine)-L-lysine + RESID-name + + + N6-L-lysine 5'-guanosine phosphoramidester + RESID-alternate + + + N6GMPLys + PSI-MOD-label + + + phospho-guanosine + UniMod-description + + + Phosphoguanosine + PSI-MS-label + + + + DiffAvg + 345.21 + + + + DiffFormula + C 10 H 12 N 5 O 7 P 1 + + + + DiffMono + 345.047434 + + + + Formula + C 16 H 24 N 7 O 8 P 1 + + + + MassAvg + 473.38 + + + + MassMono + 473.142397 + + + + Origin + K + + + + Source + natural + + + + TermSpec + none + + MOD:00912 + MOD:01163 + PSI-MOD + + + MOD:00234 + L-cysteine glutathione disulfide + + A protein modification that effectively converts an L-cysteine residue to S-glutathionyl-L-cysteine. + + 21264 + ChEBI + + + 0 + DeltaMass + + + 3083866 + PubMed + + + 8344916 + PubMed + + + AA0229 + RESID + + + 55 + UniMod + + + From DeltaMass: Average Mass: 305 + PSI-MOD-slim + + (2S)-2-amino-3-((2S)-2-((4R)-4-amino-4-carboxyl-1-oxobutyl)amino-3-(carboxylmethyl)amino-3-oxo-propyl)dithio-propanoic acid + RESID-systematic + + + cysteinyl glutathione + RESID-alternate + + + Glutathionation + DeltaMass-label + + + Glutathione + PSI-MS-label + + + glutathione disulfide + UniMod-description + + + glutathionec + OMSSA-label + + + L-cysteine glutathione disulfide + RESID-name + + + L-gamma-glutamyl-L-cysteinyl-glycine (2-1')-disulfide with L-cysteine + RESID-alternate + + + MOD_RES S-glutathionyl cysteine + UniProt-feature + + + N-(N-gamma-glutamyl-cystinyl)-glycine + RESID-alternate + + + SGltCys + PSI-MOD-label + + + + DiffAvg + 305.30 + + + + DiffFormula + C 10 H 15 N 3 O 6 S 1 + + + + DiffMono + 305.068156 + + + + Formula + C 13 H 20 N 4 O 7 S 2 + + + + MassAvg + 408.44 + + + + MassMono + 408.077341 + + + + Origin + C + + + + Source + natural + + + + TermSpec + none + + MOD:00905 + MOD:01862 + PSI-MOD + + + MOD:00235 + S-nitrosyl-L-cysteine + + A protein modification that effectively converts an L-cysteine residue to S-nitrosyl-L-cysteine. + + 10442087 + PubMed + + + 11562475 + PubMed + + + 15688001 + PubMed + + + 8626764 + PubMed + + + 8637569 + PubMed + + + AA0230 + RESID + + + 275 + UniMod + + + PSI-MOD-slim + + (2R)-2-amino-3-nitrososulfanyl-propanoic acid + RESID-systematic + + + L-cysteine nitrite ester + RESID-alternate + + + MOD_RES S-nitrosocysteine + UniProt-feature + + + Nitrosyl + PSI-MS-label + + + S-nitrosocysteine + RESID-alternate + + + S-nitrosyl-L-cysteine + RESID-name + + + S-nitrosylation + UniMod-description + + + SNOCys + PSI-MOD-label + + + + DiffAvg + 29.00 + + + + DiffFormula + C 0 H -1 N 1 O 1 S 0 + + + + DiffMono + 28.990164 + + + + Formula + C 3 H 4 N 2 O 2 S 1 + + + + MassAvg + 132.14 + + + + MassMono + 131.999348 + + + + Origin + C + + + + Source + natural + + + + TermSpec + none + + MOD:00905 + PSI-MOD + + + MOD:00236 + N4-(ADP-ribosyl)-L-asparagine + + A protein modification that effectively converts an L-asparagine residue to N4-(ADP-ribosyl)-L-asparagine. + + 15842200 + PubMed + + + 2498316 + PubMed + + + AA0231 + RESID + + + 213#N + UniMod + + + + (S)-2-amino-4-([adenosine 5'-(trihydrogen diphosphate) 5'->5'-ester with alpha-D-ribofuranosyl]amino)-4-oxobutanoic acid + RESID-systematic + + + ADP Ribose addition + UniMod-description + + + ADP-Ribosyl + PSI-MS-label + + + MOD_RES ADP-ribosylasparagine + UniProt-feature + + + N4-(ADP-ribosyl)-L-asparagine + RESID-name + + + N4-[alpha-D-ribofuranoside 5'->5'-ester with adenosine 5'-(trihydrogen diphosphate)]-L-asparagine + RESID-alternate + + + N4-alpha-D-ribofuranosyl-L-asparagine 5'->5'-ester with adenosine 5'-(trihydrogen diphosphate) + RESID-alternate + + + + DiffAvg + 541.30 + + + + DiffFormula + C 15 H 21 N 5 O 13 P 2 + + + + DiffMono + 541.061109 + + + + Formula + C 19 H 27 N 7 O 15 P 2 + + + + MassAvg + 655.41 + + + + MassMono + 655.104036 + + + + Origin + N + + + + Source + natural + + + + TermSpec + none + + MOD:00752 + MOD:00903 + PSI-MOD + + + MOD:00237 + L-beta-methylthioaspartic acid + + A protein modification that effectively converts an L-aspartic acid residue to L-beta-methylthioaspartic acid. + + 61 + DeltaMass + + + 15473684 + PubMed + + + 8844851 + PubMed + + + AA0232 + RESID + + + 39#D + UniMod + + + PSI-MOD-slim + + (2R,3Xi)-2-amino-3-(methylsulfanyl)butanedioic acid + RESID-systematic + + + 3-(methylthio)-L-aspartic acid + RESID-name + + + 3-carboxy-S-methyl-cysteine + RESID-alternate + + + 3-methylthio-aspartic acid + RESID-alternate + + + 3MeSAsp + PSI-MOD-label + + + beta-Methylthio-aspartic acid + DeltaMass-label + + + beta-methylthio-aspartic acid + RESID-alternate + + + Beta-methylthiolation + UniMod-description + + + bmethylthiold + OMSSA-label + + + Methylthio + UniMod-interim + + + methythiold + OMSSA-label + + + MOD_RES 3-methylthioaspartic acid + UniProt-feature + + + + DiffAvg + 46.09 + + + + DiffFormula + C 1 H 2 N 0 O 0 S 1 + + + + DiffMono + 45.987721 + + + + Formula + C 5 H 7 N 1 O 3 S 1 + + + + MassAvg + 161.18 + + + + MassMono + 161.014664 + + + + Origin + D + + + + Source + natural + + + + TermSpec + none + + MOD:00904 + MOD:01153 + PSI-MOD + + + MOD:00238 + 5'-(N6-L-lysine)-L-topaquinone + + A protein modification that effectively cross-links an L-lysine residue and an L-tyrosine residue by a carbon-nitrogen bond to form 5'-(N6-L-lysine)-L-topaquinone. + + 8688089 + PubMed + + + AA0233 + RESID + + + Cross-link 2; secondary to RESID:AA0147. + + 1-[(S)-5-amino-5-carboxypentyl]amino-2-[(S)-2-amino-2-carboxyethyl]-2,6-cyclohexadien-4,5-dione + RESID-systematic + + + 2'-(L-lys-N6-yl)-L-4',5'-topaquinone + RESID-name + + + 2'-(L-lysine)-L-tyrosyl-4',5'-quinone + RESID-alternate + + + CROSSLNK Lysine tyrosylquinone (Lys-Tyr) + UniProt-feature + + + CROSSLNK Lysine tyrosylquinone (Tyr-Lys) + UniProt-feature + + + LTQ + RESID-alternate + + + lysyl oxidase cofactor + RESID-alternate + + + + DiffAvg + 11.97 + + + + DiffFormula + C 0 H -4 N 0 O 1 + + + + DiffMono + 11.963614 + + + + Formula + C 15 H 17 N 3 O 4 + + + + MassAvg + 303.32 + + + + MassMono + 303.121906 + + + + Origin + K, Y + + + + Source + natural + + + + TermSpec + none + + MOD:00692 + MOD:00912 + MOD:00919 + PSI-MOD + + + MOD:00239 + S-methyl-L-cysteine + + A protein modification that effectively converts an L-cysteine residue to S-methyl-L-cysteine. + + 10660523 + PubMed + + + 11875433 + PubMed + + + 1339288 + PubMed + + + AA0234 + RESID + + + 34#C + UniMod + + + PSI-MOD-slim + + (R)-2-amino-3-(methylsulfanyl)propanoic acid + RESID-systematic + + + ACT_SITE S-methylcysteine intermediate + UniProt-feature + + + L-3-(methylthio)alanine + RESID-alternate + + + Methyl + PSI-MS-label + + + Methylation + UniMod-description + + + MOD_RES S-methylcysteine + UniProt-feature + + + S-methyl-L-cysteine + RESID-name + + + S-methylated L-cysteine + PSI-MOD-alternate + + + SMeCys + PSI-MOD-label + + + + DiffAvg + 14.03 + + + + DiffFormula + C 1 H 2 N 0 O 0 S 0 + + + + DiffMono + 14.015650 + + + + Formula + C 4 H 7 N 1 O 1 S 1 + + + + MassAvg + 117.17 + + + + MassMono + 117.024835 + + + + Origin + C + + + + Source + natural + + + + TermSpec + none + + MOD:00654 + MOD:01682 + PSI-MOD + + + MOD:00240 + 4-hydroxy-L-lysine + + A protein modification that effectively converts an L-lysine residue to 4-hydroxy-L-lysine. + + 4005040 + PubMed + + + AA0235 + RESID + + + This modification was not structurally confirmed. Later 5-hydroxy-L-lysine was found at a homologous position in the same protein from closely related species. This is a deprecated entry in RESID. It probably does not occur naturally [JSG]. + + (2S,4R)-2,6-diamino-4-hydroxyhexanoic acid + RESID-systematic + + + 4-hydroxy-L-lysine + RESID-name + + + 4-hydroxylated L-lysine + PSI-MOD-alternate + + + 4HyLys + PSI-MOD-label + + + alpha,epsilon-diamino-gamma-hydroxycaproic acid + RESID-alternate + + + L-threo-gamma-hydroxylysine + RESID-alternate + + + + DiffAvg + 16.00 + + + + DiffFormula + C 0 H 0 N 0 O 1 + + + + DiffMono + 15.994915 + + + + Formula + C 6 H 12 N 2 O 2 + + + + MassAvg + 144.17 + + + + MassMono + 144.089878 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:01047 + PSI-MOD + + + MOD:00241 + N4-hydroxymethyl-L-asparagine + + A protein modification that effectively converts an L-asparagine residue to N4-hydroxymethyl-L-asparagine. + + AA0236 + RESID + + + 414 + UniMod + + + N4-methyl-L-asparagine, see MOD:0079, was found at a homologous position of the same protein in a closely related species. Since the peptide containing this modification was obtained by enzymatic cleavage, not cyanogen bromide cleavage, it could have experienced oxidation of the following methionine residue, leading to the erroneous attribution of a mass of 29 for the modification rather than 14. comment: This is a deprecated entry in RESID. It probably does not occur naturally [JSG]. + + (2S)-2-amino-4-[(hydroxymethyl)amino]-4-oxobutanoic acid + RESID-systematic + + + 2-amino-N4-hydroxymethylbutanediamic acid + RESID-alternate + + + beta-hydroxymethylasparagine + RESID-alternate + + + Hydroxymethyl + PSI-MS-label + + + hydroxymethyl + UniMod-description + + + N(gamma)-hydroxymethylasparagine + RESID-alternate + + + N4-hydroxymethyl-L-asparagine + RESID-name + + + N4-hydroxymethylasparagine + RESID-alternate + + + + DiffAvg + 30.03 + + + + DiffFormula + C 1 H 2 N 0 O 1 + + + + DiffMono + 30.010565 + + + + Formula + C 5 H 8 N 2 O 3 + + + + MassAvg + 144.13 + + + + MassMono + 144.053492 + + + + Origin + N + + + + Source + artifact + + + + TermSpec + none + + MOD:00903 + PSI-MOD + + + MOD:00242 + O-(ADP-ribosyl)-L-serine + + A protein modification that effectively converts an L-serine residue to O-(ADP-ribosyl)-L-serine. + + 15842200 + PubMed + + + 3141412 + PubMed + + + AA0237 + RESID + + + 213#S + UniMod + + + PSI-MOD-slim + + (S)-2-amino-3-([adenosine 5'-(trihydrogen diphosphate) 5'->5'-ester with alpha-D-ribofuranosyl]oxy)-propanoic acid + RESID-systematic + + + ADP Ribose addition + UniMod-description + + + ADP-Ribosyl + PSI-MS-label + + + MOD_RES ADP-ribosylserine + UniProt-feature + + + O-(ADP-ribosyl)-L-serine + RESID-name + + + O3-(ADP-ribosyl)-L-serine + RESID-alternate + + + O3-[alpha-D-ribofuranoside 5'->5'-ester with adenosine 5'-(trihydrogen diphosphate)]-L-serine + RESID-alternate + + + O3-alpha-D-ribofuranosyl-L-serine 5'->5'-ester with adenosine 5'-(trihydrogen diphosphate) + RESID-alternate + + + OADPRibSer + PSI-MOD-label + + + + DiffAvg + 541.30 + + + + DiffFormula + C 15 H 21 N 5 O 13 P 2 + + + + DiffMono + 541.061109 + + + + Formula + C 18 H 26 N 6 O 15 P 2 + + + + MassAvg + 628.38 + + + + MassMono + 628.093137 + + + + Origin + S + + + + Source + natural + + + + TermSpec + none + + MOD:00752 + MOD:00916 + PSI-MOD + + + MOD:00243 + L-cysteine oxazole-4-carboxylic acid + + A protein modification that effectively crosslinks an L-cysteine residue and an L-serine residue to form L-cysteine oxazole-4-carboxylic acid. + + 8183941 + PubMed + + + 8895467 + PubMed + + + AA0238 + RESID + + + Cross-link 2. + + 2-(1-azanyl-2-sulfanylethyl)-4-oxazolecarboxylic acid + RESID-alternate + + + 2-[(1R)-1-amino-2-sulfanylethyl]-1,3-oxazole-4-carboxylic acid + RESID-systematic + + + CROSSLNK Oxazole-4-carboxylic acid (Cys-Ser) + UniProt-feature + + + L-cysteine oxazole-4-carboxylic acid + RESID-name + + + + DiffAvg + -20.03 + + + + DiffFormula + C 0 H -4 N 0 O -1 S 0 + + + + DiffMono + -20.026215 + + + + Formula + C 6 H 6 N 2 O 2 S 1 + + + + MassAvg + 170.19 + + + + MassMono + 170.014998 + + + + Origin + C, S + + + + Source + natural + + + + TermSpec + none + + MOD:00905 + MOD:01421 + MOD:01888 + PSI-MOD + + + MOD:00244 + L-cysteine oxazoline-4-carboxylic acid + + A protein modification that effectively crosslinks an L-cysteine residue and an L-serine residue to form L-cysteine oxazoline-4-carboxylic acid. + + 1880060 + PubMed + + + AA0239 + RESID + + + Cross-link 2. + + (4S)-2-[(1R)-1-amino-2-sulfanylethyl]-4,5-dihydro-1,3-oxazole-4-carboxylic acid + RESID-systematic + + + 2-[1-azanyl-2-sulfanylethyl]-4,5-dihydro-1,3-oxazole-4-carboxylic acid + RESID-alternate + + + CROSSLNK Oxazoline-4-carboxylic acid (Cys-Ser) + UniProt-feature + + + L-cysteine oxazoline-4-carboxylic acid + RESID-name + + + + DiffAvg + -18.02 + + + + DiffFormula + C 0 H -2 N 0 O -1 S 0 + + + + DiffMono + -18.010565 + + + + Formula + C 6 H 8 N 2 O 2 S 1 + + + + MassAvg + 172.20 + + + + MassMono + 172.030649 + + + + Origin + C, S + + + + Source + natural + + + + TermSpec + none + + MOD:00905 + MOD:01421 + PSI-MOD + + + MOD:00245 + glycine oxazole-4-carboxylic acid + + A protein modification that effectively crosslinks a glycine residue and an L-serine residue to form glycine oxazole-4-carboxylic acid. + + 8183941 + PubMed + + + 8895467 + PubMed + + + AA0240 + RESID + + + Cross-link 2. + + 2-aminomethyl-1,3-oxazole-4-carboxylic acid + RESID-systematic + + + 2-azanylmethyl-1,3-oxazole-4-carboxylic acid + RESID-alternate + + + CROSSLNK Oxazole-4-carboxylic acid (Gly-Ser) + UniProt-feature + + + glycine oxazole-4-carboxylic acid + RESID-name + + + + DiffAvg + -20.03 + + + + DiffFormula + C 0 H -4 N 0 O -1 + + + + DiffMono + -20.026215 + + + + Formula + C 5 H 4 N 2 O 2 + + + + MassAvg + 124.10 + + + + MassMono + 124.027277 + + + + Origin + G, S + + + + Source + natural + + + + TermSpec + none + + MOD:00908 + MOD:01421 + MOD:01888 + PSI-MOD + + + MOD:00246 + glycine thiazole-4-carboxylic acid + + A protein modification that effectively crosslinks an L-cysteine residue and a glycine residue to form glycine thiazole-4-carboxylic acid. + + 21276 + ChEBI + + + 8183941 + PubMed + + + 8895467 + PubMed + + + AA0241 + RESID + + + Cross-link 2. + + 2-(aminomethyl)-1,3-thiazole-4-carboxylic acid + RESID-systematic + + + 2-(azanylmethyl)-1,3-thiazole-4-carboxylic acid + RESID-alternate + + + CROSSLNK Thiazole-4-carboxylic acid (Gly-Cys) + UniProt-feature + + + glycine thiazole-4-carboxylic acid + RESID-name + + + + DiffAvg + -20.03 + + + + DiffFormula + C 0 H -4 N 0 O -1 S 0 + + + + DiffMono + -20.026215 + + + + Formula + C 5 H 4 N 2 O 1 S 1 + + + + MassAvg + 140.16 + + + + MassMono + 140.004434 + + + + Origin + C, G + + + + Source + natural + + + + TermSpec + none + + MOD:00908 + MOD:01420 + MOD:01888 + PSI-MOD + + + MOD:00247 + L-serine thiazole-4-carboxylic acid + + A protein modification that effectively crosslinks an L-cysteine residue and an L-serine residue to form L-serine thiazole-4-carboxylic acid. + + 8183941 + PubMed + + + 8895467 + PubMed + + + AA0242 + RESID + + + Cross-link 2. + + 2-[(1S)-1-amino-2-hydroxyethyl]-1,3-thiazole-4-carboxylic acid + RESID-systematic + + + 2-[1-azanyl-2-hydroxyethyl]-1,3-thiazole-4-carboxylic acid + RESID-alternate + + + CROSSLNK Thiazole-4-carboxylic acid (Ser-Cys) + UniProt-feature + + + L-serine thiazole-4-carboxylic acid + RESID-name + + + + DiffAvg + -20.03 + + + + DiffFormula + C 0 H -4 N 0 O -1 S 0 + + + + DiffMono + -20.026215 + + + + Formula + C 6 H 6 N 2 O 2 S 1 + + + + MassAvg + 170.19 + + + + MassMono + 170.014998 + + + + Origin + C, S + + + + Source + natural + + + + TermSpec + none + + MOD:00916 + MOD:01420 + MOD:01888 + PSI-MOD + + + MOD:00248 + L-phenylalanine thiazole-4-carboxylic acid + + A protein modification that effectively crosslinks an L-cysteine residue and an L-phenylalanine residue to form L-phenylalanine thiazole-4-carboxylic acid. + + 1880060 + PubMed + + + AA0243 + RESID + + + Cross-link 2. + + 2-[(1S)-1-amino-2-phenylethyl]-1,3-thiazole-4-carboxylic acid + RESID-systematic + + + 2-[1-azanyl-2-phenylethyl]-1,3-thiazole-4-carboxylic acid + RESID-alternate + + + CROSSLNK Thiazole-4-carboxylic acid (Phe-Cys) + UniProt-feature + + + L-phenylalanine thiazole-4-carboxylic acid + RESID-name + + + + DiffAvg + -20.03 + + + + DiffFormula + C 0 H -4 N 0 O -1 S 0 + + + + DiffMono + -20.026215 + + + + Formula + C 12 H 10 N 2 O 1 S 1 + + + + MassAvg + 230.29 + + + + MassMono + 230.051384 + + + + Origin + C, F + + + + Source + natural + + + + TermSpec + none + + MOD:00914 + MOD:01420 + MOD:01888 + PSI-MOD + + + MOD:00249 + L-cysteine thiazole-4-carboxylic acid + + A protein modification that effectively crosslinks two L-cysteine residues to form L-cysteine thiazole-4-carboxylic acid. + + 1880060 + PubMed + + + AA0244 + RESID + + + Cross-link 2. + + 2-[(1S)-1-amino-2-sulfanylethyl]-1,3-thiazole-4-carboxylic acid + RESID-systematic + + + 2-[1-azanyl-2-sulfanylethyl]-1,3-thiazole-4-carboxylic acid + RESID-alternate + + + CROSSLNK Thiazole-4-carboxylic acid (Cys-Cys) + UniProt-feature + + + L-cysteine thiazole-4-carboxylic acid + RESID-name + + + + DiffAvg + -20.03 + + + + DiffFormula + C 0 H -4 N 0 O -1 S 0 + + + + DiffMono + -20.026215 + + + + Formula + C 6 H 6 N 2 O 1 S 2 + + + + MassAvg + 186.25 + + + + MassMono + 185.992155 + + + + Origin + C, C + + + + Source + natural + + + + TermSpec + none + + MOD:01420 + MOD:01888 + PSI-MOD + + + MOD:00250 + L-lysine thiazole-4-carboxylic acid + + A protein modification that effectively crosslinks an L-cysteine residue and an L-lysine residue to form L-lysine thiazole-4-carboxylic acid. + + 1880060 + PubMed + + + AA0245 + RESID + + + Cross-link 2. Lysine is now thought not to be encoded in the peptide sequence modified to produce GE2270. See RESID:AA0470. This is a deprecated entry in RESID. It probably does not occur naturally [JSG]. + + 2-[(1S)-1,5-diaminopentyl]-1,3-thiazole-4-carboxylic acid + RESID-systematic + + + 2-[1,5-bis(azanyl)pentyl]-1,3-thiazole-4-carboxylic acid + RESID-alternate + + + L-lysine thiazole-4-carboxylic acid + RESID-name + + + + DiffAvg + -20.03 + + + + DiffFormula + C 0 H -4 N 0 O -1 S 0 + + + + DiffMono + -20.026215 + + + + Formula + C 9 H 13 N 3 O 1 S 1 + + + + MassAvg + 211.28 + + + + MassMono + 211.077933 + + + + Origin + C, K + + + + Source + hypothetical + + + + TermSpec + none + + MOD:00912 + MOD:01420 + MOD:01888 + PSI-MOD + + + MOD:00251 + O-(phospho-5'-DNA)-L-serine + + A protein modification that effectively crosslinks an L-serine residue and the 5'-end of DNA through a phosphodiester bond to form O-(phospho-5'-DNA)-L-serine. + + 7142163 + PubMed + + + 7265205 + PubMed + + + AA0246 + RESID + + + + (S)-2-amino-3-(5'-deoxyribonucleic acid phosphonoxy)propanoic acid + RESID-systematic + + + ACT_SITE O-(5'-phospho-DNA)-serine intermediate + UniProt-feature + + + MOD_RES O-(5'-phospho-DNA)-serine + UniProt-feature + + + O-(phospho-5'-DNA)-L-serine + RESID-name + + + O3-(phospho-5'-DNA)-L-serine + RESID-alternate + + + O3-L-serine 5'-DNA phosphodiester + RESID-alternate + + + + DiffAvg + 78.97 + + + + DiffFormula + C 0 H 0 N 0 O 3 P 1 + + + + DiffMono + 78.958505 + + + + Formula + C 3 H 5 N 1 O 5 P 1 + + + + MassAvg + 166.05 + + + + MassMono + 165.990534 + + + + Origin + S + + + + Source + natural + + + + TermSpec + none + + MOD:00750 + MOD:00916 + PSI-MOD + + + MOD:00252 + keratan sulfate D-glucuronosyl-D-galactosyl-D-galactosyl-D-xylosyl-L-threonine + + A protein modification that effectively cross-links an L-threonine residue to the polymer keratan sulfate by a D-glucuronosyl-D-galactosyl-D-galactosyl-D-xylosyl tetrasaccharide. + + 1417734 + PubMed + + + 3472204 + PubMed + + + AA0247 + RESID + + + + keratan sulfate D-glucuronosyl-D-galactosyl-D-galactosyl-D-xylosyl-L-threonine + RESID-name + + + keratosulfate + RESID-alternate + + + poly[beta-1,4-(2-acetamido-2-deoxy-6-sulfate D-glucosyl)-beta-1,3-D-galactosyl]-beta-1,4-D-glucopyranuronosyl-beta-1,3-D-galactosyl-beta-1,3-D-galactosyl-beta-1,4-D-xylosyl-beta-1,3-L-threonine + RESID-systematic + + + + DiffAvg + -1.01 + + + + DiffFormula + C 0 H -1 N 0 O 0 + + + + DiffMono + -1.007825 + + + + Formula + C 4 H 6 N 1 O 2 + + + + MassAvg + 100.10 + + + + MassMono + 100.039853 + + + + Origin + T + + + + Source + natural + + + + TermSpec + none + + MOD:00005 + PSI-MOD + + + MOD:00253 + L-selenocysteinyl molybdenum bis(molybdopterin guanine dinucleotide) (Sec) + + A protein modification that effectively converts an L-selenocysteine residue to L-selenocysteinyl molybdenum bis(molybdopterin guanine dinucleotide). + + 14235557 + PubMed + + + 2211698 + PubMed + + + 8052647 + PubMed + + + 9036855 + PubMed + + + AA0248#SEC + RESID + + + 415 + UniMod + + + + + DiffAvg + 1572.02 + + + + DiffFormula + C 40 H 47 Mo 1 N 20 O 26 P 4 S 4 Se 0 + + + + DiffMono + 1572.985775 + + + + Formula + C 43 H 52 Mo 1 N 21 O 27 P 4 S 4 Se 1 + + + + MassAvg + 1722.07 + + + + MassMono + 1723.939410 + + + + Origin + U + + + + Source + natural + + + + TermSpec + none + + MOD:00744 + MOD:01158 + PSI-MOD + + + MOD:00254 + O4'-(phospho-5'-RNA)-L-tyrosine + + A protein modification that effectively crosslinks an L-tyrosine residue and the 5'-end of RNA through a phosphodiester to form O4'-(phospho-5'-RNA)-L-tyrosine. + + 1702164 + PubMed + + + 209034 + PubMed + + + 217003 + PubMed + + + 6264310 + PubMed + + + AA0249 + RESID + + + + (S)-2-amino-3-[4-(5'-ribonucleic acid phosphonoxy)phenyl]propanoic acid + RESID-systematic + + + MOD_RES O-(5'-phospho-RNA)-tyrosine + UniProt-feature + + + O4'-(phospho-5'-RNA)-L-tyrosine + RESID-name + + + O4'-L-tyrosine 5'-RNA phosphodiester + RESID-alternate + + + + DiffAvg + 79.98 + + + + DiffFormula + C 0 H 1 N 0 O 3 P 1 + + + + DiffMono + 79.966331 + + + + Formula + C 9 H 10 N 1 O 5 P 1 + + + + MassAvg + 243.15 + + + + MassMono + 243.029659 + + + + Origin + Y + + + + Source + natural + + + + TermSpec + none + + MOD:00751 + MOD:00919 + PSI-MOD + + + MOD:00255 + 3-(3'-L-histidyl)-L-tyrosine + + A protein modification that effectively cross-links an L-histidine residue and an L-tyrosine residue by a carbon-nitrogen bond to form 3-(3'-L-histidyl)-L-tyrosine. + + 9144772 + PubMed + + + AA0250 + RESID + + + Cross-link 2. + + (2S,3R)-2-amino-3-(5-[(2S)-2-amino-2-carboxyethyl]-1H-imidazol-1-yl)-3-(4-hydroxyphenyl)propanoic acid + RESID-systematic + + + 3-(3'-L-histidyl)-L-tyrosine + RESID-name + + + 3-(N3'-histidyl)tyrosine + RESID-alternate + + + 3-(pi-histidyl)tyrosine + RESID-alternate + + + 3-(pros-histidyl)tyrosine + RESID-alternate + + + beta-(N(delta)-histidyl)tyrosine + RESID-alternate + + + beta-(N3'-histidyl)tyrosine + RESID-alternate + + + CROSSLNK 3'-histidyl-3-tyrosine (His-Tyr) + UniProt-feature + + + + DiffAvg + -2.02 + + + + DiffFormula + C 0 H -2 N 0 O 0 + + + + DiffMono + -2.015650 + + + + Formula + C 15 H 14 N 4 O 3 + + + + MassAvg + 298.30 + + + + MassMono + 298.106590 + + + + Origin + H, Y + + + + Source + natural + + + + TermSpec + none + + MOD:00692 + MOD:00909 + MOD:00919 + PSI-MOD + + + MOD:00256 + L-methionine sulfone + + A protein modification that dioxygenates an L-methionine residue to L-methionine sulfone. + + 205 + DeltaMass + + + 12686488 + PubMed + + + 7786407 + PubMed + + + 7791219 + PubMed + + + 9252331 + PubMed + + + AA0251 + RESID + + + 425#M + UniMod + + + DeltaMass gives the formula C 5 H 9 N 3 O 1 S 1 with mass 163 + PSI-MOD-slim + + (2S)-2-amino-4-(methylsulfonyl)butanoic acid + RESID-systematic + + + dihydroxy + UniMod-description + + + Dioxidation + PSI-MS-label + + + L-methionine S,S-dioxide + RESID-alternate + + + L-methionine sulfone + RESID-name + + + MethionylSulphone + DeltaMass-label + + + MetO2 + PSI-MOD-label + + + MOD_RES Methionine sulfone + UniProt-feature + + + Oxidation of Methionine (to Sulphone) + DeltaMass-label + + + S,S-dioxymethionine + RESID-alternate + + + suphonem + OMSSA-label + + + + DiffAvg + 32.00 + + + + DiffFormula + C 0 H 0 N 0 O 2 S 0 + + + + DiffMono + 31.989829 + + + + Formula + C 5 H 9 N 1 O 3 S 1 + + + + MassAvg + 163.19 + + + + MassMono + 163.030314 + + + + Origin + M + + + + Source + natural + + + + TermSpec + none + + MOD:00709 + MOD:01855 + PSI-MOD + + + MOD:00257 + dipyrrolylmethanemethyl-L-cysteine + + A protein modification that effectively converts an L-cysteine residue to dipyrrolylmethanemethyl-L-cysteine. + + 3042456 + PubMed + + + 3196304 + PubMed + + + 3421931 + PubMed + + + 8727319 + PubMed + + + AA0252 + RESID + + + 416 + UniMod + + + + (2S)-3-[5-[4-(2-carboxy)ethyl-3-carboxymethyl-1-pyrrol-2-yl]methyl-4-(2-carboxy)ethyl-3-carboxymethyl-1-pyrrol-2-yl]methylthio-2-aminopropanoic acid + RESID-systematic + + + 3-[5-(3-acetic acid-4-propanoic acid-1-pyrrol-2-yl)methyl-3-acetic acid-4-propanoic acid-1-pyrrol-2-yl]methylthio-2-aminopropanoic acid + RESID-alternate + + + dipyrrole cofactor + RESID-alternate + + + Dipyrrolylmethanemethyl + PSI-MS-label + + + dipyrrolylmethanemethyl + UniMod-description + + + dipyrrolylmethanemethyl-L-cysteine + RESID-name + + + dipyrrolylmethyl-L-cysteine + RESID-alternate + + + dipyrromethane cofactor + RESID-alternate + + + MOD_RES S-(dipyrrolylmethanemethyl)cysteine + UniProt-feature + + + pyrromethane cofactor + RESID-alternate + + + + DiffAvg + 418.40 + + + + DiffFormula + C 20 H 22 N 2 O 8 S 0 + + + + DiffMono + 418.137616 + + + + Formula + C 23 H 27 N 3 O 9 S 1 + + + + MassAvg + 521.54 + + + + MassMono + 521.146800 + + + + Origin + C + + + + Source + natural + + + + TermSpec + none + + MOD:00905 + PSI-MOD + + + MOD:00258 + S-(2-aminovinyl)-3-methyl-D-cysteine + + A protein modification that effectively cross-links an L-cysteine residue and an L-threonine residue by a thioether bond to form S-(2-aminovinyl)-3-methyl-D-cysteine. + + 9119018 + PubMed + + + AA0253 + RESID + + + Cross-link 2. + + (2S,3S)-2-amino-3-[((Z)-2-aminoethenyl)sulfanyl]butanoic acid + RESID-systematic + + + 2-amino-3-[(2-aminovinyl)sulfanyl]butanoic acid + RESID-alternate + + + CROSSLNK S-(2-aminovinyl)-3-methyl-D-cysteine (Thr-Cys) + UniProt-feature + + + decarboxylated methyllanthionine + RESID-alternate + + + S-(2-aminovinyl)-3-methyl-D-cysteine + RESID-name + + + + DiffAvg + -64.04 + + + + DiffFormula + C -1 H -4 N 0 O -3 S 0 + + + + DiffMono + -64.016044 + + + + Formula + C 6 H 9 N 2 O 1 S 1 + + + + MassAvg + 157.21 + + + + MassMono + 157.043559 + + + + Origin + C, T + + + + Source + natural + + + + TermSpec + C-term + + MOD:00687 + MOD:00917 + PSI-MOD + + + MOD:00259 + O4'-(phospho-5'-DNA)-L-tyrosine + + A protein modification that effectively crosslinks an L-tyrosine residue and the 5'-end of DNA through a phosphodiester bond to form O4'-(phospho-5'-DNA)-L-tyrosine. + + 1861973 + PubMed + + + 2940511 + PubMed + + + 3684578 + PubMed + + + AA0254 + RESID + + + + (S)-2-amino-3-[4-(5'-deoxyribonucleic acid phosphonoxy)phenyl]propanoic acid + RESID-systematic + + + ACT_SITE O-(5'-phospho-DNA)-tyrosine intermediate + UniProt-feature + + + MOD_RES O-(5'-phospho-DNA)-tyrosine + UniProt-feature + + + O4'-(phospho-5'-DNA)-L-tyrosine + RESID-name + + + O4'-L-tyrosine 5'-DNA phosphodiester + RESID-alternate + + + + DiffAvg + 79.98 + + + + DiffFormula + C 0 H 1 N 0 O 3 P 1 + + + + DiffMono + 79.966331 + + + + Formula + C 9 H 10 N 1 O 5 P 1 + + + + MassAvg + 243.15 + + + + MassMono + 243.029659 + + + + Origin + Y + + + + Source + natural + + + + TermSpec + none + + MOD:00750 + MOD:00919 + PSI-MOD + + + MOD:00260 + O-(phospho-5'-DNA)-L-threonine + + A protein modification that effectively crosslinks an L-threonine residue and the 5'-end of DNA through a phosphodiester bond to form O-(phospho-5'-DNA)-L-threonine. + + 3081736 + PubMed + + + AA0255 + RESID + + + + (S)-2-amino-3-(5'-deoxyribonucleic acid phosphonoxy)butanoic acid + RESID-systematic + + + O-(phospho-5'-DNA)-L-threonine + RESID-name + + + O3-(phospho-5'-DNA)-L-threonine + RESID-alternate + + + O3-L-threonine 5'-DNA phosphodiester + RESID-alternate + + + + DiffAvg + 78.97 + + + + DiffFormula + C 0 H 0 N 0 O 3 P 1 + + + + DiffMono + 78.958505 + + + + Formula + C 4 H 7 N 1 O 5 P 1 + + + + MassAvg + 180.08 + + + + MassMono + 180.006184 + + + + Origin + T + + + + Source + natural + + + + TermSpec + none + + MOD:00750 + MOD:00917 + PSI-MOD + + + MOD:00261 + O4'-(phospho-5'-uridine)-L-tyrosine + + A protein modification that effectively crosslinks an L-tyrosine residue and 5'-phosphouridine through a phosphodiester bond to form O4'-(phospho-5'-uridine)-L-tyrosine. + + 0 + DeltaMass + + + 11467524 + PubMed + + + 2885322 + PubMed + + + AA0256 + RESID + + + 417#Y + UniMod + + + From DeltaMass: Average Mass: 306. + PSI-MOD-slim + + (S)-2-amino-3-[4-(5'-uridine phosphonoxy)phenyl]propanoic acid + RESID-systematic + + + 5'-uridylic-O-tyrosine + RESID-alternate + + + hydrogen 5'-uridylate tyrosine ester + RESID-alternate + + + MOD_RES O-UMP-tyrosine + UniProt-feature + + + O-Uridinylylation (of Tyrosine) + DeltaMass-label + + + O4'-(phospho-5'-uridine)-L-tyrosine + RESID-name + + + O4'-L-tyrosine 5'-uridine phosphodiester + RESID-alternate + + + OUMPTyr + PSI-MOD-label + + + PhosphoUridine + PSI-MS-label + + + uridine phosphodiester + UniMod-description + + + + DiffAvg + 306.17 + + + + DiffFormula + C 9 H 11 N 2 O 8 P 1 + + + + DiffMono + 306.025302 + + + + Formula + C 18 H 20 N 3 O 10 P 1 + + + + MassAvg + 469.34 + + + + MassMono + 469.088630 + + + + Origin + Y + + + + Source + natural + + + + TermSpec + none + + MOD:00919 + MOD:01166 + PSI-MOD + + + MOD:00262 + N-(L-glutamyl)-L-tyrosine + + A protein modification that effectively forms a peptide bond between a C-terminal L-glutamic acid residue and a free L-tyrosine. + + 21477 + ChEBI + + + 6387372 + PubMed + + + 8093886 + PubMed + + + AA0257 + RESID + + + Cross-link 2. + + (S,S)-2-(2-aminopentanedio-1-yl)amino-3-(4-hydoxyphenyl)propanoic acid + RESID-systematic + + + L-glutamyl L-tyrosine + RESID-name + + + N-(L-glutamyl)-L-tyrosine + RESID-alternate + + + SITE Involved in polymerization + UniProt-feature + + + + DiffAvg + -17.01 + + + + DiffFormula + C 0 H -1 N 0 O -1 + + + + DiffMono + -17.002740 + + + + Formula + C 14 H 16 N 2 O 5 + + + + MassAvg + 292.29 + + + + MassMono + 292.105922 + + + + Origin + E, Y + + + + Source + natural + + + + TermSpec + C-term + + MOD:00906 + MOD:00919 + PSI-MOD + + + MOD:00263 + S-phycoviolobilin-L-cysteine + + A protein modification that effectively results from forming an adduct between a cysteine residue and the tetrapyrrole compound phycoviolobilin. + + 2106585 + PubMed + + + 3208761 + PubMed + + + AA0258 + RESID + + + 387 + UniMod + + + + (4S)-3-[(1R)-1-(((2R)-2-amino-2-carboxy)ethylsulfanyl)ethyl]-8,12-bis(2-carboxyethyl)-18-ethyl-4,5-dihydro-2,7,13,17-tetramethyl-(21H,22H,24H)-biladiene-bc-1,19-dione + RESID-systematic + + + BINDING Phycoviolobilin chromophore (covalent; via 1 link) + UniProt-feature + + + cryptobiliviolin + RESID-alternate + + + cryptoviolin + RESID-alternate + + + cryptoviolobilin + RESID-alternate + + + PBV + RESID-alternate + + + Phycocyanobilin + PSI-MS-label + + + phycocyanobilin + UniMod-description + + + PVB + RESID-alternate + + + PXB + RESID-alternate + + + S-phycobiliviolin-L-cysteine + RESID-alternate + + + S-phycoviolobilin-L-cysteine + RESID-name + + + + DiffAvg + 586.69 + + + + DiffFormula + C 33 H 38 N 4 O 6 S 0 + + + + DiffMono + 586.279135 + + + + Formula + C 36 H 43 N 5 O 7 S 1 + + + + MassAvg + 689.83 + + + + MassMono + 689.288320 + + + + Origin + C + + + + Source + natural + + + + TermSpec + none + + MOD:00700 + MOD:00905 + PSI-MOD + + + MOD:00264 + phycoerythrobilin-bis-L-cysteine + + A protein modification that effectively results from forming an adduct between two cysteine residues and the tetrapyrrole compound phycoerythrobilin. + + 3208761 + PubMed + + + 3838747 + PubMed + + + AA0259 + RESID + + + Cross-link 2. + + (2S,3R,16R)-3,18-bis-[(R)-1-(((2R)-2-amino-2-carboxy)ethylsulfanyl)ethyl]-8,12-bis(2-carboxyethyl)-2,7,13,17-tetramethyl-2,3,15,16-tetrahydrobilin-1,19(21H,22H,24H)-dione + RESID-systematic + + + 3,18-bis-[1-((2-amino-2-carboxy)ethylsulfanyl)ethyl]-2,3,15,16-tetrahydro-2,7,13,17-tetramethyl-1,19-dioxo-(21H,22H,24H)-biladiene-ab-8,12-dipropanoic acid + RESID-alternate + + + BINDING Phycoerythrobilin chromophore (covalent; via 2 links) + UniProt-feature + + + PEB + RESID-alternate + + + phycoerythrobilin biscysteine adduct + RESID-alternate + + + phycoerythrobilin-bis-L-cysteine + RESID-name + + + + DiffAvg + 586.69 + + + + DiffFormula + C 33 H 38 N 4 O 6 S 0 + + + + DiffMono + 586.279135 + + + + Formula + C 39 H 48 N 6 O 8 S 2 + + + + MassAvg + 792.97 + + + + MassMono + 792.297505 + + + + Origin + C, C + + + + Source + natural + + + + TermSpec + none + + MOD:00700 + MOD:00905 + PSI-MOD + + + MOD:00265 + phycourobilin-bis-L-cysteine + + A protein modification that effectively results from forming an adduct between two cysteine residues and the tetrapyrrole compound phycourobilin. + + 3208761 + PubMed + + + 3838665 + PubMed + + + 3838747 + PubMed + + + 8876649 + PubMed + + + AA0260 + RESID + + + Cross-link 2. + + 3,18-bis(1-[(R)-2-amino-2-carboxyethyl]sulfanylethyl)-2,7,13,17-tetramethyl-1,19-dioxo-4,5,15,16-tetrahydro-(21H,22H,24H)-bilene-b-8,12-dipropanoic acid + RESID-alternate + + + 3,18-bis(1-[(R)-2-amino-2-carboxyethyl]sulfanylethyl)-8,12-bis(2-carboxyethyl)-2,7,13,17-tetramethyl-4,5,15,16-tetrahydro-(21H,22H,24H)-bilene-b-1,19(4H,16H)-dione + RESID-systematic + + + BINDING Phycourobilin chromophore (covalent; via 2 links) + UniProt-feature + + + phycourobilin biscysteine adduct + RESID-alternate + + + phycourobilin-bis-L-cysteine + RESID-name + + + PUB + RESID-alternate + + + + DiffAvg + 586.69 + + + + DiffFormula + C 33 H 38 N 4 O 6 S 0 + + + + DiffMono + 586.279135 + + + + Formula + C 39 H 48 N 6 O 8 S 2 + + + + MassAvg + 792.97 + + + + MassMono + 792.297505 + + + + Origin + C, C + + + + Source + natural + + + + TermSpec + none + + MOD:00700 + MOD:00905 + PSI-MOD + + + MOD:00266 + N-L-glutamyl-poly-L-glutamic acid + + A protein modification that effectively forms a peptide bond between a C-terminal L-glutamic acid residue and one or more free L-glutamic acid molecules to form N-(L-glutamyl)-poly-L-glutamic acid. + + 2570347 + PubMed + + + 328274 + PubMed + + + AA0261 + RESID + + + + + DiffAvg + 0.00 + + + + DiffFormula + C 0 H 0 N 0 O 0 + + + + DiffMono + 0.000000 + + + + Formula + C 10 H 15 N 2 O 7 + + + + MassAvg + 275.24 + + + + MassMono + 275.087926 + + + + Origin + E + + + + Source + natural + + + + TermSpec + C-term + + MOD:00906 + PSI-MOD + + + MOD:00267 + L-cysteine sulfinic acid + + A protein modification that effectively dioxygenates an L-cysteine residue to L-cysteine sulfinic acid. + + 16345 + ChEBI + + + 12686488 + PubMed + + + 9252331 + PubMed + + + 9586994 + PubMed + + + AA0262 + RESID + + + 425#C + UniMod + + + "Hyun Ae Woo, et. al., Science 300 (5619), 653-656" + PSI-MOD-slim + + (2R)-2-amino-3-sulfinopropanoic acid + RESID-systematic + + + 2-amino-2-carboxyethanesulfinic acid + RESID-alternate + + + 2-amino-3-(dioxido-lambda(6)-sulfanyl)propanoic acid [tautomer] + RESID-alternate + + + 2-amino-3-sulfonylpropanoic acid [tautomer] + RESID-alternate + + + 3-sulfinoalanine + RESID-alternate + + + 3-sulphinoalanine + RESID-alternate + + + CysO2H + PSI-MOD-label + + + cysteine sulphinic acid + RESID-alternate + + + cysteine-S,S-dioxide [tautomer] + RESID-alternate + + + dihydroxy + UniMod-description + + + Dioxidation + PSI-MS-label + + + L-cysteine sulfinic acid + RESID-name + + + MOD_RES Cysteine sulfinic acid (-SO2H) + UniProt-feature + + + S-cysteinesulfinic acid + RESID-alternate + + + S-sulfinocysteine + RESID-alternate + + + sulfinicacid + OMSSA-label + + + + DiffAvg + 32.00 + + + + DiffFormula + C 0 H 0 N 0 O 2 S 0 + + + + DiffMono + 31.989829 + + + + Formula + C 3 H 5 N 1 O 3 S 1 + + + + MassAvg + 135.14 + + + + MassMono + 134.999014 + + + + Origin + C + + + + Source + natural + + + + TermSpec + none + + MOD:00708 + MOD:01855 + PSI-MOD + + + MOD:00268 + L-3',4',5'-trihydroxyphenylalanine + + A protein modification that effectively converts an L-tyrosine residue to L-3',4',5'-trihydroxyphenylalanine. + + 0 + DeltaMass + + + 12686488 + PubMed + + + 12771378 + PubMed + + + 8554314 + PubMed + + + 9252331 + PubMed + + + 9434739 + PubMed + + + AA0263 + RESID + + + 425#Y + UniMod + + + From DeltaMass: Average Mass: 32 + + (S)-2-amino-3-(3,4,5-trihydroxyphenyl)propanoic acid + RESID-systematic + + + 3,4,6-Trihydroxy-Phenylalanine (from Tyrosine) (TOPA) + DeltaMass-label + + + 35Hy2Tyr + PSI-MOD-label + + + dihydroxy + UniMod-description + + + Dioxidation + PSI-MS-label + + + L-3',4',5'-trihydroxyphenylalanine + RESID-name + + + L-3,4,5-TOPA + RESID-alternate + + + + DiffAvg + 32.00 + + + + DiffFormula + C 0 H 0 N 0 O 2 + + + + DiffMono + 31.989829 + + + + Formula + C 9 H 9 N 1 O 4 + + + + MassAvg + 195.17 + + + + MassMono + 195.053158 + + + + Origin + Y + + + + Source + natural + + + + TermSpec + none + + MOD:00428 + MOD:00707 + PSI-MOD + + + MOD:00269 + O-(sn-1-glycerophosphoryl)-L-serine + + A protein modification that effectively converts an L-serine residue to O-(sn-1-glycerophosphoryl)-L-serine. + + 8645220 + PubMed + + + AA0264 + RESID + + + 419#S + UniMod + + + PSI-MOD-slim + + (2S)-2-amino-3-[(2Xi)-2,3-dihydroxypropyl]phosphonoxypropanoic acid + RESID-systematic + + + alpha-glycerophosphoryl serine + RESID-alternate + + + Glycerophospho + PSI-MS-label + + + glycerophospho + UniMod-description + + + glycerophosphoserine + RESID-alternate + + + MOD_RES O-(sn-1-glycerophosphoryl)serine + UniProt-feature + + + O-(sn-1-glycerophosphoryl)-L-serine + RESID-name + + + O3-(sn-1-glycerophosphoryl)-L-serine + RESID-alternate + + + O3-2,3-dihydroxypropyl hydrogen phosphate-L-serine ester + RESID-alternate + + + O3-L-serine glyceryl-1-phosphodiester + RESID-alternate + + + + DiffAvg + 154.06 + + + + DiffFormula + C 3 H 7 N 0 O 5 P 1 + + + + DiffMono + 154.003110 + + + + Formula + C 6 H 12 N 1 O 7 P 1 + + + + MassAvg + 241.14 + + + + MassMono + 241.035138 + + + + Origin + S + + + + Source + natural + + + + TermSpec + none + + MOD:00916 + PSI-MOD + + + MOD:00270 + 1-thioglycine (internal) + + A protein modification that effectively converts a glycine residue to an internal 1-thioglycine. + + 11463785 + PubMed + + + 9367957 + PubMed + + + AA0265#INT + RESID + + + This modification occurs naturally in two forms. At an interior peptide location it exists as aminoethanethionic acid (or aminoethanethioic O-acid). At the carboxyl-terminal it exists as aminoethanethiolic acid (or aminoethanethioic S-acid). + PSI-MOD-slim + + 1-thioglycine + RESID-name + + + 2-amino-1-sulfanylethanone + RESID-alternate + + + aminoethanethioic acid + RESID-systematic + + + aminoethanethioic O-acid + RESID-alternate + + + aminoethanethionic acid + RESID-alternate + + + aminothioacetic acid + RESID-alternate + + + Carboxy->Thiocarboxy + PSI-MS-label + + + MOD_RES 1-thioglycine + UniProt-feature + + + S(O)Gly + PSI-MOD-label + + + thiocarboxylic acid + UniMod-description + + + + DiffAvg + 16.06 + + + + DiffFormula + C 0 H 0 N 0 O -1 S 1 + + + + DiffMono + 15.977156 + + + + Formula + C 2 H 3 N 1 S 1 + + + + MassAvg + 73.11 + + + + MassMono + 72.998620 + + + + Origin + G + + + + Source + natural + + + + TermSpec + none + + MOD:01625 + PSI-MOD + + + MOD:00271 + heme P460-bis-L-cysteine-L-tyrosine + + A protein modification that effectively results from forming an adduct between two cysteine residues, the C-3' of a tyrosine residue, and the porphyrin compound heme b, (7,12-diethenyl-3,8,13,17-tetramethylporphyrin-2,18-dipropanoato)iron. + + 8325841 + PubMed + + + 9095195 + PubMed + + + AA0266 + RESID + + + Cross-link 3. + + (10S,11S)-[7,12-bis((S)-1-[((R)-2-amino-2-carboxy)ethylsulfanyl]ethyl)-10-(2-hydroxy-5-[(S)-2-amino-2-carboxy]ethylphenyl)-3,8,13,17-tetramethyl-21H,23H-10,11-dihydroporphine-2,18-bis(2-carboxyethyl)-N21,N22,N23,N24]-ferrate + RESID-systematic + + + BINDING Heme (covalent; via 3 links) + UniProt-feature + + + bis(S-cysteinyl)-(tyros-3'-yl)-heme + RESID-alternate + + + heme P460-bis-L-cysteine-L-tyrosine + RESID-name + + + + DiffAvg + 614.48 + + + + DiffFormula + C 34 Fe 1 H 30 N 4 O 4 S 0 + + + + DiffMono + 614.161643 + + + + Formula + C 49 Fe 1 H 49 N 7 O 8 S 2 + + + + MassAvg + 983.94 + + + + MassMono + 983.243341 + + + + Origin + C, C, Y + + + + Source + natural + + + + TermSpec + none + + MOD:00699 + MOD:00905 + MOD:00919 + PSI-MOD + + + MOD:00272 + O-(phospho-5'-adenosine)-L-threonine + + A protein modification that effectively crosslinks an L-threonine residue and 5'-phosphoadenosine through a phosphodiester bond to form O-(phospho-5'-adenosine)-L-threonine. + + 2989287 + PubMed + + + 8917428 + PubMed + + + AA0267 + RESID + + + 405#T + UniMod + + + PSI-MOD-slim + + (2S,3R)-2-amino-3-(5'-adenosine phosphonoxy)butanoic acid + RESID-systematic + + + 5'-adenylic-O3-L-threonine + RESID-alternate + + + ACT_SITE O-AMP-threonine intermediate + UniProt-feature + + + AMP binding site + UniMod-description + + + beta-5'-adenylic-L-threonine + RESID-alternate + + + L-threonine monoanhydride with 5'-adenylic acid + RESID-alternate + + + MOD_RES O-AMP-threonine + UniProt-feature + + + O(gamma)-5'-adenylic-L-threonine + RESID-alternate + + + O-(phospho-5'-adenosine)-L-threonine + RESID-name + + + O3-(phospho-5'-adenosine)-L-threonine + RESID-alternate + + + O3-L-threonine 5'-adenosine phosphodiester + RESID-alternate + + + Phosphoadenosine + PSI-MS-label + + + + DiffAvg + 329.21 + + + + DiffFormula + C 10 H 12 N 5 O 6 P 1 + + + + DiffMono + 329.052520 + + + + Formula + C 14 H 19 N 6 O 8 P 1 + + + + MassAvg + 430.31 + + + + MassMono + 430.100198 + + + + Origin + T + + + + Source + natural + + + + TermSpec + none + + MOD:00917 + MOD:01165 + PSI-MOD + + + MOD:00273 + tris-L-cysteinyl L-cysteine persulfido bis-L-glutamato L-histidino tetrairon disulfide trioxide + + A protein modification that effectively converts four L-cysteine residues, two L-glutamic acid residues, an L-histidine residue and a four-iron three-sulfur three-oxygen cluster to tris-L-cysteinyl L-cysteine persulfido bis-L-glutamato L-histidino tetrairon disulfide trioxide. + + 12764602 + PubMed + + + AA0268 + RESID + + + Cross-link 7; secondary to RESID:AA0269. + + 4Fe-2S-3O cluster + RESID-alternate + + + hybrid four iron cluster 2 + RESID-alternate + + + METAL Iron-oxo-sulfur (4Fe-2O-2S) + UniProt-feature + + + METAL Iron-oxo-sulfur (4Fe-2O-2S); via persulfide group + UniProt-feature + + + METAL Iron-oxo-sulfur (4Fe-2O-2S); via tele nitrogen + UniProt-feature + + + mu-1:2kappaO-oxido-mu-1:3kappaO-oxido-mu-2:4kappaO-oxido-mu-3:4kappaS-sulfido-mu3-2:3:4kappaS-sulfido-S-cysteinyl-N1'-histidino-O5-glutamato 1-iron-S5-cysteine persulfido-O5-glutamato 2-iron-3,4-bis-(S-cysteinyl iron) + RESID-systematic + + + prismane iron-sulfur cofactor + RESID-misnomer + + + tris-L-cysteinyl L-cysteine persulfido bis-L-glutamato L-histidino tetrairon disulfide trioxide + RESID-name + + + + DiffAvg + 360.50 + + + + DiffFormula + C 0 Fe 4 H -7 N 0 O 3 S 3 + + + + DiffMono + 360.585932 + + + + Formula + C 28 Fe 4 H 34 N 9 O 14 S 7 + + + + MassAvg + 1168.43 + + + + MassMono + 1167.766769 + + + + Origin + C, C, C, C, E, E, H + + + + Source + natural + + + + TermSpec + none + + MOD:00739 + MOD:00905 + MOD:00906 + MOD:00909 + PSI-MOD + + + MOD:00274 + L-cysteine persulfide + + A protein modification that effectively replaces the hydrogen atom of a cysteine sulfanyl group with a sulfanyl group, forming a disulfanyl group, and converting an L-cysteine residue to L-cysteine persulfide. + + 28839 + ChEBI + + + 15096637 + PubMed + + + 4276457 + PubMed + + + 8161529 + PubMed + + + AA0269 + RESID + + + 421 + UniMod + + + PSI-MOD-slim + + (R)-2-amino-3-disulfanylpropanoic acid + RESID-systematic + + + 2-amino-3-disulfanylpropanoic acid + RESID-alternate + + + 2-amino-3-hydrodisulfidopropanoic acid + RESID-alternate + + + 2-amino-3-hydropersulfidopropanoic acid + RESID-alternate + + + 2-amino-3-persulfhydrylpropanoic acid + RESID-alternate + + + 3-(thiosulfeno)-alanine + RESID-alternate + + + 3-disulfanylalanine + RESID-alternate + + + ACT_SITE Cysteine persulfide intermediate + UniProt-feature + + + L-cysteine persulfide + RESID-name + + + MOD_RES Cysteine persulfide + UniProt-feature + + + persulfide + UniMod-description + + + S-mercaptocysteine + RESID-alternate + + + S-sulfanylcysteine + RESID-alternate + + + Sulfide + PSI-MS-label + + + thiocysteine + RESID-alternate + + + + DiffAvg + 32.06 + + + + DiffFormula + C 0 H 0 N 0 O 0 S 1 + + + + DiffMono + 31.972071 + + + + Formula + C 3 H 5 N 1 O 1 S 2 + + + + MassAvg + 135.20 + + + + MassMono + 134.981256 + + + + Origin + C + + + + Source + natural + + + + TermSpec + none + + MOD:00905 + MOD:01886 + PSI-MOD + + + MOD:00275 + 3'-(1'-L-histidyl)-L-tyrosine + + A protein modification that effectively cross-links an L-histidine residue and an L-tyrosine residue by a carbon-nitrogen bond to form 3'-(1'-L-histidyl)-L-tyrosine. + + 19837 + ChEBI + + + 10338009 + PubMed + + + AA0270 + RESID + + + Cross-link 2. + PSI-MOD-slim + + (2S)-2-amino-3-[1-(5-[(2S)-2-amino-2-carboxyethyl]-2-hydroxyphenyl)-1H-imidazol-4-yl]propanoic acid + RESID-systematic + + + 3'-(1'-L-histidyl)-L-tyrosine + RESID-name + + + 3'-(N(epsilon)-histidyl)tyrosine + RESID-alternate + + + 3'-(N1'-histidyl)tyrosine + RESID-alternate + + + 3'-(tau-histidyl)tyrosine + RESID-alternate + + + 3'-(tele-histidyl)tyrosine + RESID-alternate + + + CROSSLNK 1'-histidyl-3'-tyrosine (His-Tyr) + UniProt-feature + + + + DiffAvg + -2.02 + + + + DiffFormula + C 0 H -2 N 0 O 0 + + + + DiffMono + -2.015650 + + + + Formula + C 15 H 14 N 4 O 3 + + + + MassAvg + 298.30 + + + + MassMono + 298.106590 + + + + Origin + H, Y + + + + Source + natural + + + + TermSpec + none + + MOD:00692 + MOD:00909 + MOD:00919 + PSI-MOD + + + MOD:00276 + heme P460-bis-L-cysteine-L-lysine + + A protein modification that effectively results from forming an adduct between two cysteine residues, a lysine residue, and the porphyrin compound heme b, (7,12-diethenyl-3,8,13,17-tetramethylporphyrin-2,18-dipropanoato)iron. + + 12709052 + PubMed + + + 9237682 + PubMed + + + AA0271 + RESID + + + Cross-link 3. + + (19S,20S)-[7,12-bis((S)-1-[((R)-2-amino-2-carboxy)ethylsulfanyl]ethyl)-20-([(S)-5-amino-5-carboxypentyl]amino)-3,8,13,17-tetramethyl-21H,23H-19,20-dihydroporphine-2,18-bis(2-carboxyethyl)-N21,N22,N23,N24]-ferrate + RESID-systematic + + + BINDING Heme (covalent; via 3 links) + UniProt-feature + + + bis(S-cysteinyl)-N6-lysino-heme + RESID-alternate + + + heme P460-bis-L-cysteine-L-lysine + RESID-name + + + + DiffAvg + 614.48 + + + + DiffFormula + C 34 Fe 1 H 30 N 4 O 4 S 0 + + + + DiffMono + 614.161643 + + + + Formula + C 46 Fe 1 H 52 N 8 O 7 S 2 + + + + MassAvg + 948.94 + + + + MassMono + 948.274976 + + + + Origin + C, C, K + + + + Source + natural + + + + TermSpec + none + + MOD:00699 + MOD:00905 + MOD:00912 + PSI-MOD + + + MOD:00277 + 5-methyl-L-arginine + + A protein modification that effectively converts an L-arginine residue to 5-methyl-L-arginine. + + 10660523 + PubMed + + + 11875433 + PubMed + + + 9367957 + PubMed + + + AA0272 + RESID + + + + (2S,5S)-2-amino-5-carbamimidamidohexanoic acid + RESID-systematic + + + 2-amino-5-guanidinohexanoic acid + RESID-alternate + + + 4-methylarginine + RESID-misnomer + + + 5-methyl-L-arginine + RESID-name + + + 5-methylated L-arginine + PSI-MOD-alternate + + + C5Me1Arg + PSI-MOD-label + + + delta-methylarginine + RESID-alternate + + + Methyl + PSI-MS-label + + + Methylation + UniMod-description + + + MOD_RES 5-methylarginine + UniProt-feature + + + + DiffAvg + 14.03 + + + + DiffFormula + C 1 H 2 N 0 O 0 + + + + DiffMono + 14.015650 + + + + Formula + C 7 H 14 N 4 O 1 + + + + MassAvg + 170.22 + + + + MassMono + 170.116761 + + + + Origin + R + + + + Source + natural + + + + TermSpec + none + + MOD:00414 + MOD:00656 + PSI-MOD + + + MOD:00278 + 2-methyl-L-glutamine + + A protein modification that effectively converts an L-glutamine residue to 2-methyl-L-glutamine. + + 10660523 + PubMed + + + 11875433 + PubMed + + + 9367957 + PubMed + + + AA0273 + RESID + + + + (S)-2-amino-2-methylpentanediamic acid + RESID-systematic + + + 2-methyl-L-glutamine + RESID-name + + + 2-methylated L-glutamine + PSI-MOD-alternate + + + 2-methylglutamine + RESID-alternate + + + alpha-methylglutamine + RESID-alternate + + + C2MeGln + PSI-MOD-label + + + Methyl + PSI-MS-label + + + Methylation + UniMod-description + + + MOD_RES 2-methylglutamine + UniProt-feature + + + + DiffAvg + 14.03 + + + + DiffFormula + C 1 H 2 N 0 O 0 + + + + DiffMono + 14.015650 + + + + Formula + C 6 H 10 N 2 O 2 + + + + MassAvg + 142.16 + + + + MassMono + 142.074228 + + + + Origin + Q + + + + Source + natural + + + + TermSpec + none + + MOD:00656 + MOD:00722 + PSI-MOD + + + MOD:00279 + N-pyruvic acid 2-iminyl-L-cysteine + + A protein modification that effectively converts an Lcysteline residue to N-pyruvic acid 2-iminyl-L-cysteine. + + 1388164 + PubMed + + + AA0274 + RESID + + + 422#C + UniMod + + + PSI-MOD-slim + + (R)-2-(1-carboxy-2-sulfanylethanimino)propanoic acid + RESID-systematic + + + MOD_RES N-pyruvate 2-iminyl-cysteine + UniProt-feature + + + N-pyruvic acid 2-iminyl + UniMod-description + + + N-pyruvic acid 2-iminyl-L-cysteine + RESID-name + + + PyruvicAcidIminyl + PSI-MS-label + + + + DiffAvg + 70.05 + + + + DiffFormula + C 3 H 2 N 0 O 2 S 0 + + + + DiffMono + 70.005479 + + + + Formula + C 6 H 8 N 1 O 3 S 1 + + + + MassAvg + 174.19 + + + + MassMono + 174.022489 + + + + Origin + C + + + + Source + natural + + + + TermSpec + N-term + + MOD:00905 + MOD:01170 + PSI-MOD + + + MOD:00280 + N-pyruvic acid 2-iminyl-L-valine + + A protein modification that effectively converts an L-valine residue to N-pyruvic acid 2-iminyl-L-valine. + + 2071591 + PubMed + + + AA0275 + RESID + + + 422#V + UniMod + + + PSI-MOD-slim + + (S)-2-(1-carboxy-2-methylpropanimino)propanoic acid + RESID-systematic + + + MOD_RES N-pyruvate 2-iminyl-valine + UniProt-feature + + + N-pyruvic acid 2-iminyl + UniMod-description + + + N-pyruvic acid 2-iminyl-L-valine + RESID-name + + + PyruvicAcidIminyl + PSI-MS-label + + + + DiffAvg + 70.05 + + + + DiffFormula + C 3 H 2 N 0 O 2 + + + + DiffMono + 70.005479 + + + + Formula + C 8 H 12 N 1 O 3 + + + + MassAvg + 170.19 + + + + MassMono + 170.081718 + + + + Origin + V + + + + Source + natural + + + + TermSpec + N-term + + MOD:00920 + MOD:01170 + PSI-MOD + + + MOD:00281 + 3'-heme-L-histidine + + A protein modification that effectively results from forming an adduct between the pros nitrogen of a histidine residue and the porphyrin compound heme b, (7,12-diethenyl-3,8,13,17-tetramethylporphyrin-2,18-dipropanoato)iron. + + 12119398 + PubMed + + + 12429096 + PubMed + + + 12486054 + PubMed + + + 9712585 + PubMed + + + AA0276 + RESID + + + + 2-[1-(N3'-histidyl)ethyl]protoporphyrin IX + RESID-alternate + + + 3'-heme-L-histidine + RESID-name + + + [7-ethenyl-12-((S)-1-[((R)-2-amino-2-carboxyethyl)-3H-imidazol-3-yl]ethyl)-3,8,13,17-tetramethyl-21H,23H-porphine-2,18-bis(2-carboxyethyl)-N21,N22,N23,N24]-ferrate + RESID-systematic + + + BINDING Heme (covalent; via pros nitrogen) + UniProt-feature + + + N(delta)-histidyl heme + RESID-alternate + + + N(pi)-histidyl heme + RESID-alternate + + + N3'-histidyl heme + RESID-alternate + + + pros-histidyl heme + RESID-alternate + + + + DiffAvg + 616.50 + + + + DiffFormula + C 34 Fe 1 H 32 N 4 O 4 + + + + DiffMono + 616.177293 + + + + Formula + C 40 Fe 1 H 39 N 7 O 5 + + + + MassAvg + 753.64 + + + + MassMono + 753.236205 + + + + Origin + H + + + + Source + natural + + + + TermSpec + none + + MOD:00699 + MOD:00909 + PSI-MOD + + + MOD:00282 + S-selenyl-L-cysteine + + A protein modification that effectively converts an L-cysteine residue to S-selenyl-L-cysteine. + + 10430865 + PubMed + + + 10966817 + PubMed + + + 11827487 + PubMed + + + 12716131 + PubMed + + + 14594807 + PubMed + + + AA0277 + RESID + + + 423#C + UniMod + + + + (R)-2-amino-3-(selanylsulfanyl)propanoic acid + RESID-systematic + + + 2-amino-3-hydroselenosulfidopropanoic acid + RESID-alternate + + + 2-amino-3-hydroselenylsulfidopropanoic acid + RESID-alternate + + + 2-amino-3-hydroselenylthiopropanoic acid + RESID-alternate + + + ACT_SITE S-selanylcysteine intermediate + UniProt-feature + + + cysteine perselenide + RESID-misnomer + + + Delta:Se(1) + PSI-MS-label + + + MOD_RES S-selanylcysteine + UniProt-feature + + + S-selanyl-L-cysteine + RESID-name + + + S-selanylcysteine + RESID-alternate + + + S-selenylcysteine + RESID-alternate + + + selenyl + UniMod-description + + + + DiffAvg + 78.97 + + + + DiffFormula + C 0 H 0 N 0 O 0 S 0 Se 1 + + + + DiffMono + 79.916521 + + + + Formula + C 3 H 5 N 1 O 1 S 1 Se 1 + + + + MassAvg + 182.11 + + + + MassMono + 182.925706 + + + + Origin + C + + + + Source + hypothetical + + + + TermSpec + none + + MOD:00745 + MOD:00778 + MOD:00905 + PSI-MOD + + + MOD:00283 + N6-propylamino-poly(propylmethylamino)-propyldimethylamine-L-lysine + + A protein modification that effectively converts an L-lysine residue to an N6-propylamino-poly(propylmethylamino)-propyldimethylamine-L-lysine. + + 10550045 + PubMed + + + 11349130 + PubMed + + + AA0278 + RESID + + + + (alpha)- ([([(5S)-5-amino-5-carboxypentyl]amino)propyl][(methyl)amino])-(omega)-methyl poly[propane-1,3-diyl(methylimino)] + RESID-systematic + + + lysine derivative Lys(x) + RESID-alternate + + + MOD_RES N6-poly(methylaminopropyl)lysine + UniProt-feature + + + N6-[3-([(omega)-(dimethyl)aminopropyl-poly(3-[methylamino]propyl)]amino)propyl]lysine + RESID-alternate + + + N6-propylamino-poly(propylmethylamino)-propyldimethylamine-L-lysine + RESID-name + + + silaffin polycationic lysine derivative + RESID-alternate + + + + DiffAvg + 426.74 + + + + DiffFormula + C 24 H 54 N 6 O 0 + + + + DiffMono + 426.440996 + + + + Formula + C 30 H 66 N 8 O 1 + + + + MassAvg + 554.91 + + + + MassMono + 554.535959 + + + + Origin + K + + + + Source + natural + + + + TermSpec + none + + MOD:00912 + PSI-MOD + + + MOD:00284 + dihydroxyheme-L-aspartate ester-L-glutamate ester + + A protein modification that effectively results from forming an adduct between an aspartic acid residue, a glutamic acid residue, and the porphyrin compound heme b, (7,12-diethenyl-3,8,13,17-tetramethylporphyrin-2,18-dipropanoato)iron. + + 10447690 + PubMed + + + AA0279 + RESID + + + Cross-link 2. + + 1,5-bishydroxymethyl protoporphyrin IX 1-glutamate ester 5-aspartate ester + RESID-alternate + + + [13-[(S)-(4-amino-4-carboxy)butanoyloxymethyl]-3-[(S)-(3-amino-3-carboxy)propanoyloxymethyl]-7,12-diethenyl-8,17-dimethyl-21H,23H-porphine-2,18-bis(2-carboxyethyl)-N21,N22,N23,N24]-ferrate + RESID-systematic + + + BINDING Heme (covalent; via 2 links) + UniProt-feature + + + dihydroxyheme-L-aspartate ester-L-glutamate ester + RESID-name + + + peroxidase heme cofactor + RESID-alternate + + + + DiffAvg + 612.47 + + + + DiffFormula + C 34 Fe 1 H 28 N 4 O 4 + + + + DiffMono + 612.145993 + + + + Formula + C 43 Fe 1 H 40 N 6 O 10 + + + + MassAvg + 856.67 + + + + MassMono + 856.215529 + + + + Origin + D, E + + + + Source + hypothetical + + + + TermSpec + none + + MOD:00699 + MOD:00904 + MOD:00906 + PSI-MOD + + + MOD:00285 + dihydroxyheme-L-aspartate ester-L-glutamate ester-L-methionine sulfonium + + A protein modification that effectively results from forming an adduct between an aspartic acid residue, a glutamic acid residue, a methionine residue (forming a sulfonium ether), and the porphyrin compound heme b, (7,12-diethenyl-3,8,13,17-tetramethylporphyrin-2,18-dipropanoato)iron. + + 10447690 + PubMed + + + 10480885 + PubMed + + + 1320128 + PubMed + + + 7840679 + PubMed + + + AA0280 + RESID + + + Cross-link 3. + + 1,5-bishydroxymethyl protoporphyrin IX 1-glutamate ester 5-aspartate ester 2-methionine sulfonium + RESID-alternate + + + [13-[(S)-(4-amino-4-carboxy)butanoyloxymethyl]-3-[(S)-(3-amino-3-carboxy)propanoyloxymethyl]-12-[(S)-(3-amino-3-carboxy)propylsulfoniumethyl]-7-ethenyl-8,17-dimethyl-21H,23H-porphine-2,18-bis(2-carboxyethyl)-N21,N22,N23,N24]-ferrate + RESID-systematic + + + BINDING Heme (covalent; via 3 links) + UniProt-feature + + + dihydroxyheme-L-aspartate ester-L-glutamate ester-L-methionine sulfonium + RESID-name + + + myeloperoxidase heme cofactor + RESID-alternate + + + + DiffAvg + 613.47 + + + + DiffFormula + C 34 Fe 1 H 29 N 4 O 4 S 0 + + + + DiffMono + 613.153269 + + + + FormalCharge + 1+ + + + + Formula + C 48 Fe 1 H 50 N 7 O 11 S 1 + + + + MassAvg + 988.87 + + + + MassMono + 988.263290 + + + + Origin + D, E, M + + + + Source + natural + + + + TermSpec + none + + MOD:00699 + MOD:00904 + MOD:00906 + MOD:00913 + PSI-MOD + + + MOD:00286 + L-cysteinyl molybdenum bis(molybdopterin guanine dinucleotide) + + A protein modification that effectively converts an L-cysteine residue to L-cysteinyl molybdenum bis(molybdopterin guanine dinucleotide). + + AA0281 + RESID + + + 424#C + UniMod + + + + 2-amino-5,6-dimercapto-7-methyl-3,7,8a,9-tetrahydro-8-oxa-1,3,9,10-tetraazaanthracen-4-one guanosine dinucleotide + RESID-alternate + + + bis[8-amino-1a,2,4a,5,6,7,10-heptahydro-2-(trihydrogen diphosphate 5'-ester with guanosine)methyl-6-oxo-3,4-disulfanyl-pteridino[6,7-5,6]pyranoato-S3,S4]-cystein-S-yl-molybdenum + RESID-systematic + + + L-cysteinyl molybdenum bis(molybdopterin guanine dinucleotide) + RESID-name + + + molybdenum bis(molybdopterin guanine dinucleotide) + UniMod-description + + + MolybdopterinGD + PSI-MS-label + + + + DiffAvg + 1572.02 + + + + DiffFormula + C 40 H 47 Mo 1 N 20 O 26 P 4 S 4 + + + + DiffMono + 1572.985775 + + + + Formula + C 43 H 52 Mo 1 N 21 O 27 P 4 S 5 + + + + MassAvg + 1675.15 + + + + MassMono + 1675.994960 + + + + Origin + C + + + + Source + hypothetical + + + + TermSpec + none + + MOD:00905 + MOD:01167 + PSI-MOD + + + MOD:00287 + (2S,3R,4S)-3,4-dihydroxyproline + + A protein modification that effectively converts an L-proline residue to a (2S,3R,4S)-3,4-dihydroxyproline. + + 0 + DeltaMass + + + 12686488 + PubMed + + + AA0282 + RESID + + + 425#P + UniMod + + + From DeltaMass: Average Mass: 32. + + (2S,3R,4S)-3,4-dihydroxyproline + RESID-name + + + (2S,3R,4S)-3,4-dihydroxypyrrolidine-2-carboxylic acid + RESID-systematic + + + 2,3-trans-3,4-cis-3,4-dihydroxy-L-proline + RESID-alternate + + + 2-alpha-3-beta-4-beta-3,4-dihydroxyproline + RESID-alternate + + + 3,4-dihydroxylated L-proline + PSI-MOD-alternate + + + 3,4-Dihydroxylation (of Proline) + DeltaMass-label + + + 34Hy2Pro + PSI-MOD-label + + + dihydroxy + UniMod-description + + + Dioxidation + PSI-MS-label + + + MOD_RES (3R,4S)-3,4-dihydroxyproline + UniProt-feature + + + trans-2,3-cis-3,4-dihydroxy-L-proline + RESID-alternate + + + + DiffAvg + 32.00 + + + + DiffFormula + C 0 H 0 N 0 O 2 + + + + DiffMono + 31.989829 + + + + Formula + C 5 H 7 N 1 O 3 + + + + MassAvg + 129.12 + + + + MassMono + 129.042593 + + + + Origin + P + + + + Source + natural + + + + TermSpec + none + + MOD:00866 + PSI-MOD + + + MOD:00288 + pyrroloquinoline quinone + + A protein modification that effectively doubly cross-links an L-glutamic acid residue and an L-tyrosine residue with a carbon-carbon bond and a carbon-nitrogen bond to form pyrroloquinoline quinone. + + 18315 + ChEBI + + + 1310505 + PubMed + + + 7665488 + PubMed + + + AA0283 + RESID + + + Cross-link 2. + + 2,4,6-tricarboxylic-pyrrolo[2,3-5,6]quinoline 8,9-quinone + RESID-alternate + + + 2,7,9-tricarboxy-1H-pyrrolo(2,3-f)quinoline-4,5-dione + RESID-alternate + + + 4,5-dihydro-4,5-dioxo-1H-pyrrolo[2,3-5,6]quinoline-2,7,9-tricarboxylic acid + RESID-systematic + + + coenzyme PQQ + RESID-alternate + + + CROSSLNK Pyrroloquinoline quinone (Glu-Tyr) + UniProt-feature + + + methoxatin + RESID-alternate + + + pyrroloquinoline quinone + RESID-name + + + + DiffAvg + 37.92 + + + + DiffFormula + C 0 H -10 N 0 O 3 + + + + DiffMono + 37.906494 + + + + Formula + C 14 H 6 N 2 O 8 + + + + MassAvg + 330.21 + + + + MassMono + 330.012415 + + + + Origin + E, Y + + + + Source + natural + + + + TermSpec + none + + MOD:00692 + MOD:00906 + MOD:00919 + PSI-MOD + + + MOD:00289 + tris-L-cysteinyl L-N1'-histidino tetrairon tetrasulfide + + A protein modification that effectively converts three L-cysteine residues, an L-histidine residue and a four-iron four-sulfur cluster to tris-L-cysteinyl L-N1'-histidino tetrairon tetrasulfide. + + 9836629 + PubMed + + + AA0284 + RESID + + + Cross-link 4. + + METAL Iron-sulfur (4Fe-4S) + UniProt-feature + + + METAL Iron-sulfur (4Fe-4S); via tele nitrogen + UniProt-feature + + + tetra-mu3-sulfidotris(S-cysteinyliron)(N1'-histidinoiron) + RESID-systematic + + + tris-L-cysteinyl L-N1'-histidino tetrairon tetrasulfide + RESID-name + + + + DiffAvg + 347.59 + + + + DiffFormula + C 0 Fe 4 H -4 N 0 O 0 S 4 + + + + DiffMono + 347.597831 + + + + FormalCharge + 2- + + + + Formula + C 15 Fe 4 H 18 N 6 O 4 S 7 + + + + MassAvg + 794.15 + + + + MassMono + 793.684297 + + + + Origin + C, C, C, H + + + + Source + natural + + + + TermSpec + none + + MOD:00739 + MOD:00905 + MOD:00909 + PSI-MOD + + + MOD:00290 + tris-L-cysteinyl L-N3'-histidino tetrairon tetrasulfide + + A protein modification that effectively converts three L-cysteine residues, an L-histidine residue and a four-iron four-sulfur cluster to tris-L-cysteinyl L-N3'-histidino tetrairon tetrasulfide. + + 7854413 + PubMed + + + AA0285 + RESID + + + Cross-link 4. + + METAL Iron-sulfur (4Fe-4S) + UniProt-feature + + + METAL Iron-sulfur (4Fe-4S); via pros nitrogen + UniProt-feature + + + tetra-mu3-sulfidotris(S-cysteinyliron)(N3'-histidinoiron) + RESID-systematic + + + tris-L-cysteinyl L-N3'-histidino tetrairon tetrasulfide + RESID-name + + + + DiffAvg + 347.59 + + + + DiffFormula + C 0 Fe 4 H -4 N 0 O 0 S 4 + + + + DiffMono + 347.597831 + + + + FormalCharge + 2- + + + + Formula + C 15 Fe 4 H 18 N 6 O 4 S 7 + + + + MassAvg + 794.15 + + + + MassMono + 793.684297 + + + + Origin + C, C, C, H + + + + Source + natural + + + + TermSpec + none + + MOD:00739 + MOD:00905 + MOD:00909 + PSI-MOD + + + MOD:00291 + tris-L-cysteinyl L-aspartato tetrairon tetrasulfide + + A protein modification that effectively converts three L-cysteine residues, an L-aspartic acid residue and a four-iron four-sulfur cluster to tris-L-cysteinyl L-aspartato tetrairon tetrasulfide. + + 7819255 + PubMed + + + 9283079 + PubMed + + + AA0286 + RESID + + + Cross-link 4. + + METAL Iron-sulfur (4Fe-4S) + UniProt-feature + + + tetra-mu3-sulfidotris(S-cysteinyliron)(O4-aspartatoiron) + RESID-systematic + + + tris-L-cysteinyl L-aspartato tetrairon tetrasulfide + RESID-name + + + + DiffAvg + 347.59 + + + + DiffFormula + C 0 Fe 4 H -4 N 0 O 0 S 4 + + + + DiffMono + 347.597831 + + + + FormalCharge + 2- + + + + Formula + C 13 Fe 4 H 16 N 4 O 6 S 7 + + + + MassAvg + 772.09 + + + + MassMono + 771.652328 + + + + Origin + C, C, C, D + + + + Source + natural + + + + TermSpec + none + + MOD:00739 + MOD:00904 + MOD:00905 + PSI-MOD + + + MOD:00292 + N6-pyruvic acid 2-iminyl-L-lysine + + A protein modification that effectively converts an L-lysine residue to N6-pyruvic acid 2-iminyl-L-lysine. + + 1463470 + PubMed + + + 7853400 + PubMed + + + 9047371 + PubMed + + + AA0287 + RESID + + + 422#K + UniMod + + + + (2S)-2-amino-6-([1-carboxyethylidene]amino)hexanoic acid + RESID-systematic + + + ACT_SITE Schiff-base intermediate with substrate + UniProt-feature + + + N-pyruvic acid 2-iminyl + UniMod-description + + + N6-pyruvic acid 2-iminyl-L-lysine + RESID-name + + + PyruvicAcidIminyl + PSI-MS-label + + + + DiffAvg + 70.05 + + + + DiffFormula + C 3 H 2 N 0 O 2 + + + + DiffMono + 70.005479 + + + + Formula + C 9 H 14 N 2 O 3 + + + + MassAvg + 198.22 + + + + MassMono + 198.100442 + + + + Origin + K + + + + Source + natural + + + + TermSpec + none + + MOD:00912 + MOD:01170 + PSI-MOD + + + MOD:00293 + tris-L-cysteinyl L-serinyl tetrairon tetrasulfide + + A protein modification that effectively converts three L-cysteine residues, an L-serine residue and a four-iron four-sulfur cluster to tris-L-cysteinyl L-serinyl tetrairon tetrasulfide. + + AA0288 + RESID + + + Cross-link 4. + + tetra-mu3-sulfidotris(S-cysteinyliron)(O3-serinyliron) + RESID-systematic + + + tris-L-cysteinyl L-serinyl tetrairon tetrasulfide + RESID-name + + + + DiffAvg + 347.59 + + + + DiffFormula + C 0 Fe 4 H -4 N 0 O 0 S 4 + + + + DiffMono + 347.597831 + + + + FormalCharge + 2- + + + + Formula + C 12 Fe 4 H 16 N 4 O 5 S 7 + + + + MassAvg + 744.08 + + + + MassMono + 743.657414 + + + + Origin + C, C, C, S + + + + Source + hypothetical + + + + TermSpec + none + + MOD:00739 + MOD:00905 + MOD:00916 + PSI-MOD + + + MOD:00294 + bis-L-cysteinyl L-N3'-histidino L-serinyl tetrairon tetrasulfide + + A protein modification that effectively converts two L-cysteine residues, an L-histidine residues, an L-serine residue and a four-iron four-sulfur cluster to bis-L-cysteinyl L-N3'-histidino L-serinyl tetrairon tetrasulfide. + + AA0289 + RESID + + + Cross-link 4. + + bis-L-cysteinyl L-N3'-histidino L-serinyl tetrairon tetrasulfide + RESID-name + + + METAL Iron-sulfur (4Fe-4S) + UniProt-feature + + + METAL Iron-sulfur (4Fe-4S); via pros nitrogen + UniProt-feature + + + tetra-mu3-sulfidobis(S-cysteinyliron)(N3'-histidinoiron)(O3-serinyliron) + RESID-systematic + + + + DiffAvg + 347.59 + + + + DiffFormula + C 0 Fe 4 H -4 N 0 O 0 S 4 + + + + DiffMono + 347.597831 + + + + FormalCharge + 2- + + + + Formula + C 15 Fe 4 H 18 N 6 O 5 S 6 + + + + MassAvg + 778.09 + + + + MassMono + 777.707141 + + + + Origin + C, C, H, S + + + + Source + hypothetical + + + + TermSpec + none + + MOD:00739 + MOD:00905 + MOD:00909 + MOD:00916 + PSI-MOD + + + MOD:00295 + O-octanoyl-L-serine + + A protein modification that effectively converts an L-serine residue to O-octanoyl-L-serine. + + 10604470 + PubMed + + + 12716131 + PubMed + + + AA0290 + RESID + + + 426#S + UniMod + + + PSI-MOD-slim + + (2S)-2-amino-3-(octanoyloxy)propanoic acid + RESID-systematic + + + L-serine octanoate ester + RESID-alternate + + + LIPID O-octanoyl serine + UniProt-feature + + + O-octanoyl-L-serine + RESID-name + + + O-octanoylated L-serine + PSI-MOD-alternate + + + O3-octanoyl-L-serine + RESID-alternate + + + Octanoyl + PSI-MS-label + + + octanoyl + UniMod-description + + + OOctSer + PSI-MOD-label + + + + DiffAvg + 126.20 + + + + DiffFormula + C 8 H 14 N 0 O 1 + + + + DiffMono + 126.104465 + + + + Formula + C 11 H 19 N 1 O 3 + + + + MassAvg + 213.28 + + + + MassMono + 213.136493 + + + + Origin + S + + + + Source + natural + + + + TermSpec + none + + MOD:00669 + MOD:00916 + PSI-MOD + + + MOD:00296 + O-D-glucuronosyl-L-serine + + A protein modification that effectively converts an L-serine residue to O-D-glucuronosyl-L-serine. + + 10858503 + PubMed + + + 12716131 + PubMed + + + 7398618 + PubMed + + + AA0291 + RESID + + + 54#S + UniMod + + + PSI-MOD-slim + + (2S)-2-amino-3-(beta-D-glucopyranuronosyl)propanoic acid + RESID-systematic + + + CARBOHYD O-linked (GlcA) + UniProt-feature + + + Glucuronyl + PSI-MS-label + + + N-glucuronylation + UniMod-description + + + O-D-glucuronosyl-L-serine + RESID-name + + + O3-D-glucuronosyl-L-serine + RESID-alternate + + + + DiffAvg + 176.12 + + + + DiffFormula + C 6 H 8 N 0 O 6 + + + + DiffMono + 176.032088 + + + + Formula + C 9 H 13 N 1 O 8 + + + + MassAvg + 263.20 + + + + MassMono + 263.064116 + + + + Origin + S + + + + Source + natural + + + + TermSpec + none + + MOD:00447 + MOD:00916 + PSI-MOD + + + MOD:00297 + tris-L-cysteinyl L-cysteine persulfido bis-L-glutamato L-histidino nickel triiron disulfide trioxide + + A protein modification that effectively converts four L-cysteine residues, two L-glutamic acid residues, an L-histidine residue and a three-iron three-sulfur three-oxygen cluster to tris-L-cysteinyl L-cysteine persulfido bis-L-glutamato L-histidino nickel triiron disulfide trioxide. + + AA0292 + RESID + + + Cross-link 7; secondary to RESID:AA0269. This is a deprecated entry in RESID. It probably does not occur naturally [JSG]. + + carbon monoxide dehydrogenase nickel-iron cofactor + RESID-alternate + + + hybrid nickel-triiron cluster + RESID-alternate + + + mu-1:2kappaO-oxido-mu-1:3kappaO-oxido-mu-2:4kappaO-oxido-mu-3:4kappaS-sulfido-mu3-2:3:4kappaS-sulfido-S-cysteinyl-N1'-histidino-O5-glutamato 1-iron-S5-cysteine persulfido-O5-glutamato 2-nickel-3,4-bis-(S-cysteinyl iron) + RESID-systematic + + + Ni-3Fe-2S-3O cluster + RESID-alternate + + + tris-L-cysteinyl L-cysteine persulfido bis-L-glutamato L-histidino nickel triiron disulfide trioxide + RESID-name + + + + DiffAvg + 363.35 + + + + DiffFormula + C 0 Fe 3 H -7 N 0 Ni 1 O 3 S 3 + + + + DiffMono + 362.586337 + + + + Formula + C 28 Fe 3 H 34 N 9 Ni 1 O 14 S 7 + + + + MassAvg + 1171.28 + + + + MassMono + 1169.767174 + + + + Origin + C, C, C, C, E, E, H + + + + Source + artifact + + + + TermSpec + none + + MOD:00739 + MOD:00741 + MOD:00905 + MOD:00906 + MOD:00909 + PSI-MOD + + + MOD:00298 + tris-L-cysteinyl L-cysteine persulfido L-glutamato L-histidino L-serinyl nickel triiron disulfide trioxide + + A protein modification that effectively converts four L-cysteine residues, an L-glutamic acid residue, an L-histidine residue, an L-serine residue and a one-nickel three-iron three-sulfur three-oxygen cluster to tris-L-cysteinyl L-cysteine persulfido L-glutamato L-histidino L-serinyl nickel triiron disulfide trioxide. + + 2550436 + PubMed + + + AA0293 + RESID + + + Cross-link 7; secondary to RESID:AA0269. This is a deprecated entry in RESID. It probably does not occur naturally [JSG]. + + carbon monoxide dehydrogenase nickel-iron cofactor + RESID-alternate + + + hybrid nickel-triiron cluster + RESID-alternate + + + mu-1:2kappaO-oxido-mu-1:3kappaO-oxido-mu-2:4kappaO-oxido-mu-3:4kappaS-sulfido-mu3-2:3:4kappaS-sulfido-S-cysteinyl-N1'-histidino-O5-glutamato 1-iron-S5-cysteine persulfido-O3-serinyl 2-nickel-3,4-bis-(S-cysteinyl iron) + RESID-systematic + + + Ni-3Fe-2S-3O cluster + RESID-alternate + + + tris-L-cysteinyl L-cysteine persulfido L-glutamato L-histidino L-serinyl nickel triiron disulfide trioxide + RESID-name + + + + DiffAvg + 363.35 + + + + DiffFormula + C 0 Fe 3 H -7 N 0 Ni 1 O 3 S 3 + + + + DiffMono + 362.586337 + + + + Formula + C 26 Fe 3 H 32 N 9 Ni 1 O 13 S 7 + + + + MassAvg + 1129.24 + + + + MassMono + 1127.756609 + + + + Origin + C, C, C, C, E, H, S + + + + Source + artifact + + + + TermSpec + none + + MOD:00739 + MOD:00741 + MOD:00905 + MOD:00906 + MOD:00909 + MOD:00916 + PSI-MOD + + + MOD:00299 + N6-(L-isoaspartyl)-L-lysine (Asn) + + A protein modification that effectively crosslinks an L-asparagine residue and an L-lysine residue by an isopeptide bond with the formation of N6-(L-isoaspartyl)-L-lysine and the release of ammonia. + + 21862 + ChEBI + + + 0 + DeltaMass + + + 11000116 + PubMed + + + 6503713 + PubMed + + + AA0294 + RESID + + + Cross-link 2. + + (2S)-2-amino-6-([(3S)-3-amino-3-carboxypropanoyl]amino)hexanoic acid + RESID-systematic + + + beta-(N6-lysyl)aspartyl acid + RESID-alternate + + + CROSSLNK Isoaspartyl lysine isopeptide (Lys-Asn) + UniProt-feature + + + isoaspartyl N6-lysine + RESID-alternate + + + N(epsilon)-(beta-aspartyl)lysine + RESID-alternate + + + N-(beta-Aspartyl)-Lysine (Crosslink) + DeltaMass-label + + + N6-(L-isoaspartyl)-L-lysine + RESID-name + + + XLNK-4Asp-N6Lys(Asn) + PSI-MOD-label + + + + DiffAvg + -17.03 + + + + DiffFormula + C 0 H -3 N -1 O 0 + + + + DiffMono + -17.026549 + + + + Formula + C 10 H 15 N 3 O 3 + + + + MassAvg + 225.25 + + + + MassMono + 225.111341 + + + + Origin + K, N + + + + Source + natural + + + + TermSpec + none + + MOD:00903 + MOD:00946 + MOD:01929 + PSI-MOD + + + MOD:00300 + L-glutamyl-5-poly(ADP-ribose) + + A protein modification that effectively converts an L-glutamic acid residue to L-glutamyl-5-poly(ADP-ribose). + + 0 + DeltaMass + + + 11246023 + PubMed + + + 15842200 + PubMed + + + 8533153 + PubMed + + + AA0295 + RESID + + + 213#E + UniMod + + + + (S)-2-amino-5-poly[2'-adenosine 5'-(trihydrogen diphosphate) 5'->5'-ester with 1alpha-D-ribofuranosyl]oxy-5-oxopentanoic acid + RESID-systematic + + + ADP Ribose addition + UniMod-description + + + ADP-Ribosyl + PSI-MS-label + + + L-glutamyl-5-poly(ADP-ribose) + RESID-name + + + L-isoglutamyl-poly(ADP-ribose) + RESID-alternate + + + MOD_RES PolyADP-ribosyl glutamic acid + UniProt-feature + + + O-ADP-ribosylation (on Glutamate or C terminus) + DeltaMass-label + + + + DiffAvg + 541.30 + + + + DiffFormula + C 15 H 21 N 5 O 13 P 2 + + + + DiffMono + 541.061109 + + + + Formula + C 20 H 28 N 6 O 16 P 2 + + + + MassAvg + 670.42 + + + + MassMono + 670.103702 + + + + Origin + E + + + + Source + natural + + + + TermSpec + none + + MOD:00752 + MOD:00906 + PSI-MOD + + + MOD:00301 + O-(N-acetylglucosamine-1-phosphoryl)-L-serine + + A protein modification that effectively converts an L-serine residue to O-(N-acetylglucosamine-1-phosphoryl)-L-serine. + + 0 + DeltaMass + + + 6438439 + PubMed + + + 6993483 + PubMed + + + 8631906 + PubMed + + + AA0296 + RESID + + + 428 + UniMod + + + + (2S)-2-amino-3-[([(2-acetamido-2-deoxy-alpha-D-glucopyranosyl)oxy][hydroxy]phosphoryl)oxy]propanoic acid + RESID-systematic + + + N-acetylglucosamine-1-phosphoryl + UniMod-description + + + O-(N-acetylglucosamine-1-phosphoryl)-L-serine + RESID-name + + + O-beta(N-acetyl-glucosamine-alpha1-phosphate)serine + RESID-alternate + + + O-GlcNAc-1-phosphorylation (of Serine) + DeltaMass-label + + + O3-(N-acetylglucosamine-1-phosphoryl)-L-serine + RESID-alternate + + + O3-L-serine 2-(acetylamino)-2-deoxy-D-glucopyranose 1-phosphodiester + RESID-alternate + + + PhosphoHexNAc + PSI-MS-label + + + + DiffAvg + 283.17 + + + + DiffFormula + C 8 H 14 N 1 O 8 P 1 + + + + DiffMono + 283.045703 + + + + Formula + C 11 H 19 N 2 O 10 P 1 + + + + MassAvg + 370.25 + + + + MassMono + 370.077731 + + + + Origin + S + + + + Source + natural + + + + TermSpec + none + + MOD:00916 + MOD:01804 + PSI-MOD + + + MOD:00302 + O-(phosphoglycosyl-D-mannose-1-phosphoryl)-L-serine + + A protein modification that effectively converts an L-serine residue to O-(phosphoglycosyl-D-mannose-1-phosphoryl)-L-serine. + + 10037765 + PubMed + + + 15649890 + PubMed + + + AA0297 + RESID + + + 429 + UniMod + + + + O-(alpha-D-mannosyl-1-phosphoryl)-L-serine + RESID-alternate + + + O-(D-mannose-1-phosphoryl)-L-serine + RESID-name + + + O-[alpha-D-mannopyranosyloxy(hydroxy)phosphoryl]-L-serine + RESID-systematic + + + O3-(D-mannose-1-phosphoryl)-L-serine + RESID-alternate + + + O3-L-serine alpha-D-mannopyranose 1-phosphodiester + RESID-alternate + + + phosphoglycosyl-D-mannose-1-phosphoryl + UniMod-description + + + PhosphoHex + PSI-MS-label + + + + DiffAvg + 242.12 + + + + DiffFormula + C 6 H 11 N 0 O 8 P 1 + + + + DiffMono + 242.019154 + + + + Formula + C 9 H 16 N 1 O 10 P 1 + + + + MassAvg + 329.20 + + + + MassMono + 329.051182 + + + + Origin + S + + + + Source + natural + + + + TermSpec + none + + MOD:00916 + MOD:01804 + PSI-MOD + + + MOD:00303 + heptakis-L-histidino tetracopper mu4-sulfide hydroxide + + A protein modification that effectively converts seven L-histidinine residues and a four-copper one-sulfur one-hydroxide cluster to heptakis-L-histidino tetracopper mu4-sulfide hydroxide. + + 11024061 + PubMed + + + 11041839 + PubMed + + + AA0298 + RESID + + + Cross-link 7. + + heptakis-L-histidino tetracopper mu4-sulfide hydroxide + RESID-name + + + mu4-sulfido bis(bis-N1'-histidino copper)(N1'-histidino-N3'-histidino copper)(N3'-histidino hydroxide copper) + RESID-systematic + + + nitrous oxide reductase nosZ CuZ cluster + RESID-alternate + + + pentakis-L-N1'-histidino-bis-L-N3'-histidino tetracopper sulfide hydroxide + RESID-alternate + + + + DiffAvg + 296.19 + + + + DiffFormula + C 0 Cu 4 H -6 N 0 O 1 S 1 + + + + DiffMono + 293.638425 + + + + Formula + C 42 Cu 4 H 43 N 21 O 8 S 1 + + + + MassAvg + 1256.19 + + + + MassMono + 1253.050808 + + + + Origin + H, H, H, H, H, H, H + + + + Source + natural + + + + TermSpec + none + + MOD:00742 + MOD:00860 + MOD:00909 + PSI-MOD + + + MOD:00304 + L-leucine methyl ester + + A protein modification that effectively converts an L-leucine residue to L-leucine methyl ester. + + 10191253 + PubMed + + + 11875433 + PubMed + + + 8206937 + PubMed + + + AA0299 + RESID + + + 34#C-term + UniMod + + + incidental to RESID:AA0039 + PSI-MOD-slim + + 2-amino-4-methylpentanoic methyl ester + RESID-alternate + + + alpha-aminoisocaproic methyl ester + RESID-alternate + + + L-leucine methyl ester + RESID-name + + + Methyl + PSI-MS-label + + + methyl (2S)-2-amino-4-methylpentanoate + RESID-systematic + + + methyl esterified L-leucine + PSI-MOD-alternate + + + methyl L-leucinate + RESID-alternate + + + Methylation + UniMod-description + + + MOD_RES Leucine methyl ester + UniProt-feature + + + OMeLeu + PSI-MOD-label + + + + DiffAvg + 14.03 + + + + DiffFormula + C 1 H 2 N 0 O 0 + + + + DiffMono + 14.015650 + + + + Formula + C 7 H 14 N 1 O 2 + + + + MassAvg + 144.19 + + + + MassMono + 144.102454 + + + + Origin + L + + + + Source + natural + + + + TermSpec + C-term + + MOD:00599 + MOD:00662 + MOD:01689 + PSI-MOD + + + MOD:00305 + hexakis-L-cysteinyl L-serinyl octairon heptasulfide + + A protein modification that effectively converts six L-cysteine residues, an L-serine residue and a eight-iron seven-sulfur cluster to hexakis-L-cysteinyl L-serinyl octairon heptasulfide. + + 10525412 + PubMed + + + 12215645 + PubMed + + + 9063865 + PubMed + + + AA0300 + RESID + + + Cross-link 7; incidental to RESID:AA0141. + + Cys6Ser-[8Fe7S] + PSI-MOD-label + + + hexakis-L-cysteinyl L-serinyl octairon heptasulfide + RESID-name + + + METAL Iron-sulfur (8Fe-7S) + UniProt-feature + + + nitrogenase P-cluster + RESID-alternate + + + + DiffAvg + 663.12 + + + + DiffFormula + C 0 Fe 8 H -8 N 0 O 0 S 7 + + + + DiffMono + 663.223042 + + + + FormalCharge + 3- + + + + Formula + C 21 Fe 8 H 27 N 7 O 8 S 13 + + + + MassAvg + 1369.03 + + + + MassMono + 1368.310179 + + + + Origin + C, C, C, C, C, C, S + + + + Source + natural + + + + TermSpec + none + + MOD:00739 + MOD:00905 + MOD:00916 + PSI-MOD + + + MOD:00306 + residues isobaric at 113.084064 Da + + Natural or modified residues with a mass of 113.084064 Da. + + 10523135 + PubMed + + + AA0301 + RESID + + + PSI-MOD-slim + + L-isoleucine or L-leucine + RESID-name + + + Xle + PSI-MOD-label + + + + DiffAvg + 0.00 + + + + DiffFormula + C 0 H 0 N 0 O 0 + + + + DiffMono + 0.000000 + + + + Formula + C 6 H 11 N 1 O 1 + + + + MassAvg + 113.16 + + + + MassMono + 113.084064 + + + + Origin + X + + + + Source + none + + + + TermSpec + none + + MOD:00569 + MOD:00624 + PSI-MOD + + + MOD:00307 + L-aspartimide + + A protein modification that effectively cyclizes an L-asparagine residue to form a carboxyl-terminal L-aspartimide. + + 18 + DeltaMass + + + 12771378 + PubMed + + + 2378679 + PubMed + + + 7662664 + PubMed + + + 7988548 + PubMed + + + 9309583 + PubMed + + + AA0302 + RESID + + + 23#N + UniMod + + + From DeltaMass: Average Mass: -17 Average Mass Change:-17 References:Clarke, S., Lability of Aspargine and Aspartic Acid Residues in Protein and Peptides, in: Stability of Protein Pharmaceuticals : Chemical and Physical Paths of Protein Degradation, Part A (T.J. Ahern and M.C. Manning, eds.), 1992,Plenum Press, New York, pp.1-29Xie, M.; Vander Velde, D.; Morton, M.; Borchardt, R.T.; Schowen,R.L.: pH-Induced Change in the Rate-Determining Step for the Hydrolysis of the Asp/Asn-Derived Cyclic-Imide Intermediate in Protein Degradation. (1996) J. Am. Chem. Soc. 118: 8955-8956. + + (3S)-3-amino-2,5-pyrrolidinedione + RESID-systematic + + + 2-amino-butanimide + RESID-alternate + + + alpha-aminosuccinimide + RESID-alternate + + + ASI + RESID-alternate + + + Dehydrated + UniMod-interim + + + Dehydration + UniMod-description + + + L-2-aminosuccinimide + RESID-alternate + + + L-3-aminosuccinimide + RESID-misnomer + + + L-asparaginimide + RESID-alternate + + + L-aspartimide + RESID-name + + + Succinimide formation from asparagine + DeltaMass-label + + + + DiffAvg + -18.02 + + + + DiffFormula + C 0 H -2 N 0 O -1 + + + + DiffMono + -18.010565 + + + + Formula + C 4 H 5 N 2 O 2 + + + + MassAvg + 113.10 + + + + MassMono + 113.035102 + + + + Origin + N + + + + Source + natural + + + + TermSpec + C-term + + MOD:00601 + MOD:00704 + MOD:00903 + PSI-MOD + + + MOD:00308 + L-glutamimide + + A protein modification that effectively cyclizes an L-glutamine residue to form a carboxyl-terminal L-glutamimide. + + 12771378 + PubMed + + + 14593103 + PubMed + + + AA0303 + RESID + + + 23#Q + UniMod + + + + (3S)-3-aminopiperidine-2,6-dione + RESID-systematic + + + 2-aminopentanimide + RESID-alternate + + + 3-amino-2,6-piperidinedione + RESID-alternate + + + alpha-aminoglutarimide + RESID-alternate + + + Dehydrated + UniMod-interim + + + Dehydration + UniMod-description + + + L-glutamimide + RESID-name + + + + DiffAvg + -18.02 + + + + DiffFormula + C 0 H -2 N 0 O -1 + + + + DiffMono + -18.010565 + + + + Formula + C 5 H 7 N 2 O 2 + + + + MassAvg + 127.12 + + + + MassMono + 127.050752 + + + + Origin + Q + + + + Source + hypothetical + + + + TermSpec + C-term + + MOD:00601 + MOD:00704 + MOD:00907 + PSI-MOD + + + MOD:00309 + L-beta-carboxyaspartic acid + + A protein modification that effectively converts an L-aspartic acid residue to L-beta-carboxyaspartic acid. + + 6390094 + PubMed + + + 7138832 + PubMed + + + 7457858 + PubMed + + + 8135347 + PubMed + + + AA0304 + RESID + + + 299#D + UniMod + + + References to this modification as a gamma-carboxylation are in error [JSG]. + + (2S)-2-aminoethane-1,1,2-tricarboxylic acid + RESID-systematic + + + 2-amino-3-carboxybutanedioic acid + RESID-alternate + + + 3-carboxy-L-aspartic acid + RESID-name + + + 3-carboxyaspartic acid + RESID-alternate + + + 3CbxAsp + PSI-MOD-label + + + beta-carboxyaspartic acid + RESID-alternate + + + Carboxy + PSI-MS-label + + + Carboxy + UniMod-interim + + + Carboxylation + UniMod-description + + + gammacarboxyld + OMSSA-label + + + + DiffAvg + 44.01 + + + + DiffFormula + C 1 H 0 N 0 O 2 + + + + DiffMono + 43.989829 + + + + Formula + C 5 H 5 N 1 O 5 + + + + MassAvg + 159.10 + + + + MassMono + 159.016772 + + + + Origin + D + + + + Source + hypothetical + + + + TermSpec + none + + MOD:00904 + MOD:01152 + PSI-MOD + + + MOD:00310 + N5-methyl-L-arginine + + A protein modification that effectively converts an L-arginine residue to N5-methyl-L-arginine. + + 11875433 + PubMed + + + 9792625 + PubMed + + + 9873020 + PubMed + + + AA0305 + RESID + + + + (2S)-2-amino-5-(N-methylcarbamimidamido)pentanoic acid + RESID-systematic + + + delta-N-methylarginine + RESID-alternate + + + Methyl + PSI-MS-label + + + Methylation + UniMod-description + + + MOD_RES N5-methylarginine + UniProt-feature + + + N5-carbamimidoyl-N5-methyl-L-ornithine + RESID-alternate + + + N5-methyl-L-arginine + RESID-name + + + N5-methylated L-arginine + PSI-MOD-alternate + + + N5Me1Arg + PSI-MOD-label + + + + DiffAvg + 14.03 + + + + DiffFormula + C 1 H 2 N 0 O 0 + + + + DiffMono + 14.015650 + + + + Formula + C 7 H 14 N 4 O 1 + + + + MassAvg + 170.22 + + + + MassMono + 170.116761 + + + + Origin + R + + + + Source + hypothetical + + + + TermSpec + none + + MOD:00414 + MOD:00602 + PSI-MOD + + + MOD:00311 + L-cysteine coenzyme A disulfide + + A protein modification that effectively converts an L-cysteine residue to L-cysteine coenzyme A disulfide. + + 0 + DeltaMass + + + 1734967 + PubMed + + + AA0306 + RESID + + + 281#C + UniMod + + + DeltaMass gives no formula with mass as 454. + + (2R)-2-amino-3-(2-((3-(((2R)-2,4-dihydroxy-3,3-dimethyl-1-oxobutyl)amino)-1-oxopropyl)amino)ethyl)dithio-propanoic acid 4'-ester with adenosine 5'-(trihydrogen diphosphate) 3'-(dihydrogen phosphate) + RESID-systematic + + + coenzyme A L-cysteine mixed disulfide + RESID-alternate + + + CoenzymeA + PSI-MS-label + + + Cysteine modified Coenzyme A + UniMod-description + + + L-cysteine coenzyme A disulfide + RESID-name + + + SCoACys + PSI-MOD-label + + + + DiffAvg + 765.52 + + + + DiffFormula + C 21 H 34 N 7 O 16 P 3 S 1 + + + + DiffMono + 765.099559 + + + + Formula + C 24 H 39 N 8 O 17 P 3 S 2 + + + + MassAvg + 868.66 + + + + MassMono + 868.108744 + + + + Origin + C + + + + Source + hypothetical + + + + TermSpec + none + + MOD:00861 + MOD:00905 + MOD:01862 + PSI-MOD + + + MOD:00312 + S-myristoyl-L-cysteine + + A protein modification that effectively converts an L-cysteine residue to S-myristoyl-L-cysteine. + + 10026218 + PubMed + + + 10080938 + PubMed + + + 8824274 + PubMed + + + AA0307 + RESID + + + 45#C + UniMod + + + + (R)-2-amino-3-(tetradecanoylsulfanyl)propanoic acid + RESID-systematic + + + LIPID S-myristoyl cysteine + UniProt-feature + + + Myristoyl + PSI-MS-label + + + Myristoylation + UniMod-description + + + S-(C14:1 aliphatic acyl)cysteine + PSI-MOD-alternate + + + S-myristoyl-L-cysteine + RESID-name + + + S-myristoylated L-cysteine + PSI-MOD-alternate + + + SMyrCys + PSI-MOD-label + + + tetradecanoate cysteine thioester + RESID-alternate + + + + DiffAvg + 210.36 + + + + DiffFormula + C 14 H 26 N 0 O 1 S 0 + + + + DiffMono + 210.198365 + + + + Formula + C 17 H 31 N 1 O 2 S 1 + + + + MassAvg + 313.50 + + + + MassMono + 313.207550 + + + + Origin + C + + + + Source + hypothetical + + + + TermSpec + none + + MOD:00655 + MOD:00905 + PSI-MOD + + + MOD:00313 + S-palmitoleyl-L-cysteine + + A protein modification that effectively converts an L-cysteine residue to S-palmitoleyl-L-cysteine. + + 8294460 + PubMed + + + AA0308 + RESID + + + 431#C + UniMod + + + + (R)-2-amino-3-((Z)-9-hexadecenoylsulfanyl)propanoic acid + RESID-systematic + + + cis-9-hexadecenoate cysteine thioester + RESID-alternate + + + mod187 + OMSSA-label + + + Palmitoleyl + PSI-MS-label + + + palmitoleyl + UniMod-description + + + S-palmitoleyl-L-cysteine + RESID-name + + + S-palmitoleylated L-cysteine + PSI-MOD-alternate + + + SPamD1Cys + PSI-MOD-label + + + + DiffAvg + 236.40 + + + + DiffFormula + C 16 H 28 N 0 O 1 S 0 + + + + DiffMono + 236.214016 + + + + Formula + C 19 H 33 N 1 O 2 S 1 + + + + MassAvg + 339.54 + + + + MassMono + 339.223200 + + + + Origin + C + + + + Source + hypothetical + + + + TermSpec + none + + MOD:00672 + MOD:00905 + MOD:01423 + PSI-MOD + + + MOD:00314 + glycine cholesterol ester + + A protein modification that effectively converts a glycine residue to glycine cholesterol ester. + + 11111088 + PubMed + + + 8824192 + PubMed + + + AA0309 + RESID + + + 432#C-term + UniMod + + + Incidental to RESID:AA0060. UniMod origin corrected [JSG]. + PSI-MOD-slim + + C-cholesterol + UniMod-interim + + + cholesterol ester + UniMod-description + + + cholesteryl glycinate + RESID-alternate + + + glycine cholest-5-en-3beta-ol ester + RESID-systematic + + + glycine cholesterol ester + RESID-name + + + hedgehog lipophilic adduct + RESID-alternate + + + LIPID Cholesterol glycine ester + UniProt-feature + + + + DiffAvg + 368.65 + + + + DiffFormula + C 27 H 44 N 0 O 0 + + + + DiffMono + 368.344301 + + + + Formula + C 29 H 48 N 1 O 2 + + + + MassAvg + 442.71 + + + + MassMono + 442.368505 + + + + Origin + G + + + + Source + natural + + + + TermSpec + C-term + + MOD:00908 + MOD:01155 + PSI-MOD + + + MOD:00315 + pentakis-L-cysteinyl L-histidino nickel tetrairon pentasulfide + + A protein modification that effectively converts five L-cysteine residues, an L-histidine residue and a one-nickel four-iron five-sulfur cluster to pentakis-L-cysteinyl L-histidino nickel tetrairon pentasulfide. + + 11509720 + PubMed + + + 2550436 + PubMed + + + AA0310 + RESID + + + Cross-link 6. + + carbon monoxide dehydrogenase nickel-iron cofactor + RESID-alternate + + + METAL Nickel-iron-sulfur (Ni-4Fe-5S) + UniProt-feature + + + METAL Nickel-iron-sulfur (Ni-4Fe-5S); via tele nitrogen + UniProt-feature + + + mu-1:2kappaS-sulfido-mu3-1:3:5kappaS-sulfido-mu3-2:3:4kappaS-sulfido-mu3-2:4:5kappaS-sulfido-mu3-3:4:5kappaS-sulfido-N1'-histidino-S-cysteinyl-1-iron-S-cysteinyl-2-nickel-3,4,5-tris-(S-cysteinyl iron) + RESID-systematic + + + Ni-4Fe-5S cluster + RESID-alternate + + + pentakis-L-cysteinyl L-histidino nickel tetrairon pentasulfide + RESID-name + + + + DiffAvg + 436.33 + + + + DiffFormula + C 0 Fe 4 H -6 N 0 Ni 1 O 0 S 5 + + + + DiffMono + 435.488498 + + + + Formula + C 21 Fe 4 H 26 N 8 Ni 1 O 6 S 10 + + + + MassAvg + 1089.16 + + + + MassMono + 1087.593333 + + + + Origin + C, C, C, C, C, H + + + + Source + natural + + + + TermSpec + none + + MOD:00739 + MOD:00741 + MOD:00905 + MOD:00909 + PSI-MOD + + + MOD:00316 + N4,N4-dimethyl-L-asparagine + + A protein modification that effectively converts an L-asparagine residue to N4,N4-dimethyl-L-asparagine. + + 12964758 + PubMed + + + 14570711 + PubMed + + + 8783012 + PubMed + + + AA0311 + RESID + + + 36#N + UniMod + + + + (2S)-2-amino-4-(dimethylamino)-4-oxobutanoic acid + RESID-systematic + + + 2-amino-N4,N4-dimethylbutanediamic acid + RESID-alternate + + + beta-dimethylasparagine + RESID-misnomer + + + di-Methylation + UniMod-description + + + Dimethyl + PSI-MS-label + + + MOD_RES N4,N4-dimethylasparagine + UniProt-feature + + + N(gamma),N(gamma)-dimethylasparagine + RESID-alternate + + + N4,N4-dimethyl-L-asparagine + RESID-name + + + N4,N4-dimethylated L-asparagine + PSI-MOD-alternate + + + N4Me2Asn + PSI-MOD-label + + + + DiffAvg + 28.05 + + + + DiffFormula + C 2 H 4 N 0 O 0 + + + + DiffMono + 28.031300 + + + + Formula + C 6 H 10 N 2 O 2 + + + + MassAvg + 142.16 + + + + MassMono + 142.074228 + + + + Origin + N + + + + Source + hypothetical + + + + TermSpec + none + + MOD:00429 + MOD:00602 + MOD:00673 + PSI-MOD + + + MOD:00317 + N6-3,4-didehydroretinylidene-L-lysine + + A protein modification that effectively converts an L-lysine residue to N6-3,4-didehydroretinylidene-L-lysine. + + 10717661 + PubMed + + + 3257009 + PubMed + + + 4056688 + PubMed + + + AA0312 + RESID + + + 433#K + UniMod + + + + (S)-2-amino-6-[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)-2,4,6,8-nonatetraenylidene]aminohexanoic acid + RESID-systematic + + + 3,4-didehydroretinylidene + UniMod-description + + + Didehydroretinylidene + PSI-MS-label + + + N6-(3,4-didehydroretinylidene)-L-lysine + RESID-name + + + N6-3-dehydroretinal-L-lysine + RESID-alternate + + + N6-3-dehydroretinyl-lysine + RESID-alternate + + + + DiffAvg + 264.41 + + + + DiffFormula + C 20 H 24 N 0 O 0 + + + + DiffMono + 264.187801 + + + + Formula + C 26 H 36 N 2 O 1 + + + + MassAvg + 392.59 + + + + MassMono + 392.282764 + + + + Origin + K + + + + Source + natural + + + + TermSpec + none + + MOD:00912 + PSI-MOD + + + MOD:00318 + 4'-(S-L-cysteinyl)-L-tryptophyl quinone + + A protein modification that effectively cross-links an L-cysteine residue and an L-tryptophan residue by a thioether bond to form 4'-(S-L-cysteinyl)-L-tryptophyl quinone. + + 11555656 + PubMed + + + 11717396 + PubMed + + + AA0313 + RESID + + + Cross-link 2; secondary to RESID:AA0148. + + (2R)-2-amino-3-[(3-[(2S)-2-amino-2-carboxyethyl]-6,7-dioxo-6,7-dihydro-1H-indol-4-yl)sulfanyl]propanoic acid + RESID-systematic + + + 3-(2-amino-2-carboxyethyl)-4-[2-amino-2-carboxyethyl]sulfanyl-6,7-indolinedione + RESID-alternate + + + 4'-(L-cystein-S-yl)-L-tryptophyl quinone + RESID-name + + + 4-(S-cysteinyl)tryptophan-6,7-dione + RESID-alternate + + + CROSSLNK 4'-cysteinyl-tryptophylquinone (Cys-Trp) + UniProt-feature + + + CTQ + RESID-alternate + + + cysteine tryptophylquinone + RESID-alternate + + + + DiffAvg + 27.97 + + + + DiffFormula + C 0 H -4 N 0 O 2 S 0 + + + + DiffMono + 27.958529 + + + + Formula + C 14 H 11 N 3 O 4 S 1 + + + + MassAvg + 317.32 + + + + MassMono + 317.047027 + + + + Origin + C, W + + + + Source + natural + + + + TermSpec + none + + MOD:00687 + MOD:00918 + PSI-MOD + + + MOD:00319 + 3-(S-L-cysteinyl)-L-aspartic acid + + A protein modification that effectively cross-links an L-cysteine residue and an L-aspartic acid residue by a thioether bond to form 2-(S-L-cysteinyl)-L-aspartic acid. + + 11555656 + PubMed + + + 11717396 + PubMed + + + AA0314 + RESID + + + Cross-link 2. + + (2R,3S)-2-amino-3-([(2R)-2-amino-2-carboxyethyl]sulfanyl)butanedioic acid + RESID-systematic + + + (2R,3S,6R)-2,6-diamino-3-carboxy-4-thiaheptanedioic acid + RESID-alternate + + + 3-(L-cystein-S-yl)-L-aspartic acid + RESID-name + + + 3-carboxy-L-lanthionine + RESID-alternate + + + CROSSLNK 3-cysteinyl-aspartic acid (Cys-Asp) + UniProt-feature + + + + DiffAvg + -2.02 + + + + DiffFormula + C 0 H -2 N 0 O 0 S 0 + + + + DiffMono + -2.015650 + + + + Formula + C 7 H 8 N 2 O 4 S 1 + + + + MassAvg + 216.21 + + + + MassMono + 216.020478 + + + + Origin + C, D + + + + Source + natural + + + + TermSpec + none + + MOD:00904 + MOD:01993 + PSI-MOD + + + MOD:00320 + 4-(S-L-cysteinyl)-L-glutamic acid + + A protein modification that effectively cross-links an L-cysteine residue and an L-glutamic acid residue by a thioether bond to form 4-(S-L-cysteinyl)-L-glutamic acid. + + 20293 + ChEBI + + + 11555656 + PubMed + + + 11717396 + PubMed + + + AA0315 + RESID + + + Cross-link 2. + + (2S,3S,7R)-2,7-diamino-4-carboxy-5-thiaoctanedioic acid + RESID-alternate + + + (2S,4S)-2-amino-4-[(R)-2-amino-2-carboxyethyl]sulfanylpentanedioic acid + RESID-systematic + + + 4-(L-cystein-S-yl)-L-glutamic acid + RESID-name + + + CROSSLNK 4-cysteinyl-glutamic acid (Cys-Glu) + UniProt-feature + + + + DiffAvg + -2.02 + + + + DiffFormula + C 0 H -2 N 0 O 0 S 0 + + + + DiffMono + -2.015650 + + + + Formula + C 8 H 10 N 2 O 4 S 1 + + + + MassAvg + 230.24 + + + + MassMono + 230.036128 + + + + Origin + C, E + + + + Source + natural + + + + TermSpec + none + + MOD:00687 + MOD:00906 + PSI-MOD + + + MOD:00321 + cis-14-hydroxy-10,13-dioxo-7-heptadecenoic acid L-aspartate ester + + A protein modification that effectively converts an L-aspartic acid residue to cis-14-hydroxy-10,13-dioxo-7-heptadecenoic acid L-aspartate ester. + + 11435437 + PubMed + + + 7949339 + PubMed + + + AA0316 + RESID + + + 434#D + UniMod + + + + (7Z,14Xi)-14-[(S)-3-amino-3-carboxy-propanoyl]oxy-10,13-dioxo-7-heptadecenoic acid + RESID-systematic + + + barley lipid transfer protein modification + RESID-alternate + + + CHDH + PSI-MS-label + + + cis-14-hydroxy-10,13-dioxo-7-heptadecenoic acid L-aspartate ester + RESID-name + + + cis-14-hydroxy-10,13-dioxo-7-heptadecenoic ester + UniMod-description + + + LIPID Cis-14-hydroxy-10,13-dioxo-7-heptadecenoic acid aspartate ester + UniProt-feature + + + + DiffAvg + 294.39 + + + + DiffFormula + C 17 H 26 N 0 O 4 + + + + DiffMono + 294.183109 + + + + Formula + C 21 H 31 N 1 O 7 + + + + MassAvg + 409.48 + + + + MassMono + 409.210052 + + + + Origin + D + + + + Source + natural + + + + TermSpec + none + + MOD:00904 + MOD:01155 + PSI-MOD + + + MOD:00322 + 1'-methyl-L-histidine + + A protein modification that effectively converts an L-histidine residue to tele-methyl-L-histidine. + + 10601317 + PubMed + + + 11474090 + PubMed + + + 11875433 + PubMed + + + 6692818 + PubMed + + + 8076 + PubMed + + + 8645219 + PubMed + + + AA0317 + RESID + + + PSI-MOD-slim + + (S)-2-amino-3-(1-methyl-1H-imidazol-4-yl)propanoic acid + RESID-systematic + + + 1'-methyl-L-histidine + RESID-name + + + 3-methylhistidine + RESID-misnomer + + + 4-methyl-histidine + RESID-misnomer + + + Methyl + PSI-MS-label + + + Methylation + UniMod-description + + + MOD_RES Tele-methylhistidine + UniProt-feature + + + N(epsilon)-methylhistidine + RESID-alternate + + + N(tau)-methylhistidine + RESID-alternate + + + NteleMeHis + PSI-MOD-label + + + tele-methylated L-histidine + PSI-MOD-alternate + + + tele-methylhistidine + RESID-alternate + + + + DiffAvg + 14.03 + + + + DiffFormula + C 1 H 2 N 0 O 0 + + + + DiffMono + 14.015650 + + + + Formula + C 7 H 9 N 3 O 1 + + + + MassAvg + 151.17 + + + + MassMono + 151.074562 + + + + Origin + H + + + + Source + natural + + + + TermSpec + none + + MOD:00724 + PSI-MOD + + + MOD:00323 + L-lysine methyl ester + + A protein modification that effectively converts an L-lysine residue to L-lysine methyl ester. + + 10973948 + PubMed + + + 11875433 + PubMed + + + AA0318 + RESID + + + 34#C-term + UniMod + + + PSI-MOD-slim + + 2,6-diaminohexanoic methyl ester + RESID-alternate + + + alpha,epsilon-diaminocaproic methyl ester + RESID-alternate + + + L-lysine methyl ester + RESID-name + + + Methyl + PSI-MS-label + + + methyl (S)-2,6-diaminohexanoate + RESID-systematic + + + methyl esterified L-lysine + PSI-MOD-alternate + + + methyl L-lysinate + RESID-alternate + + + Methylation + UniMod-description + + + MOD_RES Lysine methyl ester + UniProt-feature + + + OMeLys + PSI-MOD-label + + + + DiffAvg + 14.03 + + + + DiffFormula + C 1 H 2 N 0 O 0 + + + + DiffMono + 14.015650 + + + + Formula + C 7 H 15 N 2 O 2 + + + + MassAvg + 159.21 + + + + MassMono + 159.113353 + + + + Origin + K + + + + Source + natural + + + + TermSpec + C-term + + MOD:01683 + MOD:01689 + PSI-MOD + + + MOD:00324 + L-serinyl molybdenum bis(molybdopterin guanine dinucleotide) + + A protein modification that effectively converts an L-serine residue to L-serinyl molybdenum bis(molybdopterin guanine dinucleotide). + + 8658132 + PubMed + + + 8658134 + PubMed + + + AA0319 + RESID + + + + 2-amino-5,6-dimercapto-7-methyl-3,7,8a,9-tetrahydro-8-oxa-1,3,9,10-tetraazaanthracen-4-one guanosine dinucleotide + RESID-alternate + + + bis[8-amino-1a,2,4a,5,6,7,10-heptahydro-2-(trihydrogen diphosphate 5'-ester with guanosine)methyl-6-oxo-3,4-disulfanyl-pteridino[6,7-5,6]pyranoato-S3,S4]-O3-serinyl-molybdenum oxide + RESID-systematic + + + L-serinyl molybdenum bis(molybdopterin guanine dinucleotide) + RESID-name + + + + DiffAvg + 1588.01 + + + + DiffFormula + C 40 H 47 Mo 1 N 20 O 27 P 4 S 4 + + + + DiffMono + 1588.980690 + + + + Formula + C 43 H 52 Mo 1 N 21 O 29 P 4 S 4 + + + + MassAvg + 1675.09 + + + + MassMono + 1676.012718 + + + + Origin + S + + + + Source + natural + + + + TermSpec + none + + MOD:00744 + MOD:00916 + PSI-MOD + + + MOD:00325 + L-beta-methylthioasparagine + + A protein modification that effectively converts an L-asparagine residue to L-beta-methylthioasparagine. + + AA0320 + RESID + + + 39#N + UniMod + + + This modification was predicted for ribosomal protein S12 in Bacillus subtilis when the sequence in the original version of the genome was reported to have asparagine rather than aspartic acid at the position of the methylthioaspartic acid modification (see MOD:00237). Two groups independently confirmed that the genome sequence was incorrect. The sequence in the revised genome has aspartic acid at that position. This is a deprecated entry in RESID. It probably does not occur naturally [JSG]. + + (2R,3Xi)-2-amino-3-(methylsulfanyl)-4-butanediamic acid + RESID-systematic + + + 2,4-diamino-3-(methylsulfanyl)-4-oxobutanoic acid + RESID-alternate + + + 3-(methylthio)-L-asparagine + RESID-name + + + 3-carboxamido-S-methyl-cysteine + RESID-alternate + + + beta-(methylthio)asparagine + RESID-alternate + + + Beta-methylthiolation + UniMod-description + + + Methylthio + UniMod-interim + + + + DiffAvg + 46.09 + + + + DiffFormula + C 1 H 2 N 0 O 0 S 1 + + + + DiffMono + 45.987721 + + + + Formula + C 5 H 8 N 2 O 2 S 1 + + + + MassAvg + 160.19 + + + + MassMono + 160.030649 + + + + Origin + N + + + + Source + hypothetical + + + + TermSpec + none + + MOD:00903 + MOD:01153 + PSI-MOD + + + MOD:00326 + L-pyrrolysine (Lys) + + A protein modification that effectively converts an L-lysine residue to L-pyrrolysine (not known as a natural, post-translational modification process). + + 11435424 + PubMed + + + 12029131 + PubMed + + + 12029132 + PubMed + + + 15314242 + PubMed + + + 16096277 + PubMed + + + AA0321#LYS + RESID + + + 435#K + UniMod + + + This entry is for the artifactual formation of L-pyrrolysine from lysine. For encoded L-pyrrolysine, use MOD:01187 [JSG]. + + (2S)-2-amino-6-[(2R,3R)-3-methyl-3,4-dihydro-2H-pyrrol-2-ylcarbonyl]aminohexanoic acid + RESID-systematic + + + 2-azanyl-6-[(2R,3R)-3-methyl-3,4-dihydro-2H-pyrrol-2-ylcarbonyl]azanylhexanoic acid + RESID-alternate + + + L-pyrrolysine + RESID-name + + + monomethylamine methyltransferase cofactor lysine adduct + RESID-alternate + + + N6-(4-methyl-1,2-didehydropyrrolidine-5-carboxyl)-L-lysine + RESID-alternate + + + N6-(4-methyl-delta-1-pyrroline-5-carboxyl)-L-lysine + RESID-alternate + + + N6-([(2R,3R)-3-methyl-3,4-dihydro-2H-pyrrol-2-yl]carbonyl)-L-lysine + RESID-alternate + + + NON_STD Pyrrolysine + UniProt-feature + + + Pyl(Lys) + PSI-MOD-label + + + + DiffAvg + 109.13 + + + + DiffFormula + C 6 H 7 N 1 O 1 + + + + DiffMono + 109.052764 + + + + Formula + C 12 H 19 N 3 O 2 + + + + MassAvg + 237.30 + + + + MassMono + 237.147727 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00912 + MOD:01187 + PSI-MOD + + + MOD:00327 + 3-hydroxy-L-tryptophan + + A protein modification that effectively converts an L-tryptophan residue to a 3-hydroxy-L-tryptophan. + + 10024453 + PubMed + + + 11457355 + PubMed + + + AA0322 + RESID + + + + (2S,3S)-2-amino-3-hydroxy-3-(1H-indol-3-yl)propanoic acid + RESID-systematic + + + 3-hydroxy-L-tryptophan + RESID-name + + + 3-hydroxylated L-tryptophan + PSI-MOD-alternate + + + 3-hydroxytryptophan + RESID-alternate + + + 3HyTrp + PSI-MOD-label + + + beta-hydroxytryptophan + RESID-alternate + + + MOD_RES 3-hydroxytryptophan + UniProt-feature + + + + DiffAvg + 16.00 + + + + DiffFormula + C 0 H 0 N 0 O 1 + + + + DiffMono + 15.994915 + + + + Formula + C 11 H 10 N 2 O 2 + + + + MassAvg + 202.21 + + + + MassMono + 202.074228 + + + + Origin + W + + + + Source + hypothetical + + + + TermSpec + none + + MOD:01622 + PSI-MOD + + + MOD:00328 + O4'-(phospho-3'-DNA)-L-tyrosine + + A protein modification that effectively crosslinks an L-tyrosine residue and the 3'-end of DNA through a phosphodiester bond to form O4'-(phospho-3'-DNA)-L-tyrosine. + + 2211714 + PubMed + + + AA0323 + RESID + + + + (S)-2-amino-3-[4-(3'-deoxyribonucleic acid phosphonoxy)phenyl]propanoic acid + RESID-systematic + + + ACT_SITE O-(3'-phospho-DNA)-tyrosine intermediate + UniProt-feature + + + O4'-(phospho-3'-DNA)-L-tyrosine + RESID-name + + + O4'-L-tyrosine 3'-DNA phosphodiester + RESID-alternate + + + + DiffAvg + 79.98 + + + + DiffFormula + C 0 H 1 N 0 O 3 P 1 + + + + DiffMono + 79.966331 + + + + Formula + C 9 H 10 N 1 O 5 P 1 + + + + MassAvg + 243.15 + + + + MassMono + 243.029659 + + + + Origin + Y + + + + Source + natural + + + + TermSpec + none + + MOD:00750 + MOD:00919 + PSI-MOD + + + MOD:00329 + hydroxyheme-L-glutamate ester + + A protein modification that effectively results from forming an adduct between a glutamic acid residue and the porphyrin compound heme b, (7,12-diethenyl-3,8,13,17-tetramethylporphyrin-2,18-dipropanoato)iron. + + 11139583 + PubMed + + + 11821421 + PubMed + + + 11980497 + PubMed + + + AA0324 + RESID + + + 436#E + UniMod + + + + 5-hydroxymethyl protoporphyrin IX 5-glutamate ester + RESID-alternate + + + [3-[(S)-(4-amino-4-carboxy)butanoyloxymethyl]-7,12-diethenyl-8,13,17-trimethyl-21H,23H-porphine-2,18-bis(2-carboxyethyl)-N21,N22,N23,N24]-ferrate + RESID-systematic + + + BINDING Heme (covalent; via 1 link) + UniProt-feature + + + cytochrome P450 CYP4A family heme cofactor + RESID-alternate + + + Hydroxyheme + PSI-MS-label + + + hydroxyheme + UniMod-description + + + hydroxyheme-L-glutamate ester + RESID-name + + + + DiffAvg + 614.48 + + + + DiffFormula + C 34 Fe 1 H 30 N 4 O 4 + + + + DiffMono + 614.161643 + + + + Formula + C 39 Fe 1 H 37 N 5 O 7 + + + + MassAvg + 743.60 + + + + MassMono + 743.204236 + + + + Origin + E + + + + Source + natural + + + + TermSpec + none + + MOD:00699 + MOD:00906 + PSI-MOD + + + MOD:00330 + (phospho-5'-guanosine)-L-histidine + + A protein modification that effectively converts an L-histidine residue to a (phospho-5'-guanosine)-L-histidine. + + 10529169 + PubMed + + + 10869342 + PubMed + + + 7559521 + PubMed + + + AA0325 + RESID + + + 413#H + UniMod + + + + (2S)-2-amino-3-(1-(5'-adenosine phosphono)imidazol-4-yl)propanoic acid + RESID-systematic + + + 1'-(phospho-5'-guanosine)-L-histidine + RESID-name + + + ACT_SITE GMP-histidine intermediate + UniProt-feature + + + L-histidine 5'-guanosine phosphoramidester + RESID-alternate + + + L-histidine monoanhydride with 5'-guanylic acid + RESID-alternate + + + N(tau)-5'-guanylic-L-histidine + RESID-alternate + + + N1'-guanylylated histidine + RESID-alternate + + + phospho-guanosine + UniMod-description + + + Phosphoguanosine + PSI-MS-label + + + tele-5'-guanylic-L-histidine + RESID-alternate + + + + DiffAvg + 345.21 + + + + DiffFormula + C 10 H 12 N 5 O 7 P 1 + + + + DiffMono + 345.047434 + + + + Formula + C 16 H 19 N 8 O 8 P 1 + + + + MassAvg + 482.35 + + + + MassMono + 482.106346 + + + + Origin + H + + + + Source + natural + + + + TermSpec + none + + MOD:00909 + MOD:01163 + PSI-MOD + + + MOD:00331 + tetrakis-L-cysteinyl triiron tetrasulfide + + A protein modification that effectively converts four L-cysteine residues and a three-iron four-sulfur cluster to tetrakis-L-cysteinyl triiron tetrasulfide. + + 11592901 + PubMed + + + 11941493 + PubMed + + + 2511202 + PubMed + + + 6094558 + PubMed + + + AA0326 + RESID + + + Cross-link 4. + + bis[bis-L-cysteinyl iron disulfido]iron + RESID-alternate + + + di-mu-1:2kappaS-sulfido di-mu-2:3kappaS-sulfido iron bis(bis-S-cysteinyliron) + RESID-systematic + + + tetra-mu-sulfido tetrakis-S-L-cysteinyl triiron + RESID-alternate + + + tetrakis-L-cysteinyl linear [3Fe-4S] cluster + RESID-alternate + + + tetrakis-L-cysteinyl triiron tetrasulfide + RESID-name + + + tetrakis-L-cysteinyl triiron tetrasulfide D2 cluster + RESID-alternate + + + + DiffAvg + 291.74 + + + + DiffFormula + C 0 Fe 3 H -4 N 0 O 0 S 4 + + + + DiffMono + 291.663442 + + + + FormalCharge + 3- + + + + Formula + C 12 Fe 3 H 16 N 4 O 4 S 8 + + + + MassAvg + 704.30 + + + + MassMono + 703.700181 + + + + Origin + C, C, C, C + + + + Source + hypothetical + + + + TermSpec + none + + MOD:00739 + MOD:00905 + PSI-MOD + + + MOD:00332 + omega-N-glucosyl-L-arginine + + A protein modification that effectively converts an L-arginine residue to N4-glucosyl-arginine. + + 15279557 + PubMed + + + 8521968 + PubMed + + + 9536051 + PubMed + + + AA0327 + RESID + + + 41#R + UniMod + + + + (2S)-2-amino-5-(beta-D-glucopyranosyl[imino(methylamino)methyl]amino)pentanoic acid + RESID-systematic + + + Hex + PSI-MS-label + + + Hexose + UniMod-description + + + NG-beta-D-glucosylarginine + RESID-alternate + + + omega-N-(beta-D-glucosyl)-L-arginine + RESID-alternate + + + omega-N-glucosyl-L-arginine + RESID-name + + + omega-N-glycosyl-L-arginine + RESID-alternate + + + + DiffAvg + 162.14 + + + + DiffFormula + C 6 H 10 N 0 O 5 + + + + DiffMono + 162.052823 + + + + Formula + C 12 H 22 N 4 O 6 + + + + MassAvg + 318.33 + + + + MassMono + 318.153934 + + + + Origin + R + + + + Source + natural + + + + TermSpec + none + + MOD:00433 + MOD:00761 + MOD:01980 + PSI-MOD + + + MOD:00333 + (3-aminopropyl)(L-aspartyl-1-amino)phosphoryl-5'-adenosine + + A protein modification that effectively converts an L-asparagine residue to (3-aminopropyl)(L-aspartyl-1-amino)phosphoryl-5'-adenosine. + + 7559516 + PubMed + + + 7835418 + PubMed + + + 8183363 + PubMed + + + AA0328 + RESID + + + 437#C-term + UniMod + + + UniMod origin shown as C-term [JSG]. + + (3-aminopropyl)(L-aspartyl-1-amino)phosphoryl-5'-adenosine + RESID-name + + + (3-aminopropyl)(L-aspartyl-1-amino)phosphoryl-5-adenosine + UniMod-description + + + 5'-O-[(3-aminopropoxy)(L-aspart-1-ylamino)phosphoryl]adenosine + RESID-systematic + + + 9-(5'-O-[(3-aminopropoxy)(L-aspart-1-ylamino)phosphoryl]-beta-D-ribofuranosyl)adenine + RESID-alternate + + + C-Asn-deriv + UniMod-interim + + + microcin C7 asparagine modification + RESID-alternate + + + MOD_RES Aspartic acid 1-[(3-aminopropyl)(5'-adenosyl)phosphono]amide + UniProt-feature + + + N-(aspart-1-yl)-O-(3-aminopropyl)-O-(5'-adenosyl)phosphoramide + RESID-alternate + + + + DiffAvg + 386.30 + + + + DiffFormula + C 13 H 19 N 6 O 6 P 1 + + + + DiffMono + 386.110369 + + + + Formula + C 17 H 26 N 8 O 9 P 1 + + + + MassAvg + 517.42 + + + + MassMono + 517.156036 + + + + Origin + N + + + + Source + natural + + + + TermSpec + C-term + + MOD:00701 + MOD:00903 + PSI-MOD + + + MOD:00334 + 1'-heme-L-histidine + + A protein modification that effectively results from forming an adduct between the tele nitrogen of a histidine residue and the porphyrin compound heme b, (7,12-diethenyl-3,8,13,17-tetramethylporphyrin-2,18-dipropanoato)iron. + + 12033922 + PubMed + + + 12121092 + PubMed + + + AA0329 + RESID + + + 390#H + UniMod + + + + (S)-[7-ethenyl-12-[1-((2-amino-2-carboxyethyl)-1H-imidazol-1-yl)ethyl]-3,8,13,17-tetramethyl-21H,23H-porphine-2,18-bis(2-carboxyethyl)-N21,N22,N23,N24]-ferrate + RESID-systematic + + + 1'-heme-L-histidine + RESID-name + + + 2-[1-(N1'-histidyl)ethyl]protoporphyrin IX + RESID-alternate + + + BINDING Heme (covalent; via tele nitrogen) + UniProt-feature + + + Heme + PSI-MS-label + + + heme + UniMod-description + + + N(epsilon)-histidyl heme + RESID-alternate + + + N(tau)-histidyl heme + RESID-alternate + + + N1'-histidyl heme + RESID-alternate + + + tele-histidyl heme + RESID-alternate + + + + DiffAvg + 616.50 + + + + DiffFormula + C 34 Fe 1 H 32 N 4 O 4 + + + + DiffMono + 616.177293 + + + + Formula + C 40 Fe 1 H 39 N 7 O 5 + + + + MassAvg + 753.64 + + + + MassMono + 753.236205 + + + + Origin + H + + + + Source + hypothetical + + + + TermSpec + none + + MOD:00699 + MOD:00909 + PSI-MOD + + + MOD:00335 + (2S,3S,2'R)-3-methyllanthionine sulfoxide + + A protein modification that effectively cross-links an L-cysteine residue and an L-threonine residue by a thioether bond to form (2S,3S,2'R)-3-methyllanthionine sulfoxide. + + 7737178 + PubMed + + + 9219543 + PubMed + + + AA0330 + RESID + + + Cross-link 2. + + (2S,3S,4Xi,6R)-2,6-diamino-3-methyl-4-oxo-4-thiaheptanedioic acid + RESID-alternate + + + (2S,3S,SXi)-2-amino-3-([(R)-2-amino-2-carboxyethyl]sulfinyl)butanoic acid + RESID-systematic + + + 3-methyl-L-lanthionine S-oxide + RESID-alternate + + + 3-methyl-L-lanthionine sulfoxide + RESID-name + + + CROSSLNK Beta-methyllanthionine sulfoxide (Thr-Cys) + UniProt-feature + + + S-oxy-3-methyllanthionine + RESID-alternate + + + + DiffAvg + -2.02 + + + + DiffFormula + C 0 H -2 N 0 O 0 S 0 + + + + DiffMono + -2.015650 + + + + Formula + C 7 H 10 N 2 O 3 S 1 + + + + MassAvg + 202.23 + + + + MassMono + 202.041213 + + + + Origin + C, T + + + + Source + natural + + + + TermSpec + none + + MOD:00917 + MOD:01993 + + has_functional_parent + MOD:019810 + + PSI-MOD + + + MOD:00336 + tris-L-cysteinyl L-aspartato diiron disulfide + + A protein modification that effectively converts three L-cysteine residues, an L-aspartic acid residue and a two-iron two-sulfur cluster to tris-L-cysteinyl L-aspartato diiron disulfide. + + 10968624 + PubMed + + + 1312028 + PubMed + + + 7947772 + PubMed + + + AA0331 + RESID + + + Cross-link 4. + + di-mu-sulfido(bis-S-cysteinyliron)(S-cysteinyl-O4-aspartatoiron) + RESID-systematic + + + METAL Iron-sulfur (2Fe-2S) + UniProt-feature + + + tris-L-cysteinyl L-aspartato diiron disulfide + RESID-name + + + + DiffAvg + 171.78 + + + + DiffFormula + C 0 Fe 2 H -4 N 0 O 0 S 2 + + + + DiffMono + 171.783814 + + + + FormalCharge + 2- + + + + Formula + C 13 Fe 2 H 16 N 4 O 6 S 5 + + + + MassAvg + 596.28 + + + + MassMono + 595.838311 + + + + Origin + C, C, C, D + + + + Source + hypothetical + + + + TermSpec + none + + MOD:00739 + MOD:00904 + MOD:00905 + PSI-MOD + + + MOD:00337 + S-carbamoyl-L-cysteine + + A protein modification that effectively converts an L-cysteine residue to S-carbamoyl-L-cysteine. + + 12586941 + PubMed + + + 240389 + PubMed + + + AA0332 + RESID + + + 5#C + UniMod + + + + (R)-2-amino-3-(carbamoylsulfanyl)propanoic acid + RESID-systematic + + + 2-amino-3-(aminocarbonyl)sulfanylpropanoic acid + RESID-alternate + + + 2-amino-3-(aminocarbonyl)thiopropanoic acid + RESID-alternate + + + alpha-amino-beta-carbamylthiopropionic acid + RESID-alternate + + + beta-carbamylthioalanine + RESID-alternate + + + MOD_RES S-carbamoylcysteine + UniProt-feature + + + S-(aminocarbonyl)cysteine + RESID-alternate + + + S-carbamoyl-L-cysteine + RESID-name + + + S-carbamoylcysteine + RESID-alternate + + + S-carbamylcysteine + RESID-alternate + + + S-cysteinyl carbamate ester + RESID-alternate + + + SCbmCys + PSI-MOD-label + + + + DiffAvg + 43.02 + + + + DiffFormula + C 1 H 1 N 1 O 1 S 0 + + + + DiffMono + 43.005814 + + + + Formula + C 4 H 6 N 2 O 2 S 1 + + + + MassAvg + 146.16 + + + + MassMono + 146.014998 + + + + Origin + C + + + + Source + natural + + + + TermSpec + none + + MOD:00398 + MOD:00905 + PSI-MOD + + + MOD:00338 + S-cyano-L-cysteine + + A protein modification that effectively converts an L-cysteine residue to S-cyano-L-cysteine. + + 12586941 + PubMed + + + 4808702 + PubMed + + + AA0333 + RESID + + + 438#C + UniMod + + + + (2R)-2-amino-3-thiocyanatopropanoic acid + RESID-systematic + + + alpha-amino-beta-thiocyanatopropionic acid + RESID-alternate + + + beta-thiocyanatoalanine + RESID-alternate + + + Cyano + PSI-MS-label + + + cyano + UniMod-description + + + MOD_RES S-cyanocysteine + UniProt-feature + + + S-cyano-L-cysteine + RESID-name + + + S-cyanocysteine + RESID-alternate + + + serine thiocyanic acid ester + RESID-alternate + + + + DiffAvg + 25.01 + + + + DiffFormula + C 1 H -1 N 1 O 0 S 0 + + + + DiffMono + 24.995249 + + + + Formula + C 4 H 4 N 2 O 1 S 1 + + + + MassAvg + 128.15 + + + + MassMono + 128.004434 + + + + Origin + C + + + + Source + natural + + + + TermSpec + none + + MOD:00893 + MOD:00905 + PSI-MOD + + + MOD:00339 + L-cysteinyl hydrogenase diiron subcluster + + A protein modification that effectively converts an L-cysteine residue to L-cysteinyl hydrogenase diiron subcluster. + + 10694885 + PubMed + + + 9836629 + PubMed + + + AA0334 + RESID + + + 439#C + UniMod + + + incidental to RESID:AA0140. + + 1,7-biscarbonyl-1-(cystein-S-yl)-8-oxo-4-aza-2lambda(3),6 lambda(3)-dithia-1,7-diferratricyclo[4.2.0.0(2,7)]octane-1,7-dicarbonitrile + RESID-alternate + + + Diironsubcluster + PSI-MS-label + + + hydrogenase diiron subcluster + UniMod-description + + + L-cysteinyl hydrogenase diiron subcluster + RESID-name + + + METAL Diiron subcluster + UniProt-feature + + + mu-carbonyl-dicarbonyl-1kappaC,2kappaC-dicyanido-1kappaC,2kappaC-cysteinato-1kS-1,2-azadimethanthiol-1kS,2kS'-diiron + RESID-systematic + + + + DiffAvg + 342.87 + + + + DiffFormula + C 5 Fe 2 H -1 N 2 O 5 S 2 + + + + DiffMono + 342.786913 + + + + Formula + C 8 Fe 2 H 4 N 3 O 6 S 3 + + + + MassAvg + 446.01 + + + + MassMono + 445.796098 + + + + Origin + C + + + + Source + natural + + + + TermSpec + none + + MOD:00738 + MOD:00905 + PSI-MOD + + + MOD:00340 + S-amidino-L-cysteine + + A protein modification that effectively converts an L-cysteine residue to S-amidino-L-cysteine. + + 9148748 + PubMed + + + AA0335 + RESID + + + 440#C + UniMod + + + + (2R)-2-amino-3-(carbamimidoylsulfanyl)propanoic acid + RESID-systematic + + + 2-amino-3-amidinosulfanylpropanoic acid + RESID-alternate + + + 2-amino-3-amidinothiopropanoic acid + RESID-alternate + + + ACT_SITE Amidino-cysteine intermediate + UniProt-feature + + + alpha-amino-beta-amidinothiopropionic acid + RESID-alternate + + + Amidino + PSI-MS-label + + + amidino + UniMod-description + + + beta-(S-isothiourea)alanine + RESID-alternate + + + beta-amidinothioalanine + RESID-alternate + + + S-amidino-L-cysteine + RESID-name + + + S-amidinocysteine + RESID-alternate + + + + DiffAvg + 42.04 + + + + DiffFormula + C 1 H 2 N 2 O 0 S 0 + + + + DiffMono + 42.021798 + + + + Formula + C 4 H 7 N 3 O 1 S 1 + + + + MassAvg + 145.18 + + + + MassMono + 145.030983 + + + + Origin + C + + + + Source + natural + + + + TermSpec + none + + MOD:00905 + PSI-MOD + + + MOD:00341 + N-methyl-L-isoleucine + + A protein modification that effectively converts an L-isoleucine residue to N-methyl-L-isoleucine. + + 11875433 + PubMed + + + AA0336 + RESID + + + Polypeptides with monomethylated amino terminals can undergo premature cleavage during the coupling step of an Edman degradation. This can result in "preview" with both a residue and the following residue being seen from the first step on through a sequence [JSG]. + + (2S,3S)-2-methylamino-3-methylpentanoic acid + RESID-systematic + + + Methyl + PSI-MS-label + + + Methylation + UniMod-description + + + MOD_RES N-methylisoleucine + UniProt-feature + + + N-methyl-L-isoleucine + RESID-name + + + N-methylated L-isoleucine + PSI-MOD-alternate + + + N-methylisoleucine + RESID-alternate + + + NMe1Ile + PSI-MOD-label + + + + DiffAvg + 14.03 + + + + DiffFormula + C 1 H 2 N 0 O 0 + + + + DiffMono + 14.015650 + + + + Formula + C 7 H 13 N 1 O 1 + + + + MassAvg + 127.19 + + + + MassMono + 127.099714 + + + + Origin + I + + + + Source + hypothetical + + + + TermSpec + none + + MOD:00715 + MOD:01680 + PSI-MOD + + + MOD:00342 + N-methyl-L-leucine + + A protein modification that effectively converts an L-leucine residue to N-methyl-L-leucine. + + 11875433 + PubMed + + + AA0337 + RESID + + + Polypeptides with monomethylated amino terminals can undergo premature cleavage during the coupling step of an Edman degradation. This can result in "preview" with both a residue and the following residue being seen from the first step on through a sequence [JSG]. + + (S)-2-methylamino-4-methylpentanoic acid + RESID-systematic + + + 2-(methylamino)-4-methyl-valeric acid + RESID-alternate + + + Methyl + PSI-MS-label + + + Methylation + UniMod-description + + + MOD_RES N-methylleucine + UniProt-feature + + + N-methyl-L-leucine + RESID-name + + + N-methylated L-leucine + PSI-MOD-alternate + + + N-methylleucine + RESID-alternate + + + NMe1Leu + PSI-MOD-label + + + + DiffAvg + 14.03 + + + + DiffFormula + C 1 H 2 N 0 O 0 + + + + DiffMono + 14.015650 + + + + Formula + C 7 H 13 N 1 O 1 + + + + MassAvg + 127.19 + + + + MassMono + 127.099714 + + + + Origin + L + + + + Source + hypothetical + + + + TermSpec + none + + MOD:01680 + MOD:01808 + PSI-MOD + + + MOD:00343 + N-methyl-L-tyrosine + + A protein modification that effectively converts an L-tyrosine residue to N-methyl-L-tyrosine. + + 0 + DeltaMass + + + AA0338 + RESID + + + Polypeptides with monomethylated amino terminals can undergo premature cleavage during the coupling step of an Edman degradation. This can result in "preview" with both a residue and the following residue being seen from the first step on through a sequence [JSG]. + + (2S)-3-(4-hydroxyphenyl)-2-(methylamino)propanoic acid + RESID-systematic + + + Methyl + PSI-MS-label + + + MOD_RES N-methyltyrosine + UniProt-feature + + + N-methyl Tyrosinyl + DeltaMass-label + + + N-methyl-L-tyrosine + RESID-name + + + N-methylated L-tyrosine + PSI-MOD-alternate + + + N-methyltyrosine + RESID-alternate + + + NMe1Tyr + PSI-MOD-label + + + + DiffAvg + 14.03 + + + + DiffFormula + C 1 H 2 N 0 O 0 + + + + DiffMono + 14.015650 + + + + Formula + C 10 H 11 N 1 O 2 + + + + MassAvg + 177.20 + + + + MassMono + 177.078979 + + + + Origin + Y + + + + Source + hypothetical + + + + TermSpec + none + + MOD:00718 + MOD:01680 + PSI-MOD + + + MOD:00344 + N-palmitoylglycine + + A protein modification that effectively converts a glycine residue to N-palmitoylglycine. + + 12574119 + PubMed + + + AA0339 + RESID + + + incidental to RESID:AA0060 + PSI-MOD-slim + + (hexadecanamido)acetic acid + RESID-alternate + + + (hexadecanoylamino)acetic acid + RESID-alternate + + + (hexadecanoylamino)ethanoic acid + RESID-systematic + + + LIPID N-palmitoyl glycine + UniProt-feature + + + N-(1-oxohexadecyl)glycine + RESID-alternate + + + N-palmitoyl-glycine + RESID-name + + + N-palmitoylated glycine + PSI-MOD-alternate + + + NPamGly + PSI-MOD-label + + + + DiffAvg + 238.41 + + + + DiffFormula + C 16 H 30 N 0 O 1 S 0 + + + + DiffMono + 238.229666 + + + + Formula + C 18 H 34 N 1 O 2 + + + + MassAvg + 296.47 + + + + MassMono + 296.258954 + + + + Origin + G + + + + Source + natural + + + + TermSpec + N-term + + MOD:00908 + MOD:01685 + PSI-MOD + + + MOD:00345 + 2-(S-L-cysteinyl)-L-phenylalanine + + A protein modification that effectively cross-links an L-cysteine residue and an L-phenylalanine residue by a thioether bond to form 2-(S-L-cysteinyl)-L-phenylalanine. + + 12696888 + PubMed + + + 3936839 + PubMed + + + AA0340 + RESID + + + Cross-link 2. + + (2R)-2-amino-2-[(2R)-2-amino-2-carboxyethyl]sulfanyl-3-phenylpropanoic acid + RESID-systematic + + + (2R,5R)-2,5-diamino-3-thia-2-phenylmethylhexanedioic acid + RESID-alternate + + + 2-(L-cystein-S-yl)-L-phenylalanine + RESID-name + + + alpha-(L-cystein-S-yl)-L-phenylalanine + RESID-alternate + + + CROSSLNK 2-cysteinyl-L-phenylalanine (Cys-Phe) + UniProt-feature + + + + DiffAvg + -2.02 + + + + DiffFormula + C 0 H -2 N 0 O 0 S 0 + + + + DiffMono + -2.015650 + + + + Formula + C 12 H 12 N 2 O 2 S 1 + + + + MassAvg + 248.30 + + + + MassMono + 248.061949 + + + + Origin + C, F + + + + Source + natural + + + + TermSpec + none + + MOD:00914 + MOD:01992 + PSI-MOD + + + MOD:00346 + 2-(S-L-cysteinyl)-D-phenylalanine + + A protein modification that effectively cross-links an L-cysteine residue and an L-phenylalanine residue by a thioether bond to form 2-(S-L-cysteinyl)-D-phenylalanine. + + 12696888 + PubMed + + + 3936839 + PubMed + + + AA0341 + RESID + + + Cross-link 2. + + (2S)-2-amino-2-[(2R)-2-amino-2-carboxyethyl]sulfanyl-3-phenylpropanoic acid + RESID-systematic + + + (2S,5R)-2,5-diamino-3-thia-2-phenylmethylhexanedioic acid + RESID-alternate + + + 2-(L-cystein-S-yl)-D-phenylalanine + RESID-name + + + alpha-(L-cystein-S-yl)-D-phenylalanine + RESID-alternate + + + CROSSLNK 2-cysteinyl-D-phenylalanine (Cys-Phe) + UniProt-feature + + + + DiffAvg + -2.02 + + + + DiffFormula + C 0 H -2 N 0 O 0 S 0 + + + + DiffMono + -2.015650 + + + + Formula + C 12 H 12 N 2 O 2 S 1 + + + + MassAvg + 248.30 + + + + MassMono + 248.061949 + + + + Origin + C, F + + + + Source + natural + + + + TermSpec + none + + MOD:00664 + MOD:00914 + MOD:01992 + PSI-MOD + + + MOD:00347 + 2-(S-L-cysteinyl)-D-allo-threonine + + A protein modification that effectively cross-links an L-cysteine residue and an L-threonine residue by a thioether bond to form 2-(S-L-cysteinyl)-D-allo-threonine. + + 12696888 + PubMed + + + 3936839 + PubMed + + + AA0342 + RESID + + + Cross-link 2. + + (2R,5S,6R)-2,5-diamino-5-carboxy-6-hydroxy-4-thiaheptanoic acid + RESID-alternate + + + (2S,3R)-2-amino-2-[(2R)-2-amino-2-carboxyethyl]sulfanyl-3-hydroxybutanoic acid + RESID-systematic + + + 2-(L-cystein-S-yl)-D-allo-threonine + RESID-name + + + alpha-(L-cystein-S-yl)-D-allo-threonine + RESID-alternate + + + CROSSLNK 2-cysteinyl-D-allo-threonine (Cys-Thr) + UniProt-feature + + + + DiffAvg + -2.02 + + + + DiffFormula + C 0 H -2 N 0 O 0 S 0 + + + + DiffMono + -2.015650 + + + + Formula + C 7 H 10 N 2 O 3 S 1 + + + + MassAvg + 202.23 + + + + MassMono + 202.041213 + + + + Origin + C, T + + + + Source + natural + + + + TermSpec + none + + MOD:00664 + MOD:00917 + MOD:01992 + PSI-MOD + + + MOD:00348 + N-carbamoyl-L-alanine + + A protein modification that effectively converts an L-alanine residue to N-carbamoyl-L-alanine. + + 12203680 + PubMed + + + AA0343 + RESID + + + + (S)-2-(carbamoylamino)propanoic acid + RESID-systematic + + + 2-ureidopropanoic acid + RESID-alternate + + + MOD_RES N-carbamoylalanine + UniProt-feature + + + N-carbamoyl-L-alanine + RESID-name + + + N-carbamylalanine + RESID-alternate + + + N2CbmAla + PSI-MOD-label + + + + DiffAvg + 43.02 + + + + DiffFormula + C 1 H 1 N 1 O 1 + + + + DiffMono + 43.005814 + + + + Formula + C 4 H 7 N 2 O 2 + + + + MassAvg + 115.11 + + + + MassMono + 115.050752 + + + + Origin + A + + + + Source + natural + + + + TermSpec + N-term + + MOD:00901 + MOD:01679 + PSI-MOD + + + MOD:00349 + 4-amino-3-isothiazolidinone-L-serine + + A protein modification that effectively crosslinks an L-cysteine residue and an L-serine residue to form 4-amino-3-isothiazolidinone-L-serine. + + 12802338 + PubMed + + + 12802339 + PubMed + + + AA0344 + RESID + + + Cross-link 2. + + (2S)-2-[(4R)-4-amino-3-oxo-1,2-thiazolidin-2-yl]-3-hydroxypropanoic acid + RESID-systematic + + + 2-(4-amino-3-oxo-isothiazolidin-2-yl)-3-hydroxy-propanoic acid + RESID-alternate + + + 4-amino-3-isothiazolidinone-L-serine + RESID-alternate + + + CROSSLNK N,N-(cysteine-1,S-diyl)serine (Cys-Ser) + UniProt-feature + + + N,N-(L-cysteine-1,S-diyl)-L-serine + RESID-name + + + serine-cysteine sulfenyl amide cross-link + RESID-alternate + + + serine-cysteine sulphenyl amide cross-link + RESID-alternate + + + + DiffAvg + -2.02 + + + + DiffFormula + C 0 H -2 N 0 O 0 S 0 + + + + DiffMono + -2.015650 + + + + Formula + C 6 H 8 N 2 O 3 S 1 + + + + MassAvg + 188.20 + + + + MassMono + 188.025563 + + + + Origin + C, S + + + + Source + natural + + + + TermSpec + none + + MOD:00905 + MOD:00916 + MOD:01861 + PSI-MOD + + + MOD:00350 + L-threonyl-pentaglycyl-murein peptidoglycan + + A protein modification that effectively attaches an L-threonine residue to murein peptidoglycan by a pentaglycine linker peptide. + + 10754567 + PubMed + + + 1638631 + PubMed + + + AA0345 + RESID + + + + (2R,6S)-2-(N-mureinyl-(R)-alanyl-(S)-isoglutamyl)amino-6-(threonyl-pentaglycyl)amino-pimeloyl-(S)-alanyl-(S)-alanine + RESID-alternate + + + L-threonyl-pentaglycyl-murein peptidoglycan + RESID-name + + + MOD_RES Pentaglycyl murein peptidoglycan amidated threonine + UniProt-feature + + + + DiffAvg + 268.25 + + + + DiffFormula + C 10 H 14 N 5 O 4 + + + + DiffMono + 268.104579 + + + + Formula + C 14 H 22 N 6 O 7 + + + + MassAvg + 386.37 + + + + MassMono + 386.154997 + + + + Origin + T + + + + Source + natural + + + + TermSpec + C-term + + MOD:00917 + MOD:01159 + PSI-MOD + + + MOD:00351 + N-glycyl-1-(phosphatidyl)ethanolamine + + A protein modification that effectively converts a glycine residue to N-glycyl-1-(phosphatidyl)ethanolamine. + + 11100732 + PubMed + + + AA0346 + RESID + + + + (R)-1-hexadecanoyloxy-2-((Z)-9-octadecenoyloxy)-3-[2-(aminoacetylamino)ethyloxyphospho]propane + RESID-systematic + + + LIPID Phosphatidylethanolamine amidated glycine + UniProt-feature + + + N-glycyl-1-(phosphatidyl)ethanolamine + RESID-name + + + N-glycyl-1-palmitoyl-2-oleoyl-sn-glycero-3-phosphoethanolamine + RESID-alternate + + + + DiffAvg + 699.99 + + + + DiffFormula + C 39 H 74 N 1 O 7 P 1 + + + + DiffMono + 699.520290 + + + + Formula + C 41 H 78 N 2 O 9 P 1 + + + + MassAvg + 774.05 + + + + MassMono + 773.544494 + + + + Origin + G + + + + Source + natural + + + + TermSpec + C-term + + MOD:00908 + MOD:01155 + PSI-MOD + + + MOD:00352 + L-glutamyl 5-omega-hydroxyceramide ester + + A protein modification that effectively converts an L-glutamic acid residue to L-glutamyl 5-omega-hydroxyceramide ester. + + 10411887 + PubMed + + + 9651377 + PubMed + + + AA0347 + RESID + + + + (S)-2-amino-5-[30-((2S,3R,4E)-1,3-dihydroxyicos-4-en-2-ylamino)-30-oxotriacontan-1-yloxy]-5-oxopentanoic acid + RESID-systematic + + + 2-[30-(isoglutamyloxy)triacontanoyl]icosasphingosine + RESID-alternate + + + L-glutamyl 5-omega-hydroxyceramide ester + RESID-name + + + LIPID Omega-hydroxyceramide glutamate ester + UniProt-feature + + + + DiffAvg + 761.31 + + + + DiffFormula + C 50 H 96 N 0 O 4 + + + + DiffMono + 760.730862 + + + + Formula + C 55 H 104 N 2 O 6 + + + + MassAvg + 889.44 + + + + MassMono + 888.789439 + + + + Origin + Q + + + + Source + natural + + + + TermSpec + none + + MOD:00907 + MOD:01155 + PSI-MOD + + + MOD:00353 + S-[5'-(L-tryptoph-6'-yl)-L-tyrosin-3'-yl]-L-methionin-S-ium + + A protein modification that effectively cross-links an L-tryptophan residue with an L-tyrosine residue by a carbon-carbon bond, and cross-links the L-tyrosine residue to an L-methionine residue by a thioether bond to form S-[5'-(L-tryptoph-6'-yl)-L-tyrosin-3'-yl]-L-methionin-S-ium. + + 12172540 + PubMed + + + 16285713 + PubMed + + + AA0348 + RESID + + + Cross-link 3. + + 5'-(6'-tryptophyl)-tyrosin-3'-yl-methionin-S-ium + RESID-alternate + + + S-[5'-(L-tryptoph-6'-yl)-L-tyrosin-3'-yl]-L-methionin-S-ium + RESID-name + + + + DiffAvg + -3.02 + + + + DiffFormula + C 0 H -3 N 0 O 0 S 0 + + + + DiffMono + -3.024024 + + + + FormalCharge + 1+ + + + + Formula + C 25 H 25 N 4 O 4 S 1 + + + + MassAvg + 477.56 + + + + MassMono + 477.159103 + + + + Origin + M, W, Y + + + + Source + natural + + + + TermSpec + none + + MOD:00692 + MOD:00913 + MOD:00918 + MOD:00919 + PSI-MOD + + + MOD:00354 + O-(riboflavin phosphoryl)-L-threonine + + A protein modification that effectively converts an L-threonine residue to O-(riboflavin phosphoryl)-L-threonine. + + 10587447 + PubMed + + + 11163785 + PubMed + + + 11248234 + PubMed + + + AA0349 + RESID + + + 442#T + UniMod + + + PSI-MOD-slim + + (2S,3R)-2-amino-3-(riboflavin 5'-hydrogen phosphonoxy)butanoic acid + RESID-systematic + + + FMN + PSI-MS-label + + + MOD_RES FMN phosphoryl threonine + UniProt-feature + + + O-(riboflavin phosphoryl)-L-threonine + RESID-name + + + O3-(riboflavin phosphoryl) + UniMod-description + + + O3-threonyl flavin mononucleotide + RESID-alternate + + + O3-threonyl FMN + RESID-alternate + + + OFMNThr + PSI-MOD-label + + + + DiffAvg + 438.33 + + + + DiffFormula + C 17 H 19 N 4 O 8 P 1 + + + + DiffMono + 438.094050 + + + + Formula + C 21 H 26 N 5 O 10 P 1 + + + + MassAvg + 539.44 + + + + MassMono + 539.141729 + + + + Origin + T + + + + Source + hypothetical + + + + TermSpec + none + + MOD:00917 + MOD:01164 + PSI-MOD + + + MOD:00355 + O-(riboflavin phosphoryl)-L-serine + + A protein modification that effectively converts an L-serine residue to O-(riboflavin phosphoryl)-L-serine. + + AA0350 + RESID + + + 442#S + UniMod + + + PSI-MOD-slim + + (R)-2-amino-3-(riboflavin 5'-hydrogen phosphonoxy)propanoic acid + RESID-systematic + + + FMN + PSI-MS-label + + + MOD_RES FMN phosphoryl serine + UniProt-feature + + + O-(riboflavin phosphoryl)-L-serine + RESID-name + + + O3-(riboflavin phosphoryl) + UniMod-description + + + O3-seryl flavin mononucleotide + RESID-alternate + + + O3-seryl FMN + RESID-alternate + + + OFMNSer + PSI-MOD-label + + + + DiffAvg + 438.33 + + + + DiffFormula + C 17 H 19 N 4 O 8 P 1 + + + + DiffMono + 438.094050 + + + + Formula + C 20 H 24 N 5 O 10 P 1 + + + + MassAvg + 525.41 + + + + MassMono + 525.126079 + + + + Origin + S + + + + Source + hypothetical + + + + TermSpec + none + + MOD:00916 + MOD:01164 + PSI-MOD + + + MOD:00356 + S-(4a-FMN)-L-cysteine + + A protein modification that effectively converts an L-cysteine residue to S-(4a-FMN)-L-cysteine. + + 12668455 + PubMed + + + 12846567 + PubMed + + + 7692961 + PubMed + + + AA0351 + RESID + + + 443#C + UniMod + + + PSI-MOD-slim + + (R)-2-amino-3-(4a-riboflavin 5'-dihydrogen phosphate)sulfanylpropanoic acid + RESID-systematic + + + 4a-(S-cysteinyl)flavin mononucleotide + RESID-alternate + + + 4a-(S-cysteinyl)FMN + RESID-alternate + + + FMNC + PSI-MS-label + + + MOD_RES S-4a-FMN cysteine + UniProt-feature + + + S-(4a-FMN) + UniMod-description + + + S-(4a-FMN)-L-cysteine + RESID-name + + + S4aFMNCys + PSI-MOD-label + + + + DiffAvg + 456.35 + + + + DiffFormula + C 17 H 21 N 4 O 9 P 1 S 0 + + + + DiffMono + 456.104615 + + + + Formula + C 20 H 26 N 5 O 10 P 1 S 1 + + + + MassAvg + 559.49 + + + + MassMono + 559.113800 + + + + Origin + C + + + + Source + natural + + + + TermSpec + none + + MOD:00896 + MOD:00905 + PSI-MOD + + + MOD:00357 + 1'-(8alpha-FMN)-L-histidine + + A protein modification that effectively converts an L-histidine residue to 1'-(8alpha-FMN)-L-histidine. + + 11902668 + PubMed + + + 8611516 + PubMed + + + AA0352 + RESID + + + 409#H + UniMod + + + PSI-MOD-slim + + (S)-2-amino-3-(1-[8alpha riboflavin 5'-dihydrogen phosphate]imidazol-4-yl)propanoic acid + RESID-systematic + + + 1'-(8alpha-FMN)-L-histidine + RESID-name + + + 8alpha-(N(epsilon)-histidyl)FMN + RESID-alternate + + + 8alpha-(N1'-histidyl)FMN + RESID-alternate + + + flavin mononucleotide + UniMod-description + + + FMNH + PSI-MS-label + + + MOD_RES Tele-8alpha-FMN histidine + UniProt-feature + + + N(tau)-(8alpha-FMN)-histidine + RESID-alternate + + + Ntele8aFMNHis + PSI-MOD-label + + + tele-(8alpha-FMN)-histidine + RESID-alternate + + + + DiffAvg + 454.33 + + + + DiffFormula + C 17 H 19 N 4 O 9 P 1 + + + + DiffMono + 454.088965 + + + + Formula + C 23 H 26 N 7 O 10 P 1 + + + + MassAvg + 591.47 + + + + MassMono + 591.147877 + + + + Origin + H + + + + Source + natural + + + + TermSpec + none + + MOD:00896 + MOD:00909 + PSI-MOD + + + MOD:00358 + 3'-(8alpha-FMN)-L-histidine + + A protein modification that effectively converts an L-histidine residue to 3'-(8alpha-FMN)-L-histidine. + + 12417325 + PubMed + + + AA0353 + RESID + + + 409#H + UniMod + + + In a later publication, PubMed:19438211, the authors changed the enzyme activity, the connection from a histidine nitrogen to a cysteine sulfur, and the identity of the flavin from FMN to FAD. They now believe the modification is S-(8alpha-FAD)-L-cysteine, see MOD:00152. This is a deprecated entry in RESID. It probably does not occur naturally [JSG]. + PSI-MOD-slim + + (S)-2-amino-3-(3-[8alpha riboflavin 5'-dihydrogen phosphate]imidazol-4-yl)propanoic acid + RESID-systematic + + + 3'-(8alpha-FMN)-L-histidine + RESID-name + + + 8alpha-(N(delta)-histidyl)FMN + RESID-alternate + + + 8alpha-(N3'-histidyl)FMN + RESID-alternate + + + flavin mononucleotide + UniMod-description + + + FMNH + PSI-MS-label + + + N(pi)-(8alpha-FMN)-histidine + RESID-alternate + + + Npros8aFMNHis + PSI-MOD-label + + + pros-(8alpha-FMN)-histidine + RESID-alternate + + + + DiffAvg + 454.33 + + + + DiffFormula + C 17 H 19 N 4 O 9 P 1 + + + + DiffMono + 454.088965 + + + + Formula + C 23 H 26 N 7 O 10 P 1 + + + + MassAvg + 591.47 + + + + MassMono + 591.147877 + + + + Origin + H + + + + Source + hypothetical + + + + TermSpec + none + + MOD:00896 + MOD:00909 + PSI-MOD + + + MOD:00359 + N2-acetyl-L-arginine + + A protein modification that effectively converts an L-arginine residue to N2-acetyl-L-arginine. + + 12883043 + PubMed + + + 1894641 + PubMed + + + AA0354 + RESID + + + + (S)-2-acetamido-5-carbamimidamidopentanoic acid + RESID-systematic + + + 2-acetamido-5-guanidinopentanoic acid + RESID-alternate + + + 2-acetylamino-5-guanidinopentanoic acid + RESID-alternate + + + AcArg + PSI-MOD-label + + + acetylarginine + RESID-alternate + + + alpha-acetylamino-delta-guanidinovaleric acid + RESID-alternate + + + MOD_RES N2-acetylarginine + UniProt-feature + + + N(alpha)-acetylarginine + RESID-alternate + + + N2-acetyl-L-arginine + RESID-name + + + N2-acetylated L-arginine + PSI-MOD-alternate + + + + DiffAvg + 42.04 + + + + DiffFormula + C 2 H 2 N 0 O 1 + + + + DiffMono + 42.010565 + + + + Formula + C 8 H 15 N 4 O 2 + + + + MassAvg + 199.23 + + + + MassMono + 199.119501 + + + + Origin + R + + + + Source + natural + + + + TermSpec + N-term + + MOD:00902 + MOD:01458 + PSI-MOD + + + MOD:00360 + L-cysteinyl copper sulfido molybdopterin cytosine dinuncleotide + + A protein modification that effectively converts an L-cysteine residue to L-cysteinyl copper sulfido molybdopterin cytosine dinuncleotide. + + 12475995 + PubMed + + + AA0355 + RESID + + + 444#C + UniMod + + + + [8-amino-1a,2,4a,5,6,7,10-heptahydro-2-(trihydrogen diphosphate 5'-ester with cytosine)methyl-6-oxo-3,4-dimercapto-pteridino[6,7-5,6]pyranoato-S3,S4]-cysteinyl-S-copper-mu-sulfido-molybdenum hydroxide oxide + RESID-systematic + + + copper sulfido molybdopterin cytosine dinuncleotide + UniMod-description + + + CuSMo + PSI-MS-label + + + cysteinyl copper mu-sulfido Mo-pterin cytosine dinucleotide + RESID-alternate + + + L-cysteinyl copper sulfido molybdopterin cytosine dinucleotide + RESID-name + + + + DiffAvg + 922.07 + + + + DiffFormula + C 19 Cu 1 H 24 Mo 1 N 8 O 15 P 2 S 3 + + + + DiffMono + 922.834854 + + + + Formula + C 22 Cu 1 H 29 Mo 1 N 9 O 16 P 2 S 4 + + + + MassAvg + 1025.20 + + + + MassMono + 1025.844039 + + + + Origin + C + + + + Source + natural + + + + TermSpec + none + + MOD:00742 + MOD:00744 + MOD:00860 + MOD:00905 + PSI-MOD + + + MOD:00361 + tris-L-cysteinyl S-adenosylmethion-N,O-diyl tetrairon tetrasulfide + + A protein modification that effectively converts three L-cysteine residues, an S-adenosylmethionine and a four-iron four-sulfur cluster to tris-L-cysteinyl S-adenosylmethion-N,O-diyl tetrairon tetrasulfide. + + 11222759 + PubMed + + + 14704425 + PubMed + + + AA0356 + RESID + + + Cross-link 3. + + METAL Iron-sulfur (4Fe-4S-S-AdoMet) + UniProt-feature + + + tetra-mu3-sulfido(S-adenosylmethion-N,O-diyliron)tris(S-cysteinyliron) + RESID-systematic + + + tris-L-cysteinyl S-adenosylmethion-N,O-diyl tetrairon tetrasulfide + RESID-name + + + + DiffAvg + 747.03 + + + + DiffFormula + C 15 Fe 4 H 19 N 6 O 5 S 5 + + + + DiffMono + 746.742346 + + + + FormalCharge + 1- + + + + Formula + C 24 Fe 4 H 34 N 9 O 8 S 8 + + + + MassAvg + 1056.45 + + + + MassMono + 1055.769901 + + + + Origin + C, C, C + + + + Source + natural + + + + TermSpec + none + + MOD:00739 + MOD:00905 + PSI-MOD + + + MOD:00362 + tris-L-cysteinyl L-arginyl diiron disulfide + + A protein modification that effectively converts three L-cysteine residues, an L-arginine residue and a two-iron two-sulfur cluster to tris-L-cysteinyl L-arginyl diiron disulfide. + + 14704425 + PubMed + + + AA0357 + RESID + + + Cross-link 4. + + di-mu-sulfido(N(eta1)-arginyl-S-cysteinyliron)(bis-S-cysteinyliron) + RESID-systematic + + + METAL Iron-sulfur (2Fe-2S) + UniProt-feature + + + tris-L-cysteinyl L-arginyl diiron disulfide + RESID-name + + + + DiffAvg + 172.79 + + + + DiffFormula + C 0 Fe 2 H -3 N 0 O 0 S 2 + + + + DiffMono + 172.791639 + + + + FormalCharge + 2- + + + + Formula + C 15 Fe 2 H 24 N 7 O 4 S 5 + + + + MassAvg + 638.39 + + + + MassMono + 637.920304 + + + + Origin + C, C, C, R + + + + Source + natural + + + + TermSpec + none + + MOD:00739 + MOD:00902 + MOD:00905 + PSI-MOD + + + MOD:00363 + L-cysteinyl-L-selenocysteine (Cys-Sec) + + A protein modification that effectively cross-links an L-cysteine residue and an L-selenocysteine residues to form L-cysteinyl-L-selenocystine. + + 12911312 + PubMed + + + AA0358#SEC + RESID + + + Cross-link 2. + PSI-MOD-slim + + (R,R)-2-amino-3-[3-(2-aminopropanoic acid)sulfanyl]selanylpropanoic acid + RESID-systematic + + + CROSSLNK Cysteinyl-selenocysteine (Cys-Sec) + UniProt-feature + + + CROSSLNK Cysteinyl-selenocysteine (Sec-Cys) + UniProt-feature + + + L-cysteinyl-L-selenocysteine + RESID-name + + + + DiffAvg + -2.02 + + + + DiffFormula + C 0 H -2 N 0 O 0 S 0 Se 0 + + + + DiffMono + -2.015650 + + + + Formula + C 6 H 8 N 2 O 2 S 1 Se 1 + + + + MassAvg + 251.17 + + + + MassMono + 251.947170 + + + + Origin + C, U + + + + Source + natural + + + + TermSpec + none + + MOD:01158 + MOD:01627 + PSI-MOD + + + MOD:00364 + 5-hydroxy-N6,N6,N6-trimethyl-L-lysine + + A protein modification that effectively converts an L-lysine residue to 5-hydroxy-N6,N6,N6-trimethyl-L-lysine. + + 11349130 + PubMed + + + 14661085 + PubMed + + + AA0359 + RESID + + + 445#K + UniMod + + + Incidental to RESID:AA0278; secondary to RESID:AA0028; secondary to RESID:AA0074. + + (2R,5Xi)-5-amino-5-carboxy-2-hydroxy-N,N,N-trimethylpentan-1-aminium + RESID-systematic + + + (2Xi,5S)-5-amino-5-carboxy-2-hydroxy-N,N,N-trimethylpentanaminium + RESID-alternate + + + (2Xi,5S)-5-azanyl-5-carboxy-2-hydroxy-N,N,N-trimethylpentanazanium + RESID-alternate + + + 5-hydroxy-N(zeta)-trimethyllysine + RESID-alternate + + + 5-hydroxy-N6,N6,N6-trimethyl + UniMod-description + + + 5-hydroxy-N6,N6,N6-trimethyl-L-lysine + RESID-name + + + 5-hydroxy-N6,N6,N6-trimethyllysin-N6-ium + RESID-alternate + + + 5-hydroxy-N6,N6,N6-trimethyllysine cation + RESID-alternate + + + 5-hydroxylated N6,N6,N6-trimethylated L-lysine + PSI-MOD-alternate + + + 5HyN6Me3Lys + PSI-MOD-label + + + alpha-amino-epsilon-dimethylamino-delta-hydroxycaproic acid + RESID-alternate + + + delta-hydroxy-epsilon-N,N,N-trimethyllysine + RESID-alternate + + + Hydroxytrimethyl + PSI-MS-label + + + lysine derivative Lys(z) + RESID-alternate + + + MOD_RES N6,N6,N6-trimethyl-5-hydroxylysine + UniProt-feature + + + + DiffAvg + 59.09 + + + + DiffFormula + C 3 H 7 N 0 O 1 + + + + DiffMono + 59.049141 + + + + FormalCharge + 1+ + + + + Formula + C 9 H 19 N 2 O 2 + + + + MassAvg + 187.26 + + + + MassMono + 187.144104 + + + + Origin + K + + + + Source + natural + + + + TermSpec + none + + MOD:00602 + MOD:00912 + + has_functional_parent + MOD:000370 + + + has_functional_parent + MOD:000830 + + PSI-MOD + + + MOD:00365 + N-(L-isoglutamyl)-glycine + + A protein modification that effectively crosslinks an L-glutamic acid residue and a glycine residue by an isopeptide bond to form N-(L-isoglutamyl)-glycine. + + 14531691 + PubMed + + + AA0360 + RESID + + + Cross-link 2. + + (S)-2-amino-5-(carboxymethyl)amino-5-oxopentanoic acid + RESID-systematic + + + 2-amino-N5-(carboxymethyl)-pentanediamic acid + RESID-alternate + + + CROSSLNK Isoglutamyl glycine isopeptide (Gly-Glu) + UniProt-feature + + + isoglutamyl glycine + RESID-alternate + + + N-(L-isoglutamyl)-glycine + RESID-name + + + N-gamma-glutamylglycine + RESID-alternate + + + + DiffAvg + -18.02 + + + + DiffFormula + C 0 H -2 N 0 O -1 + + + + DiffMono + -18.010565 + + + + Formula + C 7 H 9 N 2 O 3 + + + + MassAvg + 169.16 + + + + MassMono + 169.061317 + + + + Origin + E, G + + + + Source + natural + + + + TermSpec + N-term + + MOD:00688 + MOD:00906 + MOD:00908 + MOD:00954 + PSI-MOD + + + MOD:00366 + O-sulfo-L-serine + + A protein modification that effectively converts an L-serine residue to O-sulfo-L-serine. + + 14752058 + PubMed + + + AA0361 + RESID + + + 40#S + UniMod + + + PSI-MOD-slim + + (2S)-2-amino-3-(sulfooxy)propanoic acid + RESID-systematic + + + 2-amino-3-hydroxypropanoic acid 3-sulfate + RESID-alternate + + + MOD_RES Sulfoserine + UniProt-feature + + + O-sulfo-L-serine + RESID-name + + + O-Sulfonation + UniMod-description + + + O3-sulfonoserine + RESID-alternate + + + O3-sulfoserine + RESID-alternate + + + serine sulfate ester + RESID-alternate + + + Sulfo + PSI-MS-label + + + + DiffAvg + 80.06 + + + + DiffFormula + C 0 H 0 N 0 O 3 S 1 + + + + DiffMono + 79.956815 + + + + Formula + C 3 H 5 N 1 O 5 S 1 + + + + MassAvg + 167.13 + + + + MassMono + 166.988843 + + + + Origin + S + + + + Source + natural + + + + TermSpec + none + + MOD:00695 + MOD:00771 + MOD:00916 + PSI-MOD + + + MOD:00367 + O-sulfo-L-threonine + + A protein modification that effectively converts an L-threonine residue to O-sulfo-L-threonine. + + 14752058 + PubMed + + + AA0362 + RESID + + + 40#T + UniMod + + + PSI-MOD-slim + + (2S,3R)-2-amino-3-(sulfooxy)butanoic acid + RESID-systematic + + + 2-amino-3-hydroxybutanoic acid 3-sulfate + RESID-alternate + + + MOD_RES Sulfothreonine + UniProt-feature + + + O-sulfo-L-threonine + RESID-name + + + O-Sulfonation + UniMod-description + + + O3-sulfonothreonine + RESID-alternate + + + O3-sulfothreonine + RESID-alternate + + + Sulfo + PSI-MS-label + + + threonine sulfate ester + RESID-alternate + + + + DiffAvg + 80.06 + + + + DiffFormula + C 0 H 0 N 0 O 3 S 1 + + + + DiffMono + 79.956815 + + + + Formula + C 4 H 7 N 1 O 5 S 1 + + + + MassAvg + 181.16 + + + + MassMono + 181.004493 + + + + Origin + T + + + + Source + natural + + + + TermSpec + none + + MOD:00695 + MOD:00773 + MOD:00917 + PSI-MOD + + + MOD:00368 + N-carboxy-L-methionine + + A protein modification that effectively converts an L-methionine residue to N-carboxy-L-methionine. + + 10368287 + PubMed + + + 11120890 + PubMed + + + 12595263 + PubMed + + + 8312270 + PubMed + + + AA0363 + RESID + + + 299#M + UniMod + + + At least three protein crystallographic structures have been reported with this modification. However, no chemical evidence for this modification is provided, there were no reports of this modification before these crystallographic reports, and there is no metabolic explanation for the conversion of a formyl group to a carboxy group. There is confusion in its description, and misnaming is common. This modification is probably a misidentification of N-(dihydroxymethyl)methionine, the hydrated form of N-formylmethionine. See MOD:01446 [JSG]. + + (S)-2-carboxyamino-4-(methylsulfanyl)butanoic acid + RESID-systematic + + + 2-carbamic-4-(methylsulfanyl)butanoic acid + RESID-alternate + + + 2-carbamic-4-(methylthio)butanoic acid + RESID-alternate + + + Carboxy + UniMod-interim + + + Carboxylation + UniMod-description + + + N-carboxy-L-methionine + RESID-name + + + N-carboxymethionine + RESID-alternate + + + + DiffAvg + 44.01 + + + + DiffFormula + C 1 H 0 N 0 O 2 S 0 + + + + DiffMono + 43.989829 + + + + Formula + C 6 H 10 N 1 O 3 S 1 + + + + MassAvg + 176.21 + + + + MassMono + 176.038139 + + + + Origin + M + + + + Source + hypothetical + + + + TermSpec + N-term + + MOD:00913 + MOD:01152 + PSI-MOD + + + MOD:00369 + O-acetyl-L-serine + + A protein modification that effectively converts an L-serine residue to O-acetyl-L-serine. + + 17981 + ChEBI + + + 11857757 + PubMed + + + 11999733 + PubMed + + + 12175151 + PubMed + + + 14730666 + PubMed + + + 15350136 + PubMed + + + 16731519 + PubMed + + + 489587 + PubMed + + + 7309355 + PubMed + + + AA0364 + RESID + + + 1#S + UniMod + + + incidental to RESID:AA0051 + PSI-MOD-slim + + (2S)-3-(acetyloxy)-2-aminopropanoic acid + RESID-systematic + + + Acetyl + PSI-MS-label + + + Acetylation + UniMod-description + + + MOD_RES O-acetylserine + UniProt-feature + + + O-acetyl-L-serine + RESID-name + + + O-acetylated L-serine + PSI-MOD-alternate + + + O-acetylserine + RESID-alternate + + + OAcSer + PSI-MOD-label + + + serine acetate ester + RESID-alternate + + + + DiffAvg + 42.04 + + + + DiffFormula + C 2 H 2 N 0 O 1 + + + + DiffMono + 42.010565 + + + + Formula + C 5 H 7 N 1 O 3 + + + + MassAvg + 129.12 + + + + MassMono + 129.042593 + + + + Origin + S + + + + Source + natural + + + + TermSpec + none + + MOD:00644 + MOD:00647 + PSI-MOD + + + MOD:00370 + (E)-2,3-didehydrotyrosine + + A protein modification that effectively converts an L-tyrosine residue to (E)-2,3-didehydrotyrosine. + + 12623015 + PubMed + + + AA0365 + RESID + + + incidental to RESID:AA0184; incidental to RESID:AA0187; incidental to RESID:AA0188; incidental to RESID:AA0189; incidental to RESID:AA0378; incidental to RESID:AA0379; incidental to RESID:AA0380; incidental to RESID:AA0381 + PSI-MOD-slim + + (2E)-2-amino-3-(4-hydroxyphenyl)prop-2-enoic acid + RESID-systematic + + + (E)-2,3-didehydrogenated tyrosine + PSI-MOD-alternate + + + (E)-2,3-didehydrotyrosine + RESID-name + + + 2-amino-3-oxo-butanoic_acid + UniMod-description + + + amino-(para-hydroxybenzylidenyl)acetic acid + RESID-alternate + + + blue non-fluorescent pocilloporin chromophore + RESID-alternate + + + Didehydro + PSI-MS-label + + + E-dHTyr + PSI-MOD-label + + + MOD_RES (E)-2,3-didehydrotyrosine + UniProt-feature + + + para-hydroxybenzylidene-imidazolidinone chromophore + RESID-alternate + + + trans-dehydrotyrosine + RESID-alternate + + + + DiffAvg + -2.02 + + + + DiffFormula + C 0 H -2 N 0 O 0 + + + + DiffMono + -2.015650 + + + + Formula + C 9 H 7 N 1 O 2 + + + + MassAvg + 161.16 + + + + MassMono + 161.047678 + + + + Origin + Y + + + + Source + natural + + + + TermSpec + none + + MOD:00706 + PSI-MOD + + + MOD:00371 + bis-L-aspartato tris-L-glutamato L-histidino calcium tetramanganese tetroxide + + A protein modification that effectively converts two L-aspartic acid residues, three L-glutamic acid residues, an L-histidine residue, and a one-calcium, four-iron, four-oxygen cluster to bis-L-aspartato tris-L-glutamato L-histidino calcium tetramanganese tetroxide. + + 14764885 + PubMed + + + AA0366 + RESID + + + Cross-link 6. + + 4Mn-Ca-4O cluster + RESID-alternate + + + bis-L-aspartato tris-L-glutamato L-histidino calcium tetramanganese tetroxide + RESID-name + + + mu3-1:2:3kappaO-oxido-mu3-1:3:4kappaO-oxido-mu3-2:3:4kappaO-oxido-mu4-1:2:4:5kappaO-oxido-N1'-histidino-O5-glutamato 2-manganese-O5,O5-glutamato 3-manganese-O4-aspartato 4-manganese-O4-aspartato-O5-glutamato 5-manganese + RESID-systematic + + + photosystem II catalytic cluster + RESID-alternate + + + + DiffAvg + 317.78 + + + + DiffFormula + C 0 Ca 1 H -6 Mn 4 N 0 O 4 + + + + DiffMono + 317.647480 + + + + Formula + C 29 Ca 1 H 32 Mn 4 N 8 O 20 + + + + MassAvg + 1072.44 + + + + MassMono + 1071.888057 + + + + Origin + D, D, E, E, E, H + + + + Source + hypothetical + + + + TermSpec + none + + MOD:00740 + MOD:00904 + MOD:00906 + MOD:00909 + MOD:01482 + PSI-MOD + + + MOD:00372 + 3'-(3'-L-tyrosinyl)-L-tyrosine + + A protein modification that effectively cross-links two L-tyrosine residues with a carbon-carbon bond to form 3'-(3'-L-tyrosinyl)-L-tyrosine. + + 0 + DeltaMass + + + 14249161 + PubMed + + + 637884 + PubMed + + + 8702710 + PubMed + + + 8937563 + PubMed + + + AA0367 + RESID + + + Cross-link 2; From DeltaMass: Average Mass: -2. + + (2S,2'S)-3,3'-(6,6'-dihydroxybiphenyl-3,3'-diyl)bis(2-aminopropanoic acid) + RESID-systematic + + + 3'-(L-tyros-3'-yl)-L-tyrosine + RESID-name + + + 3,3'-BiTyr (Crosslink) + DeltaMass-label + + + 6,6'-dihydroxy-(1,1'-biphenyl)-3,3'-bis(2-aminopropanoic acid) + RESID-alternate + + + alpha,alpha'-diamino-6,6'-dihydroxy-(1,1'-biphenyl)-3,3'-dipropanoic acid + RESID-alternate + + + bityrosine + RESID-alternate + + + o,o-dityrosine + RESID-alternate + + + + DiffAvg + -2.02 + + + + DiffFormula + C 0 H -2 N 0 O 0 + + + + DiffMono + -2.015650 + + + + Formula + C 18 H 16 N 2 O 4 + + + + MassAvg + 324.34 + + + + MassMono + 324.111007 + + + + Origin + Y, Y + + + + Source + natural + + + + TermSpec + none + + MOD:00692 + MOD:00919 + PSI-MOD + + + MOD:00373 + 3'-(O4'-L-tyrosinyl)-L-tyrosine + + A protein modification that effectively cross-links L-tyrosine residues with an ether bond to form 3'-(O4'-L-tyrosinyl)-L-tyrosine. + + 0 + DeltaMass + + + 12719529 + PubMed + + + 7115340 + PubMed + + + 8702710 + PubMed + + + AA0368 + RESID + + + Cross-link 2; secondary to RESID:AA0146; From DeltaMass: Average Mass: -2. + + (2S)-2-amino-3-[3-(4-[(2S)-2-amino-2-carboxyethyl]phenoxy)-4-hydroxyphenyl]propanoic acid + RESID-systematic + + + 2-amino-3-[4-(5-[(2S)-2-amino-2-carboxyethyl]-2-hydroxyphenoxy)phenyl]propanoic acid + RESID-alternate + + + 3'-(L-tyros-O4'-yl)-L-tyrosine + RESID-name + + + CROSSLNK Isodityrosine (Tyr-Tyr) + UniProt-feature + + + IsodiTyr (Crosslink) + DeltaMass-label + + + isodityrosine + RESID-alternate + + + O-(5-(2-amino-2-carboxyethyl)-2-hydroxyphenyl)-L-tyrosine + RESID-alternate + + + + DiffAvg + -2.02 + + + + DiffFormula + C 0 H -2 N 0 O 0 + + + + DiffMono + -2.015650 + + + + Formula + C 18 H 16 N 2 O 4 + + + + MassAvg + 324.34 + + + + MassMono + 324.111007 + + + + Origin + Y, Y + + + + Source + natural + + + + TermSpec + none + + MOD:00692 + MOD:00919 + PSI-MOD + + + MOD:00374 + 3,4-dihydroxy-L-arginine + + A protein modification that effectively converts an L-arginine residue to 3,4-dihydroxy-L-arginine. + + 10978343 + PubMed + + + 12686488 + PubMed + + + AA0369 + RESID + + + 425#R + UniMod + + + + (2S,3Xi,4Xi)-2-amino-5-carbamimidamido-3,4-dihydroxypentanoic acid + RESID-systematic + + + 2-amino-5-guanidino-3,4-dihydroxypentanoic acid + RESID-alternate + + + 3,4-dihydroxy-L-arginine + RESID-name + + + 3,4-dihydroxylated L-arginine + PSI-MOD-alternate + + + 34Hy2Arg + PSI-MOD-label + + + beta,gamma-dihydroxyarginine + RESID-alternate + + + dihydroxy + UniMod-description + + + Dioxidation + PSI-MS-label + + + MOD_RES 3,4-dihydroxyarginine + UniProt-feature + + + + DiffAvg + 32.00 + + + + DiffFormula + C 0 H 0 N 0 O 2 + + + + DiffMono + 31.989829 + + + + Formula + C 6 H 12 N 4 O 3 + + + + MassAvg + 188.19 + + + + MassMono + 188.090940 + + + + Origin + R + + + + Source + natural + + + + TermSpec + none + + MOD:00428 + MOD:00682 + PSI-MOD + + + MOD:00375 + 4,5-dihydroxy-L-lysine + + A protein modification that effectively converts an L-lysine residue to 4,5-dihydroxy-L-lysine. + + 10978343 + PubMed + + + 12686488 + PubMed + + + AA0370 + RESID + + + 425#K + UniMod + + + + (2S,4Xi,5Xi)-2,6-diamino-4,5-dihydroxyhexanoic acid + RESID-systematic + + + 4,5-dihydroxy-L-lysine + RESID-name + + + 4,5-dihydroxylated L-lysine + PSI-MOD-alternate + + + 45Hy2Lys + PSI-MOD-label + + + alpha,epsilon-diamino-delta,gamma-dihydroxycaproic acid + RESID-alternate + + + delta,gamma-dihydroxylysine + RESID-alternate + + + dihydroxy + UniMod-description + + + Dioxidation + PSI-MS-label + + + MOD_RES 4,5-dihydroxylysine + UniProt-feature + + + + DiffAvg + 32.00 + + + + DiffFormula + C 0 H 0 N 0 O 2 + + + + DiffMono + 31.989829 + + + + Formula + C 6 H 12 N 2 O 3 + + + + MassAvg + 160.17 + + + + MassMono + 160.084792 + + + + Origin + K + + + + Source + natural + + + + TermSpec + none + + MOD:00428 + MOD:00681 + PSI-MOD + + + MOD:00376 + 1'-(phospho-5'-adenosine)-L-histidine + + A protein modification that effectively crosslinks an L-histidine residue and 5'-phosphoadenosine through a phosphoramide ester bond to form 1'-(phospho-5'-adenosine)-L-histidine. + + 15182206 + PubMed + + + 9323207 + PubMed + + + AA0371 + RESID + + + 405#H + UniMod + + + PSI-MOD-slim + + (2S)-2-amino-3-[1-(5'-adenosine phosphono)imidazol-4-yl]propanoic acid + RESID-systematic + + + 1'-(phospho-5'-adenosine)-L-histidine + RESID-name + + + ACT_SITE Tele-AMP-histidine intermediate + UniProt-feature + + + AMP binding site + UniMod-description + + + L-histidine 5'-adenosine phosphoramidester + RESID-alternate + + + L-histidine monoanhydride with 5'-adenylic acid + RESID-alternate + + + N(tau)-5'-adenylic-L-histidine + RESID-alternate + + + N1'-adenylylated histidine + RESID-alternate + + + Phosphoadenosine + PSI-MS-label + + + tele-5'-adenylic-L-histidine + RESID-alternate + + + + DiffAvg + 329.21 + + + + DiffFormula + C 10 H 12 N 5 O 6 P 1 + + + + DiffMono + 329.052520 + + + + Formula + C 16 H 19 N 8 O 7 P 1 + + + + MassAvg + 466.35 + + + + MassMono + 466.111432 + + + + Origin + H + + + + Source + natural + + + + TermSpec + none + + MOD:00909 + MOD:01165 + PSI-MOD + + + MOD:00377 + 1'-(phospho-5'-uridine)-L-histidine + + A protein modification that effectively crosslinks an L-histidine residue and 5'-phosphouridine through a phosphoramide ester bond to form 1'-(phospho-5'-uridine)-L-histidine. + + 11467524 + PubMed + + + 321007 + PubMed + + + 380639 + PubMed + + + 8794735 + PubMed + + + AA0372 + RESID + + + 417#H + UniMod + + + PSI-MOD-slim + + (S)-2-amino-3-[1-(5'-uridine phosphono)imidazol-4-yl]propanoic acid + RESID-systematic + + + 1'-(phospho-5'-uridine)-L-histidine + RESID-name + + + ACT_SITE Tele-UMP-histidine intermediate + UniProt-feature + + + L-histidine 5'-uridine phosphoramidester + RESID-alternate + + + L-histidine monoanhydride with 5'-uridylic acid + RESID-alternate + + + N(tau)-5'-uridylic-L-histidine + RESID-alternate + + + N1'-uridylylated histidine + RESID-alternate + + + PhosphoUridine + PSI-MS-label + + + tele-5'-uridylic-L-histidine + RESID-alternate + + + uridine phosphodiester + UniMod-description + + + + DiffAvg + 306.17 + + + + DiffFormula + C 9 H 11 N 2 O 8 P 1 + + + + DiffMono + 306.025302 + + + + Formula + C 15 H 18 N 5 O 9 P 1 + + + + MassAvg + 443.31 + + + + MassMono + 443.084214 + + + + Origin + H + + + + Source + natural + + + + TermSpec + none + + MOD:00909 + MOD:01166 + PSI-MOD + + + MOD:00378 + L-aspartyl semialdehyde + + A protein modification that effectively converts an L-aspartic acid residue to L-aspartyl semialdehyde. + + 1093385 + PubMed + + + 14235557 + PubMed + + + 15237995 + PubMed + + + AA0373 + RESID + + + 447#D + UniMod + + + PSI-MOD-slim + + (S)-2-amino-4-oxobutanoic acid + RESID-systematic + + + aspartyl 4-semialdehyde + PSI-MOD-alternate + + + aspartyl aldehyde + PSI-MOD-alternate + + + Deoxy + PSI-MS-label + + + L-aminosuccinaldehydic acid + RESID-alternate + + + L-aminosuccinic acid semialdehyde + RESID-alternate + + + L-aspartate-beta-semialdehyde + RESID-alternate + + + L-aspartic beta-semialdehyde + RESID-alternate + + + L-aspartyl aldehyde + RESID-name + + + L-beta-formylalanine + RESID-alternate + + + MOD_RES Aspartyl aldehyde + UniProt-feature + + + reduction + UniMod-description + + + + DiffAvg + -16.00 + + + + DiffFormula + C 0 H 0 N 0 O -1 + + + + DiffMono + -15.994915 + + + + Formula + C 4 H 5 N 1 O 2 + + + + MassAvg + 99.09 + + + + MassMono + 99.032028 + + + + Origin + D + + + + Source + natural + + + + TermSpec + none + + MOD:00904 + MOD:01161 + PSI-MOD + + + MOD:00379 + L-serine microcin E492 siderophore ester + + A protein modification that effectively converts an L-serine residue to L-serine microcin E492 siderophore ester. + + 15102848 + PubMed + + + AA0374 + RESID + + + 448#C-term + UniMod + + + UniMod origin corrected [JSG]. + + L-serine microcin E492 siderophore ester + RESID-name + + + Microcin + PSI-MS-label + + + microcin E492 siderophore ester from serine + UniMod-description + + + MOD_RES Serine microcin E492 siderophore ester + UniProt-feature + + + N-[5-(6-O-seryl-beta-glucosyl)-2,3-dihydroxybenzoyl]-O-[N-(2,3-dihydroxybenzoyl)-O-[N-(2,3-dihydroxybenzoyl)seryl]seryl]serine + RESID-systematic + + + + DiffAvg + 831.69 + + + + DiffFormula + C 36 H 37 N 3 O 20 + + + + DiffMono + 831.197041 + + + + Formula + C 39 H 43 N 4 O 23 + + + + MassAvg + 935.78 + + + + MassMono + 935.231809 + + + + Origin + S + + + + Source + natural + + + + TermSpec + C-term + + MOD:00916 + PSI-MOD + + + MOD:00380 + L-aspartyl molybdenum bis(molybdopterin guanine dinucleotide) + + A protein modification that effectively converts an L-aspartic acid residue to L-aspartyl molybdenum bis(molybdopterin guanine dinucleotide). + + 12910261 + PubMed + + + 14725769 + PubMed + + + AA0375 + RESID + + + 424#D + UniMod + + + + 2-amino-5,6-dimercapto-7-methyl-3,7,8a,9-tetrahydro-8-oxa-1,3,9,10-tetraazaanthracen-4-one guanosine dinucleotide + RESID-alternate + + + bis[8-amino-1a,2,4a,5,6,7,10-heptahydro-2-(trihydrogen diphosphate 5'-ester with guanosine)methyl-6-oxo-3,4-disulfanyl-pteridino[6,7-5,6]pyranoato-S3,S4]-aspartyl-molybdenum + RESID-systematic + + + L-aspartyl molybdenum bis(molybdopterin guanine dinucleotide) + RESID-name + + + molybdenum bis(molybdopterin guanine dinucleotide) + UniMod-description + + + MolybdopterinGD + PSI-MS-label + + + nitrate reductase A aspartyl Mo-bisMGD cofactor + RESID-alternate + + + phosphoric acid 4-(2-amino-4-oxo-3,4,5,6,-tetrahydro-pteridin-6-yl)-2-hydroxy-3,4-dimercapto-but-3-en-yl ester guanylate ester + RESID-alternate + + + + DiffAvg + 1572.02 + + + + DiffFormula + C 40 H 47 Mo 1 N 20 O 26 P 4 S 4 + + + + DiffMono + 1572.985775 + + + + Formula + C 44 H 52 Mo 1 N 21 O 29 P 4 S 4 + + + + MassAvg + 1687.10 + + + + MassMono + 1688.012718 + + + + Origin + D + + + + Source + natural + + + + TermSpec + none + + MOD:00904 + MOD:01167 + PSI-MOD + + + MOD:00381 + L-selenocysteinyl tungsten bis(molybdopterin guanine dinucleotide) (Sec) + + A protein modification that effectively converts an L-selenocysteine residue to L-selenocysteinyl tungsten bis(molybdopterin guanine dinucleotide). + + 11372198 + PubMed + + + 12220497 + PubMed + + + AA0376#SEC + RESID + + + + + DiffAvg + 1691.97 + + + + DiffFormula + C 40 H 47 N 20 O 26 P 4 S 5 Se 0 W 1 + + + + DiffMono + 1691.003369 + + + + Formula + C 43 H 52 N 21 O 27 P 4 S 5 Se 1 W 1 + + + + MassAvg + 1842.02 + + + + MassMono + 1841.957004 + + + + Origin + U + + + + Source + natural + + + + TermSpec + none + + MOD:00746 + MOD:00748 + MOD:01158 + PSI-MOD + + + MOD:00382 + 3-(2-methylthio)ethyl-6-(4-hydroxybenzylidene)-5-iminopiperazin-2-one + + A protein modification that effectively crosslinks an L-methionyl-L-tyrosine dipeptide to form 3-(2-methylthio)ethyl-6-(4-hydroxybenzylidene)-5-iminopiperazin-2-one. + + 10852900 + PubMed + + + 11259412 + PubMed + + + 15491166 + PubMed + + + AA0377 + RESID + + + carboxamidine; cross-link 1. This is a deprecated entry in RESID. It probably does not occur naturally [JSG]. + + 3-(2-methylsulfanyl)ethyl-6-(4-hydroxybenzylidene)-5-iminopiperazin-2-one + RESID-systematic + + + 3-(2-methylthio)ethyl-6-(4-hydroxybenzylidene)-5-amino-3,6-didehydropyrazin-2-ol + RESID-alternate + + + 3-(2-methylthio)ethyl-6-(4-hydroxybenzylidene)-5-iminopiperazin-2-one + RESID-name + + + GFP-like chromoprotein asFP595 chromophore + RESID-alternate + + + L-methionyl-L-tyrosyl-2-keto-5-iminopiperazine + RESID-alternate + + + + DiffAvg + -20.03 + + + + DiffFormula + C 0 H -4 N 0 O -1 S 0 + + + + DiffMono + -20.026215 + + + + Formula + C 14 H 15 N 2 O 2 S 1 + + + + MassAvg + 275.35 + + + + MassMono + 275.085424 + + + + Origin + M, Y + + + + Source + hypothetical + + + + TermSpec + N-term + + MOD:00913 + MOD:00919 + PSI-MOD + + + MOD:00383 + 2-imino-glutamic acid 5-imidazolinone glycine + + A protein modification that effectively crosslinks an L-glutamic acid residue and a glycine residue to form 2-imino-glutamic acid 5-imidazolinone glycine. + + 11682051 + PubMed + + + AA0378 + RESID + + + Cross-link 2; carboxamidine; cross-link 1; incidental to RESID:AA0183; incidental to RESID:AA0365. + + 2,N-didehydroglutamyl-5-imidazolinone glycine + RESID-alternate + + + 2-(3-carboxy-1-iminopropyl)-1-carboxymethyl-1-imidazolin-5-one + RESID-alternate + + + 2-imino-glutamic acid 5-imidazolinone glycine + RESID-name + + + 2-imino-glutamyl-5-imidazolinone glycine + RESID-alternate + + + 4-[1-(carboxymethyl)-5-oxo-4,5-dihydro-1H-imidazol-2-yl]-4-iminobutanoic acid + RESID-systematic + + + [2-(3-carboxy-1-iminopropyl)-5-oxo-4,5-dihydro-imidazol-1-yl]-acetic acid + RESID-alternate + + + CROSSLNK 2-iminomethyl-5-imidazolinone (Glu-Gly) + UniProt-feature + + + para-hydroxybenzylidene-imidazolidinone chromophore + RESID-alternate + + + + DiffAvg + -20.03 + + + + DiffFormula + C 0 H -4 N 0 O -1 + + + + DiffMono + -20.026215 + + + + Formula + C 7 H 6 N 2 O 3 + + + + MassAvg + 166.14 + + + + MassMono + 166.037842 + + + + Origin + E, G + + + + Source + hypothetical + + + + TermSpec + none + + MOD:00906 + MOD:00908 + MOD:01882 + PSI-MOD + + + MOD:00384 + 2-imino-methionine 5-imidazolinone glycine + + A protein modification that effectively crosslinks an L-methionine residue and a glycine residue to form 2-imino-methionine 5-imidazolinone glycine. + + 10852900 + PubMed + + + 12185250 + PubMed + + + 12909624 + PubMed + + + 15542608 + PubMed + + + AA0379 + RESID + + + Cross-link 2; carboxamidine; cross-link 1; incidental to RESID:AA0183; incidental to RESID:AA0365. + + (2-[1-imino-3-(methylsulfanyl)propyl]-5-oxo-4,5-dihydro-imidazol-1-yl)acetic acid + RESID-alternate + + + (2-[3-(methylsulfanyl)propanimidoyl]-5-oxo-4,5-dihydro-1H-imidazol-1-yl)acetic acid + RESID-systematic + + + 2,N-didehydromethionyl-5-imidazolinone glycine + RESID-alternate + + + 2-[1-imino-3-(methylsulfanyl)propyl]-1-carboxymethyl-1-imidazolin-5-one + RESID-alternate + + + 2-imino-methionine 5-imidazolinone glycine + RESID-name + + + 2-imino-methionyl-5-imidazolinone glycine + RESID-alternate + + + CROSSLNK 2-iminomethyl-5-imidazolinone (Met-Gly) + UniProt-feature + + + GFP-like chromoprotein asFP595 chromophore + RESID-alternate + + + para-hydroxybenzylidene-imidazolidinone chromophore + RESID-alternate + + + red fluorescent protein eqFP611 chromophore + RESID-alternate + + + + DiffAvg + -20.03 + + + + DiffFormula + C 0 H -4 N 0 O -1 S 0 + + + + DiffMono + -20.026215 + + + + Formula + C 7 H 8 N 2 O 1 S 1 + + + + MassAvg + 168.21 + + + + MassMono + 168.035734 + + + + Origin + G, M + + + + Source + natural + + + + TermSpec + none + + MOD:00908 + MOD:00913 + MOD:01882 + PSI-MOD + + + MOD:00385 + L-asparagine 5-imidazolinone glycine + + A protein modification that effectively crosslinks an L-asparagine residue and a glycine residue to form L-asparagine 5-imidazolinone glycine. + + 10504696 + PubMed + + + AA0380 + RESID + + + Cross-link 2; carboxamidine; incidental to RESID:AA0183; incidental to RESID:AA0365. + + (2-[(1S)-1,3-diamino-3-oxopropyl]-5-oxo-4,5-dihydro-1H-imidazol-1-yl)acetic acid + RESID-systematic + + + 2-[(S)-1,3-diamino-3-oxopropyl]-1-carboxymethyl-1-imidazolin-5-one + RESID-alternate + + + [2-(1,3-diamino-3-oxopropyl)-5-oxo-4,5-dihydro-imidazol-1-yl]-acetic acid + RESID-alternate + + + asparaginyl-5-imidazolinone glycine + RESID-alternate + + + CROSSLNK 5-imidazolinone (Asn-Gly) + UniProt-feature + + + L-asparagine 5-imidazolinone glycine + RESID-name + + + para-hydroxybenzylidene-imidazolidinone chromophore + RESID-alternate + + + Zoanthus sp. fluorescent protein FP506 chromophore + RESID-alternate + + + + DiffAvg + -18.02 + + + + DiffFormula + C 0 H -2 N 0 O -1 + + + + DiffMono + -18.010565 + + + + Formula + C 6 H 7 N 3 O 2 + + + + MassAvg + 153.14 + + + + MassMono + 153.053826 + + + + Origin + G, N + + + + Source + hypothetical + + + + TermSpec + none + + MOD:00903 + MOD:00908 + MOD:01882 + PSI-MOD + + + MOD:00386 + L-lysine 5-imidazolinone glycine + + A protein modification that effectively crosslinks an L-lysine residue and a glycine residue to form L-lysine 5-imidazolinone glycine. + + 10504696 + PubMed + + + AA0381 + RESID + + + Cross-link 2; carboxamidine; incidental to RESID:AA0183; incidental to RESID:AA0365. + + (2-[(1S)-1,5-diaminopentyl]-5-oxo-4,5-dihydro-1H-imidazol-1-yl)acetic acid + RESID-systematic + + + 2-[(S)-1,5-diaminopentanyl]-1-carboxymethyl-1-imidazolin-5-one + RESID-alternate + + + [2-(1,5-diaminopentanyl)-5-oxo-4,5-dihydro-imidazol-1-yl]-acetic acid + RESID-alternate + + + Anemonia majano fluorescent protein FP486 chromophore + RESID-alternate + + + CROSSLNK 5-imidazolinone (Lys-Gly) + UniProt-feature + + + L-lysine 5-imidazolinone glycine + RESID-name + + + lysyl-5-imidazolinone glycine + RESID-alternate + + + para-hydroxybenzylidene-imidazolidinone chromophore + RESID-alternate + + + + DiffAvg + -18.02 + + + + DiffFormula + C 0 H -2 N 0 O -1 + + + + DiffMono + -18.010565 + + + + Formula + C 8 H 13 N 3 O 1 + + + + MassAvg + 167.21 + + + + MassMono + 167.105862 + + + + Origin + G, K + + + + Source + hypothetical + + + + TermSpec + none + + MOD:00908 + MOD:00912 + MOD:01882 + PSI-MOD + + + MOD:00387 + 2-tetrahydropyridinyl-5-imidazolinone glycine + + A protein modification that effectively crosslinks an L-lysine residue and a glycine residue to form 2-tetrahydropyridinyl-5-imidazolinone glycine. + + 10504696 + PubMed + + + 15628861 + PubMed + + + AA0382 + RESID + + + Cross-link 2; carboxamidine; incidental to RESID:AA0183; incidental to RESID:AA0365. + + 2-(3,4,5,6-tetrahydropyridin-2-yl)-1-carboxymethyl-1-imidazolin-5-one + RESID-alternate + + + 2-(tetrahydropyrid-2-yl)-5-imidazolinone glycine + RESID-alternate + + + 2-tetrahydropyridinyl-5-imidazolinone glycine + RESID-name + + + [5-oxo-2-(3,4,5,6-tetrahydropyridin-2-yl)-4,5-dihydro-1H-imidazol-1-yl]acetic acid + RESID-alternate + + + [5-oxo-2-(3,4,5,6-tetrahydropyridin-2-yl)-4,5-dihydro-1H-imidazol-1-yl]acetic acid + RESID-systematic + + + CROSSLNK 2-tetrahydro-2-pyridyl-5-imidazolinone (Lys-Gly) + UniProt-feature + + + para-hydroxybenzylidene-imidazolidinone chromophore + RESID-alternate + + + Zoanthus sp. fluorescent protein zFP538 chromophore + RESID-alternate + + + + DiffAvg + -37.06 + + + + DiffFormula + C 0 H -7 N -1 O -1 + + + + DiffMono + -37.052764 + + + + Formula + C 8 H 9 N 2 O 1 + + + + MassAvg + 149.17 + + + + MassMono + 149.071488 + + + + Origin + G, K + + + + Source + natural + + + + TermSpec + N-term + + MOD:00908 + MOD:00912 + MOD:01882 + PSI-MOD + + + MOD:00388 + L-alanyl-pentaglycyl-murein peptidoglycan + + A protein modification that effectively attaches an L-alanine residue to murein peptidoglycan by a pentaglycine linker peptide. + + 8163519 + PubMed + + + AA0383 + RESID + + + + (2R,6S)-2-(N-mureinyl-(R)-alanyl-(S)-isoglutamyl)amino-6-(alanyl-pentaglycyl)amino-pimeloyl-(S)-alanyl-(S)-alanine + RESID-alternate + + + L-alanyl-pentaglycyl-murein peptidoglycan + RESID-name + + + MOD_RES Pentaglycyl murein peptidoglycan amidated alanine + UniProt-feature + + + + DiffAvg + 268.25 + + + + DiffFormula + C 10 H 14 N 5 O 4 + + + + DiffMono + 268.104579 + + + + Formula + C 13 H 20 N 6 O 6 + + + + MassAvg + 356.34 + + + + MassMono + 356.144432 + + + + Origin + A + + + + Source + hypothetical + + + + TermSpec + C-term + + MOD:00901 + MOD:01159 + PSI-MOD + + + MOD:00389 + N-formyl-L-proline + + A protein modification that effectively converts an L-proline residue to N-formyl-L-proline. + + 12051774 + PubMed + + + 5464655 + PubMed + + + AA0384 + RESID + + + 122#N-term + UniMod + + + CAUTION - observations of this modification can be attributed to unintended artifactual production, or to spurious peptide MS identification. This modification is probably not a natural post-translational modification [JSG]. + + (2S)-1-formylpyrrolidine-2-carboxylic acid + RESID-systematic + + + 1-formyl-2-pyrrolidinecarboxylic acid + RESID-alternate + + + 1-formylproline + RESID-alternate + + + N-formyl-L-proline + RESID-name + + + N-formylated L-proline + PSI-MOD-alternate + + + NFoPro + PSI-MOD-label + + + + DiffAvg + 28.01 + + + + DiffFormula + C 1 H 0 N 0 O 1 + + + + DiffMono + 27.994915 + + + + Formula + C 6 H 8 N 1 O 2 + + + + MassAvg + 126.14 + + + + MassMono + 126.055504 + + + + Origin + P + + + + Source + hypothetical + + + + TermSpec + N-term + + MOD:00409 + MOD:00915 + MOD:01696 + PSI-MOD + + + MOD:00390 + O-decanoyl-L-serine + + A protein modification that effectively converts an L-serine residue to O-decanoyl-L-serine. + + 12630926 + PubMed + + + AA0385 + RESID + + + 449#S + UniMod + + + + (2S)-2-amino-3-(decanoyloxy)propanoic acid + RESID-systematic + + + Decanoyl + PSI-MS-label + + + L-serine decanoate ester + RESID-alternate + + + lipid + UniMod-description + + + LIPID O-decanoyl serine + UniProt-feature + + + O-decanoyl-L-serine + RESID-name + + + O-decanoylated L-serine + PSI-MOD-alternate + + + O3-decanoyl-L-serine + RESID-alternate + + + ODecSer + PSI-MOD-label + + + + DiffAvg + 154.25 + + + + DiffFormula + C 10 H 18 N 0 O 1 + + + + DiffMono + 154.135765 + + + + Formula + C 13 H 23 N 1 O 3 + + + + MassAvg + 241.33 + + + + MassMono + 241.167794 + + + + Origin + S + + + + Source + natural + + + + TermSpec + none + + MOD:00668 + MOD:00916 + PSI-MOD + + + MOD:00391 + O-octanoyl-L-threonine + + A protein modification that effectively converts an L-threonine residue to O-octanoyl-L-threonine. + + 11546772 + PubMed + + + 12716131 + PubMed + + + AA0386 + RESID + + + 426#T + UniMod + + + PSI-MOD-slim + + (2S)-2-amino-3-(octanoyloxy)butanoic acid + RESID-systematic + + + L-threonine octanoate ester + RESID-alternate + + + LIPID O-octanoyl threonine + UniProt-feature + + + O-octanoyl-L-threonine + RESID-name + + + O-octanoylated L-threonine + PSI-MOD-alternate + + + O3-octanoyl-L-threonine + RESID-alternate + + + Octanoyl + PSI-MS-label + + + octanoyl + UniMod-description + + + OOctThr + PSI-MOD-label + + + + DiffAvg + 126.20 + + + + DiffFormula + C 8 H 14 N 0 O 1 + + + + DiffMono + 126.104465 + + + + Formula + C 12 H 21 N 1 O 3 + + + + MassAvg + 227.30 + + + + MassMono + 227.152144 + + + + Origin + T + + + + Source + natural + + + + TermSpec + none + + MOD:00669 + MOD:00917 + PSI-MOD + + + MOD:00392 + O-decanoyl-L-threonine + + A protein modification that effectively converts an L-threonine residue to O-decanoyl-L-threonine. + + 11546772 + PubMed + + + AA0387 + RESID + + + 449#T + UniMod + + + + (2S)-2-amino-3-(decanoyloxy)propanoic acid + RESID-systematic + + + Decanoyl + PSI-MS-label + + + L-threonine decanoate ester + RESID-alternate + + + lipid + UniMod-description + + + LIPID O-decanoyl threonine + UniProt-feature + + + O-decanoyl-L-threonine + RESID-name + + + O-decanoylated L-threonine + PSI-MOD-alternate + + + O3-decanoyl-L-threonine + RESID-alternate + + + ODecThr + PSI-MOD-label + + + + DiffAvg + 154.25 + + + + DiffFormula + C 10 H 18 N 0 O 1 + + + + DiffMono + 154.135765 + + + + Formula + C 14 H 25 N 1 O 3 + + + + MassAvg + 255.36 + + + + MassMono + 255.183444 + + + + Origin + T + + + + Source + natural + + + + TermSpec + none + + MOD:00668 + MOD:00917 + PSI-MOD + + + MOD:00393 + O-methylated residue + + A protein modification that effectively replaces a hydroxyl group hydrogen with a methyl group to produce either an ether from an alcohol or an ester from an acid. + + 18688235 + PubMed + + + PSI-MOD-slim + + OMeRes + PSI-MOD-label + + MOD:00427 + PSI-MOD + + + MOD:00394 + acetylated residue + + A protein modification that effectively replaces a hydrogen atom with an acetyl group. + + 0 + DeltaMass + + + 11857757 + PubMed + + + 11999733 + PubMed + + + 12175151 + PubMed + + + 14730666 + PubMed + + + 15350136 + PubMed + + + 1 + UniMod + + + Amino hydrogens are replaced to produce amides; hydroxyl hydrogens are replaced to produce esters; and hydrosulfanyl (thiol) hydrogens are replaced to produce sulfanyl esters (thiol esters). From DeltaMass: Average Mass: 42 + PSI-MOD-slim + + Acetyl + PSI-MS-label + + + Acetylation + UniMod-description + + + Acetylation (N terminus, N epsilon of Lysine, O of Serine) (Ac) + DeltaMass-label + + + AcRes + PSI-MOD-label + + + + DiffAvg + 42.04 + + + + DiffFormula + C 2 H 2 O 1 + + + + DiffMono + 42.010565 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00649 + PSI-MOD + + + MOD:00395 + thioester crosslinked residues + + A protein modification that crosslinks two residues by formation of a thioester bond between a cysteine thiol and either an alpha-carbonyl, as in S-(L-methionyl-L-cysteine), or a sidechain carbonyl, as in S-(L-isoglutamyl)-L-cysteine. + + 18688235 + PubMed + + + PSI-MOD-slim + MOD:00033 + MOD:00905 + PSI-MOD + + + MOD:00396 + O-glycosylated residue + + A protein modification that effectively replaces a residue hydrogen atom on an oxygen with a carbohydrate-like group through a glycosidic bond. + + 18688235 + PubMed + + + PSI-MOD-slim + + OGlycoRes + PSI-MOD-label + + MOD:00693 + PSI-MOD + + + MOD:00397 + iodoacetamide derivatized residue + + A protein modification that is produced by reaction with iodoacetamide, usually replacement of a reactive hydrogen with a methylcarboxamido group. + + 11327326 + PubMed + + + 11510821 + PubMed + + + 12422359 + PubMed + + + 4 + UniMod + + + PSI-MOD-slim + + Carbamidomethyl + PSI-MS-label + + + Iodoacetamide derivative + UniMod-description + + + + DiffAvg + 57.05 + + + + DiffFormula + C 2 H 3 N 1 O 1 + + + + DiffMono + 57.021464 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + PSI-MOD + + + MOD:00398 + carbamoylated residue + + A protein modification that effectively replaces a hydrogen atom with a carbamoyl (carboxamido) group. Replacement of an amino hydrogen produces a ureido group. + + 56 + DeltaMass + + + 10978403 + PubMed + + + 12203680 + PubMed + + + 5 + UniMod + + + This modification can be produced by hydrogen cyanate, either used as a reagent or as released by urea degradation in solution [JSG]. + PSI-MOD-slim + + Carbamyl + UniMod-interim + + + Carbamylation + DeltaMass-label + + + Carbamylation + UniMod-description + + + + DiffAvg + 43.02 + + + + DiffFormula + C 1 H 1 N 1 O 1 + + + + DiffMono + 43.005814 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + none + + + + TermSpec + none + + MOD:01156 + PSI-MOD + + + MOD:00399 + iodoacetic acid derivatized residue + + A protein modification that is produced by reaction with iodoacetic acid, usually replacement of a reactive hydrogen with a methylcarboxy group. + + 64 + DeltaMass + + + 6 + UniMod + + + From DeltaMass: Average Mass: 58 Abbreviation:CmC Average Mass Change:58 Notes:Cysteine reacts with iodoacetic acid to produce carboxymethyl cysteine. + PSI-MOD-slim + + Carboxymethyl + PSI-MS-label + + + Carboxymethyl (on Cysteine) + DeltaMass-label + + + Iodoacetic acid derivative + UniMod-description + + + + DiffAvg + 58.04 + + + + DiffFormula + C 2 H 2 O 2 + + + + DiffMono + 58.005479 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + PSI-MOD + + + MOD:00400 + deamidated residue + + A protein modification that effectively replaces a carboxamido group with a carboxyl group, with both a gain of oxygen and loss of a nitrogen and a hydrogen. + + 32 + DeltaMass + + + 7 + UniMod + + + From DeltaMass: References:Vish Katta. + PSI-MOD-slim + + Deamidated + PSI-MS-label + + + Deamidation + UniMod-description + + + Deamidation of Asparagine and Glutamine to Aspartate and Glutamate + DeltaMass-label + + + deamidationkq + OMSSA-label + + + dNRes + PSI-MOD-label + + + + DiffAvg + 0.98 + + + + DiffFormula + H -1 N -1 O 1 + + + + DiffMono + 0.984016 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + none + + + + TermSpec + none + + MOD:01156 + PSI-MOD + + + MOD:00401 + Gygi ICAT(TM) d0 modified cysteine + + A protein modification that is produced by formation of an adduct of a cysteine residue with the Gygi isotope-coded affinity tag d0 reagent. + + 10504701 + PubMed + + + 8#C + UniMod + + + + Gygi ICAT(TM) d0 + UniMod-description + + + ICAT-G + PSI-MS-label + + + + DiffAvg + 486.63 + + + + DiffFormula + C 22 H 38 N 4 O 6 S 1 + + + + DiffMono + 486.251206 + + + + Formula + C 25 H 43 N 5 O 7 S 2 + + + + MassAvg + 589.77 + + + + MassMono + 589.260391 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:01426 + MOD:01820 + PSI-MOD + + + MOD:00402 + Gygi ICAT(TM) d8 modified cysteine + + A protein modification that is produced by formation of an adduct of a cysteine residue with the Gygi isotope-coded affinity tag d8 reagent. + + 10504701 + PubMed + + + 9#C + UniMod + + + + Gygi ICAT(TM) d8 + UniMod-description + + + ICAT-G:2H(8) + PSI-MS-label + + + + DiffAvg + 494.30 + + + + DiffFormula + C 22 (1)H 30 (2)H 8 N 4 O 6 S 1 + + + + DiffMono + 494.301420 + + + + Formula + C 25 (1)H 35 (2)H 8 N 5 O 7 S 2 + + + + MassAvg + 597.31 + + + + MassMono + 597.310605 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:01431 + MOD:01820 + PSI-MOD + + + MOD:00403 + homoserine + + A protein modification that effectively converts an L-methionine residue to homoserine. + + 113 + DeltaMass + + + 10#M + UniMod + + + Usually formed from methionine by reaction with cyanogen bromide, CNBr, which cleaves the peptide at the methionine carboxyl group and the following residue amino group. + PSI-MOD-slim + + ctermpephsem + OMSSA-label + + + Homoserine + UniMod-description + + + Homoserine formed from Met by CNBr treatment + DeltaMass-label + + + Met->Hse + PSI-MS-label + + + + DiffAvg + -30.09 + + + + DiffFormula + C -1 H -2 O 1 S -1 + + + + DiffMono + -29.992806 + + + + Formula + C 4 H 7 N 1 O 2 + + + + MassAvg + 101.10 + + + + MassMono + 101.047678 + + + + Origin + M + + + + Source + artifact + + + + TermSpec + C-term + + MOD:00913 + PSI-MOD + + + MOD:00404 + homoserine lactone + + A protein modification that effectively converts an L-methionine residue to homoserine lactone. + + 90 + DeltaMass + + + 11#M + UniMod + + + Usually formed from methionine by reaction with cyanogen bromide, CNBr, which cleaves the peptide at the methionine carboxyl group. Under acid conditions the homoserine dehydrates to form the cyclic lactone. + PSI-MOD-slim + + ctermpephselactm + OMSSA-label + + + Homoserine lactone + UniMod-description + + + Met->Hsl + UniMod-interim + + + + DiffAvg + -48.10 + + + + DiffFormula + C -1 H -4 S -1 + + + + DiffMono + -48.003371 + + + + Formula + C 4 H 5 N 1 O 1 + + + + MassAvg + 83.09 + + + + MassMono + 83.037114 + + + + Origin + M + + + + Source + artifact + + + + TermSpec + C-term + + MOD:00601 + MOD:00913 + PSI-MOD + + + MOD:00405 + Applied Biosystems original ICAT(TM) d8 modified cysteine + + A protein modification that is produced by formation of an adduct of a cysteine residue with the Applied Biosystems original isotope-coded affinity tag d8 reagent. + + 12#C + UniMod + + + PSI-MOD-slim + + Applied Biosystems original ICAT(TM) d8 + UniMod-description + + + ICAT-D:2H(8) + PSI-MS-label + + + + DiffAvg + 450.28 + + + + DiffFormula + C 20 (1)H 26 (2)H 8 N 4 O 5 S 1 + + + + DiffMono + 450.275205 + + + + Formula + C 23 (1)H 31 (2)H 8 N 5 O 6 S 2 + + + + MassAvg + 553.28 + + + + MassMono + 553.284390 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:01431 + MOD:01820 + PSI-MOD + + + MOD:00406 + Applied Biosystems original ICAT(TM) d0 modified cysteine + + A protein modification that is produced by formation of an adduct of a cysteine residue with the Applied Biosystems original isotope-coded affinity tag d0 reagent. + + 13#C + UniMod + + + PSI-MOD-slim + + Applied Biosystems original ICAT(TM) d0 + UniMod-description + + + ICAT-D + PSI-MS-label + + + + DiffAvg + 442.22 + + + + DiffFormula + C 20 (1)H 34 N 4 O 5 S 1 + + + + DiffMono + 442.224991 + + + + Formula + C 23 (1)H 39 N 5 O 6 S 2 + + + + MassAvg + 545.23 + + + + MassMono + 545.234176 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:01426 + MOD:01820 + PSI-MOD + + + MOD:00407 + residue methyl ester + + A protein modification that effectively replaces a carboxyl group with a carboxy methyl ester group. OBSOLETE because UniMod:14 merged with entry 34, remap to MOD:00599. + + 14 merged with entry 34 + UniMod + + + 18688235 + PubMed + + + + ResOMe + PSI-MOD-label + + + + DiffAvg + 14.03 + + + + DiffFormula + C 1 H 2 + + + + DiffMono + 14.015650 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + none + + + + TermSpec + none + + 1 + PSI-MOD + + + MOD:00408 + N-acetylated residue + + A protein modification that effectively replaces a residue amino or imino hydrogen with an acetyl group. + + 18688235 + PubMed + + + PSI-MOD-slim + + N-Acetyl + PSI-MOD-alternate + + + N-Acetylation + PSI-MOD-alternate + + + NAcRes + PSI-MOD-label + + + + DiffAvg + 42.04 + + + + DiffFormula + C 2 H 2 O 1 + + + + DiffMono + 42.010565 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + none + + + + TermSpec + none + + MOD:00394 + MOD:00670 + PSI-MOD + + + MOD:00409 + N-formylated residue + + A protein modification that effectively replaces a residue amino group with a formamido group. + + PSI-MOD-slim + + Formyl + PSI-MS-label + + + NFoRes + PSI-MOD-label + + + ntermformyl + OMSSA-label + + + ntermpepformyl + OMSSA-label + + + + DiffAvg + 28.01 + + + + DiffFormula + C 1 O 1 + + + + DiffMono + 27.994915 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + none + + + + TermSpec + none + + MOD:00493 + MOD:00670 + PSI-MOD + + + MOD:00410 + S-(N-isopropylcarboxamidomethyl)-L-cysteine + + A protein modification that effectively converts an L-cysteine residue to S-(N-isopropylcarboxamidomethyl)-L-cysteine. + + 11465505 + PubMed + + + 8465942 + PubMed + + + 17#C + UniMod + + + + N-isopropylcarboxamidomethyl + UniMod-description + + + NIPCAM + PSI-MS-label + + + nipcam + OMSSA-label + + + + DiffAvg + 99.13 + + + + DiffFormula + C 5 H 9 N 1 O 1 S 0 + + + + DiffMono + 99.068414 + + + + Formula + C 8 H 14 N 2 O 2 S 1 + + + + MassAvg + 202.27 + + + + MassMono + 202.077599 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + MOD:00905 + PSI-MOD + + + MOD:00411 + O18 label + + modification from UniMod Isotopic label. OBSOLETE because UniMod:18 is now merged with entry 258 remap to MOD:00581 'single 018 label' + + 18 is now merged with entry 258 remap to MOD:00581 'single 018 label'" [PubMed:18688235 + UniMod + + + A modification from UniMod:18 + + + DiffAvg + 2.00 + + + + DiffFormula + (16)O -1 (18)O 1 + + + + DiffMono + 2.004246 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + 1 + PSI-MOD + + + MOD:00412 + oxidation + + modification from UniMod artifact. OBSOLETE because UniMod entry 19 is now merged with UniMod 35 remap to MOD:00425 'monohydroxylated residue'. + + 18688235 + PubMed + + + + + DiffAvg + 16.00 + + + + DiffFormula + O 1 + + + + DiffMono + 15.994915 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + none + + + + TermSpec + none + + 1 + PSI-MOD + + + MOD:00413 + biotinyl-iodoacetamidyl-3,6-dioxaoctanediamine derivatized cysteine + + A protein modification that is produced by reaction of a cysteine residue with biotinyl-iodoacetamidyl-3,6-dioxaoctanediamine. + + 20#C + UniMod + + + + Biotinyl-iodoacetamidyl-3,6-dioxaoctanediamine + UniMod-description + + + PEO-Iodoacetyl-LC-Biotin + UniMod-interim + + + + DiffAvg + 414.52 + + + + DiffFormula + C 18 H 30 N 4 O 5 S 1 + + + + DiffMono + 414.193691 + + + + Formula + C 21 H 35 N 5 O 6 S 2 + + + + MassAvg + 517.66 + + + + MassMono + 517.202876 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + MOD:00905 + PSI-MOD + + + MOD:00414 + monomethylated L-arginine + + A protein modification that effectively replaces one hydrogen atom of an L-arginine residue with one methyl group. + + 215 + DeltaMass + + + 34#R + UniMod + + + From DeltaMass: formula incorrect, N and O reversed + PSI-MOD-slim + + Me1Arg + PSI-MOD-label + + + Methyl + PSI-MS-label + + + methylr + OMSSA-label + + + N-methyl Arginyl + DeltaMass-label + + + + DiffAvg + 14.03 + + + + DiffFormula + C 1 H 2 N 0 O 0 + + + + DiffMono + 14.015650 + + + + Formula + C 7 H 14 N 4 O 1 + + + + MassAvg + 170.22 + + + + MassMono + 170.116761 + + + + Origin + R + + + + Source + none + + + + TermSpec + none + + MOD:00599 + MOD:00658 + PSI-MOD + + + MOD:00415 + phosphorylation without neutral loss + + modification from UniMod - OBSOLETE because UniMod entry 22 is now merged with entry 21 remap to MOD:00696 'phosphorylated residue'. + + 18688235 + PubMed + + + + + DiffAvg + 79.98 + + + + DiffFormula + H 1 O 3 P 1 + + + + DiffMono + 79.966331 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + 1 + PSI-MOD + + + MOD:00416 + phosphorylation of an hydroxyl amino acid with prompt loss of phosphate + + A change resulting in an alteration of the measured molecular mass of a peptide or protein hydroxyl amino acid phosphorylated promptly followed by secondary loss of a neutral trihydrogen phosphate molecular fragment. + + 23 + UniMod + + + O4-phosphotyrosine does not lose phosphate by this mechanism. UniMod does not provide a citation for this particular modification [JSG]. + PSI-MOD-slim + + Dehydrated + UniMod-interim + + + Dehydration + UniMod-description + + + + DiffAvg + -18.02 + + + + DiffFormula + H -2 O -1 + + + + DiffMono + -18.010565 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00432 + MOD:00704 + PSI-MOD + + + MOD:00417 + S-carboxamidoethyl-L-cysteine + + A protein modification that effectively converts an L-cysteine residue to S-carboxamidoethyl-L-cysteine. + + 72 + DeltaMass + + + 1481983 + PubMed + + + 24#C + UniMod + + + From DeltaMass: References: Anal. Biochem. Vol 216 No. 1 p131 (citation not found) Notes: Residual acrylamide in SDS gels can label free cysteines to produce propionamido-Cys (also known as PAM-Cys) + + Acrylamide adduct + UniMod-description + + + PAM-Cys + DeltaMass-label + + + Propionamide + PSI-MS-label + + + Propionamide or Acrylamide adduct + DeltaMass-label + + + propionamidec + OMSSA-label + + + S-(3-amino-3-oxopropyl)cysteine + PSI-MOD-alternate + + + S-carbamoylethyl-L-cysteine + PSI-MOD-alternate + + + S-propanamide-L-cysteine + PSI-MOD-alternate + + + + DiffAvg + 71.08 + + + + DiffFormula + C 3 H 5 N 1 O 1 S 0 + + + + DiffMono + 71.037114 + + + + Formula + C 6 H 10 N 2 O 2 S 1 + + + + MassAvg + 174.22 + + + + MassMono + 174.046299 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:00905 + PSI-MOD + + + MOD:00418 + pyridylacetylated residue + + A protein modification that effectively replaces a hydrogen atom with an (pyridin-3-yl)acetyl group. + + 9276974 + PubMed + + + 25 + UniMod + + + Produced by reaction with N-[(pyrid-3-yl)acetyl]oxy-succinimide [JSG]. + + Pyridylacetyl + PSI-MS-label + + + pyridylacetyl + UniMod-description + + + + DiffAvg + 119.12 + + + + DiffFormula + C 7 H 5 N 1 O 1 + + + + DiffMono + 119.037114 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00649 + MOD:00848 + PSI-MOD + + + MOD:00419 + (R)-5-oxo-1,4-tetrahydrothiazine-3-carboxylic acid + + A protein modification that effectively converts an L-cysteine residue to (R)-5-oxo-1,4-tetrahydrothiazine-3-carboxylic acid. + + 336 + DeltaMass + + + 12643538 + PubMed + + + 26#C + UniMod + + + From DeltaMass: A secondary modification affecting peptides with S-carbamoylmethyl-L-cysteine (CamC) at the N-terminus. These exist in enzymatic digests of proteins that have been S-alkylated with iodoacetamide. Cyclization of N-terminal CamC gives a residue of (R)-5-oxoperhydro-1,4-thiazine-3-carboxylic acid. Peptides in which this has occurred become more hydrophobic, and lose 17 Da from the N-terminal residue. + + (R)-5-oxoperhydro-1,4-thiazine-3-carboxylic acid + DeltaMass-label + + + 5-oxothiomorpholine-3-carboxylic acid + PSI-MOD-alternate + + + Otc + DeltaMass-label + + + Pyro-carbamidomethyl + UniMod-interim + + + S-carbamoylmethylcysteine cyclization (N-terminus) + DeltaMass-label + + + S-carbamoylmethylcysteine cyclization (N-terminus) + UniMod-description + + + + DiffAvg + 40.02 + + + + DiffFormula + C 2 H 0 N 0 O 1 S 0 + + + + DiffMono + 39.994915 + + + + Formula + C 5 H 6 N 1 O 2 S 1 + + + + MassAvg + 144.17 + + + + MassMono + 144.011924 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + N-term + + MOD:00601 + MOD:00905 + PSI-MOD + + + MOD:00420 + 2-pyrrolidone-5-carboxylic acid (Glu) + + A protein modification that effectively converts an L-glutamic acid residue to 2-pyrrolidone-5-carboxylic acid. + + 16 + DeltaMass + + + 10214721 + PubMed + + + 1836357 + PubMed + + + 3473473 + PubMed + + + 8382902 + PubMed + + + AA0031#GLU + RESID + + + 27#E + UniMod + + + From DeltaMass: References: The conversion of glutamic acid to pyroglutamic was reported for the beta-amyloid protein. Miller et al. Arch. Biochem. Biophy. (1993) 301, 41-52 [DeltaMass]. The modification in amyloid protein is probably an artifact of treatment with strong acid under anhydrous conditions. Peptides with N-terminal glutamic acid isolated from single cells of Aplysia neurons show partial conversion to pyroglutamic acid, possibly dependent on a temperature sensitive factor [JSG]. + + (2S)-5-oxo-2-pyrrolidinecarboxylic acid + RESID-systematic + + + 2-oxopyrrolidine-5-carboxylic acid + RESID-alternate + + + 2-pyrrolidone-5-carboxylic acid + RESID-name + + + 5-oxoproline + RESID-alternate + + + 5-oxopyrrolidine-2-carboxylic acid + RESID-alternate + + + 5-pyrrolidone-2-carboxylic acid + RESID-alternate + + + Glu->pyro-Glu + PSI-MS-label + + + MOD_RES Pyrrolidone carboxylic acid (Glu) + UniProt-feature + + + ntermpeppyroe + OMSSA-label + + + PCA + RESID-alternate + + + PyrGlu(Glu) + PSI-MOD-label + + + Pyro-glu from E + UniMod-description + + + pyroglutamic acid + RESID-alternate + + + Pyroglutamic Acid formed from Glutamic Acid + DeltaMass-label + + + + DiffAvg + -18.02 + + + + DiffFormula + C 0 H -2 N 0 O -1 + + + + DiffMono + -18.010565 + + + + Formula + C 5 H 6 N 1 O 2 + + + + MassAvg + 112.11 + + + + MassMono + 112.039853 + + + + Origin + E + + + + Source + artifact + + + + TermSpec + N-term + + MOD:00906 + MOD:01048 + PSI-MOD + + + MOD:00421 + C-glycosylated residue + + A protein modification that effectively replaces a residue hydrogen atom on a carbon with a carbohydrate-like group through a glycosidic bond. + + 18688235 + PubMed + + + PSI-MOD-slim + + CGlycoRes + PSI-MOD-label + + MOD:00693 + PSI-MOD + + + MOD:00422 + alpha-amino morpholine-2-acetylated residue + + A protein modification that effectively replaces a residue alpha-amino- or alpha-imino-hydrogen with a morpholine-2-acetyl group. + + 10446193 + PubMed + + + 29#N-term + UniMod + + + The UniMod name "N-Succinimidyl-3-morpholine acetate" appears to have been a typographical error [JSG]. + + N-Succinimidyl-2-morpholine acetate + UniMod-description + + + N-succinimidylmorpholine-2-acetate alpha-amino derivative + PSI-MOD-alternate + + + SMA + PSI-MS-label + + + + DiffAvg + 127.14 + + + + DiffFormula + C 6 H 9 N 1 O 2 + + + + DiffMono + 127.063329 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + N-term + + MOD:01696 + MOD:01813 + PSI-MOD + + + MOD:00423 + monosodium salt + + A protein modification that effectively substitutes one sodium atom for one hydrogen atom. + + 0 + DeltaMass + + + 30 + UniMod + + + PSI-MOD-slim + + Cation:Na + PSI-MS-label + + + Na1Res + PSI-MOD-label + + + Sodium + DeltaMass-label + + + Sodium adduct + UniMod-description + + + + DiffAvg + 21.98 + + + + DiffFormula + H -1 Na 1 + + + + DiffMono + 21.981944 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + TermSpec + none + + MOD:00747 + PSI-MOD + + + MOD:00424 + S-pyridylethyl-L-cysteine + + A protein modification that effectively converts an L-cysteine residue to S-pyridylethyl-L-cysteine. + + 253 + DeltaMass + + + 11760118 + PubMed + + + 626389 + PubMed + + + 8297018 + PubMed + + + 8783016 + PubMed + + + 31#C + UniMod + + + From DeltaMass: Formula:C10H12O2N1S1 (formula incorrect, N and O reversed) Monoisotopic Mass Change:208.067 Average Mass Change:208.286 (mass incorrect, aggregate not delta) References:PE Sciex + + PECys + DeltaMass-label + + + Pyridylethyl + PSI-MS-label + + + Pyridylethyl Cystenyl + DeltaMass-label + + + S-pyridinylethyl-L-cysteine + PSI-MOD-alternate + + + S-pyridylethylation + UniMod-description + + + spyridylethylc + OMSSA-label + + + vinylpyridine derivatized cysteine residue + PSI-MOD-alternate + + + + DiffAvg + 105.14 + + + + DiffFormula + C 7 H 7 N 1 + + + + DiffMono + 105.057849 + + + + Formula + C 10 H 12 N 2 O 1 S 1 + + + + MassAvg + 208.28 + + + + MassMono + 208.067034 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + MOD:00905 + PSI-MOD + + + MOD:00425 + monohydroxylated residue + + A protein modification that effectively replaces one hydrogen atom with a hydroxyl group. + + 35 + UniMod + + + PSI-MOD-slim + + Hy1Res + PSI-MOD-label + + + Oxidation + UniMod-interim + + + Oxidation or Hydroxylation + UniMod-description + + + + DiffAvg + 16.00 + + + + DiffFormula + O 1 + + + + DiffMono + 15.994915 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + none + + + + TermSpec + C-term + + MOD:00677 + PSI-MOD + + + MOD:00426 + S-glycosylated residue + + A protein modification that effectively replaces a residue hydrogen atom on a sulfur with a carbohydrate-like group through a glycosidic bond. + + 18688235 + PubMed + + + + SGlycoRes + PSI-MOD-label + + MOD:00693 + PSI-MOD + + + MOD:00427 + methylated residue + + A protein modification that effectively replaces a hydrogen atom with a methyl group. + + 36 + DeltaMass + + + From DeltaMass: Average Mass: 14 Average Mass Change:14 References:Methylation of Asparagine (found in phycobiliproteins) Klotz and Glazer (1987) J. Biol. Chem. 262; 17350-17355 + PSI-MOD-slim + + MeRes + PSI-MOD-label + + + Methylation (N terminus, N epsilon of Lysine, O of Serine, Threonine or C terminus, N of Asparagine) + DeltaMass-label + + MOD:00001 + PSI-MOD + + + MOD:00428 + dihydroxylated residue + + A protein modification that effectively replaces two hydrogen atoms with two hydroxyl groups. + + 12686488 + PubMed + + + 425 + UniMod + + + PSI-MOD-slim + + dihydroxy + UniMod-description + + + Dioxidation + PSI-MS-label + + + Hy2Res + PSI-MOD-label + + + + DiffAvg + 32.00 + + + + DiffFormula + C 0 H 0 N 0 O 2 + + + + DiffMono + 31.989829 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + none + + + + TermSpec + none + + MOD:00677 + PSI-MOD + + + MOD:00429 + dimethylated residue + + A protein modification that effectively replaces two hydrogen atoms with two methyl groups. + + 0 + DeltaMass + + + 12964758 + PubMed + + + 14570711 + PubMed + + + 36 + UniMod + + + For amino-terminal proline residues, dimethylation can effectively only be accomplished with a protonated imino group. This process accounts only for dimethylation and not protonation. The alternative Me2+Res process accounts for both protonation and dimethylation [JSG]. + PSI-MOD-slim + + di-Methylation + UniMod-description + + + Dimethyl + PSI-MS-label + + + Me2Res + PSI-MOD-label + + + N,N dimethylation (of Arginine or Lysine) + DeltaMass-label + + + + DiffAvg + 28.05 + + + + DiffFormula + C 2 H 4 + + + + DiffMono + 28.031300 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + none + + + + TermSpec + none + + MOD:00427 + PSI-MOD + + + MOD:00430 + trimethylated residue + + A protein modification that effectively replaces three hydrogen atoms with three methyl groups. + + 12590383 + PubMed + + + 3145979 + PubMed + + + 4304194 + PubMed + + + 6778808 + PubMed + + + 7093227 + PubMed + + + 8453381 + PubMed + + + 37 + UniMod + + + For amino acids residues, amine trimethylation can effectively only be accomplished with an aminium, protonated primary amino, group. This process accounts only for trimethylation and not protonation. The alternative Me3+Res process accounts for both protonation and trimethylation. + PSI-MOD-slim + + Me3Res + PSI-MOD-label + + + tri-Methylation + UniMod-description + + + Trimethyl + PSI-MS-label + + + + DiffAvg + 42.08 + + + + DiffFormula + C 3 H 6 + + + + DiffMono + 42.046950 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + none + + + + TermSpec + none + + MOD:00427 + PSI-MOD + + + MOD:00431 + modified residue with a secondary neutral loss + + Covalent modification of, or a change resulting in an alteration of the measured molecular mass of, a peptide or protein amino acid residue with a secondary loss of a neutral molecular fragment. + + 18688235 + PubMed + + + PSI-MOD-slim + + NLModRes + PSI-MOD-label + + MOD:01157 + PSI-MOD + + + MOD:00432 + modified residue with neutral loss of phosphate + + Covalent modification of, or a change resulting in an alteration of the measured molecular mass of, a peptide or protein amino acid residue with a secondary loss of a neutral trihydrogen phosphate molecular fragment. + + 18688235 + PubMed + + + PSI-MOD-slim + + dPhosModRes + PSI-MOD-label + + MOD:00431 + PSI-MOD + + + MOD:00433 + glucosylated residue + + A protein modification that effectively replaces a hydrogen atom with an glucose group through a glycosidic bond. + + 18688235 + PubMed + + + PSI-MOD-slim + + GlcRes + PSI-MOD-label + + + + DiffAvg + 162.14 + + + + DiffFormula + C 6 H 10 N 0 O 5 + + + + DiffMono + 162.052823 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + none + + + + TermSpec + none + + MOD:00434 + MOD:00726 + PSI-MOD + + + MOD:00434 + hexosylated residue + + A protein modification that effectively replaces a hydrogen atom of an amino acid residue or of a modifying group with a hexose sugar group through a glycosidic bond. + + 203 + DeltaMass + + + 15279557 + PubMed + + + 41 + UniMod + + + From DeltaMass: Average Mass: 162 Formula:C6 H10 05 Monoisotopic Mass Change:162.053 Average Mass Change:162.143 References:PE Sciex. + PSI-MOD-slim + + Hex + PSI-MOD-label + + + Hex + PSI-MS-label + + + Hexose + UniMod-description + + + Hexoses (Fru, Gal, Glc, Man) + DeltaMass-label + + + O-Glycosyl- + DeltaMass-label + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + natural + + + + TermSpec + none + + MOD:00693 + PSI-MOD + + + MOD:00435 + O-phospho-L-serine with neutral loss of phosphate + + Covalent modification of a peptide or protein amino acid phosphorylated serine with a secondary loss of a neutral trihydrogen phosphate molecular fragment. + + 18688235 + PubMed + + + PSI-MOD-slim + + dPhosOPhosSer + PSI-MOD-label + + + + DiffAvg + -97.99 + + + + DiffFormula + C 0 H -3 N 0 O -4 P -1 + + + + DiffMono + -97.976895 + + + + Formula + C 3 H 3 N 1 O 1 + + + + MassAvg + 69.06 + + + + MassMono + 69.021464 + + + + Origin + MOD:00046 + + + + Source + artifact + + + + TermSpec + none + + MOD:01151 + + derives_from + MOD:000460 + + PSI-MOD + + + MOD:00436 + N-acetylhexosaminylated + + A protein modification that effectively replaces a hydrogen atom of an amino acid residue or of a modifying group with an N-acetylhexosamine group through a glycosidic bond. + + 18688235 + PubMed + + + PSI-MOD-slim + + HexNAc + PSI-MS-label + + + HexNAc + PSI-MOD-label + + + N-Acetylhexosamine + UniMod-description + + + + DiffAvg + 203.19 + + + + DiffFormula + C 8 H 13 N 1 O 5 + + + + DiffMono + 203.079373 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + none + + + + TermSpec + none + + MOD:00693 + PSI-MOD + + + MOD:00437 + farnesylated residue + + A protein modification that effectively replaces a hydrogen atom with a farnesyl group. + + 0 + DeltaMass + + + 15609361 + PubMed + + + 44 + UniMod + + + From DeltaMass: Average Mass: 204 + PSI-MOD-slim + + Farnesyl + PSI-MS-label + + + Farnesylation + DeltaMass-label + + + Farnesylation + UniMod-description + + + FarnRes + PSI-MOD-label + + + + DiffAvg + 204.36 + + + + DiffFormula + C 15 H 24 + + + + DiffMono + 204.187801 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + natural + + + + TermSpec + none + + MOD:00703 + PSI-MOD + + + MOD:00438 + myristoylated residue + + A protein modification that effectively replaces a hydrogen atom with a myristoyl group. + + 0 + DeltaMass + + + 45 + UniMod + + + From DeltaMass: Average Mass: 210 + PSI-MOD-slim + + C14:0 aliphatic acylated residue + PSI-MOD-alternate + + + Myristoyl + PSI-MS-label + + + Myristoylation + DeltaMass-label + + + Myristoylation + UniMod-description + + + MyrRes + PSI-MOD-label + + + + DiffAvg + 210.36 + + + + DiffFormula + C 14 H 26 O 1 + + + + DiffMono + 210.198365 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + natural + + + + TermSpec + none + + MOD:00649 + MOD:01155 + PSI-MOD + + + MOD:00439 + O-phospho-L-threonine with neutral loss of phosphate + + Covalent modification of a peptide or protein amino acid phosphorylated threonine with a secondary loss of a neutral trihydrogen phosphate molecular fragment. + + 18688235 + PubMed + + + PSI-MOD-slim + + dPhosOPhosThr + PSI-MOD-label + + + + DiffAvg + -97.99 + + + + DiffFormula + C 0 H -3 N 0 O -4 P -1 + + + + DiffMono + -97.976895 + + + + Formula + C 4 H 5 N 1 O 1 + + + + MassAvg + 83.09 + + + + MassMono + 83.037114 + + + + Origin + MOD:00047 + + + + Source + artifact + + + + TermSpec + none + + MOD:00917 + MOD:01151 + + derives_from + MOD:000470 + + PSI-MOD + + + MOD:00440 + palmitoylated residue + + A protein modification that effectively replaces a hydrogen atom with a palmitoyl group. + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 238 + PSI-MOD-slim + + Palmitoyl + PSI-MS-label + + + Palmitoylation + DeltaMass-label + + + Palmitoylation + UniMod-description + + + PamRes + PSI-MOD-label + + + + DiffAvg + 238.41 + + + + DiffFormula + C 16 H 30 O 1 + + + + DiffMono + 238.229666 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + natural + + + + TermSpec + none + + MOD:00649 + MOD:01155 + PSI-MOD + + + MOD:00441 + geranylgeranylated residue + + A protein modification that effectively replaces a hydrogen atom with a geranylgeranyl group. + + 0 + DeltaMass + + + 15609361 + PubMed + + + 48 + UniMod + + + From DeltaMass: Average Mass: 272 + PSI-MOD-slim + + Geranyl-geranyl + UniMod-description + + + GeranylGeranyl + PSI-MS-label + + + Geranylgeranylation + DeltaMass-label + + + GergerRes + PSI-MOD-label + + + + DiffAvg + 272.48 + + + + DiffFormula + C 20 H 32 + + + + DiffMono + 272.250401 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + natural + + + + TermSpec + none + + MOD:00703 + PSI-MOD + + + MOD:00442 + protonated omega-N,omega-N'-dimethylated L-arginine with secondary neutral loss of N,N'-carbodiimide + + Covalent modification of a peptide or protein L-arginine residue to protonated omega-N,omega-N'-dimethylated L-arginine with secondary loss of an N,N'-carbodiimide molecular fragment. + + 15835918 + PubMed + + + 18688235 + PubMed + + + + dCDI-NNMe2+Arg + PSI-MOD-label + + + + DiffAvg + 42.04 + + + + DiffFormula + C 1 H 2 N 2 O 0 + + + + DiffMono + 42.021798 + + + + Formula + C 7 H 14 N 2 O 1 + + + + MassAvg + 142.20 + + + + MassMono + 142.110613 + + + + Origin + R + + + + Source + artifact + + + + TermSpec + none + + MOD:00431 + MOD:00902 + PSI-MOD + + + MOD:00443 + protonated omega-N,omega-N-dimethlyated L-arginine with secondary neutral loss of N,N-dimethylamine + + Covalent modification of a peptide or protein L-arginine residue to protonated omega-N,omega-N-dimethlyated L-arginine with secondary neutral loss of an N,N-dimethylamine molecular fragment. + + 15835918 + PubMed + + + 18688235 + PubMed + + + + dDMA-NoMe2+Arg + PSI-MOD-label + + + + DiffAvg + 59.09 + + + + DiffFormula + C 2 H 7 N 2 + + + + DiffMono + 59.060923 + + + + Formula + C 6 H 10 N 3 O 1 + + + + MassAvg + 140.17 + + + + MassMono + 140.082387 + + + + Origin + R + + + + Source + artifact + + + + TermSpec + none + + MOD:00431 + MOD:00902 + PSI-MOD + + + MOD:00444 + N-palmitoyl-S-(sn-1-2,3-dipalmitoyl-glycerol)cysteine + + A protein modification that effectively converts an L-cysteine residue to N-palmitoyl-S-(sn-1-2,3-dipalmitoyl-glycerol)cysteine. + + 10356335 + PubMed + + + 51 + UniMod + + + + N-acyl diglyceride cysteine + UniMod-description + + + ntermpeptripalmitatec + OMSSA-label + + + Tripalmitate + PSI-MS-label + + + + DiffAvg + 789.32 + + + + DiffFormula + C 51 H 96 O 5 + + + + DiffMono + 788.725776 + + + + Formula + C 54 H 101 N 1 O 6 S 1 + + + + MassAvg + 892.46 + + + + MassMono + 891.734961 + + + + Origin + C + + + + Source + natural + + + + TermSpec + N-term + + MOD:00899 + + has_functional_parent + MOD:011440 + + PSI-MOD + + + MOD:00445 + L-homoarginine + + A protein modification that effectively converts an L-lysine residue to L-homoarginine, such as reaction with O-methylisourea. + + 11078590 + PubMed + + + 11085420 + PubMed + + + 11821862 + PubMed + + + 52 + UniMod + + + PSI-MOD-slim + + Guanidination + UniMod-description + + + guanidinationk + OMSSA-label + + + Guanidinyl + PSI-MS-label + + + + DiffAvg + 42.04 + + + + DiffFormula + C 1 H 2 N 2 + + + + DiffMono + 42.021798 + + + + Formula + C 7 H 14 N 4 O 1 + + + + MassAvg + 170.22 + + + + MassMono + 170.116761 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + MOD:00912 + PSI-MOD + + + MOD:00446 + 4-hydroxynonenal adduct + + A protein modification produced by formation of an adduct of a residue with 4-hydroxynonenal. + + 11327326 + PubMed + + + 15133838 + PubMed + + + 53 + UniMod + + + 4-hydroxynonenal, a toxic lipid aldehyde, is a product of the hydroperoxide beta-cleavage degradation of omega-6 polyunsaturated fatty acids, such as arachidonic and linoleic acids [JSG]. + + 4-hydroxynonenal (HNE) + UniMod-description + + + HNE + PSI-MS-label + + + + DiffAvg + 156.22 + + + + DiffFormula + C 9 H 16 O 2 + + + + DiffMono + 156.115030 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:01155 + PSI-MOD + + + MOD:00447 + N-glucuronylated residue + + A protein modification that effectively results from forming an adduct with a glucuronic acid either through a carboxyl group amide or ester bond, or through C1-glycosylation. + + 0 + DeltaMass + + + 7398618 + PubMed + + + 54#N-term + UniMod + + + PSI-MOD-slim + + Glucuronyl + PSI-MS-label + + + N-Glucuronyl (N terminus) + DeltaMass-label + + + N-glucuronylation + UniMod-description + + + + DiffAvg + 176.12 + + + + DiffFormula + C 6 H 8 O 6 + + + + DiffMono + 176.032088 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + none + + + + TermSpec + none + + MOD:00764 + PSI-MOD + + + MOD:00448 + N-acetylaminoglucosylated residue + + A protein modification that effectively replaces a hydrogen atom with an N-acetylaminoglucose group through a glycosidic bond. + + 18688235 + PubMed + + + PSI-MOD-slim + + GlcNAcRes + PSI-MOD-label + + + HexNAc + PSI-MS-label + + + + DiffAvg + 203.19 + + + + DiffFormula + C 8 H 13 N 1 O 5 + + + + DiffMono + 203.079373 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + none + + + + TermSpec + none + + MOD:00733 + MOD:01673 + PSI-MOD + + + MOD:00449 + acetate labeling reagent (N-term) (heavy form, +3amu) + + modification from UniMod Isotopic label + + 11857757 + PubMed + + + 11999733 + PubMed + + + 12175151 + PubMed + + + 56 + UniMod + + + + Acetate labeling reagent (N-term & K) (heavy form, +3amu) + UniMod-description + + + Acetyl:2H(3) + PSI-MS-label + + + + DiffAvg + 45.03 + + + + DiffFormula + C 2 (1)H -1 (2)H 3 O 1 + + + + DiffMono + 45.029395 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + N-term + + MOD:01431 + PSI-MOD + + + MOD:00450 + acetate labeling reagent light form (K) + + OBSOLETE because this isotopic label from UniMod entry 57 is deprecated + + 11857757 + PubMed + + + + + DiffAvg + 42.01 + + + + DiffFormula + C 2 (1)H 2 O 1 + + + + DiffMono + 42.010565 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + 1 + PSI-MOD + + + MOD:00451 + alpha-amino propanoylated residue + + A protein modification that effectively replaces a residue alpha-amino- or alpha-imino-hydrogen with a propanoyl group. + + 11857757 + PubMed + + + 11999733 + PubMed + + + 12175151 + PubMed + + + 58#N-term + UniMod + + + + Propionate labeling reagent light form (N-term & K) + UniMod-description + + + Propionyl + PSI-MS-label + + + + DiffAvg + 56.06 + + + + DiffFormula + C 3 H 4 O 1 + + + + DiffMono + 56.026215 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + N-term + + MOD:01894 + PSI-MOD + + + MOD:00452 + alpha-amino 3x(13)C-labeled propanoylated residue + + A protein modification that effectively replaces a residue alpha-amino- or alpha-imino-hydrogen with a 3x(13)C-labeled propanoyl group. + + 11857757 + PubMed + + + 11999733 + PubMed + + + 12175151 + PubMed + + + 59#N-term + UniMod + + + + Propionate labeling reagent heavy form (+3amu), N-term & K + UniMod-description + + + Propionyl:13C(3) + PSI-MS-label + + + + DiffAvg + 59.04 + + + + DiffFormula + (13)C 3 H 4 O 1 + + + + DiffMono + 59.036279 + + + + Formula + (12)C 6 (13)C 3 H 16 N 2 O 2 + + + + MassAvg + 187.13 + + + + MassMono + 187.131242 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00451 + PSI-MOD + + + MOD:00453 + quaternary amine labeling reagent light form (N-term & K) + + A protein modification that effectively replaces a residue alpha-amino- or alpha-imino-hydrogen with a quaternary amine reagent light form group. + + 11857757 + PubMed + + + 60 + UniMod + + + + GIST-Quat + PSI-MS-label + + + Quaternary amine labeling reagent light form (N-term & K) + UniMod-description + + + + DiffAvg + 127.19 + + + + DiffFormula + C 7 H 13 N 1 O 1 + + + + DiffMono + 127.099714 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:01426 + PSI-MOD + + + MOD:00454 + quaternary amine labeling reagent heavy form (+3amu) (N-term & K) + + A protein modification that effectively replaces a residue alpha-amino- or alpha-imino-hydrogen with a quaternary amine reagent heavy (+3amu) form group. + + 11857757 + PubMed + + + 61 + UniMod + + + + GIST-Quat:2H(3) + PSI-MS-label + + + Quaternary amine labeling reagent heavy (+3amu) form, N-term & K + UniMod-description + + + + DiffAvg + 130.12 + + + + DiffFormula + C 7 (1)H 10 (2)H 3 N 1 O 1 + + + + DiffMono + 130.118544 + + + + Formula + C 13 (1)H 22 (2)H 3 N 3 O 2 + + + + MassAvg + 258.21 + + + + MassMono + 258.213507 + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:01426 + PSI-MOD + + + MOD:00455 + quaternary amine labeling reagent heavy form (+6amu) (N-term & K) + + A protein modification that effectively replaces a residue alpha-amino- or alpha-imino-hydrogen with a quaternary amine reagent heavy (+6amu) form group. + + 11857757 + PubMed + + + 62 + UniMod + + + + GIST-Quat:2H(6) + PSI-MS-label + + + Quaternary amine labeling reagent heavy form (+6amu), N-term & K + UniMod-description + + + + DiffAvg + 133.14 + + + + DiffFormula + C 7 H 7 (2)H 6 N 1 O 1 + + + + DiffMono + 133.137375 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:01426 + PSI-MOD + + + MOD:00456 + quaternary amine labeling reagent heavy form (+9amu) (N-term & K) + + A protein modification that effectively replaces a residue alpha-amino- or alpha-imino-hydrogen with a quaternary amine reagent heavy (+9amu) form group. + + 11857757 + PubMed + + + 63 + UniMod + + + + GIST-Quat:2H(9) + PSI-MS-label + + + Quaternary amine labeling reagent heavy form (+9amu), N-term & K + UniMod-description + + + + DiffAvg + 136.16 + + + + DiffFormula + C 7 (1)H 4 (2)H 9 N 1 O 1 + + + + DiffMono + 136.156205 + + + + Formula + C 13 (1)H 16 (2)H 9 N 3 O 2 + + + + MassAvg + 264.25 + + + + MassMono + 264.251168 + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:01426 + PSI-MOD + + + MOD:00457 + alpha-amino succinylated residue + + A protein modification that effectively replaces a residue alpha-amino- or alpha-imino-hydrogen with a succinyl group. + + 11857757 + PubMed + + + 12175151 + PubMed + + + 64#N-term + UniMod + + + + Succinic anhydride labeling reagent light form (N-term) + UniMod-description + + + Succinyl + PSI-MS-label + + + + DiffAvg + 100.02 + + + + DiffFormula + (12)C 4 (1)H 4 O 3 + + + + DiffMono + 100.016044 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + natural + + + + TermSpec + N-term + + MOD:00848 + MOD:01029 + MOD:01696 + PSI-MOD + + + MOD:00458 + 4x(2)H labeled alpha-amino succinylated residue + + A protein modification that effectively replaces a residue alpha-amino- or alpha-imino-hydrogen with a 4x(2)H labeled succinyl group. + + 11857757 + PubMed + + + 12175151 + PubMed + + + 65#N-term + UniMod + + + + Succinic anhydride labeling reagent, heavy form (+4amu, 4H2), N-term + UniMod-description + + + Succinyl:2H(4) + PSI-MS-label + + + + DiffAvg + 104.04 + + + + DiffFormula + C 4 (2)H 4 O 3 + + + + DiffMono + 104.041151 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + N-term + + MOD:00457 + PSI-MOD + + + MOD:00459 + 4x(13)C labeled alpha-amino succinylated residue + + A protein modification that effectively replaces a residue alpha-amino- or alpha-imino-hydrogen with a 4x(13)C labeled succinyl group. + + 11857757 + PubMed + + + 12175151 + PubMed + + + 66#N-term + UniMod + + + + Succinic anhydride labeling reagent, heavy form (+4amu, 4C13), N-term & K + UniMod-description + + + Succinyl:13C(4) + PSI-MS-label + + + + DiffAvg + 104.03 + + + + DiffFormula + (13)C 4 H 4 O 3 + + + + DiffMono + 104.029463 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + TermSpec + none + + MOD:00457 + PSI-MOD + + + MOD:00460 + L-cysteic acid (L-cysteine sulfonic acid) + + A protein modification that effectively trioxygenates an L-cysteine residue to L-cysteine sulfonic acid. + + 17285 + ChEBI + + + 334 + DeltaMass + + + 14678012 + PubMed + + + 18306178 + PubMed + + + 19522542 + PubMed + + + 9252331 + PubMed + + + AA0556 + RESID + + + 345#C + UniMod + + + From DeltaMass: Notes:Treatment of cysteine by strongly oxidising reagents such as performic acid results in the complete oxidation of the sulphur atom. Such treatment is often carried out prior to amino acid analysis as the resulting cysteic acid is then resistant to acid degradation during the hydrolysis procedure. + PSI-MOD-slim + + (2R)-2-amino-3-sulfopropanoic acid + RESID-systematic + + + 2-amino-2-carboxyethanesulfonic acid + RESID-alternate + + + 2-azanyl-3-sulfopropanoic acid + RESID-alternate + + + 3-sulfoalanine + RESID-alternate + + + Cya + DeltaMass-label + + + CysO3H + PSI-MOD-label + + + cysteic acid + RESID-alternate + + + Cysteic acid, oxidation of cysteine + DeltaMass-label + + + cysteicacidc + OMSSA-label + + + cysteine oxidation to cysteic acid + UniMod-description + + + cysteine sulphonic acid + RESID-alternate + + + L-cysteine sulfonic acid + RESID-name + + + Trioxidation + PSI-MS-label + + + + DiffAvg + 48.00 + + + + DiffFormula + C 0 H 0 N 0 O 3 S 0 + + + + DiffMono + 47.984744 + + + + Formula + C 3 H 5 N 1 O 4 S 1 + + + + MassAvg + 151.14 + + + + MassMono + 150.993929 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:00708 + PSI-MOD + + + MOD:00461 + nitrosylation + + A protein modification that effectively substitutes a nitrite (NO2) group for a hydrogen atom. + + 0 + DeltaMass + + + 8839040 + PubMed + + + 9252331 + PubMed + + + 354 + UniMod + + + Note, this is often misrepresented as the introduction of a nitrate (NO3) group [JSG]. + PSI-MOD-slim + + Nitro + PSI-MS-label + + + Nitro (NO2) + DeltaMass-label + + + Oxidation to nitro + UniMod-description + + + + DiffAvg + 45.00 + + + + DiffFormula + H -1 N 1 O 2 + + + + DiffMono + 44.985078 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + TermSpec + none + + MOD:00848 + PSI-MOD + + + MOD:00462 + L-kynurenine + + A protein modification that effectively converts an L-tryptophan residue to L-kynurenine. + + 357 + DeltaMass + + + 11029593 + PubMed + + + 9252331 + PubMed + + + 351#W + UniMod + + + PSI-MOD-slim + + (2S)-2-amino-4-(2-aminophenyl)-4-oxo-butanoic acid + PSI-MOD-alternate + + + kynureninw + OMSSA-label + + + Trp->Kynurenin + PSI-MS-label + + + tryptophan oxidation to kynurenin + UniMod-description + + + + DiffAvg + 3.99 + + + + DiffFormula + C -1 O 1 + + + + DiffMono + 3.994915 + + + + Formula + C 10 H 10 N 2 O 2 + + + + MassAvg + 190.20 + + + + MassMono + 190.074228 + + + + Origin + W + + + + Source + artifact + + + + TermSpec + none + + MOD:00918 + PSI-MOD + + + MOD:00463 + 3'-hydroxy-L-kynurenine + + A protein modification that effectively converts an L-tryptophan residue to 3'-hydroxy-L-kynurenine. + + 9252331 + PubMed + + + 350#W + UniMod + + + PSI-MOD-slim + + hydroxykynureninw + OMSSA-label + + + Trp->Hydroxykynurenin + PSI-MS-label + + + tryptophan oxidation to hydroxykynurenin + UniMod-description + + + + DiffAvg + 19.99 + + + + DiffFormula + C -1 O 2 + + + + DiffMono + 19.989829 + + + + Formula + C 10 H 10 N 2 O 3 + + + + MassAvg + 206.20 + + + + MassMono + 206.069142 + + + + Origin + W + + + + Source + artifact + + + + TermSpec + none + + MOD:00679 + MOD:00918 + PSI-MOD + + + MOD:00464 + N'-formyl-L-kynurenine + + A protein modification that effectively converts an L-tryptophan residue to N'-formyl-L-kynurenine. + + 356 + DeltaMass + + + 12124932 + PubMed + + + 12686488 + PubMed + + + 9252331 + PubMed + + + 425#W + UniMod + + + From DeltaMass: References:Willy V. Bienvenut, Catherine Déon, Carla Pasquarello, Jennifer M. Campbell, Jean-Charles Sanchez, Marvin L. Vestal, Denis F. Hochstrasser Matrix-assisted laser desorption/ionization-tandemmass spectrometry with high resolution andsensitivity for identification and characterizationof proteins. Proteomics 2002, 2, 868-876 Notes: A double oxidation of tryptophan for which the N-formylkynurenine (+32) structure can be proposed. Many minor peaks accompanying the main peak might also be attributed to other oxidation products of the tryptophan such as kynurenine (+4), an unknown by-product found in all oxidized tryptophan patterns (+13), hydroxytryptophan (+16), 3-hydroxykynurenine (+20) and hydroxy-N-formylkynurenine (+48). See proposed structures at http://www.abrf.org/images/misc/dmass32.jpg. + PSI-MOD-slim + + dihydroxy + UniMod-description + + + Dioxidation + PSI-MS-label + + + Double oxidation of Trp + DeltaMass-label + + + formylkynureninw + OMSSA-label + + + tryptophan oxidation to formylkynurenin + UniMod-alternate + + + + DiffAvg + 32.00 + + + + DiffFormula + O 2 + + + + DiffMono + 31.989829 + + + + Formula + C 11 H 10 N 2 O 3 + + + + MassAvg + 218.21 + + + + MassMono + 218.069142 + + + + Origin + W + + + + Source + artifact + + + + TermSpec + none + + MOD:00679 + MOD:00918 + PSI-MOD + + + MOD:00465 + dihydroxyphenylalanine (Phe) + + A protein modification that effectively converts an L-phenylalanine residue to a dihydroxyphenylalanine. + + 1610822 + PubMed + + + 1903612 + PubMed + + + 3734192 + PubMed + + + 9252331 + PubMed + + + AA0146#var + RESID + + + 425#F + UniMod + + + Dihydroxyphenyalanines with a 4'-hydroxyl orginate naturally by a monohydroxylation of tyrosine, and not by dihydroxylation of phenylalanine [JSG]. + PSI-MOD-slim + + dihydroxy + UniMod-description + + + dihydroxyf + OMSSA-label + + + Dioxidation + PSI-MS-label + + + + DiffAvg + 32.00 + + + + DiffFormula + O 2 + + + + DiffMono + 31.989829 + + + + Formula + C 9 H 9 N 1 O 3 + + + + MassAvg + 179.17 + + + + MassMono + 179.058243 + + + + Origin + F + + + + Source + artifact + + + + TermSpec + none + + MOD:00428 + MOD:00914 + PSI-MOD + + + MOD:00466 + glycosylsphingolipidinositolated residue + + A protein modification that effectively converts a residue to a glycosylsphingolipidinositolethanolamidated. + + 12626404 + PubMed + + + 18688235 + PubMed + + + 8404891 + PubMed + + + + GSIRes + PSI-MOD-label + + MOD:00764 + MOD:01155 + PSI-MOD + + + MOD:00467 + iminobiotinyl modified residue + + A protein modification that effectively substitutes an iminobiotinyl group for a hydrogen atom. + + 9750125 + PubMed + + + 89 + UniMod + + + + Iminobiotin + PSI-MS-label + + + Iminobiotinylation + UniMod-description + + + + DiffAvg + 225.31 + + + + DiffFormula + C 10 H 15 N 3 O 1 S 1 + + + + DiffMono + 225.093583 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + PSI-MOD + + + MOD:00468 + ESP-Tag light d0 + + modification from UniMod Isotopic label + + 90 + UniMod + + + + ESP + PSI-MS-label + + + ESP-Tag light d0 + UniMod-description + + + + DiffAvg + 338.47 + + + + DiffFormula + C 16 H 26 N 4 O 2 S 1 + + + + DiffMono + 338.177647 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:01426 + PSI-MOD + + + MOD:00469 + ESP-Tag heavy d10 + + modification from UniMod Isotopic label + + 91 + UniMod + + + + ESP-Tag heavy d10 + UniMod-description + + + ESP:2H(10) + PSI-MS-label + + + + DiffAvg + 348.24 + + + + DiffFormula + C 16 (1)H 16 (2)H 10 N 4 O 2 S 1 + + + + DiffMono + 348.240415 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:01431 + PSI-MOD + + + MOD:00470 + NHS-LC-Biotin + + modification from UniMod Chemical derivative + + 92 + UniMod + + + + NHS-LC-Biotin + UniMod-interim + + + NHS-LC-Biotin + UniMod-description + + + + DiffAvg + 339.45 + + + + DiffFormula + C 16 H 25 N 3 O 3 S 1 + + + + DiffMono + 339.161663 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + PSI-MOD + + + MOD:00471 + EDT-maleimide-PEO-biotin + + modification from UniMod Chemical derivative + + 93 + UniMod + + + + EDT-maleimide-PEO-biotin + UniMod-interim + + + EDT-maleimide-PEO-biotin + UniMod-description + + + + DiffAvg + 601.80 + + + + DiffFormula + C 25 H 39 N 5 O 6 S 3 + + + + DiffMono + 601.206247 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + PSI-MOD + + + MOD:00472 + IMID d0 + + modification from UniMod Isotopic label + + 11746907 + PubMed + + + 94 + UniMod + + + + IMID + PSI-MS-label + + + IMID d0 + UniMod-description + + + + DiffAvg + 68.04 + + + + DiffFormula + C 3 (1)H 4 N 2 + + + + DiffMono + 68.037448 + + + + Formula + C 9 H 16 N 4 O 1 + + + + MassAvg + 196.13 + + + + MassMono + 196.132411 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:01426 + PSI-MOD + + + MOD:00473 + IMID d4 + + modification from UniMod Isotopic label + + 11746907 + PubMed + + + 95 + UniMod + + + + IMID d4 + UniMod-description + + + IMID:2H(4) + PSI-MS-label + + + + DiffAvg + 72.06 + + + + DiffFormula + C 3 (2)H 4 N 2 + + + + DiffMono + 72.062555 + + + + Formula + C 9 (1)H 12 (2)H 4 N 4 O 1 + + + + MassAvg + 200.16 + + + + MassMono + 200.157518 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:01426 + PSI-MOD + + + MOD:00474 + S-([1,1,2-(2)H3]-carboxamidoethyl)-L-cysteine + + A protein modification that effectively converts an L-cysteine residue to S-(1,1,2-(2)H3)-propanamide-L-cysteine. + + 97#C + UniMod + + + + Acrylamide d3 + UniMod-description + + + Propionamide:2H(3) + PSI-MS-label + + + S-([1,1,2-(2)H3]-3-amino-3-oxopropyl)cysteine + PSI-MOD-alternate + + + S-([1,1,2-(2)H3]-carbamoylethyl)-L-cysteine + PSI-MOD-alternate + + + S-([1,1,2-(2)H3]-propanamide)-L-cysteine + PSI-MOD-alternate + + + + DiffAvg + 74.06 + + + + DiffFormula + C 3 (1)H 2 (2)H 3 N 1 O 1 + + + + DiffMono + 74.055944 + + + + Formula + C 6 (1)H 7 (2)H 3 N 2 O 2 S 1 + + + + MassAvg + 177.07 + + + + MassMono + 177.065129 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:00417 + MOD:01426 + PSI-MOD + + + MOD:00475 + tyrosine oxidation to 2-aminotyrosine + + modification from UniMod Chemical derivative + + 8839040 + PubMed + + + 9252331 + PubMed + + + 342#Y + UniMod + + + May be misdescribed. Name (if not misdescribed) should be 2'-aminotyrosine [JSG]. + + Amino + PSI-MS-label + + + Tyrosine oxidation to 2-aminotyrosine + UniMod-description + + + + DiffAvg + 15.02 + + + + DiffFormula + H 1 N 1 + + + + DiffMono + 15.010899 + + + + Formula + C 9 H 10 N 2 O 2 + + + + MassAvg + 178.19 + + + + MassMono + 178.074228 + + + + Origin + Y + + + + Source + artifact + + + + TermSpec + none + + MOD:00003 + PSI-MOD + + + MOD:00476 + galactosylated residue + + A protein modification that effectively replaces a hydrogen atom with an galactose group through a glycosidic bond. + + 18688235 + PubMed + + + PSI-MOD-slim + + GalRes + PSI-MOD-label + + MOD:00434 + MOD:00728 + PSI-MOD + + + MOD:00477 + 2-pyrrolidone + + A protein modification that effectively converts, by oxidative decarboxylation, an L-proline residue to 2-pyrrolidone with breakage of the peptide chain. + + 2161657 + PubMed + + + 9252331 + PubMed + + + 360#P + UniMod + + + The oxidative decarboxylation of a proline residue results in breaking of the peptide chain, leaving a peptidyl-2-pyrrolidone at the C-terminus. The difference formula, derived from the result in the original citation, has been corrected from the UniMod entry. + + Pro->Pyrrolidinone + PSI-MS-label + + + Proline oxidation to pyrrolidinone + UniMod-description + + + + DiffAvg + -13.02 + + + + DiffFormula + C -1 H -1 N 0 O 0 + + + + DiffMono + -13.007825 + + + + Formula + C 4 H 6 N 1 O 1 + + + + MassAvg + 84.10 + + + + MassMono + 84.044939 + + + + Origin + P + + + + Source + artifact + + + + TermSpec + none + + MOD:00683 + MOD:00915 + MOD:00960 + PSI-MOD + + + MOD:00478 + glutamyl semialdehyde (Pro) + + A protein modification that effectively converts an L-proline residue to L-glutamyl semialdehyde. + + 354 + DeltaMass + + + 11120890 + PubMed + + + 2563380 + PubMed + + + 9252331 + PubMed + + + 35#P + UniMod + + + + gamma-glutamyl semialdehyde + PSI-MOD-alternate + + + glutamyl 5-semialdehyde + PSI-MOD-alternate + + + glutamyl aldehyde + PSI-MOD-alternate + + + Oxidation + UniMod-interim + + + Oxidation of proline to gamma-glutamyl semialdehyde + DeltaMass-label + + + Oxidation or Hydroxylation + UniMod-description + + + + DiffAvg + 16.00 + + + + DiffFormula + C 0 H 0 N 0 O 1 + + + + DiffMono + 15.994915 + + + + Formula + C 5 H 7 N 1 O 2 + + + + MassAvg + 113.12 + + + + MassMono + 113.047678 + + + + Origin + P + + + + Source + artifact + + + + TermSpec + none + + MOD:00679 + MOD:00915 + MOD:01440 + PSI-MOD + + + MOD:00479 + glutamyl semialdehyde (Arg) + + A protein modification that effectively converts an L-arginine residue to L-glutamyl semialdehyde. + + 351 + DeltaMass + + + 11120890 + PubMed + + + 1680314 + PubMed + + + 9252331 + PubMed + + + 344#R + UniMod + + + From DeltaMass: Average Mass: -27 Monoisotopic Mass Change:-27.06 Average Mass Change:-27.07 References:Amici A, Levine, RL, Tsai, L, and Stadtman, ER: Conversion of amino acid residues in proteins and amino acid homopolymers to carbonyl derivatives by metal-catalyzed oxidation reactions. Journal of Biological Chemistry 264: 3341-3346 1989.Requena JR, Chao CC, Levine RL, and Stadtman ER: Glutamic and aminoadipic semialdehydes are the main carbonyl products of metal-catalyzed oxidation of proteins. Proceedings of the National Academy of Sciences USA 98: 69-74 2001. + + Arg->GluSA + PSI-MS-label + + + Arginine oxidation to glutamic semialdehyde + UniMod-description + + + Oxidation of arginine (to glutamic acid) + DeltaMass-label + + + + DiffAvg + -43.07 + + + + DiffFormula + C -1 H -5 N -3 O 1 + + + + DiffMono + -43.053433 + + + + Formula + C 5 H 7 N 1 O 2 + + + + MassAvg + 113.12 + + + + MassMono + 113.047678 + + + + Origin + R + + + + Source + artifact + + + + TermSpec + none + + MOD:00902 + MOD:01440 + PSI-MOD + + + MOD:00480 + Applied Biosystems cleavable ICAT(TM) light + + modification from UniMod Isotopic label + + 105#C + UniMod + + + PSI-MOD-slim + + Applied Biosystems cleavable ICAT(TM) light + UniMod-description + + + ICAT-C + PSI-MS-label + + + icatlight + OMSSA-label + + + + DiffAvg + 227.26 + + + + DiffFormula + C 10 H 17 N 3 O 3 + + + + DiffMono + 227.126991 + + + + Formula + C 13 H 22 N 4 O 4 S 1 + + + + MassAvg + 330.40 + + + + MassMono + 330.136176 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:01426 + PSI-MOD + + + MOD:00481 + Applied Biosystems cleavable ICAT(TM) heavy + + modification from UniMod Isotopic label + + 106#C + UniMod + + + PSI-MOD-slim + + Applied Biosystems cleavable ICAT(TM) heavy + UniMod-description + + + ICAT-C:13C(9) + PSI-MS-label + + + icatheavy + OMSSA-label + + + + DiffAvg + 236.16 + + + + DiffFormula + (12)C 1 (13)C 9 H 17 N 3 O 3 + + + + DiffMono + 236.157185 + + + + Formula + (12)C 4 (13)C 9 H 22 N 4 O 4 S 1 + + + + MassAvg + 339.17 + + + + MassMono + 339.166370 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:01428 + PSI-MOD + + + MOD:00482 + N-formyl-L-methionine (Met) + + A protein modification that effectively converts an L-methionine residue to N-formyl-L-methionine (not known as a natural, post-translational modification process). + + 11152118 + PubMed + + + 2165784 + PubMed + + + 3042771 + PubMed + + + AA0021#MET + RESID + + + This entry is for the artifactual formation of N-formyl-L-methionine from methionine. For encoded N-formyl-L-methionine, use MOD:00030 [JSG]. + + (2S)-2-formylamino-4-(methylsulfanyl)butanoic acid + RESID-systematic + + + 2-formamido-4-(methylsulfanyl)butanoic acid + RESID-alternate + + + 2-formylamino-4-(methylthio)butanoic acid + RESID-alternate + + + 2-formylazanyl-4-(methylsulfanyl)butanoic acid + RESID-alternate + + + MOD_RES N-formylmethionine + UniProt-feature + + + N-formyl-L-methionine + RESID-name + + + N-formylated L-methionine + PSI-MOD-alternate + + + NFoMet + PSI-MOD-label + + + + DiffAvg + 28.01 + + + + DiffFormula + C 1 H 0 N 0 O 1 S 0 + + + + DiffMono + 27.994915 + + + + Formula + C 6 H 10 N 1 O 2 S 1 + + + + MassAvg + 160.21 + + + + MassMono + 160.043225 + + + + Origin + M + + + + Source + artifact + + + + TermSpec + N-term + + MOD:00030 + MOD:00913 + PSI-MOD + + + MOD:00483 + N-ethylmaleimide derivatized cysteine + + A protein modification that is produced by reaction with N-ethylmaleimide. + + 11813307 + PubMed + + + 12777388 + PubMed + + + 108#C + UniMod + + + + N-ethylmaleimide on cysteines + UniMod-description + + + nemc + OMSSA-label + + + Nethylmaleimide + PSI-MS-label + + + + DiffAvg + 125.13 + + + + DiffFormula + C 6 H 7 N 1 O 2 + + + + DiffMono + 125.047678 + + + + Formula + C 9 H 12 N 2 O 3 S 1 + + + + MassAvg + 228.27 + + + + MassMono + 228.056863 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + MOD:00905 + PSI-MOD + + + MOD:00484 + oxidized lysine biotinylated with biotin-LC-hydrazide, reduced + + modification from UniMod Chemical derivative + + 112#K + UniMod + + + + Oxidized lysine biotinylated with biotin-LC-hydrazide, reduced + UniMod-description + + + OxLysBiotinRed + UniMod-interim + + + + DiffAvg + 354.47 + + + + DiffFormula + C 16 H 26 N 4 O 3 S 1 + + + + DiffMono + 354.172562 + + + + Formula + C 22 H 38 N 6 O 4 S 1 + + + + MassAvg + 482.64 + + + + MassMono + 482.267525 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + MOD:00912 + PSI-MOD + + + MOD:00485 + oxidized lysine biotinylated with biotin-LC-hydrazide + + modification from UniMod Chemical derivative + + 113#K + UniMod + + + + Oxidized lysine biotinylated with biotin-LC-hydrazide + UniMod-description + + + OxLysBiotin + UniMod-interim + + + + DiffAvg + 352.45 + + + + DiffFormula + C 16 H 24 N 4 O 3 S 1 + + + + DiffMono + 352.156912 + + + + Formula + C 22 H 36 N 6 O 4 S 1 + + + + MassAvg + 480.63 + + + + MassMono + 480.251875 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + MOD:00912 + PSI-MOD + + + MOD:00486 + oxidized proline biotinylated with biotin-LC-hydrazide, reduced + + modification from UniMod Chemical derivative + + 114#C + UniMod + + + + Oxidized proline biotinylated with biotin-LC-hydrazide, reduced + UniMod-description + + + OxProBiotinRed + UniMod-interim + + + + DiffAvg + 371.50 + + + + DiffFormula + C 16 H 29 N 5 O 3 S 1 + + + + DiffMono + 371.199111 + + + + Formula + C 21 H 36 N 6 O 4 S 1 + + + + MassAvg + 468.62 + + + + MassMono + 468.251875 + + + + Origin + P + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + MOD:00915 + PSI-MOD + + + MOD:00487 + oxidized proline biotinylated with biotin-LC-hydrazide + + modification from UniMod Chemical derivative + + 115#C + UniMod + + + + Oxidized Proline biotinylated with biotin-LC-hydrazide + UniMod-description + + + OxProBiotin + UniMod-interim + + + + DiffAvg + 369.48 + + + + DiffFormula + C 16 H 27 N 5 O 3 S 1 + + + + DiffMono + 369.183461 + + + + Formula + C 21 H 34 N 6 O 4 S 1 + + + + MassAvg + 466.60 + + + + MassMono + 466.236225 + + + + Origin + P + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + MOD:00915 + PSI-MOD + + + MOD:00488 + oxidized arginine biotinylated with biotin-LC-hydrazide + + modification from UniMod Chemical derivative + + 116#C + UniMod + + + + OxArgBiotin + UniMod-interim + + + Oxidized arginine biotinylated with biotin-LC-hydrazide + UniMod-description + + + + DiffAvg + 310.41 + + + + DiffFormula + C 15 H 22 N 2 O 3 S 1 + + + + DiffMono + 310.135114 + + + + Formula + C 21 H 34 N 6 O 4 S 1 + + + + MassAvg + 466.60 + + + + MassMono + 466.236225 + + + + Origin + R + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + MOD:00902 + PSI-MOD + + + MOD:00489 + oxidized arginine biotinylated with biotin-LC-hydrazide, reduced + + modification from UniMod Chemical derivative + + 117#C + UniMod + + + + OxArgBiotinRed + UniMod-interim + + + Oxidized arginine biotinylated with biotin-LC-hydrazide, reduced + UniMod-description + + + + DiffAvg + 312.43 + + + + DiffFormula + C 15 H 24 N 2 O 3 S 1 + + + + DiffMono + 312.150764 + + + + Formula + C 21 H 36 N 6 O 4 S 1 + + + + MassAvg + 468.62 + + + + MassMono + 468.251875 + + + + Origin + R + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + MOD:00902 + PSI-MOD + + + MOD:00490 + EDT-iodo-PEO-biotin + + modification from UniMod Chemical derivative + + 118 + UniMod + + + + EDT-iodo-PEO-biotin + UniMod-description + + + EDT-iodoacetyl-PEO-biotin + PSI-MS-label + + + + DiffAvg + 490.70 + + + + DiffFormula + C 20 H 34 N 4 O 4 S 3 + + + + DiffMono + 490.174219 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + TermSpec + none + + MOD:00848 + PSI-MOD + + + MOD:00491 + thio ether formation - BTP Adduct + + modification from UniMod Chemical derivative + + 11861642 + PubMed + + + 119#C + UniMod + + + + IBTP + PSI-MS-label + + + Thio Ether Formation - BTP Adduct + UniMod-description + + + + DiffAvg + 316.38 + + + + DiffFormula + C 22 H 21 P 1 + + + + DiffMono + 316.138087 + + + + Formula + C 25 H 26 N 1 O 1 P 1 S 1 + + + + MassAvg + 419.52 + + + + MassMono + 419.147272 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + MOD:00861 + MOD:00905 + PSI-MOD + + + MOD:00492 + ubiquitination signature dipeptidyl lysine + + A protein modification that crosslinks the N6-amino of a peptidyl lysine with the carboxyl of glycylglycine, the two glycine residues left after tryptic digestion of ubiquitin. + + 11125103 + PubMed + + + 12612601 + PubMed + + + 12872131 + PubMed + + + AA0125#var + RESID + + + 121#K + UniMod + + + + GlyGly + PSI-MS-label + + + glyglyk + OMSSA-label + + + N6-(glycylglycyl)lysine + PSI-MOD-alternate + + + N6-glycylglycyl-L-lysine + PSI-MOD-alternate + + + ubiquitinylation residue + UniMod-description + + + + DiffAvg + 114.10 + + + + DiffFormula + C 4 H 6 N 2 O 2 + + + + DiffMono + 114.042927 + + + + Formula + C 10 H 18 N 4 O 3 + + + + MassAvg + 242.28 + + + + MassMono + 242.137890 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00908 + MOD:01875 + + derives_from + MOD:011480 + + PSI-MOD + + + MOD:00493 + formylated residue + + A protein modification that effectively replaces a hydrogen atom with a formyl group. + + 0 + DeltaMass + + + 15799070 + PubMed + + + 122 + UniMod + + + From DeltaMass: Average Mass: 28 + PSI-MOD-slim + + FoRes + PSI-MOD-label + + + Formyl + PSI-MS-label + + + Formylation + UniMod-description + + + Formylation (CHO) + DeltaMass-label + + + + DiffAvg + 28.01 + + + + DiffFormula + C 1 O 1 + + + + DiffMono + 27.994915 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + TermSpec + none + + MOD:00649 + PSI-MOD + + + MOD:00494 + N-iodoacetyl, p-chlorobenzyl-12C6-glucamine + + modification from UniMod Isotopic label + + 12185208 + PubMed + + + 123#C + UniMod + + + + ICAT-H + PSI-MS-label + + + N-iodoacetyl, p-chlorobenzyl-12C6-glucamine + UniMod-description + + + + DiffAvg + 345.78 + + + + DiffFormula + C 15 Cl 1 H 20 N 1 O 6 S 0 + + + + DiffMono + 345.097915 + + + + Formula + C 18 Cl 1 H 25 N 2 O 7 S 1 + + + + MassAvg + 448.91 + + + + MassMono + 448.107100 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:00905 + MOD:01426 + PSI-MOD + + + MOD:00495 + N-iodoacetyl, p-chlorobenzyl-13C6-glucamine + + modification from UniMod Isotopic label + + 12185208 + PubMed + + + 124#C + UniMod + + + + ICAT-H:13C(6) + PSI-MS-label + + + N-iodoacetyl, p-chlorobenzyl-13C6-glucamine + UniMod-description + + + + DiffAvg + 351.12 + + + + DiffFormula + (12)C 9 (13)C 6 Cl 1 H 20 N 1 O 6 S 0 + + + + DiffMono + 351.118044 + + + + Formula + (12)C 12 (13)C 6 Cl 1 H 25 N 2 O 7 S 1 + + + + MassAvg + 454.13 + + + + MassMono + 454.127229 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:00905 + MOD:01426 + PSI-MOD + + + MOD:00496 + reductive amination-D + + OBSOLETE because UniMod entry 125 is merged with entry 199, remap to id: MOD:00552 + + 125 + UniMod + + + + + DiffAvg + 32.06 + + + + DiffFormula + C 2 (2)H 4 + + + + DiffMono + 32.056407 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + 1 + PSI-MOD + + + MOD:00497 + 3-sulfanylpropanoyl (N-term and Lys) + + modification from UniMod [(35)S]dithiobis(succinimidyl propionate) crosslinking + + 957432 + PubMed + + + 126 + UniMod + + + The name "thioacylation of primary amines" in UniMod was a misdescription [JSG]. + + 3,3-Dithio-bis-(sulfosuccinimidyl)propionate + UniMod-alternate + + + 3-sulfanylpropanoyl + UniMod-description + + + Thioacyl + PSI-MS-label + + + + DiffAvg + 88.12 + + + + DiffFormula + C 3 H 4 O 1 S 1 + + + + DiffMono + 87.998286 + + + + Formula + C 9 H 16 N 2 O 2 S 1 + + + + MassAvg + 216.30 + + + + MassMono + 216.093249 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + MOD:00912 + PSI-MOD + + + MOD:00498 + fluorinated residue + + A protein modification that effectively substitutes a hydrogen of a residue with a fluorine atom. + + 18688235 + PubMed + + + + Fluoro + PSI-MS-label + + + fluorophenylalanine replacement of phenylalanine + UniMod-description + + + Fluorophenylalanyl + DeltaMass-label + + + FRes + PSI-MOD-label + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00694 + PSI-MOD + + + MOD:00499 + 5-iodoacetamidofluorescein + + modification from UniMod Chemical derivative + + 3311742 + PubMed + + + 3578767 + PubMed + + + 128#C + UniMod + + + + 5-Iodoacetamidofluorescein (Molecular Probe, Eugene, OR) + UniMod-description + + + Fluorescein + PSI-MS-label + + + + DiffAvg + 388.35 + + + + DiffFormula + C 22 H 14 N 1 O 6 + + + + DiffMono + 388.082112 + + + + Formula + C 25 H 19 N 2 O 7 S 1 + + + + MassAvg + 491.49 + + + + MassMono + 491.091297 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + MOD:00905 + PSI-MOD + + + MOD:00500 + monoiodinated residue + + A protein modification that effectively substitutes one hydrogen atom of a residue with one iodine atom. + + 0 + DeltaMass + + + 15627961 + PubMed + + + 2026710 + PubMed + + + 129 + UniMod + + + From DeltaMass: Average Mass: 126 + PSI-MOD-slim + + I1Res + PSI-MOD-label + + + Iodination + UniMod-description + + + Iodination (of Histidine[C4] or Tyrosine[C3]) + DeltaMass-label + + + Iodo + PSI-MS-label + + + + DiffAvg + 125.90 + + + + DiffFormula + H -1 I 1 + + + + DiffMono + 125.896648 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + TermSpec + none + + MOD:00755 + PSI-MOD + + + MOD:00501 + diiodinated residue + + A protein modification that effectively substitutes two hydrogen atoms of a residue with two iodine atoms. + + 130 + UniMod + + + From DeltaMass: Average Mass: 252 + PSI-MOD-slim + + di-Iodination + UniMod-description + + + Diiodo + PSI-MS-label + + + I2Res + PSI-MOD-label + + + + DiffAvg + 251.79 + + + + DiffFormula + H -2 I 2 + + + + DiffMono + 251.793295 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + TermSpec + none + + MOD:00755 + PSI-MOD + + + MOD:00502 + triiodinated residue + + A protein modification that effectively substitutes three hydrogen atoms of a residue with three iodine atoms. + + 15627961 + PubMed + + + 2026710 + PubMed + + + 131 + UniMod + + + From UniMod. In PubMed:2026710, mono- and diiodination of tyrosine are discussed, but triiodination of tyrosine is not mentioned. In PubMed:15627961, triiodothyronine (see MOD:00186) is discussed, but triiodotyrosine is not mentioned. This modification probably does not exist, and may be a confusion of "tyrosine" for "thyronine", a common error [JSG]. + PSI-MOD-slim + + I3Res + PSI-MOD-label + + + tri-Iodination + UniMod-description + + + triiodinationy + OMSSA-label + + + Triiodo + PSI-MS-label + + + + DiffAvg + 377.69 + + + + DiffFormula + H -3 I 3 + + + + DiffMono + 377.689943 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00755 + PSI-MOD + + + MOD:00503 + N-(cis-delta 5)-tetradecaenoylglycine + + A protein modification that effectively converts a glycine residue to N-(cis-delta 5)-tetradecaenoylglycine. + + 11955007 + PubMed + + + 11955008 + PubMed + + + 1326520 + PubMed + + + 1386601 + PubMed + + + 6436247 + PubMed + + + 7543369 + PubMed + + + AA0059#var + RESID + + + 134#G + UniMod + + + + (cis-delta 5)-tetradecaenoyl + UniMod-description + + + Myristoleyl + PSI-MS-label + + + myristoleylation (one double bond) + DeltaMass-label + + + N-(C14:1 aliphatic acyl)glycine + PSI-MOD-alternate + + + ntermpepmyristoyeylationg + OMSSA-label + + + + DiffAvg + 208.35 + + + + DiffFormula + C 14 H 24 N 0 O 1 + + + + DiffMono + 208.182715 + + + + Formula + C 16 H 27 N 1 O 2 + + + + MassAvg + 265.40 + + + + MassMono + 265.204179 + + + + Origin + G + + + + Source + natural + + + + TermSpec + N-term + + MOD:00908 + MOD:01696 + PSI-MOD + + + MOD:00504 + N-(cis,cis-delta 5,delta 8)-tetradecadienoylglycine + + A protein modification that effectively converts a glycine residue to N-(cis,cis-delta 5,delta 8)-tetradecadienoylglycine. + + 11955007 + PubMed + + + 11955008 + PubMed + + + 1326520 + PubMed + + + 1386601 + PubMed + + + 6436247 + PubMed + + + 7543369 + PubMed + + + AA0059#var + RESID + + + 135#G + UniMod + + + + (cis,cis-delta 5, delta 8)-tetradecadienoyl + UniMod-description + + + Myristoyl+Delta:H(-4) + PSI-MS-label + + + myristoylation-4H (two double bonds) + DeltaMass-label + + + N-(C14:2 aliphatic acyl)glycine + PSI-MOD-alternate + + + ntermpepmyristoyl4hg + OMSSA-label + + + + DiffAvg + 206.33 + + + + DiffFormula + C 14 H 22 O 1 + + + + DiffMono + 206.167065 + + + + Formula + C 16 H 25 N 1 O 2 + + + + MassAvg + 263.38 + + + + MassMono + 263.188529 + + + + Origin + G + + + + Source + natural + + + + TermSpec + N-term + + MOD:00908 + MOD:01696 + PSI-MOD + + + MOD:00505 + benzoyl labeling reagent light form (N-term and K) + + modification from UniMod Isotopic label + + 0 + DeltaMass + + + 15456300 + PubMed + + + 136 + UniMod + + + From DeltaMass: Average Mass: 104 + + Benzoyl + PSI-MS-label + + + Benzoyl (Bz) + DeltaMass-label + + + labeling reagent light form (N-term & K) + UniMod-description + + + + DiffAvg + 104.11 + + + + DiffFormula + C 7 H 4 O 1 + + + + DiffMono + 104.026215 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + PSI-MOD + + + MOD:00506 + N-linked glycan core + + modification from UniMod N-linked glycosylation, Hex(5) HexNAc(2) + + 111247 + PubMed + + + 1694179 + PubMed + + + 5490222 + PubMed + + + AA0151#var + RESID + + + 137#N + UniMod + + + + Hex(5)HexNAc(2) + PSI-MS-label + + + N-linked glycan core + UniMod-description + + + + DiffAvg + 1217.09 + + + + DiffFormula + C 46 H 76 N 2 O 35 + + + + DiffMono + 1216.422862 + + + + Formula + C 50 H 82 N 4 O 37 + + + + MassAvg + 1331.20 + + + + MassMono + 1330.465790 + + + + Origin + N + + + + Source + natural + + + + TermSpec + none + + MOD:00725 + MOD:00903 + PSI-MOD + + + MOD:00507 + 5-dimethylaminonaphthalene-1-sulfonyl + + OBSOLETE because redundant, replaced by MOD:01653. Remap to MOD:01653. + + 0 + DeltaMass + + + 139 + UniMod + + + From DeltaMass: Average Mass: 233 + + 5-dimethylaminonaphthalene-1-sulfonyl + UniMod-description + + + Dansyl + PSI-MS-label + + + Dansyl (Dns) + DeltaMass-label + + + + DiffAvg + 233.29 + + + + DiffFormula + C 12 H 11 N 1 O 2 S 1 + + + + DiffMono + 233.051050 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + 1 + PSI-MOD + + + MOD:00508 + ISD a-series (C-Term) + + modification from UniMod Other + + 14588022 + PubMed + + + 140 + UniMod + + + Virtual Modification for MS/MS of a-type ions, by decarboxylation of C-terminus as reaction inside the mass spectrometer. + + a-type-ion + PSI-MS-label + + + ISD a-series (C-Term) + UniMod-description + + + + DiffAvg + -29.02 + + + + DiffFormula + C -1 H -1 O -1 + + + + DiffMono + -29.002740 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + C-term + + MOD:00003 + PSI-MOD + + + MOD:00509 + amidination of lysines or N-terminal amines with methyl acetimidate + + modification from UniMod Chemical derivative + + 12643539 + PubMed + + + 6273432 + PubMed + + + 141 + UniMod + + + + amidination of lysines or N-terminal amines with methyl acetimidate + UniMod-description + + + Amidine + PSI-MS-label + + + + DiffAvg + 41.05 + + + + DiffFormula + C 2 H 3 N 1 + + + + DiffMono + 41.026549 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + PSI-MOD + + + MOD:00510 + HexNAc1dHex1 + + modification from UniMod N-linked glycosylation, dHex HexNAc + + 111247 + PubMed + + + 1694179 + PubMed + + + 5490222 + PubMed + + + AA0151#var + RESID + + + 142 + UniMod + + + + dHexHexNAcN + OMSSA-label + + + HexNAc(1)dHex(1) + PSI-MS-label + + + HexNAc1dHex1 + UniMod-description + + + + DiffAvg + 349.34 + + + + DiffFormula + C 14 H 23 N 1 O 9 + + + + DiffMono + 349.137281 + + + + Formula + C 18 H 29 N 3 O 11 + + + + MassAvg + 463.44 + + + + MassMono + 463.180209 + + + + Origin + N + + + + Source + natural + + + + TermSpec + none + + MOD:00725 + MOD:00903 + PSI-MOD + + + MOD:00511 + HexNAc2 + + modification from UniMod N-linked glycosylation, HexNAc(2) + + 111247 + PubMed + + + 1694179 + PubMed + + + 5490222 + PubMed + + + AA0151#var + RESID + + + 143 + UniMod + + + + HexNAc(2) + PSI-MS-label + + + HexNAc2 + UniMod-description + + + + DiffAvg + 406.39 + + + + DiffFormula + C 16 H 26 N 2 O 10 + + + + DiffMono + 406.158745 + + + + Formula + C 20 H 32 N 4 O 12 + + + + MassAvg + 520.49 + + + + MassMono + 520.201672 + + + + Origin + N + + + + Source + natural + + + + TermSpec + none + + MOD:00725 + MOD:00903 + PSI-MOD + + + MOD:00512 + Hex3 + + modification from UniMod N-linked glycosylation, Hex3 + + 111247 + PubMed + + + 1694179 + PubMed + + + 5490222 + PubMed + + + AA0151#var + RESID + + + 144 + UniMod + + + + Hex(3) + PSI-MS-label + + + Hex3 + UniMod-description + + + + DiffAvg + 486.42 + + + + DiffFormula + C 18 H 30 O 15 + + + + DiffMono + 486.158470 + + + + Formula + C 22 H 36 N 2 O 17 + + + + MassAvg + 600.53 + + + + MassMono + 600.201398 + + + + Origin + N + + + + Source + natural + + + + TermSpec + none + + MOD:00725 + MOD:00903 + PSI-MOD + + + MOD:00513 + HexNAc1dHex2 + + modification from UniMod N-linked glycosylation, dHex(2) HexNAc + + 111247 + PubMed + + + 1694179 + PubMed + + + 5490222 + PubMed + + + AA0151#var + RESID + + + 145 + UniMod + + + + HexNAc(1)dHex(2) + PSI-MS-label + + + HexNAc1dHex2 + UniMod-description + + + + DiffAvg + 495.48 + + + + DiffFormula + C 20 H 33 N 1 O 13 + + + + DiffMono + 495.195190 + + + + Formula + C 24 H 39 N 3 O 15 + + + + MassAvg + 609.58 + + + + MassMono + 609.238118 + + + + Origin + N + + + + Source + natural + + + + TermSpec + none + + MOD:00725 + MOD:00903 + PSI-MOD + + + MOD:00514 + Hex1HexNAc1dHex1 + + modification from UniMod N-linked glycosylation, dHex Hex HexNAc + + 111247 + PubMed + + + 1694179 + PubMed + + + 5490222 + PubMed + + + AA0151#var + RESID + + + 146 + UniMod + + + + Hex(1)HexNAc(1)dHex(1) + PSI-MS-label + + + Hex1HexNAc1dHex1 + UniMod-description + + + + DiffAvg + 511.48 + + + + DiffFormula + C 20 H 33 N 1 O 14 + + + + DiffMono + 511.190105 + + + + Formula + C 24 H 39 N 3 O 16 + + + + MassAvg + 625.58 + + + + MassMono + 625.233032 + + + + Origin + N + + + + Source + natural + + + + TermSpec + none + + MOD:00725 + MOD:00903 + PSI-MOD + + + MOD:00515 + HexNAc2dHex1 + + modification from UniMod N-linked glycosylation, dHex HexNAc(2) + + 111247 + PubMed + + + 1694179 + PubMed + + + 5490222 + PubMed + + + AA0151#var + RESID + + + 147 + UniMod + + + + HexNAc(2)dHex(1) + PSI-MS-label + + + HexNAc2dHex1 + UniMod-description + + + + DiffAvg + 552.53 + + + + DiffFormula + C 22 H 36 N 2 O 14 + + + + DiffMono + 552.216654 + + + + Formula + C 26 H 42 N 4 O 16 + + + + MassAvg + 666.63 + + + + MassMono + 666.259581 + + + + Origin + N + + + + Source + natural + + + + TermSpec + none + + MOD:00725 + MOD:00903 + PSI-MOD + + + MOD:00516 + Hex1HexNAc2 + + modification from UniMod N-linked glycosylation + + AA0151#var + RESID + + + 148 + UniMod + + + + Hex(1)HexNAc(2) + PSI-MS-label + + + Hex1HexNAc2 + UniMod-description + + + + DiffAvg + 568.53 + + + + DiffFormula + C 22 H 36 N 2 O 15 + + + + DiffMono + 568.211568 + + + + Formula + C 26 H 42 N 4 O 17 + + + + MassAvg + 682.63 + + + + MassMono + 682.254496 + + + + Origin + N + + + + Source + natural + + + + TermSpec + none + + MOD:00725 + MOD:00903 + PSI-MOD + + + MOD:00517 + Hex1HexNAc1NeuAc1 glycosylated residue + + A protein modification that effectively replaces a hydrogen atom of an amino acid residue or of a modifying group with a carbohydrate-like group composed of Hex1HexNAc1NeuAc1 linked through a glycosidic bond. + + 0 + DeltaMass + + + 149 + UniMod + + + From DeltaMass: Average Mass: 657 + + Hex(1)HexNAc(1)NeuAc(1) + PSI-MS-label + + + Hex1HexNAc1NeuAc1 + UniMod-description + + + NeuAc-Hex-HexNAc + DeltaMass-label + + + + DiffAvg + 657.60 + + + + DiffFormula + C 25 H 41 N 2 O 18 + + + + DiffMono + 657.235437 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + natural + + + + TermSpec + none + + MOD:00725 + PSI-MOD + + + MOD:00518 + HexNAc2dHex2 + + modification from UniMod N-linked glycosylation + + AA0151#var + RESID + + + 150 + UniMod + + + + HexNAc(2)dHex(2) + PSI-MS-label + + + HexNAc2dHex2 + UniMod-description + + + + DiffAvg + 698.67 + + + + DiffFormula + C 28 H 46 N 2 O 18 + + + + DiffMono + 698.274563 + + + + Formula + C 32 H 52 N 4 O 20 + + + + MassAvg + 812.78 + + + + MassMono + 812.317490 + + + + Origin + N + + + + Source + natural + + + + TermSpec + none + + MOD:00725 + PSI-MOD + + + MOD:00519 + Hex1HexNAc2Pent1 + + modification from UniMod N-linked glycosylation + + AA0151#var + RESID + + + 151 + UniMod + + + + Hex(1)HexNAc(2)Pent(1) + PSI-MS-label + + + Hex1HexNAc2Pent1 + UniMod-description + + + + DiffAvg + 700.64 + + + + DiffFormula + C 27 H 44 N 2 O 19 + + + + DiffMono + 700.253827 + + + + Formula + C 31 H 50 N 4 O 21 + + + + MassAvg + 814.75 + + + + MassMono + 814.296755 + + + + Origin + N + + + + Source + natural + + + + TermSpec + none + + MOD:00725 + PSI-MOD + + + MOD:00520 + Hex1HexNAc2dHex1 + + modification from UniMod N-linked glycosylation + + AA0151#var + RESID + + + 152 + UniMod + + + + Hex(1)HexNAc(2)dHex(1) + PSI-MS-label + + + Hex1HexNAc2dHex1 + UniMod-description + + + + DiffAvg + 714.67 + + + + DiffFormula + C 28 H 46 N 2 O 19 + + + + DiffMono + 714.269477 + + + + Formula + C 32 H 52 N 4 O 21 + + + + MassAvg + 828.77 + + + + MassMono + 828.312405 + + + + Origin + N + + + + Source + natural + + + + TermSpec + none + + MOD:00725 + PSI-MOD + + + MOD:00521 + Hex2HexNAc2 + + modification from UniMod N-linked glycosylation + + AA0151#var + RESID + + + 153 + UniMod + + + + Hex(2)HexNAc(2) + PSI-MS-label + + + Hex2HexNAc2 + UniMod-description + + + + DiffAvg + 730.67 + + + + DiffFormula + C 28 H 46 N 2 O 20 + + + + DiffMono + 730.264392 + + + + Formula + C 32 H 52 N 4 O 22 + + + + MassAvg + 844.77 + + + + MassMono + 844.307319 + + + + Origin + N + + + + Source + natural + + + + TermSpec + none + + MOD:00725 + PSI-MOD + + + MOD:00522 + Hex3HexNAc1Pent1 + + modification from UniMod N-linked glycosylation + + AA0151#var + RESID + + + 154 + UniMod + + + + Hex(3)HexNAc(1)Pent(1) + PSI-MS-label + + + Hex3HexNAc1Pent1 + UniMod-description + + + + DiffAvg + 821.73 + + + + DiffFormula + C 31 H 51 N 1 O 24 + + + + DiffMono + 821.280102 + + + + Formula + C 35 H 57 N 3 O 26 + + + + MassAvg + 935.84 + + + + MassMono + 935.323029 + + + + Origin + N + + + + Source + natural + + + + TermSpec + none + + MOD:00725 + PSI-MOD + + + MOD:00523 + Hex1HexNAc2dHex1Pent1 + + modification from UniMod N-linked glycosylation + + AA0151#var + RESID + + + 155 + UniMod + + + + Hex(1)HexNAc(2)dHex(1)Pent(1) + PSI-MS-label + + + Hex1HexNAc2dHex1Pent1 + UniMod-description + + + + DiffAvg + 846.79 + + + + DiffFormula + C 33 H 54 N 2 O 23 + + + + DiffMono + 846.311736 + + + + Formula + C 35 H 57 N 3 O 26 + + + + MassAvg + 935.84 + + + + MassMono + 935.323029 + + + + Origin + N + + + + Source + natural + + + + TermSpec + none + + MOD:00725 + PSI-MOD + + + MOD:00524 + Hex1HexNAc2dHex2 + + modification from UniMod N-linked glycosylation + + AA0151#var + RESID + + + 156 + UniMod + + + + Hex(1)HexNAc(2)dHex(2) + PSI-MS-label + + + Hex1HexNAc2dHex2 + UniMod-description + + + + DiffAvg + 860.81 + + + + DiffFormula + C 34 H 56 N 2 O 23 + + + + DiffMono + 860.327386 + + + + Formula + C 38 H 62 N 4 O 25 + + + + MassAvg + 974.92 + + + + MassMono + 974.370313 + + + + Origin + N + + + + Source + natural + + + + TermSpec + none + + MOD:00725 + PSI-MOD + + + MOD:00525 + Hex2HexNAc2Pent1 + + modification from UniMod N-linked glycosylation + + AA0151#var + RESID + + + 157 + UniMod + + + + Hex(2)HexNAc(2)Pent(1) + PSI-MS-label + + + Hex2HexNAc2Pent1 + UniMod-description + + + + DiffAvg + 862.79 + + + + DiffFormula + C 33 H 54 N 2 O 24 + + + + DiffMono + 862.306651 + + + + Formula + C 37 H 60 N 4 O 26 + + + + MassAvg + 976.89 + + + + MassMono + 976.349578 + + + + Origin + N + + + + Source + natural + + + + TermSpec + none + + MOD:00725 + PSI-MOD + + + MOD:00526 + Hex2HexNAc2dHex1 + + modification from UniMod N-linked glycosylation + + AA0151#var + RESID + + + 158 + UniMod + + + + Hex(2)HexNAc(2)dHex(1) + PSI-MS-label + + + Hex2HexNAc2dHex1 + UniMod-description + + + + DiffAvg + 876.81 + + + + DiffFormula + C 34 H 56 N 2 O 24 + + + + DiffMono + 876.322301 + + + + Formula + C 38 H 62 N 4 O 26 + + + + MassAvg + 990.92 + + + + MassMono + 990.365228 + + + + Origin + N + + + + Source + natural + + + + TermSpec + none + + MOD:00725 + PSI-MOD + + + MOD:00527 + Hex3HexNAc2 + + modification from UniMod N-linked glycosylation + + 0 + DeltaMass + + + AA0151#var + RESID + + + 159 + UniMod + + + From DeltaMass: Average Mass: 893 + + (Hex)3-HexNAc-HexNAc + DeltaMass-label + + + Hex(3)HexNAc(2) + PSI-MS-label + + + Hex3HexNAc2 + UniMod-description + + + + DiffAvg + 892.81 + + + + DiffFormula + C 34 H 56 N 2 O 25 + + + + DiffMono + 892.317215 + + + + Formula + C 38 H 62 N 4 O 27 + + + + MassAvg + 1006.92 + + + + MassMono + 1006.360143 + + + + Origin + N + + + + Source + natural + + + + TermSpec + none + + MOD:00725 + PSI-MOD + + + MOD:00528 + Hex1HexNAc1NeuAc2 glycosylated residue + + A protein modification that effectively replaces a hydrogen atom of an amino acid residue or of a modifying group with a carbohydrate-like group composed of Hex1HexNAc1NeuAc2 linked through a glycosidic bond. + + 160 + UniMod + + + + Hex(1)HexNAc(1)NeuAc(2) + PSI-MS-label + + + Hex1HexNAc1NeuAc2 + UniMod-description + + + + DiffAvg + 947.85 + + + + DiffFormula + C 36 H 57 N 3 O 26 + + + + DiffMono + 947.323029 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + natural + + + + TermSpec + none + + MOD:00725 + PSI-MOD + + + MOD:00529 + Hex3HexNAc2P1 + + modification from UniMod N-linked glycosylation + + AA0151#var + RESID + + + 161 + UniMod + + + + Hex(3)HexNAc(2)P(1) + PSI-MS-label + + + Hex3HexNAc2P1 + UniMod-description + + + + DiffAvg + 972.79 + + + + DiffFormula + C 34 H 57 N 2 O 28 P 1 + + + + DiffMono + 972.283546 + + + + Formula + C 38 H 63 N 4 O 30 P 1 + + + + MassAvg + 1086.89 + + + + MassMono + 1086.326473 + + + + Origin + N + + + + Source + natural + + + + TermSpec + none + + MOD:00725 + PSI-MOD + + + MOD:00530 + L-selenomethionine + + A protein modification that effectively converts an L-methionine residue to L-selenomethionine. + + 12148805 + PubMed + + + 162#M + UniMod + + + + Delta:S(-1)Se(1) + PSI-MS-label + + + Se(S)Met + PSI-MOD-label + + + Selenium replaces sulphur + UniMod-description + + + semetm + OMSSA-label + + + + DiffAvg + 46.91 + + + + DiffFormula + C 0 H 0 N 0 S -1 Se 1 + + + + DiffMono + 47.944450 + + + + Formula + C 5 H 9 N 1 O 1 Se 1 + + + + MassAvg + 178.10 + + + + MassMono + 178.984935 + + + + Origin + M + + + + Source + artifact + + + + TermSpec + none + + MOD:00007 + MOD:00913 + PSI-MOD + + + MOD:00531 + (18)O labeled deglycosylated asparagine + + A protein modification that effectively converts an L-asparagine residue to L-aspartic acid with one (18)O as the result of having been deglycosylated in (18)O water. + + 14435542 + PubMed + + + 170 + UniMod + + + PSI-MOD-slim + + Delta:H(1)O(-1)18O(1) + PSI-MS-label + + + glycosylated asparagine 18O labeling + UniMod-description + + + + DiffAvg + 2.99 + + + + DiffFormula + H -1 N -1 (18)O 1 + + + + DiffMono + 2.988262 + + + + Formula + C 4 H 5 N 1 (16)O 2 (18)O 1 + + + + MassAvg + 117.03 + + + + MassMono + 117.031189 + + + + Origin + N + + + + Source + artifact + + + + TermSpec + none + + MOD:01293 + PSI-MOD + + + MOD:00532 + Shimadzu 13CNBS + + modification from UniMod Chemical derivative + + 12845591 + PubMed + + + 171 + UniMod + + + + NBS:13C(6) + UniMod-interim + + + Shimadzu NBS-13C + UniMod-description + + + + DiffAvg + 159.01 + + + + DiffFormula + (13)C 6 H 3 N 1 O 2 S 1 + + + + DiffMono + 159.008578 + + + + Formula + (12)C 11 (13)C 6 H 13 N 3 O 3 S 1 + + + + MassAvg + 345.09 + + + + MassMono + 345.087891 + + + + Origin + W + + + + Source + artifact + + + + TermSpec + none + + MOD:01426 + PSI-MOD + + + MOD:00533 + Shimadzu 12CNBS + + modification from UniMod Chemical derivative + + 12845591 + PubMed + + + 172 + UniMod + + + + NBS + UniMod-interim + + + Shimadzu NBS-12C + UniMod-description + + + + DiffAvg + 152.99 + + + + DiffFormula + (12)C 6 H 3 N 1 O 2 S 1 + + + + DiffMono + 152.988449 + + + + Formula + (12)C 17 H 13 N 3 O 3 S 1 + + + + MassAvg + 339.07 + + + + MassMono + 339.067762 + + + + Origin + W + + + + Source + artifact + + + + TermSpec + none + + MOD:01426 + PSI-MOD + + + MOD:00534 + Michael addition of BHT quinone methide to cysteine and lysine + + modification from UniMod Post-translational + + 9448752 + PubMed + + + 176 + UniMod + + + Butylated Hydroxytoluene adduct. + + BHT + PSI-MS-label + + + Michael addition of BHT quinone methide to Cysteine and Lysine + UniMod-description + + + + DiffAvg + 218.34 + + + + DiffFormula + C 15 H 22 O 1 + + + + DiffMono + 218.167065 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + PSI-MOD + + + MOD:00535 + phosphorylation to amine thiol + + modification from UniMod Chemical derivative + + 12216740 + PubMed + + + 178 + UniMod + + + DAET = 2-(dimethylamino)ethanethiol. The phosphorylation to amine is the beta elimination of phosphate and Michael addition of 2-(dimethylamino)ethanethiol to the site. + + DAET + PSI-MS-label + + + phosphorylation to amine thiol + UniMod-description + + + + DiffAvg + 87.18 + + + + DiffFormula + C 4 H 9 N 1 O -1 S 1 + + + + DiffMono + 87.050656 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + PSI-MOD + + + MOD:00536 + L-serine to L-alanine replacement + + OBSOLETE because UniMod 179 merged wth UniMod 447 remap to ??? a protein modification that replaces an L-serine residue with an L-alanine residue + + 179 + UniMod + + + + Ser_Ala + PSI-MOD-label + + + + DiffAvg + -16.00 + + + + DiffFormula + O -1 + + + + DiffMono + -15.994915 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + S + + + + Source + artifact + + + + TermSpec + none + + 1 + PSI-MOD + + + MOD:00537 + L-alanine residue (Thr) + + A protein modification that effectively converts an L-threonine residue to L-alanine. + + 659 + UniMod + + + This could represent either an engineered replacement or a chemical modification. + + Thr(Ala) + PSI-MOD-label + + + Thr->Ala + UniMod-interim + + + Thr->Ala substitution + UniMod-description + + + + DiffAvg + -30.03 + + + + DiffFormula + C -1 H -2 O -1 + + + + DiffMono + -30.010565 + + + + Formula + C 3 H 5 N 1 O 1 + + + + MassAvg + 71.08 + + + + MassMono + 71.037114 + + + + Origin + T + + + + Source + none + + + + TermSpec + none + + MOD:00010 + MOD:00917 + PSI-MOD + + + MOD:00538 + protein modification categorized by isobaric sets + + Modified amino acid residues groups into isobaric sets at particular mass resolution cut-offs. + + 18688235 + PubMed + + + PSI-MOD-slim + MOD:00000 + PSI-MOD + + + MOD:00539 + threonine reduced to aminobutynate + + OBSOLETE because UniMod 179 merged wth UniMod 447 remap to ??? modification from UniMod O-linked glycosylation + + 182 + UniMod + + + + + DiffAvg + -17.01 + + + + DiffFormula + H -1 O -1 + + + + DiffMono + -17.002740 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + T + + + + Source + artifact + + + + TermSpec + none + + 1 + PSI-MOD + + + MOD:00540 + 9x(13)C labeled residue + + A protein modification that effectively converts a residue containing common isotopes to a 9x(13)C labeled residue. + + 12716131 + PubMed + + + 184 + UniMod + + + + 13C(9) Silac label + UniMod-description + + + Label:13C(9) + PSI-MS-label + + + + DiffAvg + 9.03 + + + + DiffFormula + (12)C -9 (13)C 9 + + + + DiffMono + 9.030194 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00842 + PSI-MOD + + + MOD:00541 + 9x(13)C labeled L-phosphotyrosine + + A protein modification that effectively converts an L-tyrosine residue to 9x(13)C labeled L-phosphotyrosine. + + 12716131 + PubMed + + + 185 + UniMod + + + + C13 label (Phosphotyrosine) + UniMod-description + + + Label:13C(9)+Phospho + PSI-MS-label + + + + DiffAvg + 89.00 + + + + DiffFormula + (12)C -9 (13)C 9 H 1 O 3 P 1 + + + + DiffMono + 88.996524 + + + + Formula + (13)C 9 H 10 N 1 O 5 P 1 + + + + MassAvg + 252.06 + + + + MassMono + 252.059853 + + + + Origin + Y + + + + Source + artifact + + + + TermSpec + none + + MOD:00540 + MOD:00919 + + derives_from + MOD:000480 + + PSI-MOD + + + MOD:00542 + hydroxyphenylglyoxal arginine + + modification from UniMod Chemical derivative + + 11698400 + PubMed + + + 11914093 + PubMed + + + 186 + UniMod + + + + HPG + PSI-MS-label + + + Hydroxyphenylglyoxal arginine + UniMod-description + + + + DiffAvg + 132.12 + + + + DiffFormula + C 8 H 4 O 2 + + + + DiffMono + 132.021129 + + + + Formula + C 14 H 16 N 4 O 3 + + + + MassAvg + 288.31 + + + + MassMono + 288.122240 + + + + Origin + R + + + + Source + artifact + + + + TermSpec + none + + MOD:00003 + PSI-MOD + + + MOD:00543 + bis(hydroxyphenylglyoxal) arginine + + modification from UniMod Chemical derivative + + 11698400 + PubMed + + + 187 + UniMod + + + OH-PGO and PGO react with arginine at a stoichiometry of 2:1 [UniMod]. + + 2HPG + PSI-MS-label + + + bis(hydroxphenylglyoxal) arginine + UniMod-description + + + + DiffAvg + 282.25 + + + + DiffFormula + C 16 H 10 O 5 + + + + DiffMono + 282.052823 + + + + Formula + C 22 H 22 N 4 O 6 + + + + MassAvg + 438.44 + + + + MassMono + 438.153934 + + + + Origin + R + + + + Source + artifact + + + + TermSpec + none + + MOD:00003 + PSI-MOD + + + MOD:00544 + 6x(13)C labeled residue + + A protein modification that effectively converts a residue containing common isotopes to a 6x(13)C labeled residue. + + 12716131 + PubMed + + + 188 + UniMod + + + PSI-MOD-slim + + 13C(6) Silac label + UniMod-description + + + Label:13C(6) + PSI-MS-label + + + + DiffAvg + 6.02 + + + + DiffFormula + (12)C -6 (13)C 6 + + + + DiffMono + 6.020129 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00842 + PSI-MOD + + + MOD:00545 + deuterated dimethyl labeling (D) + + OBSOLETE because redundant with MOD:00927. Remap to MOD:00927. + + 14670044 + PubMed + + + + + DiffAvg + 34.07 + + + + DiffFormula + C 2 (1)H -2 (2)H 6 + + + + DiffMono + 34.068961 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + N-term + + 1 + PSI-MOD + + + MOD:00546 + (18)O label at both C-terminal oxygens + + A protein modification that effectively substitutes two (18)O atom for the two (16)O atoms of an alpha-carboxyl (1-carboxyl) group. + + 11467524 + PubMed + + + 193 + UniMod + + + PSI-MOD-slim + + ctermpepdio18 + OMSSA-label + + + Label:18O(2) + PSI-MS-label + + + O18 label at both C-terminal oxygens + UniMod-description + + + + DiffAvg + 4.01 + + + + DiffFormula + (16)O -2 (18)O 2 + + + + DiffMono + 4.008493 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + C-term + + MOD:00847 + PSI-MOD + + + MOD:00547 + 6-aminoquinolyl-N-hydroxysuccinimidyl carbamate + + modification from UniMod Chemical derivative + + 14997490 + PubMed + + + 194 + UniMod + + + + 6-aminoquinolyl-N-hydroxysuccinimidyl carbamate + UniMod-description + + + AccQTag + PSI-MS-label + + + + DiffAvg + 170.17 + + + + DiffFormula + C 10 H 6 N 2 O 1 + + + + DiffMono + 170.048013 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00003 + PSI-MOD + + + MOD:00548 + APTA-d0 + + modification from UniMod Chemical derivative + + 15283597 + PubMed + + + 195 + UniMod + + + Derivatization of cysteine with 3-acrylamidopropyl)trimethylammonium chloride [JSG]. + + APTA-d0 + UniMod-description + + + QAT + PSI-MS-label + + + + DiffAvg + 171.26 + + + + DiffFormula + C 9 H 19 N 2 O 1 + + + + DiffMono + 171.149738 + + + + Formula + C 12 H 24 N 3 O 2 S 1 + + + + MassAvg + 274.40 + + + + MassMono + 274.158923 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:01426 + PSI-MOD + + + MOD:00549 + APTA d3 + + modification from UniMod Isotopic label + + 15283597 + PubMed + + + 196 + UniMod + + + Derivatization of cysteine with 3-acrylamidopropyl)trimethylammonium chloride (difference formula correct) [JSG]. + + (3-acrylamidopropyl)trimethylammonium + UniMod-description + + + APTA d3 + UniMod-description + + + QAT:2H(3) + PSI-MS-label + + + + DiffAvg + 174.17 + + + + DiffFormula + C 9 (1)H 16 (2)H 3 N 2 O 1 + + + + DiffMono + 174.168568 + + + + Formula + C 12 (1)H 21 (2)H 3 N 3 O 2 S 1 + + + + MassAvg + 277.18 + + + + MassMono + 277.177753 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:01431 + PSI-MOD + + + MOD:00550 + EAPTA d0 + + modification from UniMod Chemical derivative + + 197 + UniMod + + + + EAPTA d0 + UniMod-description + + + EQAT + PSI-MS-label + + + + DiffAvg + 184.28 + + + + DiffFormula + C 10 H 20 N 2 O 1 + + + + DiffMono + 184.157563 + + + + Formula + C 13 H 25 N 3 O 2 S 1 + + + + MassAvg + 287.42 + + + + MassMono + 287.166748 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:01426 + PSI-MOD + + + MOD:00551 + EAPTA d5 + + modification from UniMod Isotopic label + + 198 + UniMod + + + + EAPTA d5 + UniMod-description + + + EQAT:2H(5) + PSI-MS-label + + + + DiffAvg + 189.19 + + + + DiffFormula + C 10 (1)H 15 (2)H 5 N 2 O 1 + + + + DiffMono + 189.188947 + + + + Formula + C 13 (1)H 20 (2)H 5 N 3 O 2 S 1 + + + + MassAvg + 292.20 + + + + MassMono + 292.198132 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:01431 + PSI-MOD + + + MOD:00552 + 4x(2)H labeled dimethylated residue + + A protein modification that effectively converts a residue containing common isotopes to a 4x(2)H labeled dimethylated residue. + + 14670044 + PubMed + + + 199 + UniMod + + + Supposed to be alpha-amino and Lys-N6 derivatized by C(2)H2O and reduction. + PSI-MOD-slim + + DiMethyl-CHD2 + UniMod-description + + + Dimethyl:2H(4) + PSI-MS-label + + + + DiffAvg + 32.06 + + + + DiffFormula + C 2 (2)H 4 + + + + DiffMono + 32.056407 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00839 + PSI-MOD + + + MOD:00553 + 1,2-ethanedithiol modified residue + + A protein modification that effectively substitutes a (2-sulfanylethyl)sulfanyl (or thioethylthiol) group for a hydroxy group. + + 0 + DeltaMass + + + 11507762 + PubMed + + + 200 + UniMod + + + From DeltaMass: Average Mass: 93; supposed to be derivatization of serine and threonine. + + 1,2-ethanedithiol (EDT) + DeltaMass-label + + + EDT + UniMod-description + + + Ethanedithiol + PSI-MS-label + + + + DiffAvg + 76.18 + + + + DiffFormula + C 2 H 4 O -1 S 2 + + + + DiffMono + 75.980528 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + PSI-MOD + + + MOD:00554 + APTA-d0 with no neutral loss + + OBSOLETE because UniMod entry 202 was merged with entry 195, remap to MOD:00548. modification from UniMod Chemical derivative + + 202 + UniMod + + + + + DiffAvg + 170.26 + + + + DiffFormula + C 9 H 18 N 2 O 1 + + + + DiffMono + 170.141913 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + 1 + PSI-MOD + + + MOD:00555 + APTA-d0 with quaternary amine loss + + OBSOLETE because UniMod entry 202 was merged with entry 195, remap to MOD:00548. modification from UniMod Chemical derivative + + 203 + UniMod + + + + + DiffAvg + 170.26 + + + + DiffFormula + C 9 H 18 N 2 O 1 + + + + DiffMono + 170.141913 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + 1 + PSI-MOD + + + MOD:00556 + acrolein addition +94 + + modification from UniMod Other + + 205 + UniMod + + + + Acrolein addition +94 + UniMod-description + + + Delta:H(6)C(6)O(1) + PSI-MS-label + + + + DiffAvg + 94.11 + + + + DiffFormula + C 6 H 6 O 1 + + + + DiffMono + 94.041865 + + + + Formula + C 12 H 18 N 2 O 2 + + + + MassAvg + 222.29 + + + + MassMono + 222.136828 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00003 + PSI-MOD + + + MOD:00557 + acrolein addition +56 + + modification from UniMod Other + + 10825247 + PubMed + + + 15541752 + PubMed + + + 206 + UniMod + + + + Acrolein addition +56 + UniMod-description + + + Delta:H(4)C(3)O(1) + PSI-MS-label + + + + DiffAvg + 56.06 + + + + DiffFormula + C 3 H 4 O 1 + + + + DiffMono + 56.026215 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00003 + PSI-MOD + + + MOD:00558 + acrolein addition +38 + + modification from UniMod Other + + 207 + UniMod + + + + Acrolein addition +38 + UniMod-description + + + Delta:H(2)C(3) + PSI-MS-label + + + + DiffAvg + 38.05 + + + + DiffFormula + C 3 H 2 + + + + DiffMono + 38.015650 + + + + Formula + C 9 H 14 N 2 O 1 + + + + MassAvg + 166.22 + + + + MassMono + 166.110613 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00003 + PSI-MOD + + + MOD:00559 + acrolein addition +76 + + modification from UniMod Other + + 208 + UniMod + + + + Acrolein addition +76 + UniMod-description + + + Delta:H(4)C(6) + PSI-MS-label + + + + DiffAvg + 76.10 + + + + DiffFormula + C 6 H 4 + + + + DiffMono + 76.031300 + + + + Formula + C 12 H 16 N 2 O 1 + + + + MassAvg + 204.27 + + + + MassMono + 204.126263 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00003 + PSI-MOD + + + MOD:00560 + acrolein addition +112 + + modification from UniMod Other + + 209 + UniMod + + + + Acrolein addition +112 + UniMod-description + + + Delta:H(8)C(6)O(2) + PSI-MS-label + + + + DiffAvg + 112.13 + + + + DiffFormula + C 6 H 8 O 2 + + + + DiffMono + 112.052429 + + + + Formula + C 12 H 20 N 2 O 3 + + + + MassAvg + 240.30 + + + + MassMono + 240.147393 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00003 + PSI-MOD + + + MOD:00561 + N-ethyl iodoacetamide-d0 + + modification from UniMod Isotopic label + + 12766232 + PubMed + + + 211 + UniMod + + + + N-ethyl iodoacetamide-d0 + UniMod-description + + + NEIAA + PSI-MS-label + + + + DiffAvg + 85.11 + + + + DiffFormula + C 4 H 7 N 1 O 1 + + + + DiffMono + 85.052764 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:01426 + PSI-MOD + + + MOD:00562 + N-ethyl iodoacetamide-d5 + + modification from UniMod Isotopic label + + 12766232 + PubMed + + + 212 + UniMod + + + + N-ethyl iodoacetamide-d5 + UniMod-description + + + NEIAA:2H(5) + PSI-MS-label + + + + DiffAvg + 90.08 + + + + DiffFormula + C 4 (1)H 2 (2)H 5 N 1 O 1 + + + + DiffMono + 90.084148 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:01431 + PSI-MOD + + + MOD:00563 + N-acetylaminogalactosylated residue + + A protein modification that effectively replaces a hydrogen atom with an N-acetylaminogalactose group through a glycosidic bond. + + 18688235 + PubMed + + + PSI-MOD-slim + + GalNAcRes + PSI-MOD-label + + + HexNAc + PSI-MS-label + + + + DiffAvg + 203.19 + + + + DiffFormula + C 8 H 13 N 1 O 5 + + + + DiffMono + 203.079373 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + none + + + + TermSpec + none + + MOD:00734 + MOD:01673 + PSI-MOD + + + MOD:00564 + Applied Biosystems iTRAQ(TM) multiplexed quantitation chemistry + + Modification from UniMod Isotopic label. The UniMod term was extracted when it had not been approved. OBSOLETE because redundant to MOD:01505. Remap to MOD:01505, or one of the child terms MOD:01493 or MOD:01497. + + 214 + UniMod + + + + iTRAQ4plex + UniMod-interim + + + Representative mass and accurate mass for 116 & 117 + UniMod-description + + + + DiffAvg + 144.10 + + + + DiffFormula + (12)C 4 (13)C 3 H 12 (14)N 1 (15)N 1 O 1 + + + + DiffMono + 144.102062 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + 1 + PSI-MOD + + + MOD:00565 + deglycosylated asparagine + + modification from UniMod N-linked glycosylation + + 7#N + UniMod + + + Conversion of glycosylated asparagine residues upon deglycosylation with PGNase F in H2O. CAUTION - the difference formula appears to be based on a partial structure [JSG]. + + Deamidated + UniMod-interim + + + Deamidation + UniMod-description + + + + DiffAvg + 0.98 + + + + DiffFormula + H -1 N -1 O 1 + + + + DiffMono + 0.984016 + + + + Formula + C 4 H 5 N 1 O 3 + + + + MassAvg + 115.09 + + + + MassMono + 115.026943 + + + + Origin + N + + + + Source + artifact + + + + TermSpec + none + + MOD:00903 + PSI-MOD + + + MOD:00566 + label cysteine with IGBP reagent + + modification from UniMod Chemical derivative + + 243 + UniMod + + + "IDBEST tag for quantitation, http://www.targetdiscovery.com/index.php?topic=prod.idbe" + + IGBP + PSI-MS-label + + + Light IDBEST tag for quantitation + UniMod-description + + + + DiffAvg + 297.15 + + + + DiffFormula + Br 1 C 12 H 13 N 2 O 2 + + + + DiffMono + 296.016040 + + + + Formula + Br 1 C 15 H 18 N 3 O 3 S 1 + + + + MassAvg + 400.29 + + + + MassMono + 399.025225 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:00003 + PSI-MOD + + + MOD:00567 + histidine oxidation to asparagine + + OBSOLETE because UniMod entry 244 is redundant with UniMod 348. Remap to MOD:00775. + + 29956 + ChEBI + + + 15736973 + PubMed + + + 5681232 + PubMed + + + 6692818 + PubMed + + + 9789001 + PubMed + + + AA0003 + RESID + + + 244 + UniMod + + + + + DiffAvg + -23.04 + + + + DiffFormula + C -2 H -1 N -1 O 1 + + + + DiffMono + -23.015984 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + H + + + + Source + artifact + + + + TermSpec + none + + 1 + PSI-MOD + + + MOD:00568 + histidine oxidation to aspartic acid + + OBSOLETE because UniMod entry 245 is redundant with UniMod 349. Remap to MOD:00776 + + 1097438 + PubMed + + + 339692 + PubMed + + + 4399050 + PubMed + + + 5764436 + PubMed + + + 6692818 + PubMed + + + 8089117 + PubMed + + + 9521123 + PubMed + + + 9582379 + PubMed + + + 245 + UniMod + + + + + DiffAvg + -22.05 + + + + DiffFormula + C -2 H -2 N -2 O 2 + + + + DiffMono + -22.031969 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + H + + + + Source + artifact + + + + TermSpec + none + + 1 + PSI-MOD + + + MOD:00569 + residues isobaric at a resolution below 0.000001 Da + + Natural or modified residues that are isobaric at a resolution below 0.000001 Da. + + 18688235 + PubMed + + + PSI-MOD-slim + MOD:00770 + PSI-MOD + + + MOD:00570 + residues isobaric at 71.037114 Da + + Natural or modified residues with a mass of 71.037114 Da. + + 18688235 + PubMed + + + MOD:00569 + MOD:00769 + PSI-MOD + + + MOD:00571 + 2-pyrrolidone-5-carboxylic acid (Pro) + + A modification that effectively oxygenates C5 of an L-proline residue to form a 2-pyrrolidone-5-carboxylic acid, pyroglutamic acid. + + 9252331 + PubMed + + + 359 + UniMod + + + The review article PubMed:9252331 does not provide an original citation for this modification [JSG]. + + Pro->pyro-Glu + PSI-MS-label + + + PyrGlu(Pro) + PSI-MOD-label + + + Pyroglutamic + UniMod-interim + + + pyroglutamicp + OMSSA-label + + + + DiffAvg + 13.98 + + + + DiffFormula + H -2 O 1 + + + + DiffMono + 13.979265 + + + + Formula + C 5 H 6 N 1 O 2 + + + + MassAvg + 112.11 + + + + MassMono + 112.039853 + + + + Origin + P + + + + Source + artifact + + + + TermSpec + none + + MOD:00679 + MOD:00915 + MOD:01048 + PSI-MOD + + + MOD:00572 + oxidized arginine biotinylated with biotin hydrazide + + modification from UniMod Chemical derivative + + 15174056 + PubMed + + + 15828771 + PubMed + + + 343 + UniMod + + + + Argbiotinhydrazide + UniMod-interim + + + oxidized Arginine biotinylated with biotin hydrazide + UniMod-description + + + + DiffAvg + 199.27 + + + + DiffFormula + C 9 H 13 N 1 O 2 S 1 + + + + DiffMono + 199.066700 + + + + Formula + C 15 H 25 N 5 O 3 S 1 + + + + MassAvg + 355.46 + + + + MassMono + 355.167811 + + + + Origin + R + + + + Source + artifact + + + + TermSpec + none + + MOD:00003 + PSI-MOD + + + MOD:00573 + oxidized lysine biotinylated with biotin hydrazide + + modification from UniMod Chemical derivative + + 15174056 + PubMed + + + 353 + UniMod + + + "http://www.piercenet.com/Proteomics/browse.cfm?fldID=84EBE112-F871-4CA5-807F-47327153CFCB" + + Lysbiotinhydrazide + UniMod-interim + + + oxidized Lysine biotinylated with biotin hydrazide + UniMod-description + + + + DiffAvg + 241.31 + + + + DiffFormula + C 10 H 15 N 3 O 2 S 1 + + + + DiffMono + 241.088498 + + + + Formula + C 16 H 27 N 5 O 3 S 1 + + + + MassAvg + 369.48 + + + + MassMono + 369.183461 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00003 + PSI-MOD + + + MOD:00574 + oxidized proline biotinylated with biotin hydrazide + + modification from UniMod Chemical derivative + + 15174056 + PubMed + + + 357 + UniMod + + + "http://www.piercenet.com/Proteomics/browse.cfm?fldID=84EBE112-F871-4CA5-807F-47327153CFCB" + + oxidized proline biotinylated with biotin hydrazide + UniMod-description + + + probiotinhydrazide + UniMod-interim + + + + DiffAvg + 258.34 + + + + DiffFormula + C 10 H 18 N 4 O 2 S 1 + + + + DiffMono + 258.115047 + + + + Formula + C 15 H 25 N 5 O 3 S 1 + + + + MassAvg + 355.46 + + + + MassMono + 355.167811 + + + + Origin + P + + + + Source + artifact + + + + TermSpec + none + + MOD:00003 + PSI-MOD + + + MOD:00575 + oxidized threonine biotinylated with biotin hydrazide + + modification from UniMod Chemical derivative + + 15174056 + PubMed + + + 361 + UniMod + + + "http://www.piercenet.com/Proteomics/browse.cfm?fldID=84EBE112-F871-4CA5-807F-47327153CFCB" + + oxidized Threonine biotinylated with biotin hydrazide + UniMod-description + + + Thrbiotinhydrazide + UniMod-interim + + + + DiffAvg + 240.32 + + + + DiffFormula + C 10 H 16 N 4 O 1 S 1 + + + + DiffMono + 240.104482 + + + + Formula + C 14 H 23 N 5 O 3 S 1 + + + + MassAvg + 341.43 + + + + MassMono + 341.152161 + + + + Origin + T + + + + Source + artifact + + + + TermSpec + none + + MOD:00003 + PSI-MOD + + + MOD:00576 + crotonaldehyde + + modification from UniMod Other + + 11283024 + PubMed + + + 253 + UniMod + + + + Crotonaldehyde + PSI-MS-label + + + Crotonaldehyde + UniMod-description + + + + DiffAvg + 70.09 + + + + DiffFormula + C 4 H 6 O 1 + + + + DiffMono + 70.041865 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00003 + PSI-MOD + + + MOD:00577 + acetaldehyde +26 + + modification from UniMod Other + + 7744761 + PubMed + + + 254 + UniMod + + + + Acetaldehyde +26 + UniMod-description + + + Delta:H(2)C(2) + PSI-MS-label + + + + DiffAvg + 26.04 + + + + DiffFormula + C 2 H 2 + + + + DiffMono + 26.015650 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00003 + PSI-MOD + + + MOD:00578 + acetaldehyde +28 + + modification from UniMod Other + + 255 + UniMod + + + + Acetaldehyde +28 + UniMod-description + + + Delta:H(4)C(2) + PSI-MS-label + + + + DiffAvg + 28.05 + + + + DiffFormula + C 2 H 4 + + + + DiffMono + 28.031300 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00003 + PSI-MOD + + + MOD:00579 + propionaldehyde +40 + + modification from UniMod Other + + 256 + UniMod + + + + Delta:H(4)C(3) + PSI-MS-label + + + Propionaldehyde +40 + UniMod-description + + + + DiffAvg + 40.06 + + + + DiffFormula + C 3 H 4 + + + + DiffMono + 40.031300 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00003 + PSI-MOD + + + MOD:00580 + propionaldehyde +42 + + OBSOLETE because entry removed from UniMod. Remap potentially to MOD:00579 propionaldehyde +40 + + 257 + UniMod + + + + + DiffAvg + 42.08 + + + + DiffFormula + C 3 H 6 + + + + DiffMono + 42.046950 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + 1 + PSI-MOD + + + MOD:00581 + (18)O monosubstituted residue + + A protein modification that effectively substitutes one (18)O atom for one (16)O atom. + + 11467524 + PubMed + + + 258 + UniMod + + + PSI-MOD-slim + + ctermpepo18 + OMSSA-label + + + Label:18O(1) + PSI-MS-label + + + O18 Labeling + UniMod-description + + + + DiffAvg + 2.00 + + + + DiffFormula + (16)O -1 (18)O 1 + + + + DiffMono + 2.004246 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + C-term + + MOD:00845 + PSI-MOD + + + MOD:00582 + 6x(13)C,2x(15)N labeled L-lysine + + A protein modification that effectively converts an L-lysine residue to 6x(13)C,2x(15)N labeled L-lysine. + + 12716131 + PubMed + + + 259 + UniMod + + + + 13C(6) 15N(2) Silac label + UniMod-description + + + Label:13C(6)15N(2) + PSI-MS-label + + + lys-13C615N2 + OMSSA-label + + + + DiffAvg + 8.01 + + + + DiffFormula + (12)C -6 (13)C 6 (14)N -2 (15)N 2 + + + + DiffMono + 8.014199 + + + + Formula + (13)C 6 H 12 (15)N 2 O 1 + + + + MassAvg + 136.11 + + + + MassMono + 136.109162 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00842 + MOD:00843 + MOD:00912 + PSI-MOD + + + MOD:00583 + thiophosphorylated residue + + A protein modification that effectively replaces a hydrogen atom with a thiophosphono group (H2PO2S, 'thiophosphate'). + + 12110917 + PubMed + + + 260 + UniMod + + + + Thiophospho + PSI-MS-label + + + Thiophosphorylation + UniMod-description + + + + DiffAvg + 96.04 + + + + DiffFormula + H 1 O 2 P 1 S 1 + + + + DiffMono + 95.943487 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00860 + MOD:00861 + PSI-MOD + + + MOD:00584 + 4-sulfophenyl isothiocyanate derivatized residue + + A protein modification produced by formation of an adduct with 4-sulfophenyl isothiocyanate. + + 14689565 + PubMed + + + 14745769 + PubMed + + + 16526082 + PubMed + + + 261 + UniMod + + + + 4-sulfophenyl isothiocyanate + UniMod-description + + + SPITC + PSI-MS-label + + + + DiffAvg + 215.24 + + + + DiffFormula + C 7 H 5 N 1 O 3 S 2 + + + + DiffMono + 214.971085 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + N-term + + MOD:00841 + PSI-MOD + + + MOD:00585 + deuterium trisubstituted residue + + A protein modification that effectively substitutes three (2)H deuterium atoms for three (1)H protium atoms. + + 262 + UniMod + + + + D(H)3Res + PSI-MOD-label + + + Label:2H(3) + PSI-MS-label + + + Trideuteration + UniMod-description + + + + DiffAvg + 3.02 + + + + DiffFormula + (1)H -3 (2)H 3 + + + + DiffMono + 3.018830 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00786 + PSI-MOD + + + MOD:00586 + phosphorylation to pyridyl thiol + + modification from UniMod Chemical derivative + + 264 + UniMod + + + + PET + PSI-MS-label + + + phosphorylation to pyridyl thiol + UniMod-description + + + + DiffAvg + 121.20 + + + + DiffFormula + C 7 H 7 N 1 O -1 S 1 + + + + DiffMono + 121.035006 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00003 + PSI-MOD + + + MOD:00587 + 6x(13)C,4x(15)N labeled L-arginine + + A protein modification that effectively converts an L-arginine residue to 6x(13)C, 4x(15)N labeled L-arginine. + + 12716131 + PubMed + + + 267 + UniMod + + + PSI-MOD-slim + + 13C(6) 15N(4) Silac label + UniMod-description + + + arg-13c6-15n4 + OMSSA-label + + + Label:13C(6)15N(4) + PSI-MS-label + + + + DiffAvg + 10.01 + + + + DiffFormula + (12)C -6 (13)C 6 (14)N -4 (15)N 4 + + + + DiffMono + 10.008269 + + + + Formula + (13)C 6 H 12 (15)N 4 O 1 + + + + MassAvg + 166.11 + + + + MassMono + 166.109380 + + + + Origin + R + + + + Source + artifact + + + + TermSpec + none + + MOD:00842 + MOD:00843 + MOD:00902 + PSI-MOD + + + MOD:00588 + 5x(13)C,1x(15)N labeled L-valine + + A protein modification that effectively converts an L-valine residue to 5x(13)C,1x(15)N labeled L-valine. + + 12771378 + PubMed + + + 268#V + UniMod + + + + 13C(5) 15N(1) Silac label + UniMod-description + + + Label:13C(5)15N(1) + PSI-MS-label + + + + DiffAvg + 6.01 + + + + DiffFormula + (12)C -5 (13)C 5 (14)N -1 (15)N 1 + + + + DiffMono + 6.013809 + + + + Formula + (13)C 5 H 9 (15)N 1 O 1 + + + + MassAvg + 105.08 + + + + MassMono + 105.082223 + + + + Origin + V + + + + Source + artifact + + + + TermSpec + none + + MOD:00920 + MOD:01809 + PSI-MOD + + + MOD:00589 + 1x(13)C,1x(15)N labeled L-phenylalanine + + A protein modification that effectively converts an L-phenylalanine residue to (13)C,(15)N labeled L-phenylalanine. + + 12771378 + PubMed + + + 269 + UniMod + + + + 13C(9) 15N(1) Silac label + UniMod-description + + + Label:13C(9)15N(1) + PSI-MS-label + + + + DiffAvg + 10.03 + + + + DiffFormula + (12)C -9 (13)C 9 (14)N -1 (15)N 1 + + + + DiffMono + 10.027228 + + + + Formula + (13)C 9 H 9 (15)N 1 O 1 + + + + MassAvg + 157.10 + + + + MassMono + 157.095642 + + + + Origin + F + + + + Source + artifact + + + + TermSpec + none + + MOD:00842 + MOD:00843 + MOD:00914 + PSI-MOD + + + MOD:00590 + nucleophilic addtion to cytopiloyne + + modification from UniMod Chemical derivative + + 15549660 + PubMed + + + 270 + UniMod + + + + Cytopiloyne + PSI-MS-label + + + nucleophilic addtion to cytopiloyne + UniMod-description + + + + DiffAvg + 362.38 + + + + DiffFormula + C 19 H 22 O 7 + + + + DiffMono + 362.136553 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00003 + PSI-MOD + + + MOD:00591 + nucleophilic addition to cytopiloyne+H2O + + modification from UniMod Chemical derivative + + 15549660 + PubMed + + + 271 + UniMod + + + + Cytopiloyne+water + PSI-MS-label + + + nucleophilic addition to cytopiloyne+H2O + UniMod-description + + + + DiffAvg + 380.39 + + + + DiffFormula + C 19 H 24 O 8 + + + + DiffMono + 380.147118 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00003 + PSI-MOD + + + MOD:00592 + sulfonation of N-terminal + + modification from UniMod Chemical derivative + + 12705581 + PubMed + + + 15732931 + PubMed + + + 16046801 + PubMed + + + 272 + UniMod + + + + CAF + PSI-MS-label + + + sulfonation of N-terminus + UniMod-description + + + + DiffAvg + 136.12 + + + + DiffFormula + C 3 H 4 O 4 S 1 + + + + DiffMono + 135.983030 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + N-term + + MOD:00003 + PSI-MOD + + + MOD:00593 + covalent modification of lysine by omega-maleimido alkanoyl N-hydroxysuccinimido esters + + modification from UniMod Chemical derivative + + 273 + UniMod + + + J. Prot. Chem. 2, 263-277, 1983 + + covalent modification of lysine by cross-linking reagent + UniMod-description + + + Xlink:SSD + PSI-MS-label + + + + DiffAvg + 253.25 + + + + DiffFormula + C 12 H 15 N 1 O 5 + + + + DiffMono + 253.095023 + + + + Formula + C 18 H 27 N 3 O 6 + + + + MassAvg + 381.43 + + + + MassMono + 381.189986 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00003 + PSI-MOD + + + MOD:00594 + residues isobaric at 113.047678 Da + + Natural or modified resiues with a mass of 113.047678 Da. + + 18688235 + PubMed + + + PSI-MOD-slim + MOD:00569 + MOD:00624 + PSI-MOD + + + MOD:00595 + mannosylated residue + + A protein modification that effectively replaces a hydrogen atom with an manose group through a glycosidic bond + + 18688235 + PubMed + + + PSI-MOD-slim + + ManRes + PSI-MOD-label + + + + DiffAvg + 162.14 + + + + DiffFormula + C 6 H 10 N 0 O 5 + + + + DiffMono + 162.052823 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + none + + + + TermSpec + none + + MOD:00434 + MOD:00727 + PSI-MOD + + + MOD:00596 + 4-(2-aminoethyl)benzenesulfonyl fluoride derivatized residue + + A protein modification that is produced by formation of an adduct with 4-(2-aminoethyl)benzenesulfonyl fluoride, AEBS. + + 235 + DeltaMass + + + 8597590 + PubMed + + + 276 + UniMod + + + From DeltaMass: Average Mass: 183 Average Mass Change:183 References:We have found that AEBSF modifies many proteins by covalent attachment, preferentially on Tyr, and to a lesser extent on Lys, His, and the amino-terminus. These modifications were identified by electrospray MS of the proteins (adds 183 Da per AEBS-group) and by peptide mapping and MS/MS. All the proteins we examined were modified after 24 hrs. at 4 C with 1 mM AEBSF in TRIS, pH 8.0. The reaction is 10-20x slower at pH 7; however AEBSF is quite stable in aqueous solution and the extent of to which the protein is modified continues to increase for several days. We have seen the addition of 10 or more AEBS-groups to proteins after prolonged storage. We found no equivalent modification from PMSF, probably because it degrades so quickly. We no longer use AEBSF, and urge caution to those who do. To address the problem, Boehringer Mannheim (now Roche Molecular Biochemicals) introduced Pefabloc PLUS which includes an additional component to compete for these side reactions. In our limited experience with Pefabloc PLUS, it reduces the +183 modifications, but does not always eliminate them. As a result, we prefer PMSF, despite its own set of drawbacks. We have never found PMSF-induced modification of proteins (except trypsin), probably due to its short half-life in aqeous solution. + + AEBS + PSI-MS-label + + + AEBSF + DeltaMass-label + + + Aminoethylbenzenesulfonylation + UniMod-description + + + + DiffAvg + 183.23 + + + + DiffFormula + C 8 H 9 N 1 O 2 S 1 + + + + DiffMono + 183.035400 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:01652 + PSI-MOD + + + MOD:00597 + methyl methanethiosulfonate + + OBSOLETE because UniMod entry 277 redundant with UniMod 39. Remap to MOD:00110. + + 277 + UniMod + + + + + DiffAvg + 46.09 + + + + DiffFormula + C 1 H 2 S 1 + + + + DiffMono + 45.987721 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + 1 + PSI-MOD + + + MOD:00598 + S-(2-hydroxyethyl)cysteine + + A protein modification that effectively converts an L-cysteine residue to S-(2-hydroxyethyl)cysteine + + 15351294 + PubMed + + + 278 + UniMod + + + This modification of cysteine is produced by the reagent iodoethanol with triethylphosphine [JSG]. + PSI-MOD-slim + + Ethanolation of Cys + UniMod-description + + + Ethanolyl + PSI-MS-label + + + + DiffAvg + 44.05 + + + + DiffFormula + C 2 H 4 O 1 + + + + DiffMono + 44.026215 + + + + Formula + C 5 H 9 N 1 O 2 S 1 + + + + MassAvg + 147.19 + + + + MassMono + 147.035400 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:00905 + PSI-MOD + + + MOD:00599 + monomethylated residue + + A protein modification that effectively replaces one hydrogen atom with one methyl group. + + 11875433 + PubMed + + + 34 + UniMod + + + PSI-MOD-slim + + Me1Res + PSI-MOD-label + + + Methyl + PSI-MS-label + + + Methylation + UniMod-description + + + + DiffAvg + 14.03 + + + + DiffFormula + C 1 H 2 + + + + DiffMono + 14.015650 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + none + + + + TermSpec + none + + MOD:00427 + PSI-MOD + + + MOD:00600 + L-glutamic acid 5-ethyl ester + + A protein modification that effectively converts an L-glutamic acid residue to L-glutamate 5-ethyl ester. + + 0 + DeltaMass + + + 9629898 + PubMed + + + 280#E + UniMod + + + From DeltaMass: Average Mass: 28 with no citation. The UniMod citation refers to the formation of glutamate ethyl ester and not to either lysine or N-terminal alkylation. For dimethylated residues, see MOD:00429 and its children [JSG]. + + Ethyl + DeltaMass-label + + + Ethyl + PSI-MS-label + + + Ethylation + UniMod-description + + + + DiffAvg + 28.05 + + + + DiffFormula + C 2 H 4 + + + + DiffMono + 28.031300 + + + + Formula + C 7 H 11 N 1 O 3 + + + + MassAvg + 157.17 + + + + MassMono + 157.073893 + + + + Origin + E + + + + Source + artifact + + + + TermSpec + none + + MOD:00906 + MOD:01339 + PSI-MOD + + + MOD:00601 + cyclized residue + + A protein modification that effectively produces an heterocyclic amino acid with a covalent bond between the side chain and either its alpha amino or 1-carboxyl group, possibly breaking the peptide chain. + + 18688235 + PubMed + + + PSI-MOD-slim + + CycRes + PSI-MOD-label + + MOD:01156 + PSI-MOD + + + MOD:00602 + N-methylated residue + + A protein modification that effectively replaces a hydrogen atom of a residue amino or imino group with an methyl group. + + 18688235 + PubMed + + + PSI-MOD-slim + + NMeRes + PSI-MOD-label + + MOD:00427 + PSI-MOD + + + MOD:00603 + N-ethylation + + OBSOLETE because UniMod entry 283 is redundant with UniMod 280. Remap to MOD:00600 + + 283 + UniMod + + + + + DiffAvg + 28.05 + + + + DiffFormula + C 2 H 4 + + + + DiffMono + 28.031300 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + N-term + + 1 + PSI-MOD + + + MOD:00604 + 2x(2)H monomethylated L-lysine + + A protein modification that effectively converts an L-lysine residue to 2x(2)H labeled monomethylated L-lysine. + + 15525938 + PubMed + + + 284 + UniMod + + + + Deuterium Methylation of Lysine + UniMod-description + + + Methyl:2H(2) + PSI-MS-label + + + + DiffAvg + 16.03 + + + + DiffFormula + C 1 (2)H 2 + + + + DiffMono + 16.028204 + + + + Formula + C 7 (1)H 12 (2)H 2 N 2 O 1 + + + + MassAvg + 144.12 + + + + MassMono + 144.123167 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00839 + MOD:00912 + + derives_from + MOD:000850 + + PSI-MOD + + + MOD:00605 + Sulfanilic Acid (SA), light C12 + + modification from UniMod Chemical derivative, C-Terminal/Glutamate/Aspartate sulfonation + + 285 + UniMod + + + + Light Sulfanilic Acid (SA) C12 + UniMod-description + + + SulfanilicAcid + PSI-MS-label + + + + DiffAvg + 155.17 + + + + DiffFormula + C 6 H 5 N 1 O 2 S 1 + + + + DiffMono + 155.004099 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + C-term + + MOD:01426 + PSI-MOD + + + MOD:00606 + Sulfanilic Acid (SA), heavy C13 + + modification from UniMod Chemical derivative + + 9254591 + PubMed + + + 286 + UniMod + + + + Heavy Sulfanilic Acid (SA) C13 + UniMod-description + + + SulfanilicAcid:13C(6) + PSI-MS-label + + + + DiffAvg + 161.02 + + + + DiffFormula + (13)C 6 H 5 N 1 O 2 S 1 + + + + DiffMono + 161.024228 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + C-term + + MOD:01426 + PSI-MOD + + + MOD:00607 + dioxoindolealanine lactone + + modification from UniMod Chemical derivative + + 7949339 + PubMed + + + 288 + UniMod + + + UniMod name, formula, and terminal specification corrected. Formula corresponded to uncleaved intermediate [JSG]. + + Trp->Oxolactone + PSI-MS-label + + + Tryptophan oxidation to oxolactone + UniMod-description + + + + DiffAvg + 30.99 + + + + DiffFormula + H -1 O 2 + + + + DiffMono + 30.982004 + + + + Formula + C 11 H 9 N 2 O 3 + + + + MassAvg + 217.20 + + + + MassMono + 217.061317 + + + + Origin + W + + + + Source + artifact + + + + TermSpec + C-term + + MOD:00918 + PSI-MOD + + + MOD:00608 + biotin polyethyleneoxide amine + + modification from UniMod Chemical derivative + + 289 + UniMod + + + + Biotin polyethyleneoxide amine + UniMod-description + + + Biotin-PEO-Amine + UniMod-interim + + + + DiffAvg + 356.49 + + + + DiffFormula + C 16 H 28 N 4 O 3 S 1 + + + + DiffMono + 356.188212 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00003 + PSI-MOD + + + MOD:00609 + Pierce EZ-Link Biotin-HPDP + + modification from UniMod Chemical derivative + + 290 + UniMod + + + + Biotin-HPDP + UniMod-interim + + + Pierce EZ-Link Biotin-HPDP + UniMod-description + + + + DiffAvg + 428.61 + + + + DiffFormula + C 19 H 32 N 4 O 3 S 2 + + + + DiffMono + 428.191583 + + + + Formula + C 22 H 37 N 5 O 4 S 3 + + + + MassAvg + 531.75 + + + + MassMono + 531.200768 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:00003 + PSI-MOD + + + MOD:00610 + cysteinyl mercury + + modification from UniMod Chemical derivative + + 10695144 + PubMed + + + 291 + UniMod + + + + Delta:Hg(1) + PSI-MS-label + + + Mercury Mercaptan + UniMod-description + + + + DiffAvg + 200.59 + + + + DiffFormula + Hg 1 + + + + DiffMono + 201.970643 + + + + Formula + C 3 H 5 Hg 1 N 1 O 1 S 1 + + + + MassAvg + 303.73 + + + + MassMono + 304.979828 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + MOD:00905 + MOD:01075 + PSI-MOD + + + MOD:00611 + iodouridine monophosphate derivatized residue + + A protein modification that is produced by reaction of iodouridine monophosphate, or a polynucleotide containing iodouridine, with a residue. + + 11112526 + PubMed + + + 11567090 + PubMed + + + 6540775 + PubMed + + + 292 + UniMod + + + + Cross-link of (Iodo)-uracil MP with W,F,Y + UniMod-description + + + IodoU-AMP + PSI-MS-label + + + + DiffAvg + 322.17 + + + + DiffFormula + C 9 H 11 N 2 O 9 P 1 + + + + DiffMono + 322.020217 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + PSI-MOD + + + MOD:00612 + 3-(carboxamidomethylthio)propanoylated residue + + A protein modification that is produced by derivatization of a residue with 3,3-dithiobis[sulfosuccinimidyl propanoate], DTSSP, or with Pierce EZ-Link Sulfo-NHS-SS-Biotin reagent, sulfosuccinimidyl 3-[(2-[biotinamido]ethyl)disulfanyl]propanoate, followed by reduction with dithiothreitol and then reaction with iodoacetamide. + + 15121203 + PubMed + + + 293 + UniMod + + + + 3-(carbamidomethylthio)propanoyl + UniMod-description + + + CAMthiopropanoyl + PSI-MS-label + + + + DiffAvg + 145.18 + + + + DiffFormula + C 5 H 7 N 1 O 2 S 1 + + + + DiffMono + 145.019749 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00649 + MOD:00848 + PSI-MOD + + + MOD:00613 + biotinoyl-iodoacetyl-ethylenediamine + + modification from UniMod Chemical derivative + + 10906242 + PubMed + + + 294 + UniMod + + + + biotinoyl-iodoacetyl-ethylenediamine + UniMod-description + + + IED-Biotin + PSI-MS-label + + + + DiffAvg + 326.42 + + + + DiffFormula + C 14 H 22 N 4 O 3 S 1 + + + + DiffMono + 326.141262 + + + + Formula + C 17 H 27 N 5 O 4 S 2 + + + + MassAvg + 429.55 + + + + MassMono + 429.150446 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + MOD:00905 + PSI-MOD + + + MOD:00614 + fucosylated + + A protein modification that effectively replaces a hydrogen atom of an amino acid residue or of a modifying group with a fucose (6-deoxy-D-galactose) group through a glycosidic bond. + + 11344537 + PubMed + + + 15189151 + PubMed + + + 295 + UniMod + + + PSI-MOD-slim + + dHex + PSI-MS-label + + + Fuc + PSI-MOD-label + + + Fucose + UniMod-description + + + + DiffAvg + 146.14 + + + + DiffFormula + C 6 H 10 O 4 + + + + DiffMono + 146.057909 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + natural + + + + TermSpec + none + + MOD:00736 + PSI-MOD + + + MOD:00615 + 4-sulfophenyl isothiocyante modification to N-term R + + OBSOLETE because entry UniMod:261 site N-term R was abandoned. Remap to MOD:00584 + + 261 site N-term R was abandoned. Remap to MOD:00584" [PubMed:14689565 + UniMod + + + 261 + UniMod + + + + + DiffAvg + 215.24 + + + + DiffFormula + C 7 H 5 N 1 O 3 S 2 + + + + DiffMono + 214.971085 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + R + + + + Source + artifact + + + + TermSpec + N-term + + 1 + PSI-MOD + + + MOD:00616 + residues isobaric at a resolution below 0.1 Da + + Natural or modified residues that are isobaric at a resolution below 0.1 Da. + + 18688235 + PubMed + + + PSI-MOD-slim + MOD:00538 + PSI-MOD + + + MOD:00617 + 3x(2)H residue methyl ester + + A protein modification that effectively converts a residue containing common isotopes to a 3x(2)H labeled residue methyl ester. + + 298 + UniMod + + + + ctermpeptrideuteromethyl + OMSSA-label + + + deuterated methyl ester + UniMod-description + + + Methyl:2H(3) + PSI-MS-label + + + + DiffAvg + 17.03 + + + + DiffFormula + C 1 (1)H -1 (2)H 3 + + + + DiffMono + 17.034480 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + C-term + + MOD:00839 + PSI-MOD + + + MOD:00618 + tryptophan carboxylation + + modification from UniMod Chemical derivative + + 299#W + UniMod + + + There is no literature citation for this UniMod entry [JSG]. + + Carboxy + UniMod-interim + + + Carboxylation + UniMod-description + + + + DiffAvg + 44.01 + + + + DiffFormula + C 1 O 2 + + + + DiffMono + 43.989829 + + + + Formula + C 12 H 10 N 2 O 3 + + + + MassAvg + 230.22 + + + + MassMono + 230.069142 + + + + Origin + W + + + + Source + artifact + + + + TermSpec + none + + MOD:00918 + MOD:01152 + PSI-MOD + + + MOD:00619 + hydroxylethanone + + OBSOLETE because entry 300 is redundant with UniMod 6 remap to MOD:01328 + + 300 + UniMod + + + + + DiffAvg + 58.04 + + + + DiffFormula + C 2 H 2 O 2 + + + + DiffMono + 58.005479 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + W + + + + Source + artifact + + + + TermSpec + none + + 1 + PSI-MOD + + + MOD:00620 + cysteine monobromobimane derivative + + modification from UniMod Chemical derivative + + 7856876 + PubMed + + + 301 + UniMod + + + 1-(bromomethyl)-2,6,7-trimethylpyrazolo[1,2-a]pyrazole-3,5-dione, C 10 H 11 Br 1 N 2 O 2. + + Bromobimane + PSI-MS-label + + + Monobromobimane derivative + UniMod-description + + + + DiffAvg + 190.20 + + + + DiffFormula + C 10 H 10 N 2 O 2 + + + + DiffMono + 190.074228 + + + + Formula + C 13 H 15 N 3 O 3 S 1 + + + + MassAvg + 293.34 + + + + MassMono + 293.083412 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + MOD:00905 + PSI-MOD + + + MOD:00621 + menadione quinone derivative + + modification from UniMod Chemical derivative + + 15939799 + PubMed + + + 302 + UniMod + + + + Menadione + UniMod-interim + + + Menadione quinone derivative + UniMod-description + + + + DiffAvg + 170.17 + + + + DiffFormula + C 11 H 6 O 2 + + + + DiffMono + 170.036779 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + PSI-MOD + + + MOD:00622 + cysteine mercaptoethanol + + modification from UniMod Chemical derivative + + 80 + DeltaMass + + + 12442261 + PubMed + + + 303 + UniMod + + + From DeltaMass: Average Mass: 76 Average Mass Change:76 PubMed:8019414. + + Beta mercaptoethanol adduct + DeltaMass-label + + + Cysteine mercaptoethanol + UniMod-description + + + DeStreak + PSI-MS-label + + + + DiffAvg + 76.11 + + + + DiffFormula + C 2 H 4 O 1 S 1 + + + + DiffMono + 75.998286 + + + + Formula + C 5 H 9 N 1 O 2 S 2 + + + + MassAvg + 179.25 + + + + MassMono + 179.007471 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + MOD:00905 + PSI-MOD + + + MOD:00623 + fucosylated biantennary (-2 galactose) + + modification from UniMod N-linked glycosylation + + 305 + UniMod + + + + dHex(1)Hex(3)HexNAc(4) + PSI-MS-label + + + Fucosylated biantennary (-2 galactose) + UniMod-description + + + + DiffAvg + 1443.33 + + + + DiffFormula + C 56 H 90 N 4 O 39 + + + + DiffMono + 1442.518219 + + + + Formula + C 60 H 96 N 6 O 41 + + + + MassAvg + 1557.43 + + + + MassMono + 1556.561147 + + + + Origin + N + + + + Source + natural + + + + TermSpec + none + + MOD:00725 + MOD:00903 + PSI-MOD + + + MOD:00624 + residues isobaric at 113.0-113.1 Da + + Natural or modified residues with a mass of 113.0-113.1 Da. + + 18688235 + PubMed + + + PSI-MOD-slim + MOD:00616 + PSI-MOD + + + MOD:00625 + N-methylmaleimide derivatized residue + + modification from UniMod Chemical derivative + + 314 + UniMod + + + + Nmethylmaleimide + PSI-MS-label + + + Nmethylmaleimide + UniMod-description + + + + DiffAvg + 111.10 + + + + DiffFormula + C 5 H 5 N 1 O 2 + + + + DiffMono + 111.032028 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + PSI-MOD + + + MOD:00626 + fluorescein-5-thiosemicarbazide + + modification from UniMod Chemical derivative + + 2883911 + PubMed + + + 478 + UniMod + + + + fluorescein-5-thiosemicarbazide + UniMod-description + + + FTC + PSI-MS-label + + + + DiffAvg + 421.43 + + + + DiffFormula + C 21 H 15 N 3 O 5 S 1 + + + + DiffMono + 421.073242 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + PSI-MOD + + + MOD:00627 + 2,5-dimethylpyrrole lysine from 2,5-hexanedione adduct + + modification from UniMod Chemical derivative + + 316 + UniMod + + + There is no citation for this UniMod entry. Add PubMed:7981420, correct spelling [JSG]. + + (2S)-2-amino-6-(2,5-dimethylpyrrolidin-1-yl)hexanoic acid + PSI-MOD-alternate + + + 2,5-dimethypyrrole + UniMod-description + + + 6-(2,5-dimethylpyrrolidin-1-yl)norleucine + PSI-MOD-alternate + + + DimethylpyrroleAdduct + PSI-MS-label + + + + DiffAvg + 78.11 + + + + DiffFormula + C 6 H 6 + + + + DiffMono + 78.046950 + + + + Formula + C 12 H 18 N 2 O 1 + + + + MassAvg + 206.29 + + + + MassMono + 206.141913 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + MOD:00912 + PSI-MOD + + + MOD:00628 + Hex2 + + a protein modification that effectively replaces a hydrogen atom of an amino acid residue or of a modifying group with two hexose sugar groups through glycosidic bonds + + 18688235 + PubMed + + + + + DiffAvg + 324.28 + + + + DiffFormula + C 12 H 20 O 10 + + + + DiffMono + 324.105647 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + natural + + + + TermSpec + none + + MOD:00725 + PSI-MOD + + + MOD:00629 + MDA adduct +62 + + modification from UniMod Chemical derivative + + 318 + UniMod + + + Usually major adduct formed from malondialdehyde (MDA) with the amino group of lysine residues [UniProt]. + + Delta:H(2)C(5) + PSI-MS-label + + + MDA adduct +62 + UniMod-description + + + + DiffAvg + 62.07 + + + + DiffFormula + C 5 H 2 + + + + DiffMono + 62.015650 + + + + Formula + C 11 H 14 N 2 O 1 + + + + MassAvg + 190.25 + + + + MassMono + 190.110613 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + MOD:00912 + PSI-MOD + + + MOD:00630 + C3-H2-O adduct (+54 amu) of malondialdehyde with lysine or methylglyoxal with arginine. + + modification from UniMod Chemical derivative + + 9328283 + PubMed + + + 319 + UniMod + + + This is not a legitimate ontological entry and will become obsolete when the children are reassigned [JSG] + + Delta:H(2)C(3)O(1) + PSI-MS-label + + + MDA adduct +54 + UniMod-description + + + + DiffAvg + 54.05 + + + + DiffFormula + C 3 H 2 O 1 + + + + DiffMono + 54.010565 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + PSI-MOD + + + MOD:00631 + hydrolyzed N-ethylmaleimide adduct + + modification from UniMod Chemical derivative + + 320 + UniMod + + + N-ethylmaeimide adduct + H20 (a mixture of isobaric products) [JSG]. + + Nethylmaleimide+water + PSI-MS-label + + + Nethylmaleimidehydrolysis + UniMod-description + + + + DiffAvg + 143.14 + + + + DiffFormula + C 6 H 9 N 1 O 3 + + + + DiffMono + 143.058243 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + PSI-MOD + + + MOD:00632 + N-succinimide + + OBSOLETE because this chemical derivative modification from UniMod 321 is deprecated. + + 321 + UniMod + + + + + DiffAvg + -17.01 + + + + DiffFormula + H -1 O -1 + + + + DiffMono + -17.002740 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + N + + + + Source + artifact + + + + TermSpec + none + + 1 + PSI-MOD + + + MOD:00633 + bis-N-I-sulfonerahodamine + + modification from UniMod Chemical derivative + + 323 + UniMod + + + Invitrogen B-10621, a red fluorescent cross-linking reagent (only link to Cys is indicated) [UniMod]. + + bis-((N-iodoacetyl)piperazinyl)sulfonerhodamine + PSI-MOD-alternate + + + bis-N-I-sulfonerahodamine + UniMod-description + + + Xlink:B10621 + PSI-MS-label + + + + DiffAvg + 713.57 + + + + DiffFormula + C 31 H 30 I 1 N 4 O 6 S 1 + + + + DiffMono + 713.093078 + + + + Formula + C 34 H 35 I 1 N 5 O 7 S 2 + + + + MassAvg + 816.71 + + + + MassMono + 816.102263 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + MOD:00905 + PSI-MOD + + + MOD:00634 + dimethyl 3,3'-dithiobispropionimidate + + modification from UniMod Chemical derivative + + 770170 + PubMed + + + 324 + UniMod + + + Pierce reagent, needs sites for N, Q, R, K, and N-term [JSG]. + + dimethyl 3,3'-dithiobispropionimidate + UniMod-description + + + DTBP + UniMod-interim + + + + DiffAvg + 123.60 + + + + DiffFormula + C 3 Cl 1 H 6 N 1 S 1 + + + + DiffMono + 122.990948 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00003 + PSI-MOD + + + MOD:00635 + 10-fluoroethoxyphosphinyl-N-(biotinamidopentyl)decanamide + + modification from UniMod Chemical derivative + + 10611275 + PubMed + + + 325 + UniMod + + + + 10-ethoxyphosphinyl-N-(biotinamidopentyl)decanamide + UniMod-description + + + FP-Biotin + UniMod-interim + + + + DiffAvg + 572.75 + + + + DiffFormula + C 27 H 49 N 4 O 5 P 1 S 1 + + + + DiffMono + 572.316128 + + + + Formula + C 30 H 54 N 5 O 7 P 1 S 1 + + + + MassAvg + 659.82 + + + + MassMono + 659.348157 + + + + Origin + S + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + MOD:00861 + MOD:00916 + PSI-MOD + + + MOD:00636 + S-ethylcysteine (Ser) + + A protein modification that effectively converts an L-serine residue to S-ethylcysteine. + + 327 + UniMod + + + Modification from UniMod. Phosphoserine is converted to dehydroalanine then by Michael addition of ethanethiol to S-ethylcysteine. Needs parent and sibling for S-ethyl-cysteine. + + Delta:H(4)C(2)O(-1)S(1) + PSI-MS-label + + + S-Ethylcystine from Serine + UniMod-description + + + + DiffAvg + 44.11 + + + + DiffFormula + C 2 H 4 O -1 S 1 + + + + DiffMono + 44.008457 + + + + Formula + C 5 H 9 N 1 O 1 S 1 + + + + MassAvg + 131.19 + + + + MassMono + 131.040485 + + + + Origin + S + + + + Source + artifact + + + + TermSpec + none + + MOD:00916 + PSI-MOD + + + MOD:00637 + 1x(13)C,3x(2)H labeled monomethylated L-arginine + + A protein modification that effectively replaces one hydrogen atom of an L-arginine residue with a (13)C,3x(2)H labeled methyl group to form a 1x(13)C,3x(2)H labeled monomethylated L-arginine. + + 329 + UniMod + + + + Methyl:2H(3)13C(1) + PSI-MS-label + + + monomethylated arginine + UniMod-description + + + + DiffAvg + 18.04 + + + + DiffFormula + (13)C 1 (1)H -1 (2)H 3 + + + + DiffMono + 18.037835 + + + + Formula + (12)C 6 (13)C 1 (1)H 11 (2)H 3 N 4 O 1 + + + + MassAvg + 174.14 + + + + MassMono + 174.138946 + + + + Origin + R + + + + Source + artifact + + + + TermSpec + none + + MOD:00839 + MOD:00842 + MOD:00902 + + derives_from + MOD:004140 + + PSI-MOD + + + MOD:00638 + 2x(13)C,6x(2)H labeled dimethylated L-arginine + + A protein modification that effectively replaces two hydrogen atoms of an L-arginine residue with two (13)C,3x(2)H labeled methyl groups to form a 2x(13)C,6x(2)H labeled dimethylated L-arginine. + + 15782174 + PubMed + + + 330 + UniMod + + + + Dimethyl:2H(6)13C(2) + PSI-MS-label + + + dimethylated arginine + UniMod-description + + + + DiffAvg + 36.08 + + + + DiffFormula + (13)C 2 (1)H -2 (2)H 6 + + + + DiffMono + 36.075670 + + + + Formula + (12)C 6 (13)C 2 (1)H 10 (2)H 6 N 4 O 1 + + + + MassAvg + 192.18 + + + + MassMono + 192.176781 + + + + Origin + R + + + + Source + artifact + + + + TermSpec + none + + MOD:00839 + MOD:00842 + MOD:00902 + + derives_from + MOD:007830 + + PSI-MOD + + + MOD:00639 + thiophosphate labeled with biotin-HPDP + + modification from UniMod Chemical derivative + + 332 + UniMod + + + + Thiophos-S-S-biotin + PSI-MS-label + + + thiophosphate labeled with biotin-HPDP + UniMod-description + + + + DiffAvg + 525.66 + + + + DiffFormula + C 19 H 34 N 4 O 5 P 1 S 3 + + + + DiffMono + 525.142895 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + MOD:00861 + PSI-MOD + + + MOD:00640 + 6-N-biotinylaminohexyl isopropyl phosphorofluoridate + + modification from UniMod Chemical derivative + + 333 + UniMod + + + + 6-N-biotinylaminohexyl isopropyl phosphate + UniMod-description + + + Can-FP-biotin + UniMod-interim + + + + DiffAvg + 467.54 + + + + DiffFormula + C 19 F 1 H 35 N 3 O 5 P 1 S 1 + + + + DiffMono + 467.201907 + + + + Formula + C 22 F 1 H 40 N 4 O 7 P 1 S 1 + + + + MassAvg + 554.62 + + + + MassMono + 554.233935 + + + + Origin + S + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + MOD:00861 + MOD:00916 + PSI-MOD + + + MOD:00641 + CAMthiopropanoyl of Lys + + OBSOLETE because UniMod entry 334 is merged with UniMod 293. Remap to MOD:00612 + + 334 + UniMod + + + + + DiffAvg + 146.18 + + + + DiffFormula + C 5 H 8 N 1 O 2 S 1 + + + + DiffMono + 146.027574 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + 1 + PSI-MOD + + + MOD:00642 + reduced 4-hydroxynonenal adduct + + A protein modification produced by formation of an adduct of a residue with 4-hydroxynonenal artificially reduced by a reagent such as NaBH4. + + 11910026 + PubMed + + + 15133838 + PubMed + + + 335 + UniMod + + + 4-hydroxynonenal, a toxic lipid aldehyde, is a product of the hydroperoxide beta-cleavage degradation of omega-6 polyunsaturated fatty acids, such as arachidonic and linoleic acids [JSG]. + + HNE+Delta:H(2) + PSI-MS-label + + + reduced 4-Hydroxynonenal + UniMod-description + + + + DiffAvg + 158.24 + + + + DiffFormula + C 9 H 18 O 2 + + + + DiffMono + 158.130680 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + MOD:01155 + + derives_from + MOD:004460 + + PSI-MOD + + + MOD:00643 + methylamine Michael addition derivatized residue + + modification from UniMod Artifact + + 11968134 + PubMed + + + 337 + UniMod + + + + Methylamine + PSI-MS-label + + + Michael addition with methylamine + UniMod-description + + + + DiffAvg + 13.04 + + + + DiffFormula + C 1 H 3 N 1 O -1 + + + + DiffMono + 13.031634 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00003 + PSI-MOD + + + MOD:00644 + O-acetylated residue + + A protein modification that effectively replaces a residue hydroxyl group with an acetoxy group. + + 18688235 + PubMed + + + PSI-MOD-slim + + OAcRes + PSI-MOD-label + + + + DiffAvg + 42.04 + + + + DiffFormula + C 2 H 2 O 1 + + + + DiffMono + 42.010565 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + natural + + + + TermSpec + none + + MOD:00394 + MOD:00671 + PSI-MOD + + + MOD:00645 + S-acetylated residue + + A protein modification that effectively replaces a residue sulfanyl group with an acetylsulfanyl group. + + 18688235 + PubMed + + + PSI-MOD-slim + + SAcRes + PSI-MOD-label + + + + DiffAvg + 42.04 + + + + DiffFormula + C 2 H 2 O 1 S 0 + + + + DiffMono + 42.010565 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + natural + + + + TermSpec + none + + MOD:00394 + MOD:00672 + PSI-MOD + + + MOD:00646 + acetylated L-cysteine + + A protein modification that effectively converts an L-cysteine residue to either N-acetyl-L-cysteine or S-acetyl-L-cysteine. + + 18688235 + PubMed + + + PSI-MOD-slim + + AcCys + PSI-MOD-label + + + + DiffAvg + 42.04 + + + + DiffFormula + C 2 H 2 N 0 O 1 S 0 + + + + DiffMono + 42.010565 + + + + Formula + C 5 H 7 N 1 O 2 S 1 + + + + MassAvg + 145.18 + + + + MassMono + 145.019749 + + + + Origin + C + + + + Source + natural + + MOD:00394 + MOD:00905 + PSI-MOD + + + MOD:00647 + acetylated L-serine + + A protein modification that effectively converts an L-serine residue to either N-acetyl-L-serine, O-acetyl-L-serine, or N,O-diacetyl-L-serine. + + 18688235 + PubMed + + + PSI-MOD-slim + + AcSer + PSI-MOD-label + + + + DiffAvg + 42.04 + + + + DiffFormula + C 2 H 2 N 0 O 1 + + + + DiffMono + 42.010565 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + S + + + + Source + natural + + MOD:00394 + MOD:00916 + PSI-MOD + + + MOD:00648 + N,O-diacetylated L-serine + + A protein modification that effectively converts an L-serine residue to N,O-diacetyl-L-serine. + + 16731519 + PubMed + + + 489587 + PubMed + + + 7309355 + PubMed + + + AA0051#var + RESID + + + AA0364#var + RESID + + + The samples were prepared using glacial acetic acid, and were probably artifactual [JSG]. + + (S)-2-acetamido-3-acetyloxypropanoic acid + PSI-MOD-alternate + + + N,O-diacetyl-L-serine + PSI-MOD-alternate + + + N,O-diacetylserine + PSI-MOD-alternate + + + NOAc2Ser + PSI-MOD-label + + + + DiffAvg + 84.07 + + + + DiffFormula + C 4 H 4 N 0 O 2 + + + + DiffMono + 84.021129 + + + + Formula + C 7 H 10 N 1 O 4 + + + + MassAvg + 172.16 + + + + MassMono + 172.060983 + + + + Origin + S + + + + Source + artifact + + + + TermSpec + N-term + + MOD:00408 + MOD:00644 + MOD:00647 + + has_functional_parent + MOD:000600 + + + has_functional_parent + MOD:003690 + + PSI-MOD + + + MOD:00649 + acylated residue + + A protein modification that effectively replaces a hydrogen atom with an acyl group. + + 18688235 + PubMed + + + PSI-MOD-slim + + AcylRes + PSI-MOD-label + + MOD:01156 + PSI-MOD + + + MOD:00650 + N-myristoylated residue + + A protein modification that effectively replaces a residue amino group with a myristoylamino group. + + 18688235 + PubMed + + + PSI-MOD-slim + + NMyrRes + PSI-MOD-label + + + + DiffAvg + 210.36 + + + + DiffFormula + C 14 H 26 O 1 + + + + DiffMono + 210.198365 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + natural + + + + TermSpec + none + + MOD:00438 + MOD:00670 + PSI-MOD + + + MOD:00651 + N-palmitoylated residue + + A protein modification that effectively replaces a residue amino group with a palmitoylamino group. + + 18688235 + PubMed + + + PSI-MOD-slim + + NPamRes + PSI-MOD-label + + + + DiffAvg + 238.41 + + + + DiffFormula + C 16 H 30 O 1 + + + + DiffMono + 238.229666 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + natural + + + + TermSpec + none + + MOD:00440 + MOD:00670 + PSI-MOD + + + MOD:00652 + O-palmitoylated residue + + A protein modification that effectively replaces a residue hydroxyl group with a palmitoyloxy group. + + 18688235 + PubMed + + + PSI-MOD-slim + + OPamRes + PSI-MOD-label + + + + DiffAvg + 238.41 + + + + DiffFormula + C 16 H 30 O 1 + + + + DiffMono + 238.229666 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + natural + + + + TermSpec + none + + MOD:00440 + MOD:00671 + PSI-MOD + + + MOD:00653 + S-palmitoylated residue + + A protein modification that effectively replaces a residue sulfanyl group with an palmitoylsulfanyl group. + + 18688235 + PubMed + + + PSI-MOD-slim + + SPamRes + PSI-MOD-label + + + + DiffAvg + 238.41 + + + + DiffFormula + C 16 H 30 O 1 S 0 + + + + DiffMono + 238.229666 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + natural + + + + TermSpec + none + + MOD:00440 + MOD:00672 + PSI-MOD + + + MOD:00654 + S-methylated residue + + a protein modification that effectively replaces a sulfanyl group with a methylsulfanyl group + + 18688235 + PubMed + + + PSI-MOD-slim + + SMeRes + PSI-MOD-label + + MOD:00427 + PSI-MOD + + + MOD:00655 + S-myristoylated residue + + A protein modification that effectively replaces a residue sulfanyl group with an myristoylsulfanyl group. + + 18688235 + PubMed + + + + SMyrRes + PSI-MOD-label + + + + DiffAvg + 210.36 + + + + DiffFormula + C 14 H 26 O 1 S 0 + + + + DiffMono + 210.198365 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + natural + + + + TermSpec + none + + MOD:00438 + MOD:00672 + PSI-MOD + + + MOD:00656 + C-methylated residue + + A protein modification that effectively replaces a residue hydrocarbyl hydrogen with an methyl group. + + 18688235 + PubMed + + + + CMeRes + PSI-MOD-label + + MOD:00427 + PSI-MOD + + + MOD:00657 + L-glutamic acid 5-methyl ester (Gln) + + A protein modification that effectively converts an L-glutamine residue to L-glutamate 5-methyl ester. + + 16888 + PubMed + + + 6300110 + PubMed + + + AA0072#GLN + RESID + + + 528 + UniMod + + + This is known to be a natural modification of glutamine in prokaryotes. + PSI-MOD-slim + + (2S)-2-amino-5-methoxy-5-oxopentanoic acid + RESID-systematic + + + (5)-methyl L-hydrogen glutamate + RESID-alternate + + + 2-aminopentanedioic acid 5-methyl ester + RESID-alternate + + + 5-methyl L-2-aminoglutarate + RESID-alternate + + + 5-methyl L-glutamate + RESID-alternate + + + deamidated 5-methyl esterified glutamine + PSI-MOD-alternate + + + Deamidation followed by a methylation + UniMod-description + + + glutamic acid 5-methyl ester + RESID-alternate + + + glutamic acid gamma-methyl ester + RESID-alternate + + + L-glutamic acid 5-methyl ester + RESID-name + + + Methyl+Deamidated + PSI-MS-label + + + MOD_RES Glutamate methyl ester (Gln) + UniProt-feature + + + O5MeGlu(Gln) + PSI-MOD-label + + + + DiffAvg + 15.01 + + + + DiffFormula + C 1 H 1 N -1 O 1 + + + + DiffMono + 14.999666 + + + + Formula + C 6 H 9 N 1 O 3 + + + + MassAvg + 143.14 + + + + MassMono + 143.058243 + + + + Origin + Q + + + + Source + natural + + + + TermSpec + none + + MOD:01369 + MOD:01453 + + has_functional_parent + MOD:006590 + + PSI-MOD + + + MOD:00658 + methylated arginine + + A protein modification that effectively converts an L-arginine residue to a methylated arginine, either 5-methylargine, N5-methylarginine, or an omega-N-methylated L-arginine. + + 18688235 + PubMed + + + PSI-MOD-slim + + MeArg + PSI-MOD-label + + + + Origin + R + + MOD:00427 + MOD:00902 + PSI-MOD + + + MOD:00659 + methylated glutamine + + A protein modification that effectively converts an L-glutamine residue to a methylated glutamine, either 2-methylated glutamine, N5-methylated glutamine, or methyl esterified deamidated glutamine. + + 18688235 + PubMed + + + PSI-MOD-slim + + MeGln + PSI-MOD-label + + + + Origin + Q + + + + Source + natural + + + + TermSpec + none + + MOD:00427 + MOD:00907 + PSI-MOD + + + MOD:00660 + methylated cysteine + + A protein modification that effectively converts an L-cysteine residue to a methylated cysteine, either S-methylcysteine, or cysteine methyl ester. + + 18688235 + PubMed + + + PSI-MOD-slim + + MeCys + PSI-MOD-label + + + + Origin + C + + + + Source + natural + + + + TermSpec + none + + MOD:00427 + MOD:00905 + PSI-MOD + + + MOD:00661 + methylated histidine + + A protein modification that effectively converts an L-histidine residue to a methylated histidine, such as pros-methylhistidine, or tele-methylhistidine. + + 18688235 + PubMed + + + PSI-MOD-slim + + MeHis + PSI-MOD-label + + + + Origin + H + + + + Source + natural + + + + TermSpec + none + + MOD:00427 + MOD:00909 + PSI-MOD + + + MOD:00662 + methylated leucine + + A protein modification that effectively converts an L-leucine residue to a methylated leucine, either N-methylleucine, or leucine methyl ester. + + 18688235 + PubMed + + + PSI-MOD-slim + + MeLeu + PSI-MOD-label + + + + Origin + L + + + + Source + natural + + + + TermSpec + none + + MOD:00427 + MOD:00911 + PSI-MOD + + + MOD:00663 + methylated lysine + + A protein modification that effectively converts an L-lysine residue to a methylated lysine. + + 18688235 + PubMed + + + PSI-MOD-slim + + MeLys + PSI-MOD-label + + + + Origin + K + + + + Source + natural + + + + TermSpec + none + + MOD:00427 + MOD:00912 + PSI-MOD + + + MOD:00664 + stereoisomerized residue + + A protein modification that effectively replaces a residue L-enantiomer (stereoisomer) with a D-enantiomer or with a different diastereomeric isomer. + + 18688235 + PubMed + + + + D-Res + PSI-MOD-label + + MOD:01156 + PSI-MOD + + + MOD:00665 + methylated alanine + + A protein modification that effectively converts an L-alanine residue to a methylated alanine, such as N-methylalanine, N,N-dimethylalanine, or N,N,N-trimethylalanine. + + 18688235 + PubMed + + + PSI-MOD-slim + + MeAla + PSI-MOD-label + + + + Origin + A + + + + Source + natural + + + + TermSpec + none + + MOD:00427 + MOD:00901 + PSI-MOD + + + MOD:00666 + octanoylated residue + + A protein modification that effectively replaces a hydrogen atom with an octanoyl group. + + 18688235 + PubMed + + + PSI-MOD-slim + + OctRes + PSI-MOD-label + + + + DiffAvg + 126.20 + + + + DiffFormula + C 8 H 14 N 0 O 1 + + + + DiffMono + 126.104465 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + natural + + + + TermSpec + none + + MOD:00649 + MOD:01155 + PSI-MOD + + + MOD:00667 + decanoylated residue + + A protein modification that effectively replaces a hydrogen atom with a decanoyl group. + + 18688235 + PubMed + + + + DecRes + PSI-MOD-label + + + + DiffAvg + 154.25 + + + + DiffFormula + C 10 H 18 N 0 O 1 + + + + DiffMono + 154.135765 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + natural + + + + TermSpec + none + + MOD:00649 + MOD:01155 + PSI-MOD + + + MOD:00668 + O-decanoylated residue + + A protein modification that effectively replaces a residue hydroxyl group with a decanoyloxy group. + + 449 + UniMod + + + + Decanoyl + PSI-MS-label + + + lipid + UniMod-description + + + ODecRes + PSI-MOD-label + + + + DiffAvg + 154.25 + + + + DiffFormula + C 10 H 18 N 0 O 1 + + + + DiffMono + 154.135765 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + natural + + + + TermSpec + none + + MOD:00667 + MOD:00671 + PSI-MOD + + + MOD:00669 + O-octanoylated residue + + A protein modification that effectively replaces a residue hydroxyl group with a octanoyloxy group. + + 426 + UniMod + + + PSI-MOD-slim + + Octanoyl + PSI-MS-label + + + octanoyl + UniMod-description + + + OOctRes + PSI-MOD-label + + + + DiffAvg + 126.20 + + + + DiffFormula + C 8 H 14 N 0 O 1 + + + + DiffMono + 126.104465 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + natural + + + + TermSpec + none + + MOD:00666 + MOD:00671 + PSI-MOD + + + MOD:00670 + N-acylated residue + + A protein modification that effectively replaces a residue alpha-amino- or alpha-imino-hydrogen with an acyl group. + + 18688235 + PubMed + + + PSI-MOD-slim + + NAcylRes + PSI-MOD-label + + MOD:00649 + PSI-MOD + + + MOD:00671 + O-acylated residue + + A protein modification that effectively replaces a residue hydroxyl group with a acyloxy group. + + 18688235 + PubMed + + + PSI-MOD-slim + + OAcylRes + PSI-MOD-label + + MOD:00649 + PSI-MOD + + + MOD:00672 + S-acylated residue + + A protein modification that effectively replaces a residue sulfanyl group with an acylsulfanyl group. + + 18688235 + PubMed + + + PSI-MOD-slim + + SAcylRes + PSI-MOD-label + + MOD:00649 + PSI-MOD + + + MOD:00673 + methylated asparagine + + A protein modification that effectively converts an L-asparagine residue to a methylated asparagine, such as N4-methyl-L-asparagine, or N4,N4-dimethyl-L-asparagine. + + 18688235 + PubMed + + + PSI-MOD-slim + + MeAsn + PSI-MOD-label + + + + Origin + N + + + + Source + natural + + + + TermSpec + none + + MOD:00427 + MOD:00903 + PSI-MOD + + + MOD:00674 + amidated residue + + A protein modification that effectively replaces a carboxyl group with a carboxamido group. + + 18688235 + PubMed + + + PSI-MOD-slim + + + DiffAvg + -0.98 + + + + DiffFormula + C 0 H 1 N 1 O -1 + + + + DiffMono + -0.984016 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + none + + + + TermSpec + none + + MOD:01156 + PSI-MOD + + + MOD:00675 + oxidized residue + + A protein modification that effectively either removes neutral hydrogen atoms (proton and electron), or adds oxygen atoms to a residue with or without the removal of hydrogen atoms. + + 18688235 + PubMed + + + PSI-MOD-slim + + OxRes + PSI-MOD-label + + + + Origin + X + + + + Source + none + + + + TermSpec + none + + MOD:01156 + PSI-MOD + + + MOD:00676 + oxygenated residue + + A protein modification that effectively adds oxygen atoms to a residue with or without the removal of hydrogen atoms. + + 18688235 + PubMed + + + PSI-MOD-slim + + OxyRes + PSI-MOD-label + + + + Origin + X + + + + Source + none + + + + TermSpec + none + + MOD:00675 + PSI-MOD + + + MOD:00677 + hydroxylated residue + + A protein modification that effectively replaces a hydrogen atom with an hydroxyl group. + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 16 + PSI-MOD-slim + + Hydroxylation (of delta C of Lysine, beta C of Tryptophan, C3 or C4 of Proline, beta C of Aspartate) + DeltaMass-label + + + HyRes + PSI-MOD-label + + + + Origin + X + + + + Source + none + + + + TermSpec + none + + MOD:00679 + PSI-MOD + + + MOD:00678 + hydroxylated proline + + A protein modification that effectively converts an L-proline residue to an hydroxylated L-proline. + + 18688235 + PubMed + + + PSI-MOD-slim + + HyPro + PSI-MOD-label + + + + Origin + P + + + + Source + none + + + + TermSpec + none + + MOD:00677 + MOD:00915 + PSI-MOD + + + MOD:00679 + carbon oxygenated residue + + A protein modification that effectively adds oxygen atoms to a carbon atom of a residue and removes hydrogen atoms. + + 18688235 + PubMed + + + PSI-MOD-slim + + COxyRes + PSI-MOD-label + + MOD:00676 + PSI-MOD + + + MOD:00680 + sulfur oxygenated residue + + A protein modification that effectively adds oxygen atoms to a sulfur atom of a residue without removing hydrogen atoms. + + 18688235 + PubMed + + + PSI-MOD-slim + + SOxyRes + PSI-MOD-label + + MOD:00676 + PSI-MOD + + + MOD:00681 + hydroxylated lysine + + A protein modification that effectively converts an L-lysine residue to a hydroxylated L-lysine. + + 18688235 + PubMed + + + PSI-MOD-slim + + HyLys + PSI-MOD-label + + + + Origin + K + + MOD:00677 + MOD:00912 + PSI-MOD + + + MOD:00682 + hydroxylated arginine + + A protein modification that effectively converts an L-arginine residue to a hydroxylated L-arginine. + + 18688235 + PubMed + + + + HyArg + PSI-MOD-label + + + + Origin + R + + MOD:00677 + MOD:00902 + PSI-MOD + + + MOD:00683 + dehydrogenated residue + + A protein modification that effectively removes neutral hydrogen atoms (proton and electron) from a residue. + + 18688235 + PubMed + + + PSI-MOD-slim + + dHRes + PSI-MOD-label + + + + Origin + X + + MOD:00675 + PSI-MOD + + + MOD:00684 + deamidated L-asparagine + + A protein modification that effectively converts an L-asparagine residue to L-aspartic acid. + + 1097438 + PubMed + + + 339692 + PubMed + + + 4399050 + PubMed + + + 5764436 + PubMed + + + 6692818 + PubMed + + + 8089117 + PubMed + + + 9521123 + PubMed + + + 9582379 + PubMed + + + AA0004#ASN + RESID + + + 7#N + UniMod + + + incidental to RESID:AA0059 + PSI-MOD-slim + + (2S)-2-aminobutanedioic acid + RESID-systematic + + + 2-azanylbutanedioic acid + RESID-alternate + + + aminosuccinic acid + RESID-alternate + + + dNAsn + PSI-MOD-label + + + L-aspartic acid + RESID-name + + + MOD_RES Deamidated asparagine + UniProt-feature + + + + DiffAvg + 0.98 + + + + DiffFormula + C 0 H -1 N -1 O 1 + + + + DiffMono + 0.984016 + + + + Formula + C 4 H 5 N 1 O 3 + + + + MassAvg + 115.09 + + + + MassMono + 115.026943 + + + + Origin + N + + + + Source + natural + + + + TermSpec + none + + MOD:00013 + MOD:00400 + MOD:00903 + PSI-MOD + + + MOD:00685 + deamidated L-glutamine + + A protein modification that effectively converts an L-glutamine residue to L-glutamic acid. + + 1881881 + PubMed + + + 4565668 + PubMed + + + 4922541 + PubMed + + + 6692818 + PubMed + + + 9192900 + PubMed + + + 957425 + PubMed + + + AA0006#GLN + RESID + + + 7#Q + UniMod + + + PSI-MOD-slim + + (2S)-2-aminopentanedioic acid + RESID-systematic + + + 1-aminopropane-1,3-dicarboxylic acid + RESID-alternate + + + 2-aminoglutaric acid + RESID-alternate + + + 2-azanylpentanedioic acid + RESID-alternate + + + alpha-aminoglutaric acid + RESID-alternate + + + dNGln + PSI-MOD-label + + + glutaminic acid + RESID-alternate + + + L-glutamic acid + RESID-name + + + MOD_RES Deamidated glutamine + UniProt-feature + + + + DiffAvg + 0.98 + + + + DiffFormula + C 0 H -1 N -1 O 1 + + + + DiffMono + 0.984016 + + + + Formula + C 5 H 7 N 1 O 3 + + + + MassAvg + 129.12 + + + + MassMono + 129.042593 + + + + Origin + Q + + + + Source + natural + + + + TermSpec + none + + MOD:00015 + MOD:00400 + PSI-MOD + + + MOD:00686 + L-selenocysteine (Cys) + + A protein modification that effectively converts an L-cysteine residue to L-selenocysteine (not known as a natural, post-translational modification process). + + 10523135 + PubMed + + + 2037562 + PubMed + + + 2963330 + PubMed + + + 6217842 + PubMed + + + 6714945 + PubMed + + + AA0022#CYS + RESID + + + 162#C + UniMod + + + This entry is for the artifactual formation of L-selenocysteine from cysteine. For encoded L-selenocysteine, use MOD:00031 [JSG]. + + (2R)-2-amino-3-selanylpropanoic acid + RESID-systematic + + + 2-azanyl-3-selanylpropanoic acid + RESID-alternate + + + 3-selenylalanine + RESID-alternate + + + L-selenocysteine + RESID-name + + + NON_STD Selenocysteine + UniProt-feature + + + Sec(Cys) + PSI-MOD-label + + + SeCys + RESID-alternate + + + selenium cysteine + RESID-alternate + + + + DiffAvg + 46.91 + + + + DiffFormula + C 0 H 0 N 0 O 0 S -1 Se 1 + + + + DiffMono + 47.944450 + + + + Formula + C 3 H 5 N 1 O 1 Se 1 + + + + MassAvg + 150.05 + + + + MassMono + 150.953635 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:00007 + MOD:00031 + MOD:00905 + PSI-MOD + + + MOD:00687 + thioether crosslinked residues + + A protein modification that crosslinks two residues by formation of a thioether bond between a cysteine thiol and either an alkyl C as in lanthionine, or an aryl C as 2'-(S-cysteinyl)-L-histidine. + + 18688235 + PubMed + + + MOD:00033 + MOD:00905 + PSI-MOD + + + MOD:00688 + isopeptide crosslinked residues + + A protein modification that crosslinks two residues with an amide bond where either the donor amino or carboxyl is not an alpha group. + + 18688235 + PubMed + + + PSI-MOD-slim + MOD:00033 + PSI-MOD + + + MOD:00689 + disulfide crosslinked residues + + A protein modification that crosslinks two cysteine residues by formation of a disulfide bond. + + 18688235 + PubMed + + + PSI-MOD-slim + MOD:01619 + PSI-MOD + + + MOD:00690 + oxazole/thiazole ring crosslinked residues + + A protein modification that crosslinks two residues by formation of an oxazole or thiazole ring. + + 18688235 + PubMed + + + MOD:00033 + PSI-MOD + + + MOD:00691 + 5-imidazolinone ring crosslinked residues + + A protein modification that crosslinks two residues by formation of an 5-imidazolinone ring. + + 18688235 + PubMed + + + MOD:00033 + PSI-MOD + + + MOD:00692 + uncategorized crosslinked residues + + A protein crosslink modification that is not chemically categorized. + + 18688235 + PubMed + + + PSI-MOD-slim + MOD:00033 + PSI-MOD + + + MOD:00693 + glycosylated residue + + A protein modification that effectively replaces a hydrogen atom with an carbohydrate-like group through a glycosidic bond. + + 18688235 + PubMed + + + PSI-MOD-slim + + GlycoRes + PSI-MOD-label + + + + Source + natural + + MOD:00764 + PSI-MOD + + + MOD:00694 + halogen containing residue + + A protein modification that effectively substitutes a halogen atom for a hydrogen atom. + + 18688235 + PubMed + + + PSI-MOD-slim + + halogenated residue + PSI-MOD-alternate + + + HalRes + PSI-MOD-label + + MOD:01156 + PSI-MOD + + + MOD:00695 + sulfated residue + + A protein modification that effectively substitutes a sulfonyl group for the hydrogen atom of a hydroxyl or sulfanyl group. + + 0 + DeltaMass + + + 14752058 + PubMed + + + 40 + UniMod + + + From DeltaMass: Average Mass: 80. + PSI-MOD-slim + + O-Sulfonation + UniMod-description + + + Sulfo + PSI-MS-label + + + SulfRes + PSI-MOD-label + + + Sulphonation (SO3H) (of PMC group) + DeltaMass-label + + + + DiffAvg + 80.06 + + + + DiffFormula + O 3 S 1 + + + + DiffMono + 79.956815 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + natural + + + + TermSpec + none + + MOD:00860 + PSI-MOD + + + MOD:00696 + phosphorylated residue + + A protein modification that effectively replaces a hydrogen atom with a phosphono group (H2PO3 or 'phosphate'). + + 0 + DeltaMass + + + 21 + UniMod + + + From DeltaMass: Average Mass: 80. + PSI-MOD-slim + + Phospho + PSI-MS-label + + + Phosphorylation + UniMod-description + + + Phosphorylation (O of Serine, Threonine, Tyrosine and Aspartate, N epsilon of Lysine) + DeltaMass-label + + + PhosRes + PSI-MOD-label + + + + DiffAvg + 79.98 + + + + DiffFormula + H 1 O 3 P 1 + + + + DiffMono + 79.966331 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + none + + + + TermSpec + none + + MOD:00861 + PSI-MOD + + + MOD:00697 + flavin modified residue + + A protein modification that effectively results from forming an adduct with a compound containing a flavin group. + + 50 + UniMod + + + PSI-MOD-slim + + FAD + PSI-MS-label + + + Flavin adenine dinucleotide + UniMod-description + + + FlavRes + PSI-MOD-label + + + + DiffAvg + 783.54 + + + + DiffFormula + C 27 H 31 N 9 O 15 P 2 S 0 + + + + DiffMono + 783.141485 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + natural + + + + TermSpec + none + + MOD:01156 + PSI-MOD + + + MOD:00698 + metal or metal cluster containing modified residue + + A protein modification that effectively substitutes a metal atom or a metal cluster for hydrogen atoms, or coordinates a metal ion. + + 18688235 + PubMed + + + PSI-MOD-slim + + MetalRes + PSI-MOD-label + + MOD:01156 + PSI-MOD + + + MOD:00699 + porphyrin modified residue + + A protein modification that effectively results from forming an adduct with a compound containing a porphyrin group. + + 18688235 + PubMed + + + PSI-MOD-slim + + PorphRes + PSI-MOD-label + + MOD:01156 + PSI-MOD + + + MOD:00700 + tetrapyrrole modified residue + + A protein modification that effectively results from forming an adduct with a compound containing a tetrapyrrole group. + + 18688235 + PubMed + + + + TetrapyrRes + PSI-MOD-label + + MOD:01156 + PSI-MOD + + + MOD:00701 + nucleotide or nucleic acid modified residue + + A protein modification that effectively results from forming an adduct with a compound containing a nucleotide or a polynucleotide through formation of either a phosphodiester bond, a phosphoramide ester bond, or a glycosidic bond. + + 18688235 + PubMed + + + PSI-MOD-slim + + NucRes + PSI-MOD-label + + MOD:01156 + PSI-MOD + + + MOD:00702 + isotope labeled residue + + A protein modification that effectively substitutes atoms of particular common isotopes with atoms or groups containing isotopes that are not the most common. + + 18688235 + PubMed + + + In SILAC (stable isotope labelling of amino acids in cell culture), the label may be introduced either through labeling of an incorporated residue or labeling of the substrates in a metabolic modification. For isotope labeling introduced through a modification reagent see MOD:01426. + PSI-MOD-slim + + IsoTagRes + PSI-MOD-label + + + SILAC + PSI-MOD-alternate + + MOD:01156 + PSI-MOD + + + MOD:00703 + isoprenylated residue + + A protein modification that effectively replaces a hydrogen atom with a group derived from an isoprene polymer, such as a geranyl (C10), farnesyl (C15) or geranylgeranyl (C20) group. + + 18688235 + PubMed + + + PSI-MOD-slim + + IpRes + PSI-MOD-label + + MOD:00001 + MOD:01155 + PSI-MOD + + + MOD:00704 + dehydrated residue + + A protein modification that effectively forms a double bond by removing a molecule of water from a residue. + + 0 + DeltaMass + + + 23 + UniMod + + + PSI-MOD-slim + + Dehydrated + UniMod-interim + + + Dehydration + UniMod-description + + + + DiffAvg + -18.02 + + + + DiffFormula + C 0 H -2 N 0 O -1 + + + + DiffMono + -18.010565 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + natural + + + + TermSpec + none + + MOD:01156 + PSI-MOD + + + MOD:00705 + D-valine + + A protein modification that effectively converts an L-valine residue to D-valine. + + 30016 + ChEBI + + + 15853325 + PubMed + + + AA0200 + RESID + + + + (R)-2-amino-3-methylbutanoic acid + RESID-systematic + + + alpha-amino-beta-methylbutyric acid + RESID-alternate + + + alpha-aminoisovaleric acid + RESID-alternate + + + D-Val + PSI-MOD-label + + + D-valine + RESID-name + + + MOD_RES D-valine + UniProt-feature + + + + DiffAvg + 0.00 + + + + DiffFormula + C 0 H 0 N 0 O 0 + + + + DiffMono + 0.000000 + + + + Formula + C 5 H 9 N 1 O 1 + + + + MassAvg + 99.13 + + + + MassMono + 99.068414 + + + + Origin + V + + + + Source + natural + + + + TermSpec + none + + MOD:00664 + PSI-MOD + + + MOD:00706 + dehydrogenated tyrosine + + A protein modification that effectively converts L-tyrosine to 2,3-didehydrotyrosine. + + 401#Y + UniMod + + + PSI-MOD-slim + + dHTyr + PSI-MOD-label + + + + DiffAvg + -2.02 + + + + DiffFormula + C 0 H -2 N 0 O 0 + + + + DiffMono + -2.015650 + + + + Formula + C 9 H 7 N 1 O 2 + + + + MassAvg + 161.16 + + + + MassMono + 161.047678 + + + + Origin + Y + + + + Source + natural + + + + TermSpec + none + + MOD:00919 + MOD:01888 + PSI-MOD + + + MOD:00707 + hydroxylated tyrosine + + a protein modification that effectively converts an L-tyrosine residue to a multihydroxylated L-phenylalanine + + 18688235 + PubMed + + + PSI-MOD-slim + + HyTyr + PSI-MOD-label + + + + Origin + Y + + + + Source + natural + + + + TermSpec + none + + MOD:00677 + MOD:00919 + PSI-MOD + + + MOD:00708 + sulfur oxygenated L-cysteine + + A protein modification that effectively adds oxygen atoms to a sulfur atom of L-cysteine residue without removing hydrogen atoms. + + 18688235 + PubMed + + + PSI-MOD-slim + + SOxyCys + PSI-MOD-label + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:00680 + MOD:00905 + PSI-MOD + + + MOD:00709 + sulfur oxygenated L-methionine + + A protein modification that effectively adds oxygen atoms to a sulfur atom of L-methionine residue without removing hydrogen atoms. + + 18688235 + PubMed + + + PSI-MOD-slim + + SOxyMet + PSI-MOD-label + + + + Origin + M + + + + Source + artifact + + + + TermSpec + none + + MOD:00680 + MOD:00913 + PSI-MOD + + + MOD:00710 + protonated-dimethylated residue + + A protein modification that effectively adds a proton and replaces two hydrogen atoms with two methyl groups. + + 18688235 + PubMed + + + For N-terminal proline residues, dimethylation can effectively only be accomplished with a protonated imino group. This process accounts for both protonation and dimethylation. The alternative Me2Res process accounts only for dimethylation and not protonation. + PSI-MOD-slim + + Me2+Res + PSI-MOD-label + + MOD:00429 + PSI-MOD + + + MOD:00711 + trimethylated protonated-residue + + A protein modification that effectively replaces three hydrogen atoms with three methyl groups, after a proton has been added to form an aminium group. + + 18688235 + PubMed + + + For amino acids residues, amine trimethylation can effectively only be accomplished with a protonated primary amino group. This process accounts for both protonation and trimethylation. The alternative Me3Res process accounts only for trimethylation and not protonation. + PSI-MOD-slim + + Me3+Res + PSI-MOD-label + + + + DiffAvg + 43.09 + + + + DiffFormula + C 3 H 7 N 0 O 0 S 0 + + + + DiffMono + 43.054227 + + + + FormalCharge + 1+ + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + natural + + + + TermSpec + N-term + + MOD:00430 + PSI-MOD + + + MOD:00712 + methylated proline + + A protein modification that effectively converts an L-proline residue to a methylated proline, such as N,N-dimethylproline. + + 18688235 + PubMed + + + PSI-MOD-slim + + MePro + PSI-MOD-label + + + + Origin + P + + + + Source + natural + + + + TermSpec + none + + MOD:00427 + MOD:00915 + PSI-MOD + + + MOD:00713 + methylated glutamic acid + + A protein modification that effectively converts an L-glutamic acid residue to a methylated glutamic acid, such as L-glutamate 5-methyl ester. + + 18688235 + PubMed + + + PSI-MOD-slim + + MeGlu + PSI-MOD-label + + + + Origin + X + + + + Source + natural + + + + TermSpec + none + + MOD:00427 + MOD:00906 + PSI-MOD + + + MOD:00714 + methylated glycine + + A protein modification that effectively converts a glycine residue to a methylated glycine, such as N-methylglycine. + + 18688235 + PubMed + + + + MeGly + PSI-MOD-label + + + + Origin + G + + + + Source + natural + + + + TermSpec + none + + MOD:00427 + MOD:00908 + PSI-MOD + + + MOD:00715 + methylated isoleucine + + A protein modification that effectively converts an L-isoleucine residue to a methylated isoleucine residue, such as N-methyl-L-isoleucine. + + 18688235 + PubMed + + + + MeIle + PSI-MOD-label + + + + Origin + I + + + + Source + natural + + + + TermSpec + none + + MOD:00427 + MOD:00910 + PSI-MOD + + + MOD:00716 + methylated methionine + + A protein modification that effectively converts an L-methionine residue to a methylated methionine, such as N-methyl-L-methionine. + + 18688235 + PubMed + + + PSI-MOD-slim + + MeMet + PSI-MOD-label + + + + Origin + M + + + + Source + natural + + + + TermSpec + N-term + + MOD:00427 + MOD:00913 + PSI-MOD + + + MOD:00717 + methylated phenylalanine + + A protein modification that effectively converts an L-phenylalanine residue to a methylated phenylalanine, such as N-methyl-L-phenylalanine. + + 18688235 + PubMed + + + PSI-MOD-slim + + MePhe + PSI-MOD-label + + + + Origin + F + + + + Source + natural + + + + TermSpec + none + + MOD:00427 + MOD:00914 + PSI-MOD + + + MOD:00718 + methylated tyrosine + + A protein modification that effectively converts an L-tyrosine residue to a methylated tyrosine, such as N-methyl-L-tyrosine. + + 18688235 + PubMed + + + + MeTyr + PSI-MOD-label + + + + Origin + Y + + + + Source + natural + + + + TermSpec + N-term + + MOD:00427 + MOD:00919 + PSI-MOD + + + MOD:00719 + L-methionine sulfoxide + + A protein modification that oxygenates an L-methionine residue to one of the diastereomeric L-methionine sulfoxide residues. + + 177 + DeltaMass + + + 21406390 + PubMed + + + 22116028 + PubMed + + + AA0581 + RESID + + + 35#M + UniMod + + + From DeltaMass: Average Mass: 147 Formula:C5H9O1N2S Monoisotopic Mass Change:147.035 Average Mass Change:147.195 (formula incorrect, N and O reversed) References:PE Sciex. + PSI-MOD-slim + + (2S)-2-amino-4-[(R)-methylsulfinyl]butanoic acid + RESID-systematic + + + L-methionine (R)-S-oxide + RESID-alternate + + + L-methionine (R)-sulfoxide + RESID-name + + + L-methionine S-oxide + PSI-MOD-alternate + + + L-methionine sulfoxide + PSI-MOD-alternate + + + Methionyl Sulfoxide + DeltaMass-label + + + MetO + PSI-MOD-label + + + MOD_RES Methionine (R)-sulfoxide + UniProt-feature + + + Oxidation + PSI-MS-label + + + oxym + OMSSA-label + + + + DiffAvg + 16.00 + + + + DiffFormula + C 0 H 0 N 0 O 1 S 0 + + + + DiffMono + 15.994915 + + + + Formula + C 5 H 9 N 1 O 2 S 1 + + + + MassAvg + 147.19 + + + + MassMono + 147.035400 + + + + Origin + M + + + + Source + artifact + + + + TermSpec + none + + MOD:00709 + MOD:01854 + PSI-MOD + + + MOD:00720 + L-methionine (R)-sulfoxide + + A protein modification that effectively oxygenates an L-methionine residue to L-methionine sulfoxide R-diastereomer. + + 45764 + ChEBI + + + 21406390 + PubMed + + + 22116028 + PubMed + + + 23911929 + PubMed + + + AA0581 + RESID + + + + (2S)-2-amino-4-[(R)-methylsulfinyl]butanoic acid + RESID-systematic + + + L-methionine (R)-S-oxide + RESID-alternate + + + L-methionine (R)-sulfoxide + RESID-name + + + MOD_RES Methionine (R)-sulfoxide + UniProt-feature + + + R-MetO + PSI-MOD-label + + + + DiffAvg + 16.00 + + + + DiffFormula + C 0 H 0 N 0 O 1 S 0 + + + + DiffMono + 15.994915 + + + + Formula + C 5 H 9 N 1 O 2 S 1 + + + + MassAvg + 147.19 + + + + MassMono + 147.035400 + + + + Origin + M + + + + Source + natural + + + + TermSpec + none + + MOD:00719 + PSI-MOD + + + MOD:00721 + L-methionine (S)-sulfoxide + + A protein modification that effectively oxygenates an L-methionine residue to L-methionine sulfoxide S-diastereomer. + + 18688235 + PubMed + + + + S-MetO + PSI-MOD-label + + + + DiffAvg + 16.00 + + + + DiffFormula + C 0 H 0 N 0 O 1 S 0 + + + + DiffMono + 15.994915 + + + + Formula + C 5 H 9 N 1 O 2 S 1 + + + + MassAvg + 147.19 + + + + MassMono + 147.035400 + + + + Origin + M + + + + Source + artifact + + + + TermSpec + none + + MOD:00719 + PSI-MOD + + + MOD:00722 + monomethylated L-glutamine + + A protein modification that effectively replaces one hydrogen atom of an L-glutamine residue with one methyl group. + + 34#Q + UniMod + + + PSI-MOD-slim + + Me1Gln + PSI-MOD-label + + + methylq + OMSSA-label + + + + DiffAvg + 14.03 + + + + DiffFormula + C 1 H 2 N 0 O 0 + + + + DiffMono + 14.015650 + + + + Formula + C 6 H 10 N 2 O 2 + + + + MassAvg + 142.16 + + + + MassMono + 142.074228 + + + + Origin + Q + + + + Source + natural + + + + TermSpec + none + + MOD:00599 + MOD:00659 + PSI-MOD + + + MOD:00723 + N-acetylated L-lysine + + A protein modification that effectively converts an L-lysine residue to either N2-acetyl-L-lysine, or N6-acetyl-L-lysine. + + 18688235 + PubMed + + + PSI-MOD-slim + + NAcLys + PSI-MOD-label + + + + DiffAvg + 42.04 + + + + DiffFormula + C 2 H 2 N 0 O 1 + + + + DiffMono + 42.010565 + + + + Formula + C 8 H 15 N 2 O 2 + + + + MassAvg + 171.22 + + + + MassMono + 171.113353 + + + + Origin + K + + + + Source + natural + + + + TermSpec + none + + MOD:00408 + MOD:00912 + PSI-MOD + + + MOD:00724 + N-methylated L-histidine + + A protein modification that effectively replaces one hydrogen atom on a nitrogen of an L-histidine residue with one methyl group. + + 34#H + UniMod + + + PSI-MOD-slim + + Methyl + PSI-MS-label + + + methylh + OMSSA-label + + + NMeHis + PSI-MOD-label + + + + DiffAvg + 14.03 + + + + DiffFormula + C 1 H 2 N 0 O 0 + + + + DiffMono + 14.015650 + + + + Formula + C 7 H 9 N 3 O 1 + + + + MassAvg + 151.17 + + + + MassMono + 151.074562 + + + + Origin + H + + + + Source + natural + + + + TermSpec + none + + MOD:00599 + MOD:00602 + MOD:00661 + PSI-MOD + + + MOD:00725 + complex glycosylation + + A protein modification that effectively replaces a hydrogen atom of an amino acid residue or of a modifying group with a carbohydrate-like group linked through a glycosidic bond. + + 18688235 + PubMed + + + MOD:00693 + PSI-MOD + + + MOD:00726 + glucosylated + + A protein modification that effectively replaces a hydrogen atom of an amino acid residue or of a modifying group with a glucose group through a glycosidic bond. + + 18688235 + PubMed + + + + Glc + PSI-MOD-label + + + + DiffAvg + 162.14 + + + + DiffFormula + C 6 H 10 O 5 + + + + DiffMono + 162.052823 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + natural + + + + TermSpec + none + + MOD:00693 + PSI-MOD + + + MOD:00727 + mannosylated + + A protein modification that effectively replaces a hydrogen atom of an amino acid residue or of a modifying group with a mannose group through a glycosidic bond, + + 18688235 + PubMed + + + + Man + PSI-MOD-label + + + + DiffAvg + 162.14 + + + + DiffFormula + C 6 H 10 O 5 + + + + DiffMono + 162.052823 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + natural + + + + TermSpec + none + + MOD:00693 + PSI-MOD + + + MOD:00728 + galactosylated + + A protein modification that effectively replaces a hydrogen atom of an amino acid residue or of a modifying group with a galactose group through a glycosidic bond. + + 18688235 + PubMed + + + + Gal + PSI-MOD-label + + + + DiffAvg + 162.14 + + + + DiffFormula + C 6 H 10 O 5 + + + + DiffMono + 162.052823 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + natural + + + + TermSpec + none + + MOD:00693 + PSI-MOD + + + MOD:00729 + pentosylated residue + + a protein modification that effectively replaces a hydrogen atom of an amino acid residue or of a modifying group with a pentose sugar group through a glycosidic bond + + 172 + DeltaMass + + + for Pentoses DeltaMass gives mass 132, for Pentosyl DeltaMass gives formula C 6 H 10 N4 with mass 146 + + Pent + PSI-MOD-label + + + Pentoses (Ara, Rib, Xyl) + DeltaMass-label + + + Pentosyl + DeltaMass-label + + + + DiffAvg + 132.12 + + + + DiffFormula + C 5 H 8 O 4 + + + + DiffMono + 132.042259 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + natural + + + + TermSpec + none + + MOD:00693 + PSI-MOD + + + MOD:00730 + arabinosylated + + a protein modification that effectively replaces a hydrogen atom of an amino acid residue or of a modifying group with a arabinose sugar group through a glycosidic bond + + 18688235 + PubMed + + + + Ara + PSI-MOD-label + + + + DiffAvg + 132.12 + + + + DiffFormula + C 5 H 8 O 4 + + + + DiffMono + 132.042259 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + natural + + + + TermSpec + none + + MOD:00729 + PSI-MOD + + + MOD:00731 + ribosylated + + a protein modification that effectively replaces a hydrogen atom of an amino acid residue or of a modifying group with a ribose sugar group through a glycosidic bond + + 18688235 + PubMed + + + + Rib + PSI-MOD-label + + + + DiffAvg + 132.12 + + + + DiffFormula + C 5 H 8 O 4 + + + + DiffMono + 132.042259 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + natural + + + + TermSpec + none + + MOD:00729 + PSI-MOD + + + MOD:00732 + xylosylated + + a protein modification that effectively replaces a hydrogen atom of an amino acid residue or of a modifying group with a xylose sugar group through a glycosidic bond + + 18688235 + PubMed + + + + Xyl + PSI-MOD-label + + + + DiffAvg + 132.12 + + + + DiffFormula + C 5 H 8 O 4 + + + + DiffMono + 132.042259 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + natural + + + + TermSpec + none + + MOD:00729 + PSI-MOD + + + MOD:00733 + N-acetylaminoglucosylated + + A protein modification that effectively replaces a hydrogen atom of an amino acid residue or of a modifying group with an N-acetylglucosamine group through a glycosidic bond. + + 18688235 + PubMed + + + + GlcNAc + PSI-MOD-label + + + + DiffAvg + 203.19 + + + + DiffFormula + C 8 H 13 N 1 O 5 + + + + DiffMono + 203.079373 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + none + + + + TermSpec + none + + MOD:00436 + PSI-MOD + + + MOD:00734 + N-acetylaminogalactosylated + + A protein modification that effectively replaces a hydrogen atom of an amino acid residue or of a modifying group with an N-acetylgalactosamine group through a glycosidic bond. + + 247 + DeltaMass + + + From DeltaMass: Average Mass: 203 Formula:C8H13O5N1 Monoisotopic Mass Change:203.079 Average Mass Change:203.196 References:PE Sciex + + GalNAc + PSI-MOD-label + + + N-acetylhexosamines (GalNAc, GlcNAc) + DeltaMass-label + + + + DiffAvg + 203.19 + + + + DiffFormula + C 8 H 13 N 1 O 5 + + + + DiffMono + 203.079373 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + none + + + + TermSpec + none + + MOD:00436 + PSI-MOD + + + MOD:00735 + hexosuronylated + + A protein modification that effectively replaces a hydrogen atom of an amino acid residue or of a modifying group with a hexosuronic acid group through a glycosidic bond. + + 18688235 + PubMed + + + + HexA + PSI-MOD-label + + + + DiffAvg + 176.12 + + + + DiffFormula + C 6 H 8 O 6 + + + + DiffMono + 176.032088 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + natural + + + + TermSpec + none + + MOD:00693 + PSI-MOD + + + MOD:00736 + deoxyhexosylated + + a protein modification that effectively replaces a hydrogen atom of an amino acid residue or of a modifying group with a deoxyhexose group through a glycosidic bond + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 146 + PSI-MOD-slim + + Deoxyhexoses (Fuc, Rha) + DeltaMass-label + + + dHex + PSI-MOD-label + + + + DiffAvg + 146.14 + + + + DiffFormula + C 6 H 10 O 4 + + + + DiffMono + 146.057909 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + natural + + + + TermSpec + none + + MOD:00693 + PSI-MOD + + + MOD:00737 + N-acetylneuraminylated + + A protein modification that effectively replaces a hydrogen atom of an amino acid residue or of a modifying group with an N-acetylneuraminic acid (sialic acid) group through a glycosidic bond. + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 291 + + N-acetylneuraminic acid (Sialic acid, NeuAc, NANA, SA) + DeltaMass-label + + + NeuNAc + PSI-MOD-label + + + + DiffAvg + 291.26 + + + + DiffFormula + C 11 H 17 N 1 O 8 + + + + DiffMono + 291.095417 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + natural + + + + TermSpec + none + + MOD:00693 + PSI-MOD + + + MOD:00738 + iron containing modified residue + + A protein modification that effectively substitutes an iron atom or a cluster containing iron for hydrogen atoms, or that coordinates an iron ion. + + 18688235 + PubMed + + + + FeRes + PSI-MOD-label + + MOD:00698 + PSI-MOD + + + MOD:00739 + iron-sulfur cluster containing modification + + A protein modification that effectively substitutes a cluster of iron and sulfur atoms for hydrogen atoms. + + 18688235 + PubMed + + + + FeSRes + PSI-MOD-label + + MOD:00738 + MOD:00860 + PSI-MOD + + + MOD:00740 + manganese containing modified residue + + A protein modification that effectively substitutes a manganese atom or a cluster containing manganese for hydrogen atoms, or that coordinates a manganese ion. + + 18688235 + PubMed + + + + MnRes + PSI-MOD-label + + MOD:00698 + PSI-MOD + + + MOD:00741 + nickel containing modified residue + + A protein modification that effectively substitutes a nickel atom or a cluster containing nickel for hydrogen atoms, or that coordinates a nickel ion. + + 18688235 + PubMed + + + + NiRes + PSI-MOD-label + + MOD:00698 + PSI-MOD + + + MOD:00742 + copper containing modified residue + + A protein modification that effectively substitutes a copper atom or a cluster containing copper for hydrogen atoms, or that coordinates a copper ion. + + 18688235 + PubMed + + + + CuRes + PSI-MOD-label + + MOD:00698 + PSI-MOD + + + MOD:00743 + molybdenum containing modified residue + + A protein modification that effectively substitutes a molybdenum atom or a cluster containing molybdenum for hydrogen atoms, or that coordinates a molybdenum ion. + + 18688235 + PubMed + + + PSI-MOD-slim + + MoRes + PSI-MOD-label + + MOD:00698 + PSI-MOD + + + MOD:00744 + molybdenum pterin containing modification + + A protein modification containing a molybdenum atom in a pterin ring system. + + 18688235 + PubMed + + + PSI-MOD-slim + + MoPterRes + PSI-MOD-label + + MOD:00743 + MOD:00748 + PSI-MOD + + + MOD:00745 + selenium containing residue + + A protein modification that effectively substitutes a selenium atom or a cluster containing selenium for hydrogen atoms. + + 18688235 + PubMed + + + PSI-MOD-slim + + SeRes + PSI-MOD-label + + MOD:01156 + PSI-MOD + + + MOD:00746 + tungsten containing modified residue + + A protein modification that effectively substitutes a tungsten atom or a cluster containing tungsten for hydrogen atoms, or that coordinates a tungsten ion. + + 18688235 + PubMed + + + + WRes + PSI-MOD-label + + MOD:00698 + PSI-MOD + + + MOD:00747 + sodium containing modified residue + + A protein modification that effectively substitutes a sodium atom for a hydrogen atom. + + 18688235 + PubMed + + + PSI-MOD-slim + + NaRes + PSI-MOD-label + + MOD:00698 + PSI-MOD + + + MOD:00748 + pterin modified residue + + A protein modification that effectively results from forming an adduct with a compound containing a pterin group. + + 18688235 + PubMed + + + PSI-MOD-slim + + PterRes + PSI-MOD-label + + MOD:01156 + PSI-MOD + + + MOD:00749 + sulfur substitution for oxygen + + A protein modification that effectively substitutes a sulfur atom for an oxygen atom. + + 18688235 + PubMed + + + PSI-MOD-slim + + S(O)Res + PSI-MOD-label + + MOD:00860 + PSI-MOD + + + MOD:00750 + deoxyribonucleic acid linked residue + + A protein modification that effectively crosslinks an amino acid residue and the 3'- or 5'-end of DNA through a phosphodiester bond. + + 18688235 + PubMed + + + + DNARes + PSI-MOD-label + + MOD:00701 + PSI-MOD + + + MOD:00751 + ribonucleic acid linked residue + + a protein modification + + 18688235 + PubMed + + + + RNARes + PSI-MOD-label + + MOD:00701 + PSI-MOD + + + MOD:00752 + adenosine diphosphoribosyl (ADP-ribosyl) modified residue + + A protein modification that effectively results from forming an adduct with ADP-ribose through formation of a glycosidic bond. + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 541. + PSI-MOD-slim + + ADP-rybosylation (from NAD) + DeltaMass-label + + + ADPRibRes + PSI-MOD-label + + + + DiffAvg + 541.30 + + + + DiffFormula + C 15 H 21 N 5 O 13 P 2 + + + + DiffMono + 541.061109 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + natural + + + + TermSpec + none + + MOD:00701 + PSI-MOD + + + MOD:00753 + chlorinated residue + + A protein modification that effectively substitutes a chlorine atom for a hydrogen atom. + + 18688235 + PubMed + + + + ClRes + PSI-MOD-label + + + + Origin + X + + + + Source + none + + + + TermSpec + none + + MOD:00694 + PSI-MOD + + + MOD:00754 + brominated residue + + A protein modification that effectively substitutes a bromine atom for a hydrogen atom. + + 18688235 + PubMed + + + + BrRes + PSI-MOD-label + + + + Origin + X + + + + Source + none + + + + TermSpec + none + + MOD:00694 + PSI-MOD + + + MOD:00755 + iodinated residue + + A protein modification that effectively substitutes an iodine atom of a residue for a hydrogen atom. + + 18688235 + PubMed + + + PSI-MOD-slim + + IRes + PSI-MOD-label + + + + Origin + X + + + + Source + none + + + + TermSpec + none + + MOD:00694 + PSI-MOD + + + MOD:00756 + 4-hydroxy-D-valine + + A protein modification that effectively converts an L-valine residue to 4-hydroxy-D-valine. + + 15853325 + PubMed + + + AA0388 + RESID + + + + (2R,3Xi)-2-amino-4-hydroxy-3-methylbutanoic acid + RESID-systematic + + + 4-hydroxy-D-valine + RESID-name + + + D-4HyVal + PSI-MOD-label + + + D-gamma-hydroxyvaline + RESID-alternate + + + MOD_RES D-4-hydroxyvaline + UniProt-feature + + + + DiffAvg + 16.00 + + + + DiffFormula + C 0 H 0 N 0 O 1 + + + + DiffMono + 15.994915 + + + + Formula + C 5 H 9 N 1 O 2 + + + + MassAvg + 115.13 + + + + MassMono + 115.063329 + + + + Origin + V + + + + Source + natural + + + + TermSpec + none + + MOD:00425 + MOD:00664 + PSI-MOD + + + MOD:00757 + O4-galactosyl-L-hydroxyproline + + A protein modification that effectively converts an L-proline residue to O4-galactosyl-L-hydroxyproline. + + AA0389 + RESID + + + secondary to RESID:AA0030 + + (2S,4R)-4-(beta-D-galactopyranosyloxy)pyrrolidine-2-carboxylic acid + RESID-systematic + + + 4-(beta-D-galactopyranosyloxy)proline + RESID-alternate + + + 4-(galactosyloxy)proline + RESID-alternate + + + beta-galactopyranosyl-4-hydroxyproline + RESID-alternate + + + O4-galactosyl-L-hydroxyproline + RESID-name + + + O4-glycosyl-hydroxyproline + RESID-alternate + + + + DiffAvg + 178.14 + + + + DiffFormula + C 6 H 10 N 0 O 6 + + + + DiffMono + 178.047738 + + + + Formula + C 11 H 17 N 1 O 7 + + + + MassAvg + 275.26 + + + + MassMono + 275.100502 + + + + Origin + P + + + + Source + natural + + + + TermSpec + none + + MOD:00915 + PSI-MOD + + + MOD:00758 + O4-(N-acetylamino)glucosyl-L-hydroxyproline + + A protein modification that effectively converts an L-proline residue to O4-(N-acetylamino)glucosyl-L-hydroxyproline. + + 15238247 + PubMed + + + 9660787 + PubMed + + + AA0390 + RESID + + + secondary to RESID:AA0030 + + (2S,4R)-4-[2-acetamido-2-deoxy-alpha-D-glucopyranosyloxy]pyrrolidine-2-carboxylic acid + RESID-systematic + + + 4-(N-acetylglucosaminyloxy)proline + RESID-alternate + + + 4-[(2-N-acetylamino)-alpha-D-glucopyranosyl]oxyproline + RESID-alternate + + + alpha-2-(N-acetylamino)glucopyranosyl-4-hydroxyproline + RESID-alternate + + + HexNAc + PSI-MS-label + + + O4-(N-acetylamino)glucosyl-L-hydroxyproline + RESID-name + + + O4-glycosyl-hydroxyproline + RESID-alternate + + + O4GlcNAcHyPro + PSI-MOD-label + + + + DiffAvg + 219.19 + + + + DiffFormula + C 8 H 13 N 1 O 6 + + + + DiffMono + 219.074287 + + + + Formula + C 13 H 20 N 2 O 7 + + + + MassAvg + 316.31 + + + + MassMono + 316.127051 + + + + Origin + P + + + + Source + natural + + + + TermSpec + none + + MOD:00448 + MOD:01677 + PSI-MOD + + + MOD:00759 + fucosylated biantennary (-1 galactose) + + modification from UniMod N-linked glycosylation + + 307 + UniMod + + + + dHex(1)Hex(4)HexNAc(4) + PSI-MS-label + + + Fucosylated biantennary (-1 galactose) + UniMod-description + + + + DiffAvg + 1607.48 + + + + DiffFormula + C 62 H 102 N 4 O 44 + + + + DiffMono + 1606.586693 + + + + Formula + C 66 H 108 N 6 O 46 + + + + MassAvg + 1721.59 + + + + MassMono + 1720.629620 + + + + Origin + N + + + + Source + natural + + + + TermSpec + none + + MOD:00725 + MOD:00903 + PSI-MOD + + + MOD:00760 + biantennary + + modification from UniMod N-linked glycosylation - missing ref + + 311 + UniMod + + + + Biantennary + UniMod-description + + + Hex(5)HexNAc(4) + PSI-MS-label + + + + DiffAvg + 1623.48 + + + + DiffFormula + C 62 H 102 N 4 O 45 + + + + DiffMono + 1622.581607 + + + + Formula + C 66 H 108 N 6 O 47 + + + + MassAvg + 1737.59 + + + + MassMono + 1736.624535 + + + + Origin + N + + + + Source + natural + + + + TermSpec + none + + MOD:00725 + MOD:00903 + PSI-MOD + + + MOD:00761 + monohexosylated (Hex1) + + A protein modification that effectively replaces a hydrogen atom of an amino acid residue or of a modifying group with one hexose sugar group through a glycosidic bond. + + 18688235 + PubMed + + + + Hex1 + PSI-MOD-alternate + + + + DiffAvg + 162.14 + + + + DiffFormula + C 6 H 10 O 5 + + + + DiffMono + 162.052823 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + natural + + + + TermSpec + none + + MOD:00434 + PSI-MOD + + + MOD:00762 + biantennary (-2 galactose) + + modification from UniMod N-linked glycosylation - missing ref + + 309 + UniMod + + + + Biantennary (-2 galactose) + UniMod-description + + + Hex(3)HexNAc(4) + PSI-MS-label + + + + DiffAvg + 1299.20 + + + + DiffFormula + C 50 H 82 N 4 O 35 + + + + DiffMono + 1298.475960 + + + + Formula + C 54 H 88 N 6 O 37 + + + + MassAvg + 1413.30 + + + + MassMono + 1412.518888 + + + + Origin + N + + + + Source + natural + + + + TermSpec + none + + MOD:00725 + MOD:00903 + PSI-MOD + + + MOD:00763 + biantennary (-1 galactose) + + modification from UniMod N-linked glycosylation - missing ref + + 310 + UniMod + + + + Biantennary (-1 galactose) + UniMod-description + + + Hex(4)HexNAc(4) + PSI-MS-label + + + + DiffAvg + 1461.34 + + + + DiffFormula + C 56 H 92 N 4 O 40 + + + + DiffMono + 1460.528784 + + + + Formula + C 60 H 98 N 6 O 42 + + + + MassAvg + 1575.44 + + + + MassMono + 1574.571711 + + + + Origin + N + + + + Source + natural + + + + TermSpec + none + + MOD:00725 + MOD:00903 + PSI-MOD + + + MOD:00764 + glycoconjugated residue + + A protein modification that effectively results from forming an adduct with a carbohydrate-like group either through enzymatic formation of a glycosidic bond, or through non-enzymatic glycation formation of a Schiff-base or an Amadori ketosamine residue adduct. + + 18688235 + PubMed + + + 3743566 + PubMed + + + PSI-MOD-slim + MOD:01156 + PSI-MOD + + + MOD:00765 + cysteinylation (disulfide with free L-cysteine) + + A protein modification that effectively converts an L-cysteine residue to S-(L-cysteinyl)-L-cysteine, forming a disulfide bond with free cysteine. + + 260 + DeltaMass + + + 1988019 + PubMed + + + 2001356 + PubMed + + + 2076469 + PubMed + + + 3083866 + PubMed + + + 366603 + PubMed + + + 7918467 + PubMed + + + 8344916 + PubMed + + + AA0025#CYS1 + RESID + + + 312 + UniMod + + + This entry is for formation of a disulfide bond between a peptide cysteine and a free cysteine. For the cystine cross-link, see MOD:00234. From DeltaMass: (name misspelled and formula incorrect, N and O reversed) Formula: C6H10O2N3S2 Monoisotopic Mass Change: 222.013 Average Mass Change: 222.283 + PSI-MOD-slim + + (2R,2'R)-3,3'-disulfane-1,2-diylbis(2-aminopropanoic acid) + RESID-systematic + + + 2-amino-3-(2-amino-2-carboxy-ethyl)disulfanyl-propanoic acid + RESID-misnomer + + + 3,3'-disulfane-1,2-diylbis(2-azanylpropanoic acid) + RESID-alternate + + + 3,3'-dithiobis(2-aminopropanoic acid) + RESID-alternate + + + 3,3'-dithiobisalanine + RESID-alternate + + + 3,3'-dithiodialanine + RESID-alternate + + + beta,beta'-diamino-beta,beta'-dicarboxydiethyldisulfide + RESID-alternate + + + beta,beta'-dithiodialanine + RESID-alternate + + + bis(alpha-aminopropionic acid)-beta-disulfide + RESID-alternate + + + bis(beta-amino-beta-carboxyethyl)disulfide + RESID-alternate + + + Cysteinylation + DeltaMass-label + + + dicysteine + RESID-alternate + + + L-cystine + RESID-name + + + MOD_RES S-cysteinyl cysteine + UniProt-feature + + + S-cystenyl cystenyl + DeltaMass-label + + + SCysCys + PSI-MOD-label + + + + DiffAvg + 119.14 + + + + DiffFormula + C 3 H 5 N 1 O 2 S 1 + + + + DiffMono + 119.004099 + + + + Formula + C 6 H 10 N 2 O 3 S 2 + + + + MassAvg + 222.28 + + + + MassMono + 222.013284 + + + + Origin + C + + + + Source + natural + + + + TermSpec + none + + MOD:00905 + MOD:01862 + PSI-MOD + + + MOD:00766 + C terminal -K from HC of MAb + + modification from UniMod Post-translational - C-terminal loss of lysine + + 16078144 + PubMed + + + 313 + UniMod + + + + Loss of C-terminal K from Heavy Chain of MAb + UniMod-description + + + Lys-loss + PSI-MS-label + + + + DiffAvg + -128.18 + + + + DiffFormula + C -6 H -12 N -2 O -1 + + + + DiffMono + -128.094963 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + TermSpec + C-term + + MOD:00003 + PSI-MOD + + + MOD:00767 + glycated residue + + A modification produced in a non-enzymatic reaction between a carbohydrate carbonyl group (C1 of aldohexose or C2 of fructose) and a protein amino group to form a Schiff-base or an Amadori ketosamine residue adduct. + + 18688235 + PubMed + + + + + Source + artifact + + MOD:00764 + PSI-MOD + + + MOD:00768 + methionine oxidation with neutral loss of 80 Da + + Oxidation of methionine to methionine sulfone with neutral loss of CH3SO2H. + + 18688235 + PubMed + + + 9004526 + PubMed + + + Originally created from UniMod:508 that was later deleted. + + + DiffAvg + -80.10 + + + + DiffFormula + C -1 H -4 N 0 O -2 S -1 + + + + DiffMono + -79.993200 + + + + Formula + C 4 H 5 N 1 O 1 S 0 + + + + MassAvg + 83.09 + + + + MassMono + 83.037114 + + + + Origin + M + + + + Source + artifact + + + + TermSpec + none + + MOD:00431 + PSI-MOD + + + MOD:00769 + residues isobaric at 71.0-71.1 Da + + Natural or modified residues with a mass of 71.0-71.1 Da. + + 18688235 + PubMed + + + PSI-MOD-slim + MOD:00616 + PSI-MOD + + + MOD:00770 + residues isobaric at a resolution below 0.01 Da + + Natural or modified residues that are isobaric at a resolution below 0.01 Da. + + 18688235 + PubMed + + + PSI-MOD-slim + MOD:00616 + PSI-MOD + + + MOD:00771 + residues isobaric at 166.98-167.00 Da + + Natural or modified residues with a mass of 166.98-167.00 Da. + + 18688235 + PubMed + + + PSI-MOD-slim + MOD:00770 + PSI-MOD + + + MOD:00772 + vanadium containing modified residue + + A protein modification that effectively substitutes a vanadium atom or a cluster containing vanadium for hydrogen atoms, or that coordinates a vanadium ion. + + 18688235 + PubMed + + + + VRes + PSI-MOD-label + + MOD:00698 + PSI-MOD + + + MOD:00773 + residues isobaric at 181.00-181.02 Da + + Natural or modified residues with a mass of 181.00-181.02 Da. + + 18688235 + PubMed + + + PSI-MOD-slim + MOD:00770 + PSI-MOD + + + MOD:00774 + residues isobaric at 243.02-243.03 Da + + Natural or modified residues with a mass of 243.02-243.03 Da. + + 18688235 + PubMed + + + PSI-MOD-slim + MOD:00770 + PSI-MOD + + + MOD:00775 + L-asparagine (His) + + An artifactual protein modification that converts an L-histidine residue to L-asparagine by oxidative degradation. + + 9252331 + PubMed + + + 348 + UniMod + + + + His->Asn + PSI-MS-label + + + his2asnh + OMSSA-label + + + histidine oxidation to aspargine + UniMod-description + + + + DiffAvg + -23.04 + + + + DiffFormula + C -2 H -1 N -1 O 1 + + + + DiffMono + -23.015984 + + + + Formula + C 4 H 6 N 2 O 2 + + + + MassAvg + 114.10 + + + + MassMono + 114.042927 + + + + Origin + H + + + + Source + artifact + + + + TermSpec + none + + MOD:00012 + MOD:00909 + PSI-MOD + + + MOD:00776 + L-aspartic acid (His) + + An artifactual protein modification that converts an L-histidine residue to L-aspartic acid by oxidative degradation. + + 9252331 + PubMed + + + 349 + UniMod + + + From OMSSA: desc="oxidation of H to D" monomass= -23.015984 (this is the same mass difference as OMSSA:54, his2asnh) [JSG]. + + His->Asp + PSI-MS-label + + + his2asph + OMSSA-label + + + histidine oxidation to aspartic acid + UniMod-description + + + + DiffAvg + -22.05 + + + + DiffFormula + C -2 H -2 N -2 O 2 + + + + DiffMono + -22.031969 + + + + Formula + C 4 H 5 N 1 O 3 + + + + MassAvg + 115.09 + + + + MassMono + 115.026943 + + + + Origin + H + + + + Source + artifact + + + + TermSpec + none + + MOD:00013 + MOD:00909 + PSI-MOD + + + MOD:00777 + residues isobaric at 182.96-182.98 Da + + Natural or modified residues with a mass of 182.96-182.98 Da. + + 18688235 + PubMed + + + MOD:00770 + MOD:00778 + PSI-MOD + + + MOD:00778 + residues isobaric at 182.9-183.0 Da + + Natural or modified residues with a mass of 182.9-183.0 Da. + + 18688235 + PubMed + + + PSI-MOD-slim + MOD:00616 + PSI-MOD + + + MOD:00779 + lysine oxidation to aminoadipic semialdehyde + + OBSOLETE because redundant with MOD:00130. Remap to MOD:00130. + + 352 + DeltaMass + + + 11332453 + PubMed + + + 358196 + PubMed + + + 5337886 + PubMed + + + 5529814 + PubMed + + + 352 + UniMod + + + From DeltaMass: Average Mass: -1 Average Mass Change:-1 References:Amici A, Levine, RL, Tsai, L, and Stadtman, ER: Conversion of amino acid residues in proteins and amino acid homopolymers to carbonyl derivatives by metal-catalyzed oxidation reactions. Journal of Biological Chemistry 264: 3341-3346 1989.Requena JR, Chao CC, Levine RL, and Stadtman ER: Glutamic and aminoadipic semialdehydes are the main carbonyl products of metal-catalyzed oxidation of proteins. Proceedings of the National Academy of Sciences USA 98: 69-74 2001. + + Oxidation of lysine (to aminoadipic semialdehyde) + DeltaMass-label + + + + DiffAvg + -1.03 + + + + DiffFormula + H -3 N -1 O 1 + + + + DiffMono + -1.031634 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + K + + + + Source + natural + + + + TermSpec + none + + 1 + PSI-MOD + + + MOD:00780 + N-acetyl-L-asparagine + + A protein modification that effectively converts an L-asparagine residue to N-acetyl-L-asparagine. + + 18688235 + PubMed + + + This modification has not been observed to occur naturally. + + AcAsn + PSI-MOD-label + + + + DiffAvg + 42.04 + + + + DiffFormula + C 2 H 2 N 0 O 1 + + + + DiffMono + 42.010565 + + + + Formula + C 6 H 8 N 2 O 3 + + + + MassAvg + 156.14 + + + + MassMono + 156.053492 + + + + Origin + N + + + + Source + artifact + + + + TermSpec + N-term + + MOD:00903 + MOD:01458 + PSI-MOD + + + MOD:00781 + N2-acetyl-L-histidine + + A protein modification that effectively converts an L-histidine residue to N2-acetyl-L-histidine. + + 18688235 + PubMed + + + This modification has not been observed to occur naturally. + + AcHis + PSI-MOD-label + + + + DiffAvg + 42.04 + + + + DiffFormula + C 2 H 2 N 0 O 1 + + + + DiffMono + 42.010565 + + + + Formula + C 8 H 9 N 3 O 2 + + + + MassAvg + 179.18 + + + + MassMono + 179.069477 + + + + Origin + H + + + + Source + artifact + + + + TermSpec + N-term + + MOD:00909 + MOD:01458 + PSI-MOD + + + MOD:00782 + N-acetyl-L-leucine + + A protein modification that effectively converts an L-leucine residue to N-acetyl-L-leucine. + + 18688235 + PubMed + + + This modification has not been observed to occur naturally. + + AcLeu + PSI-MOD-label + + + + DiffAvg + 42.04 + + + + DiffFormula + C 2 H 2 N 0 O 1 + + + + DiffMono + 42.010565 + + + + Formula + C 8 H 14 N 1 O 2 + + + + MassAvg + 156.20 + + + + MassMono + 156.102454 + + + + Origin + L + + + + Source + artifact + + + + TermSpec + N-term + + MOD:00911 + MOD:01458 + PSI-MOD + + + MOD:00783 + dimethylated L-arginine + + A protein modification that effectively replaces two hydrogen atoms of an L-arginine residue with two methyl groups. + + 36#R + UniMod + + + PSI-MOD-slim + + Dimethyl + PSI-MS-label + + + dimethylr + OMSSA-label + + + NNMe2Arg + PSI-MOD-label + + + + DiffAvg + 28.05 + + + + DiffFormula + C 2 H 4 N 0 O 0 + + + + DiffMono + 28.031300 + + + + Formula + C 8 H 16 N 4 O 1 + + + + MassAvg + 184.24 + + + + MassMono + 184.132411 + + + + Origin + R + + + + Source + natural + + + + TermSpec + none + + MOD:00429 + MOD:00658 + PSI-MOD + + + MOD:00784 + N-acetyl-L-phenylalanine + + A protein modification that effectively converts an L-phenylalanine residue to N-acetyl-L-phenylalanine. + + 18688235 + PubMed + + + This modification has not been observed to occur naturally. + + AcPhe + PSI-MOD-label + + + + DiffAvg + 42.04 + + + + DiffFormula + C 2 H 2 N 0 O 1 + + + + DiffMono + 42.010565 + + + + Formula + C 11 H 11 N 1 O 2 + + + + MassAvg + 189.21 + + + + MassMono + 189.078979 + + + + Origin + F + + + + Source + artifact + + + + TermSpec + N-term + + MOD:00914 + MOD:01458 + PSI-MOD + + + MOD:00785 + N2-acetyl-L-tryptophan + + A protein modification that effectively converts an L-tryptophan residue to N2-acetyl-L-tryptophan. + + 18688235 + PubMed + + + This modification has not been observed to occur naturally. + + AcTrp + PSI-MOD-label + + + + DiffAvg + 42.04 + + + + DiffFormula + C 2 H 2 N 0 O 1 + + + + DiffMono + 42.010565 + + + + Formula + C 13 H 12 N 2 O 2 + + + + MassAvg + 228.25 + + + + MassMono + 228.089878 + + + + Origin + W + + + + Source + artifact + + + + TermSpec + N-term + + MOD:00918 + MOD:01458 + PSI-MOD + + + MOD:00786 + deuterium substituted residue + + A protein modification that effectively substitutes one or more (2)H deuterium atoms for (1)H protium atoms. + + 18688235 + PubMed + + + PSI-MOD-slim + + D(H)Res + PSI-MOD-label + + MOD:00839 + PSI-MOD + + + MOD:00787 + diisopropylphosphoserine + + modification from UniMod - label for the active site serine of the serine esterase/protease family also shown to label tyrosine in serum albumin + + 362 + UniMod + + + + Diisopropylphosphate + UniMod-interim + + + O-Diisopropylphosphorylation + UniMod-description + + + + DiffAvg + 164.14 + + + + DiffFormula + C 6 H 13 O 3 P 1 + + + + DiffMono + 164.060231 + + + + Formula + C 9 H 18 N 1 O 5 P 1 + + + + MassAvg + 251.22 + + + + MassMono + 251.092259 + + + + Origin + S + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + MOD:00861 + MOD:00916 + PSI-MOD + + + MOD:00788 + isopropylphosphotyrosine + + modification from UniMod + + 363 + UniMod + + + + Isopropylphospho + UniMod-interim + + + O-Isopropylphosphorylation + UniMod-description + + + + DiffAvg + 122.06 + + + + DiffFormula + C 3 H 7 O 3 P 1 + + + + DiffMono + 122.013281 + + + + Formula + C 12 H 16 N 1 O 5 P 1 + + + + MassAvg + 285.24 + + + + MassMono + 285.076609 + + + + Origin + Y + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + MOD:00861 + MOD:00919 + PSI-MOD + + + MOD:00789 + Bruker Daltonics SERVA-ICPL(TM) quantification chemistry, heavy form + + modification from UniMod - isotopic label ICPL method - The paper describes an H/D labeling strategy whereas the commercial product follows a C/13C labeling strategy. The digest is typically applied AFTER ICPL_light/heavy labeling, only Protein N-term labeling and Lys-specific labeling is applied. + + 15602776 + PubMed + + + 364 + UniMod + + + + Bruker Daltonics SERVA-ICPL(TM) quantification chemistry, heavy form + UniMod-description + + + ICPL:13C(6) + PSI-MS-label + + + + DiffAvg + 111.04 + + + + DiffFormula + (13)C 6 H 3 N 1 O 1 + + + + DiffMono + 111.041593 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:01426 + PSI-MOD + + + MOD:00790 + Bruker Daltonics SERVA-ICPL(TM) quantification chemistry, light form + + modification from UniMod - isotopic label ICPL method - The paper describes an H/D labeling strategy whereas the commercial product follows a C/13C labeling strategy. The digest is typically applied AFTER ICPL_light/heavy labeling, only Protein N-term labeling and Lys-specific labeling is applied. + + 15602776 + PubMed + + + 365 + UniMod + + + + Bruker Daltonics SERVA-ICPL(TM) quantification chemistry, light form + UniMod-description + + + ICPL + PSI-MS-label + + + + DiffAvg + 105.02 + + + + DiffFormula + (12)C 6 H 3 N 1 O 1 + + + + DiffMono + 105.021464 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:01426 + PSI-MOD + + + MOD:00791 + 1x(18)O labeled deamidated L-glutamine + + A protein modification that effectively converts an L-glutamine residue to L-glutamic acid with one (18)O. + + 8382902 + PubMed + + + 366#Q + UniMod + + + PSI-MOD-slim + + Deamidated:18O(1) + PSI-MS-label + + + Deamidation in presence of O18 + UniMod-description + + + + DiffAvg + 2.99 + + + + DiffFormula + H -1 N -1 (18)O 1 + + + + DiffMono + 2.988262 + + + + Formula + C 5 H 7 N 1 (16)O 2 (18)O 1 + + + + MassAvg + 131.05 + + + + MassMono + 131.046839 + + + + Origin + Q + + + + Source + artifact + + + + TermSpec + none + + MOD:00685 + MOD:00852 + PSI-MOD + + + MOD:00792 + deuterium monosubstituted residue + + A protein modification that effectively substitutes one (2)H deuterium atom for one (1)H protium atom. + + 18688235 + PubMed + + + PSI-MOD-slim + + D(H)1Res + PSI-MOD-label + + MOD:00786 + PSI-MOD + + + MOD:00793 + dehydroalanine (Cys) + + A protein modification that effectively converts an L-cysteine residue to dehydroalanine. + + 17123 + ChEBI + + + 8 + DeltaMass + + + 10220322 + PubMed + + + 11212008 + PubMed + + + 1547888 + PubMed + + + 15799070 + PubMed + + + 1815586 + PubMed + + + 20805503 + PubMed + + + 2914619 + PubMed + + + 7947813 + PubMed + + + 8239649 + PubMed + + + AA0181#CYS + RESID + + + 368 + UniMod + + + From DeltaMass: In an attempt to clarfiy the difference between the modification of cysteine to lanthionine and cysteine to dehydroalanine, the following contributions from the ABRF email forum are presented:Structurally speaking lanthionine is like cystine but lacks one S atom. I imagine one can think of it as a condensation of cysteine and dehydroalanine but I do not know how it is made biologically. Dehydroalanine could be derived from either serine or cysteine. If I recall Biochem 101 correctly lanthionine was first found in wool.-Lowell Ericsson (ERICSSONLH@U.WASHINGTON.EDU)As far as I know, the structure of lanthionine is two Ala's joined by a single sulphur with the loss of two hydrogens from the methyl group of the Ala.Stephen Bayne (sbay@novo.dk)Regarding the structure of lanthionine and dehydroalanine: dehydroalanine is formed by the loss of one sulfur atom and two hydrogen atoms from ONE cysteine residue. lanthionine is formed from TWO cysteines, is a thioether, and contains one sulfur atom less than the amino acid cystine. Dan McCormick (MCCORMICK@rcf.mayo.edu) [DeltaMass]. Most bacterially produced lanthionine crosslinks are made by dehydration of L-serine to dehydroalanine, and then reaction with L-cysteine so as to produce chiral inversion at the alpha-carbon of the original L-serine; the lanthionine is a meso-diastereomer with L-configuration of the original cysteine alpha-carbon and D-configuration of the original L-serine alpha-carbon. In cypemycin dehydroalanine has been shown to be produced by loss of hydrogen sulfide from cysteine. Beta-elimination of hydrogen sulfide does occur during treatment with performic acid [JSG]. + PSI-MOD-slim + + 2,3-didehydroalanine + RESID-alternate + + + 2-aminoacrylic acid + RESID-alternate + + + 2-aminopropenoic acid + RESID-systematic + + + 4-methylidene-imidazole-5-one (MIO) active site + RESID-alternate + + + anhydroserine + RESID-alternate + + + Cys->Dha + PSI-MS-label + + + dehydroalanine + RESID-name + + + Dehydroalanine (from Cysteine) + DeltaMass-label + + + Dehydroalanine (from Cysteine) + UniMod-description + + + Dha + RESID-alternate + + + dHAla(Cys) + PSI-MOD-label + + + MOD_RES 2,3-didehydroalanine (Cys) + UniProt-feature + + + + DiffAvg + -34.08 + + + + DiffFormula + C 0 H -2 N 0 O 0 S -1 + + + + DiffMono + -33.987721 + + + + Formula + C 3 H 3 N 1 O 1 + + + + MassAvg + 69.06 + + + + MassMono + 69.021464 + + + + Origin + C + + + + Source + natural + + + + TermSpec + none + + MOD:00905 + MOD:01168 + PSI-MOD + + + MOD:00794 + pyrrolidone from proline + + OBSOLETE because redundant and identical to MOD:00477. Remap to MOD:00477. + + 9252331 + PubMed + + + 369 + UniMod + + + This UniMod entry appears to have come from the same description in PubMed:9252331 as UniMod:360. This entry was not annotated as being approved. Neither difference formula corresponds to the result described in the original citation PubMed:2161657. + + Pro->Pyrrolidone + UniMod-interim + + + Pyrrolidone from Proline + UniMod-description + + + + DiffAvg + -28.01 + + + + DiffFormula + C -1 O -1 + + + + DiffMono + -27.994915 + + + + Formula + C 4 H 7 N 1 O 0 + + + + MassAvg + 69.11 + + + + MassMono + 69.057849 + + + + Origin + P + + + + Source + artifact + + + + TermSpec + none + + 1 + PSI-MOD + + + MOD:00795 + Michael addition of hydroxymethylvinyl ketone to cysteine + + modification from UniMod + + 11743741 + PubMed + + + 371 + UniMod + + + + HMVK + PSI-MS-label + + + Michael addition of hydroxymethylvinyl ketone to cysteine + UniMod-description + + + + DiffAvg + 86.09 + + + + DiffFormula + C 4 H 6 O 2 + + + + DiffMono + 86.036779 + + + + Formula + C 7 H 11 N 1 O 3 S 1 + + + + MassAvg + 189.23 + + + + MassMono + 189.045964 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:00905 + PSI-MOD + + + MOD:00796 + L-ornithine (Arg) + + A protein modification that effectively converts an L-arginine residue to L-ornithine. + + 129 + DeltaMass + + + 15489230 + PubMed + + + 372 + UniMod + + + PSI-MOD-slim + + Arg->Orn + PSI-MS-label + + + arg2orn + OMSSA-label + + + Ornithine (from Arginine) + DeltaMass-label + + + Ornithine from Arginine + UniMod-description + + + Ornithyl + DeltaMass-label + + + + DiffAvg + -42.04 + + + + DiffFormula + C -1 H -2 N -2 + + + + DiffMono + -42.021798 + + + + Formula + C 5 H 10 N 2 O 1 + + + + MassAvg + 114.15 + + + + MassMono + 114.079313 + + + + Origin + R + + + + Source + artifact + + + + TermSpec + none + + MOD:00902 + PSI-MOD + + + MOD:00797 + 2-(S-L-cysteinyl)pyruvic acid O-phosphothioketal + + a protein modification that effectively converts an L-cysteine residue to the PEP adduct, 2-(S-L-cysteinyl)pyruvic acid O-phosphothioketal + + 4696757 + PubMed + + + 7999765 + PubMed + + + 8664284 + PubMed + + + AA0391 + RESID + + + + (2R)-2-amino-3-[1-carboxy-1-(phosphonooxy)ethyl]sulfanylpropanoic acid + RESID-systematic + + + 2-([(2R)-2-amino-2-carboxyethyl]sulfanyl)-2-(phosphonooxy)propanoic acid + RESID-alternate + + + 2-([(2R)-2-azanyl-2-carboxyethyl]sulfanyl)-2-(phosphonooxy)propanoic acid + RESID-alternate + + + 2-(S-L-cysteinyl)pyruvic acid O-phosphothioketal + RESID-name + + + cysteinyl pyruvate O-phosphothioketal + RESID-alternate + + + MOD_RES 2-(S-cysteinyl)pyruvic acid O-phosphothioketal + UniProt-feature + + + phosphoenolpyruvate cysteine adduct + RESID-alternate + + + phospholactoyl cysteine adduct + RESID-alternate + + + S-[1-carboxy-1-(phosphonooxy)ethyl]cysteine + RESID-alternate + + + SPEPCys + PSI-MOD-label + + + + DiffAvg + 168.04 + + + + DiffFormula + C 3 H 5 N 0 O 6 P 1 S 0 + + + + DiffMono + 167.982375 + + + + Formula + C 6 H 10 N 1 O 7 P 1 S 1 + + + + MassAvg + 271.18 + + + + MassMono + 270.991559 + + + + Origin + C + + + + Source + natural + + + + TermSpec + none + + MOD:00861 + MOD:00905 + PSI-MOD + + + MOD:00798 + half cystine + + A protein modification that can be regarded as effectively either one half of a cystine cross-link, or a cysteine residue with one hydrogen atom or proton removed. + + 1988019 + PubMed + + + 2001356 + PubMed + + + 2076469 + PubMed + + + 3083866 + PubMed + + + 366603 + PubMed + + + 7918467 + PubMed + + + 8344916 + PubMed + + + 374 + UniMod + + + + Dehydro + PSI-MS-label + + + Half of a disulfide bridge + UniMod-description + + + + DiffAvg + -1.01 + + + + DiffFormula + C 0 H -1 N 0 O 0 S 0 + + + + DiffMono + -1.007825 + + + + Formula + C 3 H 4 N 1 O 1 S 1 + + + + MassAvg + 102.13 + + + + MassMono + 102.001360 + + + + Origin + C + + + + Source + none + + + + TermSpec + none + + MOD:00905 + PSI-MOD + + + MOD:00799 + S-galactosyl-L-cysteine + + A protein modification that effectively converts an L-cysteine residue to S-galactosyl-L-cysteine. + + 11945907 + PubMed + + + AA0392 + RESID + + + The reported peptide has not been isolated or characterized in subsequent work, and the peptide sequence has not been found in the human proteome. This is a deprecated entry in RESID. It probably does not occur naturally [JSG]. + + (2R)-2-amino-3-(D-galactopyranosylsulfanyl)propanoic acid + RESID-systematic + + + S-(beta-D-galactopyranosyl)cysteine + RESID-alternate + + + S-galactosyl-L-cysteine + RESID-name + + + S-glycosyl-cysteine + RESID-alternate + + + SGalCys + PSI-MOD-label + + + + DiffAvg + 162.14 + + + + DiffFormula + C 6 H 10 N 0 O 5 S 0 + + + + DiffMono + 162.052823 + + + + Formula + C 9 H 15 N 1 O 6 S 1 + + + + MassAvg + 265.28 + + + + MassMono + 265.062008 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:00426 + MOD:00476 + MOD:00761 + MOD:00905 + PSI-MOD + + + MOD:00800 + L-cysteinyl-L-histidino-homocitryl vanadium heptairon nonasulfide + + A protein modification that effectively converts an L-cysteine residue, an L-histidine residue, homocitric acid and a one-vanadium seven-iron nine-sulfur cluster to L-cysteinyl-L-histidino-homocitryl vanadium heptairon nonasulfide. + + 2345152 + PubMed + + + AA0393 + RESID + + + Cross-link 2; incidental to RESID:AA0300. + + CysHis-[V7Fe9S] + PSI-MOD-label + + + L-cysteinyl-L-histidino-homocitryl vanadium heptairon nonasulfide carbide + RESID-name + + + nitrogenase iron-vanadium cofactor + RESID-alternate + + + + DiffAvg + 932.51 + + + + DiffFormula + C 7 Fe 7 H 6 N 0 O 7 S 9 V 1 + + + + DiffMono + 932.248513 + + + + Formula + C 16 Fe 7 H 18 N 4 O 9 S 10 V 1 + + + + MassAvg + 1172.80 + + + + MassMono + 1172.316610 + + + + Origin + C, H + + + + Source + hypothetical + + + + TermSpec + none + + MOD:00739 + MOD:00772 + MOD:00905 + MOD:00909 + PSI-MOD + + + MOD:00801 + L-cysteinyl-L-histidino-homocitryl octairon nonasulfide + + A protein modification that effectively converts an L-cysteine residue, an L-histidine residue, homocitric acid and an eight-iron nine-sulfur cluster to L-cysteinyl-L-histidino-homocitryl octairon nonasulfide. + + 8392330 + PubMed + + + AA0394 + RESID + + + Cross-link 2; incidental to RESID:AA0300. + + CysHis-[8Fe9S] + PSI-MOD-label + + + L-cysteinyl-L-histidino-homocitryl octairon nonasulfide carbide + RESID-name + + + nitrogenase iron-iron cofactor + RESID-alternate + + + + DiffAvg + 937.42 + + + + DiffFormula + C 7 Fe 8 H 6 N 0 O 7 S 9 + + + + DiffMono + 937.240588 + + + + FormalCharge + 2- + + + + Formula + C 16 Fe 8 H 18 N 4 O 9 S 10 + + + + MassAvg + 1177.70 + + + + MassMono + 1177.308685 + + + + Origin + C, H + + + + Source + hypothetical + + + + TermSpec + none + + MOD:00739 + MOD:00905 + MOD:00909 + PSI-MOD + + + MOD:00802 + L-histidino vanadium tetraoxide + + a protein modification that effectively converts an L-histidine residue to L-histidino vanadium tetraoxide + + 10543953 + PubMed + + + 16494433 + PubMed + + + 8552646 + PubMed + + + AA0395 + RESID + + + + (4-[(2S)-2-amino-2-carboxyethyl]-1H-imidazol-1-yl) (dihydroxy)dioxovanadium + RESID-alternate + + + 1'-vanadato-L-histidine + RESID-alternate + + + bromoperoxidase vanadium cofactor + RESID-alternate + + + chloroperoxidase vanadium cofactor + RESID-alternate + + + dihydrogen (4-[(2S)-2-amino-2-carboxyethyl]-1H-imidazol-1-yl) (tetraoxido)vanadate + RESID-systematic + + + haloperoxidase vanadium cofactor + RESID-alternate + + + histidine-1-vanadate + RESID-alternate + + + histidine-N(epsilon)-vanadate + RESID-alternate + + + histidine-N1'-vanadate + RESID-alternate + + + L-histidino vanadium tetraoxide + RESID-name + + + N(tau)-vanadatohistidine + RESID-alternate + + + NtauH2VO4His + PSI-MOD-label + + + tele-vanadatohistidine + RESID-alternate + + + + DiffAvg + 116.95 + + + + DiffFormula + C 0 H 2 N 0 O 4 V 1 + + + + DiffMono + 116.939268 + + + + Formula + C 6 H 9 N 3 O 5 V 1 + + + + MassAvg + 254.10 + + + + MassMono + 253.998180 + + + + Origin + H + + + + Source + natural + + + + TermSpec + none + + MOD:00772 + MOD:00909 + PSI-MOD + + + MOD:00803 + 3-(S-L-cysteinyl)-L-tyrosine + + A protein modification that effectively cross-links an L-cysteine residue and an L-tyrosine residue by a thioether bond to form 3-(S-L-cysteinyl)-L-tyrosine. + + 15342250 + PubMed + + + AA0396 + RESID + + + Cross-link 2. + + (2S,3R)-2-amino-3-([(2R)-2-amino-2-carboxyethyl]sulfanyl)-3-(4-hydroxyphenyl)propanoic acid + RESID-systematic + + + 2-amino-3-(2-amino-2-carboxyethylthio)-3-(4-hydroxyphenyl)propanoic acid + RESID-alternate + + + 3-(L-cystein-S-yl)-L-tyrosine + RESID-name + + + CROSSLNK 3-(S-cysteinyl)-tyrosine (Cys-Tyr) + UniProt-feature + + + S-(tyros-3'-yl)cysteine + RESID-alternate + + + XLNKSCys3Tyr + PSI-MOD-label + + + + DiffAvg + -2.02 + + + + DiffFormula + C 0 H -2 N 0 O 0 S 0 + + + + DiffMono + -2.015650 + + + + Formula + C 12 H 12 N 2 O 3 S 1 + + + + MassAvg + 264.30 + + + + MassMono + 264.056863 + + + + Origin + C, Y + + + + Source + natural + + + + TermSpec + none + + MOD:00919 + MOD:01993 + PSI-MOD + + + MOD:00804 + O-glucosyl-L-serine + + A protein modification that effectively converts an L-serine residue to O3-beta-glucosylated L-serine. + + 10734111 + PubMed + + + 2105311 + PubMed + + + 2511201 + PubMed + + + AA0397 + RESID + + + PSI-MOD-slim + + (2S)-2-amino-3-(beta-D-glucopyranosyloxy)propanoic acid + RESID-systematic + + + CARBOHYD O-linked (Glc) + UniProt-feature + + + CARBOHYD O-linked (Hex) + UniProt-feature + + + O-glucosyl-L-serine + RESID-name + + + O-glycosylserine + RESID-alternate + + + O3-glucosylserine + RESID-alternate + + + OGlcSer + PSI-MOD-label + + + + DiffAvg + 162.14 + + + + DiffFormula + C 6 H 10 N 0 O 5 + + + + DiffMono + 162.052823 + + + + Formula + C 9 H 15 N 1 O 7 + + + + MassAvg + 249.22 + + + + MassMono + 249.084852 + + + + Origin + S + + + + Source + natural + + + + TermSpec + none + + MOD:00002 + MOD:00433 + MOD:00761 + PSI-MOD + + + MOD:00805 + O-(N-acetylamino)glucosyl-L-serine + + A protein modification that effectively converts an L-serine residue to O3-(N-acetylaminoglucosyl)-L-serine. + + 3086323 + PubMed + + + 8404891 + PubMed + + + AA0398 + RESID + + + PSI-MOD-slim + + (2S)-2-amino-3-(2-acetamido-2-deoxy-beta-D-glucopyranosyloxy)propanoic acid + RESID-systematic + + + CARBOHYD O-linked (GlcNAc) + UniProt-feature + + + CARBOHYD O-linked (HexNAc) + UniProt-feature + + + HexNAc + PSI-MS-label + + + O-(2-acetylamino-2-deoxy-beta-D-glucopyranosyl)-L-serine + RESID-alternate + + + O-(N-acetylamino)glucosyl-L-serine + RESID-name + + + O-(N-acetylglucosaminyl)serine + RESID-alternate + + + O-glycosylserine + RESID-alternate + + + O-seryl-beta-N-acetylglucosaminide + RESID-alternate + + + O3-(2-acetamido-2-deoxy-beta-D-glucopyranosyl)-L-serine + RESID-alternate + + + O3-(N-acetylglucosaminyl)serine + RESID-alternate + + + OGlcNAcSer + PSI-MOD-label + + + + DiffAvg + 203.19 + + + + DiffFormula + C 8 H 13 N 1 O 5 + + + + DiffMono + 203.079373 + + + + Formula + C 11 H 18 N 2 O 7 + + + + MassAvg + 290.27 + + + + MassMono + 290.111401 + + + + Origin + S + + + + Source + natural + + + + TermSpec + none + + MOD:00448 + MOD:01675 + PSI-MOD + + + MOD:00806 + O-(N-acetylamino)glucosyl-L-threonine + + A protein modification that effectively converts an L-threonine residue to O3-(N-acetylaminoglucosyl)-L-threonine. + + 3086323 + PubMed + + + 8404891 + PubMed + + + AA0399 + RESID + + + PSI-MOD-slim + + (2S,3R)-2-amino-3-(2-acetamido-2-deoxy-beta-D-glucopyranosyloxy)butanoic acid + RESID-systematic + + + CARBOHYD O-linked (GlcNAc) + UniProt-feature + + + CARBOHYD O-linked (HexNAc) + UniProt-feature + + + HexNAc + PSI-MS-label + + + O-(2-acetylamino-2-deoxy-beta-D-glucopyranosyl)-L-threonine + RESID-alternate + + + O-(N-acetylamino)glucosyl-L-threonine + RESID-name + + + O-(N-acetylglucosaminyl)-L-threonine + RESID-alternate + + + O-glycosylthreonine + RESID-alternate + + + O-threonyl-beta-N-acetylglucosaminide + RESID-alternate + + + O3-(2-acetamido-2-deoxy-beta-D-glucopyranosyl)-L-threonine + RESID-alternate + + + O3-(N-acetylglucosaminyl)threonine + RESID-alternate + + + OGlcNAcThr + PSI-MOD-label + + + + DiffAvg + 203.19 + + + + DiffFormula + C 8 H 13 N 1 O 5 + + + + DiffMono + 203.079373 + + + + Formula + C 12 H 20 N 2 O 7 + + + + MassAvg + 304.30 + + + + MassMono + 304.127051 + + + + Origin + T + + + + Source + natural + + + + TermSpec + none + + MOD:00448 + MOD:01676 + PSI-MOD + + + MOD:00807 + pyruvic acid (Ser) + + A protein modification that effectively converts an L-serine residue to pyruvic acid. + + 23 + DeltaMass + + + 10085076 + PubMed + + + 3042771 + PubMed + + + 8464063 + PubMed + + + AA0127#SER + RESID + + + 385#S + UniMod + + + DeltaMass gives mass 70 and difference mass -16 with no formula + PSI-MOD-slim + + 2-oxopropanoic acid + RESID-systematic + + + MOD_RES Pyruvic acid (Ser) + UniProt-feature + + + Pyruvate + DeltaMass-label + + + pyruvic acid + RESID-name + + + Pyruvoyl- (Serine) + DeltaMass-label + + + + DiffAvg + -17.03 + + + + DiffFormula + C 0 H -3 N -1 O 0 + + + + DiffMono + -17.026549 + + + + Formula + C 3 H 3 O 2 + + + + MassAvg + 71.06 + + + + MassMono + 71.013304 + + + + Origin + S + + + + Source + natural + + + + TermSpec + N-term + + MOD:00916 + MOD:01154 + MOD:01160 + PSI-MOD + + + MOD:00808 + O-galactosyl-L-serine + + A protein modification that effectively converts an L-serine residue to O3-galactosylserine. + + 666730 + PubMed + + + AA0400 + RESID + + + + (2S)-2-amino-3-(alpha-D-galactopyranosyloxy)propanoic acid + RESID-systematic + + + CARBOHYD O-linked (Gal) + UniProt-feature + + + CARBOHYD O-linked (Hex) + UniProt-feature + + + O-galactosyl-L-serine + RESID-name + + + O-glycosylserine + RESID-alternate + + + O3-galactosylserine + RESID-alternate + + + OGalSer + PSI-MOD-label + + + + DiffAvg + 162.14 + + + + DiffFormula + C 6 H 10 N 0 O 5 + + + + DiffMono + 162.052823 + + + + Formula + C 9 H 15 N 1 O 7 + + + + MassAvg + 249.22 + + + + MassMono + 249.084852 + + + + Origin + S + + + + Source + natural + + + + TermSpec + none + + MOD:00002 + MOD:00476 + MOD:00761 + PSI-MOD + + + MOD:00809 + O-galactosyl-L-threonine + + A protein modification that effectively converts an L-threonine residue to O3-galactosylthreonine. + + 2673008 + PubMed + + + AA0401 + RESID + + + + (2S,3R)-2-amino-3-(alpha-D-galactopyranosyloxy)butanoic acid + RESID-systematic + + + CARBOHYD O-linked (Gal) + UniProt-feature + + + CARBOHYD O-linked (Hex) + UniProt-feature + + + O-galactosyl-L-threonine + RESID-name + + + O-glycosylthreonine + RESID-alternate + + + O3-galactosylthreonine + RESID-alternate + + + OGalThr + PSI-MOD-label + + + + DiffAvg + 162.14 + + + + DiffFormula + C 6 H 10 N 0 O 5 + + + + DiffMono + 162.052823 + + + + Formula + C 10 H 17 N 1 O 7 + + + + MassAvg + 263.25 + + + + MassMono + 263.100502 + + + + Origin + T + + + + Source + natural + + + + TermSpec + none + + MOD:00476 + MOD:00761 + MOD:01348 + PSI-MOD + + + MOD:00810 + O-mannosyl-L-serine + + A protein modification that effectively converts an L-serine residue to O3-mannosylserine. + + 391559 + PubMed + + + AA0402 + RESID + + + + (2S)-2-amino-3-(alpha-D-mannopyranosyloxy)propanoic acid + RESID-systematic + + + CARBOHYD O-linked (Hex) + UniProt-feature + + + CARBOHYD O-linked (Man) + UniProt-feature + + + O-glycosylserine + RESID-alternate + + + O-mannopyranosylserine + RESID-alternate + + + O-mannosyl-L-serine + RESID-name + + + O3-mannosylserine + RESID-alternate + + + OManSer + PSI-MOD-label + + + + DiffAvg + 162.14 + + + + DiffFormula + C 6 H 10 N 0 O 5 + + + + DiffMono + 162.052823 + + + + Formula + C 9 H 15 N 1 O 7 + + + + MassAvg + 249.22 + + + + MassMono + 249.084852 + + + + Origin + S + + + + Source + natural + + + + TermSpec + none + + MOD:00002 + MOD:00595 + MOD:00761 + PSI-MOD + + + MOD:00811 + O-mannosyl-L-threonine + + a protein modification that effectively forms a O3-mannosylthreonine + + 391559 + PubMed + + + AA0403 + RESID + + + + (2S,3R)-2-amino-3-(alpha-D-mannopyranosyloxy)butanoic acid + RESID-systematic + + + CARBOHYD O-linked (Hex) + UniProt-feature + + + CARBOHYD O-linked (Man) + UniProt-feature + + + O-glycosylthreonine + RESID-alternate + + + O-mannosyl-L-threonine + RESID-name + + + O3-mannosylthreonine + RESID-alternate + + + OManThr + PSI-MOD-label + + + + DiffAvg + 162.14 + + + + DiffFormula + C 6 H 10 N 0 O 5 + + + + DiffMono + 162.052823 + + + + Formula + C 10 H 17 N 1 O 7 + + + + MassAvg + 263.25 + + + + MassMono + 263.100502 + + + + Origin + T + + + + Source + natural + + + + TermSpec + none + + MOD:00595 + MOD:00761 + MOD:01348 + PSI-MOD + + + MOD:00812 + O-fucosyl-L-serine + + A protein modification that effectively converts an L-serine residue to an O-fucosylserine. + + 10734111 + PubMed + + + 11067851 + PubMed + + + 11344537 + PubMed + + + 12096136 + PubMed + + + 1517205 + PubMed + + + 15189151 + PubMed + + + 1904059 + PubMed + + + 3311742 + PubMed + + + 3578767 + PubMed + + + AA0404 + RESID + + + 295#S + UniMod + + + PSI-MOD-slim + + (2S)-2-amino-3-(6-deoxy-alpha-D-galactopyranosyloxy)propanoic acid + RESID-systematic + + + CARBOHYD O-linked (dHex) + UniProt-feature + + + CARBOHYD O-linked (Fuc) + UniProt-feature + + + dHex + PSI-MS-label + + + Fucose + UniMod-description + + + O-fucosyl-L-serine + RESID-name + + + O-glycosylserine + RESID-alternate + + + O3-fucosylserine + RESID-alternate + + + OFucSer + PSI-MOD-label + + + + DiffAvg + 146.14 + + + + DiffFormula + C 6 H 10 N 0 O 4 + + + + DiffMono + 146.057909 + + + + Formula + C 9 H 15 N 1 O 6 + + + + MassAvg + 233.22 + + + + MassMono + 233.089937 + + + + Origin + S + + + + Source + natural + + + + TermSpec + none + + MOD:00002 + MOD:00614 + PSI-MOD + + + MOD:00813 + O-fucosyl-L-threonine + + A protein modification that effectively converts an threonine residue to an O-fucosylthreonine. + + 11344537 + PubMed + + + 11857757 + PubMed + + + 15189151 + PubMed + + + 1740125 + PubMed + + + 1900431 + PubMed + + + AA0405 + RESID + + + 295#T + UniMod + + + PSI-MOD-slim + + (2S,3R)-2-amino-3-(6-deoxy-alpha-D-galactopyranosyloxy)butanoic acid + RESID-systematic + + + CARBOHYD O-linked (dHex) + UniProt-feature + + + CARBOHYD O-linked (Fuc) + UniProt-feature + + + dHex + PSI-MS-label + + + Fucose + UniMod-description + + + O-fucosyl-L-threonine + RESID-name + + + O-glycosylthreonine + RESID-alternate + + + O3-fucosylthreonine + RESID-alternate + + + OFucThr + PSI-MOD-label + + + + DiffAvg + 146.14 + + + + DiffFormula + C 6 H 10 N 0 O 4 + + + + DiffMono + 146.057909 + + + + Formula + C 10 H 17 N 1 O 6 + + + + MassAvg + 247.25 + + + + MassMono + 247.105587 + + + + Origin + T + + + + Source + natural + + + + TermSpec + none + + MOD:00005 + MOD:00614 + PSI-MOD + + + MOD:00814 + O-xylosyl-L-serine + + A protein modification that effectively converts an L-serine residue to O3-xylosylserine. + + 8747463 + PubMed + + + AA0406 + RESID + + + One glycosylated serine with weak electron density was modeled as O3-alpha-xylosylserine, while O3-alpha-mannosyl serine and threonine were modeled at ten other positions. The authors do not discuss this exception or provide chemical evidence for it. Since an O3-xylosyl serine modification has not been reported in any other fungal proteins, the modification is probably also an O3-alpha-mannosyl serine, see MOD:00810 [JSG]. + + (2S)-2-amino-3-(alpha-D-xylopyranosyloxy)propanoic acid + RESID-systematic + + + O-(beta-D-xylopyranosyl)-L-serine + RESID-alternate + + + O-glycosylserine + RESID-alternate + + + O-xylosyl-L-serine + RESID-name + + + O3-xylosylserine + RESID-alternate + + + OXylSer + PSI-MOD-label + + + + DiffAvg + 132.12 + + + + DiffFormula + C 5 H 8 N 0 O 4 + + + + DiffMono + 132.042259 + + + + Formula + C 8 H 13 N 1 O 6 + + + + MassAvg + 219.19 + + + + MassMono + 219.074287 + + + + Origin + S + + + + Source + artifact + + + + TermSpec + none + + MOD:00002 + PSI-MOD + + + MOD:00815 + molybdopterin + + OBSOLETE because redundant with MOD:00151. Remap to MOD:00151. + + 14527393 + PubMed + + + 7878465 + PubMed + + + 9428520 + PubMed + + + + + DiffAvg + 520.27 + + + + DiffFormula + C 10 H 11 Mo 1 N 5 O 8 P 1 S 2 + + + + DiffMono + 521.884074 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + C + + + + Source + natural + + + + TermSpec + none + + 1 + PSI-MOD + + + MOD:00816 + S-stearoyl-L-cysteine + + A protein modification that effectively converts an L-cysteine residue to S-stearoyl-L-cysteine. + + 0 + DeltaMass + + + 2371783 + PubMed + + + 3143715 + PubMed + + + 8761467 + PubMed + + + AA0407 + RESID + + + From DeltaMass: Average Mass: 266 + PSI-MOD-slim + + (R)-2-amino-3-(octadecanoylsulfanyl)propanoic acid + RESID-systematic + + + 2-amino-3-(octadecanoylthio)propanoic acid + RESID-alternate + + + cysteine octadecanoate thioester + RESID-alternate + + + cysteine stearate thioester + RESID-alternate + + + LIPID S-stearoyl cysteine + UniProt-feature + + + S-stearoyl-L-cysteine + RESID-name + + + SSteCys + PSI-MOD-label + + + Stearoylation + DeltaMass-label + + + + DiffAvg + 266.47 + + + + DiffFormula + C 18 H 34 N 0 O 1 S 0 + + + + DiffMono + 266.260966 + + + + Formula + C 21 H 39 N 1 O 2 S 1 + + + + MassAvg + 369.61 + + + + MassMono + 369.270150 + + + + Origin + C + + + + Source + natural + + + + TermSpec + none + + MOD:00672 + MOD:00905 + MOD:01155 + PSI-MOD + + + MOD:00817 + 3'-geranyl-2',3'-dihydro-2',N2-cyclo-L-tryptophan + + A protein modification that effectively converts an L-tryptophan residue to 3'-geranyl-2',3'-dihydro-2',N2-cyclo-L-tryptophan. + + 35304 + ChEBI + + + 16407988 + PubMed + + + 8168130 + PubMed + + + AA0408 + RESID + + + + (2S,3aR,8aS)-3a-[(2E)-3,7-dimethylocta-2,6-dien-1-yl]-1,2,3,3a,8,8a-hexahydropyrrolo[2,3-b]indole-2-carboxylic acid + RESID-systematic + + + (2S,3R)-3-geranyl-2,3-dihydro-2,N(alpha)-cyclo-L-tryptophan + RESID-alternate + + + 3'-geranyl-2',3'-dihydro-2',N2-cyclo-L-tryptophan + RESID-name + + + 3'Ger2'N2cycTrp + PSI-MOD-label + + + LIPID 3'-geranyl-2',N2-cyclotryptophan + UniProt-feature + + + + DiffAvg + 136.24 + + + + DiffFormula + C 10 H 16 N 0 O 0 + + + + DiffMono + 136.125201 + + + + Formula + C 21 H 26 N 2 O 1 + + + + MassAvg + 322.45 + + + + MassMono + 322.204513 + + + + Origin + W + + + + Source + natural + + + + TermSpec + none + + MOD:00601 + MOD:01115 + PSI-MOD + + + MOD:00818 + glycosylphosphatidylinositolated residue + + A protein modification that effectively converts a residue to a glycosylphosphatidylinositolethanolamidated. + + 12643538 + PubMed + + + 394#C-term + UniMod + + + + glycosylphosphatidylinositol + UniMod-description + + + GPIanchor + UniMod-interim + + + GPIRes + PSI-MOD-label + + + + DiffAvg + 123.05 + + + + DiffFormula + C 2 H 6 N 1 O 3 P 1 + + + + DiffMono + 123.008530 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + natural + + + + TermSpec + C-term + + MOD:00764 + MOD:00861 + MOD:01155 + PSI-MOD + + + MOD:00819 + L-2-aminobutanoic acid (Glu) + + A protein modification that effectively converts an L-glutamic acid residue to L-2-aminobutanoic acid. + + 35619 + ChEBI + + + 0 + DeltaMass + + + 11740505 + PubMed + + + AA0409 + RESID + + + + (S)-2-aminobutanoic acid + RESID-systematic + + + Abu + DeltaMass-label + + + Abu + PSI-MOD-label + + + alpha-amino-n-butyric acid + PSI-MOD-alternate + + + alpha-aminobutyric acid + PSI-MOD-alternate + + + butyrine + PSI-MOD-alternate + + + dCbxGlu + PSI-MOD-alternate + + + L-2-amino-n-butyric acid + RESID-alternate + + + L-2-aminobutanoic acid + RESID-name + + + L-2-aminobutyric acid + RESID-alternate + + + L-alpha-amino-n-butyric acid + RESID-alternate + + + L-alpha-aminobutyric acid + RESID-alternate + + + L-butyrine + RESID-alternate + + + + DiffAvg + -44.01 + + + + DiffFormula + C -1 H 0 N 0 O -2 + + + + DiffMono + -43.989829 + + + + Formula + C 4 H 7 N 1 O 1 + + + + MassAvg + 85.11 + + + + MassMono + 85.052764 + + + + Origin + E + + + + Source + natural + + + + TermSpec + none + + MOD:00906 + PSI-MOD + + + MOD:00820 + 2-imino-alanine 5-imidazolinone glycine + + A protein modification that effectively crosslinks an L-aspartic acid residue and a glycine residue to form 2-imino-alanine 5-imidazolinone glycine. + + 16627946 + PubMed + + + AA0410 + RESID + + + Cross-link 2; carboxamidine. + + (2-ethanimidoyl-5-oxo-4,5-dihydro-1H-imidazol-1-yl)acetic acid + RESID-systematic + + + 2,N-didehydroalanyl-5-imidazolinone glycine + RESID-alternate + + + 2-(1-iminoethyl)-1-carboxymethyl-1-imidazolin-5-one + RESID-alternate + + + 2-imino-alanine 5-imidazolinone glycine + RESID-name + + + 2-imino-alanyl-5-imidazolinone glycine + RESID-alternate + + + [2-(1-iminoethyl)-5-oxo-4,5-dihydro-imidazol-1-yl]-acetic acid + RESID-alternate + + + alanyl-5-imidazolinone glycine + RESID-alternate + + + para-hydroxybenzylidene-imidazolidinone chromophore + RESID-alternate + + + red fluorescent protein zRFP574 chromophore + RESID-alternate + + + + DiffAvg + -64.04 + + + + DiffFormula + C -1 H -4 N 0 O -3 + + + + DiffMono + -64.016044 + + + + Formula + C 5 H 4 N 2 O 1 + + + + MassAvg + 108.10 + + + + MassMono + 108.032363 + + + + Origin + D, G + + + + Source + natural + + + + TermSpec + none + + MOD:00904 + MOD:00908 + MOD:01882 + PSI-MOD + + + MOD:00821 + S-(L-alanyl)-L-cysteine + + A protein modification that effectively crosslinks an L-alanine residue and an L-cysteine residue by a thioester bond to form S-(L-alanyl)-L-cysteine. + + 11807079 + PubMed + + + AA0411 + RESID + + + Cross-link 2. + + (2R)-2-amino-3-([(2S)-2-aminopropanoyl]sulfanyl)propanoic acid + RESID-systematic + + + alanine cysteine thioester + RESID-alternate + + + CROSSLNK Alanyl cysteine thioester (Cys-Ala) + UniProt-feature + + + S-(2-aminopropanoyl)cysteine + RESID-alternate + + + S-(L-alanyl)-L-cysteine + RESID-name + + + XLNK1AlaSCys + PSI-MOD-label + + + + DiffAvg + -18.02 + + + + DiffFormula + C 0 H -2 N 0 O -1 S 0 + + + + DiffMono + -18.010565 + + + + Formula + C 6 H 9 N 2 O 2 S 1 + + + + MassAvg + 173.21 + + + + MassMono + 173.038474 + + + + Origin + A, C + + + + Source + hypothetical + + + + TermSpec + C-term + + MOD:00395 + MOD:00901 + MOD:00954 + PSI-MOD + + + MOD:00822 + S-(L-leucyl)-L-cysteine + + A protein modification that effectively crosslinks an L-leucine residue and an L-cysteine residue by a thioester bond to form S-(L-leucyl)-L-cysteine. + + 12591958 + PubMed + + + AA0412 + RESID + + + Cross-link 2. + + (2R)-2-amino-3-([(2S)-2-amino-4-methylpentanoyl]sulfanyl)propanoic acid + RESID-systematic + + + CROSSLNK Leucyl cysteine thioester (Cys-Leu) + UniProt-feature + + + leucine cysteine thioester + RESID-alternate + + + S-(2-amino-4-methylpentanoyl)cysteine + RESID-alternate + + + S-(L-leucyl)-L-cysteine + RESID-name + + + XLNK1LeuSCys + PSI-MOD-label + + + + DiffAvg + -18.02 + + + + DiffFormula + C 0 H -2 N 0 O -1 S 0 + + + + DiffMono + -18.010565 + + + + Formula + C 9 H 15 N 2 O 2 S 1 + + + + MassAvg + 215.29 + + + + MassMono + 215.085424 + + + + Origin + C, L + + + + Source + natural + + + + TermSpec + C-term + + MOD:00395 + MOD:00911 + MOD:00954 + PSI-MOD + + + MOD:00823 + S-(L-methionyl)-L-cysteine + + A protein modification that effectively crosslinks an L-methionine residue and an L-cysteine residue by a thioester bond to form S-(L-methionyl)-L-cysteine. + + 12146974 + PubMed + + + AA0413 + RESID + + + Cross-link 2. + + (2R)-2-amino-3-([(2S)-2-amino-4-(methylsulfanyl)butanoyl]sulfanyl)propanoic acid + RESID-systematic + + + CROSSLNK Methionyl cysteine thioester (Cys-Met) + UniProt-feature + + + methionine cysteine thioester + RESID-alternate + + + S-(2-amino-4-methylthiobutanoyl)cysteine + RESID-alternate + + + S-(L-methionyl)-L-cysteine + RESID-name + + + XLNK1MetSCys + PSI-MOD-label + + + + DiffAvg + -18.02 + + + + DiffFormula + C 0 H -2 N 0 O -1 S 0 + + + + DiffMono + -18.010565 + + + + Formula + C 8 H 13 N 2 O 2 S 2 + + + + MassAvg + 233.32 + + + + MassMono + 233.041845 + + + + Origin + C, M + + + + Source + natural + + + + TermSpec + C-term + + MOD:00395 + MOD:00913 + MOD:00954 + PSI-MOD + + + MOD:00824 + dehydroalanine (Tyr) + + A protein modification that effectively converts an L-tyrosine residue to dehydroalanine. + + 10220322 + PubMed + + + 1547888 + PubMed + + + 1815586 + PubMed + + + 2914619 + PubMed + + + 6838602 + PubMed + + + 7947813 + PubMed + + + 8239649 + PubMed + + + AA0181#TYR + RESID + + + 400 + UniMod + + + incidental to RESID:AA0178 + + 2,3-didehydroalanine + RESID-alternate + + + 2-aminoacrylic acid + RESID-alternate + + + 2-aminopropenoic acid + RESID-systematic + + + 4-methylidene-imidazole-5-one (MIO) active site + RESID-alternate + + + anhydroserine + RESID-alternate + + + dehydroalanine + RESID-name + + + Dha + RESID-alternate + + + dHAla(Tyr) + PSI-MOD-label + + + + DiffAvg + -94.11 + + + + DiffFormula + C -6 H -6 N 0 O -1 + + + + DiffMono + -94.041865 + + + + Formula + C 3 H 3 N 1 O 1 + + + + MassAvg + 69.06 + + + + MassMono + 69.021464 + + + + Origin + Y + + + + Source + natural + + + + TermSpec + none + + MOD:00919 + MOD:01168 + PSI-MOD + + + MOD:00825 + S-(L-phenylalanyl)-L-cysteine + + A protein modification that effectively crosslinks an L-phenylalanine residue and an L-cysteine residue by a thioester bond to form S-(L-phenylalaninyl)-L-cysteine. + + 12591958 + PubMed + + + AA0414 + RESID + + + Cross-link 2. + + (2R)-2-amino-3-([(2S)-2-amino-3-phenylpropanoyl]sulfanyl)propanoic acid + RESID-systematic + + + CROSSLNK Phenylalanyl cysteine thioester (Cys-Phe) + UniProt-feature + + + phenylalanine cysteine thioester + RESID-alternate + + + S-(2-amino-3-phenylpropanoyl)cysteine + RESID-alternate + + + S-(L-phenylalanyl)-L-cysteine + RESID-name + + + XLNK1PheSCys + PSI-MOD-label + + + + DiffAvg + -18.02 + + + + DiffFormula + C 0 H -2 N 0 O -1 S 0 + + + + DiffMono + -18.010565 + + + + Formula + C 12 H 13 N 2 O 2 S 1 + + + + MassAvg + 249.31 + + + + MassMono + 249.069774 + + + + Origin + C, F + + + + Source + natural + + + + TermSpec + C-term + + MOD:00395 + MOD:00914 + MOD:00954 + PSI-MOD + + + MOD:00826 + S-(L-threonyl)-L-cysteine + + A protein modification that effectively crosslinks an L-threonine residue and an L-cysteine residue by a thioester bond to form S-(L-threonyl)-L-cysteine. + + 15268951 + PubMed + + + AA0415 + RESID + + + Cross-link 2. + + (2R)-2-amino-3-([(2S,3R)-2-amino-3-hydroxybutanoyl]sulfanyl)propanoic acid + RESID-systematic + + + CROSSLNK Threonyl cysteine thioester (Cys-Thr) + UniProt-feature + + + S-(2-amino-3-hydroxybutanoyl)cysteine + RESID-alternate + + + S-(L-threonyl)-L-cysteine + RESID-name + + + threonine cysteine thioester + RESID-alternate + + + XLNK1ThrSCys + PSI-MOD-label + + + + DiffAvg + -18.02 + + + + DiffFormula + C 0 H -2 N 0 O -1 S 0 + + + + DiffMono + -18.010565 + + + + Formula + C 7 H 11 N 2 O 3 S 1 + + + + MassAvg + 203.24 + + + + MassMono + 203.049038 + + + + Origin + C, T + + + + Source + natural + + + + TermSpec + C-term + + MOD:00395 + MOD:00917 + MOD:00954 + PSI-MOD + + + MOD:00827 + S-(L-tyrosyl)-L-cysteine + + A protein modification that effectively crosslinks an L-tyrosine residue and an L-cysteine residue by a thioester bond to form S-(L-tyrosyl)-L-cysteine. + + 11807079 + PubMed + + + AA0416 + RESID + + + Cross-link 2. + + (2R)-2-amino-3-([(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]sulfanyl)propanoic acid + RESID-systematic + + + CROSSLNK Tyrosyl cysteine thioester (Cys-Tyr) + UniProt-feature + + + S-(L-tyrosyl)-L-cysteine + RESID-name + + + S-[2-amino-3-(4-hydoxyphenyl)propanoyl]cysteine + RESID-alternate + + + tyrosine cysteine thioester + RESID-alternate + + + XLNK1TyrSCys + PSI-MOD-label + + + + DiffAvg + -18.02 + + + + DiffFormula + C 0 H -2 N 0 O -1 S 0 + + + + DiffMono + -18.010565 + + + + Formula + C 12 H 13 N 2 O 3 S 1 + + + + MassAvg + 265.31 + + + + MassMono + 265.064688 + + + + Origin + C, Y + + + + Source + natural + + + + TermSpec + C-term + + MOD:00395 + MOD:00919 + MOD:00954 + PSI-MOD + + + MOD:00828 + S-(L-tryptophanyl)-L-cysteine + + A protein modification that effectively crosslinks an L-tryptophan residue and an L-cysteine residue by a thioester bond to form S-(L-tryptophanyl)-L-cysteine. + + 16030216 + PubMed + + + AA0417 + RESID + + + Cross-link 2. + + (2R)-2-amino-3-([(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]sulfanyl)propanoic acid + RESID-systematic + + + CROSSLNK Tryptophanyl cysteine thioester (Cys-Trp) + UniProt-feature + + + S-(L-tryptophanyl)-L-cysteine + RESID-name + + + S-[2-amino-3-(1H-indol-3-yl)propanoyl]cysteine + RESID-alternate + + + tryptophan cysteine thioester + RESID-alternate + + + XLNK1TrpSCys + PSI-MOD-label + + + + DiffAvg + -18.02 + + + + DiffFormula + C 0 H -2 N 0 O -1 S 0 + + + + DiffMono + -18.010565 + + + + Formula + C 14 H 14 N 3 O 2 S 1 + + + + MassAvg + 288.35 + + + + MassMono + 288.080673 + + + + Origin + C, W + + + + Source + natural + + + + TermSpec + C-term + + MOD:00395 + MOD:00918 + MOD:00954 + PSI-MOD + + + MOD:00829 + O-(L-phenylalanyl)-L-serine + + A protein modification that effectively crosslinks an L-phenylalanine residue and an L-serine residue by an ester bond to form S-(L-phenylalaninyl)-L-serine. + + 12591958 + PubMed + + + AA0418 + RESID + + + Cross-link 2. + + (2S)-2-amino-3-([(2S)-2-amino-3-phenylpropanoyl]oxy)propanoic acid + RESID-systematic + + + CROSSLNK Phenylalanyl serine ester (Ser-Phe) + UniProt-feature + + + O-(2-amino-3-phenylpropanoyl)serine + RESID-alternate + + + O-(L-phenylalanyl)-L-serine + RESID-name + + + phenylalanine serine ester + RESID-alternate + + + XLNK1PheOSer + PSI-MOD-label + + + + DiffAvg + -18.02 + + + + DiffFormula + C 0 H -2 N 0 O -1 S 0 + + + + DiffMono + -18.010565 + + + + Formula + C 12 H 13 N 2 O 3 + + + + MassAvg + 233.25 + + + + MassMono + 233.092617 + + + + Origin + F, S + + + + Source + natural + + + + TermSpec + C-term + + MOD:00885 + MOD:00914 + MOD:00916 + MOD:00954 + PSI-MOD + + + MOD:00830 + N-methyl-L-proline + + A protein modification that effectively converts an L-proline residue to an N-methyl-L-proline. + + 3127388 + PubMed + + + AA0419 + RESID + + + Polypeptides with monomethylated amino terminals can undergo premature cleavage during the coupling step of an Edman degradation. This can result in "preview" with both a residue and the following residue being seen from the first step on through a sequence [JSG]. + PSI-MOD-slim + + (S)-1-methylpyrrolidine-2-carboxylic acid + RESID-systematic + + + 1-methylpyrrolidine-2-carboxylic acid + RESID-alternate + + + hygric acid + RESID-alternate + + + MOD_RES N-methylproline + UniProt-feature + + + N-methyl-L-proline + RESID-name + + + N-methylated L-proline + PSI-MOD-alternate + + + NMePro + PSI-MOD-label + + + + DiffAvg + 14.03 + + + + DiffFormula + C 1 H 2 N 0 O 0 + + + + DiffMono + 14.015650 + + + + Formula + C 6 H 10 N 1 O 1 + + + + MassAvg + 112.15 + + + + MassMono + 112.076239 + + + + Origin + P + + + + Source + natural + + + + TermSpec + N-term + + MOD:01417 + MOD:01462 + MOD:01680 + PSI-MOD + + + MOD:00831 + N4-(N-acetylamino)glucosyl-L-asparagine + + A protein modification that effectively converts an L-asparagine residue to N4-(N-acetylaminoglucosyl)-L-asparagine. + + 111247 + PubMed + + + 1694179 + PubMed + + + 5490222 + PubMed + + + AA0151#var + RESID + + + PSI-MOD-slim + + HexNAc + PSI-MS-label + + + N4GlcNAcAsn + PSI-MOD-label + + + + DiffAvg + 203.19 + + + + DiffFormula + C 8 H 13 N 1 O 5 + + + + DiffMono + 203.079373 + + + + Formula + C 12 H 19 N 3 O 7 + + + + MassAvg + 317.30 + + + + MassMono + 317.122300 + + + + Origin + N + + + + Source + natural + + + + TermSpec + none + + MOD:00448 + MOD:01674 + PSI-MOD + + + MOD:00832 + N4-(N-acetylamino)galactosyl-L-asparagine + + A protein modification that effectively converts an L-asparagine residue to N4-(N-acetaminogalactosyl)-L-asparagine. + + 8262914 + PubMed + + + AA0420 + RESID + + + + (2S)-2-amino-4-(2-acetamido-2-deoxy-beta-D-galactopyranosyl)amino-4-oxobutanoic acid + RESID-systematic + + + HexNAc + PSI-MS-label + + + N4-(2-acetamido-2-deoxy-beta-D-galactopyranosyl)-L-asparagine + RESID-alternate + + + N4-(2-acetylamino-2-deoxy-beta-D-galactopyranosyl)-L-asparagine + RESID-alternate + + + N4-(N-acetylamino)galactosyl-L-asparagine + RESID-name + + + N4-(N-acetylgalactosaminyl)asparagine + RESID-alternate + + + N4-asparagine-beta-N-acetylgalactosaminide + RESID-alternate + + + N4-glycosyl-L-asparagine + RESID-alternate + + + N4-glycosylasparagine + RESID-alternate + + + N4GalNAcAsn + PSI-MOD-label + + + + DiffAvg + 203.19 + + + + DiffFormula + C 8 H 13 N 1 O 5 + + + + DiffMono + 203.079373 + + + + Formula + C 12 H 19 N 3 O 7 + + + + MassAvg + 317.30 + + + + MassMono + 317.122300 + + + + Origin + N + + + + Source + natural + + + + TermSpec + none + + MOD:00563 + MOD:01674 + PSI-MOD + + + MOD:00833 + N4-glucosyl-L-asparagine + + A protein modification that effectively converts an L-asparagine residue to N4-glucosyl-asparagine. + + 1569073 + PubMed + + + 3410849 + PubMed + + + AA0421 + RESID + + + + (2S)-2-amino-4-(D-glucopyranosyl)amino-4-oxobutanoic acid + RESID-systematic + + + CARBOHYD N-linked (Glc) + UniProt-feature + + + N4-(D-glucopyranosyl)-L-asparagine + RESID-alternate + + + N4-asparagine-glucoside + RESID-alternate + + + N4-glucosyl-L-asparagine + RESID-name + + + N4-glucosylasparagine + RESID-alternate + + + N4-glycosyl-L-asparagine + RESID-alternate + + + N4-glycosylasparagine + RESID-alternate + + + N4GlcAsn + PSI-MOD-label + + + + DiffAvg + 162.14 + + + + DiffFormula + C 6 H 10 N 0 O 5 + + + + DiffMono + 162.052823 + + + + Formula + C 10 H 16 N 2 O 7 + + + + MassAvg + 276.25 + + + + MassMono + 276.095751 + + + + Origin + N + + + + Source + natural + + + + TermSpec + none + + MOD:00433 + MOD:00761 + MOD:01346 + PSI-MOD + + + MOD:00834 + O-(N-acetylamino)fucosyl-L-serine + + A protein modification that effectively converts an L-serine residue to O3-(N-acetamino)fucosylserine. + + 11342554 + PubMed + + + 12010970 + PubMed + + + AA0422 + RESID + + + PSI-MOD-slim + + (2S)-2-amino-3-(2-acetamido-2-deoxy-beta-D-fucopyranosyloxy)propanoic acid + RESID-systematic + + + O-(2-acetylamino-2-deoxy-beta-D-fucopyranosyl)-L-serine + RESID-alternate + + + O-(N-acetylamino)fucosyl-L-serine + RESID-name + + + O-(N-acetylfucosaminyl)serine + RESID-alternate + + + O-seryl-beta-N-acetylfucosaminide + RESID-alternate + + + O3-(2-acetamido-2-deoxy-beta-D-fucopyranosyl)-L-serine + RESID-alternate + + + O3-(N-acetylfucosaminyl)serine + RESID-alternate + + + OFucNAcSer + PSI-MOD-label + + + + DiffAvg + 187.19 + + + + DiffFormula + C 8 H 13 N 1 O 4 + + + + DiffMono + 187.084458 + + + + Formula + C 11 H 18 N 2 O 6 + + + + MassAvg + 274.27 + + + + MassMono + 274.116486 + + + + Origin + S + + + + Source + natural + + + + TermSpec + none + + MOD:00002 + PSI-MOD + + + MOD:00835 + L-3-oxoalanine (Ser) + + A protein modification that effectively converts an L-serine residue to L-oxoalanine. + + 349 + DeltaMass + + + 14563551 + PubMed + + + 7628016 + PubMed + + + 8681943 + PubMed + + + 9276974 + PubMed + + + 9478923 + PubMed + + + AA0185#SER + RESID + + + 401#S + UniMod + + + PSI-MOD-slim + + (S)-2-amino-3-oxopropanoic acid + RESID-systematic + + + 2-amino-3-oxopropionic acid + RESID-alternate + + + C(alpha)-formylglycine + RESID-misnomer + + + dehydrogenated serine residue + UniMod-description + + + Didehydro + PSI-MS-label + + + formylglycine + UniMod-alternate + + + formylglycine (from serine) + DeltaMass-label + + + L-3-oxoalanine + RESID-name + + + L-amino-malonic acid semialdehyde + RESID-alternate + + + L-aminomalonaldehydic acid + RESID-alternate + + + L-serinesemialdehyde + RESID-misnomer + + + MOD_RES 3-oxoalanine (Ser) + UniProt-feature + + + oxoalanine + UniMod-alternate + + + + DiffAvg + -2.02 + + + + DiffFormula + C 0 H -2 N 0 O 0 + + + + DiffMono + -2.015650 + + + + Formula + C 3 H 3 N 1 O 2 + + + + MassAvg + 85.06 + + + + MassMono + 85.016378 + + + + Origin + S + + + + Source + natural + + + + TermSpec + none + + MOD:00916 + MOD:01169 + MOD:01888 + PSI-MOD + + + MOD:00836 + deuterium disubstituted residue + + A protein modification that effectively substitutes two (2)H deuterium atoms for two (1)H protium atoms. + + 18688235 + PubMed + + + PSI-MOD-slim + + D(H)2Res + PSI-MOD-label + + MOD:00786 + PSI-MOD + + + MOD:00837 + deuterium tetrasubstituted residue + + A protein modification that effectively substitutes four (2)H deuterium atoms for four (1)H protium atoms. + + 18688235 + PubMed + + + + D(H)4Res + PSI-MOD-label + + MOD:00786 + PSI-MOD + + + MOD:00838 + 3x(2)H labeled L-leucine + + A protein modification that effectively substitutes three (1)H protium atoms with three (2)H deuterium atoms to produce 3x(2)H labeled L-leucine. + + 262#L + UniMod + + + + D(H)3Leu + PSI-MOD-label + + + Label:2H(3) + PSI-MS-label + + + Trideuteration + UniMod-description + + + + DiffAvg + 3.02 + + + + DiffFormula + (1)H -3 (2)H 3 + + + + DiffMono + 3.018830 + + + + Formula + C 6 (1)H 8 (2)H 3 N 1 O 1 + + + + MassAvg + 116.10 + + + + MassMono + 116.102894 + + + + Origin + L + + + + Source + artifact + + + + TermSpec + none + + MOD:00585 + MOD:00911 + PSI-MOD + + + MOD:00839 + (2)H deuterium labeled residue + + A protein modification that effectively substitutes atoms of particular common isotopes with atoms of or groups containing deuteriumm, (2)H. + + 18688235 + PubMed + + + PSI-MOD-slim + MOD:00702 + PSI-MOD + + + MOD:00840 + isocyanate reagent derivatized residue + + A protein modification produced by formation of an adduct with an isocyanate compound. + + 18688235 + PubMed + + + PSI-MOD-slim + MOD:00848 + PSI-MOD + + + MOD:00841 + isothiocyanate reagent derivatized residue + + A protein modification produced by formation of an adduct with an isothiocyanate compound. + + 18688235 + PubMed + + + PSI-MOD-slim + MOD:00848 + PSI-MOD + + + MOD:00842 + (13)C labeled residue + + A protein modification that effectively substitutes atoms of particular common isotopes with atoms of or groups containing (13)C. + + 18688235 + PubMed + + + PSI-MOD-slim + MOD:00702 + PSI-MOD + + + MOD:00843 + (15)N labeled residue + + A protein modification that effectively substitutes atoms of particular common isotopes with atoms of or groups containing (15)N. + + 18688235 + PubMed + + + PSI-MOD-slim + MOD:00702 + PSI-MOD + + + MOD:00844 + (18)O labeled residue + + A protein modification that effectively substitutes atoms of particular common isotopes with atoms of or groups containing (18)O. + + 18688235 + PubMed + + + PSI-MOD-slim + MOD:00702 + PSI-MOD + + + MOD:00845 + (18)O substituted residue + + A protein modification that effectively substitutes one or more (18)O atoms for (16)O atoms. + + 18688235 + PubMed + + + PSI-MOD-slim + MOD:00844 + PSI-MOD + + + MOD:00846 + levuglandinyl (prostaglandin H2) adduct + + stub + + 18688235 + PubMed + + + MOD:00848 + PSI-MOD + + + MOD:00847 + (18)O disubstituted residue + + A protein modification that effectively substitutes two (18)O atom for two (16)O atoms. + + 18688235 + PubMed + + + PSI-MOD-slim + MOD:00845 + PSI-MOD + + + MOD:00848 + reagent derivatized residue + + A protein modification that is produced by formation of an adduct with a particular compound used as a reagent. + + 18688235 + PubMed + + + PSI-MOD-slim + MOD:01156 + PSI-MOD + + + MOD:00849 + potassium containing modified residue + + A protein modification that effectively substitutes a potassium atom for a hydrogen atom. + + 18688235 + PubMed + + + PSI-MOD-slim + + KRes + PSI-MOD-label + + MOD:00698 + PSI-MOD + + + MOD:00850 + unnatural residue + + A protein modification that inserts or replaces a residue with an unnatural residue that is not considered to be derived from a natural residue by some chemical process. + + 18688235 + PubMed + + + PSI-MOD-slim + MOD:01157 + PSI-MOD + + + MOD:00851 + (18)O labeled deamidated residue + + A protein modification that effectively replaces a carboxamido group with a carboxyl group labeled with (18)O. + + 18688235 + PubMed + + + PSI-MOD-slim + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00400 + MOD:00844 + PSI-MOD + + + MOD:00852 + 1x(18)O labeled deamidated residue + + A protein modification that effectively replaces a carboxamido group with a carboxyl group labeled with one (18)O. + + 8382902 + PubMed + + + 366 + UniMod + + + PSI-MOD-slim + + + DiffAvg + 2.99 + + + + DiffFormula + H -1 N -1 (18)O 1 + + + + DiffMono + 2.988262 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00851 + PSI-MOD + + + MOD:00853 + 2x(18)O labeled deamidated residue + + A protein modification that effectively replaces a carboxamido group with a carboxyl group labeled with two (18)O. + + 18688235 + PubMed + + + PSI-MOD-slim + + + DiffAvg + 4.99 + + + + DiffFormula + H -1 N -1 (16)O -1 (18)O 2 + + + + DiffMono + 4.992508 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00851 + PSI-MOD + + + MOD:00854 + protonated L-lysine (L-lysinium) residue + + A protein modification that effectively converts an L-lysine to L-lysinium (protonated L-lysine). + + 18688235 + PubMed + + + Some sources compute the difference formula for charged, quatenary modified lysine based on protonated lysine rather than neutral lysine residue. In such cases, a comparable difference formula can be calculated based on this derivative. + PSI-MOD-slim + + + DiffAvg + 1.01 + + + + DiffFormula + C 0 H 1 N 0 O 0 + + + + DiffMono + 1.007276 + + + + FormalCharge + 1+ + + + + Formula + C 6 H 13 N 2 O 1 + + + + MassAvg + 129.18 + + + + MassMono + 129.102239 + + + + Origin + K + + + + Source + natural + + + + TermSpec + none + + MOD:00912 + MOD:01699 + PSI-MOD + + + MOD:00855 + N6,N6,N6-trimethyl-L-lysine (from L-lysinium residue) + + A protein modification that effectively converts an L-lysinium (N6-protonated L-lysine) residue to an N6,N6,N6-trimethyl-L-lysine. + + 0 + DeltaMass + + + 12590383 + PubMed + + + 3145979 + PubMed + + + 4304194 + PubMed + + + 6778808 + PubMed + + + 7093227 + PubMed + + + 8453381 + PubMed + + + 37#K + UniMod + + + For amino acids residues, amine trimethylation can effectively only be accomplished with an aminium, protonated primary amino, group. This process accounts only for trimethylation and not protonation. The alternative N6Me3+Lys process (MOD:00083) accounts for both protonation and trimethylation. + PSI-MOD-slim + + N6Me3Lys + PSI-MOD-label + + + trimethylk + OMSSA-label + + + + DiffAvg + 42.08 + + + + DiffFormula + C 3 H 6 N 0 O 0 + + + + DiffMono + 42.046402 + + + + FormalCharge + 1+ + + + + Formula + C 9 H 19 N 2 O 1 + + + + MassAvg + 171.26 + + + + MassMono + 171.149190 + + + + Origin + MOD:00854 + + + + Source + natural + + + + TermSpec + none + + MOD:00430 + + derives_from + MOD:008540 + + PSI-MOD + + + MOD:00856 + protonated L-alanine (L-alaninium) residue + + A protein modification that effectively converts an L-alanine residue to an L-alaninium (protonated L-alanine). + + 18688235 + PubMed + + + PSI-MOD-slim + + + DiffAvg + 1.01 + + + + DiffFormula + C 0 H 1 N 0 O 0 + + + + DiffMono + 1.007276 + + + + FormalCharge + 1+ + + + + Formula + C 3 H 7 N 1 O 1 + + + + MassAvg + 73.09 + + + + MassMono + 73.052215 + + + + Origin + A + + + + Source + natural + + + + TermSpec + N-term + + MOD:00901 + MOD:01700 + PSI-MOD + + + MOD:00857 + N,N,N-trimethyl-L-alanine (from L-alaninium) + + A protein modification that effectively converts an L-alaninium (protonated L-alanine) residue to an N,N,N-trimethyl-L-alanine. + + 12590383 + PubMed + + + 332162 + PubMed + + + 3979397 + PubMed + + + 6778808 + PubMed + + + 7715456 + PubMed + + + 37#A + UniMod + + + For amino acids residues, amine trimethylation can effectively only be accomplished with an aminium, protonated primary amino, group. This process accounts only for trimethylation and not protonation. The alternative N2Me3+Ala process (MOD:00071) accounts for both protonation and trimethylation. + PSI-MOD-slim + + N2Me3Ala + PSI-MOD-label + + + + DiffAvg + 42.08 + + + + DiffFormula + C 3 H 6 N 0 O 0 + + + + DiffMono + 42.046402 + + + + FormalCharge + 1+ + + + + Formula + C 6 H 13 N 1 O 1 + + + + MassAvg + 115.18 + + + + MassMono + 115.099165 + + + + Origin + MOD:00856 + + + + Source + natural + + + + TermSpec + N-term + + MOD:01687 + + derives_from + MOD:008560 + + PSI-MOD + + + MOD:00858 + D-alanine (Ser) + + A protein modification that effectively converts an L-serine residue to D-alanine. + + 7961627 + PubMed + + + AA0191#SER + RESID + + + + (R)-2-aminopropanoic acid + RESID-systematic + + + D-Ala(Ser) + PSI-MOD-label + + + D-alanine + RESID-name + + + MOD_RES D-alanine (Ser) + UniProt-feature + + + + DiffAvg + -16.00 + + + + DiffFormula + C 0 H 0 N 0 O -1 + + + + DiffMono + -15.994915 + + + + Formula + C 3 H 5 N 1 O 1 + + + + MassAvg + 71.08 + + + + MassMono + 71.037114 + + + + Origin + S + + + + Source + natural + + + + TermSpec + none + + MOD:00862 + MOD:00916 + MOD:01161 + PSI-MOD + + + MOD:00859 + modified residue that can arise from different natural residues + + A protein modification that can be derived from different natural residues by different chemical processes. + + 18688235 + PubMed + + + PSI-MOD-slim + + + Origin + X + + + + Source + natural + + + + TermSpec + none + + MOD:01157 + PSI-MOD + + + MOD:00860 + sulfur containing modified residue + + A protein modification that produces an amino acid residue containing an exogenous sulfur atom. + + 18688235 + PubMed + + + PSI-MOD-slim + MOD:01156 + PSI-MOD + + + MOD:00861 + phosphorus containing modified residue + + A protein modification that produces an amino acid residue containing a phosphorus atom. + + 18688235 + PubMed + + + PSI-MOD-slim + MOD:01156 + PSI-MOD + + + MOD:00862 + D-alanine + + A protein modification that effectively converts a source amino acid residue to D-alanine. + + 29949 + ChEBI + + + 7287302 + PubMed + + + 7961627 + PubMed + + + AA0191 + RESID + + + + (R)-2-aminopropanoic acid + RESID-systematic + + + D-alanine + RESID-name + + + MOD_RES D-alanine (Ala) + UniProt-feature + + + MOD_RES D-alanine (Ser) + UniProt-feature + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + C 3 H 5 N 1 O 1 + + + + MassAvg + 71.08 + + + + MassMono + 71.037114 + + + + Origin + X + + + + Source + natural + + + + TermSpec + none + + MOD:00664 + MOD:00859 + PSI-MOD + + + MOD:00863 + D-allo-threonine + + A protein modification that effectively converts an L-threonine residue to D-allo-threonine. + + 32826 + ChEBI + + + 18025465 + PubMed + + + 6893271 + PubMed + + + AA0199 + RESID + + + + (2R,3R)-2-amino-3-hydroxybutanoic acid + RESID-systematic + + + D-Thr + PSI-MOD-label + + + D-threonine + RESID-name + + + MOD_RES D-threonine + UniProt-feature + + + + DiffAvg + 0.00 + + + + DiffFormula + C 0 H 0 N 0 O 0 + + + + DiffMono + 0.000000 + + + + Formula + C 4 H 7 N 1 O 2 + + + + MassAvg + 101.10 + + + + MassMono + 101.047678 + + + + Origin + T + + + + Source + natural + + + + TermSpec + none + + MOD:00664 + MOD:00917 + PSI-MOD + + + MOD:00864 + tris-L-cysteinyl L-histidino diiron disulfide + + A protein modification that effectively converts three L-cysteine residues, an L-histidine residue and a two-iron two-sulfur cluster to tris-L-cysteinyl L-histidino diiron disulfide. + + 17766439 + PubMed + + + 17766440 + PubMed + + + AA0438 + RESID + + + Cross-link 4. + + CDGSH domain iron-sulfur cluster + RESID-alternate + + + di-mu-sulfido(bis-S-cysteinyliron)(S-cysteinyl-N3'-histidinoiron) + RESID-systematic + + + METAL Iron-sulfur (2Fe-2S) + UniProt-feature + + + METAL Iron-sulfur (2Fe-2S); via pros nitrogen + UniProt-feature + + + tris-L-cysteinyl L-histidino diiron disulfide + RESID-name + + + + DiffAvg + 171.78 + + + + DiffFormula + C 0 Fe 2 H -4 N 0 O 0 S 2 + + + + DiffMono + 171.783814 + + + + FormalCharge + 2- + + + + Formula + C 15 Fe 2 H 18 N 6 O 4 S 5 + + + + MassAvg + 618.34 + + + + MassMono + 617.870280 + + + + Origin + C, C, C, H + + + + Source + natural + + + + TermSpec + none + + MOD:00739 + MOD:00905 + MOD:00909 + PSI-MOD + + + MOD:00865 + N-aspartyl-glycosylsphingolipidinositolethanolamine + + A protein modification that effectively converts an L-aspartic acid residue to N-aspartyl-glycosylsphingolipidinositolethanolamine. + + AA0439 + RESID + + + + GSIAsp + PSI-MOD-label + + + LIPID GPI-like-anchor amidated aspartate + UniProt-feature + + + N-aspartyl-glycosylsphingolipidinositolethanolamine + RESID-name + + + + DiffAvg + 123.05 + + + + DiffFormula + C 2 H 6 N 1 O 3 P 1 + + + + DiffMono + 123.008530 + + + + Formula + C 6 H 12 N 2 O 7 P 1 + + + + MassAvg + 255.14 + + + + MassMono + 255.038212 + + + + Origin + D + + + + Source + hypothetical + + + + TermSpec + C-term + + MOD:00466 + MOD:00904 + PSI-MOD + + + MOD:00866 + dihydroxylated proline + + A protein modification that effectively converts an L-proline residue to one of several dihydroxylated proline residues, such as (2S,3R,4R)-3,4-dihydroxyproline or (2S,3R,4S)-3,4-dihydroxyproline. + + 18688235 + PubMed + + + + Hy2Pro + PSI-MOD-label + + + + DiffAvg + 32.00 + + + + DiffFormula + C 0 H 0 N 0 O 2 + + + + DiffMono + 31.989829 + + + + Formula + C 5 H 7 N 1 O 3 + + + + MassAvg + 129.12 + + + + MassMono + 129.042593 + + + + Origin + P + + + + Source + natural + + + + TermSpec + none + + MOD:00428 + MOD:00678 + PSI-MOD + + + MOD:00867 + L-cysteinyl-L-selenocysteine (Cys-Cys) + + A protein modification that effectively cross-links an L-cysteine residue and an L-cysteine converted to an L-selenocysteine residue to form L-cysteinyl-L-selenocystine. + + 10801974 + PubMed + + + 12911312 + PubMed + + + 17177418 + PubMed + + + AA0358#CYS + RESID + + + Cross-link 2. + + (R,R)-2-amino-3-[3-(2-aminopropanoic acid)sulfanyl]selanylpropanoic acid + RESID-systematic + + + CROSSLNK Cysteinyl-selenocysteine (Cys-Sec) + UniProt-feature + + + CROSSLNK Cysteinyl-selenocysteine (Sec-Cys) + UniProt-feature + + + L-cysteinyl-L-selenocysteine + RESID-name + + + + DiffAvg + 44.90 + + + + DiffFormula + C 0 H -2 N 0 O 0 S -1 Se 1 + + + + DiffMono + 45.928800 + + + + Formula + C 6 H 8 N 2 O 2 S 1 Se 1 + + + + MassAvg + 251.17 + + + + MassMono + 251.947170 + + + + Origin + C, C + + + + Source + natural + + + + TermSpec + none + + MOD:00007 + MOD:01627 + PSI-MOD + + + MOD:00868 + natural, non-standard encoded residue + + A protein modification that inserts or replaces a residue with a natural, non-standard encoded residue, such as N-formyl-L-methionine, L-selenocysteine, or L-pyrrolysine. + + 18688235 + PubMed + + + These are produced exclusively by modification of amino acids acylated to special tRNA before incorporation by ribosomes into proteins. For this reason, they have also been referred to as pre-translational modifications. + PSI-MOD-slim + + + Origin + X + + + + Source + natural + + MOD:00009 + PSI-MOD + + + MOD:00869 + L-alanine residue (Asp) + + A protein modification that effectively converts an L-aspartic acid residue to L-alanine. + + 17138938 + PubMed + + + AA0001#ASP + RESID + + + This has been reported to occur by a natural process of beta-decarboxylation. + + (2S)-2-aminopropanoic acid + RESID-systematic + + + 2-aminopropionic acid + RESID-alternate + + + 2-azanylpropanoic acid + RESID-alternate + + + alpha-alanine + RESID-alternate + + + alpha-aminopropionic acid + RESID-alternate + + + Asp(Ala) + PSI-MOD-label + + + L-alanine + RESID-name + + + MOD_RES Beta-decarboxylated aspartate + UniProt-feature + + + + DiffAvg + -44.01 + + + + DiffFormula + C -1 H 0 N 0 O -2 + + + + DiffMono + -43.989829 + + + + Formula + C 3 H 5 N 1 O 1 + + + + MassAvg + 71.08 + + + + MassMono + 71.037114 + + + + Origin + D + + + + Source + natural + + + + TermSpec + none + + MOD:00010 + MOD:00904 + PSI-MOD + + + MOD:00870 + phenyl isocyanate derivatized residue + + A protein modification produced by formation of an adduct with phenyl isocyanate. + + 411 + UniMod + + + From UniMod with no citation. + PSI-MOD-slim + + phenyl isocyanate + UniMod-description + + + Phenylisocyanate + PSI-MS-label + + + + DiffAvg + 119.12 + + + + DiffFormula + C 7 H 5 N 1 O 1 + + + + DiffMono + 119.037114 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + N-term + + MOD:00840 + PSI-MOD + + + MOD:00871 + (2)H5-phenyl isocyanate derivatized residue + + A protein modification produced by formation of an adduct with (2)H5-phenyl isocyanate. + + 412 + UniMod + + + From UniMod with no citation. + PSI-MOD-slim + + d5-phenyl isocyanate + UniMod-description + + + Phenylisocyanate:2H(5) + PSI-MS-label + + + + DiffAvg + 124.07 + + + + DiffFormula + C 7 (2)H 5 N 1 O 1 + + + + DiffMono + 124.068498 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + N-term + + MOD:00870 + MOD:01431 + PSI-MOD + + + MOD:00872 + L-isoglutamyl monoglutamic acid + + OBSOLETE because redundant and identical to MOD:01970. Remap to MOD:01970. + + 10747868 + PubMed + + + 15525938 + PubMed + + + 1680872 + PubMed + + + AA0202#var + RESID + + + 450 + UniMod + + + + Glu + UniMod-interim + + + monoglutamyl + UniMod-description + + + N alpha -(gamma-Glutamyl)-Glu + DeltaMass-label + + + + DiffAvg + 129.12 + + + + DiffFormula + C 5 H 7 N 1 O 3 + + + + DiffMono + 129.042593 + + + + Formula + C 10 H 14 N 2 O 6 + + + + MassAvg + 258.23 + + + + MassMono + 258.085186 + + + + Origin + E + + + + Source + natural + + + + TermSpec + none + + 1 + PSI-MOD + + + MOD:00873 + L-isoglutamyl diglutamic acid + + A protein modification that effectively converts an L-glutamic acid residue to isoglutamyl glutamyl-glutamic acid, forming an isopeptide bond with a diglutamic acid. + + 0 + DeltaMass + + + 10747868 + PubMed + + + 1680872 + PubMed + + + AA0202#var + RESID + + + 451 + UniMod + + + + diglutamyl + UniMod-description + + + GluGlu + UniMod-interim + + + + DiffAvg + 258.23 + + + + DiffFormula + C 10 H 14 N 2 O 6 + + + + DiffMono + 258.085186 + + + + Formula + C 15 H 21 N 3 O 9 + + + + MassAvg + 387.35 + + + + MassMono + 387.127779 + + + + Origin + E + + + + Source + natural + + + + TermSpec + none + + MOD:00207 + PSI-MOD + + + MOD:00874 + L-isoglutamyl triglutamic acid + + A protein modification that effectively converts an L-glutamic acid residue to isoglutamyl glutamyl-glutamyl-glutamic acid, forming an isopeptide bond with a triglutamic acid. + + 0 + DeltaMass + + + 10747868 + PubMed + + + 1680872 + PubMed + + + AA0202#var + RESID + + + 452 + UniMod + + + From DeltaMass: Average Mass: 388. + + GluGluGlu + UniMod-interim + + + N alpha -(gamma-Glutamyl)-Glu3 + DeltaMass-label + + + triglutamyl + UniMod-description + + + + DiffAvg + 387.35 + + + + DiffFormula + C 15 H 21 N 3 O 9 + + + + DiffMono + 387.127779 + + + + Formula + C 20 H 28 N 4 O 12 + + + + MassAvg + 516.46 + + + + MassMono + 516.170372 + + + + Origin + E + + + + Source + natural + + + + TermSpec + none + + MOD:00207 + PSI-MOD + + + MOD:00875 + L-isoglutamyl tetraglutamic acid + + A protein modification that effectively converts an L-glutamic acid residue to isoglutamyl glutamyl-glutamyl-glutamyl-glutamic acid, forming an isopeptide bond with a tetraglutamic acid. + + 10747868 + PubMed + + + 1680872 + PubMed + + + AA0202#var + RESID + + + 453 + UniMod + + + + GluGluGluGlu + UniMod-interim + + + tetraglutamyl + UniMod-description + + + + DiffAvg + 516.46 + + + + DiffFormula + C 20 H 28 N 4 O 12 + + + + DiffMono + 516.170372 + + + + Formula + C 25 H 35 N 5 O 15 + + + + MassAvg + 645.57 + + + + MassMono + 645.212965 + + + + Origin + E + + + + Source + natural + + + + TermSpec + none + + MOD:00207 + PSI-MOD + + + MOD:00876 + hexosaminylated residue + + A protein modification that effectively replaces a hydrogen atom of an amino acid residue or of a modifying group with a hexosamine sugar group through a glycosidic bond. + + 454 + UniMod + + + + HexN + PSI-MS-label + + + Hexosamine + UniMod-description + + + Hexosamines (GalN, GlcN) + DeltaMass-label + + + + DiffAvg + 161.16 + + + + DiffFormula + C 6 H 11 N 1 O 4 + + + + DiffMono + 161.068808 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + natural + + + + TermSpec + none + + MOD:00693 + PSI-MOD + + + MOD:00877 + imidoester crosslink dimethyl pimelimidate singly attached + + dimethyl pimelimidate modification from UniMod + + 455 + UniMod + + + + One end of crosslink attached, one end free + UniMod-description + + + Xlink:DMP-s + UniMod-interim + + + + DiffAvg + 154.21 + + + + DiffFormula + C 8 H 14 N 2 O 1 + + + + DiffMono + 154.110613 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + PSI-MOD + + + MOD:00878 + imidoester crosslink dimethyl pimelimidate doubly attached + + dimethyl pimelimidate modification from UniMod - Mechanism of the reaction of imidoesters with amines + + 7171546 + PubMed + + + 456 + UniMod + + + + Both ends of crosslink attached to same peptide + UniMod-description + + + Xlink:DMP + UniMod-interim + + + + DiffAvg + 122.17 + + + + DiffFormula + C 7 H 10 N 2 + + + + DiffMono + 122.084398 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + PSI-MOD + + + MOD:00879 + naphthalene-2,3-dicarboxaldehyde + + modification from UniMod + + 2081203 + PubMed + + + 457 + UniMod + + + + naphthalene-2,3-dicarboxaldehyde + UniMod-description + + + NDA + UniMod-interim + + + + DiffAvg + 175.19 + + + + DiffFormula + C 13 H 5 N 1 + + + + DiffMono + 175.042199 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + PSI-MOD + + + MOD:00880 + 6x(13)C labeled 4-sulfophenyl isothiocyanate derivatized residue + + A protein modification produced by formation of an adduct with 6x(13)C labeled 4-sulfophenyl isothiocyanate. + + 15536630 + PubMed + + + 16526082 + PubMed + + + 464 + UniMod + + + + 4-sulfophenyl isothiocyanate (Heavy C13) + UniMod-description + + + SPITC:13C(6) + PSI-MS-label + + + + DiffAvg + 220.99 + + + + DiffFormula + (12)C 1 (13)C 6 H 5 N 1 O 3 S 2 + + + + DiffMono + 220.991214 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00584 + MOD:01428 + PSI-MOD + + + MOD:00881 + N-reductive amination-D + + OBSOLETE because UniMod entry 465 megerd with 199. Remap to MOD:00552 DiMethyl-CH2D. + + 9252331 + PubMed + + + 465 + UniMod + + + + + DiffAvg + 32.06 + + + + DiffFormula + C 2 (2)H 4 + + + + DiffMono + 32.056407 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + 1 + PSI-MOD + + + MOD:00882 + S-(2-aminoethyl)cysteine (Ser) + + A protein modification that effectively converts an L-serine residue to S-(2-aminoethyl)cysteine. + + 171 + DeltaMass + + + 12923550 + PubMed + + + 472#S + UniMod + + + From DeltaMass: Average Mass: 146 Abbreviation:-AECys_ Formula:C5H10O2N1S1 Monoisotopic Mass Change:146.051 Average Mass Change:146.214 References:PE Sciex. + + AEC-MAEC + UniMod-interim + + + Aminoethyl Cysteinyl (AECys) + DeltaMass-label + + + aminoethylcysteine + UniMod-description + + + + DiffAvg + 59.13 + + + + DiffFormula + C 2 H 5 N 1 O -1 S 1 + + + + DiffMono + 59.019356 + + + + Formula + C 5 H 10 N 2 O 1 S 1 + + + + MassAvg + 146.21 + + + + MassMono + 146.051384 + + + + Origin + S + + + + Source + artifact + + + + TermSpec + none + + MOD:00916 + PSI-MOD + + + MOD:00883 + C1-amidated residue + + A protein modification that effectively replaces a 1-carboxyl group (usually referred to as the alpha-carboxyl) with a carboxamido group. + + 0 + DeltaMass + + + 2 + UniMod + + + The normal biological process involves formation of an amide of an amino acid residue in a peptide sequence where it is followed by a glycine and two basic residues, either arginine or lysine, although in some taxa only one basic residue is required. The peptide is cleaved after the basic residues, glycine is oxidized to hydroxyglycine, which decomposes to release a carboxamide C-terminal [JSG]. + PSI-MOD-slim + + alpha-amidated residue + PSI-MOD-alternate + + + Amidated + PSI-MS-label + + + Amidation + UniMod-description + + + Amide formation (C terminus) + DeltaMass-label + + + ctermamide + OMSSA-label + + + ResN + PSI-MOD-label + + + + DiffAvg + -0.98 + + + + DiffFormula + C 0 H 1 N 1 O -1 + + + + DiffMono + -0.984016 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + natural + + + + TermSpec + C-term + + MOD:00674 + PSI-MOD + + + MOD:00884 + S-aminoethylcysteine (Cys) + + A protein modification that effectively converts an L-cysteine residue to S-2-aminoethylcysteine. + + 1175632 + PubMed + + + 18688235 + PubMed + + + This modified residue is a chemical isolog of L-lysine for trypsin hydolysis produced from L-cysteine by aziridine. + PSI-MOD-slim + + 4-thialysine + PSI-MOD-alternate + + + L-cysteine aziridine adduct + PSI-MOD-alternate + + + S-(2-aminoethyl)-L-cysteine + PSI-MOD-alternate + + + + DiffAvg + 43.07 + + + + DiffFormula + C 2 H 5 N 1 O 0 S 0 + + + + DiffMono + 43.042199 + + + + Formula + C 5 H 10 N 2 O 1 S 1 + + + + MassAvg + 146.21 + + + + MassMono + 146.051384 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + MOD:00905 + PSI-MOD + + + MOD:00885 + ester crosslinked residues + + A protein modification that crosslinks two residues by formation of an ester bond. + + 18688235 + PubMed + + + MOD:00033 + PSI-MOD + + + MOD:00886 + 6'-chloro-L-tryptophan + + A protein modification that effectively converts an L-tryptophan residue to 6'-chloro-L-tryptophan. + + 9033387 + PubMed + + + AA0180 + RESID + + + 936#W + UniMod + + + The UniMod:340 cross-reference to RESID:AA0180 is incorrect. RESID:AA0180 should be cross-referenced by UniMod:936 [JSG]. + + (2S)-2-amino-3-(6-chloro-1H-indol-3-yl)propanoic acid + RESID-systematic + + + 6'-chloro-L-tryptophan + RESID-name + + + 6'-ClTrp + PSI-MOD-label + + + MOD_RES 6'-chlorotryptophan + UniProt-feature + + + + DiffAvg + 34.44 + + + + DiffFormula + C 0 Cl 1 H -1 N 0 O 0 + + + + DiffMono + 33.961028 + + + + Formula + C 11 Cl 1 H 9 N 2 O 1 + + + + MassAvg + 220.66 + + + + MassMono + 220.040341 + + + + Origin + W + + + + Source + natural + + + + TermSpec + none + + MOD:01913 + PSI-MOD + + + MOD:00887 + methylated aspartic acid + + A protein modification that effectively converts an L-aspartic acid residue to a methylated aspartic acid, such as aspartic acid 4-methyl ester. + + 18688235 + PubMed + + + MOD:00427 + MOD:00904 + PSI-MOD + + + MOD:00888 + protonated L-proline (L-prolinium) residue + + A protein modification that effectively converts an L-proline to an L-prolinium (protonated L-proline). + + 18688235 + PubMed + + + PSI-MOD-slim + + + DiffAvg + 1.01 + + + + DiffFormula + C 0 H 1 N 0 O 0 + + + + DiffMono + 1.007276 + + + + FormalCharge + 1+ + + + + Formula + C 5 H 9 N 1 O 1 + + + + MassAvg + 99.13 + + + + MassMono + 99.067865 + + + + Origin + P + + + + Source + natural + + + + TermSpec + N-term + + MOD:00915 + MOD:01700 + PSI-MOD + + + MOD:00889 + N,N-dimethyl-L-proline (from L-prolinium) + + A protein modification that effectively converts an L-prolinium (charged L-proline) residue to N,N-dimethyl-L-proline. + + 36#P + UniMod + + + PSI-MOD-slim + + + DiffAvg + 28.05 + + + + DiffFormula + C 2 H 4 N 0 O 0 + + + + DiffMono + 28.030752 + + + + FormalCharge + 1+ + + + + Formula + C 7 H 13 N 1 O 1 + + + + MassAvg + 127.19 + + + + MassMono + 127.099165 + + + + Origin + MOD:00888 + + + + Source + natural + + + + TermSpec + N-term + + MOD:00075 + + derives_from + MOD:008880 + + PSI-MOD + + + MOD:00890 + phosphorylated L-histidine + + A protein modification that effectively converts an L-histidine residue to a phosphorylated L-histidine, such as pros-phosphohistidine, or tele-phosphohistidine. + + 21#H + UniMod + + + PSI-MOD-slim + + mod192 + OMSSA-label + + + NPhosHis + PSI-MOD-label + + + Phospho + PSI-MS-label + + + phosphohistidine + PSI-MOD-alternate + + + + DiffAvg + 79.98 + + + + DiffFormula + C 0 H 1 N 0 O 3 P 1 + + + + DiffMono + 79.966331 + + + + Formula + C 6 H 8 N 3 O 4 P 1 + + + + MassAvg + 217.12 + + + + MassMono + 217.025242 + + + + Origin + H + + + + Source + natural + + + + TermSpec + none + + MOD:00909 + MOD:01456 + PSI-MOD + + + MOD:00891 + D-serine + + A protein modification that effectively converts a source amino acid residue to D-serine. + + 29998 + ChEBI + + + 6893271 + PubMed + + + 7973665 + PubMed + + + AA0195 + RESID + + + + (R)-2-amino-3-hydroxypropanoic acid + RESID-systematic + + + D-Ser + PSI-MOD-label + + + D-serine + RESID-name + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + C 3 H 5 N 1 O 2 + + + + MassAvg + 87.08 + + + + MassMono + 87.032028 + + + + Origin + X + + + + Source + natural + + + + TermSpec + none + + MOD:00664 + MOD:00859 + PSI-MOD + + + MOD:00892 + D-serine (Cys) + + A protein modification that effectively converts an L-cysteine residue to D-serine. + + 18025465 + PubMed + + + 6893271 + PubMed + + + AA0195#CYS + RESID + + + + (R)-2-amino-3-hydroxypropanoic acid + RESID-systematic + + + D-serine + RESID-name + + + + DiffAvg + -16.06 + + + + DiffFormula + C 0 H 0 N 0 O 1 S -1 + + + + DiffMono + -15.977156 + + + + Formula + C 3 H 5 N 1 O 2 + + + + MassAvg + 87.08 + + + + MassMono + 87.032028 + + + + Origin + C + + + + Source + natural + + + + TermSpec + none + + MOD:00891 + MOD:00905 + PSI-MOD + + + MOD:00893 + residues isobaric at 128.0-128.1 + + Natural or modified residues with a mass of 128.0-128.1 Da. + + 18688235 + PubMed + + + PSI-MOD-slim + MOD:00616 + PSI-MOD + + + MOD:00894 + residues isobaric at 128.058578 Da + + Natural or modified resiues with a mass of 128.058578 Da. + + 18688235 + PubMed + + + PSI-MOD-slim + MOD:00569 + MOD:00893 + PSI-MOD + + + MOD:00895 + FAD modified residue + + A protein modification that effectively results from forming an adduct with a compound containing a flavin adenine dinucleotide (FAD) group. + + 18688235 + PubMed + + + PSI-MOD-slim + MOD:00697 + MOD:00861 + PSI-MOD + + + MOD:00896 + FMN modified residue + + A protein modification that effectively results from forming an adduct with a compound containing a riboflavin phosphate (flavin mononucleotide, FMN) group. + + 18688235 + PubMed + + + PSI-MOD-slim + MOD:00697 + MOD:00861 + PSI-MOD + + + MOD:00897 + N-acetyl-S-archeol-cysteine + + A protein modification that effectively converts an L-cysteine residue to N-acetyl-S-archeol-L-cysteine. + + AA0043#var + RESID + + + AA0223#var + RESID + + + + + DiffAvg + 677.20 + + + + DiffFormula + C 45 H 88 N 0 O 3 S 0 + + + + DiffMono + 676.673347 + + + + Formula + C 48 H 93 N 1 O 4 S 1 + + + + MassAvg + 780.34 + + + + MassMono + 779.682531 + + + + Origin + C + + + + Source + natural + + + + TermSpec + N-term + + MOD:00905 + + has_functional_parent + MOD:000520 + + + has_functional_parent + MOD:002280 + + PSI-MOD + + + MOD:00898 + S-(sn-1-2-oleoyl-3-palmitoyl-glycerol)cysteine + + A protein modification that effectively converts an L-cysteine residue to S-(sn-1-2-oleoyl-3-palmitoyl-glycerol)cysteine. + + 10896212 + PubMed + + + 4575979 + PubMed + + + 9056182 + PubMed + + + AA0107#var + RESID + + + 377 + UniMod + + + Incidental to RESID:AA0060. + + Diacylglycerol + PSI-MS-label + + + diacylglycerol + UniMod-description + + + + DiffAvg + 576.95 + + + + DiffFormula + C 37 H 68 N 0 O 4 S 0 + + + + DiffMono + 576.511761 + + + + Formula + C 40 H 73 N 1 O 5 S 1 + + + + MassAvg + 680.09 + + + + MassMono + 679.520945 + + + + Origin + C + + + + Source + natural + + + + TermSpec + none + + MOD:00116 + PSI-MOD + + + MOD:00899 + N-palmitoyl-S-diacylglycerol-L-cysteine + + A protein modification that effectively converts an L-cysteine residue to N-palmitoyl-S-diacylglycerol-L-cysteine. + + AA0069#var + RESID + + + AA0107#var + RESID + + + + + Origin + C + + + + Source + natural + + + + TermSpec + N-term + + MOD:00905 + + has_functional_parent + MOD:000690 + + + has_functional_parent + MOD:001160 + + PSI-MOD + + + MOD:00900 + N-palmitoyl-S-(sn-1-2-oleoyl-3-palmitoyl-glycerol)cysteine + + A protein modification that effectively converts an L-cysteine residue to N-palmitoyl-S-(sn-1-2-oleoyl-3-palmitoyl-glycerol)cysteine. + + 18688235 + PubMed + + + + (R)-2-hexadecanoylamino-3-[(S)-2-((Z)-9-octadecenoyloxy)-3-(hexadecanoyloxy)propyl]sulfanylpropanoic acid + PSI-MOD-alternate + + + 2-hexadecanoylamino-3-[(S)-2-((Z)-9-octadecenoyloxy)-3-(hexadecanoyloxy)propyl]thiopropanoic acid + PSI-MOD-alternate + + + + DiffAvg + 815.36 + + + + DiffFormula + C 53 H 98 N 0 O 5 S 0 + + + + DiffMono + 814.741426 + + + + Formula + C 56 H 103 N 1 O 6 S 1 + + + + MassAvg + 918.50 + + + + MassMono + 917.750611 + + + + Origin + C + + + + Source + natural + + + + TermSpec + N-term + + MOD:00899 + + has_functional_parent + MOD:000690 + + + has_functional_parent + MOD:008980 + + PSI-MOD + + + MOD:00901 + modified L-alanine residue + + A protein modification that modifies an L-alanine. + + 18688235 + PubMed + + + PSI-MOD-slim + + ModAla + PSI-MOD-label + + + + Origin + A + + MOD:01157 + PSI-MOD + + + MOD:00902 + modified L-arginine residue + + A protein modification that modifies an L-arginine residue. + + 18688235 + PubMed + + + PSI-MOD-slim + + ModArg + PSI-MOD-label + + + + Origin + R + + MOD:01157 + PSI-MOD + + + MOD:00903 + modified L-asparagine residue + + A protein modification that modifies an L-asparagine residue. + + 18688235 + PubMed + + + PSI-MOD-slim + + ModAsn + PSI-MOD-label + + + + Origin + N + + MOD:01157 + PSI-MOD + + + MOD:00904 + modified L-aspartic acid residue + + A protein modification that modifies an L-aspartic acid residue. + + 18688235 + PubMed + + + PSI-MOD-slim + + ModAsp + PSI-MOD-label + + + + Origin + D + + MOD:01157 + PSI-MOD + + + MOD:00905 + modified L-cysteine residue + + A protein modification that modifies an L-cysteine residue. + + 18688235 + PubMed + + + PSI-MOD-slim + + ModCys + PSI-MOD-label + + + + Origin + C + + MOD:01157 + PSI-MOD + + + MOD:00906 + modified L-glutamic acid residue + + A protein modification that modifies an L-glutamic acid residue. + + 18688235 + PubMed + + + PSI-MOD-slim + + ModGlu + PSI-MOD-label + + + + Origin + E + + MOD:01157 + PSI-MOD + + + MOD:00907 + modified L-glutamine residue + + A protein modification that modifies an L-glutamine residue. + + 18688235 + PubMed + + + PSI-MOD-slim + + ModGln + PSI-MOD-label + + + + Origin + Q + + MOD:01157 + PSI-MOD + + + MOD:00908 + modified glycine residue + + A protein modification that modifies a glycine residue. + + 18688235 + PubMed + + + PSI-MOD-slim + + ModGly + PSI-MOD-label + + + + Origin + G + + MOD:01157 + PSI-MOD + + + MOD:00909 + modified L-histidine residue + + A protein modification that modifies an L-histidine residue. + + 18688235 + PubMed + + + PSI-MOD-slim + + ModHis + PSI-MOD-label + + + + Origin + H + + MOD:01157 + PSI-MOD + + + MOD:00910 + modified L-isoleucine residue + + A protein modification that modifies an L-isoleucine residue. + + 18688235 + PubMed + + + PSI-MOD-slim + + ModIle + PSI-MOD-label + + + + Origin + I + + MOD:01157 + PSI-MOD + + + MOD:00911 + modified L-leucine residue + + A protein modification that modifies an L-leucine residue. + + 18688235 + PubMed + + + PSI-MOD-slim + + ModLeu + PSI-MOD-label + + + + Origin + L + + MOD:01157 + PSI-MOD + + + MOD:00912 + modified L-lysine residue + + A protein modification that modifies an L-lysine residue. + + 18688235 + PubMed + + + PSI-MOD-slim + + ModLys + PSI-MOD-label + + + + Origin + K + + MOD:01157 + PSI-MOD + + + MOD:00913 + modified L-methionine residue + + A protein modification that modifies an L-methionine residue. + + 18688235 + PubMed + + + PSI-MOD-slim + + ModMet + PSI-MOD-label + + + + Origin + M + + MOD:01157 + PSI-MOD + + + MOD:00914 + modified L-phenylalanine residue + + A protein modification that modifies an L-phenylalanine residue. + + 18688235 + PubMed + + + PSI-MOD-slim + + ModPhe + PSI-MOD-label + + + + Origin + F + + MOD:01157 + PSI-MOD + + + MOD:00915 + modified L-proline residue + + A protein modification that modifies an L-proline residue. + + 18688235 + PubMed + + + PSI-MOD-slim + + ModPro + PSI-MOD-label + + + + Origin + P + + MOD:01157 + PSI-MOD + + + MOD:00916 + modified L-serine residue + + A protein modification that modifies an L-serine residue. + + 18688235 + PubMed + + + PSI-MOD-slim + + ModSer + PSI-MOD-label + + + + Origin + S + + MOD:01157 + PSI-MOD + + + MOD:00917 + modified L-threonine residue + + A protein modification that modifies an L-threonine residue. + + 18688235 + PubMed + + + PSI-MOD-slim + + ModThr + PSI-MOD-label + + + + Origin + T + + MOD:01157 + PSI-MOD + + + MOD:00918 + modified L-tryptophan residue + + A protein modification that modifies an L-tryptophan residue. + + 18688235 + PubMed + + + PSI-MOD-slim + + ModTrp + PSI-MOD-label + + + + Origin + W + + MOD:01157 + PSI-MOD + + + MOD:00919 + modified L-tyrosine residue + + A protein modification that modifies an L-tyrosine residue. + + 18688235 + PubMed + + + PSI-MOD-slim + + ModTyr + PSI-MOD-label + + + + Origin + Y + + MOD:01157 + PSI-MOD + + + MOD:00920 + modified L-valine residue + + A protein modification that modifies an L-valine residue. + + 18688235 + PubMed + + + PSI-MOD-slim + + ModVal + PSI-MOD-label + + + + Origin + V + + MOD:01157 + PSI-MOD + + + MOD:00921 + new uncategorized UniMod entries + + New uncategorized UniMod. OBSOLETE because organizational use is no longer required. + + 18688235 + PubMed + + + 1 + PSI-MOD + + + MOD:00922 + Cy3 CyDye DIGE Fluor saturation dye + + modification from UniMod Chemical derivative + + 494 + UniMod + + + + Cy3 CyDye DIGE Fluor saturation dye + UniMod-description + + + CyDye-Cy3 + UniMod-interim + + + + DiffAvg + 672.84 + + + + DiffFormula + C 37 H 44 N 4 O 6 S 1 + + + + DiffMono + 672.298156 + + + + Formula + C 40 H 49 N 5 O 7 S 2 + + + + MassAvg + 775.98 + + + + MassMono + 775.307341 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + MOD:00905 + PSI-MOD + + + MOD:00923 + Cy5 CyDye DIGE Fluor saturation dye + + modification from UniMod Chemical derivative + + 495 + UniMod + + + + Cy5 CyDye DIGE Fluor saturation dye + UniMod-description + + + CyDye-Cy5 + UniMod-interim + + + + DiffAvg + 684.85 + + + + DiffFormula + C 38 H 44 N 4 O 6 S 1 + + + + DiffMono + 684.298156 + + + + Formula + C 41 H 49 N 5 O 7 S 2 + + + + MassAvg + 787.99 + + + + MassMono + 787.307341 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + MOD:00905 + PSI-MOD + + + MOD:00924 + N6-(L-threonyl)-L-lysine + + A protein modification that effectively crosslinks an L-lysine residue and an L-threonine residue by an isopeptide bond to form N6-(L-threonyl)-L-lysine. + + 18063774 + PubMed + + + AA0440 + RESID + + + Cross-link 2. + + (2S)-2-amino-6-([(2S,3R)-2-amino-3-hydroxybutanoyl]amino)hexanoic acid + RESID-systematic + + + N6-(L-threonyl)-L-lysine + RESID-name + + + N6-threonyl-lysine + RESID-alternate + + + + DiffAvg + -18.02 + + + + DiffFormula + C 0 H -2 N 0 O -1 + + + + DiffMono + -18.010565 + + + + Formula + C 10 H 18 N 3 O 3 + + + + MassAvg + 228.27 + + + + MassMono + 228.134816 + + + + Origin + K, T + + + + Source + natural + + + + TermSpec + C-term + + MOD:00688 + MOD:00917 + MOD:00954 + MOD:01875 + PSI-MOD + + + MOD:00925 + heptosylated residue + + A protein modification that effectively replaces a hydrogen atom of an amino acid residue or of a modifying group with a heptose sugar group through a glycosidic bond. + + 490 + UniMod + + + From UniMod with no citation [JSG]. + + Hep + PSI-MS-label + + + Heptose + UniMod-description + + + + DiffAvg + 192.17 + + + + DiffFormula + C 7 H 12 O 6 + + + + DiffMono + 192.063388 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + natural + + + + TermSpec + none + + MOD:00693 + PSI-MOD + + + MOD:00926 + Bisphenol A diglycidyl ether derivative + + Modification from UniMod Non-standard residue. OBSOLETE because not an amino acid modification. From UniMod not an approved entry. + + 11225353 + PubMed + + + 493 + UniMod + + + + BADGE + UniMod-interim + + + Bisphenol A diglycidyl ether derivative + UniMod-description + + + + DiffAvg + 340.42 + + + + DiffFormula + C 21 H 24 O 4 + + + + DiffMono + 340.167459 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + 1 + PSI-MOD + + + MOD:00927 + 2x(13)C,4x(2)H labeled dimethylated residue + + A protein modification that effectively replaces two hydrogen atoms of a residue containing common isotopes with two (13)C,3x(2)H labeled methyl groups to form a 2x(13)C,6x(2)H labeled dimethylated residue. + + 16335955 + PubMed + + + 3802193 + PubMed + + + 510 + UniMod + + + + DiMethyl-C13HD2 + UniMod-description + + + Dimethyl:2H(4)13C(2) + PSI-MS-label + + + + DiffAvg + 34.06 + + + + DiffFormula + (13)C 2 (2)H 4 + + + + DiffMono + 34.063117 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00839 + MOD:00842 + PSI-MOD + + + MOD:00928 + [3-(2,5)-dioxopyrrolidin-1-yloxycarbonyl)-propyl]dimethyloctylammonium + + modification from UniMod Chemical derivative + + 16771548 + PubMed + + + 513 + UniMod + + + Should have children for K and X-N-term [JSG]. + + [3-(2,5)-Dioxopyrrolidin-1-yloxycarbonyl)-propyl]dimethyloctylammonium + UniMod-description + + + C8-QAT + UniMod-interim + + + + DiffAvg + 227.39 + + + + DiffFormula + C 14 H 29 N 1 O 1 + + + + DiffMono + 227.224915 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + PSI-MOD + + + MOD:00929 + lactose glycated lysine + + A modification produced in a non-enzymatic reaction between a lactose carbonyl group and an L-lysine to form a Schiff-base or an Amadori ketosamine lysine adduct. + + 9606156 + PubMed + + + 512 + UniMod + + + The term lactosylation used with this meaning is a misnomer [JSG]. + + Hex(2) + UniMod-interim + + + Lactosylation + UniMod-description + + + + DiffAvg + 342.30 + + + + DiffFormula + C 12 H 22 O 11 + + + + DiffMono + 342.116212 + + + + Formula + C 18 H 34 N 2 O 12 + + + + MassAvg + 470.47 + + + + MassMono + 470.211175 + + + + Origin + K + + + + Source + natural + + + + TermSpec + none + + MOD:00767 + MOD:00912 + PSI-MOD + + + MOD:00930 + propyl-NAG tyrosine adduct + + tyrosine adduct with substrate analog inhibitor 1,2-dideoxy-2'-methyl-alpha-D-glucopyranoso-[2,1-d]-Delta2'-thiazoline. + + 15795231 + PubMed + + + 514 + UniMod + + + + + DiffAvg + 232.27 + + + + DiffFormula + C 9 H 14 N 1 O 4 S 1 + + + + DiffMono + 232.064354 + + + + Formula + C 18 H 23 N 2 O 6 S 1 + + + + MassAvg + 395.45 + + + + MassMono + 395.127682 + + + + Origin + Y + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + MOD:00919 + PSI-MOD + + + MOD:00931 + Michael addition of t-butyl hydroxylated BHT (BHTOH) to C, H or K + + modification from UniMod Other - BHTOH is formed upon metabolism of BHT with P450 enzymes. The BHTOH is further metabolized to its quinone methide (electrophile) which reacts with -SH and -NH2 groups + + 11085420 + PubMed + + + 498 + UniMod + + + + BHTOH + UniMod-interim + + + Michael addition of t-butyl hydroxylated BHT (BHTOH) to C, H or K + UniMod-description + + + + DiffAvg + 234.34 + + + + DiffFormula + C 15 H 22 O 2 + + + + DiffMono + 234.161980 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + PSI-MOD + + + MOD:00932 + IDBEST tag for quantitation + + modification from UniMod Isotopic label + + 11821862 + PubMed + + + 499 + UniMod + + + + Heavy IDBEST tag for quantitation + UniMod-description + + + IGBP:13C(2) + PSI-MS-label + + + + DiffAvg + 298.02 + + + + DiffFormula + Br 1 (12)C 10 (13)C 2 H 13 N 2 O 2 + + + + DiffMono + 298.022749 + + + + Formula + Br 1 (12)C 13 (13)C 2 H 18 N 3 O 3 S 1 + + + + MassAvg + 401.03 + + + + MassMono + 401.031934 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:00905 + MOD:01426 + PSI-MOD + + + MOD:00933 + methylglyoxal arginine adduct (+54 amu) + + modification from UniMod Chemical derivative - 5-hydro-5-methylimidazol-4-one, arginine methylglyoxal arginine adduct (+54 amu) + + 319#R + UniMod + + + Ref. Uchida K, Sakai K, Itakura K, Osawa T, Toyokuni S. 1977. Protein modification by lipid peroxidation products: formation of malondialdehyde-derived N(epsilon)-(2-propenol)lysine in proteins. Arch Biochem Biophys. 346(1):45-52. + + Delta:H(2)C(3)O(1) + PSI-MS-label + + + MDA adduct +54 + UniMod-description + + + + DiffAvg + 54.05 + + + + DiffFormula + C 3 H 2 O 1 + + + + DiffMono + 54.010565 + + + + Formula + C 9 H 14 N 4 O 2 + + + + MassAvg + 210.24 + + + + MassMono + 210.111676 + + + + Origin + R + + + + Source + artifact + + + + TermSpec + none + + MOD:00630 + MOD:00902 + PSI-MOD + + + MOD:00934 + Levuglandinyl - arginine hydroxylactam adduct + + modification from UniMod Post-translational + + 506 + UniMod + + + + Levuglandinyl - arginine hydroxylactam adduct + UniMod-description + + + LG-Hlactam-R + UniMod-interim + + + + DiffAvg + 306.40 + + + + DiffFormula + C 19 H 26 N -2 O 5 + + + + DiffMono + 306.171876 + + + + Formula + C 25 H 38 N 2 O 6 + + + + MassAvg + 462.59 + + + + MassMono + 462.272987 + + + + Origin + R + + + + Source + natural + + + + TermSpec + none + + MOD:00846 + MOD:00902 + PSI-MOD + + + MOD:00935 + methionine oxidation with neutral loss of 64 Da + + Oxidation of methionine to methionine sulfoxide with neutral loss of CH3SOH. + + 18688235 + PubMed + + + 9004526 + PubMed + + + Originally created from UniMod:507 that was later deleted. + + + DiffAvg + -64.10 + + + + DiffFormula + C -1 H -4 N 0 O -1 S -1 + + + + DiffMono + -63.998286 + + + + Formula + C 4 H 5 N 1 O 1 S 0 + + + + MassAvg + 83.09 + + + + MassMono + 83.037114 + + + + Origin + M + + + + Source + artifact + + + + TermSpec + none + + MOD:00431 + MOD:00913 + PSI-MOD + + + MOD:00936 + Levuglandinyl - hydroxylactam adduct, K and N-term + + modification from UniMod Post-translational + + 504 + UniMod + + + + Levuglandinyl - lysine hydroxylactam adduct + UniMod-description + + + LG-Hlactam-K + UniMod-interim + + + + DiffAvg + 348.44 + + + + DiffFormula + C 20 H 28 O 5 + + + + DiffMono + 348.193674 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00846 + PSI-MOD + + + MOD:00937 + Levuglandinyl - arginine lactam adduct + + modification from UniMod Post-translational + + 505 + UniMod + + + + Levuglandinyl - arginine lactam adduct + UniMod-description + + + LG-lactam-R + UniMod-interim + + + + DiffAvg + 290.40 + + + + DiffFormula + C 19 H 26 N -2 O 4 + + + + DiffMono + 290.176961 + + + + Formula + C 25 H 38 N 2 O 5 + + + + MassAvg + 446.59 + + + + MassMono + 446.278072 + + + + Origin + R + + + + Source + artifact + + + + TermSpec + none + + MOD:00846 + MOD:00902 + PSI-MOD + + + MOD:00938 + Levuglandinyl - lactam adduct, K and N-term + + modification from UniMod Post-translational + + 12590383 + PubMed + + + 503 + UniMod + + + + Levuglandinyl - lysine lactam adduct + UniMod-description + + + LG-lactam-K + UniMod-interim + + + + DiffAvg + 332.44 + + + + DiffFormula + C 20 H 28 O 4 + + + + DiffMono + 332.198759 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00846 + PSI-MOD + + + MOD:00939 + hydrolyzed N-methylmaleimide cysteine adduct + + modification from UniMod Chemical derivative + + 500 + UniMod + + + + Nmethylmaleimide+water + UniMod-interim + + + Nmethylmaleimidehydrolysis + UniMod-description + + + + DiffAvg + 129.12 + + + + DiffFormula + C 5 H 7 N 1 O 3 + + + + DiffMono + 129.042593 + + + + Formula + C 8 H 12 N 2 O 4 S 1 + + + + MassAvg + 232.25 + + + + MassMono + 232.051778 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + MOD:00905 + PSI-MOD + + + MOD:00940 + 3-methyl-2-pyridyl isocyanate derivatized residue + + A protein modification produced by formation of an adduct with 3-methyl-2-pyridyl isocyanate. + + 11078590 + PubMed + + + 501 + UniMod + + + + 3-methyl-2-pyridyl isocyanate + UniMod-description + + + PyMIC + UniMod-interim + + + + DiffAvg + 134.14 + + + + DiffFormula + C 7 H 6 N 2 O 1 + + + + DiffMono + 134.048013 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + N-term + + MOD:00840 + PSI-MOD + + + MOD:00941 + dehydropyrrolizidine alkaloid (dehydroretronecine) derivatized cysteine + + modification from UniMod Chemical derivative + + 12175151 + PubMed + + + 488 + UniMod + + + + Dehydropyrrolizidine alkaloid (dehydroretronecine) on cysteines + UniMod-description + + + DHP + UniMod-interim + + + + DiffAvg + 118.16 + + + + DiffFormula + C 8 H 8 N 1 + + + + DiffMono + 118.065674 + + + + Formula + C 11 H 13 N 2 S 1 + + + + MassAvg + 205.30 + + + + MassMono + 205.079944 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + MOD:00905 + PSI-MOD + + + MOD:00942 + (4,4,5,5-(2)H4)-L-lysine + + A protein modification that effectively substitutes four (1)H protium atoms with four (2)H deuterium atoms to produce (4,4,5,5-(2)H4)-L-lysine. + + 481 + UniMod + + + For SILAC experiments. + + 4,4,5,5-D4 Lysine + UniMod-description + + + 4,4,5,5-tetradeuterolysine + PSI-MOD-alternate + + + Label:2H(4) + UniMod-interim + + + lys-2H4 + OMSSA-label + + + + DiffAvg + 4.03 + + + + DiffFormula + (1)H -4 (2)H 4 + + + + DiffMono + 4.025107 + + + + Formula + C 6 (1)H 8 (2)H 4 N 2 O 1 + + + + MassAvg + 132.12 + + + + MassMono + 132.120070 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00837 + MOD:00912 + PSI-MOD + + + MOD:00943 + 4-trimethylammoniumbutanoyl derivatized residue + + modification from UniMod Isotopic label + + 12643539 + PubMed + + + 476 + UniMod + + + + 4-trimethyllammoniumbutyryl- + UniMod-description + + + TMAB + UniMod-interim + + + + DiffAvg + 128.19 + + + + DiffFormula + C 7 H 14 N 1 O 1 + + + + DiffMono + 128.107539 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + PSI-MOD + + + MOD:00944 + d9-4-trimethylammoniumbutanoyl derivatized residue + + modification from UniMod Isotopic label + + 477 + UniMod + + + + d9-4-trimethyllammoniumbutyryl- + UniMod-description + + + TMAB:2H(9) + UniMod-interim + + + + DiffAvg + 137.16 + + + + DiffFormula + C 7 (1)H 5 (2)H 9 N 1 O 1 + + + + DiffMono + 137.164030 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00943 + MOD:01431 + PSI-MOD + + + MOD:00945 + fluorescein-5-thiosemicarbazide adduct + + OBSOLETE because redundant and identical to MOD:00626. Remap to MOD:00626. + + 18688235 + PubMed + + + + + DiffAvg + 421.43 + + + + DiffFormula + C 21 H 15 N 3 O 5 S 1 + + + + DiffMono + 421.073242 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + S + + + + Source + artifact + + + + TermSpec + none + + 1 + PSI-MOD + + + MOD:00946 + crosslinked residues with loss of ammonia + + A protein modification that crosslinks two residues with a covalent bond and the loss of ammonia. + + 18688235 + PubMed + + + PSI-MOD-slim + MOD:00033 + PSI-MOD + + + MOD:00947 + DeltaMass + + Entries from DeltaMass see http://www.abrf.org/index.cfm/dm.home?AvgMass=all. + + 18688235 + PubMed + + + MOD:00032 + PSI-MOD + + + MOD:00948 + 5'-dephospho + + modification from DeltaMass + + 0 + DeltaMass + + + From DeltaMass: Average Mass: -79 + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + none + + + + TermSpec + none + + MOD:00947 + PSI-MOD + + + MOD:00949 + desmosine + + OBSOLETE because redundant and identical to MOD:01933. Remap to MOD:01933. + + 0 + DeltaMass + + + From DeltaMass: Average Mass: -58 + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + K + + + + Source + none + + + + TermSpec + none + + MOD:00947 + PSI-MOD + + + MOD:00950 + decomposed carboxymethylated methionine + + modification from DeltaMass + + 3 + DeltaMass + + + From DeltaMass: Average Mass: -48 Average Mass Change:-48 References:Anal. Biochem. Vol 216 No.1 p141 + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + M + + + + Source + none + + + + TermSpec + none + + MOD:00947 + PSI-MOD + + + MOD:00951 + L-gamma-carboxyglutamic acid with neutral loss of carbon dioxide + + Covalent modification of a peptide or protein L-glutamic acid residue to gamma-carboxyglutamic acid with secondary loss of a neutral carbon dioxide molecular fragment. + + 58 + DeltaMass + + + From DeltaMass: Average Mass: -44 Formula:CO2 Average Mass Change:-44 References:Nakamura T, Yu Z, Fainzilber M, Burlingame AL. Protein Sci (1996) 5, 524-530 Mass spectrometric-based revision of the structure of a cysteine-rich peptide toxin with gamma-carboxyglutamic acid, TxVIIA, from the sea snail, Conus textile. Notes: The elimination of CO2 will regenerate glutamate as if there was no modification. However, peaks appearing with an interval of 44 is quite characteristic. It would be noteworthy to remind that loss of 44 from a gamma-carboxyglutamate-containing peptide may be observed not only as a result of spontaneous decarboxylation but also as an artifact under some ionization conditions such as negative ion mode MALDI. + + d4CbxGlu + PSI-MOD-label + + + + DiffAvg + -44.01 + + + + DiffFormula + C -1 H 0 N 0 O -2 + + + + DiffMono + -43.989829 + + + + Formula + C 5 H 7 N 1 O 3 + + + + MassAvg + 129.12 + + + + MassMono + 129.042593 + + + + Origin + E + + + + Source + artifact + + + + TermSpec + none + + MOD:00015 + MOD:00906 + MOD:00957 + MOD:00960 + PSI-MOD + + + MOD:00952 + (2-aminosuccinimidyl)acetic acid (Asp) + + A protein modification that crosslinks an aspartic acid and the following glycine residue with the formation of (2-aminosuccinimidyl)acetic acid and the loss of a water molecule. + + 10801322 + PubMed + + + AA0441#ASP + RESID + + + Cross-link 2; this cross-link is formed by the condensation of an aspartic acid residue with the alpha-amido of the following residue. + PSI-MOD-slim + + (2-aminosuccinimidyl)acetic acid + RESID-name + + + (3-amino-2,5-dioxo-1-pyrrolidinyl)acetic acid + RESID-alternate + + + [(3S)-3-amino-2,5-dioxopyrrolidin-1-yl]acetic acid + RESID-systematic + + + anhydroaspartyl glycine + RESID-alternate + + + aspartimide glycine + RESID-alternate + + + CROSSLNK (2-aminosuccinimidyl)acetic acid (Asp-Gly) + UniProt-feature + + + N-(2-aminosuccinyl)glycine + RESID-alternate + + + + DiffAvg + -18.02 + + + + DiffFormula + C 0 H -2 N 0 O -1 + + + + DiffMono + -18.010565 + + + + Formula + C 6 H 6 N 2 O 3 + + + + MassAvg + 154.13 + + + + MassMono + 154.037842 + + + + Origin + D, G + + + + Source + hypothetical + + + + TermSpec + none + + MOD:00904 + MOD:00954 + MOD:01628 + PSI-MOD + + + MOD:00953 + O-(L-isoglutamyl)-L-serine (Glu-Ser) + + A protein modification that effectively crosslinks an L-glutamic acid residue and an L-serine residue by an ester bond and releasing water to form O-(L-isoglutamyl)-L-serine. + + 0 + DeltaMass + + + 19035375 + PubMed + + + AA0597#ESX + RESID + + + Cross-link 2; From DeltaMass: with no citation. + + (2S)-2-amino-5-[(2S)-2-amino-2-carboxyethoxy]-5-oxopentanoic acid + RESID-systematic + + + CROSSLNK isoglutamyl serine ester (Ser-Glu) + UniProt-feature + + + O(beta)-(gamma-glutamyl)serine + RESID-alternate + + + O-(L-isoglutamyl)-L-serine + RESID-name + + + O-gamma-Glutamyl- (Crosslink to Serine) + DeltaMass-label + + + O3-(isoglutamyl)-serine + RESID-alternate + + + + DiffAvg + -18.02 + + + + DiffFormula + C 0 H -2 N 0 O -1 + + + + DiffMono + -18.010565 + + + + Formula + C 8 H 10 N 2 O 4 + + + + MassAvg + 198.18 + + + + MassMono + 198.064057 + + + + Origin + E, S + + + + Source + artifact + + + + TermSpec + none + + MOD:00906 + MOD:00954 + MOD:01977 + PSI-MOD + + + MOD:00954 + crosslinked residues with loss of water + + A protein modification that crosslinks two residues with a covalent bond and the loss of water. + + 18688235 + PubMed + + + PSI-MOD-slim + MOD:00033 + PSI-MOD + + + MOD:00955 + alaninohistidine (serine crosslinked to tele or pros nitrogen of histidine) + + A protein modification that effectively crosslinks an L-serine residue and an L-histidine residue to release water and form tele- or pros-(2-amino-2-carboxyethyl)histidine. + + 0 + DeltaMass + + + Cross-link 2; From DeltaMass with no citation or formula: Average Mass: -18. The DeltaMass description "Serine crosslinked to theta or pi carbon of Histidine" is incorrect. The histidine ring nitrogens (not carbons) are designated tele or N-tau (not theta), and pros or N-pi [JSG]. + + beta-alaninohistidine + PSI-MOD-alternate + + + + DiffAvg + -18.02 + + + + DiffFormula + C 0 H -2 N 0 O -1 + + + + DiffMono + -18.010565 + + + + Formula + C 9 H 10 N 4 O 2 + + + + MassAvg + 206.20 + + + + MassMono + 206.080376 + + + + Origin + H, S + + + + Source + artifact + + + + TermSpec + none + + MOD:00909 + MOD:00916 + MOD:00954 + PSI-MOD + + + MOD:00956 + misincorporation of norleucine for methionine + + modification from DeltaMass + + 10 + DeltaMass + + + From DeltaMass: Average Mass: -18 Average Mass Change:-18 Notes: It has the same mass as leucine or isoleucine and can be charged on the methionyl t-RNA. This often happens in minimal media-prepared fermentations that are not supplemented with enough free methionine. It gives a mass change of -18 and can often be confused with dehydration. + + + DiffAvg + -18.03 + + + + DiffFormula + C 1 H 2 N 0 O 0 S -1 + + + + DiffMono + -17.956421 + + + + Formula + C 6 H 11 N 1 O 1 + + + + MassAvg + 113.16 + + + + MassMono + 113.084064 + + + + Origin + M + + + + Source + none + + + + TermSpec + none + + MOD:01026 + PSI-MOD + + + MOD:00957 + modified residue with neutral loss of carbon dioxide + + Covalent modification of, or a change resulting in an alteration of the measured molecular mass of, a peptide or protein amino acid residue with a secondary loss of a neutral carbon dioxide molecular fragment. + + 18688235 + PubMed + + + + dCO2ModRes + PSI-MOD-label + + + + DiffAvg + -44.01 + + + + DiffFormula + C -1 H 0 N 0 O -2 + + + + DiffMono + -43.989829 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00431 + PSI-MOD + + + MOD:00958 + crosslink between Arg and His sidechains + + modification from DeltaMass + + 0 + DeltaMass + + + Cross-link 2; From DeltaMass: Average Mass: -5 + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + H, R + + + + Source + none + + + + TermSpec + none + + MOD:00947 + PSI-MOD + + + MOD:00959 + 3,3',5,5'-TerTyr (Crosslink) + + modification from DeltaMass + + 0 + DeltaMass + + + Cross-link 4; From DeltaMass: Average Mass: -4 + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + Y, Y, Y, Y + + + + Source + none + + + + TermSpec + none + + MOD:00692 + PSI-MOD + + + MOD:00960 + decarboxylated residue + + A protein modification that effectively replaces a carboxylic acid group with a hydrogen atom. + + 18688235 + PubMed + + + + + DiffAvg + -44.01 + + + + DiffFormula + C -1 H 0 N 0 O -2 + + + + DiffMono + -43.989829 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:01156 + PSI-MOD + + + MOD:00961 + reduction of disulfide crosslink in cystine to two cysteines + + A protein modification that effectively reduces the disulfide bond of cystine to form two cysteine residues. + + 333 + DeltaMass + + + Cross-link 2; this modification destroys the cross-link. From DeltaMass: Treatment of cystine (cys-cys) by reducing agents such as dithiothreitol (DTT) or triscarboxyethylphosphine (TCEP) results in cleavage of the disulphide bond and reduction of the sulphur atom of each molecule to create cysteine. + PSI-MOD-slim + + + DiffAvg + 2.02 + + + + DiffFormula + C 0 H 2 N 0 O 0 S 0 + + + + DiffMono + 2.015650 + + + + Formula + C 6 H 10 N 2 O 2 S 2 + + + + MassAvg + 206.28 + + + + MassMono + 206.018370 + + + + Origin + MOD:00034 + + + + Source + none + + + + TermSpec + none + + MOD:00905 + MOD:01473 + + derives_from + MOD:000340 + + PSI-MOD + + + MOD:00962 + 2',3'-dihydrotryptophan + + A protein modification that by reducing the indole ring system of tryptophan to indoline effectively converts an L-tryptophan residue to 2',3'-dihydrotryptophan. + + 343 + DeltaMass + + + From DeltaMass: References:1. Pearson,D.A., Blanchette,M., Baker,M.L. and Guindon,C.A. (1989) Trialkylsilanes as scavengers for the trifluoroacetic acid deblocking ofprotecting groups in peptide synthesis. Tetrahedron Lett., 30(21), 2739-2742 Notes: Reduction of indole double bond of Trp which occurs when triethylsilane (TES) is used as a scavenger and Trp is incorporated without protection of indole nitrogen [1]. This side reaction is likely to be accompanied by oxidation of indoline ring with formation of intensively colored peptide by-products. Triisopropylsilane (TIPS) does not give this side reaction. See structure at http://www.abrf.org/images/misc/dmass2.gif. [However, the pictured indoline structure is incorrect - JSG]. + + + DiffAvg + 2.02 + + + + DiffFormula + C 0 H 2 N 0 O 0 S 0 + + + + DiffMono + 2.015650 + + + + Formula + C 11 H 12 N 2 O 1 + + + + MassAvg + 188.23 + + + + MassMono + 188.094963 + + + + Origin + W + + + + Source + artifact + + + + TermSpec + none + + MOD:00918 + MOD:01473 + PSI-MOD + + + MOD:00963 + Oxidation of Trp to kynurenine + + Modification from DeltaMass. OBSOLETE because redundant and identical to MOD:00462. Remap to MOD:00462. + + 357 + DeltaMass + + + From DeltaMass: Average Mass: 4 Monoisotopic Mass Change:3.995 Average Mass Change:3.989 References:Ruoppolo M, Amoresano A, Pucci P, Pascarella S, Polticelli F, Trovato M,Menegatti E, Ascenzi P.Characterization of five new low-molecular-mass trypsin inhibitors fromwhite mustard (Sinapis alba L.) seed.Eur J Biochem. 2000 267:6486-92. Notes: See structure at http://www.abrf.org/images/misc/dmass32.jpg. + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + W + + + + Source + artifact + + + + TermSpec + none + + 1 + PSI-MOD + + + MOD:00964 + lysine epsilon amino to imine + 12 amu + + modification from DeltaMass + + 34 + DeltaMass + + + From DeltaMass: Average Mass: 12 Average Mass Change: 12 References: Mathews, W. Rodney; Runge, Thomas A.; Haroldsen, Peter E.; Gaskell, Simon J. (1989) Characterization of impurities in a synthetic renin substrate peptide by fast-atom bombardment mass spectrometry and hybrid tandem mass spectrometry. Rapid Commun. Mass Spectrom. 3(9), 314-19 Notes: Fast-atom bombardment mass spectrometry of a synthetic renin substrate decapeptide (Pro-His-Pro-Phe-His-Leu-Val-Ile-His-D-Lys) indicated the presence of several side products, including a component 12 Da higher in mass. Low-energy collisionally activated ***decompn*** analyses were performed using a hybrid tandem instrument and demonstrated that the heavier side product had two components, in which the structural modification was either at the N- or the C-terminus. Addnl. analyses of the N-acetyl deriv. indicated that for each component the structural modification blocked a site of N-acetylation. It is suggested that the formation of these side products is attributable to the generation of formaldehyde, during removal of the histidine protecting group (benzyloxymethyl), which reacts with the N-terminus of the peptide to give an imidazolidinone structure or with the D- ***lysine***.epsilon.-amine group to yield an ***imine*** . While the precise genesis of the side-products remains speculative, it is clear that the combined strategy of derivatization and tandem mass spectrometry has allowed structural conclusions concerning individual components of an isobaric mixt. + + N6-(methylidene)-lysine + PSI-MOD-alternate + + + + DiffAvg + 12.01 + + + + DiffFormula + C 1 H 0 N 0 O 0 + + + + DiffMono + 12.000000 + + + + Formula + C 7 H 12 N 2 O 1 + + + + MassAvg + 140.19 + + + + MassMono + 140.094963 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00947 + PSI-MOD + + + MOD:00965 + 4-thiazolidinecarboxylic acid + + A protein modification that effectively converts an N-terminal L-cysteine residue by a formadehyde adduct to 4-thiazolidinecarboxylic acid. + + 342 + DeltaMass + + + From DeltaMass: References: Mitchell, M.A., Runge, T.A., Mathews, W.R., Ichhpurani, A.K., Harn, N.K., Dobrowolski, P.J. and Eckenrrrode, F.M. Problems associated with use of the benzylozymethyl protecting group for histidines. Formaldehyde adducts formed during cleavage by hydrogen fluoride. Int. J. Pept. Protein Res. 1990, 36(4), 350-355. Gesquiere, J.-C., Diesis, E. and Tartar, A. Conversion of N-terminal cysteine to thiazolidine carboxylic acid during hydrogen fluoride deprotection of peptides containing pi-N-Bom protected histidine. J. Chem. Soc. Chem. Commun. 1990, (20), 1402-1403. Kumagaye, K.Y., Inui, T., Nakajima, K., Kimura,T. and Sakakibara, S. Suppression of a side reaction associated with Nim-benzyloxymethyl group during synthesis of peptides containing cysteinyl residue at the N-terminus. Pept. Res. 1991, 4(2), 84-87. Colombo, R., Colombo, F. and Jones, J.H. Acid-labile histidine side-chain protection. The N(pi)-t-butoxymethyl group. J. Chem. Soc. Chem. Commun. 1984, (5), 292-293. Notes: Conversion of N-term Cys to thiazolidine during HF deprotection of His(Bom)-containing peptides [1-3]. See structure at http://www.abrf.org/images/misc/dmass12b.gif; modification in red. This modification cannot be excluded during final deprotection/cleavage in Fmoc-chemistry in cases when His(Bum) was employed [4]. For formation of free imino acid see PubMed:1527501. + + thioproline + DeltaMass-label + + + + DiffAvg + 12.01 + + + + DiffFormula + C 1 H 0 N 0 O 0 S 0 + + + + DiffMono + 12.000000 + + + + Formula + C 4 H 6 N 1 O 1 S 1 + + + + MassAvg + 116.16 + + + + MassMono + 116.017010 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + N-term + + MOD:00905 + PSI-MOD + + + MOD:00966 + 1,2,3,4-tetrahydro-beta-carboline-3-carboxylic acid + + A protein modification that effectively converts an N-terminal L-tryptophan residue by a formadehyde adduct to 1,2,3,4-tetrahydro-beta-carboline-3-carboxylic acid. + + 339 + DeltaMass + + + From DeltaMass: Average Mass: 12 Average Mass Change: 12 References: Lippke, K. P., W. G. Schunack, W. Wenning, W. E. Mueller. 1983..beta.-Carbolines as benzodiazepine receptor ligands. 1. Synthesis andbenzodiazepine receptor interaction of esters of.beta.-carboline-3-carboxylic acid. J. Med. Chem.26: 499-503 Cain, M., R. W. Weber, F. Guzman, J. M. Cook, S. A. Barker, K. C.Rice, J. N. Crawley, S. M. Paul, P. Skolnick. 1982. .beta.-Carbolines:synthesis and neurochemical and pharmacological actions on brainbenzodiazepine receptors.J. Med. Chem. 25: 1081-91 Notes: +12 Da modification corresponds to formaldehyde adduct of Trp having beta-carboline structure (methylene bridge links carbon-2 of indole ring and alfa-N. See structure at http://www.abrf.org/images/misc/dmass12a.gif; modification in red. + + + DiffAvg + 12.01 + + + + DiffFormula + C 1 H 0 N 0 O 0 S 0 + + + + DiffMono + 12.000000 + + + + Formula + C 12 H 10 N 2 O 1 + + + + MassAvg + 198.22 + + + + MassMono + 198.079313 + + + + Origin + W + + + + Source + artifact + + + + TermSpec + none + + MOD:00918 + PSI-MOD + + + MOD:00967 + syndesine + + A protein modification that effectively cross-links two L-lysine residues to form syndesine, hydroxylysinohydroxynorleucine. + + 35 + DeltaMass + + + 75151974 + PubMed + + + Cross-link 2; From DeltaMass: Average Mass: 13 Average Mass Change: 13 (incorrect) [JSG]. + + hydroxylysinohydroxynorleucine + PSI-MOD-alternate + + + + DiffAvg + 16.96 + + + + DiffFormula + C 0 H -3 N -2 O 3 + + + + DiffMono + 16.955121 + + + + Formula + C 12 H 21 N 2 O 5 + + + + MassAvg + 273.31 + + + + MassMono + 273.145047 + + + + Origin + K, K + + + + Source + none + + + + TermSpec + none + + MOD:00947 + PSI-MOD + + + MOD:00968 + CM-Cys vs PAM-Cys + + modification from DeltaMass + + 347 + DeltaMass + + + From DeltaMass: Average Mass: 13 Formula:C2H2O2 vs C3H5ON Monoisotopic Mass Change:13.03 Average Mass Change:13.05 Notes:Residual acrylamide in SDS gels can partly label cysteine residues in proteins (propionamido-Cys, PAM-Cys, DeltaMass +71Da; see entry). Subsequent alkylation of protein bands with iodoacetic acid e.g. in preparation for proteomic analysis, will convert remaining free cysteines into carboxymethyl-Cys (CM-Cys, DeltaMass +58Da; see entry). Peptide mass fingerprinting may therefore potentially reveal the same cysteine-containing peptide in two forms, differing in mass by 13Da. The relative ratios of the peaks will depend on the initial degree of labelling with acrylamide. Use of high quality, deionised acrylamide in the SDS gel will minimise modification of cysteine through this route. Where it remains a problem, deliberate alkylation using acrylamide instead of iodoacetamide will ensure chemical homogeneity of the final product. + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:00947 + PSI-MOD + + + MOD:00969 + CAM-Cys vs PAM-Cys + + modification from DeltaMass + + 346 + DeltaMass + + + From DeltaMass: Average Mass: 14 Formula:CH2 Monoisotopic Mass Change:14.016 Average Mass Change:14.027 Notes: Residual acrylamide in SDS gels can partly label cysteine residues in proteins (propionamido-Cys, PAM-Cys, DeltaMass +71Da; see entry). Subsequent alkylation of protein bands with iodoacetamide e.g. in preparation for proteomic analysis, will convert remaining free cysteines into carboxamidomethyl-Cys (CAM-Cys, DeltaMass +57Da; see entry). Peptide mass fingerprinting may therefore potentially reveal the same cysteine-containing peptide in two forms, differing in mass by 14Da. The relative ratios of the peaks will depend on the initial degree of labelling with acrylamide. Use of high quality, deionised acrylamide in the SDS gel will minimise modification of cysteine through this route. Where it remains a problem, deliberate alkylation using acrylamide instead of iodoacetamide will ensure chemical homogeneity of the final product. + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:00947 + PSI-MOD + + + MOD:00970 + delta-hydroxy-allysine (Lys) + + modification from DeltaMass + + 37 + DeltaMass + + + From DeltaMass: Average Mass: 15 Average Mass Change:15 Notes:In going from Lys to hydroxy-allysine, two separate reactions are involved:1. the oxidative deamination converting Lys to allysine (-CH2NH2 being converted to -CHO) with a net mass change of -1;2.conversion of allysine to delta-hydroxy-allysine (-CH2-CHO being converted to -CH(OH)-CHO) with a mass change of +16. The net change from Lys to hydroxyallysine thus is +15. + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + K + + + + Source + natural + + + + TermSpec + none + + MOD:00947 + PSI-MOD + + + MOD:00971 + Oxohistidine (from histidine) + + modification from DeltaMass + + 38 + DeltaMass + + + From DeltaMass: Average Mass: 16 Average Mass Change:16 References:Lewisch, S. A. and Levine, R. L. (1995) Anal. Biochem. 231, 440-446. Determination of 2-oxo-histidine by amino acid analysis Notes:Rod LevineNIHBldg 3, Room 106 MSC 0320Bethesda, MD 20892-0320email: rlevine@nih.govvoice: 1 (301) 496-2310fax: 1 (301) 496-0599 + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + H + + + + Source + none + + + + TermSpec + none + + MOD:00947 + PSI-MOD + + + MOD:00972 + monobrominated L-phenylalanine + + A protein modification that effectively converts an L-phenylalanine residue to a monobrominated L-phenylalanine, such as L-2'-bromophenylalanine. + + 340#F + UniMod + + + From DeltaMass: Average Mass: 78 Average Mass Change:78 References:Yoshino,K et.al. Biochemistry Vol. 30 pg 6203-9 (1991) Identifidation of a novel amino acid, o-bromo-L-phenylananine, in egg-associated peptides that activate spermatozoa + + Br1Phe + PSI-MOD-label + + + bromination + UniMod-description + + + Bromo + PSI-MS-label + + + + DiffAvg + 78.90 + + + + DiffFormula + Br 1 C 0 H -1 N 0 O 0 + + + + DiffMono + 77.910512 + + + + Formula + Br 1 C 9 H 8 N 1 O 1 + + + + MassAvg + 226.07 + + + + MassMono + 224.978926 + + + + Origin + F + + + + Source + natural + + + + TermSpec + none + + MOD:01066 + MOD:01912 + PSI-MOD + + + MOD:00973 + Oxidation of proline (to glutamic acid) + + modification from DeltaMass + + 355 + DeltaMass + + + From DeltaMass: Average Mass: 32 Monoisotopic Mass Change:31.99 Average Mass Change:32 References:Amici A, Levine, RL, Tsai, L, and Stadtman, ER: Conversion of amino acid residues in proteins and amino acid homopolymers to carbonyl derivatives by metal-catalyzed oxidation reactions. Journal of Biological Chemistry 264: 3341-3346 1989.Rod Levine (unpublished) + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + P + + + + Source + artifact + + + + TermSpec + none + + MOD:00947 + PSI-MOD + + + MOD:00974 + (35)Cl labeled 3'-chlorotyrosine + + modification from DeltaMass + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 34 + + + DiffAvg + 33.96 + + + + DiffFormula + (35)Cl 1 H -1 + + + + DiffMono + 33.961028 + + + + Formula + C 9 (35)Cl 1 H 8 N 1 O 2 + + + + MassAvg + 197.02 + + + + MassMono + 197.024356 + + + + Origin + Y + + + + Source + artifact + + + + TermSpec + none + + MOD:01046 + PSI-MOD + + + MOD:00975 + (37)Cl labeled 3'-chlorotyrosine + + modification from DeltaMass + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 36 + + + DiffAvg + 35.96 + + + + DiffFormula + (37)Cl 1 H -1 + + + + DiffMono + 35.958078 + + + + Formula + C 9 (37)Cl 1 H 8 N 1 O 2 + + + + MassAvg + 199.02 + + + + MassMono + 199.021406 + + + + Origin + Y + + + + Source + artifact + + + + TermSpec + none + + MOD:01046 + PSI-MOD + + + MOD:00976 + potassium salt + + modification from DeltaMass - OBSOLETE because redundant and identical to MOD:01072. Remap to MOD:01072. + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 38 + + + DiffAvg + 38.09 + + + + DiffFormula + H -1 K 1 + + + + DiffMono + 37.955882 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + none + + + + TermSpec + none + + 1 + PSI-MOD + + + MOD:00977 + disodium salt + + modification from DeltaMass + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 44 + PSI-MOD-slim + + + DiffAvg + 43.96 + + + + DiffFormula + H -2 Na 2 + + + + DiffMono + 43.963888 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + none + + + + TermSpec + none + + MOD:00747 + PSI-MOD + + + MOD:00978 + piperidine adduct to C-terminal Cys + + modification from DeltaMass + + 345 + DeltaMass + + + From DeltaMass: Average Mass: 51 Average Mass Change: 51 References:Lukszo, Patterson, Albericio, and Kates, Letters in Peptide Science 3, 157-166(1996) Notes:The side reaction can be very significant, and the level to which it occurs depends on how the C-terminal Cys is anchored and what the side-chain protecting group is. The mechanism involves piperidine-mediated beta-elimination of sulfur (with the protecting group on), followed by addition of piperidine across the C-terminaldehydroalanine. Since this last-mentioned step creates a chiral center, a mixture of diastereomers is formed which in special cases can be separatedby HPLC. Another problem with C-terminal Cys is racemization; some references in the review article by Andreu, Albericio, Sole, Munson, Ferrer, and Barany in Pennington-Dunn Peptide Synthesis and Purification Protocols, vol 35, 1994, pp. 91-169. + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:00947 + PSI-MOD + + + MOD:00979 + t-butyl ester (OtBu) and t-butyl (tBu) + + modification from DeltaMass + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 56 + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00947 + PSI-MOD + + + MOD:00980 + Carboxamidomethyl (on Cysteine) + + modification from DeltaMass - OBSOLETE because redundant, the difference component of MOD:01060. Remap to MOD:01060. + + 337 + DeltaMass + + + From DeltaMass: Average Mass: 57 Abbreviation:CamCys Formula:C2H3NO Monoisotopic Mass Change:57.021 Average Mass Change:57.051 Notes:Cysteine reacts with iodoacetamide to produce carboxamidomethyl cysteine. Alternative names are often used, such as amidocarboxymethylcysteine and carbamoylmethylcysteine + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + 1 + PSI-MOD + + + MOD:00981 + sodium and potassium salt + + modification from DeltaMass + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 60 + PSI-MOD-slim + + + DiffAvg + 60.07 + + + + DiffFormula + H -2 K 1 Na 1 + + + + DiffMono + 59.937826 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + none + + + + TermSpec + none + + MOD:00747 + MOD:00849 + PSI-MOD + + + MOD:00982 + L-selenocysteine (Ser) + + A protein modification that effectively converts an L-serine residue to L-selenocysteine (not known as a natural post-translational modification process). + + 0 + DeltaMass + + + [From DeltaMass: Average Mass: 64.] Although selenocysteine-charged tRNA(Sec) is biosynthesized from serine-charged tRNA(Sec), in peptide work selenocysteine is usually considered as either a natural residue or as a modified cysteine residue. This entry is for the artifactual formation of L-selenocysteine from serine. For encoded L-selenocysteine, use MOD:00031 [JSG]. + + Sec(Ser) + PSI-MOD-label + + + Selenocysteine (from Serine) + DeltaMass-label + + + + DiffAvg + 62.97 + + + + DiffFormula + C 0 H 0 N 0 O -1 Se 1 + + + + DiffMono + 63.921607 + + + + Formula + C 3 H 5 N 1 O 1 Se 1 + + + + MassAvg + 150.05 + + + + MassMono + 150.953635 + + + + Origin + S + + + + Source + artifact + + + + TermSpec + none + + MOD:00031 + MOD:00916 + PSI-MOD + + + MOD:00983 + Asp transamidation with piperidine + + modification from DeltaMass + + 67 + DeltaMass + + + From DeltaMass: Average Mass: 67 Average Mass Change:67 References:http://www.abrf.org/archives/hmail/0008/0007.html Notes:1.) Get rid of the DBU. It can cause piperidine amides at Asp residues. The tbu ester side chain comes off during synthesis and the residue is trans-amidated with piperidine (+67Da by MS). If you haven't yet seen this, you will. Even "normal" 20% pip/DMF (NMP) will cause this, but less frequently. Literature exists for this; I don't remember the exact reference. David H. Singleton Scientist Pfizer Central Research PO Box 8118-101 Eastern Point Road Groton, CT 06340 (860)441-4404. + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + D + + + + Source + artifact + + + + TermSpec + none + + MOD:00947 + PSI-MOD + + + MOD:00984 + (35)Cl labeled 3',5'-dichlorotyrosine + + modification from DeltaMass + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 68 + + + DiffAvg + 67.92 + + + + DiffFormula + (35)Cl 2 H -2 + + + + DiffMono + 67.922055 + + + + Formula + C 9 (35)Cl 2 H 7 N 1 O 2 + + + + MassAvg + 230.99 + + + + MassMono + 230.985384 + + + + Origin + Y + + + + Source + artifact + + + + TermSpec + none + + MOD:01045 + PSI-MOD + + + MOD:00985 + halogenated tyrosine + + A protein modification that effectively substitutes a hydrogen atom of an L-tyrosine residue with a halogen atom. + + 18688235 + PubMed + + + PSI-MOD-slim + + HalTyr + PSI-MOD-label + + + + Origin + Y + + + + Source + none + + + + TermSpec + none + + MOD:00694 + MOD:00919 + PSI-MOD + + + MOD:00986 + (35)Cl and (37)Cl labeled 3',5'-dichlorotyrosine + + modification from DeltaMass + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 70. + + + DiffAvg + 69.92 + + + + DiffFormula + (35)Cl 1 (37)Cl 1 H -2 + + + + DiffMono + 69.919105 + + + + Formula + C 9 (35)Cl 1 (37)Cl 1 H 7 N 1 O 2 + + + + MassAvg + 232.98 + + + + MassMono + 232.982434 + + + + Origin + Y + + + + Source + artifact + + + + TermSpec + none + + MOD:01045 + PSI-MOD + + + MOD:00987 + chlorinated tyrosine + + A protein modification that effectively substitutes a hydrogen atom of an L-tyrosine residue with a chlorine atom. + + 18688235 + PubMed + + + + ClTyr + PSI-MOD-label + + + + Origin + Y + + + + Source + none + + + + TermSpec + none + + MOD:00753 + MOD:00985 + PSI-MOD + + + MOD:00988 + brominated tyrosine + + A protein modification that effectively substitutes a hydrogen atom of an L-tyrosine residue with a bromine atom. + + 18688235 + PubMed + + + + BrTyr + PSI-MOD-label + + + + Origin + Y + + + + Source + none + + + + TermSpec + none + + MOD:00754 + MOD:00985 + PSI-MOD + + + MOD:00989 + acetamidomethyl (Acm) + + OBSOLETE because redundant, the difference component of MOD:01079. Remap to MOD:01079. + + 0 + DeltaMass + + + From DeltaMass with no citation or formula. + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + 1 + PSI-MOD + + + MOD:00990 + (37)Cl labeled 3',5'-dichlorotyrosine + + modification from DeltaMass + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 72 + + + DiffAvg + 71.92 + + + + DiffFormula + (37)Cl 2 H -2 + + + + DiffMono + 71.916155 + + + + Formula + C 9 (37)Cl 2 H 7 N 1 O 2 + + + + MassAvg + 234.98 + + + + MassMono + 234.979484 + + + + Origin + Y + + + + Source + artifact + + + + TermSpec + none + + MOD:01045 + PSI-MOD + + + MOD:00991 + S-(sn-1-glyceryl)-L-cysteine + + modification from DeltaMass + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 74 with no citation. + + + DiffAvg + 74.08 + + + + DiffFormula + C 3 H 6 O 2 + + + + DiffMono + 74.036779 + + + + Formula + C 6 H 11 N 1 O 3 S 1 + + + + MassAvg + 177.22 + + + + MassMono + 177.045964 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:00947 + PSI-MOD + + + MOD:00992 + glutamate 5-glycerol ester + + modification from DeltaMass + + 78 + DeltaMass + + + 18767873 + PubMed + + + From DeltaMass: Average Mass: 74 Average Mass Change: 74 References: Anal. Biochem. 1993 Vol 208 No. 2 382-386, PubMed:8452236. [DeltaMass] This article only suggests this as a possible modification and does no characterization. Isolation and stuctural evidence for artifactual modification are found in PubMed:18767873 [JSG]. + + + DiffAvg + 74.08 + + + + DiffFormula + C 3 H 6 O 2 + + + + DiffMono + 74.036779 + + + + Formula + C 8 H 13 N 1 O 5 + + + + MassAvg + 203.19 + + + + MassMono + 203.079373 + + + + Origin + E + + + + Source + artifact + + + + TermSpec + none + + MOD:00906 + PSI-MOD + + + MOD:00993 + phenyl ester + + modification from DeltaMass + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 76, on acidic amino acids + + OPh + DeltaMass-label + + + + DiffAvg + 76.10 + + + + DiffFormula + C 6 H 4 + + + + DiffMono + 76.031300 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + PSI-MOD + + + MOD:00994 + (79)Br labeled 3'-bromotyrosine + + modification from DeltaMass + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 78 + + + DiffAvg + 77.91 + + + + DiffFormula + (79)Br 1 H -1 + + + + DiffMono + 77.910512 + + + + Formula + (79)Br 1 C 9 H 8 N 1 O 2 + + + + MassAvg + 240.97 + + + + MassMono + 240.973841 + + + + Origin + Y + + + + Source + artifact + + + + TermSpec + none + + MOD:01025 + PSI-MOD + + + MOD:00995 + (81)Br labeled 2'-bromophenylalanine + + A protein modification that effectively converts an L-phenylalanine residue to (81)Br-L-2'-bromophenylalanine. + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 80 + + + DiffAvg + 79.91 + + + + DiffFormula + (81)Br 1 H -1 + + + + DiffMono + 79.908466 + + + + Formula + (81)Br 1 C 9 H 8 N 1 O 1 + + + + MassAvg + 226.98 + + + + MassMono + 226.976879 + + + + Origin + F + + + + Source + artifact + + + + TermSpec + none + + MOD:00183 + PSI-MOD + + + MOD:00996 + (81)Br labeled 3'-bromotyrosine + + modification from DeltaMass + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 80 + + + DiffAvg + 79.91 + + + + DiffFormula + (81)Br 1 H -1 + + + + DiffMono + 79.908466 + + + + Formula + (81)Br 1 C 9 H 8 N 1 O 2 + + + + MassAvg + 242.97 + + + + MassMono + 242.971794 + + + + Origin + Y + + + + Source + artifact + + + + TermSpec + none + + MOD:01025 + PSI-MOD + + + MOD:00997 + cyclohexyl ester + + modification from DeltaMass + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 82 + + OcHex + DeltaMass-label + + + + DiffAvg + 82.15 + + + + DiffFormula + C 6 H 10 + + + + DiffMono + 82.078250 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + PSI-MOD + + + MOD:00998 + iodinated tyrosine + + A protein modification that effectively substitutes a hydrogen atom of an L-tyrosine residue with an iodine atom. + + 18688235 + PubMed + + + PSI-MOD-slim + + ITyr + PSI-MOD-label + + + + Origin + Y + + + + Source + none + + + + TermSpec + none + + MOD:00755 + MOD:00985 + PSI-MOD + + + MOD:00999 + homoseryl lactone + + OBSOLETE because redundant and identical to MOD:00404. Remap to MOD:00404. + + 90 + DeltaMass + + + From DeltaMass: Average Mass: 83 Formula:C4H5O1N1 Monoisotopic Mass Change:83.037 Average Mass Change:83.09 + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + M + + + + Source + artifact + + + + TermSpec + none + + 1 + PSI-MOD + + + MOD:01000 + monobrominated tyrosine + + A protein modification that effectively substitutes one hydrogen atom of an L-tyrosine residue with one bromine atom. + + 18688235 + PubMed + + + + Br1Tyr + PSI-MOD-label + + + + Origin + Y + + + + Source + none + + + + TermSpec + none + + MOD:00988 + PSI-MOD + + + MOD:01001 + 2-aminoisobutyric acid residue (Aib) + + A protein modification that inserts or replaces a residue with a 2-aminoisobutyric acid. + + 0 + DeltaMass + + + Modification from DeltaMass: Average Mass: 85. + + 2-amino-2-methylpropanoic acid + PSI-MOD-alternate + + + 2-amino-2-methylpropionic acid + PSI-MOD-alternate + + + 2-methylalanine + PSI-MOD-alternate + + + Aib + PSI-MOD-alternate + + + alpha,alpha-dimethylglycine + PSI-MOD-alternate + + + alpha-aminoisobutyric acid + PSI-MOD-alternate + + + alpha-methylalanine + PSI-MOD-alternate + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + C 4 H 7 N 1 O 1 + + + + MassAvg + 85.11 + + + + MassMono + 85.052764 + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00850 + PSI-MOD + + + MOD:01002 + gamma-aminobutyryl + + modification from DeltaMass + + 92 + DeltaMass + + + From DeltaMass: Average Mass: 85 Formula: C 4 H 7 O 1 N 1 Monoisotopic Mass Change: 85.053 Average Mass Change: 85.106 + + + DiffAvg + 85.11 + + + + DiffFormula + C 4 H 7 N 1 O 1 + + + + DiffMono + 85.052764 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00947 + PSI-MOD + + + MOD:01003 + t-butyloxymethyl (Bum) + + modification from DeltaMass + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 86 + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00947 + PSI-MOD + + + MOD:01004 + diaminopropionyl + + modification from DeltaMass + + 95 + DeltaMass + + + From DeltaMass: Average Mass: 86 Formula: C 3 H 6 O 2 N 1 Monoisotopic Mass Change: 86.048 Average Mass Change: 86.094 + + + DiffAvg + 86.09 + + + + DiffFormula + C 3 H 6 N 2 O 1 + + + + DiffMono + 86.048013 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00947 + PSI-MOD + + + MOD:01005 + t-butylsulfenyl + + modification from DeltaMass + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 88 + + StBu + DeltaMass-label + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00947 + PSI-MOD + + + MOD:01006 + dibrominated tyrosine + + A protein modification that effectively substitutes two hydrogen atoms of an L-tyrosine residue with two bromine atoms. + + 534 + UniMod + + + + Br2Tyr + PSI-MOD-label + + + Dibromo + PSI-MS-label + + + Dibromo + UniMod-description + + + + DiffAvg + 157.79 + + + + DiffFormula + Br 2 C 0 H -2 N 0 O 0 + + + + DiffMono + 155.821024 + + + + Formula + Br 2 C 9 H 7 N 1 O 2 + + + + MassAvg + 320.97 + + + + MassMono + 318.884353 + + + + Origin + Y + + + + Source + none + + + + TermSpec + none + + MOD:00988 + PSI-MOD + + + MOD:01007 + anisyl modified residue + + A protein modification that effectively substitutes an anisyl (methoxyphenyl) group for a hydroxyl group, typically at the 4 or para position. + + 0 + DeltaMass + + + From DeltaMass with no citation or formula: Average Mass: 90. + + + DiffAvg + 90.13 + + + + DiffFormula + C 7 H 6 + + + + DiffMono + 90.046950 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + PSI-MOD + + + MOD:01008 + benzyl (Bzl) and benzyl ester (OBzl) modified residue + + A protein modification that effectively substitutes a benzyl (phenylmethyl) group for a hydrogen atom. + + 0 + DeltaMass + + + From DeltaMass with no citation or formula: Average Mass: 90 + + + DiffAvg + 90.13 + + + + DiffFormula + C 7 H 6 + + + + DiffMono + 90.046950 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + PSI-MOD + + + MOD:01009 + dehydrogenated proline + + modification from DeltaMass + + 0 + DeltaMass + + + From DeltaMass with no citation. + + + DiffAvg + -2.02 + + + + DiffFormula + C 0 H -2 N 0 O 0 + + + + DiffMono + -2.015650 + + + + Formula + C 5 H 5 N 1 O 1 + + + + MassAvg + 95.10 + + + + MassMono + 95.037114 + + + + Origin + P + + + + Source + none + + + + TermSpec + none + + MOD:00915 + MOD:01888 + PSI-MOD + + + MOD:01010 + trifluoroacetylated residue + + A protein modification that effectively substitutes a trifluoroacetyl group for a hydrogen atom. + + 0 + DeltaMass + + + + TFA + DeltaMass-label + + + + DiffAvg + 96.01 + + + + DiffFormula + C 2 F 3 H -1 O 1 + + + + DiffMono + 95.982299 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00498 + MOD:00649 + MOD:00848 + PSI-MOD + + + MOD:01011 + N-hydroxysuccinimide (ONSu, OSu) + + modification from DeltaMass + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 97 + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00947 + PSI-MOD + + + MOD:01012 + oxidation of disulfide crosslink in cystine to two cysteic acids + + A protein modification that effectively oxidizes the disulfide bond of a cystine crosslink to form two cysteic acid residues. + + 335 + DeltaMass + + + Cross-link 2. This modification destroys a cross-link. From DeltaMass: Average Mass: 98 Abbreviation: Cya Average Mass Change: 98 Notes: Treatment of cystine by strongly oxidising reagents such as performic acid results in the breakage of the disulphide bond and complete oxidation of the sulphur atoms on each molecule. Such treatment is often carried out prior to amino acid analysis as the resulting cysteic acid is then resistant to acid degradation during the hydrolysis procedure. + + + DiffAvg + 98.01 + + + + DiffFormula + C 0 H 2 N 0 O 6 S 0 + + + + DiffMono + 97.985138 + + + + Formula + C 6 H 10 N 2 O 8 S 2 + + + + MassAvg + 302.27 + + + + MassMono + 301.987857 + + + + Origin + MOD:00034 + + + + Source + artifact + + + + TermSpec + none + + MOD:00460 + + derives_from + MOD:000340 + + PSI-MOD + + + MOD:01013 + tetramethylguanidinium termination by-product on amine + + modification from DeltaMass + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 98 + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + none + + + + TermSpec + none + + MOD:00947 + PSI-MOD + + + MOD:01014 + phosphate/sulphate adduct of proteins + + modification from DeltaMass + + 358 + DeltaMass + + + From DeltaMass: Average Mass: 98 Formula:H3PO4 or H2SO4 Monoisotopic Mass Change:97.97 Average Mass Change:98 Notes:Proteins may pick up non-covalent salt adducts during purification. Phosphate and sulphate salts are commonly used and may be observed as +98 amu adducts (or multiples thereof) forming ion pairs with basic residues. Monoisotopic masses H2SO4 97.967, H3PO4 97.977 + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + none + + + + TermSpec + none + + MOD:00947 + PSI-MOD + + + MOD:01015 + isovaline residue (Iva) + + A protein modification that inserts or replaces a residue with an isovaline. + + 110 + DeltaMass + + + + 2-amino-2-methylbutanoic acid + PSI-MOD-alternate + + + Isovalyl (-I-,-Iva-) + DeltaMass-label + + + Iva + PSI-MOD-label + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + C 5 H 9 N 1 O 1 + + + + MassAvg + 99.13 + + + + MassMono + 99.068414 + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00850 + PSI-MOD + + + MOD:01016 + t-butyloxycarbonyl + + modification from DeltaMass + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 100 + + tBoc + DeltaMass-label + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00947 + PSI-MOD + + + MOD:01017 + homoseryl (-Hse-) + + OBSOLETE because redundant and identical to MOD:00403. Remap to MOD:00403. + + 113 + DeltaMass + + + From DeltaMass: Average Mass: 101 Abbreviation:-Hse- Formula:C4H7O2N Monoisotopic Mass Change:101.048 Average Mass Change:101.105 + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + M + + + + Source + artifact + + + + TermSpec + none + + 1 + PSI-MOD + + + MOD:01018 + 4-methylbenzyl + + modification from DeltaMass + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 104 + + Meb + DeltaMass-label + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + PSI-MOD + + + MOD:01019 + hydroxymethylphenyl linker + + modification from DeltaMass + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 106 + + HMP + DeltaMass-label + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00947 + PSI-MOD + + + MOD:01020 + thioanisyl + + modification from DeltaMass + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 106 + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00947 + PSI-MOD + + + MOD:01021 + thiocresyl + + modification from DeltaMass + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 106 + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00947 + PSI-MOD + + + MOD:01022 + 2-piperidinecarboxylic acid + + A protein modification that effectively converts an L-lysine residue to 2-piperidinecarboxylic acid. + + 0 + DeltaMass + + + + Pip + DeltaMass-label + + + + DiffAvg + -17.03 + + + + DiffFormula + C 0 H -3 N -1 O 0 + + + + DiffMono + -17.026549 + + + + Formula + C 6 H 9 N 1 O 1 + + + + MassAvg + 111.14 + + + + MassMono + 111.068414 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00601 + MOD:00912 + MOD:01160 + PSI-MOD + + + MOD:01023 + 3',5'-dibromo-L-tyrosine + + A protein modification that effectively converts an L-tyrosine residue to 3',5'-dibromo-L-tyrosine. + + 156 + DeltaMass + + + + 3',5'-Br2Tyr + PSI-MOD-label + + + + DiffAvg + 157.79 + + + + DiffFormula + Br 2 C 0 H -2 N 0 O 0 + + + + DiffMono + 155.821024 + + + + Formula + Br 2 C 9 H 7 N 1 O 2 + + + + MassAvg + 320.97 + + + + MassMono + 318.884353 + + + + Origin + Y + + + + Source + none + + + + TermSpec + none + + MOD:01006 + PSI-MOD + + + MOD:01024 + monohydroxylated proline + + A protein modification that effectively converts an L-proline residue to one of several monohydroxylated proline residues, including 3-hydroxy-L-proline and 4-hydroxy-L-proline. + + 0 + DeltaMass + + + 35#P + UniMod + + + From DeltaMass: Average Mass: 131. This is the mass of the free amino acid [JSG]. + PSI-MOD-slim + + Hy1Pro + PSI-MOD-label + + + hydroxylationp + OMSSA-label + + + Hydroxyproline + DeltaMass-label + + + Hyp + DeltaMass-label + + + Oxidation + PSI-MS-label + + + + DiffAvg + 16.00 + + + + DiffFormula + C 0 H 0 N 0 O 1 + + + + DiffMono + 15.994915 + + + + Formula + C 5 H 7 N 1 O 2 + + + + MassAvg + 113.12 + + + + MassMono + 113.047678 + + + + Origin + P + + + + Source + natural + + + + TermSpec + none + + MOD:00425 + MOD:00594 + MOD:00678 + PSI-MOD + + + MOD:01025 + 3'-bromo-L-tyrosine + + A protein modification that effectively converts an L-tyrosine residue to 3'-bromo-L-tyrosine. + + 18688235 + PubMed + + + + 3'-BrTyr + PSI-MOD-label + + + + DiffAvg + 78.90 + + + + DiffFormula + Br 1 H -1 + + + + DiffMono + 77.910512 + + + + Formula + Br 1 C 9 H 8 N 1 O 2 + + + + MassAvg + 242.07 + + + + MassMono + 240.973841 + + + + Origin + Y + + + + Source + none + + + + TermSpec + none + + MOD:01000 + PSI-MOD + + + MOD:01026 + norleucine residue (Nle) + + A protein modification that inserts or replaces a residue with a norleucine. + + 126 + DeltaMass + + + + Nle + DeltaMass-label + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + C 6 H 11 N 1 O 1 + + + + MassAvg + 113.16 + + + + MassMono + 113.084064 + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00850 + PSI-MOD + + + MOD:01027 + t-amyloxycarbonyl + + modification from DeltaMass + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 114 + + Aoc + DeltaMass-label + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00947 + PSI-MOD + + + MOD:01028 + monochlorinated L-tyrosine + + A protein modification that effectively substitutes one hydrogen atom of an L-tyrosine residue with one chlorine atom. + + 18688235 + PubMed + + + + Cl1Tyr + PSI-MOD-label + + + + DiffAvg + 34.44 + + + + DiffFormula + C 0 Cl 1 H -1 N 0 O 0 + + + + DiffMono + 33.961028 + + + + Formula + C 9 Cl 1 H 8 N 1 O 2 + + + + MassAvg + 197.62 + + + + MassMono + 197.024356 + + + + Origin + Y + + + + Source + artifact + + + + TermSpec + none + + MOD:00987 + MOD:01911 + PSI-MOD + + + MOD:01029 + succinylated residue + + A protein modification that effectively replaces a hydrogen atom with a succinyl group linked through a carbonyl carbon. + + 0 + DeltaMass + + + 64 + UniMod + + + From DeltaMass with no citation or formula, Average Mass: 117 [JSG]. + PSI-MOD-slim + + Succinic anhydride labeling reagent light form (N-term & K) + UniMod-description + + + + DiffAvg + 100.07 + + + + DiffFormula + C 4 H 4 O 3 + + + + DiffMono + 100.016044 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + none + + + + TermSpec + none + + MOD:00649 + PSI-MOD + + + MOD:01030 + hydroxybenzotriazole ester + + modification from DeltaMass + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 117 + + HOBt + DeltaMass-label + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00947 + PSI-MOD + + + MOD:01031 + dimethylbenzyl + + modification from DeltaMass + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 118 + + diMeBzl + DeltaMass-label + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00947 + PSI-MOD + + + MOD:01032 + benzyloxymethyl modified residue + + A protein modification that effectively substitutes a benzyloxymethyl group for a hydrogen atom. + + 0 + DeltaMass + + + + Bom + DeltaMass-label + + + + DiffAvg + 120.15 + + + + DiffFormula + C 8 H 8 O 1 + + + + DiffMono + 120.057515 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + PSI-MOD + + + MOD:01033 + p-methoxybenzyl modified residue + + A protein modification that effectively substitutes a p-methoxybenzyl group for a hydrogen atom. + + 0 + DeltaMass + + + + Mbzl + DeltaMass-label + + + Mob + DeltaMass-label + + + + DiffAvg + 120.15 + + + + DiffFormula + C 8 H 8 O 1 + + + + DiffMono + 120.057515 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + PSI-MOD + + + MOD:01034 + 4-nitrophenyl modified residue + + A protein modification that effectively substitutes a 4-nitrophenyl group for a hydrogen atom. + + 0 + DeltaMass + + + + ONp + DeltaMass-label + + + p-nitrophenyl + DeltaMass-label + + + + DiffAvg + 121.10 + + + + DiffFormula + C 6 H 3 N 1 O 2 + + + + DiffMono + 121.016378 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + PSI-MOD + + + MOD:01035 + chlorobenzyl + + modification from DeltaMass + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 125 + + ClBzl + DeltaMass-label + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00947 + PSI-MOD + + + MOD:01036 + O-methyl aspartyl + + OBSOLETE because redundant and identical to MOD:01181. Remap to MOD:01181. + + 18688235 + PubMed + + + From DeltaMass:148 (name misspelled "aspartamyl", and formula incorrect, N and O reversed) Average Mass: 129 Formula: C5H7O1N3 Monoisotopic Mass Change: 129.042 Average Mass Change: 129.116 + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + C 5 H 7 N 1 O 3 + + + + MassAvg + 129.12 + + + + MassMono + 129.042593 + + + + Origin + D + + + + Source + none + + + + TermSpec + none + + 1 + PSI-MOD + + + MOD:01037 + dichlorinated tyrosine + + A protein modification that effectively substitutes two hydrogen atoms of an L-tyrosine residue with two chlorine atoms. + + 18688235 + PubMed + + + + Cl2Tyr + PSI-MOD-label + + + + DiffAvg + 68.88 + + + + DiffFormula + C 0 Cl 2 H -2 N 0 O 0 + + + + DiffMono + 67.922055 + + + + Formula + C 9 Cl 2 H 7 N 1 O 2 + + + + MassAvg + 232.06 + + + + MassMono + 230.985384 + + + + Origin + Y + + + + Source + artifact + + + + TermSpec + none + + MOD:00987 + PSI-MOD + + + MOD:01038 + norleucine (Nle) + + OBSOLETE because this represents a free amino acid and the corresponding residue is MOD:01026. + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 131. + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + none + + + + Source + none + + + + TermSpec + none + + 1 + PSI-MOD + + + MOD:01039 + hydroxy aspartyl + + OBSOLETE because redundant and identical to MOD:00036. Remap to MOD:00036. + + 18688235 + PubMed + + + From DeltaMass:152 (name misspelled "aspartamyl", and formula incorrect, N and O reversed) Average Mass: 131 Formula:C4H5O1N4 Monoisotopic Mass Change:131.022 Average Mass Change:131.088 + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + C 4 H 5 N 1 O 4 + + + + MassAvg + 131.09 + + + + MassMono + 131.021858 + + + + Origin + D + + + + Source + none + + + + TermSpec + none + + 1 + PSI-MOD + + + MOD:01040 + penicillamine residue + + A protein modification that inserts or replaces a residue with a penicillamine. + + 154 + DeltaMass + + + From DeltaMass: Name misspelled 'bb-dimethyl cystenyl'. No citation provided. + + 2-amino-3-mercapto-3-methylbutanoic acid + PSI-MOD-alternate + + + 2-amino-3-methyl-3-sulfanylbutanoic acid + PSI-MOD-alternate + + + 3,3-dimethylcysteine + PSI-MOD-alternate + + + 3-mercapto-L-valine + PSI-MOD-alternate + + + beta,beta-dimethylcysteine + DeltaMass-label + + + Pen + DeltaMass-label + + + Pen + PSI-MOD-alternate + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + C 5 H 9 N 1 O 1 S 1 + + + + MassAvg + 131.19 + + + + MassMono + 131.040485 + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00850 + PSI-MOD + + + MOD:01041 + benzyloxycarbonyl modified residue + + A protein modification that effectively substitutes a benzyloxycarbonyl group for a hydrogen atom. + + 0 + DeltaMass + + + + Z + DeltaMass-label + + + + DiffAvg + 134.13 + + + + DiffFormula + C 8 H 6 O 2 + + + + DiffMono + 134.036779 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + none + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + PSI-MOD + + + MOD:01042 + adamantyl modified residue + + A protein modification that effectively substitutes a adamantyl group for a hydrogen atom. + + 0 + DeltaMass + + + + Ada + DeltaMass-label + + + + DiffAvg + 134.22 + + + + DiffFormula + C 10 H 14 + + + + DiffMono + 134.109550 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + none + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + PSI-MOD + + + MOD:01043 + p-nitrobenzyl ester modified residue + + A protein modification that effectively substitutes a p-nitrobenzyl group for the hydrogen atom of a carboxyl group. + + 0 + DeltaMass + + + + ONb + DeltaMass-label + + + + DiffAvg + 135.12 + + + + DiffFormula + C 7 H 5 N 1 O 2 + + + + DiffMono + 135.032028 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + none + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + PSI-MOD + + + MOD:01044 + N-methyl glutamyl + + OBSOLETE because redundant and identical to MOD:00080. Remap to MOD:00080. + + 166 + DeltaMass + + + From DeltaMass with no citation. Formula:C6H10O2N2 (name misspelled, formula for N5-methylglutaminyl, rather than N2-methylglutamyl) + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + Q + + + + Source + none + + + + TermSpec + none + + 1 + PSI-MOD + + + MOD:01045 + 3',5'-dichloro-L-tyrosine + + A protein modification that effectively converts an L-tyrosine residue to 3',5'-dichloro-L-tyrosine. + + 18688235 + PubMed + + + + 3',5'-Cl2Tyr + PSI-MOD-label + + + + DiffAvg + 68.88 + + + + DiffFormula + C 0 Cl 2 H -2 N 0 O 0 + + + + DiffMono + 67.922055 + + + + Formula + C 9 Cl 2 H 7 N 1 O 2 + + + + MassAvg + 232.06 + + + + MassMono + 230.985384 + + + + Origin + Y + + + + Source + artifact + + + + TermSpec + none + + MOD:01037 + PSI-MOD + + + MOD:01046 + 3'-chloro-L-tyrosine + + A protein modification that effectively converts an L-tyrosine residue to 3'-chloro-L-tyrosine. + + 18688235 + PubMed + + + + 3'-ClTyr + PSI-MOD-label + + + + DiffAvg + 34.44 + + + + DiffFormula + C 0 Cl 1 H -1 N 0 O 0 + + + + DiffMono + 33.961028 + + + + Formula + C 9 Cl 1 H 8 N 1 O 2 + + + + MassAvg + 197.62 + + + + MassMono + 197.024356 + + + + Origin + Y + + + + Source + artifact + + + + TermSpec + none + + MOD:01028 + PSI-MOD + + + MOD:01047 + monohydroxylated lysine + + A protein modification that effectively converts an L-lysine residue to a monohydroxylated lysine. + + 168 + DeltaMass + + + 35#K + UniMod + + + From DeltaMass: Average Mass: 144 Abbreviation:-Hyl- Formula:C6H12N2O2 Monoisotopic Mass Change:144.09 Average Mass Change:144.174. + PSI-MOD-slim + + Hy1Lys + PSI-MOD-label + + + Hydroxy Lysyl (-Hyl-) + DeltaMass-label + + + hydroxylationk + OMSSA-label + + + Oxidation + PSI-MS-label + + + + DiffAvg + 16.00 + + + + DiffFormula + C 0 H 0 N 0 O 1 + + + + DiffMono + 15.994915 + + + + Formula + C 6 H 12 N 2 O 2 + + + + MassAvg + 144.17 + + + + MassMono + 144.089878 + + + + Origin + K + + + + Source + natural + + + + TermSpec + none + + MOD:00425 + MOD:00681 + PSI-MOD + + + MOD:01048 + 2-pyrrolidone-5-carboxylic acid + + A protein modification that effectively converts a source amino acid residue to 2-pyrrolidone-5-carboxylic acid. + + 18688235 + PubMed + + + From DeltaMass: Average Mass: -18 Average Mass Change: -18.01 References:The conversion of glutamic acid to pyroglutamic was reported for the beta-amiloid protein. Miller et al. Arch. Biochem. Biophy. (1993) 301, 41-52. + PSI-MOD-slim + + PyrGlu + PSI-MOD-label + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + C 5 H 6 N 1 O 2 + + + + MassAvg + 112.11 + + + + MassMono + 112.039853 + + + + Origin + X + + + + Source + none + + + + TermSpec + N-term + + MOD:00601 + MOD:00859 + PSI-MOD + + + MOD:01049 + halogenated histidine + + A protein modification that effectively substitutes a hydrogen atom of an L-histidine residue with a halogen atom. + + 18688235 + PubMed + + + + HalHis + PSI-MOD-label + + + + Origin + H + + + + Source + none + + + + TermSpec + none + + MOD:00694 + MOD:00909 + PSI-MOD + + + MOD:01050 + pyridyl alanyl + + modification from DeltaMass + + 180 + DeltaMass + + + From DeltaMass: Average Mass: 148 Formula:C8H8O2N1 Monoisotopic Mass Change:148.064 Average Mass Change:148.165 + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + A + + + + Source + artifact + + + + TermSpec + none + + MOD:00947 + PSI-MOD + + + MOD:01051 + 2-nitrobenzoyl + + modification from DeltaMass + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 149 + + NBz + DeltaMass-label + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + none + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + PSI-MOD + + + MOD:01052 + dimethoxybenzyl Trp + + modification from DeltaMass + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 150 + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + W + + + + Source + artifact + + + + TermSpec + none + + MOD:00947 + PSI-MOD + + + MOD:01053 + 2-nitrophenylsulphenyl + + modification from DeltaMass + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 153 + + Nps + DeltaMass-label + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + none + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + PSI-MOD + + + MOD:01054 + 4-toluenesulfonyl + + modification from DeltaMass + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 154 + + 4-toluenesulphonyl + DeltaMass-label + + + Tos + DeltaMass-label + + + Tosyl + DeltaMass-label + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + none + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + PSI-MOD + + + MOD:01055 + 3-nitro-2-pyridinesulfenyl + + modification from DeltaMass + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 154 + + Npys + DeltaMass-label + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + none + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + PSI-MOD + + + MOD:01056 + (79)Br labeled 3',5'-dibromotyrosine + + modification from DeltaMass + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 156 + + + DiffAvg + 155.82 + + + + DiffFormula + (79)Br 2 C 0 H -2 N 0 O 0 + + + + DiffMono + 155.821024 + + + + Formula + (79)Br 2 C 9 H 7 N 1 O 2 + + + + MassAvg + 318.88 + + + + MassMono + 318.884353 + + + + Origin + Y + + + + Source + artifact + + + + TermSpec + none + + MOD:01023 + PSI-MOD + + + MOD:01057 + (79)Br and (81)Br labeled 3',5'-dibromotyrosine + + modification from DeltaMass + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 158 + + + DiffAvg + 157.82 + + + + DiffFormula + (79)Br 1 (81)Br 1 C 0 H -2 N 0 O 0 + + + + DiffMono + 157.818978 + + + + Formula + (79)Br 1 (81)Br 1 C 9 H 7 N 1 O 2 + + + + MassAvg + 320.88 + + + + MassMono + 320.882306 + + + + Origin + Y + + + + Source + artifact + + + + TermSpec + none + + MOD:01023 + PSI-MOD + + + MOD:01058 + dichlorobenzyl + + modification from DeltaMass + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 159 + + Dcb + DeltaMass-label + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + none + + + + Source + artifact + + + + TermSpec + none + + MOD:00947 + PSI-MOD + + + MOD:01059 + (81)Br labeled 3',5'-dibromotyrosine + + modification from DeltaMass + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 160 + + + DiffAvg + 159.82 + + + + DiffFormula + (81)Br 2 C 0 H -2 N 0 O 0 + + + + DiffMono + 159.816931 + + + + Formula + (81)Br 2 C 9 H 7 N 1 O 2 + + + + MassAvg + 322.88 + + + + MassMono + 322.880260 + + + + Origin + Y + + + + Source + artifact + + + + TermSpec + none + + MOD:01023 + PSI-MOD + + + MOD:01060 + S-carboxamidomethyl-L-cysteine + + A protein modification that effectively converts an L-cysteine residue to S-carboxamidomethyl-L-cysteine. + + 196 + DeltaMass + + + 337 + DeltaMass + + + 10504701 + PubMed + + + 11510821 + PubMed + + + 12422359 + PubMed + + + 18306178 + PubMed + + + 4#C + UniMod + + + From DeltaMass: (name misspelled "Carboxyamidomethyl Cystenyl") [JSG]. + PSI-MOD-slim + + amidocarboxymethylcysteine + DeltaMass-label + + + CamC + PSI-MOD-alternate + + + CamCys + DeltaMass-label + + + Carbamidomethyl + PSI-MS-label + + + carbamidomethylc + OMSSA-label + + + carbamoylmethylcysteine + DeltaMass-label + + + Carboxamidomethyl (on Cysteine) + DeltaMass-label + + + Carboxyamidomethyl Cystenyl + DeltaMass-label + + + Iodoacetamide derivative + UniMod-description + + + S-carbamoylmethyl-L-cysteine + PSI-MOD-alternate + + + + DiffAvg + 57.05 + + + + DiffFormula + C 2 H 3 N 1 O 1 S 0 + + + + DiffMono + 57.021464 + + + + Formula + C 5 H 8 N 2 O 2 S 1 + + + + MassAvg + 160.19 + + + + MassMono + 160.030649 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:00397 + MOD:00905 + PSI-MOD + + + MOD:01061 + S-carboxymethyl-L-cysteine + + A protein modification that effectively converts an L-cysteine residue to S-carboxymethyl-L-cysteine. + + 0 + DeltaMass + + + 197 + DeltaMass + + + 6#C + UniMod + + + From DeltaMass with no citation, name misspelled "Carboxymethyl Cystenyl", and formula incorrect, N and O reversed: Average Mass: 161 Abbreviation: -Cmc- Formula: C5H7O1N3S1 Monoisotopic Mass Change: 161.015 Average Mass Change: 161.179 [JSG]. + PSI-MOD-slim + + Carboxymethyl + PSI-MS-label + + + Carboxymethyl cysteine + DeltaMass-label + + + Carboxymethyl Cystenyl + DeltaMass-label + + + carboxymethylc + OMSSA-label + + + CmC + PSI-MOD-alternate + + + Iodoacetic acid derivative + UniMod-description + + + + DiffAvg + 58.04 + + + + DiffFormula + C 2 H 2 N 0 O 2 S 0 + + + + DiffMono + 58.005479 + + + + Formula + C 5 H 7 N 1 O 3 S 1 + + + + MassAvg + 161.18 + + + + MassMono + 161.014664 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:00399 + MOD:00905 + PSI-MOD + + + MOD:01062 + carboxymethyl cysteinyl + + OBSOLETE because duplicate and redundant with MOD:01061. Remap to MOD:01061 + + 197 + DeltaMass + + + From DeltaMass:197 (Name misspelled "cystenyl", and formula incorrect, N and O reversed) Abbreviation:-Cmc- Formula:C5H7O1N3S1 Monoisotopic Mass Change:161.015 Average Mass Change:161.179 + + Carboxymethyl Cystenyl + DeltaMass-label + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + C 5 H 7 N 3 O 1 S 1 + + + + MassAvg + 157.19 + + + + MassMono + 157.030983 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + 1 + PSI-MOD + + + MOD:01063 + monomethylated phenylalanine + + A protein modification that effectively converts an L-phenylalanine residue to a monomethylated phenylalanine. + + 198 + DeltaMass + + + From DeltaMass: Average Mass: 161 Formula: C10H11O1N1 Monoisotopic Mass Change: 161.084 Average Mass Change: 161.205. No citation provided. It is not obvious whether the DeltaMass entry is supposed to represent N-methylphenylalanine, alpha-methylphenylalanine, 2'-, 3'-, or 4'-methylphenylalanine [JSG]. + PSI-MOD-slim + + NMePhe + PSI-MOD-label + + + + DiffAvg + 14.03 + + + + DiffFormula + C 1 H 2 N 0 O 0 + + + + DiffMono + 14.015650 + + + + Formula + C 10 H 11 N 1 O 1 + + + + MassAvg + 161.20 + + + + MassMono + 161.084064 + + + + Origin + F + + + + Source + none + + + + TermSpec + none + + MOD:00599 + MOD:00717 + PSI-MOD + + + MOD:01064 + inositol + + modification from DeltaMass + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 162 + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + none + + + + Source + none + + + + TermSpec + none + + MOD:00947 + PSI-MOD + + + MOD:01065 + hexose glycated N-terminal + + A modification produced in a non-enzymatic reaction between a carbohydrate carbonyl group (C1 of aldohexose or C2 of fructose) and a protein N-terminal amino group to form a Schiff-base or an Amadori ketosamine (or aminoketose) residue adduct. + + 0 + DeltaMass + + + 41#N-term + UniMod + + + From DeltaMass: Average Mass: 162 + + + DiffAvg + 162.14 + + + + DiffFormula + C 6 H 10 O 5 + + + + DiffMono + 162.052823 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + none + + + + Source + none + + + + TermSpec + N-term + + MOD:00767 + PSI-MOD + + + MOD:01066 + halogenated phenylalanine + + A protein modification that effectively substitutes a hydrogen atom of an L-phenylalanine residue with a halogen atom. + + 18688235 + PubMed + + + + HalPhe + PSI-MOD-label + + + + Origin + F + + + + Source + none + + + + TermSpec + none + + MOD:00694 + MOD:00914 + PSI-MOD + + + MOD:01067 + linker attached to peptide in Fmoc peptide synthesis + + modification from DeltaMass + + 341 + DeltaMass + + + From DeltaMass: Average Mass: 162 Average Mass Change:162 Notes: (from the ABRF discussion list archive) There may be ... things in the reagent K that would allow cleavage of the peptide to occur at the wrong place...in this case it removes the dimethoxybenzyl group first inactivating that site for cleavage, and it goes after tne next amide bond closer to the resin. Try the TFA/TIS/water/EDT cocktail...TFA = 92%, TIS =3%, and water is at 5%. .. had this issue on longer peptides.. and by increasing the amount of water a little bit... able to elminate this problem. + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + none + + + + Source + artifact + + + + TermSpec + none + + MOD:00947 + PSI-MOD + + + MOD:01068 + halogenated tryptophan + + A protein modification that effectively substitutes a hydrogen atom of an L-tryptophan residue with a halogen atom. + + 18688235 + PubMed + + + + HalTrp + PSI-MOD-label + + + + Origin + W + + + + Source + none + + + + TermSpec + none + + MOD:00694 + MOD:00918 + PSI-MOD + + + MOD:01069 + 2,4-dinitrophenyl modified residue + + A protein modification that effectively substitutes a 2,4-dinitrophenyl group for a hydrogen atom. + + 0 + DeltaMass + + + + Dnp + DeltaMass-label + + + + DiffAvg + 166.09 + + + + DiffFormula + C 6 H 2 N 2 O 4 + + + + DiffMono + 166.001457 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + none + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + PSI-MOD + + + MOD:01070 + pentafluorophenyl modified residue + + A protein modification that effectively substitutes a pentafluorophenyl group for a hydrogen atom. + + 0 + DeltaMass + + + From DeltaMass: name mispelled "pentaflourophenyl" + + Pfp + DeltaMass-label + + + + DiffAvg + 166.05 + + + + DiffFormula + C 6 F 5 H -1 + + + + DiffMono + 165.984191 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + none + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + PSI-MOD + + + MOD:01071 + diphenylmethyl modified residue + + A protein modification that effectively substitutes a diphenylmethyl group for a hydrogen atom. + + 0 + DeltaMass + + + + Dpm + DeltaMass-label + + + + DiffAvg + 166.22 + + + + DiffFormula + C 13 H 10 + + + + DiffMono + 166.078250 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + PSI-MOD + + + MOD:01072 + monopotassium salt + + A protein modification that effectively substitutes one potassium atom for one hydrogen atom. + + 0 + DeltaMass + + + PSI-MOD-slim + + K1Res + PSI-MOD-label + + + + DiffAvg + 38.09 + + + + DiffFormula + H -1 K 1 + + + + DiffMono + 37.955882 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + none + + + + TermSpec + none + + MOD:00849 + PSI-MOD + + + MOD:01073 + 2-chlorobenzyloxycarbonyl modified residue + + A protein modification that effectively substitutes a 2-chlorobenzyloxycarbonyl group for a hydrogen atom. + + 0 + DeltaMass + + + + Clz + DeltaMass-label + + + + DiffAvg + 169.58 + + + + DiffFormula + C 8 Cl 1 H 6 O 2 + + + + DiffMono + 169.005632 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + PSI-MOD + + + MOD:01074 + napthylacetyl modified residue + + A protein modification that effectively substitutes a napthylacetyl group for a hydrogen atom. + + 0 + DeltaMass + + + + + DiffAvg + 169.20 + + + + DiffFormula + C 12 H 9 O 1 + + + + DiffMono + 169.065340 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + PSI-MOD + + + MOD:01075 + mercury containing modified residue + + A protein modification that effectively substitutes a mercury atom or a cluster containing mercury for hydrogen atoms, or that coordinates a mercury ion. + + 18688235 + PubMed + + + + HgRes + PSI-MOD-label + + MOD:00698 + PSI-MOD + + + MOD:01076 + N-methyl arginyl + + modification from DeltaMass - OBSOLETE because redundant and identical to MOD:00414. Remap to MOD:00414. + + 215 + DeltaMass + + + From DeltaMass: Average Mass: 170 Formula:C7H14O4N1 Monoisotopic Mass Change:170.117 Average Mass Change:170.215 + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + C 7 H 14 N 4 O 1 + + + + MassAvg + 170.22 + + + + MassMono + 170.116761 + + + + Origin + R + + + + Source + none + + + + TermSpec + none + + 1 + PSI-MOD + + + MOD:01077 + ethanedithiol/TFA cyclic adduct + + modification from DeltaMass + + 216 + DeltaMass + + + From DeltaMass: Average Mass: 172 Average Mass Change:172 References:[1]. Sieber,P.(1987) Modification of tryptophan residues during acidolysis of4-methoxy-2,3,6-trimethylbenzenesulfonyl groups. Effects of scavengers. Tetrahedron Lett., 28(15),1637-1640. Notes: TFA-cyclic dithioketal by-product is formed when Trp-containing peptide is subjected to prolonged TFA/EDT treatment [1]. See structure at http://www.abrf.org/images/misc/dmass172.gif. Additional discussion of this adduct, and how to avoid it, can befound in Methods in Enzymology 289, 67 (1997) + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + none + + + + Source + artifact + + + + TermSpec + none + + MOD:00947 + PSI-MOD + + + MOD:01078 + S-(2-aminoethyl)-3-methylcysteine (Thr) + + A protein modification that effectively converts an L-threonine residue to S-(2-aminoethyl)-3-methylcysteine. + + 12923550 + PubMed + + + 472#T + UniMod + + + From DeltaMass: Average Mass: 146 Abbreviation:-AECys_ Formula:C5H10O2N1S1 Monoisotopic Mass Change:146.051 Average Mass Change:146.214 References:PE Sciex. + + 2-amino-3-(2-aminoethyl)sulfanyl-3-methylbutanoic acid + PSI-MOD-alternate + + + AEC-MAEC + UniMod-interim + + + beta-methylaminoethylcysteine + UniMod-description + + + S-aminoethyl-3-methylcysteine + PSI-MOD-alternate + + + + DiffAvg + 59.13 + + + + DiffFormula + C 2 H 5 N 1 O -1 S 1 + + + + DiffMono + 59.019356 + + + + Formula + C 6 H 12 N 2 O 1 S 1 + + + + MassAvg + 160.24 + + + + MassMono + 160.067034 + + + + Origin + T + + + + Source + artifact + + + + TermSpec + none + + MOD:00917 + PSI-MOD + + + MOD:01079 + S-(acetylamino)methyl-L-cysteine + + A protein modification that effectively converts an L-cysteine residue to S-[(acetylamino)methyl]-L-cysteine. + + 218 + DeltaMass + + + 8572278 + PubMed + + + From DeltaMass: (name misspelled "Acetamidomethyl Cystenyl") Average Mass: 174 Formula: C 6 H 10 O 2 N 2 S 1 Monoisotopic Mass Change: 174.046 Average Mass Change: 174.221. [These are aggregate masses, not delta masses.] See Organic Syntheses, Coll. Vol. 6, p.5 (1988); Vol. 59, p.190 (1979); http://www.orgsyn.org/orgsyn/orgsyn/prepContent.asp?prep=cv6p0005 [JSG]. + + Acetamidomethyl Cystenyl + DeltaMass-label + + + Acm-Cys + PSI-MOD-alternate + + + N-(hydroxymethyl)acetamide derivatized L-cysteine + PSI-MOD-alternate + + + S-(acetamido)methyl-L-cysteine + PSI-MOD-alternate + + + + DiffAvg + 71.08 + + + + DiffFormula + C 3 H 5 N 1 O 1 S 0 + + + + DiffMono + 71.037114 + + + + Formula + C 6 H 10 N 2 O 2 S 1 + + + + MassAvg + 174.22 + + + + MassMono + 174.046299 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + MOD:00905 + PSI-MOD + + + MOD:01080 + acrylamidyl cysteinyl + + modification from DeltaMass + + 219 + DeltaMass + + + From DeltaMass: (name misspelled "Acrylamidyl Cystenyl") Average Mass: 174 Formula: C6H10O2N2S1 Monoisotopic Mass Change: 174.046 Average Mass Change: 174.221 + + Acrylamidyl Cystenyl + DeltaMass-label + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + C 6 H 10 N 2 O 2 S 1 + + + + MassAvg + 174.22 + + + + MassMono + 174.046299 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:00947 + PSI-MOD + + + MOD:01081 + delta-glycosyloxy- (of lysine) or beta-glycosyloxy- (of phenylalanine or tyrosine) + + modification from DeltaMass + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 177. CAUTION - mass does not match formula. + + + DiffAvg + 178.14 + + + + DiffFormula + C 6 H 10 O 6 + + + + DiffMono + 178.047738 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + none + + + + Source + none + + + + TermSpec + none + + MOD:00947 + PSI-MOD + + + MOD:01082 + 4-glycosyloxy- (hexosyl, C6) (of proline) + + modification from DeltaMass + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 177. Caution: Formula does not match mass. The natural glycosylating sugar of hydroxyproline is galactose. + + + DiffAvg + 178.14 + + + + DiffFormula + C 6 H 10 O 6 + + + + DiffMono + 178.047738 + + + + Formula + C 11 H 17 N 1 O 6 + + + + MassAvg + 259.26 + + + + MassMono + 259.105587 + + + + Origin + P + + + + Source + none + + + + TermSpec + none + + MOD:00947 + PSI-MOD + + + MOD:01083 + O-benzyl-L-serine + + A protein modification that effectively converts an L-serine residue to O-benzyl-L-serine. + + 0 + DeltaMass + + + + + DiffAvg + 90.13 + + + + DiffFormula + C 7 H 6 + + + + DiffMono + 90.046950 + + + + Formula + C 10 H 11 N 1 O 2 + + + + MassAvg + 177.20 + + + + MassMono + 177.078979 + + + + Origin + S + + + + Source + artifact + + + + TermSpec + none + + MOD:00916 + MOD:01008 + PSI-MOD + + + MOD:01084 + iodoacetic acid derivatized amino-terminal residue + + A protein modification that by reaction of iodoacetic acid effectively replaces a residue alpha-amino- or alpha-imino-hydrogen with a carboxymethyl group. + + 6#N-term + UniMod + + + PSI-MOD-slim + + Carboxymethyl + PSI-MS-label + + + Carboxymethyl (on Cysteine) + DeltaMass-label + + + Iodoacetic acid derivative + UniMod-description + + + + DiffAvg + 58.04 + + + + DiffFormula + C 2 H 2 O 2 + + + + DiffMono + 58.005479 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + N-term + + MOD:00399 + PSI-MOD + + + MOD:01085 + alpha-N-gluconoylation (His Tagged proteins) + + modification from DeltaMass + + 226 + DeltaMass + + + From DeltaMass: Average Mass: 178 Formula: C6H10O6 Monoisotopic Mass Change: 178.05 Average Mass Change: 178.14 References: Geoghegan, K. F., H. B. Dixon, et al. (1999). Spontaneous alpha-N-6-phosphogluconoylation of a His tag in Escherichia coli: the cause of extra mass of 258 or 178 Da in fusion proteins. Anal Biochem 267(1): 169-84. + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + none + + + + Source + none + + + + TermSpec + none + + MOD:00947 + PSI-MOD + + + MOD:01086 + p-nitrobenzyloxycarbonyl + + modification from DeltaMass + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 179 + + 4Nz + DeltaMass-label + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + none + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + PSI-MOD + + + MOD:01087 + 2,4,5-trichlorophenyl modified residue + + A protein modification that effectively substitutes a 2,4,5-trichlorophenyl group for a hydrogen atom. + + 0 + DeltaMass + + + + + DiffAvg + 179.42 + + + + DiffFormula + C 6 Cl 3 H 1 + + + + DiffMono + 177.914383 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + none + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + PSI-MOD + + + MOD:01088 + 2,4,6-trimethyloxybenzyl modified residue + + A protein modification that effectively substitutes a 2,4,6-trimethyloxybenzyl group for a hydrogen atom. + + 0 + DeltaMass + + + + Tmob + DeltaMass-label + + + + DiffAvg + 180.20 + + + + DiffFormula + C 10 H 12 O 3 + + + + DiffMono + 180.078644 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + PSI-MOD + + + MOD:01089 + xanthyl + + modification from DeltaMass + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 180 + + Xan + DeltaMass-label + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + none + + + + Source + artifact + + + + TermSpec + none + + MOD:00947 + PSI-MOD + + + MOD:01090 + iodoacetamide derivatized amino-terminal residue + + A protein modification that by reaction of iodoacetamide effectively replaces a residue alpha-amino- or alpha-imino-hydrogen with a carboxamidomethyl group. + + 11327326 + PubMed + + + 11510821 + PubMed + + + 12422359 + PubMed + + + 4#N-term + UniMod + + + PSI-MOD-slim + + (carbamoylmethyl)amino + PSI-MOD-alternate + + + Carbamidomethyl + PSI-MS-label + + + Iodoacetamide derivative + UniMod-description + + + + DiffAvg + 57.05 + + + + DiffFormula + C 2 H 3 N 1 O 1 + + + + DiffMono + 57.021464 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + N-term + + MOD:00397 + PSI-MOD + + + MOD:01091 + monochlorinated L-phenylalanine + + A protein modification that effectively substitutes one hydrogen atom of an L-phenylalanine residue with one chlorine atom. + + 233 + DeltaMass + + + From DeltaMass: Average Mass: 182 Formula:C9H8O1N1Cl1 Monoisotopic Mass Change:181.029 Average Mass Change:181.623 + + Cl1Phe + PSI-MOD-label + + + + DiffAvg + 34.44 + + + + DiffFormula + C 0 Cl 1 H -1 N 0 O 0 + + + + DiffMono + 33.961028 + + + + Formula + C 9 Cl 1 H 8 N 1 O 1 + + + + MassAvg + 181.62 + + + + MassMono + 181.029442 + + + + Origin + F + + + + Source + artifact + + + + TermSpec + none + + MOD:01066 + MOD:01911 + PSI-MOD + + + MOD:01092 + mesitylene-2-sulfonyl + + modification from DeltaMass + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 182 + + Mts + DeltaMass-label + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + none + + + + Source + artifact + + + + TermSpec + none + + MOD:00947 + PSI-MOD + + + MOD:01093 + isopropyl lysyl + + modification from DeltaMass + + 236 + DeltaMass + + + From DeltaMass: Average Mass: 184 Formula: C9H16O2N2 Monoisotopic Mass Change: 184.12 Average Mass Change: 184.24 with no citation. + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + C 9 H 16 N 2 O 2 + + + + MassAvg + 184.24 + + + + MassMono + 184.121178 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00947 + PSI-MOD + + + MOD:01094 + N6-carboxymethyl-L-lysine + + A protein modification that effectively converts an L-lysine residue to N6-carboxymethyl-L-lysine. + + 237 + DeltaMass + + + 6#K + UniMod + + + From DeltaMass:237 (with no citation, formula incorrect, N and O reversed) Average Mass: 186 Formula: C8H14O2N3 Monoisotopic Mass Change: 186.1 Average Mass Change: 186.211 [JSG]. + PSI-MOD-slim + + Carboxymethyl + PSI-MS-label + + + Carboxymethyl Lysyl + DeltaMass-label + + + Iodoacetic acid derivative + UniMod-description + + + + DiffAvg + 58.04 + + + + DiffFormula + C 2 H 2 O 2 + + + + DiffMono + 58.005479 + + + + Formula + C 8 H 14 N 2 O 3 + + + + MassAvg + 186.21 + + + + MassMono + 186.100442 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00399 + PSI-MOD + + + MOD:01095 + Matrix alpha cyano MH+ + + Modification from DeltaMass. OBSOLETE because not an amino acid modification. + + 240 + DeltaMass + + + From DeltaMass with no citation, formula incorrect, N and O reversed: Formula: C10H8O1N3 Monoisotopic Mass Change: 190.05 Average Mass Change: 190.18. + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + C 10 H 8 N 1 O 3 + + + + MassAvg + 190.18 + + + + MassMono + 190.050418 + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + 1 + PSI-MOD + + + MOD:01096 + O-benzyl-L-threonine + + A protein modification that effectively converts an L-threonine residue to O-benzyl-L-threonine. + + 0 + DeltaMass + + + + + DiffAvg + 90.13 + + + + DiffFormula + C 7 H 6 + + + + DiffMono + 90.046950 + + + + Formula + C 11 H 13 N 1 O 2 + + + + MassAvg + 191.23 + + + + MassMono + 191.094629 + + + + Origin + T + + + + Source + artifact + + + + TermSpec + none + + MOD:00917 + MOD:01008 + PSI-MOD + + + MOD:01097 + S-benzyl-L-cysteine + + A protein modification that effectively converts an L-cysteine residue to S-benzyl-L-cysteine. + + 242 + DeltaMass + + + From DeltaMass: misspelled "Benzyl Cystenyl". + + + DiffAvg + 90.13 + + + + DiffFormula + C 7 H 6 + + + + DiffMono + 90.046950 + + + + Formula + C 10 H 11 N 1 O 1 S 1 + + + + MassAvg + 193.26 + + + + MassMono + 193.056135 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:00905 + MOD:01008 + PSI-MOD + + + MOD:01098 + naphthylalanine residue + + A protein modification that inserts or replaces a residue with a naphthylalanine. + + 243 + DeltaMass + + + From DeltaMass: Average Mass: 197 Formula: C13H11O1N1 Monoisotopic Mass Change: 197.084 Average Mass Change: 197.238. No citation provided. It is not obvious which isomer of naphthylalanine this DeltaMass entry is supposed to represent [JSG]. + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + C 13 H 11 N 1 O 1 + + + + MassAvg + 197.24 + + + + MassMono + 197.084064 + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00850 + PSI-MOD + + + MOD:01099 + succinyl beta-aspartyl anhydride + + A protein modification that effectively converts an L-aspartic acid residue to succinyl beta-aspartyl anhydride. + + 244 + DeltaMass + + + From DeltaMass with no citation (name misspelled "aspartamyl", and formula incorrect, N and O reversed) Average Mass: 198 Formula: C8H8O1N5 Monoisotopic Mass Change: 198.04 Average Mass Change: 198.156 [JSG]. + + succinyl aspartamyl + DeltaMass-label + + + + DiffAvg + 82.06 + + + + DiffFormula + C 4 H 2 N 0 O 2 + + + + DiffMono + 82.005479 + + + + Formula + C 8 H 8 N 1 O 5 + + + + MassAvg + 198.15 + + + + MassMono + 198.040247 + + + + Origin + D + + + + Source + artifact + + + + TermSpec + N-term + + MOD:00904 + MOD:01029 + PSI-MOD + + + MOD:01100 + HMP (hydroxymethylphenyl)/TFA adduct + + modification from DeltaMass + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 201 with no citation. + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + none + + + + Source + artifact + + + + TermSpec + none + + MOD:00947 + PSI-MOD + + + MOD:01101 + S-Farnesyl- + + OBSOLETE because erroneous and apparently redundant to MOD:00111. Remap to MOD:00111. + + 0 + DeltaMass + + + Modification from DeltaMass: Average Mass: 206. This entry with no other information available appears to be the same as the entry at 204 for "Farnesylation" but with an incorrect mass. + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + none + + + + Source + none + + + + TermSpec + none + + 1 + PSI-MOD + + + MOD:01102 + myristoylation-4H (two double bonds) + + OBSOLETE because redundant and identical to MOD:00504. Remap to MOD:00504. + + 348 + DeltaMass + + + From DeltaMass: Average Mass: 206 Formula: C14 H22 O1 Monoisotopic Mass Change: 206.167 Average Mass Change: 206.324 References: Neubert TA, Johnson RS, Hurley JB, Walsh KA (1992). The rod transducin alpha subunit amino terminus is heterogeneously fatty acylated. J Biol Chem. 267(26), 18274-7. Notes: Modification of protein N-terminus with (cis,cis-delta 5, delta 8)-tetradecadienoyl group (myristoylation with 2 double bonds) + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + none + + + + Source + natural + + + + TermSpec + none + + 1 + PSI-MOD + + + MOD:01103 + myristoleylation (one double bond) + + OBSOLETE because redundant and identical to MOD:00503. Remap to MOD:00503. + + 0 + DeltaMass + + + From DeltaMass with no citation or formula: Average Mass: 208. + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + none + + + + Source + natural + + + + TermSpec + none + + 1 + PSI-MOD + + + MOD:01104 + 4-methoxy-2,3,6-trimethylbenzenesulfonyl + + modification from DeltaMass + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 212 with no citation. + + Mtr + DeltaMass-label + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + none + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + PSI-MOD + + + MOD:01105 + 2-bromobenzyloxycarbonyl + + modification from DeltaMass + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 213 with no citation. + + BrZ + DeltaMass-label + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + none + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + PSI-MOD + + + MOD:01106 + N-formyl-L-tryptophan + + A protein modification that effectively converts an L-tryptophan residue to N-formyl-L-tryptophan. + + 0 + DeltaMass + + + From DeltaMass with no citation or formula: Average Mass: 214. It is not clear what this is supposed to represent. The mass corresponds to an N-formyl tryptophan (either N2 or N1'), but neither of these modifications has been reported as commonly encountered. It may have been confused with N'-formyl-L-kynurenine, see MOD:00464 [JSG] + + formyl tryptophanyl + DeltaMass-label + + + + DiffAvg + 28.01 + + + + DiffFormula + C 1 H 0 N 0 O 1 + + + + DiffMono + 27.994915 + + + + Formula + C 12 H 10 N 2 O 2 + + + + MassAvg + 214.22 + + + + MassMono + 214.074228 + + + + Origin + W + + + + Source + artifact + + + + TermSpec + none + + MOD:00409 + MOD:00918 + PSI-MOD + + + MOD:01107 + O5-benzyl-L-glutamate + + A protein modification that effectively converts an L-glutamic acid residue to O5-benzyl-L-glutamate. + + 258 + DeltaMass + + + From DeltaMass with no citation: (formula incorrect, N and O reversed; mass incorrect, aggregate not delta) Average Mass: 219 Formula: C12H13O1N3 Monoisotopic Mass Change: 219.241 Average Mass Change: 219.09 [JSG]. + + + DiffAvg + 90.13 + + + + DiffFormula + C 7 H 6 + + + + DiffMono + 90.046950 + + + + Formula + C 12 H 13 N 1 O 3 + + + + MassAvg + 219.24 + + + + MassMono + 219.089543 + + + + Origin + E + + + + Source + artifact + + + + TermSpec + none + + MOD:00906 + MOD:01008 + PSI-MOD + + + MOD:01108 + 2-amino-5-(4-methoxyphenyl)-5-oxopentanoic acid (Glu) + + A protein modification that effectively converts an L-glutamic acid residue to 2-amino-5-(4-methoxyphenyl)-5-oxopentanoic acid, glutamtic acid anisole adduct. + + 259 + DeltaMass + + + From DeltaMass with no citation: (formula incorrect, N and O reversed; mass incorrect, aggregate not delta) Average Mass: 219 Formula: C12H13O1N3 Monoisotopic Mass Change: 219.241 Average Mass Change: 219.09 [JSG]. + + anisole adducted glutamyl + DeltaMass-label + + + + DiffAvg + 90.13 + + + + DiffFormula + C 7 H 6 + + + + DiffMono + 90.046950 + + + + Formula + C 12 H 13 N 1 O 3 + + + + MassAvg + 219.24 + + + + MassMono + 219.089543 + + + + Origin + E + + + + Source + artifact + + + + TermSpec + none + + MOD:00906 + MOD:01007 + PSI-MOD + + + MOD:01109 + 9-fluorenylmethyloxycarbonyl (Fmoc) + + modification from DeltaMass + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 222 with no citation. + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + none + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + PSI-MOD + + + MOD:01110 + isoprenylated cysteine + + A protein modification that effectively replaces a hydrogen atom of an L-cysteine residue with a group derived from an isoprene polymer, such as a geranyl (C10), farnesyl (C15) or geranylgeranyl (C20). + + 18688235 + PubMed + + + PSI-MOD-slim + + IpCys + PSI-MOD-label + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + C + + + + Source + none + + + + TermSpec + none + + MOD:00703 + MOD:00905 + PSI-MOD + + + MOD:01111 + dimethoxybenzhydryl modified residue + + A protein modification that effectively substitutes a dimethoxybenzhydryl group for a hydrogen atom. + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 226 with no citation. A reagent, typically 4,4'-dimethoxybenzhydryl chloride, used as a protecting group for the carboxamido group of asparagine and glutamine during chemical peptide synthesis [JSG]. + + 4,4'-dimethoxybenzhydryl + PSI-MOD-alternate + + + bis(4-methoxyphenyl)methyl + PSI-MOD-alternate + + + Mbh + DeltaMass-label + + + + DiffAvg + 226.27 + + + + DiffFormula + C 15 H 14 O 2 + + + + DiffMono + 226.099380 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + none + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + PSI-MOD + + + MOD:01112 + nicotinoyl lysine + + modification from DeltaMass + + 266 + DeltaMass + + + From DeltaMass: (name misspelled "nicotinyl"; formula incorrect, N and O reversed; mass incorrect, aggregate not delta) Average Mass: 233 Formula: C12H15O3N2 Monoisotopic Mass Change: 233.116 Average Mass Change: 233.271 + + nicotinyl lysyl + DeltaMass-label + + + + DiffAvg + 105.10 + + + + DiffFormula + C 6 H 3 N 1 O 1 + + + + DiffMono + 105.021464 + + + + Formula + C 12 H 15 N 3 O 2 + + + + MassAvg + 233.27 + + + + MassMono + 233.116427 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00947 + PSI-MOD + + + MOD:01113 + 2-(p-biphenyl)isopropyl-oxycarbonyl + + modification from DeltaMass + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 238 with no citation. + + Bpoc + DeltaMass-label + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + none + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + PSI-MOD + + + MOD:01114 + triphenylmethyl + + modification from DeltaMass + + 270 + DeltaMass + + + From DeltaMass: Average Mass: 242 Average Mass Change: 242.3 Notes: blocking group used in peptide synthesis for C,H,Q,N + + Trityl + DeltaMass-label + + + Trt + DeltaMass-label + + + + DiffAvg + 242.32 + + + + DiffFormula + C 19 H 14 + + + + DiffMono + 242.109550 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + none + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + PSI-MOD + + + MOD:01115 + isoprenylated tryptophan + + A protein modification that effectively replaces a hydrogen atom of an L-tryptophan residue with a group derived from an isoprene polymer, such as a geranyl (C10), farnesyl (C15) or geranylgeranyl (C20). + + 18688235 + PubMed + + + + IpTrp + PSI-MOD-label + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + W + + + + Source + none + + + + TermSpec + none + + MOD:00703 + MOD:00918 + PSI-MOD + + + MOD:01116 + S-farnesyl-L-cysteine methyl ester + + A protein modification that effectively converts an L-cysteine residue to S-farnesyl-L-cysteine methyl ester. + + 15609361 + PubMed + + + AA0102#var + RESID + + + AA0105#var + RESID + + + PSI-MOD-slim + + SFarnOMeCys + PSI-MOD-label + + + + DiffAvg + 218.38 + + + + DiffFormula + C 16 H 26 N 0 O 0 S 0 + + + + DiffMono + 218.203451 + + + + Formula + C 19 H 32 N 1 O 2 S 1 + + + + MassAvg + 338.53 + + + + MassMono + 338.215375 + + + + Origin + C + + + + Source + natural + + + + TermSpec + C-term + + MOD:00905 + + has_functional_parent + MOD:001110 + + + has_functional_parent + MOD:001140 + + PSI-MOD + + + MOD:01117 + pentamethyldihydrobenzofuransulfonyl + + modification from DeltaMass + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 252 with no citation. + + Pbf + DeltaMass-label + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + none + + + + Source + artifact + + + + TermSpec + none + + MOD:00947 + PSI-MOD + + + MOD:01118 + alpha-N-6-phosphogluconoylation (His Tagged proteins) + + modification from DeltaMass + + 275 + DeltaMass + + + From DeltaMass: Average Mass: 258 Formula: C6H10O6HPO3 Monoisotopic Mass Change: 258.01 Average Mass Change: 258.12 References: Geoghegan, K. F., H. B. Dixon, et al. (1999). Spontaneous alpha-N-6-phosphogluconoylation of a His tag in Escherichia coli: the cause of extra mass of 258 or 178 Da in fusion proteins. Anal Biochem 267(1): 169-84. + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + none + + + + Source + none + + + + TermSpec + none + + MOD:00947 + PSI-MOD + + + MOD:01119 + S-geranylgeranyl-L-cysteine methyl ester + + A protein modification that effectively converts an L-cysteine residue to S-geranylgeranyl-L-cysteine methyl ester. + + 1483450 + PubMed + + + 15609361 + PubMed + + + AA0104#var + RESID + + + AA0105#var + RESID + + + PSI-MOD-slim + + SGergerOMeCys + PSI-MOD-label + + + + DiffAvg + 286.50 + + + + DiffFormula + C 21 H 34 N 0 O 0 S 0 + + + + DiffMono + 286.266051 + + + + Formula + C 24 H 40 N 1 O 2 S 1 + + + + MassAvg + 406.65 + + + + MassMono + 406.277976 + + + + Origin + C + + + + Source + natural + + + + TermSpec + C-term + + MOD:00905 + + has_functional_parent + MOD:001130 + + + has_functional_parent + MOD:001140 + + PSI-MOD + + + MOD:01120 + 2,2,5,7,8-pentamethylchroman-6-sulfonyl chloride derivatized residue + + A protein modification that is produced by formation of an adduct with 2,2,5,7,8-pentamethylchroman-6-sulfonyl chloride, Pmc chloride. + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 266 Notes: blocking group for Arg in peptide synthesis. CAS:112160-39-1 [JSG]. + + 2,2,5,7,8-pentamethyl-3,4-dihydro-2H-chromene-6-sulfonyl + PSI-MOD-alternate + + + 2,2,5,7,8-pentamethyl-6-chromansulfonyl + PSI-MOD-alternate + + + 2,2,5,7,8-pentamethyl-chromane-6-sulfonyl + PSI-MOD-alternate + + + 2,2,5,7,8-pentamethylchroman-6-sulfonyl + PSI-MOD-alternate + + + 2,2,5,7,8-pentamethylchroman-6-sulphonyl + PSI-MOD-alternate + + + 3,4-dihydro-2,2,5,7,8-pentamethyl-2H-1-benzopyran-6-sulfonyl + PSI-MOD-alternate + + + Pmc + DeltaMass-label + + + PmcRes + PSI-MOD-label + + + + DiffAvg + 266.36 + + + + DiffFormula + C 14 H 18 O 3 S 1 + + + + DiffMono + 266.097665 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:01652 + PSI-MOD + + + MOD:01121 + monomethoxytrityl + + modification from DeltaMass + + 280 + DeltaMass + + + From DeltaMass: Average Mass: 272 Average Mass Change: 272 + + Mmt + DeltaMass-label + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + none + + + + Source + artifact + + + + TermSpec + none + + MOD:00947 + PSI-MOD + + + MOD:01122 + 5'phos dCytidinyl + + modification from DeltaMass + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 289 with no citation. + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + none + + + + Source + none + + + + TermSpec + none + + MOD:00947 + PSI-MOD + + + MOD:01123 + monoiodated tyrosine + + OBSOLETE because redundant and identical to MOD:01123. Remap to MOD:01123. + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 289 + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + Y + + + + Source + none + + + + TermSpec + none + + 1 + PSI-MOD + + + MOD:01124 + aldohexosyl lysyl + + modification from DeltaMass + + 285 + DeltaMass + + + From DeltaMass: (formula incorrect, N and O reversed; mass incorrect, aggregate not delta) Average Mass: 290 Formula: C12H22O2N6 Monoisotopic Mass Change: 290.148 Average Mass Change: 290.317 + + + DiffAvg + 162.14 + + + + DiffFormula + C 6 H 10 N 0 O 5 + + + + DiffMono + 162.052823 + + + + Formula + C 12 H 22 N 2 O 6 + + + + MassAvg + 290.32 + + + + MassMono + 290.147786 + + + + Origin + K + + + + Source + none + + + + TermSpec + none + + MOD:00947 + PSI-MOD + + + MOD:01125 + 5'phos dThymidinyl + + modification from DeltaMass + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 304 with no citation. + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + none + + + + Source + none + + + + TermSpec + none + + MOD:00947 + PSI-MOD + + + MOD:01126 + 5'phos Cytidinyl + + modification from DeltaMass + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 305 with no citation. + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + none + + + + Source + none + + + + TermSpec + none + + MOD:00947 + PSI-MOD + + + MOD:01127 + 5'phos Uridinyl + + OBSOLETE because redundant and identical to MOD:01166. Remap to MOD:01166. + + 292 + DeltaMass + + + From DeltaMass: Average Mass: 306 Formula: C9H11O2N8P1 Monoisotopic Mass Change: 306.025 Average Mass Change: 306.17 + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + none + + + + Source + none + + + + TermSpec + none + + 1 + PSI-MOD + + + MOD:01128 + N-glycolneuraminic acid + + modification from DeltaMass + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 307 with no citation. + + NeuGc + DeltaMass-label + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + none + + + + Source + none + + + + TermSpec + none + + MOD:00947 + PSI-MOD + + + MOD:01129 + 5'phos dAdenosyl + + modification from DeltaMass + + 295 + DeltaMass + + + From DeltaMass: Average Mass: 313 Formula: C10H12O5N5P1 Monoisotopic Mass Change: 313.058 Average Mass Change: 313.211 + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + none + + + + Source + none + + + + TermSpec + none + + MOD:00947 + PSI-MOD + + + MOD:01130 + SucPhencarb Lysyl + + modification from DeltaMass + + 297 + DeltaMass + + + From DeltaMass: Average Mass: 327 Formula: C17H17O3N4 Monoisotopic Mass Change: 327.122 Average Mass Change: 327.342 + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + none + + + + Source + artifact + + + + TermSpec + none + + MOD:00947 + PSI-MOD + + + MOD:01131 + 5'phos dGuanosyl + + modification from DeltaMass + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 329 + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + none + + + + Source + none + + + + TermSpec + none + + MOD:00947 + PSI-MOD + + + MOD:01132 + 5'phos Adenosinyl + + OBSOLETE because redundant and identical to MOD:01165. Remap to MOD:01165. + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 329 + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + none + + + + Source + none + + + + TermSpec + none + + 1 + PSI-MOD + + + MOD:01133 + S-12-hydroxyfarnesyl-L-cysteine methyl ester + + A protein modification that effectively converts an L-cysteine residue to S-12-hydroxyfarnesyl-L-cysteine methyl ester. + + 17790543 + PubMed + + + AA0103#var + RESID + + + AA0105#var + RESID + + + + S12HyFarnOMeCys + PSI-MOD-label + + + + DiffAvg + 234.38 + + + + DiffFormula + C 16 H 26 N 0 O 1 S 0 + + + + DiffMono + 234.198365 + + + + Formula + C 19 H 32 N 1 O 3 S 1 + + + + MassAvg + 354.53 + + + + MassMono + 354.210290 + + + + Origin + C + + + + Source + natural + + + + TermSpec + C-term + + MOD:00905 + + has_functional_parent + MOD:001120 + + + has_functional_parent + MOD:001140 + + PSI-MOD + + + MOD:01134 + fluorescein labelling of peptide N-terminal using NHS ester + + modification from DeltaMass + + 306 + DeltaMass + + + From DeltaMass: Average Mass: 359 Formula: C21H11O6 Monoisotopic Mass Change: 359.055 Average Mass Change: 359.315 Notes: Using the DHB matrix at low pH the carboxyl group and one of the oxygens on the flurorescein molecule are protinated so the delta mass is 2Da higher than most text book illustrations would indicate. See Bioconjugate Techniques by Greg Hermanson, Academic Press, page 305, figure 204. Text books of course just show the coupling reaction at neutral or basic pH. + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + none + + + + Source + artifact + + + + TermSpec + none + + MOD:00947 + PSI-MOD + + + MOD:01135 + Hex-HexNAc + + modification from DeltaMass + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 365 with no citation. + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + none + + + + Source + none + + + + TermSpec + none + + MOD:00947 + PSI-MOD + + + MOD:01136 + dioctyl phthalate + + modification from DeltaMass + + 309 + DeltaMass + + + From DeltaMass: Average Mass: 391 Average Mass Change: 391 Notes: A common plasticizer, and, unfortunaltely, a common contaminate. A sodium adduct is often associated with this peak at 413. + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + none + + + + Source + artifact + + + + TermSpec + none + + MOD:00947 + PSI-MOD + + + MOD:01137 + N6-(2,2,5,7,8-pentamethylchroman-6-sulfonyl)-L-lysine + + A protein modification that is produced by reaction of a lysine residue with 2,2,5,7,8-pentamethylchroman-6-sulfonyl chloride, Pmc chloride, to form N6-(2,2,5,7,8-pentamethylchroman-6-sulfonyl)-L-lysine. + + 310 + DeltaMass + + + From DeltaMass: Average Mass: Formula: C20H30O2N4S1 Monoisotopic Mass Change: 394.192 Average Mass Change: 394.534 + + PMC lysyl + DeltaMass-label + + + PmcLys + PSI-MOD-label + + + + DiffAvg + 266.36 + + + + DiffFormula + C 14 H 18 O 3 S 1 + + + + DiffMono + 266.097665 + + + + Formula + C 20 H 30 N 2 O 4 S 1 + + + + MassAvg + 394.53 + + + + MassMono + 394.192628 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00902 + MOD:01120 + PSI-MOD + + + MOD:01138 + Aedans Cystenyl + + modification from DeltaMass + + 311 + DeltaMass + + + [probably aminoethyldansyl, JSG] From DeltaMass: (name misspelled "Aedans Cystenyl", and formula incorrect, N and O reversed) Average Mass: 409 Abbreviation: Aedans-Cys Formula: C17H19O3N5S2 Monoisotopic Mass Change: 409.077 Average Mass Change: 409.482 + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:00947 + PSI-MOD + + + MOD:01139 + dioctyl phthalate sodium adduct + + modification from DeltaMass + + 312 + DeltaMass + + + From DeltaMass: Mass: Average Mass Change: 413 Notes: A common plasticizer, and, unfortunaltely, a common contaminate. A sodium adduct is often associated with this peak at 413. + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + none + + + + Source + artifact + + + + TermSpec + none + + MOD:00947 + PSI-MOD + + + MOD:01140 + diiodinated tyrosine + + A protein modification that effectively substitutes two hydrogen atoms of an L-tyrosine residue with two iodine atoms. + + 0 + DeltaMass + + + 15627961 + PubMed + + + 130#Y + UniMod + + + PSI-MOD-slim + + 3,5-Diiodination (of Tyrosine) + DeltaMass-label + + + di-Iodination + UniMod-description + + + diiodinationy + OMSSA-label + + + Diiodo + PSI-MS-label + + + I2Tyr + PSI-MOD-label + + + + DiffAvg + 251.79 + + + + DiffFormula + C 0 H -2 I 2 N 0 O 0 + + + + DiffMono + 251.793295 + + + + Formula + C 9 H 7 I 2 N 1 O 2 + + + + MassAvg + 414.97 + + + + MassMono + 414.856624 + + + + Origin + Y + + + + Source + natural + + + + TermSpec + none + + MOD:00501 + MOD:00998 + PSI-MOD + + + MOD:01141 + omega-N-(2,2,5,7,8-pentamethylchroman-6-sulfonyl)-L-arginine + + A protein modification that is produced by reaction with 2,2,5,7,8-pentamethylchroman-6-sulfonyl chloride, Pmc chloride, to form omega-N-(2,2,5,7,8-pentamethylchroman-6-sulfonyl)-L-arginine. + + 314 + DeltaMass + + + From DeltaMass: Average Mass: Formula: C20H30O4N4S1 Monoisotopic Mass Change: 422.199 Average Mass Change: 422.547 + + PMC arginyl + DeltaMass-label + + + PmcArg + PSI-MOD-label + + + + DiffAvg + 266.36 + + + + DiffFormula + C 14 H 18 O 3 S 1 + + + + DiffMono + 266.097665 + + + + Formula + C 20 H 30 N 4 O 4 S 1 + + + + MassAvg + 422.54 + + + + MassMono + 422.198776 + + + + Origin + R + + + + Source + artifact + + + + TermSpec + none + + MOD:00902 + MOD:01120 + PSI-MOD + + + MOD:01142 + S-15,16-dihydrobiliverdin-L-cysteine + + A protein modification that effectively results from forming an adduct between a cysteine residue and the tetrapyrrole compound 15,16-dihydrobiliverdin. + + 10430868 + PubMed + + + 15504407 + PubMed + + + 1559975 + PubMed + + + 3208761 + PubMed + + + AA0428 + RESID + + + + (16R)-18-ethenyl-8,12-bis(2-carboxyethyl)-3-[(1R)-1-(((2R)-2-amino-2-carboxy)ethylsulfanyl)ethyl]-2,7,13,17-tetramethyl-15,16-dihydrobilin-1,19(21H,24H)-dione + RESID-systematic + + + 15,16-Dhbv + RESID-alternate + + + 15,16-dihydrobiliverdin cysteine adduct + RESID-alternate + + + 15,16-dihydrobiliverdin IXalpha + RESID-alternate + + + 18-ethenyl-8,12-bis(2-carboxyethyl)-3-(2-(cysteinyl-S)-ethyl)-2,7,13,17-tetramethylbiladiene-ab-1,19(16H,21H)-dione + RESID-alternate + + + 3'-cysteinyl-15,16-dihydrobiliverdin + RESID-alternate + + + 3alpha-cysteinyl-15,16-dihydrobiliverdin + RESID-alternate + + + BINDING 15,16-dihydrobiliverdin (covalent; via 1 link) + UniProt-feature + + + DBV + RESID-alternate + + + S-15,16-dihydrobiliverdin-L-cysteine + RESID-name + + + + DiffAvg + 584.67 + + + + DiffFormula + C 33 H 36 N 4 O 6 S 0 + + + + DiffMono + 584.263485 + + + + Formula + C 36 H 41 N 5 O 7 S 1 + + + + MassAvg + 687.81 + + + + MassMono + 687.272670 + + + + Origin + C + + + + Source + natural + + + + TermSpec + none + + MOD:00700 + MOD:00905 + PSI-MOD + + + MOD:01143 + 15,16-dihydrobiliverdin-bis-L-cysteine + + A protein modification that effectively results from forming an adduct between two cysteine residues and the tetrapyrrole compound 15,16-dihydrobiliverdin. + + 1559975 + PubMed + + + 2222853 + PubMed + + + 3208761 + PubMed + + + 8420941 + PubMed + + + AA0429 + RESID + + + Cross-link 2. + + (16R)-8,12-bis(2-carboxyethyl)-3-[2-(((2R)-2-amino-2-carboxy)ethylsulfanyl)ethyl]-18-[(1Xi)-1-(((2R)-2-amino-2-carboxy)ethylsulfanyl)ethyl]-2,7,13,17-tetramethyl-15,16-dihydrobilin-1,19(21H,24H)-dione + RESID-systematic + + + 15,16-Dhbv + RESID-alternate + + + 15,16-dihydrobiliverdin cysteine adduct + RESID-alternate + + + 15,16-dihydrobiliverdin IXalpha + RESID-alternate + + + 15,16-dihydrobiliverdin-bis-L-cysteine + RESID-name + + + 3'',18'-biscysteinyl-15,16-dihydrobiliverdin + RESID-alternate + + + 3beta,18alpha-biscysteinyl-15,16-dihydrobiliverdin + RESID-alternate + + + 8,12-bis(2-carboxyethyl)-3-(2-(cysteinyl-S)-ethyl)-18-(1-(cysteinyl-S)-ethyl)-2,7,13,17-tetramethylbiladiene-ab-1,19(16H,21H)-dione + RESID-alternate + + + BINDING 15,16-dihydrobiliverdin (covalent; via 2 links) + UniProt-feature + + + DBV + RESID-alternate + + + + DiffAvg + 584.67 + + + + DiffFormula + C 33 H 36 N 4 O 6 S 0 + + + + DiffMono + 584.263485 + + + + Formula + C 39 H 46 N 6 O 8 S 2 + + + + MassAvg + 790.95 + + + + MassMono + 790.281854 + + + + Origin + C, C + + + + Source + natural + + + + TermSpec + none + + MOD:00700 + MOD:00905 + PSI-MOD + + + MOD:01144 + S-(sn-1-2,3-dipalmitoylglycerol)-L-cysteine + + A protein modification that effectively converts an L-cysteine residue to S-(sn-1-2,3-dipalmitoyl-glycerol)cysteine. + + 0 + DeltaMass + + + 10896212 + PubMed + + + 4575979 + PubMed + + + 9056182 + PubMed + + + AA0107#var + RESID + + + From DeltaMass: Average Mass: 524 + PSI-MOD-slim + + S-(sn-1-Dipalmitoyl-glyceryl)- (on Cysteine) + DeltaMass-label + + + + DiffAvg + 550.91 + + + + DiffFormula + C 35 H 66 N 0 O 4 S 0 + + + + DiffMono + 550.496111 + + + + Formula + C 38 H 71 N 1 O 5 S 1 + + + + MassAvg + 654.05 + + + + MassMono + 653.505295 + + + + Origin + C + + + + Source + natural + + + + TermSpec + none + + MOD:00116 + PSI-MOD + + + MOD:01145 + N-tau-(ADP-ribosyl)diphthamide + + A protein modification that effectively converts an L-histidine residue to N-tau-(ADP-ribosyl)diphthamide. + + 0 + DeltaMass + + + From DeltaMass: (name misspelled "N theta -(ADP-ribosyl) diphthamide (of Histidine)") Average Mass: 648 + + + DiffAvg + 684.51 + + + + DiffFormula + C 22 H 36 N 7 O 14 P 2 + + + + DiffMono + 684.178999 + + + + FormalCharge + 1+ + + + + Formula + C 28 H 43 N 10 O 15 P 2 + + + + MassAvg + 821.65 + + + + MassMono + 821.237910 + + + + Origin + H + + + + Source + natural + + + + TermSpec + none + + MOD:00752 + MOD:00909 + + derives_from + MOD:000490 + + PSI-MOD + + + MOD:01146 + S-(6-FAD)-L-cysteine + + A protein modification that effectively converts an L-cysteine residue to S-(6-FAD)-L-cystine. + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 784 with no citation. This modification has not been reported [JSG]. + PSI-MOD-slim + + FAD + PSI-MS-label + + + S6FADCys + PSI-MOD-label + + + + DiffAvg + 783.54 + + + + DiffFormula + C 27 H 31 N 9 O 15 P 2 S 0 + + + + DiffMono + 783.141485 + + + + Formula + C 30 H 36 N 10 O 16 P 2 S 1 + + + + MassAvg + 886.68 + + + + MassMono + 886.150669 + + + + Origin + C + + + + Source + hypothetical + + + + TermSpec + none + + MOD:00895 + MOD:00905 + PSI-MOD + + + MOD:01147 + (Hex)3-HexNAc-(dHex)HexNAc + + modification from DeltaMass + + 0 + DeltaMass + + + From DeltaMass: Average Mass: 1,039 + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + none + + + + Source + none + + + + TermSpec + none + + MOD:00947 + PSI-MOD + + + MOD:01148 + ubiquitinylated lysine + + A protein modification that effectively crosslinks the N6-amino of a peptidyl lysine with the carboxyl-terminal glycine of a ubiquitin. + + 11125103 + PubMed + + + 18688235 + PubMed + + + PSI-MOD-slim + + + Origin + K + + + + Source + natural + + + + TermSpec + none + + MOD:00908 + MOD:01875 + + contains + MOD:001340 + + PSI-MOD + + + MOD:01149 + sumoylated lysine + + A protein modification that effectively crosslinks the N6-amino of a peptidyl lysine with the carboxyl-terminal glycine of a sumo (Small Ubiquitin-related MOdifier) protein. + + 12612601 + PubMed + + + 18688235 + PubMed + + + PSI-MOD-slim + + + Origin + K + + + + Source + natural + + + + TermSpec + none + + MOD:00908 + MOD:01875 + + contains + MOD:001340 + + PSI-MOD + + + MOD:01150 + neddylated lysine + + A protein modification that effectively crosslinks the N6-amino of a peptidyl lysine with the carboxyl-terminal glycine of a nedd8 protein. + + 11125103 + PubMed + + + 12612601 + PubMed + + + 18688235 + PubMed + + + PSI-MOD-slim + + + Origin + K + + + + Source + natural + + + + TermSpec + none + + MOD:00908 + MOD:01875 + + contains + MOD:001340 + + PSI-MOD + + + MOD:01151 + phosphorylated residue with neutral loss of phosphate + + Covalent modification of, or a change resulting in an alteration of the measured molecular mass of, a peptide or protein amino acid phosphorylated residue with a secondary loss of a neutral trihydrogen phosphate molecular fragment. + + 18688235 + PubMed + + + PSI-MOD-slim + + + DiffAvg + -97.99 + + + + DiffFormula + C 0 H -3 N 0 O -4 P -1 + + + + DiffMono + -97.976895 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00432 + PSI-MOD + + + MOD:01152 + carboxylated residue + + A protein modification that effectively replaces a hydrogen atom with a carboxylic acid group. + + 299 + UniMod + + + PSI-MOD-slim + + Carboxy + UniMod-interim + + + Carboxylation + UniMod-description + + + + DiffAvg + 44.01 + + + + DiffFormula + C 1 H 0 N 0 O 2 + + + + DiffMono + 43.989829 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + none + + + + TermSpec + none + + MOD:01156 + PSI-MOD + + + MOD:01153 + methylthiolated residue + + A protein modification that effectively replaces a hydrogen atom with an methylsulfanyl group (thiomethyl group). + + 39 + UniMod + + + PSI-MOD-slim + + Beta-methylthiolation + UniMod-description + + + Methylthio + UniMod-interim + + + + DiffAvg + 46.09 + + + + DiffFormula + C 1 H 2 N 0 O 0 S 1 + + + + DiffMono + 45.987721 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + none + + + + TermSpec + none + + MOD:01886 + PSI-MOD + + + MOD:01154 + pyruvic acid + + A protein modification that effectively converts a source amino acid to pyruvic acid. + + 10085076 + PubMed + + + 3042771 + PubMed + + + 8464063 + PubMed + + + AA0127 + RESID + + + PSI-MOD-slim + + 2-oxopropanoic acid + RESID-systematic + + + MOD_RES Pyruvic acid (Cys) + UniProt-feature + + + MOD_RES Pyruvic acid (Ser) + UniProt-feature + + + pyruvic acid + RESID-name + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + C 3 H 3 O 2 + + + + MassAvg + 71.06 + + + + MassMono + 71.013304 + + + + Origin + X + + + + Source + none + + + + TermSpec + N-term + + MOD:00769 + MOD:00859 + PSI-MOD + + + MOD:01155 + lipoconjugated residue + + A protein modification that effectively results from forming an adduct with a compound containing a lipid-like group either through acylation, alkylation, or amidation. + + 18688235 + PubMed + + + PSI-MOD-slim + MOD:01156 + PSI-MOD + + + MOD:01156 + protein modification categorized by chemical process + + Modified amino acid residue derived from a natural amino acid by a real or hypothetical chemical process. + + 18688235 + PubMed + + + PSI-MOD-slim + MOD:00000 + PSI-MOD + + + MOD:01157 + protein modification categorized by amino acid modified + + A protein modification considered either as modified amino acid residues derived from natural amino acids, as a replacement by another natural amino acid, or as a replacement by an unnatural amino acid. + + 18688235 + PubMed + + + PSI-MOD-slim + MOD:00000 + PSI-MOD + + + MOD:01158 + modified L-selenocysteine residue + + A protein modification that modifies an L-selenocysteine residue. + + 18688235 + PubMed + + + PSI-MOD-slim + + + Origin + U + + MOD:00745 + MOD:01157 + + derives_from + MOD:000310 + + PSI-MOD + + + MOD:01159 + peptidoglycanated residue + + A protein modification that effectively attaches a residue to murein peptidoglycan by either a pentaglycine linker peptide or a peptide-like L-alanyl-D-glutamyl-2,6-diaminopimelic acid linkage. + + 18688235 + PubMed + + + + + Origin + X + + + + Source + natural + + + + TermSpec + none + + MOD:00764 + PSI-MOD + + + MOD:01160 + deaminated residue + + A protein modification that effectively results in the loss of an ammonia, usually by a process of vicinal dehydration, rearrangement, and rehydration with release of ammonia, resulting in a loss of nitrogen with no gain of oxygen. + + 385 + UniMod + + + PSI-MOD-slim + + Ammonia-loss + UniMod-interim + + + Loss of ammonia + UniMod-description + + + + DiffAvg + -17.03 + + + + DiffFormula + C 0 H -3 N -1 O 0 + + + + DiffMono + -17.026549 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + none + + + + TermSpec + none + + MOD:01156 + PSI-MOD + + + MOD:01161 + deoxygenated residue + + A protein modification that effectively removes oxygen atoms from a residue without the removal of hydrogen atoms. + + 14235557 + PubMed + + + 447 + UniMod + + + PSI-MOD-slim + + Deoxy + PSI-MS-label + + + dOxyRes + PSI-MOD-label + + + reduction + UniMod-description + + + + DiffAvg + -16.00 + + + + DiffFormula + C 0 H 0 N 0 O -1 + + + + DiffMono + -15.994915 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + none + + + + TermSpec + none + + MOD:01472 + PSI-MOD + + + MOD:01162 + fucosylated biantennary + + modification from UniMod N-linked glycosylation + + 308 + UniMod + + + + dHex(1)Hex(5)HexNAc(4) + PSI-MS-label + + + Fucosylated biantennary + UniMod-description + + + + DiffAvg + 1769.62 + + + + DiffFormula + C 68 H 112 N 4 O 49 + + + + DiffMono + 1768.639516 + + + + Formula + C 72 H 118 N 6 O 51 + + + + MassAvg + 1883.73 + + + + MassMono + 1882.682443 + + + + Origin + N + + + + Source + natural + + + + TermSpec + none + + MOD:00725 + PSI-MOD + + + MOD:01163 + guanylated residue + + A protein modification that effectively crosslinks an amino acid residue and 5'-phosphoguanosine through either a phosphodiester or a phosphoramide bond. + + 304 + DeltaMass + + + 413 + UniMod + + + From DeltaMass: (formula incorrect, N and O reversed) Average Mass: 345 Formula: C10H12O5N7P1 Monoisotopic Mass Change: 345.047 Average Mass Change: 345.209. + + 5'phos Guanosyl + DeltaMass-label + + + phospho-guanosine + UniMod-description + + + Phosphoguanosine + PSI-MS-label + + + + DiffAvg + 345.21 + + + + DiffFormula + C 10 H 12 N 5 O 7 P 1 + + + + DiffMono + 345.047434 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + none + + + + TermSpec + none + + MOD:00701 + PSI-MOD + + + MOD:01164 + riboflavin-phosphoryl + + A protein modification that effectively results from forming an adduct with a compound containing a riboflavin phosphate (flavin mononucleotide, FMN) group through a phosphodiester bond. + + 442 + UniMod + + + PSI-MOD-slim + + FMN + PSI-MS-label + + + O3-(riboflavin phosphoryl) + UniMod-description + + + + DiffAvg + 438.33 + + + + DiffFormula + C 17 H 19 N 4 O 8 P 1 + + + + DiffMono + 438.094050 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + none + + + + TermSpec + none + + MOD:00896 + PSI-MOD + + + MOD:01165 + adenylated residue + + A protein modification that effectively crosslinks an amino acid residue and 5'-phosphoadenosine through either a phosphodiester or a phosphoramide bond. + + 0 + DeltaMass + + + 405 + UniMod + + + From DeltaMass: (name misspelled "5'phos adenosinyl") Average Mass: 329 + PSI-MOD-slim + + 5'phos Adenosinyl + DeltaMass-label + + + AMP binding site + UniMod-description + + + Phosphoadenosine + PSI-MS-label + + + + DiffAvg + 329.21 + + + + DiffFormula + C 10 H 12 N 5 O 6 P 1 + + + + DiffMono + 329.052520 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + none + + + + TermSpec + none + + MOD:00701 + PSI-MOD + + + MOD:01166 + uridylated residue + + A protein modification that effectively crosslinks an amino acid residue and 5'-phosphouridine through either a phosphodiester or a phosphoramide bond. + + 292 + DeltaMass + + + 417 + UniMod + + + From DeltaMass: (name misspelled "5'phos Uridinyl" and formula incorrect, N and O reversed) Average Mass: 306 Formula: C9H11O2N8P1 Monoisotopic Mass Change: 306.025 Average Mass Change: 306.17 + + 5'phos Uridinyl + DeltaMass-label + + + PhosphoUridine + PSI-MS-label + + + uridine phosphodiester + UniMod-description + + + + DiffAvg + 306.17 + + + + DiffFormula + C 9 H 11 N 2 O 8 P 1 + + + + DiffMono + 306.025302 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + none + + + + TermSpec + none + + MOD:00701 + PSI-MOD + + + MOD:01167 + molybdopterin guanine dinucleotide + + modification from UniMod + + 424 + UniMod + + + + molybdenum bis(molybdopterin guanine dinucleotide) + UniMod-description + + + MolybdopterinGD + PSI-MS-label + + + + DiffAvg + 1572.02 + + + + DiffFormula + C 40 H 47 Mo 1 N 20 O 26 P 4 S 4 + + + + DiffMono + 1572.985775 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + none + + + + TermSpec + none + + MOD:00744 + PSI-MOD + + + MOD:01168 + dehydroalanine + + A protein modification that effectively converts a source amino acid residue to dehydroalanine. + + 10220322 + PubMed + + + 1547888 + PubMed + + + 1815586 + PubMed + + + 2914619 + PubMed + + + 6838602 + PubMed + + + 7947813 + PubMed + + + 8239649 + PubMed + + + AA0181 + RESID + + + PSI-MOD-slim + + 2,3-didehydroalanine + RESID-alternate + + + 2-aminoacrylic acid + RESID-alternate + + + 2-aminopropenoic acid + RESID-systematic + + + 4-methylidene-imidazole-5-one (MIO) active site + RESID-alternate + + + anhydroserine + RESID-alternate + + + dehydroalanine + RESID-name + + + Dha + RESID-alternate + + + dHAla + PSI-MOD-label + + + MOD_RES 2,3-didehydroalanine (Cys) + UniProt-feature + + + MOD_RES 2,3-didehydroalanine (Ser) + UniProt-feature + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + C 3 H 3 N 1 O 1 + + + + MassAvg + 69.06 + + + + MassMono + 69.021464 + + + + Origin + X + + + + Source + natural + + + + TermSpec + none + + MOD:00859 + PSI-MOD + + + MOD:01169 + L-3-oxoalanine + + A protein modification that effectively converts a source amino acid residue to L-oxoalanine. + + 349 + DeltaMass + + + 14563551 + PubMed + + + 7628016 + PubMed + + + 8681943 + PubMed + + + 9478923 + PubMed + + + AA0185 + RESID + + + PSI-MOD-slim + + (S)-2-amino-3-oxopropanoic acid + RESID-systematic + + + 2-amino-3-oxopropionic acid + RESID-alternate + + + C(alpha)-formylglycine + RESID-misnomer + + + L-3-oxoalanine + RESID-name + + + L-amino-malonic acid semialdehyde + RESID-alternate + + + L-aminomalonaldehydic acid + RESID-alternate + + + L-serinesemialdehyde + RESID-misnomer + + + MOD_RES 3-oxoalanine (Cys) + UniProt-feature + + + MOD_RES 3-oxoalanine (Ser) + UniProt-feature + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + C 3 H 3 N 1 O 2 + + + + MassAvg + 85.06 + + + + MassMono + 85.016378 + + + + Origin + X + + + + Source + natural + + + + TermSpec + none + + MOD:00859 + PSI-MOD + + + MOD:01170 + pyruvic acid iminylated residue + + A protein modification that effectively forms a 2-ketoimine of pyruvicacid with a residue amino group. + + 422 + UniMod + + + + N-pyruvic acid 2-iminyl + UniMod-description + + + PyruvicAcidIminyl + PSI-MS-label + + + + DiffAvg + 70.05 + + + + DiffFormula + C 3 H 2 N 0 O 2 + + + + DiffMono + 70.005479 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + none + + + + TermSpec + N-term + + MOD:01156 + PSI-MOD + + + MOD:01171 + O-acetyl-L-threonine + + A protein modification that effectively converts an L-threonine residue to O-acetyl-L-threonine. + + 16728640 + PubMed + + + AA0423 + RESID + + + 1#T + UniMod + + + PSI-MOD-slim + + (2S,3R)-3-(acetyloxy)-2-aminobutanoic acid + RESID-systematic + + + Acetylation + UniMod-description + + + ACT_SITE O-acetylthreonine intermediate + UniProt-feature + + + MOD_RES O-acetylthreonine + UniProt-feature + + + O-acetyl-L-threonine + RESID-name + + + O-acetylthreonine + RESID-alternate + + + OAcThr + PSI-MOD-label + + + threonine acetate ester + RESID-alternate + + + + DiffAvg + 42.04 + + + + DiffFormula + C 2 H 2 N 0 O 1 + + + + DiffMono + 42.010565 + + + + Formula + C 6 H 9 N 1 O 3 + + + + MassAvg + 143.14 + + + + MassMono + 143.058243 + + + + Origin + T + + + + Source + natural + + + + TermSpec + none + + MOD:00644 + MOD:01186 + PSI-MOD + + + MOD:01172 + N-alanyl-glycosylsphingolipidinositolethanolamine + + A protein modification that effectively converts an L-alanine residue to N-alanyl-glycosylsphingolipidinositolethanolamine. + + 12626404 + PubMed + + + AA0424 + RESID + + + + GSIAla + PSI-MOD-label + + + LIPID GPI-like-anchor amidated alanine + UniProt-feature + + + N-alanyl-glycosylsphingolipidinositolethanolamine + RESID-name + + + + DiffAvg + 123.05 + + + + DiffFormula + C 2 H 6 N 1 O 3 P 1 + + + + DiffMono + 123.008530 + + + + Formula + C 5 H 12 N 2 O 5 P 1 + + + + MassAvg + 211.13 + + + + MassMono + 211.048383 + + + + Origin + A + + + + Source + hypothetical + + + + TermSpec + C-term + + MOD:00466 + MOD:00901 + PSI-MOD + + + MOD:01173 + N-asparaginyl-glycosylsphingolipidinositolethanolamine + + A protein modification that effectively converts an L-asparagine residue to N-asparaginyl-glycosylsphingolipidinositolethanolamine. + + 12626404 + PubMed + + + AA0425 + RESID + + + + GSIAsn + PSI-MOD-label + + + LIPID GPI-like-anchor amidated asparagine + UniProt-feature + + + N-asparaginyl-glycosylsphingolipidinositolethanolamine + RESID-name + + + + DiffAvg + 123.05 + + + + DiffFormula + C 2 H 6 N 1 O 3 P 1 + + + + DiffMono + 123.008530 + + + + Formula + C 6 H 13 N 3 O 6 P 1 + + + + MassAvg + 254.16 + + + + MassMono + 254.054197 + + + + Origin + N + + + + Source + hypothetical + + + + TermSpec + C-term + + MOD:00466 + MOD:00903 + PSI-MOD + + + MOD:01174 + S-(15-deoxy-Delta12,14-prostaglandin J2-9-yl)-L-cysteine + + A protein modification that effectively converts an L-cysteine residue to S-(15-deoxy-Delta12,14-prostaglandin J2-9-yl)-L-cysteine. + + 27485 + ChEBI + + + 11466314 + PubMed + + + 12684535 + PubMed + + + AA0426 + RESID + + + + (2R)-2-amino-3-([(5Z,9Xi,12E,14Z)-1-hydroxy-1,11-oxoprosta-5,12,14-trien-9-yl]sulfanyl)propanoic acid + RESID-alternate + + + (5Z,9Xi,12E,14Z)-9-([(2R)-2-amino-3-carboxyethyl]sulfanyl)-11-oxoprosta-5,12,14-trien-1-oic acid + RESID-systematic + + + LIPID S-(15-deoxy-Delta12,14-prostaglandin J2-9-yl)cysteine + UniProt-feature + + + PG-J2Cys + PSI-MOD-label + + + S-(15-deoxy-Delta12,14-prostaglandin J2-9-yl)-L-cysteine + RESID-name + + + + DiffAvg + 316.44 + + + + DiffFormula + C 20 H 28 N 0 O 3 S 0 + + + + DiffMono + 316.203845 + + + + Formula + C 23 H 33 N 1 O 4 S 1 + + + + MassAvg + 419.58 + + + + MassMono + 419.213030 + + + + Origin + C + + + + Source + natural + + + + TermSpec + none + + MOD:00905 + MOD:01155 + PSI-MOD + + + MOD:01175 + S-phycourobilin-L-cysteine + + A protein modification that effectively results from forming an adduct between a cysteine residue and the tetrapyrrole compound phycourobilin. + + 1903388 + PubMed + + + 3208761 + PubMed + + + 3838747 + PubMed + + + AA0427 + RESID + + + + (2S,3R,16R)-18-ethenyl-3-[(1R)-1-([(R)-2-amino-2-carboxyethyl]sulfanyl)ethyl]-8,12-bis(2-carboxyethyl)-2,7,13,17-tetramethyl-4,5,15,16-tetrahydrobiline-1,19(21H,22H,24H)-dione + RESID-systematic + + + 18-ethenyl-3-[1-(2-amino-2-carboxyethylsulfanyl)ethyl]-2,3,15,16-dihydro-2,7,13,17-tetramethyl-1,19-dioxo-(21H,22H,24H)-bilin-8,12-dipropanoic acid + RESID-alternate + + + BINDING Phycourobilin chromophore (covalent; via 1 link) + UniProt-feature + + + phycourobilin cysteine adduct + RESID-alternate + + + PUB + RESID-alternate + + + PUBCys + PSI-MOD-label + + + S-phycourobilin-L-cysteine + RESID-name + + + + DiffAvg + 586.69 + + + + DiffFormula + C 33 H 38 N 4 O 6 S 0 + + + + DiffMono + 586.279135 + + + + Formula + C 36 H 43 N 5 O 7 S 1 + + + + MassAvg + 689.83 + + + + MassMono + 689.288320 + + + + Origin + C + + + + Source + natural + + + + TermSpec + none + + MOD:00700 + MOD:00905 + PSI-MOD + + + MOD:01176 + L-dehydrolysinonorleucine + + A protein modification that effectively cross-links an L-lysine residue and an L-lysine residue converted to allysine with a carbon-nitrogen bond to form L-dehydrolysinonorleucine. + + 16929109 + PubMed + + + AA0430 + RESID + + + Cross-link 2. + + (2S)-2-amino-6-([(5S)-5-amino-5-carboxypentylidene]amino)hexanoic acid + RESID-systematic + + + 6-(N6-L-didehydrolysino)-L-norleucine + RESID-alternate + + + CROSSLNK Dehydrolysinonorleucine (Lys-Lys) + UniProt-feature + + + dehydrolysinorleucine [misspelling] + RESID-alternate + + + dehydrolysylnorleucine + RESID-alternate + + + didehydrolysinonorleucine + RESID-alternate + + + L-dehydrolysinonorleucine + RESID-name + + + N6-[(5S)-5-amino-5-carboxypentylidene]-L-lysine + RESID-alternate + + + XLNK6NleN6Lys + PSI-MOD-label + + + + DiffAvg + -19.05 + + + + DiffFormula + C 0 H -5 N -1 O 0 + + + + DiffMono + -19.042199 + + + + Formula + C 12 H 19 N 3 O 2 + + + + MassAvg + 237.30 + + + + MassMono + 237.147727 + + + + Origin + K, K + + + + Source + natural + + + + TermSpec + none + + MOD:00692 + MOD:00912 + PSI-MOD + + + MOD:01177 + 1'-(1,2,3-trihydroxyprop-2-yl)-L-histidine + + A protein modification that effectively converts an L-histidine residue to 1'-(1,2,3-trihydroxyprop-2-yl)-L-histidine. + + 16760471 + PubMed + + + AA0431 + RESID + + + + (S)-2-amino-3-[1-(1,2,3-trihydroxypropan-2-yl)-1H-imidazol-4-yl]propanoic acid + RESID-systematic + + + 1'-(1,2,3-trihydroxyprop-2-yl)-L-histidine + RESID-name + + + 1-[1,2-dihydroxy-1-(hydroxymethyl)ethyl]-L-histidine + RESID-alternate + + + MOD_RES Tele-(1,2,3-trihydroxypropan-2-yl)histidine + UniProt-feature + + + N(epsilon)-histidine dihydroxyacetone adduct + RESID-alternate + + + N(tau)-(1,2,3-trihydroxypropan-2-yl)histidine + RESID-alternate + + + NtauDHAHis + PSI-MOD-label + + + tele-(1,2,3-trihydroxypropan-2-yl)histidine + RESID-alternate + + + + DiffAvg + 90.08 + + + + DiffFormula + C 3 H 6 N 0 O 3 + + + + DiffMono + 90.031694 + + + + Formula + C 9 H 13 N 3 O 4 + + + + MassAvg + 227.22 + + + + MassMono + 227.090606 + + + + Origin + H + + + + Source + natural + + + + TermSpec + none + + MOD:00909 + PSI-MOD + + + MOD:01178 + S-(aspart-4-yloxy) thiocarbonate + + A protein modification that effectively converts an L-aspartic acid residue to S-(aspart-4-yloxy) thiocarbonate. + + 16627948 + PubMed + + + AA0432 + RESID + + + This modification was originally observed in an Entamoeba histolytica enzyme expressed in Escherichia coli. It was not chemically confirmed or characterized. It did not appear in a later model at higher resolution by the same group. This is a deprecated entry in RESID. It probably does not occur naturally [JSG]. + + (2S)-2-amino-4-(carboxysulfanyl)oxy-4-oxobutanoic acid + RESID-systematic + + + 4-aspartyloxysulfanylcarbonate + RESID-alternate + + + AspOSCO2H + PSI-MOD-label + + + O-carboxysulfanyl-4-oxo-L-homoserine + RESID-alternate + + + S-(aspart-4-yloxy) thiocarbonate + RESID-name + + + + DiffAvg + 76.07 + + + + DiffFormula + C 1 H 0 N 0 O 2 S 1 + + + + DiffMono + 75.961900 + + + + Formula + C 5 H 5 N 1 O 5 S 1 + + + + MassAvg + 191.16 + + + + MassMono + 190.988843 + + + + Origin + D + + + + Source + hypothetical + + + + TermSpec + none + + MOD:00904 + PSI-MOD + + + MOD:01179 + N,N-dimethyl-L-alanine + + A protein modification that effectively converts an L-alanine residue to N,N-dimethyl-L-alanine. + + 17691833 + PubMed + + + 387091 + PubMed + + + AA0433 + RESID + + + + (S)-1-carboxy-N,N-dimethylaminoethane + RESID-alternate + + + (S)-2-(dimethylamino)propanoic acid + RESID-systematic + + + MOD_RES N,N-dimethylalanine + UniProt-feature + + + N,N-dimethyl-L-alanine + RESID-name + + + N,N-dimethylalanine + RESID-alternate + + + NMe2Ala + PSI-MOD-label + + + + DiffAvg + 28.05 + + + + DiffFormula + C 2 H 4 N 0 O 0 + + + + DiffMono + 28.031300 + + + + Formula + C 5 H 10 N 1 O 1 + + + + MassAvg + 100.14 + + + + MassMono + 100.076239 + + + + Origin + A + + + + Source + natural + + + + TermSpec + N-term + + MOD:01461 + MOD:01686 + PSI-MOD + + + MOD:01180 + 2-hydroxyglycine observational artifact + + A protein modification that effectively converts a glycine residue to 2-hydroxyglycine. + + 38048 + ChEBI + + + 16178056 + PubMed + + + 17431180 + PubMed + + + 17823333 + PubMed + + + AA0434 + RESID + + + CAUTION - peptides of 2-hydroxyglycine are known to be unstable, decaying to break the peptide backbone or to form peptidyl amides [see J. Am. Chem. Soc. 111, 1933-1934, 1989, and J. Org. Chem. 57, 3916-3921, 1992]. If computer analysis of tandem mass-spectrometric results predicts this modification, then it is most probable that there are multiple isobaric peptides differing in the location of multiple hydroxylation modifications [JSG]. + + 2-hydroxyglycine + RESID-name + + + 2HyGly + PSI-MOD-label + + + alpha-hydroxyglycine + RESID-alternate + + + amino(hydroxy)acetic acid + RESID-systematic + + + aminohydroxyacetic acid + RESID-alternate + + + + DiffAvg + 16.00 + + + + DiffFormula + C 0 H 0 N 0 O 1 + + + + DiffMono + 15.994915 + + + + Formula + C 2 H 3 N 1 O 2 + + + + MassAvg + 73.05 + + + + MassMono + 73.016378 + + + + Origin + G + + + + Source + artifact + + + + TermSpec + none + + MOD:00425 + MOD:00908 + PSI-MOD + + + MOD:01181 + L-aspartic acid 4-methyl ester + + A protein modification that effectively converts an L-aspartic acid residue to L-aspartate 4-methyl ester. + + 1556110 + PubMed + + + 16888766 + PubMed + + + 9629898 + PubMed + + + AA0435 + RESID + + + 34#D + UniMod + + + CAUTION - observations of this modifation are attributable to artifacts produced in preparation. It is extremely unlikely that eukaryotes produce this modification, because an enzyme acting to form the methyl ester of L-aspartyl peptides would interfere with the D-aspartyl peptide repair mechanism [JSG]. + + (2S)-2-amino-4-methoxy-4-oxobutanoic acid + RESID-systematic + + + 2-aminobutanedioic acid 4-methyl ester + RESID-alternate + + + 4-methyl L-2-aminosuccinic acid + RESID-alternate + + + 4-methyl L-aspartate + RESID-alternate + + + 4-methyl L-hydrogen aspartate + RESID-alternate + + + aspartic acid 4-methyl ester + RESID-alternate + + + aspartic acid beta-methyl ester + RESID-alternate + + + L-aspartic acid 4-methyl ester + RESID-name + + + meesterd + OMSSA-label + + + Methyl + PSI-MS-label + + + O4MeAsp + PSI-MOD-label + + + + DiffAvg + 14.03 + + + + DiffFormula + C 1 H 2 N 0 O 0 + + + + DiffMono + 14.015650 + + + + Formula + C 5 H 7 N 1 O 3 + + + + MassAvg + 129.12 + + + + MassMono + 129.042593 + + + + Origin + D + + + + Source + artifact + + + + TermSpec + none + + MOD:00393 + MOD:01681 + PSI-MOD + + + MOD:01182 + 6-(S-L-cysteinyl)-8alpha-(-3'-L-histidino)-FAD + + A protein modification that crosslinks a cysteine and a histidine residue by forming the adduct 6-(S-L-cysteinyl)-8alpha-(-3'-L-histidino)-FAD. + + + PubMed + + + AA0436 + RESID + + + Cross-link 2. + PSI-MOD-slim + + 6-((R)-2-amino-2-carboxyethyl)sulfanyl-8alpha-[4-((S)-2-amino-2-carboxyethyl)imidazol-3-yl]-riboflavin 5'-(trihydrogen diphosphate) 5'->5'-ester with adenosine + RESID-systematic + + + 6-(S-cysteinyl)-8alpha-(N(delta1)-histidyl)-FAD + RESID-alternate + + + 6-(S-cysteinyl)-8alpha-(N(pi)-histidyl)-FAD + RESID-alternate + + + 6-(S-cysteinyl)-8alpha-(N3'-histidyl)-FAD + RESID-alternate + + + 6-(S-cysteinyl)-8alpha-(pros-histidyl)-FAD + RESID-alternate + + + 6-(S-L-cysteinyl)-8alpha-(N3'-L-histidino)-FAD + RESID-name + + + BINDING FAD (covalent; via 2 links) + UniProt-feature + + + BINDING FAD (covalent; via 2 links, pros nitrogen) + UniProt-feature + + + SCys6-NprosHis8a-FAD + PSI-MOD-label + + + + DiffAvg + 781.52 + + + + DiffFormula + C 27 H 29 N 9 O 15 P 2 S 0 + + + + DiffMono + 781.125835 + + + + Formula + C 36 H 41 N 13 O 17 P 2 S 1 + + + + MassAvg + 1021.81 + + + + MassMono + 1021.193931 + + + + Origin + C, H + + + + Source + natural + + + + TermSpec + none + + MOD:00895 + MOD:00905 + MOD:00909 + MOD:01621 + PSI-MOD + + + MOD:01183 + L-selenocystine (oxidized selenocysteine) (Sec-Sec) + + A protein modification that effectively cross-links two L-selenocysteine residues to form L-selenocystine, + + 28553 + ChEBI + + + 17715293 + PubMed + + + 6076213 + PubMed + + + AA0437 + RESID + + + Cross-link 2; for formation of the same modification by substitution of 2 selenium for 2 sulfur atoms in L-cystine, see MOD:01184. + PSI-MOD-slim + + (R,R)-3,3'-diselane-1,2-diylbis(2-aminopropanoic acid) + RESID-systematic + + + 3,3'-diselenobis(2-aminopropanoic acid) + RESID-alternate + + + 3,3'-diselenobisalanine + RESID-alternate + + + 3,3'-diselenodialanine + RESID-alternate + + + beta,beta'-diamino-beta,beta'-dicarboxydiethyldiselenide + RESID-alternate + + + beta,beta'-diselenodialanine + RESID-alternate + + + bis(alpha-aminopropionic acid)-beta-diselenide + RESID-alternate + + + bis(beta-amino-beta-carboxyethyl)diselenide + RESID-alternate + + + CROSSLNK Selenocystine (Sec-Sec) + UniProt-feature + + + diselenocysteine + RESID-alternate + + + L-selenocystine + RESID-name + + + Sec2 + PSI-MOD-label + + + selenium cystine + RESID-alternate + + + + DiffAvg + -2.02 + + + + DiffFormula + C 0 H -2 N 0 O 0 Se 0 + + + + DiffMono + -2.015650 + + + + Formula + C 6 H 8 N 2 O 2 Se 2 + + + + MassAvg + 298.08 + + + + MassMono + 299.891620 + + + + Origin + U, U + + + + Source + hypothetical + + + + TermSpec + none + + MOD:00692 + MOD:01158 + PSI-MOD + + + MOD:01184 + L-selenocystine (selenium disubstituted L-cystine) + + A protein modification that effectively substitutes two selenium atoms for two sulfur atoms in L-cystine to form L-selenocystine. + + 17715293 + PubMed + + + AA0437#CYS2 + RESID + + + Cross-link 2; for formation of the same modification by oxidation of two L-selenocysteine residues, see MOD:01183. + + (R,R)-3,3'-diselane-1,2-diylbis(2-aminopropanoic acid) + RESID-systematic + + + 3,3'-diselenobis(2-aminopropanoic acid) + RESID-alternate + + + 3,3'-diselenobisalanine + RESID-alternate + + + 3,3'-diselenodialanine + RESID-alternate + + + beta,beta'-diamino-beta,beta'-dicarboxydiethyldiselenide + RESID-alternate + + + beta,beta'-diselenodialanine + RESID-alternate + + + bis(alpha-aminopropionic acid)-beta-diselenide + RESID-alternate + + + bis(beta-amino-beta-carboxyethyl)diselenide + RESID-alternate + + + CROSSLNK Selenocystine (Sec-Sec) + UniProt-feature + + + diselenocysteine + RESID-alternate + + + L-selenocystine + RESID-name + + + Se2(S2)Cys2 + PSI-MOD-label + + + selenium cystine + RESID-alternate + + + + DiffAvg + 91.81 + + + + DiffFormula + C 0 H -2 N 0 O 0 S -2 Se 2 + + + + DiffMono + 93.873250 + + + + Formula + C 6 H 8 N 2 O 2 Se 2 + + + + MassAvg + 298.08 + + + + MassMono + 299.891620 + + + + Origin + C, C + + + + Source + hypothetical + + + + TermSpec + none + + MOD:00007 + MOD:00905 + PSI-MOD + + + MOD:01185 + 4-amidated L-aspartic acid + + A protein modification that effectively converts an L-aspartic acid residue to L-asparagine. + + 17962566 + PubMed + + + AA0003#ASP + RESID + + + + (2S)-2-amino-4-butanediamic acid + RESID-systematic + + + 2,4-bis(azanyl)-4-oxobutanoic acid + RESID-alternate + + + 2,4-diamino-4-oxobutanoic acid + RESID-alternate + + + 2-amino-3-carbamoylpropanoic acid + RESID-alternate + + + 2-amino-4-butanediamic acid + RESID-alternate + + + 2-aminosuccinamic acid + RESID-alternate + + + 2-aminosuccinic acid 4-amide + RESID-alternate + + + 4NAsp + PSI-MOD-label + + + alpha-amino-beta-carbamylpropionic acid + RESID-alternate + + + alpha-aminosuccinamic acid + RESID-alternate + + + aspartic acid 4-amide + RESID-alternate + + + aspartic acid beta-amide + RESID-alternate + + + beta-asparagine + RESID-alternate + + + L-asparagine + RESID-name + + + MOD_RES Amidated aspartic acid + UniProt-feature + + + + DiffAvg + -0.98 + + + + DiffFormula + C 0 H 1 N 1 O -1 + + + + DiffMono + -0.984016 + + + + Formula + C 4 H 6 N 2 O 2 + + + + MassAvg + 114.10 + + + + MassMono + 114.042927 + + + + Origin + D + + + + Source + natural + + + + TermSpec + none + + MOD:00012 + MOD:00674 + MOD:00904 + PSI-MOD + + + MOD:01186 + acetylated L-threonine + + A protein modification that effectively converts an L-threonine residue to either N-acetyl-L-threonne, or O-acetyl-Lthreonine. + + 18688235 + PubMed + + + PSI-MOD-slim + + AcThr + PSI-MOD-label + + + + DiffAvg + 42.04 + + + + DiffFormula + C 2 H 2 N 0 O 1 + + + + DiffMono + 42.010565 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + T + + + + Source + natural + + MOD:00394 + MOD:00917 + PSI-MOD + + + MOD:01187 + L-pyrrolysine residue + + A protein modification that inserts or replaces a residue with an L-pyrrolysine residue, a natural pretranslational modification. + + 21860 + ChEBI + + + 11435424 + PubMed + + + 12029131 + PubMed + + + 12029132 + PubMed + + + 15314242 + PubMed + + + 16096277 + PubMed + + + AA0321 + RESID + + + 435 + UniMod + + + PSI-MOD-slim + + (2S)-2-amino-6-[(2R,3R)-3-methyl-3,4-dihydro-2H-pyrrol-2-ylcarbonyl]aminohexanoic acid + RESID-systematic + + + 2-azanyl-6-[(2R,3R)-3-methyl-3,4-dihydro-2H-pyrrol-2-ylcarbonyl]azanylhexanoic acid + RESID-alternate + + + L-pyrrolysine + RESID-name + + + monomethylamine methyltransferase cofactor lysine adduct + RESID-alternate + + + N6-(4-methyl-1,2-didehydropyrrolidine-5-carboxyl)-L-lysine + RESID-alternate + + + N6-(4-methyl-delta-1-pyrroline-5-carboxyl)-L-lysine + RESID-alternate + + + N6-([(2R,3R)-3-methyl-3,4-dihydro-2H-pyrrol-2-yl]carbonyl)-L-lysine + RESID-alternate + + + NON_STD Pyrrolysine + UniProt-feature + + + Pyl + PSI-MOD-label + + + + DiffAvg + 0.00 + + + + DiffFormula + C 0 H 0 N 0 O 0 + + + + DiffMono + 0.000000 + + + + Formula + C 12 H 19 N 3 O 2 + + + + MassAvg + 237.30 + + + + MassMono + 237.147727 + + + + Origin + O + + + + Source + natural + + + + TermSpec + none + + MOD:00868 + PSI-MOD + + + MOD:01188 + N-ethyl iodoacetamide-d5 - site Y + + modification from UniMod Isotopic label - + + 11710128 + PubMed + + + 12766232 + PubMed + + + 3155470 + PubMed + + + 957432 + PubMed + + + 212#Y + UniMod + + + + N-ethyl iodoacetamide-d5 + UniMod-description + + + NEIAA:2H(5) + PSI-MS-label + + + + DiffAvg + 90.08 + + + + DiffFormula + C 4 (1)H 2 (2)H 5 N 1 O 1 + + + + DiffMono + 90.084148 + + + + Formula + C 13 (1)H 11 (2)H 5 N 2 O 3 + + + + MassAvg + 253.15 + + + + MassMono + 253.147476 + + + + Origin + Y + + + + Source + artifact + + + + TermSpec + none + + MOD:00562 + PSI-MOD + + + MOD:01189 + N-ethyl iodoacetamide-d5 - site C + + modification from UniMod Isotopic label - + + 12766232 + PubMed + + + 212#C + UniMod + + + + N-ethyl iodoacetamide-d5 + UniMod-description + + + NEIAA:2H(5) + PSI-MS-label + + + + DiffAvg + 90.08 + + + + DiffFormula + C 4 (1)H 2 (2)H 5 N 1 O 1 + + + + DiffMono + 90.084148 + + + + Formula + C 7 (1)H 7 (2)H 5 N 2 O 2 S 1 + + + + MassAvg + 193.09 + + + + MassMono + 193.093332 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:00562 + PSI-MOD + + + MOD:01190 + dibromo + + Modification from UniMod Chemical derivative. OBSOLETE because duplicate and redundant with MOD:01006. Remap to MOD:01006. + + 534 + UniMod + + + + Dibromo + PSI-MS-label + + + Dibromo + UniMod-description + + + + DiffAvg + 157.79 + + + + DiffFormula + Br 2 H -2 + + + + DiffMono + 155.821024 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + Y + + + + Source + none + + + + TermSpec + none + + 1 + PSI-MOD + + + MOD:01191 + N-ethyl iodoacetamide-d0 - site C + + modification from UniMod Isotopic label - + + 12766232 + PubMed + + + 211#C + UniMod + + + + N-ethyl iodoacetamide-d0 + UniMod-description + + + NEIAA + PSI-MS-label + + + + DiffAvg + 85.11 + + + + DiffFormula + C 4 H 7 N 1 O 1 + + + + DiffMono + 85.052764 + + + + Formula + C 7 H 12 N 2 O 2 S 1 + + + + MassAvg + 188.25 + + + + MassMono + 188.061949 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:00561 + PSI-MOD + + + MOD:01192 + N-ethyl iodoacetamide-d0 - site Y + + modification from UniMod Isotopic label - + + 11760118 + PubMed + + + 12766232 + PubMed + + + 211#Y + UniMod + + + + N-ethyl iodoacetamide-d0 + UniMod-description + + + NEIAA + PSI-MS-label + + + + DiffAvg + 85.11 + + + + DiffFormula + C 4 H 7 N 1 O 1 + + + + DiffMono + 85.052764 + + + + Formula + C 13 H 16 N 2 O 3 + + + + MassAvg + 248.28 + + + + MassMono + 248.116092 + + + + Origin + Y + + + + Source + artifact + + + + TermSpec + none + + MOD:00561 + PSI-MOD + + + MOD:01193 + phosphorylation to pyridyl thiol - site T + + modification from UniMod Chemical derivative - + + 1093385 + PubMed + + + 264#T + UniMod + + + + PET + PSI-MS-label + + + phosphorylation to pyridyl thiol + UniMod-description + + + + DiffAvg + 121.20 + + + + DiffFormula + C 7 H 7 N 1 O -1 S 1 + + + + DiffMono + 121.035006 + + + + Formula + C 11 H 14 N 2 O 1 S 1 + + + + MassAvg + 222.31 + + + + MassMono + 222.082684 + + + + Origin + T + + + + Source + artifact + + + + TermSpec + none + + MOD:00586 + PSI-MOD + + + MOD:01194 + phosphorylation to pyridyl thiol - site S + + modification from UniMod Chemical derivative - + + 15279557 + PubMed + + + 264#S + UniMod + + + + PET + PSI-MS-label + + + phosphorylation to pyridyl thiol + UniMod-description + + + + DiffAvg + 121.20 + + + + DiffFormula + C 7 H 7 N 1 O -1 S 1 + + + + DiffMono + 121.035006 + + + + Formula + C 10 H 12 N 2 O 1 S 1 + + + + MassAvg + 208.28 + + + + MassMono + 208.067034 + + + + Origin + S + + + + Source + artifact + + + + TermSpec + none + + MOD:00586 + PSI-MOD + + + MOD:01195 + benzoyl labeling reagent light form - site K + + modification from UniMod Isotopic label - + + 11813307 + PubMed + + + 12777388 + PubMed + + + 15456300 + PubMed + + + 136#K + UniMod + + + + Benzoyl + PSI-MS-label + + + labeling reagent light form (N-term & K) + UniMod-description + + + + DiffAvg + 104.11 + + + + DiffFormula + C 7 H 4 O 1 + + + + DiffMono + 104.026215 + + + + Formula + C 13 H 16 N 2 O 2 + + + + MassAvg + 232.28 + + + + MassMono + 232.121178 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00505 + PSI-MOD + + + MOD:01196 + 5-dimethylaminonaphthalene-1-sulfonyl - site K + + OBSOLETE because redundant, replaced with MOD:01654. Remap to MOD:01654. + + 139 + UniMod + + + + 5-dimethylaminonaphthalene-1-sulfonyl + UniMod-description + + + Dansyl + PSI-MS-label + + + + DiffAvg + 233.29 + + + + DiffFormula + C 12 H 11 N 1 O 2 S 1 + + + + DiffMono + 233.051050 + + + + Formula + C 18 H 23 N 3 O 3 S 1 + + + + MassAvg + 361.46 + + + + MassMono + 361.146013 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + 1 + PSI-MOD + + + MOD:01197 + N-heptosyl-L-glutamine + + A protein modification that effectively converts an L-glutamine residue to N-heptosyl-L-glutamine. + + 490#Q + UniMod + + + From UniMod with no citation [JSG]. + + Hep + PSI-MS-label + + + Heptose + UniMod-description + + + + DiffAvg + 192.17 + + + + DiffFormula + C 7 H 12 O 6 + + + + DiffMono + 192.063388 + + + + Formula + C 12 H 20 N 2 O 8 + + + + MassAvg + 320.30 + + + + MassMono + 320.121966 + + + + Origin + Q + + + + Source + artifact + + + + TermSpec + none + + MOD:00925 + PSI-MOD + + + MOD:01198 + O-heptosyl-L-serine + + A protein modification that effectively converts an L-serine residue to O-heptosyl-L-serine. + + 490#S + UniMod + + + From UniMod with no citation [JSG]. + + Hep + PSI-MS-label + + + Heptose + UniMod-description + + + + DiffAvg + 192.17 + + + + DiffFormula + C 7 H 12 O 6 + + + + DiffMono + 192.063388 + + + + Formula + C 10 H 17 N 1 O 8 + + + + MassAvg + 279.25 + + + + MassMono + 279.095417 + + + + Origin + S + + + + Source + artifact + + + + TermSpec + none + + MOD:00925 + PSI-MOD + + + MOD:01199 + N-heptosyl-L-arginine + + A protein modification that effectively converts an L-arginine residue to an N-heptosyl-L-arginine. + + 490#R + UniMod + + + From UniMod with no citation [JSG]. + + Hep + PSI-MS-label + + + Heptose + UniMod-description + + + + DiffAvg + 192.17 + + + + DiffFormula + C 7 H 12 O 6 + + + + DiffMono + 192.063388 + + + + Formula + C 13 H 24 N 4 O 7 + + + + MassAvg + 348.36 + + + + MassMono + 348.164499 + + + + Origin + R + + + + Source + artifact + + + + TermSpec + none + + MOD:00925 + PSI-MOD + + + MOD:01200 + O-heptosyl-L-threonine + + A protein modification that effectively converts an L-threonine residue to O-heptosyl-L-threonine. + + 490#T + UniMod + + + From UniMod with no citation [JSG]. + + Hep + PSI-MS-label + + + Heptose + UniMod-description + + + + DiffAvg + 192.17 + + + + DiffFormula + C 7 H 12 O 6 + + + + DiffMono + 192.063388 + + + + Formula + C 11 H 19 N 1 O 8 + + + + MassAvg + 293.27 + + + + MassMono + 293.111067 + + + + Origin + T + + + + Source + artifact + + + + TermSpec + none + + MOD:00925 + PSI-MOD + + + MOD:01201 + N6-heptosyl-L-lysine + + A protein modification that effectively converts an L-lysine residue to N6-heptosyl-L-lysine. + + 490#K + UniMod + + + From UniMod with no citation [JSG]. + + Hep + PSI-MS-label + + + Heptose + UniMod-description + + + + DiffAvg + 192.17 + + + + DiffFormula + C 7 H 12 O 6 + + + + DiffMono + 192.063388 + + + + Formula + C 13 H 24 N 2 O 7 + + + + MassAvg + 320.34 + + + + MassMono + 320.158351 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00925 + PSI-MOD + + + MOD:01202 + N-heptosyl-L-asparagine + + A protein modification that effectively converts an L-asparagine residue to N-heptosyl-L-asparagine. + + 490#N + UniMod + + + From UniMod with no citation [JSG]. + + Hep + PSI-MS-label + + + Heptose + UniMod-description + + + + DiffAvg + 192.17 + + + + DiffFormula + C 7 H 12 O 6 + + + + DiffMono + 192.063388 + + + + Formula + C 11 H 18 N 2 O 8 + + + + MassAvg + 306.27 + + + + MassMono + 306.106316 + + + + Origin + N + + + + Source + artifact + + + + TermSpec + none + + MOD:00925 + PSI-MOD + + + MOD:01203 + N6-(pyridylacetyl)lysine + + A protein modification that effectively converts an L-lysine residue to N6-[(pyrid-3-yl)acetyl]lysine. + + 9276974 + PubMed + + + 25#K + UniMod + + + Produced by reaction with N-[(pyrid-3-yl)acetyl]oxy-succinimide [JSG]. + + Pyridylacetyl + PSI-MS-label + + + pyridylacetyl + UniMod-description + + + + DiffAvg + 119.12 + + + + DiffFormula + C 7 H 5 N 1 O 1 + + + + DiffMono + 119.037114 + + + + Formula + C 13 H 17 N 3 O 2 + + + + MassAvg + 247.30 + + + + MassMono + 247.132077 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00418 + MOD:01875 + PSI-MOD + + + MOD:01204 + prompt loss of methanethiol from oxidixed methionine + + modification from UniMod Artifact - + + 9004526 + PubMed + + + 526 + UniMod + + + + Dethiomethyl + PSI-MS-label + + + Prompt loss of side chain from oxidised Met + UniMod-description + + + + DiffAvg + -48.10 + + + + DiffFormula + C -1 H -4 S -1 + + + + DiffMono + -48.003371 + + + + Formula + C 4 H 5 N 1 O 1 S 0 + + + + MassAvg + 83.09 + + + + MassMono + 83.037114 + + + + Origin + M + + + + Source + artifact + + + + TermSpec + none + + MOD:00913 + PSI-MOD + + + MOD:01205 + Hex1HexNAc1NeuAc2 O-glycosylated serine + + A protein modification that effectively replaces an O3 hydrogen atom of a serine residue with a carbohydrate-like group composed of Hex1HexNAc1NeuAc2 linked through a glycosidic bond. + + 7949339 + PubMed + + + 160#S + UniMod + + + + Hex(1)HexNAc(1)NeuAc(2) + PSI-MS-label + + + Hex1HexNAc1NeuAc2 + UniMod-description + + + + DiffAvg + 947.85 + + + + DiffFormula + C 36 H 57 N 3 O 26 + + + + DiffMono + 947.323029 + + + + Formula + C 39 H 62 N 4 O 28 + + + + MassAvg + 1034.93 + + + + MassMono + 1034.355057 + + + + Origin + S + + + + Source + natural + + + + TermSpec + none + + MOD:00528 + MOD:00916 + PSI-MOD + + + MOD:01206 + Hex1HexNAc1NeuAc2 O-glycosylated threonine + + A protein modification that effectively replaces an O3 hydrogen atom of a threonine residue with a carbohydrate-like group composed of Hex1HexNAc1NeuAc2 linked through a glycosidic bond. + + 160#T + UniMod + + + + Hex(1)HexNAc(1)NeuAc(2) + PSI-MS-label + + + Hex1HexNAc1NeuAc2 + UniMod-description + + + + DiffAvg + 947.85 + + + + DiffFormula + C 36 H 57 N 3 O 26 + + + + DiffMono + 947.323029 + + + + Formula + C 40 H 64 N 4 O 28 + + + + MassAvg + 1048.95 + + + + MassMono + 1048.370707 + + + + Origin + T + + + + Source + natural + + + + TermSpec + none + + MOD:00528 + MOD:00917 + PSI-MOD + + + MOD:01207 + Hex1HexNAc1NeuAc2 N4-glycosylated asparagine + + A protein modification that effectively replaces an N4 hydrogen atom of an asparagine residue with a carbohydrate-like group composed of Hex1HexNAc1NeuAc2 linked through a glycosidic bond. + + 160#N + UniMod + + + + Hex(1)HexNAc(1)NeuAc(2) + PSI-MS-label + + + Hex1HexNAc1NeuAc2 + UniMod-description + + + + DiffAvg + 947.85 + + + + DiffFormula + C 36 H 57 N 3 O 26 + + + + DiffMono + 947.323029 + + + + Formula + C 40 H 63 N 5 O 28 + + + + MassAvg + 1061.95 + + + + MassMono + 1061.365956 + + + + Origin + N + + + + Source + natural + + + + TermSpec + none + + MOD:00528 + MOD:00903 + PSI-MOD + + + MOD:01208 + copper(1+) carboxylate C-terminal residue + + A protein modification that effectively converts a C-terminal residue to the copper(1+) carboxylate salt. + + 531#C-term + UniMod + + + + Cation:Cu[I] + PSI-MS-label + + + cuprous salt + PSI-MOD-alternate + + + Replacement of proton by copper + UniMod-description + + + + DiffAvg + 62.54 + + + + DiffFormula + Cu 1 H -1 + + + + DiffMono + 61.921772 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + none + + + + TermSpec + C-term + + MOD:00742 + PSI-MOD + + + MOD:01209 + copper(1+) L-aspartate + + A protein modification that effectively converts an L-aspartic acid residue to the copper(1+) aspartate salt. + + 531#D + UniMod + + + + Cation:Cu[I] + PSI-MS-label + + + cuprous salt + PSI-MOD-alternate + + + Replacement of proton by copper + UniMod-description + + + + DiffAvg + 62.54 + + + + DiffFormula + Cu 1 H -1 + + + + DiffMono + 61.921772 + + + + Formula + C 4 Cu 1 H 4 N 1 O 3 + + + + MassAvg + 177.63 + + + + MassMono + 176.948715 + + + + Origin + D + + + + Source + none + + + + TermSpec + none + + MOD:00742 + MOD:00904 + PSI-MOD + + + MOD:01210 + copper(1+) L-glutamate + + A protein modification that effectively converts an L-glutamic acid residue to the copper(1+) glutamate salt. + + 531#E + UniMod + + + + Cation:Cu[I] + PSI-MS-label + + + cuprous salt + PSI-MOD-alternate + + + Replacement of proton by copper + UniMod-description + + + + DiffAvg + 62.54 + + + + DiffFormula + Cu 1 H -1 + + + + DiffMono + 61.921772 + + + + Formula + C 5 Cu 1 H 6 N 1 O 3 + + + + MassAvg + 191.65 + + + + MassMono + 190.964366 + + + + Origin + E + + + + Source + none + + + + TermSpec + none + + MOD:00742 + MOD:00906 + PSI-MOD + + + MOD:01211 + N6-(morpholine-2-acetyl)-lysine + + A protein modification that effectively converts an L-lysine residue to N6-(morpholine-2-acetyl)-lysine. + + 10446193 + PubMed + + + 29#K + UniMod + + + The UniMod name "N-Succinimidyl-3-morpholine acetate" appears to have been a typographical error [JSG]. + + N-Succinimidyl-2-morpholine acetate + UniMod-description + + + N-succinimidylmorpholine-2-acetate N6-derivatized lysine + PSI-MOD-alternate + + + SMA + PSI-MS-label + + + + DiffAvg + 127.14 + + + + DiffFormula + C 6 H 9 N 1 O 2 + + + + DiffMono + 127.063329 + + + + Formula + C 12 H 21 N 3 O 3 + + + + MassAvg + 255.32 + + + + MassMono + 255.158292 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:01813 + MOD:01875 + PSI-MOD + + + MOD:01212 + iodoacetamide N6-derivatized lysine + + A protein modification that effectively converts an L-lysine residue to N6-(carboxamidomethyl)lysine. + + 11510821 + PubMed + + + 12422359 + PubMed + + + 12686488 + PubMed + + + 4#K + UniMod + + + PSI-MOD-slim + + Carbamidomethyl + PSI-MS-label + + + carbamidomethylk + OMSSA-label + + + Iodoacetamide derivative + UniMod-description + + + N6-(2-amino-2-oxoethyl)lysine + PSI-MOD-alternate + + + N6-(carbamoylmethyl)lysine + PSI-MOD-alternate + + + + DiffAvg + 57.05 + + + + DiffFormula + C 2 H 3 N 1 O 1 + + + + DiffMono + 57.021464 + + + + Formula + C 8 H 15 N 3 O 2 + + + + MassAvg + 185.23 + + + + MassMono + 185.116427 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00397 + MOD:00912 + PSI-MOD + + + MOD:01213 + iodoacetamide derivatized histidine + + A protein modification that effectively converts an L-histidine residue to an iodoacetamide derivatized histidine, either 1'- or 3'-(carboxamidolmethyl)histidine. + + 11510821 + PubMed + + + 12422359 + PubMed + + + 15627961 + PubMed + + + 2026710 + PubMed + + + 4#H + UniMod + + + PSI-MOD-slim + + Carbamidomethyl + PSI-MS-label + + + carbamidometylh + OMSSA-label + + + Iodoacetamide derivative + UniMod-description + + + + DiffAvg + 57.05 + + + + DiffFormula + C 2 H 3 N 1 O 1 + + + + DiffMono + 57.021464 + + + + Formula + C 8 H 10 N 4 O 2 + + + + MassAvg + 194.19 + + + + MassMono + 194.080376 + + + + Origin + H + + + + Source + artifact + + + + TermSpec + none + + MOD:00397 + MOD:00909 + PSI-MOD + + + MOD:01214 + iodoacetamide - site C + + modification from UniMod Chemical derivative - OBSOLETE because redundant, the difference component of MOD:01060. Remap to MOD:01060. + + 10504701 + PubMed + + + 11510821 + PubMed + + + 12422359 + PubMed + + + 4#C + UniMod + + + + Carbamidomethyl + PSI-MS-label + + + Iodoacetamide derivative + UniMod-description + + + + DiffAvg + 57.05 + + + + DiffFormula + C 2 H 3 N 1 O 1 + + + + DiffMono + 57.021464 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + 1 + PSI-MOD + + + MOD:01215 + iodoacetamide derivatized aspartic acid + + A protein modification that effectively converts an L-aspartic acid residue to O4-(carboxamidomethyl)aspartate. + + 11510821 + PubMed + + + 12422359 + PubMed + + + 16526082 + PubMed + + + 4#D + UniMod + + + PSI-MOD-slim + + Carbamidomethyl + PSI-MS-label + + + carbamidomethyld + OMSSA-label + + + Iodoacetamide derivative + UniMod-description + + + + DiffAvg + 57.05 + + + + DiffFormula + C 2 H 3 N 1 O 1 + + + + DiffMono + 57.021464 + + + + Formula + C 6 H 8 N 2 O 4 + + + + MassAvg + 172.14 + + + + MassMono + 172.048407 + + + + Origin + D + + + + Source + artifact + + + + TermSpec + none + + MOD:00397 + MOD:00904 + PSI-MOD + + + MOD:01216 + iodoacetamide derivatized glutamic acid + + A protein modification that effectively converts an L-glutamic acid residue to O5-(carboxamidomethyl)glutamate. + + 11510821 + PubMed + + + 12422359 + PubMed + + + 4#E + UniMod + + + PSI-MOD-slim + + Carbamidomethyl + PSI-MS-label + + + carbamidomethyle + OMSSA-label + + + Iodoacetamide derivative + UniMod-description + + + + DiffAvg + 57.05 + + + + DiffFormula + C 2 H 3 N 1 O 1 + + + + DiffMono + 57.021464 + + + + Formula + C 7 H 10 N 2 O 4 + + + + MassAvg + 186.17 + + + + MassMono + 186.064057 + + + + Origin + E + + + + Source + artifact + + + + TermSpec + none + + MOD:00397 + MOD:00906 + PSI-MOD + + + MOD:01217 + Sulfanilic Acid (SA), light C12 - site D + + modification from UniMod Isotopic label - + + 12872131 + PubMed + + + 285#D + UniMod + + + + Light Sulfanilic Acid (SA) C12 + UniMod-description + + + SulfanilicAcid + PSI-MS-label + + + + DiffAvg + 155.00 + + + + DiffFormula + (12)C 6 H 5 N 1 O 2 S 1 + + + + DiffMono + 155.004099 + + + + Formula + (12)C 10 H 10 N 2 O 5 S 1 + + + + MassAvg + 270.03 + + + + MassMono + 270.031042 + + + + Origin + D + + + + Source + artifact + + + + TermSpec + none + + MOD:00605 + PSI-MOD + + + MOD:01218 + Sulfanilic Acid (SA), light C12 - site E + + modification from UniMod Isotopic label - + + 15283597 + PubMed + + + 285#E + UniMod + + + + Light Sulfanilic Acid (SA) C12 + UniMod-description + + + SulfanilicAcid + PSI-MS-label + + + + DiffAvg + 155.00 + + + + DiffFormula + (12)C 6 H 5 N 1 O 2 S 1 + + + + DiffMono + 155.004099 + + + + Formula + (12)C 11 H 12 N 2 O 5 S 1 + + + + MassAvg + 284.05 + + + + MassMono + 284.046692 + + + + Origin + E + + + + Source + artifact + + + + TermSpec + none + + MOD:00605 + PSI-MOD + + + MOD:01219 + Sulfanilic Acid (SA), heavy C13 - site D + + modification from UniMod Chemical derivative - + + 9254591 + PubMed + + + 9750125 + PubMed + + + 286#D + UniMod + + + + Heavy Sulfanilic Acid (SA) C13 + UniMod-description + + + SulfanilicAcid:13C(6) + PSI-MS-label + + + + DiffAvg + 161.02 + + + + DiffFormula + (13)C 6 H 5 N 1 O 2 S 1 + + + + DiffMono + 161.024228 + + + + Formula + (12)C 4 (13)C 6 H 10 N 2 O 5 S 1 + + + + MassAvg + 276.05 + + + + MassMono + 276.051171 + + + + Origin + D + + + + Source + artifact + + + + TermSpec + none + + MOD:00606 + PSI-MOD + + + MOD:01220 + Sulfanilic Acid (SA), heavy C13 - site E + + modification from UniMod Chemical derivative - + + 15121203 + PubMed + + + 9254591 + PubMed + + + 286#E + UniMod + + + + Heavy Sulfanilic Acid (SA) C13 + UniMod-description + + + SulfanilicAcid:13C(6) + PSI-MS-label + + + + DiffAvg + 161.02 + + + + DiffFormula + (13)C 6 H 5 N 1 O 2 S 1 + + + + DiffMono + 161.024228 + + + + Formula + (12)C 5 (13)C 6 H 12 N 2 O 5 S 1 + + + + MassAvg + 290.07 + + + + MassMono + 290.066822 + + + + Origin + E + + + + Source + artifact + + + + TermSpec + none + + MOD:00606 + PSI-MOD + + + MOD:01221 + O-formyl-L-threonine + + A protein modification that effectively converts an L-threonine residue to O-formyl-L-threonine. + + 11861642 + PubMed + + + 15799070 + PubMed + + + 122#T + UniMod + + + From UniMod: Can occur under CNBr cleavage conditions (70% HCOOH). + + Formyl + PSI-MS-label + + + Formylation + UniMod-description + + + + DiffAvg + 28.01 + + + + DiffFormula + C 1 O 1 + + + + DiffMono + 27.994915 + + + + Formula + C 5 H 7 N 1 O 3 + + + + MassAvg + 129.12 + + + + MassMono + 129.042593 + + + + Origin + T + + + + Source + artifact + + + + TermSpec + none + + MOD:00917 + MOD:01483 + PSI-MOD + + + MOD:01222 + O-formyl-L-serine + + A protein modification that effectively converts an L-serine residue to O-formyl-L-serine. + + 15627961 + PubMed + + + 15799070 + PubMed + + + 122#S + UniMod + + + From UniMod: Can occur under CNBr cleavage conditions (70% HCOOH). + + Formyl + PSI-MS-label + + + Formylation + UniMod-description + + + + DiffAvg + 28.01 + + + + DiffFormula + C 1 O 1 + + + + DiffMono + 27.994915 + + + + Formula + C 4 H 5 N 1 O 3 + + + + MassAvg + 115.09 + + + + MassMono + 115.026943 + + + + Origin + S + + + + Source + artifact + + + + TermSpec + none + + MOD:00916 + MOD:01483 + PSI-MOD + + + MOD:01223 + thioacylation of primary amines - site N-term + + modification from UniMod Other - + + 11710128 + PubMed + + + 3155470 + PubMed + + + 957432 + PubMed + + + 126#N-term + UniMod + + + This UniMod entry is misdescribed as "thioacylation" [JSG]. + + 3,3-Dithio-bis-(sulfosuccinimidyl)propionate + UniMod-alternate + + + ntermpeptioacetyl + OMSSA-label + + + Thioacyl + PSI-MS-label + + + thioacylation of primary amines (N-term and Lys) + UniMod-description + + + + DiffAvg + 88.12 + + + + DiffFormula + C 3 H 4 O 1 S 1 + + + + DiffMono + 87.998286 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + N-term + + MOD:00497 + PSI-MOD + + + MOD:01224 + thioacylation of primary amines - site K + + modification from UniMod Other - + + 11710128 + PubMed + + + 3155470 + PubMed + + + 957432 + PubMed + + + 126#K + UniMod + + + This UniMod entry is misdescribed as "thioacylation" [JSG]. + + 3,3-Dithio-bis-(sulfosuccinimidyl)propionate + UniMod-alternate + + + thioacetylk + OMSSA-label + + + Thioacyl + PSI-MS-label + + + thioacylation of primary amines (N-term and Lys) + UniMod-description + + + + DiffAvg + 88.12 + + + + DiffFormula + C 3 H 4 O 1 S 1 + + + + DiffMono + 87.998286 + + + + Formula + C 9 H 16 N 2 O 2 S 1 + + + + MassAvg + 216.30 + + + + MassMono + 216.093249 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00497 + PSI-MOD + + + MOD:01225 + monofluorinated L-tyrosine + + A protein modification that effectively converts an L-tyrosine residue into an L-fluorotyrosine. + + 8069568 + PubMed + + + 127#Y + UniMod + + + From UniMod: the citation appears to be correct, but the PMID is not and has been corrected [JSG]. + + Fluoro + PSI-MS-label + + + fluorophenylalanine replacement of phenylalanine + UniMod-description + + + phef + OMSSA-label + + + + DiffAvg + 17.99 + + + + DiffFormula + F 1 H -1 + + + + DiffMono + 17.990578 + + + + Formula + C 9 F 1 H 8 N 1 O 2 + + + + MassAvg + 181.17 + + + + MassMono + 181.053907 + + + + Origin + Y + + + + Source + artifact + + + + TermSpec + none + + MOD:00498 + MOD:00985 + PSI-MOD + + + MOD:01226 + monofluorinated L-tryptophan + + A protein modification that effectively converts an L-tryptophan residue to an L-fluorotryptophan. + + 8069568 + PubMed + + + 127#W + UniMod + + + From UniMod: the citation appears to be correct, but the PMID is not and has been corrected [JSG]. + + Fluoro + PSI-MS-label + + + fluorophenylalanine replacement of phenylalanine + UniMod-description + + + + DiffAvg + 17.99 + + + + DiffFormula + F 1 H -1 + + + + DiffMono + 17.990578 + + + + Formula + C 11 F 1 H 9 N 2 O 1 + + + + MassAvg + 204.20 + + + + MassMono + 204.069891 + + + + Origin + W + + + + Source + artifact + + + + TermSpec + none + + MOD:00498 + MOD:01068 + PSI-MOD + + + MOD:01227 + monofluorinated L-phenylalanine + + A protein modification that effectively converts an L-phenylalanine residue to an L-fluorophenylalanine. + + 181 + DeltaMass + + + 8069568 + PubMed + + + 127#F + UniMod + + + From UniMod: the citation appears to be correct, but the PMID is not and has been corrected. From DeltaMass: (element abbreviation in formula incorrect, mass incorrect, and aggregate not delta) Average Mass: 149 Formula: C9H8O1N1Fl1 Average Mass Change: 149 References:PE Sciex with no citation [JSG]. + + Fluoro + PSI-MS-label + + + fluorophenylalanine replacement of phenylalanine + UniMod-description + + + phef + OMSSA-label + + + + DiffAvg + 17.99 + + + + DiffFormula + C 0 F 1 H -1 N 0 O 0 + + + + DiffMono + 17.990578 + + + + Formula + C 9 F 1 H 8 N 1 O 1 + + + + MassAvg + 165.17 + + + + MassMono + 165.058992 + + + + Origin + F + + + + Source + artifact + + + + TermSpec + none + + MOD:00498 + MOD:01066 + PSI-MOD + + + MOD:01228 + monoiodinated tyrosine + + A protein modification that effectively substitutes one hydrogen atom of an L-tyrosine residue with one iodine atom. + + 0 + DeltaMass + + + 1326520 + PubMed + + + 15627961 + PubMed + + + 2026710 + PubMed + + + 129#Y + UniMod + + + From DeltaMass: Average Mass: 289 [name misspelled "monoiodated" - JSG]. + PSI-MOD-slim + + I1Tyr + PSI-MOD-label + + + Iodination + UniMod-description + + + iodinationy + OMSSA-label + + + Iodo + PSI-MS-label + + + + DiffAvg + 125.90 + + + + DiffFormula + H -1 I 1 + + + + DiffMono + 125.896648 + + + + Formula + C 9 H 8 I 1 N 1 O 2 + + + + MassAvg + 289.07 + + + + MassMono + 288.959976 + + + + Origin + Y + + + + Source + artifact + + + + TermSpec + none + + MOD:00500 + MOD:00998 + PSI-MOD + + + MOD:01229 + L-iodohistidine + + A protein modification that effectively converts an L-histidine residue to an L-iodohistidine. + + 15627961 + PubMed + + + 2026710 + PubMed + + + 129#H + UniMod + + + + I1His + PSI-MOD-label + + + Iodination + UniMod-description + + + Iodo + PSI-MS-label + + + + DiffAvg + 125.90 + + + + DiffFormula + C 0 H -1 I 1 N 0 O 0 + + + + DiffMono + 125.896648 + + + + Formula + C 6 H 6 I 1 N 3 O 1 + + + + MassAvg + 263.04 + + + + MassMono + 262.955560 + + + + Origin + H + + + + Source + artifact + + + + TermSpec + none + + MOD:00500 + MOD:01049 + PSI-MOD + + + MOD:01230 + Bruker Daltonics SERVA-ICPL(TM) quantification chemistry, light form - site K + + modification from UniMod Isotopic label - + + 15602776 + PubMed + + + 365#K + UniMod + + + + Bruker Daltonics SERVA-ICPL(TM) quantification chemistry, light form + UniMod-description + + + ICPL + PSI-MS-label + + + + DiffAvg + 105.02 + + + + DiffFormula + (12)C 6 H 3 N 1 O 1 + + + + DiffMono + 105.021464 + + + + Formula + (12)C 12 H 15 N 3 O 2 + + + + MassAvg + 233.12 + + + + MassMono + 233.116427 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00790 + PSI-MOD + + + MOD:01231 + 3x(13)C labeled N6-propanoyl-L-lysine + + A protein modification that effectively converts an L-lysine residue to 3x(13)C labeled N6-propanoyl-L-lysine. + + 11857757 + PubMed + + + 11999733 + PubMed + + + 12175151 + PubMed + + + 12442261 + PubMed + + + 59#K + UniMod + + + PSI-MOD-slim + + Propionate labeling reagent heavy form (+3amu), N-term & K + UniMod-description + + + Propionyl:13C(3) + PSI-MS-label + + + + DiffAvg + 59.04 + + + + DiffFormula + (13)C 3 H 4 O 1 + + + + DiffMono + 59.036279 + + + + Formula + (12)C 6 (13)C 3 H 16 N 2 O 2 + + + + MassAvg + 187.13 + + + + MassMono + 187.131242 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:01398 + PSI-MOD + + + MOD:01232 + 3x(12)C labeled N6-propanoyl-L-lysine + + A protein modification that effectively converts an L-lysine residue to 3x(12)C labeled N6-propanoyl-L-lysine. + + 11857757 + PubMed + + + 11999733 + PubMed + + + 12175151 + PubMed + + + 58#K + UniMod + + + PSI-MOD-slim + + Propionate labeling reagent light form (N-term & K) + UniMod-description + + + Propionyl + PSI-MS-label + + + + DiffAvg + 56.03 + + + + DiffFormula + (12)C 3 H 4 O 1 + + + + DiffMono + 56.026215 + + + + Formula + (12)C 9 H 16 N 2 O 2 + + + + MassAvg + 184.12 + + + + MassMono + 184.121178 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:01398 + PSI-MOD + + + MOD:01233 + 3x(2)H labeled N6-acetyl-L-lysine + + A protein modification that effectively converts an L-lysine residue to 3x(2)H labeled N6-acetyl-L-lysine. + + 11857757 + PubMed + + + 11999733 + PubMed + + + 12175151 + PubMed + + + 56#K + UniMod + + + PSI-MOD-slim + + Acetate labeling reagent (N-term & K) (heavy form, +3amu) + UniMod-description + + + Acetyl:2H(3) + PSI-MS-label + + + + DiffAvg + 45.03 + + + + DiffFormula + C 2 (1)H -1 (2)H 3 O 1 + + + + DiffMono + 45.029395 + + + + Formula + C 8 (1)H 11 (2)H 3 N 2 O 2 + + + + MassAvg + 173.12 + + + + MassMono + 173.124358 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00064 + MOD:00449 + PSI-MOD + + + MOD:01234 + (18)O monosubstituted L-serine + + modification from UniMod Isotopic label - alkaline phosphatase to dephosphorylate + + 11467524 + PubMed + + + 258#S + UniMod + + + PSI-MOD-slim + + Label:18O(1) + PSI-MS-label + + + O18 Labeling + UniMod-description + + + + DiffAvg + 2.00 + + + + DiffFormula + (16)O -1 (18)O 1 + + + + DiffMono + 2.004246 + + + + Formula + C 3 H 5 N 1 (16)O 1 (18)O 1 + + + + MassAvg + 89.04 + + + + MassMono + 89.036275 + + + + Origin + S + + + + Source + artifact + + + + TermSpec + none + + MOD:00581 + MOD:00916 + PSI-MOD + + + MOD:01235 + (18)O monosubstituted L-threonine + + modification from UniMod Isotopic label - alkaline phosphatase to dephosphorylate + + 11467524 + PubMed + + + 15549660 + PubMed + + + 258#T + UniMod + + + PSI-MOD-slim + + Label:18O(1) + PSI-MS-label + + + O18 Labeling + UniMod-description + + + + DiffAvg + 2.00 + + + + DiffFormula + (16)O -1 (18)O 1 + + + + DiffMono + 2.004246 + + + + Formula + C 4 H 7 N 1 (16)O 1 (18)O 1 + + + + MassAvg + 103.05 + + + + MassMono + 103.051925 + + + + Origin + T + + + + Source + artifact + + + + TermSpec + none + + MOD:00581 + MOD:00917 + PSI-MOD + + + MOD:01236 + (18)O monosubstituted L-tyrosine + + modification from UniMod Isotopic label - alkaline phosphatase to dephosphorylate + + 11467524 + PubMed + + + 15549660 + PubMed + + + 258#Y + UniMod + + + PSI-MOD-slim + + Label:18O(1) + PSI-MS-label + + + O18 Labeling + UniMod-description + + + + DiffAvg + 2.00 + + + + DiffFormula + (16)O -1 (18)O 1 + + + + DiffMono + 2.004246 + + + + Formula + C 9 H 9 N 1 (16)O 1 (18)O 1 + + + + MassAvg + 165.07 + + + + MassMono + 165.067575 + + + + Origin + Y + + + + Source + artifact + + + + TermSpec + none + + MOD:00581 + MOD:00919 + PSI-MOD + + + MOD:01237 + cysteine 4-hydroxynonenal adduct + + A protein modification produced by formation of an adduct of an L-cysteine residue with 4-hydroxynonenal. + + 11327326 + PubMed + + + 15133838 + PubMed + + + 9629898 + PubMed + + + 53#C + UniMod + + + 4-hydroxynonenal, a toxic lipid aldehyde, is a product of the hydroperoxide beta-cleavage degradation of omega-6 polyunsaturated fatty acids, such as arachidonic and linoleic acids [JSG]. + + 4-hydroxynonenal (HNE) + UniMod-description + + + HNE + PSI-MS-label + + + + DiffAvg + 156.22 + + + + DiffFormula + C 9 H 16 O 2 + + + + DiffMono + 156.115030 + + + + Formula + C 12 H 21 N 1 O 3 S 1 + + + + MassAvg + 259.36 + + + + MassMono + 259.124215 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:00446 + PSI-MOD + + + MOD:01238 + lysine 4-hydroxynonenal adduct + + A protein modification produced by formation of an adduct of an L-lysine residue with 4-hydroxynonenal. + + 11327326 + PubMed + + + 15133838 + PubMed + + + 9629898 + PubMed + + + 53#K + UniMod + + + 4-hydroxynonenal, a toxic lipid aldehyde, is a product of the hydroperoxide beta-cleavage degradation of omega-6 polyunsaturated fatty acids, such as arachidonic and linoleic acids [JSG]. + + 4-hydroxynonenal (HNE) + UniMod-description + + + HNE + PSI-MS-label + + + + DiffAvg + 156.22 + + + + DiffFormula + C 9 H 16 O 2 + + + + DiffMono + 156.115030 + + + + Formula + C 15 H 28 N 2 O 3 + + + + MassAvg + 284.40 + + + + MassMono + 284.209993 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00446 + PSI-MOD + + + MOD:01239 + histidine 4-hydroxynonenal adduct + + A protein modification produced by formation of an adduct of an L-histidine residue with 4-hydroxynonenal. + + 10717661 + PubMed + + + 11327326 + PubMed + + + 15133838 + PubMed + + + 53#H + UniMod + + + 4-hydroxynonenal, a toxic lipid aldehyde, is a product of the hydroperoxide beta-cleavage degradation of omega-6 polyunsaturated fatty acids, such as arachidonic and linoleic acids [JSG]. + + 4-hydroxynonenal (HNE) + UniMod-description + + + HNE + PSI-MS-label + + + + DiffAvg + 156.22 + + + + DiffFormula + C 9 H 16 O 2 + + + + DiffMono + 156.115030 + + + + Formula + C 15 H 23 N 3 O 3 + + + + MassAvg + 293.37 + + + + MassMono + 293.173942 + + + + Origin + H + + + + Source + artifact + + + + TermSpec + none + + MOD:00446 + PSI-MOD + + + MOD:01240 + ubiquitination signature tetrapeptidyl lysine + + A protein modification that crosslinks the N6-amino of a peptidyl lysine with the carboxyl of leucyl-arginyl-glycyl-glycine, the C-terminal tetrapeptide of ubiquitin. + + 10504701 + PubMed + + + 535 + UniMod + + + + LeuArgGlyGly + PSI-MS-label + + + Ubiquitination + UniMod-description + + + + DiffAvg + 383.45 + + + + DiffFormula + C 16 H 29 N 7 O 4 + + + + DiffMono + 383.228102 + + + + Formula + C 22 H 41 N 9 O 5 + + + + MassAvg + 511.63 + + + + MassMono + 511.323065 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00908 + MOD:01875 + + derives_from + MOD:011480 + + PSI-MOD + + + MOD:01241 + 3x(2)H labeled L-aspartic acid 4-methyl ester + + A protein modification that effectively converts an L-lysine residue to 3x(2)H labeled L-aspartic acid 4-methyl ester. + + 12185208 + PubMed + + + 298#D + UniMod + + + + deuterated methyl ester + UniMod-description + + + Methyl:2H(3) + PSI-MS-label + + + trideuteromethyld + OMSSA-label + + + + DiffAvg + 17.03 + + + + DiffFormula + C 1 (1)H -1 (2)H 3 + + + + DiffMono + 17.034480 + + + + Formula + C 5 (1)H 4 (2)H 3 N 1 O 3 + + + + MassAvg + 132.06 + + + + MassMono + 132.061423 + + + + Origin + D + + + + Source + artifact + + + + TermSpec + none + + MOD:00617 + MOD:00904 + + derives_from + MOD:011810 + + PSI-MOD + + + MOD:01242 + 3x(2)H labeled L-glutamic acid 5-methyl ester + + A protein modification that effectively converts an L-lysine residue to 3x(2)H labeled L-glutamic acid 5-methyl ester. + + 1326520 + PubMed + + + 298#E + UniMod + + + + deuterated methyl ester + UniMod-description + + + Methyl:2H(3) + PSI-MS-label + + + trideuteromethyle + OMSSA-label + + + + DiffAvg + 17.03 + + + + DiffFormula + C 1 (1)H -1 (2)H 3 + + + + DiffMono + 17.034480 + + + + Formula + C 6 (1)H 6 (2)H 3 N 1 O 3 + + + + MassAvg + 146.08 + + + + MassMono + 146.077073 + + + + Origin + E + + + + Source + artifact + + + + TermSpec + none + + MOD:00617 + MOD:00906 + + derives_from + MOD:000810 + + PSI-MOD + + + MOD:01243 + potassium carboxylate C-terminal residue + + A protein modification that effectively converts a C-terminal residue to the potassium carboxylate salt. + + 530#C-term + UniMod + + + + Cation:K + PSI-MS-label + + + Replacement of proton by potassium + UniMod-description + + + + DiffAvg + 38.09 + + + + DiffFormula + H -1 K 1 + + + + DiffMono + 37.955882 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + none + + + + TermSpec + C-term + + MOD:01072 + PSI-MOD + + + MOD:01244 + potassium L-glutamate + + A protein modification that effectively converts an L-glutamioc acid residue to the potassium glutamate salt. + + 530#E + UniMod + + + + Cation:K + PSI-MS-label + + + Replacement of proton by potassium + UniMod-description + + + + DiffAvg + 38.09 + + + + DiffFormula + H -1 K 1 + + + + DiffMono + 37.955882 + + + + Formula + C 5 H 6 K 1 N 1 O 3 + + + + MassAvg + 167.21 + + + + MassMono + 166.998475 + + + + Origin + E + + + + Source + none + + + + TermSpec + none + + MOD:00906 + MOD:01072 + PSI-MOD + + + MOD:01245 + potassium L-aspartate + + A protein modification that effectively converts an L-aspartic acid residue to the potassium aspartate salt. + + 530#D + UniMod + + + + Cation:K + PSI-MS-label + + + Replacement of proton by potassium + UniMod-description + + + + DiffAvg + 38.09 + + + + DiffFormula + H -1 K 1 + + + + DiffMono + 37.955882 + + + + Formula + C 4 H 4 K 1 N 1 O 3 + + + + MassAvg + 153.18 + + + + MassMono + 152.982825 + + + + Origin + D + + + + Source + none + + + + TermSpec + none + + MOD:00904 + MOD:01072 + PSI-MOD + + + MOD:01246 + fucosylated -site S + + OBSOLETE because redundant and identical to MOD:00812 after formula correction. Remap to MOD:00812. + + 11344537 + PubMed + + + 15189151 + PubMed + + + 3311742 + PubMed + + + 3578767 + PubMed + + + 295#S + UniMod + + + + dHex + PSI-MS-label + + + Fucose + UniMod-description + + + + DiffAvg + 147.15 + + + + DiffFormula + C 6 H 11 O 4 + + + + DiffMono + 147.065734 + + + + Formula + C 9 H 16 N 1 O 6 + + + + MassAvg + 234.23 + + + + MassMono + 234.097762 + + + + Origin + S + + + + Source + natural + + + + TermSpec + none + + 1 + PSI-MOD + + + MOD:01247 + fucosylated -site T + + OBSOLETE because redundant and identical to MOD:00813 after formula correction. Remap to MOD:00813. + + 11344537 + PubMed + + + 11857757 + PubMed + + + 15189151 + PubMed + + + 295#T + UniMod + + + + dHex + PSI-MS-label + + + Fucose + UniMod-description + + + + DiffAvg + 147.15 + + + + DiffFormula + C 6 H 11 O 4 + + + + DiffMono + 147.065734 + + + + Formula + C 10 H 18 N 1 O 6 + + + + MassAvg + 248.26 + + + + MassMono + 248.113412 + + + + Origin + T + + + + Source + natural + + + + TermSpec + none + + 1 + PSI-MOD + + + MOD:01248 + iodouridine monophosphate derivatized tyrosine + + A protein modification that is produced by reaction of iodouridine monophosphate, or a polynucleotide containing iodouridine, with an L-tyrosine residue to form an ether linkage. + + 11112526 + PubMed + + + 11567090 + PubMed + + + 6540775 + PubMed + + + 292#Y + UniMod + + + This has an ether linkage and not a phosphodiester linkage with UMP. + + Cross-link of (Iodo)-uracil MP with W,F,Y + UniMod-description + + + IodoU-AMP + PSI-MS-label + + + + DiffAvg + 322.17 + + + + DiffFormula + C 9 H 11 N 2 O 9 P 1 + + + + DiffMono + 322.020217 + + + + Formula + C 18 H 20 N 3 O 11 P 1 + + + + MassAvg + 485.34 + + + + MassMono + 485.083545 + + + + Origin + Y + + + + Source + artifact + + + + TermSpec + none + + MOD:00611 + MOD:00919 + PSI-MOD + + + MOD:01249 + iodouridine monophosphate derivatized tryptophan + + A protein modification that is produced by reaction of iodouridine monophosphate, or a polynucleotide containing iodouridine, with an L-tryptophan residue. + + 11112526 + PubMed + + + 11567090 + PubMed + + + 6540775 + PubMed + + + 292#W + UniMod + + + This has a carbon-nitrogen linkage and not a phosphodiester linkage with UMP. + + Cross-link of (Iodo)-uracil MP with W,F,Y + UniMod-description + + + IodoU-AMP + PSI-MS-label + + + + DiffAvg + 322.17 + + + + DiffFormula + C 9 H 11 N 2 O 9 P 1 + + + + DiffMono + 322.020217 + + + + Formula + C 20 H 21 N 4 O 10 P 1 + + + + MassAvg + 508.38 + + + + MassMono + 508.099530 + + + + Origin + W + + + + Source + artifact + + + + TermSpec + none + + MOD:00611 + MOD:00918 + PSI-MOD + + + MOD:01250 + iodouridine monophosphate derivatized phenylalanine + + A protein modification that is produced by reaction of iodouridine monophosphate, or a polynucleotide containing iodouridine, with an L-phenylalanine residue. + + 11112526 + PubMed + + + 11567090 + PubMed + + + 6540775 + PubMed + + + 292#F + UniMod + + + This has a carbon-carbon linkage and not a phosphodiester linkage with UMP. + + Cross-link of (Iodo)-uracil MP with W,F,Y + UniMod-description + + + IodoU-AMP + PSI-MS-label + + + + DiffAvg + 322.17 + + + + DiffFormula + C 9 H 11 N 2 O 9 P 1 + + + + DiffMono + 322.020217 + + + + Formula + C 18 H 20 N 3 O 10 P 1 + + + + MassAvg + 469.34 + + + + MassMono + 469.088630 + + + + Origin + F + + + + Source + artifact + + + + TermSpec + none + + MOD:00611 + MOD:00914 + PSI-MOD + + + MOD:01251 + N6-[3-(carboxamidomethylthio)propanoyl]lysine + + A protein modification that effectively converts an L-lysine residue to N6-[3-(carboxamidomethylthio)propanoyl]lysine. + + 15121203 + PubMed + + + 293#K + UniMod + + + + 3-(carbamidomethylthio)propanoyl + UniMod-description + + + CAMthiopropanoyl + PSI-MS-label + + + + DiffAvg + 145.18 + + + + DiffFormula + C 5 H 7 N 1 O 2 S 1 + + + + DiffMono + 145.019749 + + + + Formula + C 11 H 19 N 3 O 3 S 1 + + + + MassAvg + 273.35 + + + + MassMono + 273.114712 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00612 + MOD:01875 + PSI-MOD + + + MOD:01252 + 5-hydro-5-methylimidazol-4-one, methylglyoxal arginine adduct (+54 amu) + + OBSOLETE because redundant and identical to MOD:00933. Remap to MOD:00933. + + 9448752 + PubMed + + + 319#R + UniMod + + + + Delta:H(2)C(3)O(1) + PSI-MS-label + + + MDA adduct +54 + UniMod-description + + + + DiffAvg + 54.05 + + + + DiffFormula + C 3 H 2 O 1 + + + + DiffMono + 54.010565 + + + + Formula + C 9 H 14 N 4 O 2 + + + + MassAvg + 210.24 + + + + MassMono + 210.111676 + + + + Origin + R + + + + Source + artifact + + + + TermSpec + none + + 1 + PSI-MOD + + + MOD:01253 + malondialdehyde lysine adduct (+54 amu) + + modification from UniMod Chemical derivative - Malondialdehyde (MDA) adduct + + 319#K + UniMod + + + + Delta:H(2)C(3)O(1) + PSI-MS-label + + + MDA adduct +54 + UniMod-description + + + + DiffAvg + 54.05 + + + + DiffFormula + C 3 H 2 O 1 + + + + DiffMono + 54.010565 + + + + Formula + C 9 H 14 N 2 O 2 + + + + MassAvg + 182.22 + + + + MassMono + 182.105528 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00630 + MOD:00912 + PSI-MOD + + + MOD:01254 + 4x(2)H labeled dimethylated L-lysine + + A protein modification that effectively converts an L-lysine residue to 4x(2)H labeled dimethylated L-lysine. + + 14670044 + PubMed + + + 199#K + UniMod + + + PSI-MOD-slim + + DiMethyl-CHD2 + UniMod-description + + + Dimethyl:2H(4) + PSI-MS-label + + + mod189 + OMSSA-label + + + + DiffAvg + 32.06 + + + + DiffFormula + C 2 (2)H 4 + + + + DiffMono + 32.056407 + + + + Formula + C 8 H 12 (2)H 4 N 2 O 1 + + + + MassAvg + 160.15 + + + + MassMono + 160.151370 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00552 + MOD:00912 + + derives_from + MOD:000840 + + PSI-MOD + + + MOD:01255 + S-(2-sulfanylethyl)cysteine (Ser) + + A protein modification that effectively converts an L-serine residue to S-(2-sulfanylethyl)cysteine. + + 11507762 + PubMed + + + 200#S + UniMod + + + + EDT + UniMod-description + + + Ethanedithiol + PSI-MS-label + + + S-(2-mercaptoethyl)cysteine + PSI-MOD-alternate + + + + DiffAvg + 76.18 + + + + DiffFormula + C 2 H 4 O -1 S 2 + + + + DiffMono + 75.980528 + + + + Formula + C 5 H 9 N 1 O 1 S 2 + + + + MassAvg + 163.25 + + + + MassMono + 163.012556 + + + + Origin + S + + + + Source + artifact + + + + TermSpec + none + + MOD:00553 + MOD:00916 + PSI-MOD + + + MOD:01256 + 3-methyl-S-(2-sulfanylethyl)cysteine (Thr) + + A protein modification that effectively converts an L-threonine residue to 3-methyl-S-(2-sulfanylethyl)cysteine. + + 11507762 + PubMed + + + 200#T + UniMod + + + + beta-methyl-S-(2-mercaptoethyl)cysteine + PSI-MOD-alternate + + + EDT + UniMod-description + + + Ethanedithiol + PSI-MS-label + + + + DiffAvg + 76.18 + + + + DiffFormula + C 2 H 4 O -1 S 2 + + + + DiffMono + 75.980528 + + + + Formula + C 6 H 11 N 1 O 1 S 2 + + + + MassAvg + 177.28 + + + + MassMono + 177.028206 + + + + Origin + T + + + + Source + artifact + + + + TermSpec + none + + MOD:00553 + MOD:00917 + PSI-MOD + + + MOD:01257 + 6-aminoquinolyl-N-hydroxysuccinimidyl carbamate - site K + + modification from UniMod Chemical derivative - + + 12716131 + PubMed + + + 14997490 + PubMed + + + 194#K + UniMod + + + + 6-aminoquinolyl-N-hydroxysuccinimidyl carbamate + UniMod-description + + + AccQTag + PSI-MS-label + + + + DiffAvg + 170.17 + + + + DiffFormula + C 10 H 6 N 2 O 1 + + + + DiffMono + 170.048013 + + + + Formula + C 16 H 18 N 4 O 2 + + + + MassAvg + 298.35 + + + + MassMono + 298.142976 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00547 + PSI-MOD + + + MOD:01258 + N-methylmaleimide - site C + + modification from UniMod Chemical derivative - + + 9448752 + PubMed + + + 314#C + UniMod + + + + Nmethylmaleimide + PSI-MS-label + + + Nmethylmaleimide + UniMod-description + + + + DiffAvg + 111.10 + + + + DiffFormula + C 5 H 5 N 1 O 2 + + + + DiffMono + 111.032028 + + + + Formula + C 8 H 10 N 2 O 3 S 1 + + + + MassAvg + 214.24 + + + + MassMono + 214.041213 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:00625 + MOD:00905 + PSI-MOD + + + MOD:01259 + N-methylmaleimide - site K + + modification from UniMod Chemical derivative - + + 9448752 + PubMed + + + 314#K + UniMod + + + + Nmethylmaleimide + PSI-MS-label + + + Nmethylmaleimide + UniMod-description + + + + DiffAvg + 111.10 + + + + DiffFormula + C 5 H 5 N 1 O 2 + + + + DiffMono + 111.032028 + + + + Formula + C 11 H 17 N 3 O 3 + + + + MassAvg + 239.27 + + + + MassMono + 239.126991 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00625 + MOD:00912 + PSI-MOD + + + MOD:01260 + nucleophilic addtion to cytopiloyne - site Y + + modification from UniMod Chemical derivative - + + 15549660 + PubMed + + + 270#Y + UniMod + + + + Cytopiloyne + PSI-MS-label + + + nucleophilic addtion to cytopiloyne + UniMod-description + + + + DiffAvg + 362.38 + + + + DiffFormula + C 19 H 22 O 7 + + + + DiffMono + 362.136553 + + + + Formula + C 28 H 31 N 1 O 9 + + + + MassAvg + 525.55 + + + + MassMono + 525.199882 + + + + Origin + Y + + + + Source + artifact + + + + TermSpec + none + + MOD:00590 + MOD:00919 + PSI-MOD + + + MOD:01261 + nucleophilic addtion to cytopiloyne - site S + + modification from UniMod Chemical derivative - + + 15549660 + PubMed + + + 270#C + UniMod + + + + Cytopiloyne + PSI-MS-label + + + nucleophilic addtion to cytopiloyne + UniMod-description + + + + DiffAvg + 362.38 + + + + DiffFormula + C 19 H 22 O 7 + + + + DiffMono + 362.136553 + + + + Formula + C 22 H 27 N 1 O 9 + + + + MassAvg + 449.46 + + + + MassMono + 449.168581 + + + + Origin + S + + + + Source + artifact + + + + TermSpec + none + + MOD:00590 + MOD:00916 + PSI-MOD + + + MOD:01262 + nucleophilic addtion to cytopiloyne - site R + + modification from UniMod Chemical derivative - + + 12590383 + PubMed + + + 15549660 + PubMed + + + 270#R + UniMod + + + + Cytopiloyne + PSI-MS-label + + + nucleophilic addtion to cytopiloyne + UniMod-description + + + + DiffAvg + 362.38 + + + + DiffFormula + C 19 H 22 O 7 + + + + DiffMono + 362.136553 + + + + Formula + C 25 H 34 N 4 O 8 + + + + MassAvg + 518.57 + + + + MassMono + 518.237664 + + + + Origin + R + + + + Source + artifact + + + + TermSpec + none + + MOD:00590 + MOD:00902 + PSI-MOD + + + MOD:01263 + nucleophilic addtion to cytopiloyne - site K + + modification from UniMod Chemical derivative - + + 15549660 + PubMed + + + 270#K + UniMod + + + + Cytopiloyne + PSI-MS-label + + + nucleophilic addtion to cytopiloyne + UniMod-description + + + + DiffAvg + 362.38 + + + + DiffFormula + C 19 H 22 O 7 + + + + DiffMono + 362.136553 + + + + Formula + C 25 H 34 N 2 O 8 + + + + MassAvg + 490.55 + + + + MassMono + 490.231516 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00590 + MOD:00912 + PSI-MOD + + + MOD:01264 + nucleophilic addtion to cytopiloyne - site C + + modification from UniMod Chemical derivative - + + 15549660 + PubMed + + + 270#C + UniMod + + + + Cytopiloyne + PSI-MS-label + + + nucleophilic addtion to cytopiloyne + UniMod-description + + + + DiffAvg + 362.38 + + + + DiffFormula + C 19 H 22 O 7 + + + + DiffMono + 362.136553 + + + + Formula + C 22 H 27 N 1 O 8 S 1 + + + + MassAvg + 465.52 + + + + MassMono + 465.145738 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:00590 + MOD:00905 + PSI-MOD + + + MOD:01265 + nucleophilic addtion to cytopiloyne - site P + + modification from UniMod Chemical derivative - + + 15549660 + PubMed + + + 270#P + UniMod + + + + Cytopiloyne + PSI-MS-label + + + nucleophilic addtion to cytopiloyne + UniMod-description + + + + DiffAvg + 362.38 + + + + DiffFormula + C 19 H 22 O 7 + + + + DiffMono + 362.136553 + + + + Formula + C 24 H 29 N 1 O 8 + + + + MassAvg + 459.50 + + + + MassMono + 459.189317 + + + + Origin + P + + + + Source + artifact + + + + TermSpec + none + + MOD:00590 + MOD:00915 + PSI-MOD + + + MOD:01266 + nucleophilic addition to cytopiloyne+H2O - site C + + modification from UniMod Chemical derivative - + + 15549660 + PubMed + + + 271#C + UniMod + + + + Cytopiloyne+water + PSI-MS-label + + + nucleophilic addition to cytopiloyne+H2O + UniMod-description + + + + DiffAvg + 380.39 + + + + DiffFormula + C 19 H 24 O 8 + + + + DiffMono + 380.147118 + + + + Formula + C 22 H 29 N 1 O 9 S 1 + + + + MassAvg + 483.53 + + + + MassMono + 483.156303 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:00591 + MOD:00905 + PSI-MOD + + + MOD:01267 + nucleophilic addition to cytopiloyne+H2O - site K + + modification from UniMod Chemical derivative - + + 11746907 + PubMed + + + 15549660 + PubMed + + + 271#K + UniMod + + + + Cytopiloyne+water + PSI-MS-label + + + nucleophilic addition to cytopiloyne+H2O + UniMod-description + + + + DiffAvg + 380.39 + + + + DiffFormula + C 19 H 24 O 8 + + + + DiffMono + 380.147118 + + + + Formula + C 25 H 36 N 2 O 9 + + + + MassAvg + 508.57 + + + + MassMono + 508.242081 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00591 + MOD:00912 + PSI-MOD + + + MOD:01268 + nucleophilic addition to cytopiloyne+H2O - site T + + modification from UniMod Chemical derivative - + + 15549660 + PubMed + + + 271#T + UniMod + + + + Cytopiloyne+water + PSI-MS-label + + + nucleophilic addition to cytopiloyne+H2O + UniMod-description + + + + DiffAvg + 380.39 + + + + DiffFormula + C 19 H 24 O 8 + + + + DiffMono + 380.147118 + + + + Formula + C 23 H 31 N 1 O 10 + + + + MassAvg + 481.50 + + + + MassMono + 481.194796 + + + + Origin + T + + + + Source + artifact + + + + TermSpec + none + + MOD:00591 + MOD:00917 + PSI-MOD + + + MOD:01269 + nucleophilic addition to cytopiloyne+H2O - site R + + modification from UniMod Chemical derivative - + + 15549660 + PubMed + + + 271#R + UniMod + + + + Cytopiloyne+water + PSI-MS-label + + + nucleophilic addition to cytopiloyne+H2O + UniMod-description + + + + DiffAvg + 380.39 + + + + DiffFormula + C 19 H 24 O 8 + + + + DiffMono + 380.147118 + + + + Formula + C 25 H 36 N 4 O 9 + + + + MassAvg + 536.58 + + + + MassMono + 536.248229 + + + + Origin + R + + + + Source + artifact + + + + TermSpec + none + + MOD:00591 + MOD:00902 + PSI-MOD + + + MOD:01270 + nucleophilic addition to cytopiloyne+H2O - site S + + modification from UniMod Chemical derivative - + + 14670044 + PubMed + + + 15549660 + PubMed + + + 271#S + UniMod + + + + Cytopiloyne+water + PSI-MS-label + + + nucleophilic addition to cytopiloyne+H2O + UniMod-description + + + + DiffAvg + 380.39 + + + + DiffFormula + C 19 H 24 O 8 + + + + DiffMono + 380.147118 + + + + Formula + C 22 H 29 N 1 O 10 + + + + MassAvg + 467.47 + + + + MassMono + 467.179146 + + + + Origin + S + + + + Source + artifact + + + + TermSpec + none + + MOD:00591 + MOD:00916 + PSI-MOD + + + MOD:01271 + nucleophilic addition to cytopiloyne+H2O - site Y + + modification from UniMod Chemical derivative - + + 15549660 + PubMed + + + 271#Y + UniMod + + + + Cytopiloyne+water + PSI-MS-label + + + nucleophilic addition to cytopiloyne+H2O + UniMod-description + + + + DiffAvg + 380.39 + + + + DiffFormula + C 19 H 24 O 8 + + + + DiffMono + 380.147118 + + + + Formula + C 28 H 33 N 1 O 10 + + + + MassAvg + 543.57 + + + + MassMono + 543.210446 + + + + Origin + Y + + + + Source + artifact + + + + TermSpec + none + + MOD:00591 + MOD:00919 + PSI-MOD + + + MOD:01272 + iminobiotinylation - site K + + modification from UniMod Chemical derivative - + + 9750125 + PubMed + + + 89#K + UniMod + + + + Iminobiotin + PSI-MS-label + + + Iminobiotinylation + UniMod-description + + + + DiffAvg + 225.31 + + + + DiffFormula + C 10 H 15 N 3 O 1 S 1 + + + + DiffMono + 225.093583 + + + + Formula + C 16 H 27 N 5 O 2 S 1 + + + + MassAvg + 353.49 + + + + MassMono + 353.188546 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00467 + MOD:01875 + PSI-MOD + + + MOD:01273 + O-[4-(2-aminoethyl)benzenesulfonyl] serine + + A protein modification that is produced by formation of an adduct with 4-(2-aminoethyl)benzenesulfonyl fluoride, AEBS, and an L-serine residue. + + 15283597 + PubMed + + + 8597590 + PubMed + + + 276#S + UniMod + + + + AEBS + PSI-MS-label + + + Aminoethylbenzenesulfonylation + UniMod-description + + + + DiffAvg + 183.23 + + + + DiffFormula + C 8 H 9 N 1 O 2 S 1 + + + + DiffMono + 183.035400 + + + + Formula + C 11 H 14 N 2 O 4 S 1 + + + + MassAvg + 270.30 + + + + MassMono + 270.067428 + + + + Origin + S + + + + Source + artifact + + + + TermSpec + none + + MOD:00596 + MOD:00916 + PSI-MOD + + + MOD:01274 + N'-[4-(2-aminoethyl)benzenesulfonyl] derivatized histidine + + A protein modification that is produced by formation of an adduct with 4-(2-aminoethyl)benzenesulfonyl fluoride, AEBS, and an L-histidine residue. + + 8597590 + PubMed + + + 276#H + UniMod + + + + AEBS + PSI-MS-label + + + Aminoethylbenzenesulfonylation + UniMod-description + + + + DiffAvg + 183.23 + + + + DiffFormula + C 8 H 9 N 1 O 2 S 1 + + + + DiffMono + 183.035400 + + + + Formula + C 14 H 16 N 4 O 3 S 1 + + + + MassAvg + 320.37 + + + + MassMono + 320.094311 + + + + Origin + H + + + + Source + artifact + + + + TermSpec + none + + MOD:00596 + MOD:00909 + PSI-MOD + + + MOD:01275 + N6-[4-(2-aminoethyl)benzenesulfonyl]lysine + + A protein modification that is produced by formation of an adduct with 4-(2-aminoethyl)benzenesulfonyl fluoride, AEBS, and an L-lysine residue. + + 8597590 + PubMed + + + 276#K + UniMod + + + + AEBS + PSI-MS-label + + + Aminoethylbenzenesulfonylation + UniMod-description + + + + DiffAvg + 183.23 + + + + DiffFormula + C 8 H 9 N 1 O 2 S 1 + + + + DiffMono + 183.035400 + + + + Formula + C 14 H 21 N 3 O 3 S 1 + + + + MassAvg + 311.40 + + + + MassMono + 311.130363 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00596 + MOD:00912 + PSI-MOD + + + MOD:01276 + O4'-[4-(2-aminoethyl)benzenesulfonyl]tyrosine + + A protein modification that is produced by formation of an adduct with 4-(2-aminoethyl)benzenesulfonyl fluoride, AEBS, and an L-tyrosine residue. + + 10906242 + PubMed + + + 8597590 + PubMed + + + 276#Y + UniMod + + + + AEBS + PSI-MS-label + + + Aminoethylbenzenesulfonylation + UniMod-description + + + + DiffAvg + 183.23 + + + + DiffFormula + C 8 H 9 N 1 O 2 S 1 + + + + DiffMono + 183.035400 + + + + Formula + C 17 H 18 N 2 O 4 S 1 + + + + MassAvg + 346.40 + + + + MassMono + 346.098728 + + + + Origin + Y + + + + Source + artifact + + + + TermSpec + none + + MOD:00596 + MOD:00919 + PSI-MOD + + + MOD:01277 + crotonaldehyde - site C + + modification from UniMod Other - + + 11283024 + PubMed + + + 253#C + UniMod + + + + Crotonaldehyde + PSI-MS-label + + + Crotonaldehyde + UniMod-description + + + + DiffAvg + 70.09 + + + + DiffFormula + C 4 H 6 O 1 + + + + DiffMono + 70.041865 + + + + Formula + C 7 H 11 N 1 O 2 S 1 + + + + MassAvg + 173.23 + + + + MassMono + 173.051050 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:00576 + MOD:00905 + PSI-MOD + + + MOD:01278 + crotonaldehyde - site K + + modification from UniMod Other - + + 11283024 + PubMed + + + 253#K + UniMod + + + + Crotonaldehyde + PSI-MS-label + + + Crotonaldehyde + UniMod-description + + + + DiffAvg + 70.09 + + + + DiffFormula + C 4 H 6 O 1 + + + + DiffMono + 70.041865 + + + + Formula + C 10 H 18 N 2 O 2 + + + + MassAvg + 198.27 + + + + MassMono + 198.136828 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00576 + MOD:00912 + PSI-MOD + + + MOD:01279 + crotonaldehyde - site H + + modification from UniMod Other - + + 11283024 + PubMed + + + 1443554 + PubMed + + + 253#H + UniMod + + + + Crotonaldehyde + PSI-MS-label + + + Crotonaldehyde + UniMod-description + + + + DiffAvg + 70.09 + + + + DiffFormula + C 4 H 6 O 1 + + + + DiffMono + 70.041865 + + + + Formula + C 10 H 13 N 3 O 2 + + + + MassAvg + 207.23 + + + + MassMono + 207.100777 + + + + Origin + H + + + + Source + artifact + + + + TermSpec + none + + MOD:00576 + MOD:00909 + PSI-MOD + + + MOD:01280 + EDT-iodo-PEO-biotin - site T + + modification from UniMod Chemical derivative - + + 11857757 + PubMed + + + 12175151 + PubMed + + + 118#T + UniMod + + + + EDT-iodo-PEO-biotin + UniMod-description + + + EDT-iodoacetyl-PEO-biotin + PSI-MS-label + + + + DiffAvg + 490.70 + + + + DiffFormula + C 20 H 34 N 4 O 4 S 3 + + + + DiffMono + 490.174219 + + + + Formula + C 24 H 41 N 5 O 6 S 3 + + + + MassAvg + 591.80 + + + + MassMono + 591.221897 + + + + Origin + T + + + + Source + artifact + + + + TermSpec + none + + MOD:00490 + MOD:00917 + PSI-MOD + + + MOD:01281 + EDT-iodo-PEO-biotin - site S + + modification from UniMod Chemical derivative - + + 16335955 + PubMed + + + 118#S + UniMod + + + + EDT-iodo-PEO-biotin + UniMod-description + + + EDT-iodoacetyl-PEO-biotin + PSI-MS-label + + + + DiffAvg + 490.70 + + + + DiffFormula + C 20 H 34 N 4 O 4 S 3 + + + + DiffMono + 490.174219 + + + + Formula + C 23 H 39 N 5 O 6 S 3 + + + + MassAvg + 577.77 + + + + MassMono + 577.206247 + + + + Origin + S + + + + Source + artifact + + + + TermSpec + none + + MOD:00490 + MOD:00916 + PSI-MOD + + + MOD:01282 + acrolein addition +56 - site H + + modification from UniMod Other - + + 10825247 + PubMed + + + 15541752 + PubMed + + + 206#H + UniMod + + + + Acrolein addition +56 + UniMod-description + + + Delta:H(4)C(3)O(1) + PSI-MS-label + + + + DiffAvg + 56.06 + + + + DiffFormula + C 3 H 4 O 1 + + + + DiffMono + 56.026215 + + + + Formula + C 9 H 11 N 3 O 2 + + + + MassAvg + 193.21 + + + + MassMono + 193.085127 + + + + Origin + H + + + + Source + artifact + + + + TermSpec + none + + MOD:00557 + MOD:00909 + PSI-MOD + + + MOD:01283 + acrolein addition +56 - site K + + modification from UniMod Other - + + 10825247 + PubMed + + + 15541752 + PubMed + + + 206#K + UniMod + + + + Acrolein addition +56 + UniMod-description + + + Delta:H(4)C(3)O(1) + PSI-MS-label + + + + DiffAvg + 56.06 + + + + DiffFormula + C 3 H 4 O 1 + + + + DiffMono + 56.026215 + + + + Formula + C 9 H 16 N 2 O 2 + + + + MassAvg + 184.24 + + + + MassMono + 184.121178 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00557 + MOD:00912 + PSI-MOD + + + MOD:01284 + acrolein addition +56 - site C + + modification from UniMod Other - + + 10825247 + PubMed + + + 15541752 + PubMed + + + 9254591 + PubMed + + + 206#C + UniMod + + + + Acrolein addition +56 + UniMod-description + + + Delta:H(4)C(3)O(1) + PSI-MS-label + + + + DiffAvg + 56.06 + + + + DiffFormula + C 3 H 4 O 1 + + + + DiffMono + 56.026215 + + + + Formula + C 6 H 9 N 1 O 2 S 1 + + + + MassAvg + 159.20 + + + + MassMono + 159.035400 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:00557 + MOD:00905 + PSI-MOD + + + MOD:01285 + 6x(13)C,1x(15)N labeled L-leucine + + A protein modification that effectively converts an L-leucine residue to 6x(13)C,1x(15)N isotope labeled L-leucine. + + 11857757 + PubMed + + + 11999733 + PubMed + + + 12175151 + PubMed + + + 695#L + UniMod + + + + 13C(6) 15N(1) Silac label + UniMod-description + + + Label:13C(6)15N(1) + PSI-MS-label + + + + DiffAvg + 7.02 + + + + DiffFormula + (12)C -6 (13)C 6 (14)N -1 (15)N 1 + + + + DiffMono + 7.017164 + + + + Formula + (13)C 6 H 11 (15)N 1 O 1 + + + + MassAvg + 120.10 + + + + MassMono + 120.101228 + + + + Origin + L + + + + Source + artifact + + + + TermSpec + none + + MOD:00911 + MOD:01370 + PSI-MOD + + + MOD:01286 + 6x(13)C,1x(15)N labeled L-isoleucine + + A protein modification that effectively converts an L-isoleucine residue to 6x(13)C,1x(15)N isotope labeled L-isoleucine. + + 11857757 + PubMed + + + 11999733 + PubMed + + + 12175151 + PubMed + + + 695#I + UniMod + + + + 13C(6) 15N(1) Silac label + UniMod-description + + + Label:13C(6)15N(1) + PSI-MS-label + + + + DiffAvg + 7.02 + + + + DiffFormula + (12)C -6 (13)C 6 (14)N -1 (15)N 1 + + + + DiffMono + 7.017164 + + + + Formula + (13)C 6 H 11 (15)N 1 O 1 + + + + MassAvg + 120.10 + + + + MassMono + 120.101228 + + + + Origin + I + + + + Source + artifact + + + + TermSpec + none + + MOD:00910 + MOD:01370 + PSI-MOD + + + MOD:01287 + Bruker Daltonics SERVA-ICPL(TM) quantification chemistry, heavy form - site K + + modification from UniMod Isotopic label - + + 11857757 + PubMed + + + 15602776 + PubMed + + + 364#K + UniMod + + + + Bruker Daltonics SERVA-ICPL(TM) quantification chemistry, heavy form + UniMod-description + + + ICPL:13C(6) + PSI-MS-label + + + + DiffAvg + 111.04 + + + + DiffFormula + (13)C 6 H 3 N 1 O 1 + + + + DiffMono + 111.041593 + + + + Formula + C 6 (13)C 6 H 15 N 3 O 2 + + + + MassAvg + 239.14 + + + + MassMono + 239.136556 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00789 + MOD:00912 + PSI-MOD + + + MOD:01288 + acetaldehyde +28 - site H + + modification from UniMod Other - + + 255#H + UniMod + + + + Acetaldehyde +28 + UniMod-description + + + Delta:H(4)C(2) + PSI-MS-label + + + + DiffAvg + 28.05 + + + + DiffFormula + C 2 H 4 + + + + DiffMono + 28.031300 + + + + Formula + C 8 H 11 N 3 O 1 + + + + MassAvg + 165.20 + + + + MassMono + 165.090212 + + + + Origin + H + + + + Source + artifact + + + + TermSpec + none + + MOD:00578 + MOD:00909 + PSI-MOD + + + MOD:01289 + acetaldehyde +28 - site K + + modification from UniMod Other - + + 255#K + UniMod + + + + Acetaldehyde +28 + UniMod-description + + + Delta:H(4)C(2) + PSI-MS-label + + + + DiffAvg + 28.05 + + + + DiffFormula + C 2 H 4 + + + + DiffMono + 28.031300 + + + + Formula + C 8 H 16 N 2 O 1 + + + + MassAvg + 156.23 + + + + MassMono + 156.126263 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00578 + MOD:00912 + PSI-MOD + + + MOD:01290 + dihydroxylated residue - site F + + OBSOLETE because redundant and identical to MOD:00465. Remap to MOD:00465. + + 11857757 + PubMed + + + 12175151 + PubMed + + + 12686488 + PubMed + + + 9252331 + PubMed + + + 425 + UniMod + + + + dihydroxy + UniMod-description + + + Dioxidation + PSI-MS-label + + + + DiffAvg + 32.00 + + + + DiffFormula + O 2 + + + + DiffMono + 31.989829 + + + + Formula + C 9 H 9 N 1 O 3 + + + + MassAvg + 179.17 + + + + MassMono + 179.058243 + + + + Origin + F + + + + Source + artifact + + + + TermSpec + none + + 1 + PSI-MOD + + + MOD:01291 + dihydroxylated residue - site W + + OBSOLETE because redundant and identical to MOD:00464. Remap to MOD:00464. + + 12643539 + PubMed + + + 12686488 + PubMed + + + 6273432 + PubMed + + + 9252331 + PubMed + + + 425 + UniMod + + + + dihydroxy + UniMod-description + + + Dioxidation + PSI-MS-label + + + + DiffAvg + 32.00 + + + + DiffFormula + O 2 + + + + DiffMono + 31.989829 + + + + Formula + C 11 H 10 N 2 O 3 + + + + MassAvg + 218.21 + + + + MassMono + 218.069142 + + + + Origin + W + + + + Source + artifact + + + + TermSpec + none + + 1 + PSI-MOD + + + MOD:01292 + dimethylation of proline residue + + OBSOLETE because redundant and identical to MOD:00075. Map to MOD:00075. + + 529 + UniMod + + + + Delta:H(5)C(2) + PSI-MS-label + + + Dimethylation of proline residue + UniMod-description + + + + DiffAvg + 29.06 + + + + DiffFormula + C 2 H 5 + + + + DiffMono + 29.039125 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + P + + + + Source + natural + + + + TermSpec + none + + 1 + PSI-MOD + + + MOD:01293 + 1x(18)O labeled deamidated L-asparagine + + A protein modification that effectively converts an L-asparagine residue to L-aspartic acid with one (18)O. + + 8382902 + PubMed + + + 366#N + UniMod + + + PSI-MOD-slim + + Deamidated:18O(1) + PSI-MS-label + + + Deamidation in presence of O18 + UniMod-description + + + oxy18 + OMSSA-label + + + + DiffAvg + 2.99 + + + + DiffFormula + H -1 N -1 (18)O 1 + + + + DiffMono + 2.988262 + + + + Formula + C 4 H 5 N 1 (16)O 2 (18)O 1 + + + + MassAvg + 117.03 + + + + MassMono + 117.031189 + + + + Origin + N + + + + Source + artifact + + + + TermSpec + none + + MOD:00852 + + derives_from + MOD:006840 + + PSI-MOD + + + MOD:01294 + deamidation in presence of O18 -site Q + + OBSOLETE identical and redundant with MOD:00791. Remap to MOD:00791. + + 8382902 + PubMed + + + + Deamidated:18O(1) + PSI-MS-label + + + Deamidation in presence of O18 + UniMod-description + + + + DiffAvg + 2.99 + + + + DiffFormula + H -1 N -1 (18)O 1 + + + + DiffMono + 2.988262 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + Q + + + + Source + artifact + + + + TermSpec + none + + 1 + PSI-MOD + + + MOD:01295 + monosodium L-aspartate + + A protein modification that effectively converts an L-aspartic acid residue to monosodium L-aspartate. + + 12216740 + PubMed + + + 30#D + UniMod + + + PSI-MOD-slim + + Cation:Na + PSI-MS-label + + + Na1Asp + PSI-MOD-label + + + Sodium adduct + UniMod-description + + + + DiffAvg + 21.98 + + + + DiffFormula + H -1 Na 1 + + + + DiffMono + 21.981944 + + + + Formula + C 4 H 4 N 1 Na 1 O 3 + + + + MassAvg + 137.07 + + + + MassMono + 137.008887 + + + + Origin + D + + + + Source + artifact + + + + TermSpec + none + + MOD:00423 + MOD:00904 + PSI-MOD + + + MOD:01296 + monosodium L-glutamate + + A protein modification that effectively converts an L-glutamic acid residue to monosodium L-glutamate. + + 12216740 + PubMed + + + 30#E + UniMod + + + PSI-MOD-slim + + Cation:Na + PSI-MS-label + + + MSG + PSI-MOD-alternate + + + Na1Glu + PSI-MOD-label + + + Sodium adduct + UniMod-description + + + + DiffAvg + 21.98 + + + + DiffFormula + H -1 Na 1 + + + + DiffMono + 21.981944 + + + + Formula + C 5 H 6 N 1 Na 1 O 3 + + + + MassAvg + 151.10 + + + + MassMono + 151.024537 + + + + Origin + E + + + + Source + artifact + + + + TermSpec + none + + MOD:00423 + MOD:00906 + PSI-MOD + + + MOD:01297 + 5x(13)C labeled L-proline + + A protein modification that effectively converts an L-proline residue to 5x(13)C labeled L-proline. + + 12716131 + PubMed + + + 772#P + UniMod + + + In PubMed:12716131, fully (13)C labeled proline apparently resulted from the catabolic conversion of (13)C labeled L-arginine during SILAC. + + 13C(5) Silac label + UniMod-description + + + Label:13C(5) + PSI-MS-label + + + + DiffAvg + 5.02 + + + + DiffFormula + (12)C -5 (13)C 5 + + + + DiffMono + 5.016774 + + + + Formula + (13)C 5 H 7 N 1 O 1 + + + + MassAvg + 102.07 + + + + MassMono + 102.069538 + + + + Origin + P + + + + Source + artifact + + + + TermSpec + none + + MOD:00915 + MOD:01832 + PSI-MOD + + + MOD:01298 + reduced cysteine 4-hydroxynonenal adduct + + A protein modification produced by formation of an adduct of an L-cysteine residue with 4-hydroxynonenal artificially reduced by a reagent such as NaBH4. + + 11910026 + PubMed + + + 15133838 + PubMed + + + 335#C + UniMod + + + 4-hydroxynonenal, a toxic lipid aldehyde, is a product of the hydroperoxide beta-cleavage degradation of omega-6 polyunsaturated fatty acids, such as arachidonic and linoleic acids [JSG]. + + HNE+Delta:H(2) + PSI-MS-label + + + reduced 4-Hydroxynonenal + UniMod-description + + + + DiffAvg + 158.24 + + + + DiffFormula + C 9 H 18 O 2 + + + + DiffMono + 158.130680 + + + + Formula + C 12 H 23 N 1 O 3 S 1 + + + + MassAvg + 261.38 + + + + MassMono + 261.139865 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:00642 + MOD:00905 + + derives_from + MOD:012370 + + PSI-MOD + + + MOD:01299 + reduced lysine 4-hydroxynonenal adduct + + A protein modification produced by formation of an adduct of an L-histidine residue with 4-hydroxynonenal artificially reduced by a reagent such as NaBH4. + + 11910026 + PubMed + + + 12148805 + PubMed + + + 15133838 + PubMed + + + 335#K + UniMod + + + 4-hydroxynonenal, a toxic lipid aldehyde, is a product of the hydroperoxide beta-cleavage degradation of omega-6 polyunsaturated fatty acids, such as arachidonic and linoleic acids [JSG]. + + HNE+Delta:H(2) + PSI-MS-label + + + reduced 4-Hydroxynonenal + UniMod-description + + + + DiffAvg + 158.24 + + + + DiffFormula + C 9 H 18 O 2 + + + + DiffMono + 158.130680 + + + + Formula + C 15 H 30 N 2 O 3 + + + + MassAvg + 286.42 + + + + MassMono + 286.225643 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00642 + MOD:00912 + + derives_from + MOD:012380 + + PSI-MOD + + + MOD:01300 + reduced histidine 4-hydroxynonenal adduct + + A protein modification produced by formation of an adduct of an L-histidine residue with 4-hydroxynonenal artificially reduced by a reagent such as NaBH4. + + 11910026 + PubMed + + + 12148805 + PubMed + + + 15133838 + PubMed + + + 335#H + UniMod + + + 4-hydroxynonenal, a toxic lipid aldehyde, is a product of the hydroperoxide beta-cleavage degradation of omega-6 polyunsaturated fatty acids, such as arachidonic and linoleic acids [JSG]. + + HNE+Delta:H(2) + PSI-MS-label + + + reduced 4-Hydroxynonenal + UniMod-description + + + + DiffAvg + 158.24 + + + + DiffFormula + C 9 H 18 O 2 + + + + DiffMono + 158.130680 + + + + Formula + C 15 H 25 N 3 O 3 + + + + MassAvg + 295.38 + + + + MassMono + 295.189592 + + + + Origin + H + + + + Source + artifact + + + + TermSpec + none + + MOD:00642 + MOD:00909 + + derives_from + MOD:012390 + + PSI-MOD + + + MOD:01301 + methylamine Michael addition derivatized threonine + + A protein modification that effectively converts an L-threonine residue to 2-amino-3-(methylamino)butanoic acid. + + 11743741 + PubMed + + + 337#T + UniMod + + + In PubMed:11743741 phosphothreonine is converted to dehydrobutyrine in base, then by Michael addition of methylamine to 2-amino-3-(methylamino)butanoic acid. + + Methylamine + PSI-MS-label + + + Michael addition with methylamine + UniMod-description + + + + DiffAvg + 13.04 + + + + DiffFormula + C 1 H 3 N 1 O -1 + + + + DiffMono + 13.031634 + + + + Formula + C 5 H 10 N 2 O 1 + + + + MassAvg + 114.15 + + + + MassMono + 114.079313 + + + + Origin + T + + + + Source + artifact + + + + TermSpec + none + + MOD:00643 + MOD:00917 + PSI-MOD + + + MOD:01302 + methylamine Michael addition derivatized serine + + A protein modification that effectively converts an L-serine residue to 2-amino-3-(methylamino)propanoic acid. + + 11743741 + PubMed + + + 337#S + UniMod + + + In PubMed:11743741 phosphoserine is converted to dehydroalanine in base, then by Michael addition of methylamine to 2-amino-3-(methylamino)propanoic acid. + + Methylamine + PSI-MS-label + + + Michael addition with methylamine + UniMod-description + + + + DiffAvg + 13.04 + + + + DiffFormula + C 1 H 3 N 1 O -1 + + + + DiffMono + 13.031634 + + + + Formula + C 4 H 8 N 2 O 1 + + + + MassAvg + 100.12 + + + + MassMono + 100.063663 + + + + Origin + S + + + + Source + artifact + + + + TermSpec + none + + MOD:00643 + MOD:00916 + PSI-MOD + + + MOD:01303 + N4-hexosaminylated asparagine + + A protein modification that effectively converts an L-asparagine residue to an N4-hexosaminyl-L-asparagine. + + 11467524 + PubMed + + + 454#N + UniMod + + + The natural modifications are N4-(N-acetylamino)galactosyl-L-asparagine (MOD:00832) or N4-(N-acetylamino)glucosyl-L-asparagine (MOD:00831) [JSG]. + + HexN + PSI-MS-label + + + Hexosamine + UniMod-description + + + + DiffAvg + 161.16 + + + + DiffFormula + C 6 H 11 N 1 O 4 + + + + DiffMono + 161.068808 + + + + Formula + C 10 H 17 N 3 O 6 + + + + MassAvg + 275.26 + + + + MassMono + 275.111735 + + + + Origin + N + + + + Source + artifact + + + + TermSpec + none + + MOD:00160 + MOD:00876 + PSI-MOD + + + MOD:01304 + N6-hexosaminylated lysine + + A protein modification that effectively converts an L-lysine residue to an N4-hexosaminyl-L-lysine, as a synthetic peptide protectting group. + + 454#K + UniMod + + + + HexN + PSI-MS-label + + + Hexosamine + UniMod-description + + + + DiffAvg + 161.16 + + + + DiffFormula + C 6 H 11 N 1 O 4 + + + + DiffMono + 161.068808 + + + + Formula + C 12 H 23 N 3 O 5 + + + + MassAvg + 289.33 + + + + MassMono + 289.163771 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00876 + MOD:00912 + PSI-MOD + + + MOD:01305 + N1'-hexosaminylated tryptophan + + A protein modification that effectively converts an L-tryptophan residue to N1'-hexosaminyl-L-tryptophan. + + 454#W + UniMod + + + The natural modification is N1'-mannosyl-L-tryptophan (MOD:00165) [JSG]. + + HexN + PSI-MS-label + + + Hexosamine + UniMod-description + + + + DiffAvg + 161.16 + + + + DiffFormula + C 6 H 11 N 1 O 4 + + + + DiffMono + 161.068808 + + + + Formula + C 17 H 21 N 3 O 5 + + + + MassAvg + 347.37 + + + + MassMono + 347.148121 + + + + Origin + W + + + + Source + artifact + + + + TermSpec + none + + MOD:00876 + MOD:00918 + PSI-MOD + + + MOD:01306 + O-hexosaminylated threonine + + A protein modification that effectively converts an L-threonine residue to O-hexosaminyl-L-threonine. + + 454#T + UniMod + + + The natural modifications are O-(N-acetylaminogalactosyl)-L-threonine (MOD:00164) or O-(N-acetylaminoglucosyl)-L-threonine (MOD:00806) [JSG]. + + HexN + PSI-MS-label + + + Hexosamine + UniMod-description + + + + DiffAvg + 161.16 + + + + DiffFormula + C 6 H 11 N 1 O 4 + + + + DiffMono + 161.068808 + + + + Formula + C 10 H 18 N 2 O 6 + + + + MassAvg + 262.26 + + + + MassMono + 262.116486 + + + + Origin + T + + + + Source + natural + + + + TermSpec + none + + MOD:00005 + MOD:00876 + PSI-MOD + + + MOD:01307 + thiophosphate labeled with biotin-HPDP -site S + + modification from UniMod Chemical derivative - + + 332#S + UniMod + + + + Thiophos-S-S-biotin + PSI-MS-label + + + thiophosphate labeled with biotin-HPDP + UniMod-description + + + + DiffAvg + 525.66 + + + + DiffFormula + C 19 H 34 N 4 O 5 P 1 S 3 + + + + DiffMono + 525.142895 + + + + Formula + C 22 H 39 N 5 O 7 P 1 S 3 + + + + MassAvg + 612.74 + + + + MassMono + 612.174923 + + + + Origin + S + + + + Source + artifact + + + + TermSpec + none + + MOD:00639 + MOD:00916 + PSI-MOD + + + MOD:01308 + thiophosphate labeled with biotin-HPDP -site T + + modification from UniMod Chemical derivative - + + 332#T + UniMod + + + + Thiophos-S-S-biotin + PSI-MS-label + + + thiophosphate labeled with biotin-HPDP + UniMod-description + + + + DiffAvg + 525.66 + + + + DiffFormula + C 19 H 34 N 4 O 5 P 1 S 3 + + + + DiffMono + 525.142895 + + + + Formula + C 23 H 41 N 5 O 7 P 1 S 3 + + + + MassAvg + 626.76 + + + + MassMono + 626.190573 + + + + Origin + T + + + + Source + artifact + + + + TermSpec + none + + MOD:00639 + MOD:00917 + PSI-MOD + + + MOD:01309 + thiophosphate labeled with biotin-HPDP - site Y + + modification from UniMod Chemical derivative - + + 332#Y + UniMod + + + + Thiophos-S-S-biotin + PSI-MS-label + + + thiophosphate labeled with biotin-HPDP + UniMod-description + + + + DiffAvg + 525.66 + + + + DiffFormula + C 19 H 34 N 4 O 5 P 1 S 3 + + + + DiffMono + 525.142895 + + + + Formula + C 28 H 43 N 5 O 7 P 1 S 3 + + + + MassAvg + 688.83 + + + + MassMono + 688.206223 + + + + Origin + Y + + + + Source + artifact + + + + TermSpec + none + + MOD:00639 + MOD:00919 + PSI-MOD + + + MOD:01310 + quaternary amine labeling reagent light form N6-L-lysine + + A protein modification that effectively replaces a lysine N6-hydrogen with a quaternary amine reagent light form group. + + 11857757 + PubMed + + + 60#K + UniMod + + + + GIST-Quat + PSI-MS-label + + + Quaternary amine labeling reagent light form (N-term & K) + UniMod-description + + + + DiffAvg + 59.07 + + + + DiffFormula + C 3 (1)H 9 N 1 + + + + DiffMono + 59.073499 + + + + Formula + C 9 (1)H 21 N 3 O 1 + + + + MassAvg + 187.17 + + + + MassMono + 187.168462 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00912 + MOD:01426 + PSI-MOD + + + MOD:01311 + quaternary amine labeling reagent heavy form (+3amu) N6-L-lysine + + A protein modification that effectively replaces a lysine N6-hydrogen with a quaternary amine reagent heavy (+3amu) form group. + + 11698400 + PubMed + + + 11857757 + PubMed + + + 11914093 + PubMed + + + 61#K + UniMod + + + + GIST-Quat:2H(3) + PSI-MS-label + + + Quaternary amine labeling reagent heavy (+3amu) form, N-term & K + UniMod-description + + + + DiffAvg + 62.09 + + + + DiffFormula + C 3 (1)H 6 (2)H 3 N 1 + + + + DiffMono + 62.092330 + + + + Formula + C 9 (1)H 18 (2)H 3 N 3 O 1 + + + + MassAvg + 190.19 + + + + MassMono + 190.187293 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00912 + MOD:01426 + PSI-MOD + + + MOD:01312 + quaternary amine labeling reagent heavy form (+6amu) N6-L-lysine + + A protein modification that effectively replaces a lysine N6-hydrogen with a quaternary amine reagent heavy (+6amu) form group. + + 11857757 + PubMed + + + 62#K + UniMod + + + Apparently incorrect parent [JSG]. + + GIST-Quat:2H(6) + PSI-MS-label + + + Quaternary amine labeling reagent heavy form (+6amu), N-term & K + UniMod-description + + + + DiffAvg + 65.11 + + + + DiffFormula + C 3 (1)H 3 (2)H 6 N 1 + + + + DiffMono + 65.111160 + + + + Formula + C 9 (1)H 15 (2)H 6 N 3 O 1 + + + + MassAvg + 193.21 + + + + MassMono + 193.206123 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00912 + MOD:01426 + PSI-MOD + + + MOD:01313 + quaternary amine labeling reagent heavy form (+9amu) N6-L-lysine + + A protein modification that effectively replaces a lysine N6-hydrogen with a quaternary amine reagent heavy (+9amu) form group. + + 11857757 + PubMed + + + 63#K + UniMod + + + + GIST-Quat:2H(9) + PSI-MS-label + + + Quaternary amine labeling reagent heavy form (+9amu), N-term & K + UniMod-description + + + + DiffAvg + 68.13 + + + + DiffFormula + C 3 (2)H 9 N 1 + + + + DiffMono + 68.129990 + + + + Formula + C 9 (1)H 12 (2)H 9 N 3 O 1 + + + + MassAvg + 196.22 + + + + MassMono + 196.224953 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00912 + MOD:01426 + PSI-MOD + + + MOD:01314 + 4x(1)H,4x(12)C-labeled N6-succinyl-L-lysine + + A protein modification that effectively converts an L-lysine residue to 4x(1)H,4x(12)C-labeled N6-succinyl-L-lysine. + + 11857757 + PubMed + + + 12175151 + PubMed + + + 12716131 + PubMed + + + 64#K + UniMod + + + + Succinic anhydride labeling reagent light form (K) + UniMod-description + + + Succinyl + PSI-MS-label + + + + DiffAvg + 100.02 + + + + DiffFormula + (12)C 4 (1)H 4 O 3 + + + + DiffMono + 100.016044 + + + + Formula + (12)C 10 H 16 N 2 O 4 + + + + MassAvg + 228.11 + + + + MassMono + 228.111007 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:01426 + MOD:01819 + PSI-MOD + + + MOD:01315 + 4x(2)H labeled N6-succinyl-L-lysine + + A protein modification that effectively converts an L-lysine residue to 4x(2)H-labeled N6-succinyl-L-lysine. + + 11344537 + PubMed + + + 11857757 + PubMed + + + 12175151 + PubMed + + + 15189151 + PubMed + + + 65#K + UniMod + + + + Succinic anhydride labeling reagent, heavy form (+4amu, 4H2), N-term & K + UniMod-description + + + Succinyl:2H(4) + PSI-MS-label + + + + DiffAvg + 104.04 + + + + DiffFormula + C 4 (2)H 4 O 3 + + + + DiffMono + 104.041151 + + + + Formula + C 10 (1)H 12 (2)H 4 N 2 O 4 + + + + MassAvg + 232.14 + + + + MassMono + 232.136114 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:01819 + PSI-MOD + + + MOD:01316 + 4x(13)C labeled N6-succinyl-L-lysine + + A protein modification that effectively converts an L-lysine residue to 4x(13)C labeled N6-succinyl-L-lysine. + + 11344537 + PubMed + + + 11857757 + PubMed + + + 12175151 + PubMed + + + 15189151 + PubMed + + + 66#K + UniMod + + + + Succinic anhydride labeling reagent, heavy form (+4amu, 4C13), K + UniMod-description + + + Succinyl:13C(4) + PSI-MS-label + + + + DiffAvg + 104.03 + + + + DiffFormula + (13)C 4 H 4 O 3 + + + + DiffMono + 104.029463 + + + + Formula + (12)C 6 (13)C 4 H 16 N 2 O 4 + + + + MassAvg + 232.12 + + + + MassMono + 232.124426 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:01819 + PSI-MOD + + + MOD:01317 + phosphorylation to amine thiol - site T + + modification from UniMod Chemical derivative - + + 12216740 + PubMed + + + 178#T + UniMod + + + + DAET + PSI-MS-label + + + phosphorylation to amine thiol + UniMod-description + + + + DiffAvg + 87.18 + + + + DiffFormula + C 4 H 9 N 1 O -1 S 1 + + + + DiffMono + 87.050656 + + + + Formula + C 8 H 16 N 2 O 1 S 1 + + + + MassAvg + 188.29 + + + + MassMono + 188.098334 + + + + Origin + T + + + + Source + artifact + + + + TermSpec + none + + MOD:00535 + MOD:00917 + PSI-MOD + + + MOD:01318 + phosphorylation to amine thiol - site S + + modification from UniMod Chemical derivative - + + 11510821 + PubMed + + + 12216740 + PubMed + + + 12422359 + PubMed + + + 178#S + UniMod + + + + DAET + PSI-MS-label + + + phosphorylation to amine thiol + UniMod-description + + + + DiffAvg + 87.18 + + + + DiffFormula + C 4 H 9 N 1 O -1 S 1 + + + + DiffMono + 87.050656 + + + + Formula + C 7 H 14 N 2 O 1 S 1 + + + + MassAvg + 174.26 + + + + MassMono + 174.082684 + + + + Origin + S + + + + Source + artifact + + + + TermSpec + none + + MOD:00535 + MOD:00916 + PSI-MOD + + + MOD:01319 + Michael addition of BHT quinone methide to histidine + + modification from UniMod Other + + 11510821 + PubMed + + + 12422359 + PubMed + + + 9448752 + PubMed + + + 176#H + UniMod + + + Secondary adduct, much less common than cysteine. [UniMod] + + BHT + PSI-MS-label + + + Michael addition of BHT quinone methide to Cysteine and Lysine + UniMod-description + + + + DiffAvg + 218.34 + + + + DiffFormula + C 15 H 22 O 1 + + + + DiffMono + 218.167065 + + + + Formula + C 21 H 29 N 3 O 2 + + + + MassAvg + 355.48 + + + + MassMono + 355.225977 + + + + Origin + H + + + + Source + artifact + + + + TermSpec + none + + MOD:00534 + MOD:00909 + PSI-MOD + + + MOD:01320 + Michael addition of BHT quinone methide to lysine + + modification from UniMod Other + + 16078144 + PubMed + + + 9448752 + PubMed + + + 176#K + UniMod + + + Secondary adduct, much less common than cysteine. [UniMod] + + BHT + PSI-MS-label + + + Michael addition of BHT quinone methide to Cysteine and Lysine + UniMod-description + + + + DiffAvg + 218.34 + + + + DiffFormula + C 15 H 22 O 1 + + + + DiffMono + 218.167065 + + + + Formula + C 21 H 34 N 2 O 2 + + + + MassAvg + 346.51 + + + + MassMono + 346.262028 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00534 + MOD:00912 + PSI-MOD + + + MOD:01321 + Michael addition of BHT quinone methide to cysteine + + modification from UniMod Other + + 11510821 + PubMed + + + 12422359 + PubMed + + + 9448752 + PubMed + + + 176#C + UniMod + + + Primary adduct formed. [UniMod] + + BHT + PSI-MS-label + + + Michael addition of BHT quinone methide to Cysteine and Lysine + UniMod-description + + + + DiffAvg + 218.34 + + + + DiffFormula + C 15 H 22 O 1 + + + + DiffMono + 218.167065 + + + + Formula + C 18 H 27 N 1 O 2 S 1 + + + + MassAvg + 321.48 + + + + MassMono + 321.176250 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:00534 + MOD:00905 + PSI-MOD + + + MOD:01322 + propionaldehyde +40 - site K + + modification from UniMod Other - + + 15549660 + PubMed + + + 256#K + UniMod + + + + Delta:H(4)C(3) + PSI-MS-label + + + Propionaldehyde +40 + UniMod-description + + + + DiffAvg + 40.06 + + + + DiffFormula + C 3 H 4 + + + + DiffMono + 40.031300 + + + + Formula + C 9 H 16 N 2 O 1 + + + + MassAvg + 168.24 + + + + MassMono + 168.126263 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00579 + MOD:00912 + PSI-MOD + + + MOD:01323 + propionaldehyde +40 - site H + + modification from UniMod Other - + + 256#H + UniMod + + + + Delta:H(4)C(3) + PSI-MS-label + + + Propionaldehyde +40 + UniMod-description + + + + DiffAvg + 40.06 + + + + DiffFormula + C 3 H 4 + + + + DiffMono + 40.031300 + + + + Formula + C 9 H 11 N 3 O 1 + + + + MassAvg + 177.21 + + + + MassMono + 177.090212 + + + + Origin + H + + + + Source + artifact + + + + TermSpec + none + + MOD:00579 + MOD:00909 + PSI-MOD + + + MOD:01324 + acetaldehyde +26 - site H + + modification from UniMod Other - + + 7744761 + PubMed + + + 254#H + UniMod + + + + Acetaldehyde +26 + UniMod-description + + + Delta:H(2)C(2) + PSI-MS-label + + + + DiffAvg + 26.04 + + + + DiffFormula + C 2 H 2 + + + + DiffMono + 26.015650 + + + + Formula + C 8 H 9 N 3 O 1 + + + + MassAvg + 163.18 + + + + MassMono + 163.074562 + + + + Origin + H + + + + Source + artifact + + + + TermSpec + none + + MOD:00577 + MOD:00909 + PSI-MOD + + + MOD:01325 + acetaldehyde +26 - site K + + modification from UniMod Other - + + 7744761 + PubMed + + + 254#K + UniMod + + + + Acetaldehyde +26 + UniMod-description + + + Delta:H(2)C(2) + PSI-MS-label + + + + DiffAvg + 26.04 + + + + DiffFormula + C 2 H 2 + + + + DiffMono + 26.015650 + + + + Formula + C 8 H 14 N 2 O 1 + + + + MassAvg + 154.21 + + + + MassMono + 154.110613 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00577 + MOD:00912 + PSI-MOD + + + MOD:01326 + 9x(13)C labeled L-tyrosine + + A protein modification that effectively converts an L-tyrosine residue to 9x(13)C labeled L-tyrosine. + + 11510821 + PubMed + + + 12422359 + PubMed + + + 12716131 + PubMed + + + 184#Y + UniMod + + + + 13C(9) Silac label + UniMod-description + + + Label:13C(9) + PSI-MS-label + + + + DiffAvg + 9.03 + + + + DiffFormula + (12)C -9 (13)C 9 + + + + DiffMono + 9.030194 + + + + Formula + (13)C 9 H 9 N 1 O 2 + + + + MassAvg + 172.09 + + + + MassMono + 172.093522 + + + + Origin + Y + + + + Source + artifact + + + + TermSpec + none + + MOD:00540 + MOD:00919 + PSI-MOD + + + MOD:01327 + 9x(13)C labeled L-phenylalanine + + A protein modification that effectively converts an L-phenylalanine residue to 9x(13)C labeled L-phenylalanine. + + 12716131 + PubMed + + + 184#F + UniMod + + + + 13C(9) Silac label + UniMod-description + + + Label:13C(9) + PSI-MS-label + + + + DiffAvg + 9.03 + + + + DiffFormula + (12)C -9 (13)C 9 + + + + DiffMono + 9.030194 + + + + Formula + (13)C 9 H 9 N 1 O 1 + + + + MassAvg + 156.10 + + + + MassMono + 156.098607 + + + + Origin + F + + + + Source + artifact + + + + TermSpec + none + + MOD:00540 + MOD:00914 + PSI-MOD + + + MOD:01328 + iodoacetic acid - site W + + modification from UniMod Chemical derivative - hydroxylethanone + + 17525468 + PubMed + + + 6#W + UniMod + + + There is no citation for this UniMod entry. Iodoacetic acid derivatization of tryptophan is not mentioned in the citation [JSG]. + + Carboxymethyl + PSI-MS-label + + + Iodoacetic acid derivative + UniMod-description + + + + DiffAvg + 58.04 + + + + DiffFormula + C 2 H 2 O 2 + + + + DiffMono + 58.005479 + + + + Formula + C 13 H 12 N 2 O 3 + + + + MassAvg + 244.25 + + + + MassMono + 244.084792 + + + + Origin + W + + + + Source + artifact + + + + TermSpec + none + + MOD:00399 + MOD:00918 + PSI-MOD + + + MOD:01329 + iodoacetic acid - site C + + OBSOLETE because duplicate and redundant with MOD:01061. Remap to MOD:01061 + + 197 + DeltaMass + + + Modification from UniMod Chemical derivative, UniMod:6 site C + + Carboxymethyl + PSI-MS-label + + + Iodoacetic acid derivative + UniMod-description + + + + DiffAvg + 58.04 + + + + DiffFormula + C 2 H 2 O 2 + + + + DiffMono + 58.005479 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + 1 + PSI-MOD + + + MOD:01330 + iodoacetic acid -site K + + OBSOLETE because identical with MOD:01094. Remap to MOD:01094 + + 18688235 + PubMed + + + a modification from UniMod:6 + + Carboxymethyl + PSI-MS-label + + + Iodoacetic acid derivative + UniMod-description + + + + DiffAvg + 58.04 + + + + DiffFormula + C 2 H 2 O 2 + + + + DiffMono + 58.005479 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + 1 + PSI-MOD + + + MOD:01331 + 6x(13)C labeled L-arginine + + A protein modification that effectively converts an L-arginine residue to 6x(13)C labeled L-arginine. + + 12716131 + PubMed + + + 188#R + UniMod + + + PSI-MOD-slim + + 13C(6) Silac label + UniMod-description + + + arg-13c6 + OMSSA-label + + + Label:13C(6) + PSI-MS-label + + + + DiffAvg + 6.02 + + + + DiffFormula + (12)C -6 (13)C 6 + + + + DiffMono + 6.020129 + + + + Formula + (13)C 6 H 12 N 4 O 1 + + + + MassAvg + 162.12 + + + + MassMono + 162.121240 + + + + Origin + R + + + + Source + artifact + + + + TermSpec + none + + MOD:00544 + PSI-MOD + + + MOD:01332 + 6x(13)C labeled L-leucine + + A protein modification that effectively converts an L-leucine residue to 6x(13)C labeled L-leucine. + + 12716131 + PubMed + + + 188#L + UniMod + + + PSI-MOD-slim + + 13C(6) Silac label + UniMod-description + + + Label:13C(6) + PSI-MS-label + + + + DiffAvg + 6.02 + + + + DiffFormula + (12)C -6 (13)C 6 + + + + DiffMono + 6.020129 + + + + Formula + (13)C 6 H 11 N 1 O 1 + + + + MassAvg + 119.10 + + + + MassMono + 119.104193 + + + + Origin + L + + + + Source + artifact + + + + TermSpec + none + + MOD:00544 + PSI-MOD + + + MOD:01333 + 6x(13)C labeled L-isoleucine + + A protein modification that effectively converts an L-isoleucine residue to 6x(13)C labeled L-isoleucine. + + 12716131 + PubMed + + + 12766232 + PubMed + + + 188#I + UniMod + + + PSI-MOD-slim + + 13C(6) Silac label + UniMod-description + + + Label:13C(6) + PSI-MS-label + + + + DiffAvg + 6.02 + + + + DiffFormula + (12)C -6 (13)C 6 + + + + DiffMono + 6.020129 + + + + Formula + (13)C 6 H 11 N 1 O 1 + + + + MassAvg + 119.10 + + + + MassMono + 119.104193 + + + + Origin + I + + + + Source + artifact + + + + TermSpec + none + + MOD:00544 + PSI-MOD + + + MOD:01334 + 6x(13)C labeled L-lysine + + A protein modification that effectively converts an L-lysine residue to 6x(13)C labeled L-lysine. + + 11857757 + PubMed + + + 11999733 + PubMed + + + 12175151 + PubMed + + + 12716131 + PubMed + + + 188#K + UniMod + + + PSI-MOD-slim + + 13C(6) Silac label + UniMod-description + + + Label:13C(6) + PSI-MS-label + + + lys-13c6 + OMSSA-label + + + + DiffAvg + 6.02 + + + + DiffFormula + (12)C -6 (13)C 6 + + + + DiffMono + 6.020129 + + + + Formula + (13)C 6 H 12 N 2 O 1 + + + + MassAvg + 134.12 + + + + MassMono + 134.115092 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00544 + PSI-MOD + + + MOD:01335 + 6x(13)C labeled 4-sulfophenyl isothiocyanate derivatized lysine + + modification from UniMod Chemical derivative - + + 11467524 + PubMed + + + 16526082 + PubMed + + + 464#K + UniMod + + + + 4-sulfophenyl isothiocyanate (Heavy C13) + UniMod-description + + + SPITC:13C(6) + PSI-MS-label + + + + DiffAvg + 220.99 + + + + DiffFormula + (12)C 1 (13)C 6 H 5 N 1 O 3 S 2 + + + + DiffMono + 220.991214 + + + + Formula + (12)C 7 (13)C 6 H 17 N 3 O 4 S 2 + + + + MassAvg + 349.09 + + + + MassMono + 349.086177 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00880 + MOD:00912 + PSI-MOD + + + MOD:01336 + deamidation followed by a methylation -site Q + + OBSOLETE - identical and redundant with MOD:00657. Remap to MOD:00657. + + 18688235 + PubMed + + + Modification from UniMod Post-translational - UniMod:528. + + Deamidation followed by a methylation + UniMod-description + + + Methyl+Deamidated + PSI-MS-label + + + + DiffAvg + 15.01 + + + + DiffFormula + C 1 H 1 N -1 O 1 + + + + DiffMono + 14.999666 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + Q + + + + Source + natural + + + + TermSpec + none + + 1 + PSI-MOD + + + MOD:01337 + deamidated 4-methyl esterified asparagine + + A protein modification that effectively converts an L-asparagine residue to L-aspartate 4-methyl ester. + + 528#N + UniMod + + + The deamidation and methylation of L-asparagine has not been reported as a natural modification. It is extremely unlikely that eukaryotes produce this modification, because a natural process that would form L-aspartic acid 4-methyl ester from either L-aspartic acid or L-asparagine would interfere with the D-aspartyl peptide repair mechanism [JSG]. + + Deamidation followed by a methylation + UniMod-description + + + Methyl+Deamidated + PSI-MS-label + + + + DiffAvg + 15.01 + + + + DiffFormula + C 1 H 1 N -1 O 1 + + + + DiffMono + 14.999666 + + + + Formula + C 5 H 7 N 1 O 3 + + + + MassAvg + 129.12 + + + + MassMono + 129.042593 + + + + Origin + N + + + + Source + artifact + + + + TermSpec + none + + MOD:01181 + MOD:01369 + PSI-MOD + + + MOD:01338 + N6-ethyl-L-lysine + + A protein modification that effectively converts an L-lysine residue to N6-ethyl-L-lysine. + + 9629898 + PubMed + + + 280#K + UniMod + + + The UniMod citation refers to the formation of glutamate ethyl ester and not to either lysine or N-terminal alkylation [JSG]. + + Ethyl + PSI-MS-label + + + Ethylation + UniMod-description + + + + DiffAvg + 28.05 + + + + DiffFormula + C 2 H 4 + + + + DiffMono + 28.031300 + + + + Formula + C 8 H 16 N 2 O 1 + + + + MassAvg + 156.23 + + + + MassMono + 156.126263 + + + + Origin + K + + + + Source + hypothetical + + + + TermSpec + none + + MOD:00912 + MOD:01339 + PSI-MOD + + + MOD:01339 + ethylated residue + + A protein modification that effectively replaces a hydrogen atom with an ethyl group. + + 9629898 + PubMed + + + 280 + UniMod + + + From DeltaMass: Average Mass: 28 with no citation. The UniMod citation refers to the formation of glutamate ethyl ester and not to either lysine or N-terminal alkylation [JSG]. + + Ethyl + PSI-MS-label + + + Ethylation + UniMod-description + + + EtRes + PSI-MOD-label + + + + DiffAvg + 28.05 + + + + DiffFormula + C 2 H 4 + + + + DiffMono + 28.031300 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00001 + PSI-MOD + + + MOD:01340 + ESP-Tag heavy d10 - site K + + modification from UniMod Isotopic label - + + 11078590 + PubMed + + + 11085420 + PubMed + + + 11821862 + PubMed + + + 91#K + UniMod + + + + ESP-Tag heavy d10 + UniMod-description + + + ESP:2H(10) + PSI-MS-label + + + + DiffAvg + 348.24 + + + + DiffFormula + C 16 (1)H 16 (2)H 10 N 4 O 2 S 1 + + + + DiffMono + 348.240415 + + + + Formula + C 22 (1)H 28 (2)H 10 N 6 O 3 S 1 + + + + MassAvg + 476.34 + + + + MassMono + 476.335378 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00469 + MOD:00912 + PSI-MOD + + + MOD:01341 + ESP-Tag light d0 - site K + + modification from UniMod Isotopic label - + + 90#K + UniMod + + + + ESP + PSI-MS-label + + + ESP-Tag light d0 + UniMod-description + + + + DiffAvg + 338.47 + + + + DiffFormula + C 16 H 26 N 4 O 2 S 1 + + + + DiffMono + 338.177647 + + + + Formula + C 22 H 38 N 6 O 3 S 1 + + + + MassAvg + 466.64 + + + + MassMono + 466.272610 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00468 + MOD:00912 + PSI-MOD + + + MOD:01342 + selenium substitution for sulfur - site M + + OBSOLETE because redundant and identical to MOD:00530. Remap to MOD:00530. + + 12148805 + PubMed + + + 162 + UniMod + + + + Delta:S(-1)Se(1) + PSI-MS-label + + + Selenium replaces sulphur + UniMod-description + + + + DiffAvg + 46.91 + + + + DiffFormula + S -1 Se 1 + + + + DiffMono + 47.944450 + + + + Formula + C 5 H 9 N 1 O 1 S 0 Se 1 + + + + MassAvg + 178.10 + + + + MassMono + 178.984935 + + + + Origin + M + + + + Source + artifact + + + + TermSpec + none + + 1 + PSI-MOD + + + MOD:01343 + selenium substitution for sulfur - site C + + OBSOLETE because redundant and identical to MOD:00686. Remap to MOD:00686. + + 12148805 + PubMed + + + 162 + UniMod + + + + Delta:S(-1)Se(1) + PSI-MS-label + + + Selenium replaces sulphur + UniMod-description + + + + DiffAvg + 46.91 + + + + DiffFormula + S -1 Se 1 + + + + DiffMono + 47.944450 + + + + Formula + C 3 H 5 N 1 O 1 S 0 Se 1 + + + + MassAvg + 150.05 + + + + MassMono + 150.953635 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + 1 + PSI-MOD + + + MOD:01344 + dehydrogenated residue - site S + + OBSOLETE because redundant and identical with MOD:00835. Remap to MOD:00835. + + 9252331 + PubMed + + + 9276974 + PubMed + + + 401 + UniMod + + + + 2-amino-3-oxo-butanoic_acid + UniMod-description + + + Didehydro + PSI-MS-label + + + + DiffAvg + -2.02 + + + + DiffFormula + H -2 + + + + DiffMono + -2.015650 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + S + + + + Source + natural + + + + TermSpec + none + + 1 + PSI-MOD + + + MOD:01345 + 2-amino-3-oxobutanoic acid + + A protein modification that effectively converts an L-threonine residue to 2-amino-3-oxobutanoic acid. + + 12716131 + PubMed + + + 9252331 + PubMed + + + 401#T + UniMod + + + There is no citation for this modification in the UniMod entry. Although mentioned in PubMed:9252331, there is no citation for it there [JSG]. + + 2-amino-3-ketobutyric acid + PSI-MOD-alternate + + + 2-amino-3-oxo-butanoic_acid + UniMod-description + + + 3-ketobutyrine + PSI-MOD-alternate + + + Didehydro + PSI-MS-label + + + twoamino3oxobutanoicacid + OMSSA-label + + + + DiffAvg + -2.02 + + + + DiffFormula + H -2 + + + + DiffMono + -2.015650 + + + + Formula + C 4 H 5 N 1 O 2 + + + + MassAvg + 99.09 + + + + MassMono + 99.032028 + + + + Origin + T + + + + Source + artifact + + + + TermSpec + none + + MOD:00917 + MOD:01888 + PSI-MOD + + + MOD:01346 + N4-hexosylated asparagine + + A protein modification that effectively converts an L-asparagine residue to an N4-hexosyl-L-asparagine. + + 11112526 + PubMed + + + 11567090 + PubMed + + + 15279557 + PubMed + + + 6540775 + PubMed + + + 41#N + UniMod + + + + Hex + PSI-MS-label + + + Hexose + UniMod-description + + + + DiffAvg + 162.14 + + + + DiffFormula + C 6 H 10 O 5 + + + + DiffMono + 162.052823 + + + + Formula + C 10 H 16 N 2 O 7 + + + + MassAvg + 276.25 + + + + MassMono + 276.095751 + + + + Origin + N + + + + Source + natural + + + + TermSpec + none + + MOD:00160 + MOD:00434 + PSI-MOD + + + MOD:01347 + hexose glycated L-lysine + + A modification produced in a non-enzymatic reaction between a carbohydrate carbonyl group (C1 of aldohexose or C2 of fructose) and an L-lysine residue to form a Schiff-base or an Amadori ketosamine lysine adduct. + + 0 + DeltaMass + + + 15279557 + PubMed + + + 41#K + UniMod + + + + Hex + PSI-MS-label + + + Hexose + UniMod-description + + + + DiffAvg + 162.14 + + + + DiffFormula + C 6 H 10 O 5 + + + + DiffMono + 162.052823 + + + + Formula + C 12 H 22 N 2 O 6 + + + + MassAvg + 290.32 + + + + MassMono + 290.147786 + + + + Origin + K + + + + Source + natural + + + + TermSpec + none + + MOD:00767 + MOD:00912 + PSI-MOD + + + MOD:01348 + O-hexosylated threonine + + A protein modification that effectively converts an L-threonine residue to an O-hexosyl-L-threonine. + + 15279557 + PubMed + + + 8597590 + PubMed + + + 41#T + UniMod + + + + Hex + PSI-MS-label + + + Hexose + UniMod-description + + + + DiffAvg + 162.14 + + + + DiffFormula + C 6 H 10 O 5 + + + + DiffMono + 162.052823 + + + + Formula + C 10 H 17 N 1 O 7 + + + + MassAvg + 263.25 + + + + MassMono + 263.100502 + + + + Origin + T + + + + Source + natural + + + + TermSpec + none + + MOD:00005 + MOD:00434 + PSI-MOD + + + MOD:01349 + hydrolyzed N-ethylmaleimide cysteine adduct + + modification from UniMod Chemical derivative - + + 320#C + UniMod + + + Hydolyzed N-ethylmaeimide adduct, a mixture of isobaric 2- and 3-(S-cysteinyl)-4-(ethylamino)-4-oxobutanoic acid [JSG]. + + Nethylmaleimide+water + PSI-MS-label + + + Nethylmaleimidehydrolysis + UniMod-description + + + + DiffAvg + 143.14 + + + + DiffFormula + C 6 H 9 N 1 O 3 + + + + DiffMono + 143.058243 + + + + Formula + C 9 H 14 N 2 O 4 S 1 + + + + MassAvg + 246.28 + + + + MassMono + 246.067428 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:00631 + MOD:00905 + PSI-MOD + + + MOD:01350 + hydrolyzed N-ethylmaleimide lysine adduct + + modification from UniMod Chemical derivative - + + 320#K + UniMod + + + Hydolyzed N-ethylmaeimide adduct, a mixture of isobaric 2- and 3-(N6-lysyl)-4-(ethylamino)-4-oxobutanoic acid [JSG]. + + Nethylmaleimide+water + PSI-MS-label + + + Nethylmaleimidehydrolysis + UniMod-description + + + + DiffAvg + 143.14 + + + + DiffFormula + C 6 H 9 N 1 O 3 + + + + DiffMono + 143.058243 + + + + Formula + C 12 H 21 N 3 O 4 + + + + MassAvg + 271.32 + + + + MassMono + 271.153206 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00631 + PSI-MOD + + + MOD:01351 + nitrated L-tryptophan + + A protein modification that effectively converts an L-tryptophan residue to a nitrated L-tryptophan. + + 8839040 + PubMed + + + 9252331 + PubMed + + + 354#W + UniMod + + + One or more isobaric isomers are produced by nitration with peroxynitrite reagent [JSG]. + + Nitro + PSI-MS-label + + + nitrow + OMSSA-label + + + Oxidation to nitro + UniMod-description + + + + DiffAvg + 45.00 + + + + DiffFormula + H -1 N 1 O 2 + + + + DiffMono + 44.985078 + + + + Formula + C 11 H 9 N 3 O 3 + + + + MassAvg + 231.21 + + + + MassMono + 231.064391 + + + + Origin + W + + + + Source + artifact + + + + TermSpec + none + + MOD:00461 + MOD:00918 + PSI-MOD + + + MOD:01352 + nitrated L-tyrosine + + A protein modification that effectively converts an L-tyrosine residue to a nitrated L-tyrosine. + + 14678012 + PubMed + + + 8839040 + PubMed + + + 9252331 + PubMed + + + 354#Y + UniMod + + + One or more isobaric isomers are produced by nitration with peroxynitrite reagent [JSG]. + PSI-MOD-slim + + Nitro + PSI-MS-label + + + nitroy + OMSSA-label + + + Oxidation to nitro + UniMod-description + + + + DiffAvg + 45.00 + + + + DiffFormula + H -1 N 1 O 2 + + + + DiffMono + 44.985078 + + + + Formula + C 9 H 8 N 2 O 4 + + + + MassAvg + 208.17 + + + + MassMono + 208.048407 + + + + Origin + Y + + + + Source + artifact + + + + TermSpec + none + + MOD:00461 + MOD:00919 + PSI-MOD + + + MOD:01353 + amidination of lysines or N-terminal amines with methyl acetimidate - site K + + modification from UniMod Chemical derivative - + + 12643539 + PubMed + + + 15602776 + PubMed + + + 6273432 + PubMed + + + 141#K + UniMod + + + + amidination of lysines or N-terminal amines with methyl acetimidate + UniMod-description + + + Amidine + PSI-MS-label + + + + DiffAvg + 41.05 + + + + DiffFormula + C 2 H 3 N 1 + + + + DiffMono + 41.026549 + + + + Formula + C 8 H 15 N 3 O 1 + + + + MassAvg + 169.23 + + + + MassMono + 169.121512 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00509 + MOD:00912 + PSI-MOD + + + MOD:01354 + Hex1HexNAc1NeuAc1 N4-glycosylated asparagine + + A protein modification that effectively replaces an N4 hydrogen atom of an asparagine residue with a carbohydrate-like group composed of Hex1HexNAc1NeuAc1 linked through a glycosidic bond. + + 11698400 + PubMed + + + 149#N + UniMod + + + + Hex(1)HexNAc(1)NeuAc(1) + PSI-MS-label + + + Hex1HexNAc1NeuAc1 + UniMod-description + + + + DiffAvg + 657.60 + + + + DiffFormula + C 25 H 41 N 2 O 18 + + + + DiffMono + 657.235437 + + + + Formula + C 29 H 47 N 4 O 20 + + + + MassAvg + 771.70 + + + + MassMono + 771.278365 + + + + Origin + N + + + + Source + natural + + + + TermSpec + none + + MOD:00517 + MOD:00903 + PSI-MOD + + + MOD:01355 + Hex1HexNAc1NeuAc1O-glycosylated threonine + + A protein modification that effectively replaces an O3 hydrogen atom of a threonine residue with a carbohydrate-like group composed of Hex1HexNAc1NeuAc1 linked through a glycosidic bond. + + 149#T + UniMod + + + + Hex(1)HexNAc(1)NeuAc(1) + PSI-MS-label + + + Hex1HexNAc1NeuAc1 + UniMod-description + + + + DiffAvg + 657.60 + + + + DiffFormula + C 25 H 41 N 2 O 18 + + + + DiffMono + 657.235437 + + + + Formula + C 29 H 48 N 3 O 20 + + + + MassAvg + 758.70 + + + + MassMono + 758.283116 + + + + Origin + T + + + + Source + natural + + + + TermSpec + none + + MOD:00517 + MOD:00917 + PSI-MOD + + + MOD:01356 + Hex1HexNAc1NeuAc1 O-glycosylated serine + + A protein modification that effectively replaces an O3 hydrogen atom of a serine residue with a carbohydrate-like group composed of Hex1HexNAc1NeuAc1 linked through a glycosidic bond. + + 7856876 + PubMed + + + 149#S + UniMod + + + + Hex(1)HexNAc(1)NeuAc(1) + PSI-MS-label + + + Hex1HexNAc1NeuAc1 + UniMod-description + + + + DiffAvg + 657.60 + + + + DiffFormula + C 25 H 41 N 2 O 18 + + + + DiffMono + 657.235437 + + + + Formula + C 28 H 46 N 3 O 20 + + + + MassAvg + 744.68 + + + + MassMono + 744.267466 + + + + Origin + S + + + + Source + natural + + + + TermSpec + none + + MOD:00517 + MOD:00916 + PSI-MOD + + + MOD:01357 + 2x(13)C,4x(2)H labeled dimethylated L-lysine + + A protein modification that effectively replaces two hydrogen atoms of an L-lysine residue containing common isotopes with two (13)C,3x(2)H labeled methyl groups to form a 2x(13)C,6x(2)H labeled dimethylated L-lysine. + + 12686488 + PubMed + + + 16335955 + PubMed + + + 510#K + UniMod + + + + DiMethyl-C13HD2 + UniMod-description + + + Dimethyl:2H(4)13C(2) + PSI-MS-label + + + + DiffAvg + 34.06 + + + + DiffFormula + (13)C 2 (2)H 4 + + + + DiffMono + 34.063117 + + + + Formula + (12)C 6 (13)C 2 (1)H 12 (2)H 4 N 2 O 1 + + + + MassAvg + 162.16 + + + + MassMono + 162.158080 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00912 + MOD:00927 + + derives_from + MOD:000840 + + PSI-MOD + + + MOD:01358 + Bruker Daltonics SERVA-ICPL(TM) quantification chemistry, medium form - site N-term + + modification from UniMod Isotopic label - Use when labelling post-digest + + 15602776 + PubMed + + + 687#N-term + UniMod + + + + Bruker Daltonics SERVA-ICPL(TM) quantification chemistry, medium form + UniMod-description + + + ICPL:2H(4) + PSI-MS-label + + + + DiffAvg + 109.05 + + + + DiffFormula + C 6 (1)H -1 (2)H 4 N 1 O 1 + + + + DiffMono + 109.046571 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + N-term + + MOD:01426 + PSI-MOD + + + MOD:01359 + Bruker Daltonics SERVA-ICPL(TM) quantification chemistry, medium form - site K + + modification from UniMod Isotopic label - Use when labelling post-digest + + 15602776 + PubMed + + + 687#K + UniMod + + + + Bruker Daltonics SERVA-ICPL(TM) quantification chemistry, medium form + UniMod-description + + + ICPL:2H(4) + PSI-MS-label + + + + DiffAvg + 109.05 + + + + DiffFormula + C 6 (1)H -1 (2)H 4 N 1 O 1 + + + + DiffMono + 109.046571 + + + + Formula + C 12 (1)H 11 (2)H 4 N 3 O 2 + + + + MassAvg + 237.14 + + + + MassMono + 237.141534 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00912 + MOD:01426 + PSI-MOD + + + MOD:01360 + 4-sulfophenyl isothiocyanate N6-derivatized lysine + + A protein modification that effectively converts an L-lysine residue to the 4-sulfophenyl isothiocyanate adduct, N6-[(4-sulfophenyl)carbamothioyl]lysine. + + 14689565 + PubMed + + + 14745769 + PubMed + + + 15549660 + PubMed + + + 16526082 + PubMed + + + 261#K + UniMod + + + + 4-sulfophenyl isothiocyanate + UniMod-description + + + N6-[(4-sulfophenyl)carbamothioyl]lysine + PSI-MOD-alternate + + + SPITC + PSI-MS-label + + + + DiffAvg + 215.24 + + + + DiffFormula + C 7 H 5 N 1 O 3 S 2 + + + + DiffMono + 214.971085 + + + + Formula + C 13 H 17 N 3 O 4 S 2 + + + + MassAvg + 343.42 + + + + MassMono + 343.066048 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00584 + MOD:00912 + PSI-MOD + + + MOD:01361 + O-thiophospho-L-threonine + + A protein modification that effectively converts an L-threonine residue to O-thiophospho-L-threonine. + + 11507762 + PubMed + + + 12110917 + PubMed + + + 260#T + UniMod + + + + Thiophospho + PSI-MS-label + + + Thiophosphorylation + UniMod-description + + + + DiffAvg + 96.04 + + + + DiffFormula + H 1 O 2 P 1 S 1 + + + + DiffMono + 95.943487 + + + + Formula + C 4 H 8 N 1 O 4 P 1 S 1 + + + + MassAvg + 197.14 + + + + MassMono + 196.991165 + + + + Origin + T + + + + Source + artifact + + + + TermSpec + none + + MOD:00583 + MOD:00917 + PSI-MOD + + + MOD:01362 + O-thiophospho-L-serine + + A protein modification that effectively converts an L-serine residue to O-thiophospho-L-serine. + + 11507762 + PubMed + + + 12110917 + PubMed + + + 260#S + UniMod + + + + Thiophospho + PSI-MS-label + + + Thiophosphorylation + UniMod-description + + + + DiffAvg + 96.04 + + + + DiffFormula + H 1 O 2 P 1 S 1 + + + + DiffMono + 95.943487 + + + + Formula + C 3 H 6 N 1 O 4 P 1 S 1 + + + + MassAvg + 183.12 + + + + MassMono + 182.975515 + + + + Origin + S + + + + Source + artifact + + + + TermSpec + none + + MOD:00583 + MOD:00916 + PSI-MOD + + + MOD:01363 + O4'-thiophospho-L-tyrosine + + A protein modification that effectively converts an L-tyrosine residue to O4'-thiophospho-L-tyrosine. + + 12110917 + PubMed + + + 15549660 + PubMed + + + 260#Y + UniMod + + + + Thiophospho + PSI-MS-label + + + Thiophosphorylation + UniMod-description + + + + DiffAvg + 96.04 + + + + DiffFormula + H 1 O 2 P 1 S 1 + + + + DiffMono + 95.943487 + + + + Formula + C 9 H 10 N 1 O 4 P 1 S 1 + + + + MassAvg + 259.22 + + + + MassMono + 259.006815 + + + + Origin + Y + + + + Source + artifact + + + + TermSpec + none + + MOD:00583 + MOD:00919 + PSI-MOD + + + MOD:01364 + fluorescein-5-thiosemicarbazide - site S + + modification from UniMod Chemical derivative - + + 11467524 + PubMed + + + 478#S + UniMod + + + + fluorescein-5-thiosemicarbazide + UniMod-description + + + FTC + PSI-MS-label + + + + DiffAvg + 421.43 + + + + DiffFormula + C 21 H 15 N 3 O 5 S 1 + + + + DiffMono + 421.073242 + + + + Formula + C 24 H 20 N 4 O 7 S 1 + + + + MassAvg + 508.51 + + + + MassMono + 508.105270 + + + + Origin + S + + + + Source + artifact + + + + TermSpec + none + + MOD:00626 + MOD:00916 + PSI-MOD + + + MOD:01365 + fluorescein-5-thiosemicarbazide - site C + + modification from UniMod Chemical derivative - + + 478#C + UniMod + + + + fluorescein-5-thiosemicarbazide + UniMod-description + + + FTC + PSI-MS-label + + + + DiffAvg + 421.43 + + + + DiffFormula + C 21 H 15 N 3 O 5 S 1 + + + + DiffMono + 421.073242 + + + + Formula + C 24 H 20 N 4 O 6 S 2 + + + + MassAvg + 524.57 + + + + MassMono + 524.082426 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:00626 + MOD:00905 + PSI-MOD + + + MOD:01366 + fluorescein-5-thiosemicarbazide - site K + + modification from UniMod Chemical derivative - + + 478#K + UniMod + + + + fluorescein-5-thiosemicarbazide + UniMod-description + + + FTC + PSI-MS-label + + + + DiffAvg + 421.43 + + + + DiffFormula + C 21 H 15 N 3 O 5 S 1 + + + + DiffMono + 421.073242 + + + + Formula + C 27 H 27 N 5 O 6 S 1 + + + + MassAvg + 549.60 + + + + MassMono + 549.168205 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00626 + MOD:00912 + PSI-MOD + + + MOD:01367 + fluorescein-5-thiosemicarbazide - site P + + modification from UniMod Chemical derivative - + + 478#P + UniMod + + + + fluorescein-5-thiosemicarbazide + UniMod-description + + + FTC + PSI-MS-label + + + + DiffAvg + 421.43 + + + + DiffFormula + C 21 H 15 N 3 O 5 S 1 + + + + DiffMono + 421.073242 + + + + Formula + C 26 H 22 N 4 O 6 S 1 + + + + MassAvg + 518.54 + + + + MassMono + 518.126005 + + + + Origin + P + + + + Source + artifact + + + + TermSpec + none + + MOD:00626 + MOD:00915 + PSI-MOD + + + MOD:01368 + fluorescein-5-thiosemicarbazide - site R + + modification from UniMod Chemical derivative - + + 15525938 + PubMed + + + 478#R + UniMod + + + + fluorescein-5-thiosemicarbazide + UniMod-description + + + FTC + PSI-MS-label + + + + DiffAvg + 421.43 + + + + DiffFormula + C 21 H 15 N 3 O 5 S 1 + + + + DiffMono + 421.073242 + + + + Formula + C 27 H 27 N 7 O 6 S 1 + + + + MassAvg + 577.62 + + + + MassMono + 577.174353 + + + + Origin + R + + + + Source + artifact + + + + TermSpec + none + + MOD:00626 + MOD:00902 + PSI-MOD + + + MOD:01369 + deamidated and methyl esterified residue + + A protein modification that effectively replaces a carboxamido group with a carboxyl methyl ester group. + + 528 + UniMod + + + PSI-MOD-slim + + Deamidation followed by a methylation + UniMod-description + + + Methyl+Deamidated + PSI-MS-label + + + + DiffAvg + 15.01 + + + + DiffFormula + C 1 H 1 N -1 O 1 + + + + DiffMono + 14.999666 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + none + + + + TermSpec + none + + MOD:00393 + MOD:00400 + PSI-MOD + + + MOD:01370 + 6x(13)C,1x(15)N labeled residue + + A protein modification that effectively converts a residue containing common isotopes to a 6x(13)C,1x(15)N labeled residue. + + 11857757 + PubMed + + + 11999733 + PubMed + + + 12175151 + PubMed + + + 695 + UniMod + + + + 13C(6) 15N(1) Silac label + UniMod-description + + + Label:13C(6)15N(1) + PSI-MS-label + + + + DiffAvg + 7.02 + + + + DiffFormula + (12)C -6 (13)C 6 (14)N -1 (15)N 1 + + + + DiffMono + 7.017164 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00842 + MOD:00843 + PSI-MOD + + + MOD:01371 + deamidation in presence of O18 + + OBSOLETE bcecause identical and redundant with MOD:00851. Remap to MOD:00851. + + 8382902 + PubMed + + + + Deamidated:18O(1) + PSI-MS-label + + + Deamidation in presence of O18 + UniMod-description + + + + DiffAvg + 2.99 + + + + DiffFormula + H -1 N -1 (18)O 1 + + + + DiffMono + 2.988262 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + 1 + PSI-MOD + + + MOD:01372 + (2S)-4-hydroxyleucine + + A protein modification that effectively converts an L-leucine residue to a (2S)-4-hydroxyleucine. + + 363352 + PubMed + + + 9164839 + PubMed + + + AA0442 + RESID + + + + (2S)-2-amino-4-hydroxy-4-methylpentanoic acid + RESID-systematic + + + (2S)-4-hydroxyleucine + RESID-name + + + gamma-hydroxyleucine + RESID-alternate + + + + DiffAvg + 16.00 + + + + DiffFormula + C 0 H 0 N 0 O 1 + + + + DiffMono + 15.994915 + + + + Formula + C 6 H 11 N 1 O 2 + + + + MassAvg + 129.16 + + + + MassMono + 129.078979 + + + + Origin + L + + + + Source + natural + + + + TermSpec + none + + MOD:01411 + PSI-MOD + + + MOD:01373 + (2S,4R)-5-hydroxyleucine + + A protein modification that effectively converts an L-leucine residue to a (2S,4R)-5-hydroxyleucine. + + 16858410 + PubMed + + + 7690768 + PubMed + + + 9164839 + PubMed + + + AA0443 + RESID + + + + (2S,4R)-2-amino-5-hydroxy-4-methylpentanoic acid + RESID-systematic + + + (2S,4R)-5-hydroxyleucine + RESID-name + + + (4R)-5-hydroxyleucine + RESID-alternate + + + delta-hydroxyleucine + RESID-alternate + + + + DiffAvg + 16.00 + + + + DiffFormula + C 0 H 0 N 0 O 1 + + + + DiffMono + 15.994915 + + + + Formula + C 6 H 11 N 1 O 2 + + + + MassAvg + 129.16 + + + + MassMono + 129.078979 + + + + Origin + L + + + + Source + hypothetical + + + + TermSpec + none + + MOD:01411 + PSI-MOD + + + MOD:01374 + (2S,4R)-5-oxoleucine + + A modification that effectively oxygenates C5 of an L-leucine residue to form a (2S,4R)-5-oxoleucine. + + 43739 + ChEBI + + + 16858410 + PubMed + + + AA0444 + RESID + + + + (2S,4R)-2-amino-4-methyl-5-oxopentanoic acid + RESID-systematic + + + (2S,4R)-5-oxoleucine + RESID-name + + + (4R)-5-oxo-L-leucine + RESID-alternate + + + + DiffAvg + 13.98 + + + + DiffFormula + C 0 H -2 N 0 O 1 + + + + DiffMono + 13.979265 + + + + Formula + C 6 H 9 N 1 O 2 + + + + MassAvg + 127.14 + + + + MassMono + 127.063329 + + + + Origin + L + + + + Source + hypothetical + + + + TermSpec + none + + MOD:00679 + MOD:00911 + PSI-MOD + + + MOD:01375 + (2S,4R)-4,5-dihydroxyleucine + + A protein modification that effectively converts an L-leucine residue to a (2S,4R)-4,5-dihydroxyleucine. + + 6010785 + PubMed + + + 6893271 + PubMed + + + AA0445 + RESID + + + + (2S,4R)-2-amino-4,5-dihydroxy-4-methylpentanoic acid + RESID-systematic + + + (2S,4R)-4,5-dihydroxyleucine + RESID-name + + + (4R)-4,5-dihydroxyleucine + RESID-alternate + + + gamma,delta-dihydroxyleucine + RESID-alternate + + + MOD_RES (4R)-4,5-dihydroxyleucine + UniProt-feature + + + + DiffAvg + 32.00 + + + + DiffFormula + C 0 H 0 N 0 O 2 + + + + DiffMono + 31.989829 + + + + Formula + C 6 H 11 N 1 O 3 + + + + MassAvg + 145.16 + + + + MassMono + 145.073893 + + + + Origin + L + + + + Source + natural + + + + TermSpec + none + + MOD:01412 + PSI-MOD + + + MOD:01376 + (2S,3S,4R)-3,4-dihydroxyisoleucine + + A protein modification that effectively converts an L-isoleucine residue to a (2S,3S,4R)-3,4-dihydroxyisoleucine. + + 11320328 + PubMed + + + AA0447 + RESID + + + + (2S,3S,4R)-2-amino-3,4-dihydroxy-3-methylpentanoic acid + RESID-systematic + + + (2S,3S,4R)-3,4-dihydroxyisoleucine + RESID-name + + + (3S,4R)-3,4-dihydroxyisoleucine + RESID-alternate + + + beta,gamma-dihydroxyisoleucine + RESID-alternate + + + MOD_RES (3S,4R)-3,4-dihydroxyisoleucine + UniProt-feature + + + + DiffAvg + 32.00 + + + + DiffFormula + C 0 H 0 N 0 O 2 + + + + DiffMono + 31.989829 + + + + Formula + C 6 H 11 N 1 O 3 + + + + MassAvg + 145.16 + + + + MassMono + 145.073893 + + + + Origin + I + + + + Source + natural + + + + TermSpec + none + + MOD:01416 + PSI-MOD + + + MOD:01377 + (2S,3R,4S)-4-hydroxyisoleucine + + A protein modification that effectively converts an L-isoleucine residue to a (2S,3R,4S)-4-hydroxyisoleucine. + + 363352 + PubMed + + + AA0448 + RESID + + + + (2S,3R,4S)-2-amino-3-methyl-4-hydroxyvaleric acid + RESID-alternate + + + (2S,3R,4S)-2-amino-4-hydroxy-3-methylpentanoic acid + RESID-systematic + + + (2S,3R,4S)-4-hydroxyisoleucine + RESID-name + + + (3R,4S)-4-hydroxyisoleucine + RESID-alternate + + + gamma-hydroxyisoleucine + RESID-alternate + + + MOD_RES (3R,4S)-4-hydroxyisoleucine + UniProt-feature + + + + DiffAvg + 16.00 + + + + DiffFormula + C 0 H 0 N 0 O 1 + + + + DiffMono + 15.994915 + + + + Formula + C 6 H 11 N 1 O 2 + + + + MassAvg + 129.16 + + + + MassMono + 129.078979 + + + + Origin + I + + + + Source + natural + + + + TermSpec + none + + MOD:01415 + PSI-MOD + + + MOD:01378 + (2S,3R,4R)-4,5-dihydroxyisoleucine + + A protein modification that effectively converts an L-isoleucine residue to a (2S,3R,4R)-4,5-dihydroxyisoleucine. + + 11805306 + PubMed + + + 18552824 + PubMed + + + 363352 + PubMed + + + AA0449 + RESID + + + + (2S,3R,4R)-2-amino-4,5-dihydroxy-3-methylpentanoic acid + RESID-systematic + + + (2S,3R,4R)-4,5-dihydroxyisoleucine + RESID-name + + + (3R,4R)-4,5-dihydroxyisoleucine + RESID-alternate + + + gamma,delta-dihydroxyisoleucine + RESID-alternate + + + MOD_RES (3R,4R)-4,5-dihydroxyisoleucine + UniProt-feature + + + + DiffAvg + 32.00 + + + + DiffFormula + C 0 H 0 N 0 O 2 + + + + DiffMono + 31.989829 + + + + Formula + C 6 H 11 N 1 O 3 + + + + MassAvg + 145.16 + + + + MassMono + 145.073893 + + + + Origin + I + + + + Source + natural + + + + TermSpec + none + + MOD:01416 + PSI-MOD + + + MOD:01379 + 2'-methylsulfonyl-L-tryptophan + + A protein modification that effectively converts an L-tryptophan residue to 2'-methylsulfonyl-L-tryptophan. + + 6893271 + PubMed + + + AA0450 + RESID + + + + 2'-methylsulfonyl-L-tryptophan + RESID-name + + + 2-methylsulfonyl-3-((2S)-2-amino-2-carboxyethyl)-1H-indole + RESID-systematic + + + MOD_RES 2'-methylsulfonyltryptophan + UniProt-feature + + + + DiffAvg + 78.09 + + + + DiffFormula + C 1 H 2 N 0 O 2 S 1 + + + + DiffMono + 77.977550 + + + + Formula + C 12 H 12 N 2 O 3 S 1 + + + + MassAvg + 264.30 + + + + MassMono + 264.056863 + + + + Origin + W + + + + Source + natural + + + + TermSpec + none + + MOD:00918 + PSI-MOD + + + MOD:01380 + 2'-(S-L-cysteinyl)-6'-hydroxy-L-tryptophan sulfoxide + + A protein modification that effectively cross-links an L-cysteine residue and an L-tryptophan residue by a thioether bond to form 2'-(S-L-cysteinyl)-6'-hydroxy-L-tryptophan sulfoxide. + + 11805306 + PubMed + + + 18552824 + PubMed + + + 363352 + PubMed + + + 4865716 + PubMed + + + AA0451 + RESID + + + Cross-link 2. + + 2'-(S-L-cysteinyl)-6'-hydroxy-L-tryptophan sulfoxide + RESID-name + + + 2-((2R)-2-amino-2carboxyethyl)sulfinyl-3-((2S)-2-amino-2-carboxyethyl)-1H-indole + RESID-systematic + + + 6'-hydroxy-S-oxo-tryptathionine + RESID-alternate + + + CROSSLNK 2'-cysteinyl-6'-hydroxytryptophan sulfoxide (Trp-Cys) + UniProt-feature + + + + DiffAvg + 29.98 + + + + DiffFormula + C 0 H -2 N 0 O 2 S 0 + + + + DiffMono + 29.974179 + + + + Formula + C 14 H 13 N 3 O 4 S 1 + + + + MassAvg + 319.33 + + + + MassMono + 319.062677 + + + + Origin + C, W + + + + Source + natural + + + + TermSpec + none + + MOD:00687 + MOD:00918 + PSI-MOD + + + MOD:01381 + O-palmitoleyl-L-serine + + A protein modification that effectively converts an L-serine residue to O-palmitoleyl-L-serine. + + 17141155 + PubMed + + + AA0455 + RESID + + + PSI-MOD-slim + + (2S)-2-amino-3-((9Z)-9-hexadecenoyloxy)propanoic acid + RESID-systematic + + + L-serine cis-9-hexadecenoate ester + RESID-alternate + + + LIPID O-palmitoleyl serine + UniProt-feature + + + mod186 + OMSSA-label + + + O-palmitoleyl-L-serine + RESID-name + + + O3-palmitoleyl-serine + RESID-alternate + + + + DiffAvg + 236.40 + + + + DiffFormula + C 16 H 28 N 0 O 1 + + + + DiffMono + 236.214016 + + + + Formula + C 19 H 33 N 1 O 3 + + + + MassAvg + 323.48 + + + + MassMono + 323.246044 + + + + Origin + S + + + + Source + natural + + + + TermSpec + none + + MOD:00916 + MOD:01768 + PSI-MOD + + + MOD:01382 + N,N,N-trimethyl-L-methionine + + A protein modification that effectively converts an L-methionine residue to N,N,N-trimethyl-L-methionine. + + 18611379 + PubMed + + + AA0456 + RESID + + + PSI-MOD-slim + + (1S)-1-carboxy-N,N,N-trimethyl-3-(methylsulfanyl)propanaminium + RESID-systematic + + + (1S)-1-carboxy-N,N,N-trimethyl-3-(methylsulfanyl)propanazanium + RESID-alternate + + + 2-trimethylammonio-4-(methylthio)butanoic acid + RESID-alternate + + + MOD_RES N,N,N-trimethylmethionine + UniProt-feature + + + N,N,N-trimethyl-L-methionine + RESID-name + + + N,N,N-trimethylmethionine cation + RESID-alternate + + + N,N,N-trimethylmethioninium + RESID-alternate + + + N2Me3+Met + PSI-MOD-label + + + + DiffAvg + 43.09 + + + + DiffFormula + C 3 H 7 N 0 O 0 S 0 + + + + DiffMono + 43.054227 + + + + FormalCharge + 1+ + + + + Formula + C 8 H 17 N 1 O 1 S 1 + + + + MassAvg + 175.29 + + + + MassMono + 175.102537 + + + + Origin + M + + + + Source + natural + + + + TermSpec + N-term + + MOD:01463 + MOD:01698 + PSI-MOD + + + MOD:01383 + L-cystine S-oxide + + A protein modification that effectively cross-links two L-cysteine residues and oxidizes a sulfur to form L-cystine S-oxide. + + AA0457 + RESID + + + Cross-link 2. + + (2R)-2-amino-3-[([(2R)-2-amino-2-carboxyethyl]sulfanyl)sulfinyl]propanoic acid + RESID-systematic + + + CROSSLNK S-cysteinyl 3-(oxidosulfanyl)alanine (Cys-Cys) + UniProt-feature + + + cystine sulfoxide + RESID-alternate + + + L-cystine S-oxide + RESID-name + + + S-[(2R)-2-amino-3-oxopropyl] (2R)-2-amino-3-oxopropane-1-sulfinothioate + RESID-alternate + + + S-cysteinyl 3-(oxidosulfanyl)alanine + RESID-alternate + + + + DiffAvg + 13.98 + + + + DiffFormula + C 0 H -2 N 0 O 1 S 0 + + + + DiffMono + 13.979265 + + + + Formula + C 6 H 8 N 2 O 3 S 2 + + + + MassAvg + 220.26 + + + + MassMono + 219.997634 + + + + Origin + C, C + + + + Source + hypothetical + + + + TermSpec + none + + MOD:00689 + PSI-MOD + + + MOD:01384 + aminomalonic acid (Ser) + + A protein modification that effectively converts an L-serine residue to an aminomalonic acid. + + 1621954 + PubMed + + + 5415959 + PubMed + + + 6366787 + PubMed + + + 7457858 + PubMed + + + AA0458 + RESID + + + + 2-carboxyglycine + RESID-alternate + + + Ama + RESID-alternate + + + aminomalonic acid + RESID-name + + + aminopropanedioic acid + RESID-systematic + + + MOD_RES Aminomalonic acid (Ser) + UniProt-feature + + + + DiffAvg + 13.98 + + + + DiffFormula + C 0 H -2 N 0 O 1 S 0 + + + + DiffMono + 13.979265 + + + + Formula + C 3 H 3 N 1 O 3 + + + + MassAvg + 101.06 + + + + MassMono + 101.011293 + + + + Origin + S + + + + Source + hypothetical + + + + TermSpec + none + + MOD:00916 + PSI-MOD + + + MOD:01385 + 3-hydroxy-L-phenylalanine + + A protein modification that effectively converts an L-phenylalanine residue to 3-hydroxy-L-phenylalanine. + + 16795 + ChEBI + + + 10625477 + PubMed + + + 15651011 + PubMed + + + 16734421 + PubMed + + + 1880060 + PubMed + + + 7398618 + PubMed + + + 7844053 + PubMed + + + AA0462 + RESID + + + + (2S,3S)-2-amino-3-hydroxy-3-phenylpropanoic acid + RESID-systematic + + + 3-hydoxyphenylalanine + RESID-alternate + + + 3-hydroxy-L-phenylalanine + RESID-name + + + 3-phenyl-L-serine + RESID-alternate + + + 3HyPhe + PSI-MOD-label + + + beta-hydroxyphenylalanine + RESID-alternate + + + beta-phenylserine + RESID-alternate + + + hydroxylationf + OMSSA-label + + + L-threo-3-phenylserine + RESID-alternate + + + MOD_RES 3-hydroxyphenylalanine + UniProt-feature + + + + DiffAvg + 16.00 + + + + DiffFormula + C 0 H 0 N 0 O 1 + + + + DiffMono + 15.994915 + + + + Formula + C 9 H 9 N 1 O 2 + + + + MassAvg + 163.18 + + + + MassMono + 163.063329 + + + + Origin + F + + + + Source + natural + + + + TermSpec + none + + MOD:00677 + MOD:00914 + PSI-MOD + + + MOD:01386 + 3-hydroxy-L-valine + + A protein modification that effectively converts an L-valine residue to 3-hydroxy-L-valine. + + 7328054 + PubMed + + + AA0463 + RESID + + + + (2S)-2-amino-3-hydroxy-3-methylbutanoic acid + RESID-systematic + + + 3-hydroxy-L-valine + RESID-name + + + 3-hydroxyvaline + RESID-alternate + + + 3HyVal + PSI-MOD-label + + + MOD_RES 3-hydroxyvaline + UniProt-feature + + + + DiffAvg + 16.00 + + + + DiffFormula + C 0 H 0 N 0 O 1 + + + + DiffMono + 15.994915 + + + + Formula + C 5 H 9 N 1 O 2 + + + + MassAvg + 115.13 + + + + MassMono + 115.063329 + + + + Origin + V + + + + Source + natural + + + + TermSpec + none + + MOD:00677 + MOD:00920 + PSI-MOD + + + MOD:01387 + O-methyl-L-threonine + + A protein modification that effectively converts an L-threonine residue to O-methyl-L-threonine. + + 7328054 + PubMed + + + AA0464 + RESID + + + + (2S,3R)-2-amino-3-methoxybutanoic acid + RESID-systematic + + + MOD_RES O-methylthreonine + UniProt-feature + + + O-methyl threonine + RESID-alternate + + + O-methyl-L-threonine + RESID-name + + + OMeThr + PSI-MOD-label + + + threonine methyl ether + RESID-alternate + + + + DiffAvg + 14.03 + + + + DiffFormula + C 1 H 2 N 0 O 0 + + + + DiffMono + 14.015650 + + + + Formula + C 5 H 9 N 1 O 2 + + + + MassAvg + 115.13 + + + + MassMono + 115.063329 + + + + Origin + T + + + + Source + natural + + + + TermSpec + none + + MOD:01803 + PSI-MOD + + + MOD:01388 + 1-amino-2-propanol + + A protein modification that effectively converts an L-threonine residue into 1-amino-2-propanol. + + 15675 + ChEBI + + + 7328054 + PubMed + + + AA0465 + RESID + + + + (2R)-1-aminopropan-2-ol + RESID-systematic + + + 1-amino-2-hydroxypropane + RESID-alternate + + + 1-amino-2-propanol + RESID-name + + + 1-methyl-2-aminoethanol + RESID-alternate + + + 2-amino-1-methylethanol + RESID-alternate + + + 2-hydroxy-1-propylamine + RESID-alternate + + + 2-hydroxypropanamine + RESID-alternate + + + 2-hydroxypropylamine + RESID-alternate + + + alpha-aminoisopropyl alcohol + RESID-alternate + + + dCbxThr + PSI-MOD-label + + + decarboxylated threonine + RESID-alternate + + + isopropanolamine + RESID-alternate + + + MOD_RES Decarboxylated threonine + UniProt-feature + + + threamine + RESID-alternate + + + + DiffAvg + -44.01 + + + + DiffFormula + C -1 H 0 N 0 O -2 + + + + DiffMono + -43.989829 + + + + Formula + C 3 H 8 N 1 O 1 + + + + MassAvg + 74.10 + + + + MassMono + 74.060589 + + + + Origin + T + + + + Source + natural + + + + TermSpec + C-term + + MOD:00917 + MOD:00960 + PSI-MOD + + + MOD:01389 + L-isoleucine thiazole-4-carboxylic acid + + A protein modification that effectively crosslinks an L-cysteine residue and an L-isoleucine residue to form L-isoleucine thiazole-4-carboxylic acid. + + 11320328 + PubMed + + + AA0466 + RESID + + + Cross-link 2. + + 2-[(1S,2S)-1-amino-2-methylbutyl]-1,3-thiazole-4-carboxylic acid + RESID-systematic + + + 2-[1-zanyl-2-methylbutyl]-1,3-thiazole-4-carboxylic acid + RESID-alternate + + + CROSSLNK Thiazole-4-carboxylic acid (Ile-Cys) + UniProt-feature + + + L-isoleucine thiazole-4-carboxylic acid + RESID-name + + + + DiffAvg + -20.03 + + + + DiffFormula + C 0 H -4 N 0 O -1 S 0 + + + + DiffMono + -20.026215 + + + + Formula + C 9 H 12 N 2 O 1 S 1 + + + + MassAvg + 196.27 + + + + MassMono + 196.067034 + + + + Origin + C, I + + + + Source + natural + + + + TermSpec + none + + MOD:00910 + MOD:01420 + MOD:01888 + PSI-MOD + + + MOD:01390 + L-valine thiazole-4-carboxylic acid + + A protein modification that effectively crosslinks an L-cysteine residue and an L-valine residue to form L-valine thiazole-4-carboxylic acid. + + 7328054 + PubMed + + + AA0467 + RESID + + + Cross-link 2. + + 2-[(1S)-1-amino-2-methylpropyl]-1,3-thiazole-4-carboxylic acid + RESID-systematic + + + 2-[1-azanyl-2-methylpropyl]-1,3-thiazole-4-carboxylic acid + RESID-alternate + + + CROSSLNK Thiazole-4-carboxylic acid (Val-Cys) + UniProt-feature + + + L-valine thiazole-4-carboxylic acid + RESID-name + + + + DiffAvg + -20.03 + + + + DiffFormula + C 0 H -4 N 0 O -1 S 0 + + + + DiffMono + -20.026215 + + + + Formula + C 8 H 10 N 2 O 1 S 1 + + + + MassAvg + 182.24 + + + + MassMono + 182.051384 + + + + Origin + C, V + + + + Source + natural + + + + TermSpec + none + + MOD:00920 + MOD:01420 + MOD:01888 + PSI-MOD + + + MOD:01391 + L-valine 5-(methoxymethyl)thiazole-4-carboxylic acid + + A protein modification that effectively crosslinks an L-cysteine residue and an L-valine residue, and C-5 methoxymethylates to form L-valine 5-(methoxymethyl)thiazole-4-carboxylic acid. + + 10625477 + PubMed + + + 1880060 + PubMed + + + 7844053 + PubMed + + + AA0468 + RESID + + + Cross-link 2. + + 2-[(1S)-1-amino-2-methylpropyl]-5-(methoxymethyl)-1,3-thiazole-4-carboxylic acid + RESID-systematic + + + 2-[1-azanyl-2-methylpropyl]-5-(methoxymethyl)-1,3-thiazole-4-carboxylic acid + RESID-alternate + + + CROSSLNK 5-(methoxymethyl)thiazole-4-carboxylic acid (Val-Cys) + UniProt-feature + + + L-valine 5-(methoxymethyl)thiazole-4-carboxylic acid + RESID-name + + + + DiffAvg + 24.02 + + + + DiffFormula + C 2 H 0 N 0 O 0 S 0 + + + + DiffMono + 24.000000 + + + + Formula + C 10 H 14 N 2 O 2 S 1 + + + + MassAvg + 226.29 + + + + MassMono + 226.077599 + + + + Origin + C, V + + + + Source + natural + + + + TermSpec + none + + MOD:00920 + MOD:01420 + MOD:01888 + PSI-MOD + + + MOD:01392 + L-asparagine 5-methylthiazole-4-carboxylic acid + + A protein modification that effectively crosslinks an L-cysteine residue and an L-asparagine residue, and C-4 methylates to form L-asparagine 5-methylthiazole-4-carboxylic acid. + + 10625477 + PubMed + + + 1880060 + PubMed + + + 7844053 + PubMed + + + AA0469 + RESID + + + Cross-link 2. + + 2-[(1S)-1,3-bisazanyl-3-oxopropyl]-5-methyl-1,3-thiazole-4-carboxylic acid + RESID-alternate + + + 2-[(1S)-1,3-diamino-3-oxopropyl]-5-methyl-1,3-thiazole-4-carboxylic acid + RESID-systematic + + + CROSSLNK 5-methylthiazole-4-carboxylic acid (Asn-Cys) + UniProt-feature + + + L-asparagine 5-methylthiazole-4-carboxylic acid + RESID-name + + + + DiffAvg + -6.00 + + + + DiffFormula + C 1 H -2 N 0 O -1 S 0 + + + + DiffMono + -6.010565 + + + + Formula + C 8 H 9 N 3 O 2 S 1 + + + + MassAvg + 211.24 + + + + MassMono + 211.041548 + + + + Origin + C, N + + + + Source + natural + + + + TermSpec + none + + MOD:00903 + MOD:01420 + MOD:01888 + + derives_from + MOD:006560 + + PSI-MOD + + + MOD:01393 + L-cysteine pyridine-2,5-dicarboxylic acid + + A protein modification that crosslinks two serine residues and a cysteine residue by formation of a pyridine-2,5-dicarboxylic acid. + + 10625477 + PubMed + + + 1880060 + PubMed + + + 7844053 + PubMed + + + AA0470 + RESID + + + Cross-link 3. + + 6-[(1R)-1-amino-2-sulfanylethyl]pyridine-2,5-dicarboxylic acid + RESID-systematic + + + L-cysteine pyridine-2,5-dicarboxylic acid + RESID-name + + + + DiffAvg + -70.07 + + + + DiffFormula + C 0 H -8 N -1 O -3 S 0 + + + + DiffMono + -70.050418 + + + + Formula + C 9 H 7 N 2 O 2 S 1 + + + + MassAvg + 207.23 + + + + MassMono + 207.022823 + + + + Origin + C, S, S + + + + Source + natural + + + + TermSpec + none + + MOD:01425 + PSI-MOD + + + MOD:01394 + L-cysteine 5-amino-3,4,5,6-tetrahydropyridine-2,5-dicarboxylic acid + + A protein modification that crosslinks two serine residues and a cysteine residue by formation of a 5-amino-3,4,5,6-tetrahydropyridine-2,5-dicarboxylic acid. + + 11320328 + PubMed + + + AA0471 + RESID + + + Cross-link 3. + + (5R,6R)-5-amino-6-[(1R)-1-amino-2-sulfanylethyl]-3,4,5,6-tetrahydropyridine-2,5-dicarboxylic acid + RESID-systematic + + + L-cysteine 5-amino-3,4,5,6-tetrahydropyridine-2,5-dicarboxylic acid + RESID-name + + + L-cysteine 5-aminopiperideine-2,5-dicarboxylic acid + RESID-alternate + + + + DiffAvg + -53.04 + + + + DiffFormula + C 0 H -5 N 0 O -3 S 0 + + + + DiffMono + -53.023869 + + + + Formula + C 9 H 11 N 3 O 2 S 1 + + + + MassAvg + 225.27 + + + + MassMono + 225.057198 + + + + Origin + C, S, S + + + + Source + natural + + + + TermSpec + N-term + + MOD:01425 + PSI-MOD + + + MOD:01395 + 4-(1-hydroxyethyl)-7-isoleucino-2-(threonin-O3-ylcarbonyl)-7,8-dihydroquinolin-8-ol + + A protein modification that effectively results from forming an adduct between an isoleucine residue, a threonine residue and the quinaldate compound 2-carboxy-4-(1-hydroxyethyl)--7,8-dihydroquinolin-8-ol. + + 11320328 + PubMed + + + AA0472 + RESID + + + Cross-link 2. + + (7R,8S)-7-[(1S,2S)-1-carboxy-2-methylbutyl]amino-2-([(1S,2R)-1-amino-1-carboxypropan-2-yl]oxy)carbonyl-8-hydroxy-4-[(1S)-1-hydroxyethyl]-7,8-dihydroquinoline + RESID-systematic + + + 4-(1-hydroxyethyl)-7-isoleucino-2-(threonin-O3-ylcarbonyl)-7,8-dihydroquinolin-8-ol + RESID-name + + + BINDING 4-(1-hydroxyethyl)-7,8-dihydroquinolin-8-ol (covalent; via 2 links) + UniProt-feature + + + + DiffAvg + 215.21 + + + + DiffFormula + C 12 H 9 N 1 O 3 + + + + DiffMono + 215.058243 + + + + Formula + C 22 H 28 N 3 O 6 + + + + MassAvg + 430.48 + + + + MassMono + 430.197811 + + + + Origin + I, T + + + + Source + natural + + + + TermSpec + N-term + + MOD:00910 + MOD:00917 + MOD:01424 + PSI-MOD + + + MOD:01396 + 5-hydroxy-3-methyl-L-proline (Pro) + + A protein modification that effectively converts an L-proline residue to a 5-hydroxy-3-methyl-L-proline. + + 7592021 + PubMed + + + 8557573 + PubMed + + + AA0473 + RESID + + + This entry is for the hypothetical formation of 5-hydroxy-3-methyl-L-proline from proline. For the natural production from L-isoleucine, use MOD:01897 [JSG]. + + (2S,3S,5Xi)-5-hydroxy-3-methylpyrrolidine-2-carboxylic acid + RESID-systematic + + + 5-hydroxy-3-methyl-L-proline + RESID-name + + + 5-hydroxy-3-methylproline + RESID-alternate + + + 5Hy3MePro + PSI-MOD-label + + + beta-methyl-delta-hydroxyproline + RESID-alternate + + + MOD_RES 5-hydroxy-3-methylproline (Ile) + UniProt-feature + + + + DiffAvg + 30.03 + + + + DiffFormula + C 1 H 2 N 0 O 1 + + + + DiffMono + 30.010565 + + + + Formula + C 6 H 9 N 1 O 2 + + + + MassAvg + 127.14 + + + + MassMono + 127.063329 + + + + Origin + P + + + + Source + artifactual + + + + TermSpec + none + + MOD:00915 + + has_functional_parent + MOD:010240 + + + has_functional_parent + MOD:014170 + + PSI-MOD + + + MOD:01397 + L-serine 5-methyloxazole-4-carboxylic acid + + A protein modification that effectively crosslinks an L-serine residue and an L-threonine residue to form L-serine 5-methyloxazole-4-carboxylic acid. + + 7592021 + PubMed + + + 8557573 + PubMed + + + AA0474 + RESID + + + Cross-link 2. + + 2-[(1S)-1-amino-2-hydroxyethyl]-5-methyl-1,3-oxazole-4-carboxylic acid + RESID-systematic + + + 2-[1-azanyl-2-hydroxyethyl]-5-methyl-1,3-oxazole-4-carboxylic acid + RESID-alternate + + + CROSSLNK 5-methyloxazole-4-carboxylic acid (Ser-Thr) + UniProt-feature + + + L-serine 5-methyloxazole-4-carboxylic acid + RESID-name + + + + DiffAvg + -20.03 + + + + DiffFormula + C 0 H -4 N 0 O -1 + + + + DiffMono + -20.026215 + + + + Formula + C 7 H 8 N 2 O 3 + + + + MassAvg + 168.15 + + + + MassMono + 168.053492 + + + + Origin + S, T + + + + Source + natural + + + + TermSpec + none + + MOD:00916 + MOD:01422 + MOD:01888 + PSI-MOD + + + MOD:01398 + N6-propanoyl-L-lysine + + A protein modification that effectively converts an L-lysine residue to N6-propanoyl-L-lysine. + + 17267393 + PubMed + + + 17684016 + PubMed + + + 20715035 + PubMed + + + AA0475 + RESID + + + 58#K + UniMod + + + The binding of histone peptides with propanoylated lysine to nuclear bromodomain proteins is non-specific and weaker than binding to the corresponding acetylated lysine peptides [JSG]. + PSI-MOD-slim + + (2S)-2-amino-6-(propanoylamino)hexanoic acid + RESID-systematic + + + 2-amino-6-propionylaminocaproic acid + RESID-alternate + + + epsilon-propanoyl-L-lysine + RESID-alternate + + + epsilon-propionyl-L-lysine + RESID-alternate + + + N(zeta)-propanoyllysine + RESID-alternate + + + N6-(1-oxopropyl)-L-lysine + RESID-alternate + + + N6-propanoyl-L-lysine + RESID-name + + + N6-propionyllysine + RESID-alternate + + + + DiffAvg + 56.06 + + + + DiffFormula + C 3 H 4 N 0 O 1 + + + + DiffMono + 56.026215 + + + + Formula + C 9 H 16 N 2 O 2 + + + + MassAvg + 184.24 + + + + MassMono + 184.121178 + + + + Origin + K + + + + Source + natural + + + + TermSpec + none + + MOD:01155 + MOD:01875 + MOD:01894 + PSI-MOD + + + MOD:01399 + N6-(ADP-ribosyl)-L-lysine + + A protein modification that effectively converts an L-lysine residue to an N6-(ADP-ribosyl)-L-lysine. + + 18436469 + PubMed + + + AA0476 + RESID + + + + (S)-2-amino-6-([adenosine 5'-(trihydrogen diphosphate) 5'->5'-ester with alpha-D-ribofuranosyl]amino)hexanoic acid + RESID-systematic + + + 2-amino-6-(ADP-ribosyl)amino-hexanoic acid + RESID-alternate + + + epsilon-ADP-ribosyllysine + RESID-alternate + + + MOD_RES N6-(ADP-ribosyl)lysine + UniProt-feature + + + N(zeta)-ADP-ribosyllysine + RESID-alternate + + + N6-(ADP-ribosyl)-L-lysine + RESID-name + + + N6-[alpha-D-ribofuranoside 5'->5'-ester with adenosine 5'-(trihydrogen diphosphate)]-L-lysine + RESID-alternate + + + N6-alpha-D-ribofuranosyl-L-lysine 5'->5'-ester with adenosine 5'-(trihydrogen diphosphate) + RESID-alternate + + + + DiffAvg + 541.30 + + + + DiffFormula + C 15 H 21 N 5 O 13 P 2 + + + + DiffMono + 541.061109 + + + + Formula + C 21 H 33 N 7 O 14 P 2 + + + + MassAvg + 669.48 + + + + MassMono + 669.156072 + + + + Origin + K + + + + Source + hypothetical + + + + TermSpec + none + + MOD:00752 + MOD:00912 + PSI-MOD + + + MOD:01400 + L-lysyl-poly(ADP-ribose) + + A protein modification that effectively converts an L-lysine residue to an L-lysyl-poly(ADP-ribose). + + 6772638 + PubMed + + + AA0477 + RESID + + + + L-lysyl-poly(ADP-ribose) + RESID-name + + + MOD_RES Lysyl poly(ADP-ribose) + UniProt-feature + + + poly[2'-adenosine 5'-(trihydrogen diphosphate) 5'->5'-ester with 1alpha-D-ribofuranosyl] (2S)-2,6-diaminohexanoate + RESID-systematic + + + + DiffAvg + 541.30 + + + + DiffFormula + C 15 H 21 N 5 O 13 P 2 + + + + DiffMono + 541.061109 + + + + Formula + C 21 H 34 N 7 O 15 P 2 + + + + MassAvg + 686.48 + + + + MassMono + 686.158812 + + + + Origin + K + + + + Source + natural + + + + TermSpec + C-term + + MOD:00752 + MOD:00912 + PSI-MOD + + + MOD:01401 + (2S,3S)-3-hydroxyasparagine + + A protein modification that effectively converts an L-asparagine residue to a (2S,3S)-3-hydroxyasparagine. + + 50789 + ChEBI + + + 11823643 + PubMed + + + 12042299 + PubMed + + + 12215170 + PubMed + + + 17573339 + PubMed + + + AA0478 + RESID + + + PSI-MOD-slim + + (2S,3S)-2,4-diamino-3-hydroxy-4-oxobutanoic acid + RESID-alternate + + + (2S,3S)-2-amino-3-hydroxy-4-butanediamic acid + RESID-systematic + + + (2S,3S)-3-hydroxyasparagine + RESID-name + + + (3S)3HyAsn + PSI-MOD-label + + + L-threo-beta-hydroxyasparagine + RESID-alternate + + + MOD_RES (3S)-3-hydroxyasparagine + UniProt-feature + + + + DiffAvg + 16.00 + + + + DiffFormula + C 0 H 0 N 0 O 1 + + + + DiffMono + 15.994915 + + + + Formula + C 4 H 6 N 2 O 3 + + + + MassAvg + 130.10 + + + + MassMono + 130.037842 + + + + Origin + N + + + + Source + natural + + + + TermSpec + none + + MOD:01688 + PSI-MOD + + + MOD:01402 + (2S,3R,4R)-3,4-dihydroxyproline + + A protein modification that effectively converts an L-proline residue to a (2S,3R,4R)-3,4-dihydroxyproline. + + 6893271 + PubMed + + + AA0479 + RESID + + + + (2S,3R,4R)-3,4-dihydroxyproline + RESID-name + + + (2S,3R,4R)-3,4-dihydroxypyrrolidine-2-carboxylic acid + RESID-systematic + + + 2,3-trans-3,4-trans-3,4-dihydroxy-L-proline + RESID-alternate + + + 2-alpha-3-beta-4-alpha-3,4-dihydroxyproline + RESID-alternate + + + MOD_RES (3R,4R)-3,4-dihydroxyproline + UniProt-feature + + + + DiffAvg + 32.00 + + + + DiffFormula + C 0 H 0 N 0 O 2 + + + + DiffMono + 31.989829 + + + + Formula + C 5 H 7 N 1 O 3 + + + + MassAvg + 129.12 + + + + MassMono + 129.042593 + + + + Origin + P + + + + Source + natural + + + + TermSpec + none + + MOD:00866 + PSI-MOD + + + MOD:01403 + (2S)-4,5,5'-trihydroxyleucine + + A protein modification that effectively converts an L-leucine residue to a (2S)-4,5,5'-trihydroxyleucine. + + 6893271 + PubMed + + + AA0480 + RESID + + + + (2S)-2-amino-4,5-dihydroxy-4-(hydroxymethyl)pentanoic acid + RESID-systematic + + + (2S)-4,5,5'-trihydroxyleucine + RESID-name + + + 4,5,5'-trihydroxyleucine + RESID-alternate + + + gamma,delta,delta'-trihydroxyleucine + RESID-alternate + + + MOD_RES 4,5,4'-trihydroxyleucine + UniProt-feature + + + + DiffAvg + 48.00 + + + + DiffFormula + C 0 H 0 N 0 O 3 + + + + DiffMono + 47.984744 + + + + Formula + C 6 H 11 N 1 O 4 + + + + MassAvg + 161.16 + + + + MassMono + 161.068808 + + + + Origin + L + + + + Source + natural + + + + TermSpec + none + + MOD:01413 + PSI-MOD + + + MOD:01404 + L-asparagine thiazole-4-carboxylic acid + + A protein modification that effectively crosslinks an L-cysteine residue and an L-asparagine residue to form L-asparagine thiazole-4-carboxylic acid. + + 7592021 + PubMed + + + 8557573 + PubMed + + + AA0481 + RESID + + + Cross-link 2. + + 2-[(1S)-1,3-diamino-3-oxopropyl]-1,3-thiazole-4-carboxylic acid + RESID-systematic + + + 2-[1,3-bisazanyl-3-oxopropyl]-1,3-thiazole-4-carboxylic acid + RESID-alternate + + + CROSSLNK Thiazole-4-carboxylic acid (Asn-Cys) + UniProt-feature + + + L-asparagine thiazole-4-carboxylic acid + RESID-name + + + + DiffAvg + -20.03 + + + + DiffFormula + C 0 H -4 N 0 O -1 S 0 + + + + DiffMono + -20.026215 + + + + Formula + C 7 H 7 N 3 O 2 S 1 + + + + MassAvg + 197.21 + + + + MassMono + 197.025897 + + + + Origin + C, N + + + + Source + natural + + + + TermSpec + none + + MOD:00903 + MOD:01420 + MOD:01888 + PSI-MOD + + + MOD:01405 + L-proline thiazole-4-carboxylic acid + + A protein modification that effectively crosslinks an L-cysteine residue and an L-proline residue to form L-proline thiazole-4-carboxylic acid. + + 7592021 + PubMed + + + 8557573 + PubMed + + + AA0482 + RESID + + + Cross-link 2. + + 2-[(2S)-pyrrolidin-2-yl]-1,3-thiazole-4-carboxylic acid + RESID-systematic + + + CROSSLNK Thiazole-4-carboxylic acid (Pro-Cys) + UniProt-feature + + + L-proline thiazole-4-carboxylic acid + RESID-name + + + + DiffAvg + -20.03 + + + + DiffFormula + C 0 H -4 N 0 O -1 S 0 + + + + DiffMono + -20.026215 + + + + Formula + C 8 H 8 N 2 O 1 S 1 + + + + MassAvg + 180.22 + + + + MassMono + 180.035734 + + + + Origin + C, P + + + + Source + natural + + + + TermSpec + none + + MOD:00915 + MOD:01420 + MOD:01888 + PSI-MOD + + + MOD:01406 + L-threonine thiazole-4-carboxylic acid + + A protein modification that effectively crosslinks an L-cysteine residue and an L-threonine residue to form L-threonine thiazole-4-carboxylic acid. + + 11320328 + PubMed + + + AA0483 + RESID + + + Cross-link 2. + + 2-[(1S,2R)-1-amino-2-hydroxypropyl]-1,3-thiazole-4-carboxylic acid + RESID-systematic + + + 2-[1-azanyl-2-hydroxypropyl]-1,3-thiazole-4-carboxylic acid + RESID-alternate + + + CROSSLNK Thiazole-4-carboxylic acid (Thr-Cys) + UniProt-feature + + + L-threonine thiazole-4-carboxylic acid + RESID-name + + + + DiffAvg + -20.03 + + + + DiffFormula + C 0 H -4 N 0 O -1 S 0 + + + + DiffMono + -20.026215 + + + + Formula + C 7 H 8 N 2 O 2 S 1 + + + + MassAvg + 184.21 + + + + MassMono + 184.030649 + + + + Origin + C, T + + + + Source + natural + + + + TermSpec + none + + MOD:00917 + MOD:01420 + MOD:01888 + PSI-MOD + + + MOD:01407 + L-phenylalanine thiazoline-4-carboxylic acid + + A protein modification that effectively crosslinks an L-cysteine residue and an L-phenylalanine residue to form L-phenylalanine thiazoline-4-carboxylic acid. + + 7592021 + PubMed + + + 8557573 + PubMed + + + AA0484 + RESID + + + Cross-link 2. + + (4R)-2-[(1S)-1-amino-2-phenylethyl]-4,5-dihydro-1,3-thiazole-4-carboxylic acid + RESID-systematic + + + 2-[1-azanyl-2-phenylethyl]-4,5-dihydro-1,3-thiazole-4-carboxylic acid + RESID-alternate + + + CROSSLNK Thiazoline-4-carboxylic acid (Phe-Cys) + UniProt-feature + + + L-phenylalanine thiazoline-4-carboxylic acid + RESID-name + + + + DiffAvg + -18.02 + + + + DiffFormula + C 0 H -2 N 0 O -1 S 0 + + + + DiffMono + -18.010565 + + + + Formula + C 12 H 12 N 2 O 1 S 1 + + + + MassAvg + 232.30 + + + + MassMono + 232.067034 + + + + Origin + C, F + + + + Source + natural + + + + TermSpec + none + + MOD:00914 + MOD:01420 + PSI-MOD + + + MOD:01408 + L-threonine thiazoline-4-carboxylic acid + + A protein modification that effectively crosslinks an L-cysteine residue and an L-threonine residue to form L-threonine thiazoline-4-carboxylic acid. + + 11320328 + PubMed + + + AA0485 + RESID + + + Cross-link 2. + + (4S)-2-[(1S,2R)-1-amino-2-hydroxypropyl]-4,5-dihydro-1,3-thiazole-4-carboxylic acid + RESID-systematic + + + 2-[1-azanyl-2-hydroxypropyl]-4,5-dihydro-1,3-thiazole-4-carboxylic acid + RESID-alternate + + + CROSSLNK (4S)-thiazoline-4-carboxylic acid (Thr-Cys) + UniProt-feature + + + L-threonine (4S)-thiazoline-4-carboxylic acid + RESID-name + + + + DiffAvg + -18.02 + + + + DiffFormula + C 0 H -2 N 0 O -1 S 0 + + + + DiffMono + -18.010565 + + + + Formula + C 7 H 10 N 2 O 2 S 1 + + + + MassAvg + 186.23 + + + + MassMono + 186.046299 + + + + Origin + C, T + + + + Source + natural + + + + TermSpec + none + + MOD:00917 + MOD:01420 + PSI-MOD + + + MOD:01409 + trihydroxylated residue + + A protein modification that effectively replaces three hydrogen atoms with three hydroxyl groups. + + 18688235 + PubMed + + + + Hy3Res + PSI-MOD-label + + + + DiffAvg + 48.00 + + + + DiffFormula + C 0 H 0 N 0 O 3 + + + + DiffMono + 47.984744 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + none + + + + TermSpec + none + + MOD:00677 + PSI-MOD + + + MOD:01410 + hydroxylated leucine + + A protein modification that effectively converts an L-leucine residue to an hydroxylated leucine. + + 18688235 + PubMed + + + + HyLeu + PSI-MOD-label + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + L + + + + Source + none + + + + TermSpec + none + + MOD:00677 + MOD:00911 + PSI-MOD + + + MOD:01411 + monohydroxylated leucine + + A protein modification that effectively converts an L-leucine residue to a monohydroxylated leucine. + + 18688235 + PubMed + + + + Hy1Leu + PSI-MOD-label + + + + DiffAvg + 16.00 + + + + DiffFormula + C 0 H 0 N 0 O 1 + + + + DiffMono + 15.994915 + + + + Formula + C 6 H 11 N 1 O 2 + + + + MassAvg + 129.16 + + + + MassMono + 129.078979 + + + + Origin + L + + + + Source + natural + + + + TermSpec + none + + MOD:00425 + MOD:01410 + PSI-MOD + + + MOD:01412 + dihydroxylated leucine + + A protein modification that effectively converts an L-leucine residue to a dihydroxylated leucine. + + 18688235 + PubMed + + + + Hy2Leu + PSI-MOD-label + + + + DiffAvg + 32.00 + + + + DiffFormula + C 0 H 0 N 0 O 2 + + + + DiffMono + 31.989829 + + + + Formula + C 6 H 11 N 1 O 3 + + + + MassAvg + 145.16 + + + + MassMono + 145.073893 + + + + Origin + L + + + + Source + natural + + + + TermSpec + none + + MOD:00428 + MOD:01410 + PSI-MOD + + + MOD:01413 + trihydroxylated leucine + + A protein modification that effectively converts an L-leucine residue to a trihydroxylated leucine. + + 18688235 + PubMed + + + + Hy3Leu + PSI-MOD-label + + + + DiffAvg + 48.00 + + + + DiffFormula + C 0 H 0 N 0 O 3 + + + + DiffMono + 47.984744 + + + + Formula + C 6 H 11 N 1 O 4 + + + + MassAvg + 161.16 + + + + MassMono + 161.068808 + + + + Origin + L + + + + Source + natural + + + + TermSpec + none + + MOD:01409 + MOD:01410 + PSI-MOD + + + MOD:01414 + hydroxylated isoleucine + + A protein modification that effectively converts an L-isoleucine residue to an hydroxylated isoleucine. + + 18688235 + PubMed + + + + HyIle + PSI-MOD-label + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + I + + + + Source + none + + + + TermSpec + none + + MOD:00677 + MOD:00910 + PSI-MOD + + + MOD:01415 + monohydroxylated isoleucine + + A protein modification that effectively converts an L-isoleucine residue to a monohydroxylated isoleucine. + + 18688235 + PubMed + + + + Hy1Ile + PSI-MOD-label + + + + DiffAvg + 16.00 + + + + DiffFormula + C 0 H 0 N 0 O 1 + + + + DiffMono + 15.994915 + + + + Formula + C 6 H 11 N 1 O 2 + + + + MassAvg + 129.16 + + + + MassMono + 129.078979 + + + + Origin + I + + + + Source + natural + + + + TermSpec + none + + MOD:00425 + MOD:01414 + PSI-MOD + + + MOD:01416 + dihydroxylated isoleucine + + A protein modification that effectively converts an L-isoleucine residue to a dihydroxylated isoleucine. + + 18688235 + PubMed + + + + Hy2Ile + PSI-MOD-label + + + + DiffAvg + 32.00 + + + + DiffFormula + C 0 H 0 N 0 O 2 + + + + DiffMono + 31.989829 + + + + Formula + C 6 H 11 N 1 O 3 + + + + MassAvg + 145.16 + + + + MassMono + 145.073893 + + + + Origin + I + + + + Source + natural + + + + TermSpec + none + + MOD:00428 + MOD:01414 + PSI-MOD + + + MOD:01417 + monomethylated proline + + A protein modification that effectively converts an L-proline residue to a monomethylated proline. + + 18688235 + PubMed + + + PSI-MOD-slim + + Me1Pro + PSI-MOD-label + + + + DiffAvg + 14.03 + + + + DiffFormula + C 1 H 2 N 0 O 0 + + + + DiffMono + 14.015650 + + + + Formula + C 6 H 10 N 1 O 1 + + + + MassAvg + 112.15 + + + + MassMono + 112.076239 + + + + Origin + P + + + + Source + natural + + + + TermSpec + none + + MOD:00599 + MOD:00712 + PSI-MOD + + + MOD:01418 + methylated threonine + + A protein modification that effectively converts an L-threonine residue to a methylated threonine, such as O-methyl-L-threonine. + + 18688235 + PubMed + + + + MeThr + PSI-MOD-label + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + T + + + + Source + natural + + + + TermSpec + none + + MOD:00427 + MOD:00917 + PSI-MOD + + + MOD:01419 + oxazole/oxazoline ring crosslinked residues + + A protein modification that crosslinks two residues by condensation of a serine or threonine hydroxyl with the carbonyl of the preceding residue to form an oxazole or oxazoline ring, or by rearrangement and condensation of a cysteine with the carbonyl of the preceding residue to form a 1,3-oxazole-4-carbothionic acid. + + 18688235 + PubMed + + + MOD:00690 + PSI-MOD + + + MOD:01420 + thiazole/thiazoline ring croslinked residues + + A protein modification that crosslinks two residues by condensation of a cysteine thiol with the carbonyl of the preceding residue to form a thiazole or thiazoline ring. + + 18688235 + PubMed + + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + C + + + + Source + natural + + + + TermSpec + none + + MOD:00687 + MOD:00690 + PSI-MOD + + + MOD:01421 + oxazole/oxazoline ring crosslinked residues (Ser) + + A protein modification that crosslinks two residues by condensation of a serine hydroxyl with the carbonyl of the preceding residue to form an oxazole or oxazoline ring. + + 18688235 + PubMed + + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + S + + + + Source + natural + + + + TermSpec + none + + MOD:00916 + MOD:01419 + PSI-MOD + + + MOD:01422 + oxazole/oxazoline ring crosslinked residues (Thr) + + A protein modification that crosslinks two residues by condensation of a threonine hydroxyl with the carbonyl of the preceding residue to form a 5-methyloxazole or 5-methyloxazoline ring. + + 18688235 + PubMed + + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + T + + + + Source + natural + + + + TermSpec + none + + MOD:00917 + MOD:01419 + PSI-MOD + + + MOD:01423 + palmitoleylated residue + + A protein modification that effectively replaces a hydrogen atom with a palmitoleyl group. + + 431 + UniMod + + + PSI-MOD-slim + + + DiffAvg + 236.40 + + + + DiffFormula + C 16 H 28 N 0 O 1 + + + + DiffMono + 236.214016 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + natural + + + + TermSpec + none + + MOD:00649 + PSI-MOD + + + MOD:01424 + quinaldate modified residue + + A protein modification that effectively results from forming an adduct with a compound containing a quinaldate, kynurenate, or xanthurenate group. + + 18688235 + PubMed + + + MOD:01156 + PSI-MOD + + + MOD:01425 + pyridinyl ring crosslinked residues + + A protein modification that crosslinks three residues by formation of a pyridinyl ring, such as pyridine-2,5-dicarboxylic acid or 5-aminopiperideine-2,5-dicarboxylic acid. + + 18688235 + PubMed + + + Cross-link 3. + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + C, S, S + + + + Source + natural + + + + TermSpec + none + + MOD:00033 + MOD:00905 + MOD:00916 + PSI-MOD + + + MOD:01426 + isotope tagged reagent derivatized residue + + A protein modification that forms an adduct with a particular isotope labeled compound used as a reagent. + + 18688235 + PubMed + + + PSI-MOD-slim + MOD:00848 + PSI-MOD + + + MOD:01427 + 2-aminobutanoic acid (Abu) + + OBSOLETE because redundant and identical to MOD:00819. Remap to MOD:00819. + + 18688235 + PubMed + + + + Abu + DeltaMass-label + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + C 4 H 7 N 1 O 1 + + + + MassAvg + 85.11 + + + + MassMono + 85.052764 + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + 1 + PSI-MOD + + + MOD:01428 + (13)C isotope tagged reagent + + A protein modification that forms an adduct with a (13)C labeled compound used as a reagent. + + 18688235 + PubMed + + + PSI-MOD-slim + MOD:01426 + PSI-MOD + + + MOD:01429 + (15)N isotope tagged reagent + + A protein modification that forms an adduct with a (15)N labeled compound used as a reagent. + + 18688235 + PubMed + + + PSI-MOD-slim + MOD:01426 + PSI-MOD + + + MOD:01430 + (18)O isotope tagged reagent + + A protein modification that forms an adduct with a (13)C labeled compound used as a reagent. + + 18688235 + PubMed + + + PSI-MOD-slim + MOD:01426 + PSI-MOD + + + MOD:01431 + (2)H deuterium tagged reagent + + A protein modification that forms an adduct with a (2)H labeled compound used as a reagent. + + 18688235 + PubMed + + + PSI-MOD-slim + MOD:01426 + PSI-MOD + + + MOD:01432 + (2S,4S)-4,5-dihydroxyleucine + + A protein modification that effectively converts an L-leucine residue to a (2S,4S)-4,5-dihydroxyleucine. + + 3718926 + PubMed + + + AA0446 + RESID + + + + (2S,4S)-2-amino-4,5-dihydroxy-4-methylpentanoic acid + RESID-systematic + + + (2S,4S)-4,5-dihydroxyleucine + RESID-name + + + (4S)-4,5-dihydroxyleucine + RESID-alternate + + + gamma,delta-dihydroxyleucine + RESID-alternate + + + + DiffAvg + 32.00 + + + + DiffFormula + C 0 H 0 N 0 O 2 + + + + DiffMono + 31.989829 + + + + Formula + C 6 H 11 N 1 O 3 + + + + MassAvg + 145.16 + + + + MassMono + 145.073893 + + + + Origin + L + + + + Source + natural + + + + TermSpec + none + + MOD:01412 + PSI-MOD + + + MOD:01433 + 1-amino-2-propanone + + A protein modification that effectively converts an L-threonine residue into 1-amino-2-propanone. + + 17906 + ChEBI + + + 12715872 + PubMed + + + 19196969 + PubMed + + + AA0486 + RESID + + + + 1-amino-2-propanone + RESID-name + + + 1-aminopropan-2-one + RESID-alternate + + + 1-aminopropanone + RESID-systematic + + + aminoacetone + RESID-alternate + + + MOD_RES 1-amino-2-propanone + UniProt-feature + + + + DiffAvg + -46.03 + + + + DiffFormula + C -1 H -2 N 0 O -2 + + + + DiffMono + -46.005479 + + + + Formula + C 3 H 6 N 1 O 1 + + + + MassAvg + 72.09 + + + + MassMono + 72.044939 + + + + Origin + T + + + + Source + natural + + + + TermSpec + C-term + + MOD:00683 + MOD:00917 + MOD:00960 + PSI-MOD + + + MOD:01434 + 4-hydroxy-L-glutamic acid + + A protein modification that effectively converts an L-glutamic acid residue to a 4-hydroxy-L-glutamic acid. + + 893891 + PubMed + + + AA0487 + RESID + + + + (2S,4Xi)-2-amino-4-hydroxypentanedioic acid + RESID-systematic + + + 4-hydroxy-L-glutamic acid + RESID-name + + + gamma-hydroxy glutaminic acid + RESID-alternate + + + MOD_RES 4-hydroxyglutamate + UniProt-feature + + + threo-4-hydroxy-L-glutamic acid + RESID-alternate + + + + DiffAvg + 16.00 + + + + DiffFormula + C 0 H 0 N 0 O 1 + + + + DiffMono + 15.994915 + + + + Formula + C 5 H 7 N 1 O 4 + + + + MassAvg + 145.11 + + + + MassMono + 145.037508 + + + + Origin + E + + + + Source + natural + + + + TermSpec + none + + MOD:00425 + MOD:00906 + PSI-MOD + + + MOD:01435 + 2-(cystein-S-ylcarbonyl)-3-methyl-4-(glutam-5-yloxy)methylindole + + A protein modification that effectively results from forming an adduct between a cysteine residue, a glutamic acid residue and the indole compound 2-carboxy-3-methyl-4-hydroxymethyl--indole. + + 893891 + PubMed + + + AA0488 + RESID + + + Cross-link 2. + + 2-([(1R)-1-amino-1-carboxyeth-2-yl]sulfanyl)carbonyl-3-methyl-4-([(1S)-1-amino-1-carboxy-4-oxobutan-4-yl]oxy)methyl-1H-indole + RESID-systematic + + + 2-(cystein-S-ylcarbonyl)-3-methyl-4-(glutam-5-yloxy)methylindole + RESID-name + + + 2-(cystein-S-ylcarbonyl)-4-[(glutam-5-yloxy)methyl]-3-methyl-1H-indole + RESID-alternate + + + BINDING 3-methyl-4-hydroxymethylindole-2-carboxylic acid (covalent; via 2 links) + UniProt-feature + + + + DiffAvg + 169.18 + + + + DiffFormula + C 11 H 7 N 1 O 1 S 0 + + + + DiffMono + 169.052764 + + + + Formula + C 19 H 19 N 3 O 5 S 1 + + + + MassAvg + 401.44 + + + + MassMono + 401.104542 + + + + Origin + C, E + + + + Source + natural + + + + TermSpec + none + + MOD:00672 + MOD:00905 + MOD:00906 + PSI-MOD + + + MOD:01436 + cyclo[(prolylserin)-O-yl] cysteinate (Cys) + + A protein modification that effectively converts an L-cysteine residue to cyclo[(prolylserin)-O-yl] cysteinate. + + 7961166 + PubMed + + + AA0489#CYS + RESID + + + + (3,6-dioxopyrrolo[4,5-a]piperazin-2-yl)methyl cysteinate + RESID-alternate + + + [(3S,8aS)-1,4-dioxooctahydropyrrolo[1,2-a]pyrazin-3-yl]methyl (2R)-2-amino-3-sulfanylpropanoate + RESID-systematic + + + cyclo[(prolylserin)-O-yl] cysteinate + RESID-name + + + MOD_RES Cyclo[(prolylserin)-O-yl] cysteinate + UniProt-feature + + + + DiffAvg + 166.18 + + + + DiffFormula + C 8 H 10 N 2 O 2 S 0 + + + + DiffMono + 166.074228 + + + + Formula + C 11 H 16 N 3 O 4 S 1 + + + + MassAvg + 286.33 + + + + MassMono + 286.086152 + + + + Origin + C + + + + Source + natural + + + + TermSpec + C-term + + MOD:01629 + PSI-MOD + + + MOD:01437 + cyclo[(prolylserin)-O-yl] cysteinate (Cys-Pro-Ser cross-link) + + A protein modification that effectively converts an L-cysteine residue, an L-proline residue, and an L-serine residue to cyclo[(prolylserin)-O-yl] cysteinate. + + 7961166 + PubMed + + + AA0489#TRI + RESID + + + Cross-link 3. + + (3,6-dioxopyrrolo[4,5-a]piperazin-2-yl)methyl cysteinate + RESID-alternate + + + [(3S,8aS)-1,4-dioxooctahydropyrrolo[1,2-a]pyrazin-3-yl]methyl (2R)-2-amino-3-sulfanylpropanoate + RESID-systematic + + + cyclo[(prolylserin)-O-yl] cysteinate + RESID-name + + + MOD_RES Cyclo[(prolylserin)-O-yl] cysteinate + UniProt-feature + + + + DiffAvg + -18.02 + + + + DiffFormula + C 0 H -2 N 0 O -1 S 0 + + + + DiffMono + -18.010565 + + + + Formula + C 11 H 16 N 3 O 4 S 1 + + + + MassAvg + 286.33 + + + + MassMono + 286.086152 + + + + Origin + C, P, S + + + + Source + natural + + + + TermSpec + C-term + + MOD:00915 + MOD:00916 + MOD:01629 + PSI-MOD + + + MOD:01438 + S-[2-(pyridin-2-yl)ethyl]-L-cysteine + + A protein modification that effectively converts an L-cysteine residue to S-[2-(pyridin-2-yl)ethyl]-L-cysteine. + + 18369855 + PubMed + + + 18688235 + PubMed + + + From DeltaMass: (name misspelled "Pyridylethyl Cystenyl", and formula incorrect, N and O reversed) Formula: C10H12O2N1S1 Monoisotopic Mass Change: 208.067 Average Mass Change: 208.286 + + 2-PEC + PSI-MOD-alternate + + + 2-vinylpyridine derivatized cysteine residue + PSI-MOD-alternate + + + Pyridylethyl + PSI-MS-label + + + Pyridylethyl Cystenyl + DeltaMass-label + + + S-(pyridin-2-ylethyl)-L-cysteine + PSI-MOD-alternate + + + S-pyridylethylation + UniMod-description + + + + DiffAvg + 105.14 + + + + DiffFormula + C 7 H 7 N 1 + + + + DiffMono + 105.057849 + + + + Formula + C 10 H 12 N 2 O 1 S 1 + + + + MassAvg + 208.28 + + + + MassMono + 208.067034 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:00424 + PSI-MOD + + + MOD:01439 + S-[2-(pyridin-4-yl)ethyl]-L-cysteine + + A protein modification that effectively converts an L-cysteine residue to S-[2-(pyridin-4-yl)ethyl]-L-cysteine. + + 18688235 + PubMed + + + 6528972 + PubMed + + + + 4-PEC + PSI-MOD-alternate + + + Pyridylethyl + PSI-MS-label + + + Pyridylethyl Cystenyl + DeltaMass-label + + + S-(pyridin-4-ylethyl)-L-cysteine + PSI-MOD-alternate + + + S-pyridylethylation + UniMod-description + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:00424 + PSI-MOD + + + MOD:01440 + glutamyl semialdehyde + + A protein modification that effectively converts a source amino acid residue to an L-glutamyl semialdehyde. + + 18688235 + PubMed + + + + (S)-2-amino-5-oxopentanoic acid + PSI-MOD-alternate + + + L-glutamic gamma-semialdehyde + PSI-MOD-alternate + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + C 5 H 7 N 1 O 2 + + + + MassAvg + 113.12 + + + + MassMono + 113.047678 + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00859 + PSI-MOD + + + MOD:01441 + natural, standard, encoded residue + + A protein modification that inserts or replaces a residue with a natural, standard, encoded residue. + + 18688235 + PubMed + + + 6692818 + PubMed + + + PSI-MOD-slim + + + Origin + X + + + + Source + natural + + + + TermSpec + none + + MOD:00009 + PSI-MOD + + + MOD:01442 + 3-(O4'-L-tyrosyl)-L-valine + + A protein modification that effectively cross-links an L-valine residue and an L-tyrosine residue by an ether bond to form 3-(O4'-L-tyrosyl)-L-valine. + + 19321420 + PubMed + + + AA0490 + RESID + + + Cross-link 2. + + (2S)-2-amino-3-(4-[(2S)-2-amino-2-carboxyethyl]phenoxy)-3-methylbutanoic acid + RESID-systematic + + + 3-(O4'-L-tyrosyl)-L-valine + RESID-name + + + CROSSLNK 3-(O4'-tyrosyl)-valine (Val-Tyr) + UniProt-feature + + + + DiffAvg + -2.02 + + + + DiffFormula + C 0 H -2 N 0 O 0 + + + + DiffMono + -2.015650 + + + + Formula + C 14 H 16 N 2 O 3 + + + + MassAvg + 260.29 + + + + MassMono + 260.116092 + + + + Origin + V, Y + + + + Source + natural + + + + TermSpec + none + + MOD:00692 + MOD:00919 + MOD:00920 + PSI-MOD + + + MOD:01443 + tetrakis-L-glutamato bis-L-N1'-histidino lipid carboxylato manganese iron oxide + + A protein modification that effectively converts four L-glutamic acid residues and two L-histidine residues to tetrakis-L-glutamato bis-L-N1'-histidino lipid carboxylato manganese iron oxide. + + 19321420 + PubMed + + + AA0491 + RESID + + + Cross-link 6. It is not clear whether the lipid carboxylate is a cofactor or a substrate, and its identity is not certain. It was modeled as myristic acid [JSG]. + + + DiffAvg + 350.12 + + + + DiffFormula + C 14 Fe 1 H 23 Mn 1 N 0 O 3 + + + + DiffMono + 350.038251 + + + + FormalCharge + 1- + + + + Formula + C 46 Fe 1 H 65 Mn 1 N 10 O 17 + + + + MassAvg + 1140.86 + + + + MassMono + 1140.326447 + + + + Origin + E, E, E, E, H, H + + + + Source + natural + + + + TermSpec + none + + MOD:00438 + MOD:00738 + MOD:00740 + MOD:00906 + MOD:00909 + PSI-MOD + + + MOD:01444 + L-3,3-dihydroxyoalanine (Cys) + + A protein modification that effectively converts an L-cysteine residue to L-3,3-dihydroxyoalanine. + + 11435113 + PubMed + + + 17558559 + PubMed + + + AA0492#CYS + RESID + + + + (S)-2-amino-3,3-dihydroxypropanoic acid + RESID-systematic + + + 2-(dihydroxymethyl)glycine + RESID-alternate + + + 3,3-dihydroxy-L-alanine + RESID-name + + + 3,3-dihydroxyalanine + RESID-alternate + + + 3-hydroxy-L-serine + RESID-alternate + + + 3-oxoalanine hydrate + RESID-alternate + + + C(alpha)-formylglycine hydrate + RESID-misnomer + + + + DiffAvg + -0.06 + + + + DiffFormula + C 0 H 0 N 0 O 2 S -1 + + + + DiffMono + 0.017758 + + + + Formula + C 3 H 5 N 1 O 3 + + + + MassAvg + 103.08 + + + + MassMono + 103.026943 + + + + Origin + C + + + + Source + natural + + + + TermSpec + none + + MOD:00905 + MOD:01448 + PSI-MOD + + + MOD:01445 + L-3,3-dihydroxyoalanine (Ser) + + A protein modification that effectively converts an L-serine residue to L-3,3-dihydroxyoalanine. + + 11435113 + PubMed + + + 17558559 + PubMed + + + AA0492#SER + RESID + + + + (S)-2-amino-3,3-dihydroxypropanoic acid + RESID-systematic + + + 2-(dihydroxymethyl)glycine + RESID-alternate + + + 3,3-dihydroxy-L-alanine + RESID-name + + + 3,3-dihydroxyalanine + RESID-alternate + + + 3-hydroxy-L-serine + RESID-alternate + + + 3-oxoalanine hydrate + RESID-alternate + + + C(alpha)-formylglycine hydrate + RESID-misnomer + + + + DiffAvg + 16.00 + + + + DiffFormula + C 0 H 0 N 0 O 1 + + + + DiffMono + 15.994915 + + + + Formula + C 3 H 5 N 1 O 3 + + + + MassAvg + 103.08 + + + + MassMono + 103.026943 + + + + Origin + S + + + + Source + natural + + + + TermSpec + none + + MOD:00916 + MOD:01448 + PSI-MOD + + + MOD:01446 + N-(dihydroxymethyl)-L-methionine (fMet) + + A protein modification that effectively converts an N-formyl-Lmethionine residue to N-(dihydroxymethyl)-L-methionine. + + 12595263 + PubMed + + + 9159480 + PubMed + + + AA0493 + RESID + + + + (2S)-2-[(dihydroxymethyl)amino]-4-(methylsulfanyl)butanoic acid + RESID-systematic + + + N-(dihydroxymethyl)-L-methionine + RESID-name + + + N-formyl-L-methionine hydrate + RESID-alternate + + + N-orthoformylmethionine + RESID-alternate + + + + DiffAvg + 18.02 + + + + DiffFormula + C 0 H 2 N 0 O 1 S 0 + + + + DiffMono + 18.010565 + + + + Formula + C 6 H 12 N 1 O 3 S 1 + + + + MassAvg + 178.23 + + + + MassMono + 178.053789 + + + + Origin + MOD:00030 + + + + Source + hypothetical + + + + TermSpec + N-term + + MOD:01450 + + derives_from + MOD:000300 + + PSI-MOD + + + MOD:01447 + N-(dihydroxymethyl)-L-methionine (Met) + + A protein modification that effectively converts an L-methionine residue to N-(dihydroxymethyl)-L-methionine (not known as a natural, post-translational modification process). + + 12595263 + PubMed + + + 9159480 + PubMed + + + AA0493 + RESID + + + This entry is for the artifactual formation of N-(dihydroxymethyl)-L-methionine from methionine. For N-(dihydroxymethyl)-L-methionine derived from encoded N-formyl-L-methionine, use MOD:01446. + + (2S)-2-[(dihydroxymethyl)amino]-4-(methylsulfanyl)butanoic acid + RESID-systematic + + + N-(dihydroxymethyl)-L-methionine + RESID-name + + + N-formyl-L-methionine hydrate + RESID-alternate + + + N-orthoformylmethionine + RESID-alternate + + + + DiffAvg + 46.03 + + + + DiffFormula + C 1 H 2 N 0 O 2 S 0 + + + + DiffMono + 46.005479 + + + + Formula + C 6 H 12 N 1 O 3 S 1 + + + + MassAvg + 178.23 + + + + MassMono + 178.053789 + + + + Origin + M + + + + Source + hypothetical + + + + TermSpec + N-term + + MOD:00913 + PSI-MOD + + + MOD:01448 + L-3,3-dihydroxyoalanine + + A protein modification that effectively converts a source amino acid residue to L-3,3-dihydroxyoalanine. + + 11435113 + PubMed + + + 17558559 + PubMed + + + AA0492 + RESID + + + + (S)-2-amino-3,3-dihydroxypropanoic acid + RESID-systematic + + + 2-(dihydroxymethyl)glycine + RESID-alternate + + + 3,3-dihydroxy-L-alanine + RESID-name + + + 3,3-dihydroxyalanine + RESID-alternate + + + 3-hydroxy-L-serine + RESID-alternate + + + 3-oxoalanine hydrate + RESID-alternate + + + C(alpha)-formylglycine hydrate + RESID-misnomer + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + C 3 H 5 N 1 O 3 + + + + MassAvg + 103.08 + + + + MassMono + 103.026943 + + + + Origin + X + + + + Source + natural + + + + TermSpec + none + + MOD:00859 + PSI-MOD + + + MOD:01449 + L-3,3-dihydroxyoalanine (Oxoalanine) + + A protein modification that effectively converts an L-3-oxoalanine residue to L-3,3-dihydroxyoalanine. + + 11435113 + PubMed + + + 17558559 + PubMed + + + 18688235 + PubMed + + + + + DiffAvg + 18.02 + + + + DiffFormula + C 0 H 2 N 0 O 1 + + + + DiffMono + 18.010565 + + + + Formula + C 3 H 5 N 1 O 3 + + + + MassAvg + 103.08 + + + + MassMono + 103.026943 + + + + Origin + MOD:01169 + + + + Source + natural + + + + TermSpec + none + + MOD:01448 + + derives_from + MOD:011690 + + PSI-MOD + + + MOD:01450 + modified N-formyl-L-methionine residue + + A protein modification that modifies an N-formyl-L-methionine residue. + + 18688235 + PubMed + + + + + Origin + MOD:00030 + + + + TermSpec + N-term + + MOD:01157 + + derives_from + MOD:000300 + + PSI-MOD + + + MOD:01451 + O-phospho-L-serine arising from O-phosphopantetheine-L-serine after neutral loss of pantetheine + + A protein modification that converts an L-serine residue to O-phosphopantetheine-L-serine with secondary neutral loss of pantetheine resulting in O-phospho-L-serine. + + 17042494 + PubMed + + + 18688235 + PubMed + + + Phosphoserine is generated and detected after the facile elimination of pantetheine from the phosphopantetheine tertiary phosphodiester. See MOD:01452 for alternate origin. + PSI-MOD-slim + + + DiffAvg + 79.98 + + + + DiffFormula + C 0 H 1 N 0 O 3 P 1 + + + + DiffMono + 79.966331 + + + + Formula + C 3 H 6 N 1 O 5 P 1 + + + + MassAvg + 167.06 + + + + MassMono + 166.998359 + + + + Origin + S + + + + Source + artifact + + + + TermSpec + none + + MOD:00046 + MOD:00431 + + derives_from + MOD:001590 + + PSI-MOD + + + MOD:01452 + O-phosphopantetheine-L-serine with neutral loss of pantetheine + + Covalent modification of a peptide or protein amino acid O-phosphopantetheine-L-serine with secondary neutral loss of pantetheine resulting in O-phospho-L-serine. + + 17042494 + PubMed + + + 18688235 + PubMed + + + Phosphoserine is generated and detected after the facile elimination of pantethiene from the phosphopantethiene tertiary phosphodiester. See MOD:01451 for alternate origin. + PSI-MOD-slim + + + DiffAvg + -260.35 + + + + DiffFormula + C -11 H -20 N -2 O -3 P 0 S -1 + + + + DiffMono + -260.119464 + + + + Formula + C 3 H 6 N 1 O 5 P 1 + + + + MassAvg + 167.06 + + + + MassMono + 166.998359 + + + + Origin + MOD:00159 + + + + Source + artifact + + + + TermSpec + none + + MOD:00046 + MOD:00431 + + derives_from + MOD:001590 + + PSI-MOD + + + MOD:01453 + L-glutamic acid 5-methyl ester + + A protein modification that effectively converts a source amino acid residue to L-glutamate 5-methyl ester. + + AA0072 + RESID + + + PSI-MOD-slim + + (2S)-2-amino-5-methoxy-5-oxopentanoic acid + RESID-systematic + + + (5)-methyl L-hydrogen glutamate + RESID-alternate + + + 2-aminopentanedioic acid 5-methyl ester + RESID-alternate + + + 5-methyl esterified L-glutamic acid + PSI-MOD-alternate + + + 5-methyl L-2-aminoglutarate + RESID-alternate + + + 5-methyl L-glutamate + RESID-alternate + + + glutamic acid 5-methyl ester + RESID-alternate + + + glutamic acid gamma-methyl ester + RESID-alternate + + + L-glutamic acid 5-methyl ester + RESID-name + + + O-methyl Glutamyl + DeltaMass-label + + + O5MeGlu + PSI-MOD-label + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + C 6 H 9 N 1 O 3 + + + + MassAvg + 143.14 + + + + MassMono + 143.058243 + + + + Origin + X + + + + Source + natural + + + + TermSpec + none + + MOD:00393 + MOD:00599 + MOD:00713 + MOD:00859 + PSI-MOD + + + MOD:01454 + N-(DNA-1',2'-dideoxyribos-1'-ylidene)-L-prolinium + + A protein modification that effectively crosslinks an N-terminal L-proline residue and a strand of DNA at the C-1 of a ribose, freeing the nucleotide base and forming N-(DNA-1',2'-dideoxyribos-1'-ylidene)-L-prolinium. + + 10833024 + PubMed + + + 11847126 + PubMed + + + 9030608 + PubMed + + + AA0494 + RESID + + + This linkage is not a Schiff-base [JSG]. + + (1Z,2S)-2-carboxy-1-[(3R,4R)-3,4-dihydroxy-5-(phosphonooxy)pentylidene]pyrrolidinium + RESID-systematic + + + DNA glycosylase proline Schiff base intermediate + RESID-misnomer + + + N-(DNA-1',2'-dideoxyribos-1'-ylidene)-L-prolinium + RESID-name + + + + DiffAvg + 179.09 + + + + DiffFormula + C 5 H 8 N 0 O 5 P 1 + + + + DiffMono + 179.010386 + + + + FormalCharge + 1+ + + + + Formula + C 10 H 16 N 1 O 6 P 1 + + + + MassAvg + 277.21 + + + + MassMono + 277.070975 + + + + Origin + P + + + + Source + natural + + + + TermSpec + N-term + + MOD:00750 + MOD:00915 + PSI-MOD + + + MOD:01455 + O-phosphorylated residue + + A protein modification that effectively replaces a residue hydroxyl or carboxyl hydrogen with a phosphono group (H2PO3 or 'phosphate'). + + 18688235 + PubMed + + + PSI-MOD-slim + + OPhosRes + PSI-MOD-label + + + + DiffAvg + 79.98 + + + + DiffFormula + H 1 O 3 P 1 + + + + DiffMono + 79.966331 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + none + + + + TermSpec + none + + MOD:00696 + PSI-MOD + + + MOD:01456 + N-phosphorylated residue + + A protein modification that effectively replaces a hydrogen atom of a residue amino or imino group with a phosphono group (H2PO3 or 'phosphate'). + + 18688235 + PubMed + + + PSI-MOD-slim + + OPhosRes + PSI-MOD-label + + + + DiffAvg + 79.98 + + + + DiffFormula + H 1 O 3 P 1 + + + + DiffMono + 79.966331 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + none + + + + TermSpec + none + + MOD:00696 + PSI-MOD + + + MOD:01457 + L-cysteine (Ser) + + A protein modification that effectively converts an L-serine residue to L-cysteine (not known as a natural, post-translational modification process). + + 1849824 + PubMed + + + 18688235 + PubMed + + + + Cys(Ser) + PSI-MOD-label + + + + DiffAvg + -16.06 + + + + DiffFormula + C 0 H 0 N 0 O 1 S -1 + + + + DiffMono + -15.977156 + + + + Formula + C 3 H 5 N 1 O 1 S 1 + + + + MassAvg + 103.14 + + + + MassMono + 103.009185 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:00014 + MOD:00749 + MOD:00916 + PSI-MOD + + + MOD:01458 + alpha-amino acetylated residue + + A protein modification that effectively replaces a residue alpha-amino- or alpha-imino-hydrogen with an acetyl group. + + 1#N-term + UniMod + + + PSI-MOD-slim + + N2AcRes + PSI-MOD-label + + + ntermacetyl + OMSSA-label + + + + DiffAvg + 42.04 + + + + DiffFormula + C 2 H 2 N 0 O 1 + + + + DiffMono + 42.010565 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + natural + + + + TermSpec + N-term + + MOD:00408 + MOD:01696 + PSI-MOD + + + MOD:01459 + 4x(2)H labeled alpha-dimethylamino N-terminal residue + + A protein modification that effectively converts an N-terminal residue to an 4x(2)H labeled alpha-dimethylamino N-terminal residue. + + 14670044 + PubMed + + + 199#N-term + UniMod + + + Supposed to be alpha-amino and Lys-N6 derivatized by C(2)H2O and reduction. + PSI-MOD-slim + + DiMethyl-CHD2 + UniMod-description + + + Dimethyl:2H(4) + PSI-MS-label + + + mod190 + OMSSA-label + + + + DiffAvg + 32.06 + + + + DiffFormula + C 2 (2)H 4 + + + + DiffMono + 32.056407 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + N-term + + MOD:00552 + PSI-MOD + + + MOD:01460 + alpha-amino methylated residue + + A protein modification that effectively replaces a residue alpha-amino- or alpha-imino-hydrogen with a methyl group. + + 18688235 + PubMed + + + PSI-MOD-slim + + N2MeRes + PSI-MOD-label + + + + Origin + X + + + + Source + natural + + + + TermSpec + N-term + + MOD:00602 + PSI-MOD + + + MOD:01461 + N-methylated alanine + + A protein modification that effectively replaces an L-alanine alpha amino hydrogen with a methyl group. + + 18688235 + PubMed + + + PSI-MOD-slim + + + Origin + A + + + + Source + natural + + + + TermSpec + none + + MOD:00665 + MOD:01460 + PSI-MOD + + + MOD:01462 + N-methylated proline + + A protein modification that effectively replaces an L-proline alpha imino hydrogen with a methyl group. + + 18688235 + PubMed + + + PSI-MOD-slim + + + Origin + P + + + + Source + natural + + + + TermSpec + N-term + + MOD:00712 + MOD:01460 + PSI-MOD + + + MOD:01463 + N-methylated methionine + + A protein modification that effectively replaces an L-methionine alpha amino hydrogen with a methyl group. + + 18688235 + PubMed + + + PSI-MOD-slim + + + Origin + M + + + + Source + natural + + + + TermSpec + N-term + + MOD:00716 + MOD:01460 + PSI-MOD + + + MOD:01464 + protonated L-methionine (L-methioninium) residue + + A protein modification that effectively converts an L-methionine residue to an L-methioninium (protonated L-methionine). + + 18688235 + PubMed + + + PSI-MOD-slim + + + DiffAvg + 1.01 + + + + DiffFormula + C 0 H 1 N 0 O 0 S 0 + + + + DiffMono + 1.007276 + + + + FormalCharge + 1+ + + + + Formula + C 5 H 11 N 1 O 1 S 1 + + + + MassAvg + 133.21 + + + + MassMono + 133.055586 + + + + Origin + M + + + + Source + natural + + + + TermSpec + N-term + + MOD:00913 + MOD:01700 + PSI-MOD + + + MOD:01465 + N,N,N-trimethyl-L-methionine (from L-methioninium) + + A protein modification that effectively converts an L-methioninium (protonated L-methionine) residue to an N6,N6,N6-trimethyl-L-methionine. + + 18688235 + PubMed + + + For amino acids residues, amine trimethylation can effectively only be accomplished with an aminium, protonated primary amino, group. This process accounts only for trimethylation and not protonation. The alternative N2Me3+Met process (MOD:01382) accounts for both protonation and trimethylation. + PSI-MOD-slim + + N2Me3Met + PSI-MOD-label + + + + DiffAvg + 42.08 + + + + DiffFormula + C 3 H 6 N 0 O 0 S 0 + + + + DiffMono + 42.046402 + + + + FormalCharge + 1+ + + + + Formula + C 8 H 17 N 1 O 1 S 1 + + + + MassAvg + 175.29 + + + + MassMono + 175.102537 + + + + Origin + MOD:001464 + + + + Source + natural + + + + TermSpec + N-term + + MOD:01687 + + derives_from + MOD:014640 + + PSI-MOD + + + MOD:01466 + menadione quinone derivative - site C + + modification from UniMod Chemical derivative + + 15939799 + PubMed + + + 302#K + UniMod + + + + Menadione + UniMod-interim + + + Menadione quinone derivative + UniMod-description + + + + DiffAvg + 170.17 + + + + DiffFormula + C 11 H 6 O 2 + + + + DiffMono + 170.036779 + + + + Formula + C 14 H 11 N 1 O 3 S 1 + + + + MassAvg + 273.31 + + + + MassMono + 273.045964 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:00621 + MOD:00905 + PSI-MOD + + + MOD:01467 + menadione quinone derivative - site K + + modification from UniMod Chemical derivative + + 15939799 + PubMed + + + 302#K + UniMod + + + + Menadione + UniMod-interim + + + Menadione quinone derivative + UniMod-description + + + + DiffAvg + 170.17 + + + + DiffFormula + C 11 H 6 O 2 + + + + DiffMono + 170.036779 + + + + Formula + C 17 H 18 N 2 O 3 + + + + MassAvg + 298.34 + + + + MassMono + 298.131742 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00621 + MOD:00912 + PSI-MOD + + + MOD:01468 + L-selenocysteinyl molybdenum bis(molybdopterin guanine dinucleotide) (Cys) + + A protein modification that effectively converts an L-cysteine residue to L-selenocysteinyl molybdenum bis(molybdopterin guanine dinucleotide) (not known as a natural, post-translational modification process). + + 14235557 + PubMed + + + 2211698 + PubMed + + + 8052647 + PubMed + + + 9036855 + PubMed + + + AA0248#CYS + RESID + + + 415 + UniMod + + + This entry is for the artifactual formation of L-selenocysteinyl molybdenum bis(molybdopterin guanine dinucleotide) from cysteine. For natural formation from L-selenocysteine, use MOD:00253. + + 2-amino-5,6-dimercapto-7-methyl-3,7,8a,9-tetrahydro-8-oxa-1,3,9,10-tetraazaanthracen-4-one guanosine dinucleotide + RESID-alternate + + + bis[8-amino-1a,2,4a,5,6,7,10-heptahydro-2-(trihydrogen diphosphate 5'-ester with guanosine)methyl-6-oxo-3,4-disulfanyl-pteridino[6,7-5,6]pyranoato-S3,S4]-selenocysteinyl-Se-molybdenum + RESID-systematic + + + formate dehydrogenase selenocysteine molybdenum cofactor + RESID-alternate + + + L-selenocysteinyl molybdenum bis(molybdopterin guanine dinucleotide) + UniMod-description + + + L-selenocysteinyl molybdenum bis(molybdopterin guanine dinucleotide) + RESID-name + + + molybdopterin-se + UniMod-interim + + + MolybdopterinGD+Delta:S(-1)Se(1) + PSI-MS-label + + + + DiffAvg + 1618.93 + + + + DiffFormula + C 40 H 47 Mo 1 N 20 O 26 P 4 S 3 Se 1 + + + + DiffMono + 1620.930226 + + + + Formula + C 43 H 52 Mo 1 N 21 O 27 P 4 S 4 Se 1 + + + + MassAvg + 1722.07 + + + + MassMono + 1723.939410 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:00744 + MOD:00905 + PSI-MOD + + + MOD:01469 + L-selenocysteinyl tungsten bis(molybdopterin guanine dinucleotide) (Cys) + + A protein modification that effectively converts an L-cysteine residue to L-selenocysteinyl tungsten bis(molybdopterin guanine dinucleotide) (not known as a natural, post-translational modification process). + + 11372198 + PubMed + + + 12220497 + PubMed + + + AA0376#CYS + RESID + + + This entry is for the artifactual formation of L-selenocysteinyl tungsten bis(molybdopterin guanine dinucleotide) from cysteine. For natural formation from L-selenocysteine, use MOD:00381. + + + DiffAvg + 1738.88 + + + + DiffFormula + C 40 H 47 N 20 O 26 P 4 S 4 Se 1 W 1 + + + + DiffMono + 1738.947820 + + + + Formula + C 43 H 52 N 21 O 27 P 4 S 5 Se 1 W 1 + + + + MassAvg + 1842.02 + + + + MassMono + 1841.957004 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:00746 + MOD:00748 + MOD:00905 + PSI-MOD + + + MOD:01470 + (E)-dehydrobutyrine (Thr) + + A protein modification that effectively converts an L-threonine residue to (E)-dehydrobutyrine. + + 0 + DeltaMass + + + 1547888 + PubMed + + + 20805503 + PubMed + + + 3769923 + PubMed + + + AA0547 + RESID + + + PSI-MOD-slim + + (2E)-2-aminobut-2-enoic acid + RESID-systematic + + + (E)-2-amino-2-butenoic acid + RESID-alternate + + + (E)-2-aminobutenoic acid + RESID-alternate + + + (E)-dehydrobutyrine + RESID-name + + + (E)dHAbu + PSI-MOD-label + + + 2,3-didehydrobutyrine + RESID-alternate + + + 3-methyldehydroalanine + RESID-alternate + + + alpha,beta-dehydroaminobutyric acid + RESID-alternate + + + anhydrothreonine + RESID-alternate + + + Dehydrated + UniMod-interim + + + Dehydration + UniMod-description + + + Dehydroamino butyric acid + DeltaMass-label + + + Dhb + RESID-alternate + + + methyl-dehydroalanine + RESID-alternate + + + MOD_RES (E)-2,3-didehydrobutyrine + UniProt-feature + + + + DiffAvg + -18.02 + + + + DiffFormula + C 0 H -2 N 0 O -1 + + + + DiffMono + -18.010565 + + + + Formula + C 4 H 5 N 1 O 1 + + + + MassAvg + 83.09 + + + + MassMono + 83.037114 + + + + Origin + T + + + + Source + natural + + + + TermSpec + none + + MOD:00190 + PSI-MOD + + + MOD:01471 + (Z)-dehydrobutyrine (Thr) + + A protein modification that effectively converts an L-threonine residue to (Z)-dehydrobutyrine. + + 0 + DeltaMass + + + 1547888 + PubMed + + + 3769923 + PubMed + + + AA0182 + RESID + + + PSI-MOD-slim + + (2Z)-2-aminobut-2-enoic acid + RESID-systematic + + + (Z)-2-amino-2-butenoic acid + RESID-alternate + + + (Z)-2-aminobutenoic acid + RESID-alternate + + + (Z)-dehydrobutyrine + RESID-name + + + (Z)dHAbu + PSI-MOD-label + + + 2,3-didehydrobutyrine + RESID-alternate + + + 3-methyldehydroalanine + RESID-alternate + + + alpha,beta-dehydroaminobutyric acid + RESID-alternate + + + anhydrothreonine + RESID-alternate + + + Dehydrated + UniMod-interim + + + Dehydration + UniMod-description + + + Dehydroamino butyric acid + DeltaMass-label + + + Dhb + RESID-alternate + + + methyl-dehydroalanine + RESID-alternate + + + MOD_RES (Z)-2,3-didehydrobutyrine + UniProt-feature + + + + DiffAvg + -18.02 + + + + DiffFormula + C 0 H -2 N 0 O -1 + + + + DiffMono + -18.010565 + + + + Formula + C 4 H 5 N 1 O 1 + + + + MassAvg + 83.09 + + + + MassMono + 83.037114 + + + + Origin + T + + + + Source + natural + + + + TermSpec + none + + MOD:00190 + PSI-MOD + + + MOD:01472 + reduced residue + + A protein modification that effectively either adds neutral hydrogen atoms (proton and electron), or removes oxygen atoms from a residue with or without the addition of hydrogen atoms. + + 18688235 + PubMed + + + PSI-MOD-slim + + RedRes + PSI-MOD-label + + MOD:01156 + PSI-MOD + + + MOD:01473 + hydrogenated residue + + A protein modification that effectively adds neutral hydrogen atoms (proton and electron) to a residue. + + 18688235 + PubMed + + + PSI-MOD-slim + + HRes + PSI-MOD-label + + MOD:01472 + PSI-MOD + + + MOD:01474 + O-[S-(carboxymethyl)phosphopantetheine]-L-serine + + A protein modification that effectively converts an L-serine residue to O-[S-(carboxymethyl)phosphopantetheine]-L-serine. + + 18688235 + PubMed + + + This modification results from the derivatization of the pantetheine sulfhydryl with iodoacetic acid [JSG]. + + + DiffAvg + 398.37 + + + + DiffFormula + C 13 H 23 N 2 O 8 P 1 S 1 + + + + DiffMono + 398.091273 + + + + Formula + C 16 H 28 N 3 O 10 P 1 S 1 + + + + MassAvg + 485.44 + + + + MassMono + 485.123302 + + + + Origin + S + + + + Source + artifact + + + + TermSpec + none + + MOD:00399 + MOD:00861 + MOD:00916 + + derives_from + MOD:001590 + + PSI-MOD + + + MOD:01475 + O-[S-(carboxamidomethyl)phosphopantetheine]-L-serine + + A protein modification that effectively converts an L-serine residue to O-[S-(carboxamidomethyl)phosphopantetheine]-L-serine. + + 18688235 + PubMed + + + This modification results from the derivatization of the pantetheine sulfhydryl with iodoacetamide [JSG]. + + + DiffAvg + 397.38 + + + + DiffFormula + C 13 H 24 N 3 O 7 P 1 S 1 + + + + DiffMono + 397.107258 + + + + Formula + C 16 H 29 N 4 O 9 P 1 S 1 + + + + MassAvg + 484.46 + + + + MassMono + 484.139286 + + + + Origin + S + + + + Source + artifact + + + + TermSpec + none + + MOD:00397 + MOD:00861 + MOD:00916 + + derives_from + MOD:001590 + + PSI-MOD + + + MOD:01476 + 2'-fluoro-L-phenylalanine + + A protein modification that effectively converts an L-phenylalanine residue to an 2'-fluoro-L-fluorophenylalanine. + + 18688235 + PubMed + + + 8172898 + PubMed + + + + 2-fluorophenylalanine + PSI-MOD-alternate + + + o-fluorophenylalanine + PSI-MOD-alternate + + + ortho-fluorophenylalanine + PSI-MOD-alternate + + + + DiffAvg + 17.99 + + + + DiffFormula + C 0 F 1 H -1 N 0 O 0 + + + + DiffMono + 17.990578 + + + + Formula + C 9 F 1 H 8 N 1 O 1 + + + + MassAvg + 165.17 + + + + MassMono + 165.058992 + + + + Origin + F + + + + Source + artifact + + + + TermSpec + none + + MOD:01227 + PSI-MOD + + + MOD:01477 + 3'-fluoro-L-phenylalanine + + A protein modification that effectively converts an L-phenylalanine residue to an 3'-fluoro-L-fluorophenylalanine. + + 18688235 + PubMed + + + 8172898 + PubMed + + + + 3-fluorophenylalanine + PSI-MOD-alternate + + + m-fluorophenylalanine + PSI-MOD-alternate + + + meta-fluorophenylalanine + PSI-MOD-alternate + + + + DiffAvg + 17.99 + + + + DiffFormula + C 0 F 1 H -1 N 0 O 0 + + + + DiffMono + 17.990578 + + + + Formula + C 9 F 1 H 8 N 1 O 1 + + + + MassAvg + 165.17 + + + + MassMono + 165.058992 + + + + Origin + F + + + + Source + artifact + + + + TermSpec + none + + MOD:01227 + PSI-MOD + + + MOD:01478 + 4'-fluoro-L-phenylalanine + + A protein modification that effectively converts an L-phenylalanine residue into an 4'-fluoro-L-fluorophenylalanine. + + 18688235 + PubMed + + + 8172898 + PubMed + + + + 4-fluorophenylalanine + PSI-MOD-alternate + + + p-fluorophenylalanine + PSI-MOD-alternate + + + para-fluorophenylalanine + PSI-MOD-alternate + + + rho-fluorophenylalanine + PSI-MOD-alternate + + + + DiffAvg + 17.99 + + + + DiffFormula + C 0 F 1 H -1 N 0 O 0 + + + + DiffMono + 17.990578 + + + + Formula + C 9 F 1 H 8 N 1 O 1 + + + + MassAvg + 165.17 + + + + MassMono + 165.058992 + + + + Origin + F + + + + Source + artifact + + + + TermSpec + none + + MOD:01227 + PSI-MOD + + + MOD:01479 + 4'-fluoro-L-tryptophan + + A protein modification that effectively converts an L-tryptophan residue into an 4'-fluoro-L-tryptophan. + + 18688235 + PubMed + + + 8172898 + PubMed + + + + 4-fluorotryptophan + PSI-MOD-alternate + + + + DiffAvg + 17.99 + + + + DiffFormula + F 1 H -1 + + + + DiffMono + 17.990578 + + + + Formula + C 11 F 1 H 9 N 2 O 1 + + + + MassAvg + 204.20 + + + + MassMono + 204.069891 + + + + Origin + W + + + + Source + artifact + + + + TermSpec + none + + MOD:01226 + PSI-MOD + + + MOD:01480 + 5'-fluoro-L-tryptophan + + A protein modification that effectively converts an L-tryptophan residue into an 5'-fluoro-L-tryptophan. + + 18688235 + PubMed + + + 8172898 + PubMed + + + + 5-fluorotryptophan + PSI-MOD-alternate + + + + DiffAvg + 17.99 + + + + DiffFormula + F 1 H -1 + + + + DiffMono + 17.990578 + + + + Formula + C 11 F 1 H 9 N 2 O 1 + + + + MassAvg + 204.20 + + + + MassMono + 204.069891 + + + + Origin + W + + + + Source + artifact + + + + TermSpec + none + + MOD:01226 + PSI-MOD + + + MOD:01481 + 6'-fluoro-L-tryptophan + + A protein modification that effectively converts an L-tryptophan residue into an 6'-fluoro-L-tryptophan. + + 18688235 + PubMed + + + 8172898 + PubMed + + + + 6-fluorotryptophan + PSI-MOD-alternate + + + + DiffAvg + 17.99 + + + + DiffFormula + F 1 H -1 + + + + DiffMono + 17.990578 + + + + Formula + C 11 F 1 H 9 N 2 O 1 + + + + MassAvg + 204.20 + + + + MassMono + 204.069891 + + + + Origin + W + + + + Source + artifact + + + + TermSpec + none + + MOD:01226 + PSI-MOD + + + MOD:01482 + calcium containing modified residue + + A protein modification that effectively substitutes a calcium atom or a cluster containing calcium for hydrogen atoms, or that coordinates a calcium ion. + + 18688235 + PubMed + + + PSI-MOD-slim + + CaRes + PSI-MOD-label + + MOD:00698 + PSI-MOD + + + MOD:01483 + O-formylated residue + + A protein modification that effectively replaces a residue hydroxyl group with a formyloxy group. + + 18688235 + PubMed + + + + OFoRes + PSI-MOD-label + + + + DiffAvg + 28.01 + + + + DiffFormula + C 1 O 1 + + + + DiffMono + 27.994915 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00493 + MOD:00671 + PSI-MOD + + + MOD:01484 + N6-(L-isoglutamyl)-L-lysine (Glu) + + A protein modification that effectively crosslinks an L-glutamic acid residue and an L-lysine residue by an isopeptide bond to form N6-(L-isoglutamyl)-L-lysine and the release of water. + + 21863 + ChEBI + + + 19015515 + PubMed + + + AA0124#GLU + RESID + + + Cross-link 2. This cross-link is usually made by glutamine and releases ammonia, rather than glutamic acid and requiring the consumption of ATP. + + (2S)-2-amino-6-([(4S)-4-amino-4-carboxybutanoyl]amino)hexanoic acid + RESID-systematic + + + 2-azanyl-6-([4-azanyl-4-carboxybutanoyl]azanyl)hexanoic acid + RESID-alternate + + + 5-glutamyl N6-lysine + RESID-alternate + + + N alpha -(gamma-Glutamyl)-lysine + DeltaMass-label + + + N(epsilon)-(gamma-glutamyl)lysine + RESID-alternate + + + N6-(L-isoglutamyl)-L-lysine + RESID-name + + + + DiffAvg + -18.02 + + + + DiffFormula + C 0 H -2 N 0 O -1 + + + + DiffMono + -18.010565 + + + + Formula + C 11 H 17 N 3 O 3 + + + + MassAvg + 239.27 + + + + MassMono + 239.126991 + + + + Origin + K, E + + + + Source + natural + + + + TermSpec + none + + MOD:00906 + MOD:00954 + MOD:01630 + PSI-MOD + + + MOD:01485 + iTRAQ4plex-114 reporter+balance reagent acylated residue + + A protein modification that effectively replaces a hydrogen atom of a residue with the Applied Biosystems iTRAQ4plex-114 reporter+balance group. + + 532 + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a carbonyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + Accurate mass for 114 + UniMod-description + + + Applied Biosystems iTRAQ(TM) multiplexed quantitation chemistry + UniMod-alternate + + + iTRAQ114 + UniMod-interim + + + iTRAQ4plex114 + PSI-MS-label + + + + DiffAvg + 144.11 + + + + DiffFormula + (12)C 5 (13)C 2 H 12 N 2 (18)O 1 + + + + DiffMono + 144.105919 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:01428 + MOD:01430 + MOD:01516 + MOD:01518 + PSI-MOD + + + MOD:01486 + iTRAQ4plex-114 reporter+balance reagent acylated N-terminal + + A protein modification that effectively replaces a hydrogen atom of a protein N-terminal with the Applied Biosystems iTRAQ4plex-114 reporter+balance group. + + 532#N-term + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a carbonyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + Accurate mass for 114 + UniMod-description + + + Applied Biosystems iTRAQ(TM) multiplexed quantitation chemistry + UniMod-alternate + + + iTRAQ114 + UniMod-interim + + + iTRAQ114nterm + OMSSA-label + + + iTRAQ4plex114 + PSI-MS-label + + + + DiffAvg + 144.11 + + + + DiffFormula + (12)C 5 (13)C 2 H 12 N 2 (18)O 1 + + + + DiffMono + 144.105919 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + N-term + + MOD:01485 + MOD:01711 + PSI-MOD + + + MOD:01487 + iTRAQ4plex-114 reporter+balance reagent N6-acylated lysine + + A protein modification that effectively replaces the N6'-hydrogen atom of a lysine residue with the Applied Biosystems iTRAQ4plex-114 reporter+balance group. + + 532#K + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a carbonyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + Accurate mass for 114 + UniMod-description + + + Applied Biosystems iTRAQ(TM) multiplexed quantitation chemistry + UniMod-alternate + + + iTRAQ114 + UniMod-interim + + + iTRAQ114K + OMSSA-label + + + iTRAQ4plex114 + PSI-MS-label + + + + DiffAvg + 144.11 + + + + DiffFormula + (12)C 5 (13)C 2 H 12 N 2 (18)O 1 + + + + DiffMono + 144.105919 + + + + Formula + (12)C 11 (13)C 2 H 24 N 4 (16)O 1 (18)O 1 + + + + MassAvg + 272.20 + + + + MassMono + 272.200882 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:01485 + MOD:01709 + MOD:01875 + PSI-MOD + + + MOD:01488 + iTRAQ4plex-114 reporter+balance reagent O4'-acylated tyrosine + + A protein modification that effectively replaces the O4'-hydrogen atom of a tyrosine residue with the Applied Biosystems iTRAQ4plex-114 reporter+balance group. + + 532#Y + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a carbonyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + Accurate mass for 114 + UniMod-description + + + Applied Biosystems iTRAQ(TM) multiplexed quantitation chemistry + UniMod-alternate + + + iTRAQ114 + UniMod-interim + + + iTRAQ114Y + OMSSA-label + + + iTRAQ4plex114 + PSI-MS-label + + + + DiffAvg + 144.11 + + + + DiffFormula + (12)C 5 (13)C 2 H 12 N 2 (18)O 1 + + + + DiffMono + 144.105919 + + + + Formula + (12)C 14 (13)C 2 H 21 N 3 (16)O 2 (18)O 1 + + + + MassAvg + 307.17 + + + + MassMono + 307.169248 + + + + Origin + Y + + + + Source + artifact + + + + TermSpec + none + + MOD:00919 + MOD:01485 + MOD:01713 + PSI-MOD + + + MOD:01489 + iTRAQ4plex-114 reporter+balance reagent N'-acylated histidine + + A protein modification that effectively replaces an N'-hydrogen atom of a histidine residue with the Applied Biosystems iTRAQ4plex-114 reporter+balance group. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a carbonyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + iTRAQ4plex114 + PSI-MS-label + + + + DiffAvg + 144.11 + + + + DiffFormula + (12)C 5 (13)C 2 H 12 N 2 (18)O 1 + + + + DiffMono + 144.105919 + + + + Formula + (12)C 11 (13)C 2 H 19 N 5 O 1 (18)O 1 + + + + MassAvg + 281.16 + + + + MassMono + 281.164831 + + + + Origin + H + + + + Source + artifact + + + + TermSpec + none + + MOD:00909 + MOD:01485 + MOD:01709 + PSI-MOD + + + MOD:01490 + iTRAQ4plex-114 reporter+balance reagent O3-acylated serine + + A protein modification that effectively replaces an O3-hydrogen atom of a serine residue with the Applied Biosystems iTRAQ4plex-114 reporter+balance group. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a carbonyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + iTRAQ4plex114 + PSI-MS-label + + + + DiffAvg + 144.11 + + + + DiffFormula + (12)C 5 (13)C 2 H 12 N 2 (18)O 1 + + + + DiffMono + 144.105919 + + + + Formula + (12)C 8 (13)C 2 H 17 N 3 O 2 (18)O 1 + + + + MassAvg + 231.14 + + + + MassMono + 231.137947 + + + + Origin + S + + + + Source + artifact + + + + TermSpec + none + + MOD:00916 + MOD:01485 + MOD:01713 + PSI-MOD + + + MOD:01491 + iTRAQ4plex-114 reporter+balance reagent O3-acylated threonine + + A protein modification that effectively replaces an O3-hydrogen atom of a threonine residue with the Applied Biosystems iTRAQ4plex-114 reporter+balance group. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a carbonyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + iTRAQ4plex114 + PSI-MS-label + + + + DiffAvg + 144.11 + + + + DiffFormula + (12)C 5 (13)C 2 H 12 N 2 (18)O 1 + + + + DiffMono + 144.105919 + + + + Formula + (12)C 9 (13)C 2 H 19 N 3 O 2 (18)O 1 + + + + MassAvg + 245.15 + + + + MassMono + 245.153598 + + + + Origin + T + + + + Source + artifact + + + + TermSpec + none + + MOD:00917 + MOD:01485 + MOD:01713 + PSI-MOD + + + MOD:01492 + iTRAQ4plex-115 reporter+balance reagent acylated residue + + A protein modification that effectively replaces a hydrogen atom of a residue with the Applied Biosystems iTRAQ4plex-115 reporter+balance group. + + 533 + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a carbonyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + Accurate mass for 115 + UniMod-description + + + Applied Biosystems iTRAQ(TM) multiplexed quantitation chemistry + UniMod-alternate + + + iTRAQ115 + UniMod-interim + + + iTRAQ4plex115 + PSI-MS-label + + + + DiffAvg + 144.10 + + + + DiffFormula + (12)C 6 (13)C 1 H 12 (14)N 1 (15)N 1 (18)O 1 + + + + DiffMono + 144.099599 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:01428 + MOD:01429 + MOD:01430 + MOD:01516 + MOD:01518 + PSI-MOD + + + MOD:01493 + iTRAQ4plex-115 reporter+balance reagent acylated N-terminal + + A protein modification that effectively replaces a hydrogen atom of a protein N-terminal with the Applied Biosystems iTRAQ4plex-115 reporter+balance group. + + 533#N-term + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a carbonyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + Accurate mass for 115 + UniMod-description + + + Applied Biosystems iTRAQ(TM) multiplexed quantitation chemistry + UniMod-alternate + + + iTRAQ115 + UniMod-interim + + + iTRAQ115nterm + OMSSA-label + + + iTRAQ4plex115 + PSI-MS-label + + + + DiffAvg + 144.10 + + + + DiffFormula + (12)C 6 (13)C 1 H 12 (14)N 1 (15)N 1 (18)O 1 + + + + DiffMono + 144.099599 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + N-term + + MOD:01492 + MOD:01711 + PSI-MOD + + + MOD:01494 + iTRAQ4plex-115 reporter+balance reagent N6-acylated lysine + + A protein modification that effectively replaces the N6'-hydrogen atom of a lysine residue with the Applied Biosystems iTRAQ4plex-115 reporter+balance group. + + 533#K + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a carbonyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + Accurate mass for 115 + UniMod-description + + + Applied Biosystems iTRAQ(TM) multiplexed quantitation chemistry + UniMod-alternate + + + iTRAQ115 + UniMod-interim + + + iTRAQ115K + OMSSA-label + + + iTRAQ4plex115 + PSI-MS-label + + + + DiffAvg + 144.10 + + + + DiffFormula + (12)C 6 (13)C 1 H 12 (14)N 1 (15)N 1 (18)O 1 + + + + DiffMono + 144.099599 + + + + Formula + (12)C 12 (13)C 1 H 24 (14)N 3 (15)N 1 (16)O 1 (18)O 1 + + + + MassAvg + 272.19 + + + + MassMono + 272.194562 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:01492 + MOD:01709 + MOD:01875 + PSI-MOD + + + MOD:01495 + iTRAQ4plex-115 reporter+balance reagent O4'-acylated tyrosine + + A protein modification that effectively replaces the O4'-hydrogen atom of a tyrosine residue with the Applied Biosystems iTRAQ4plex-115 reporter+balance group. + + 533#Y + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a carbonyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + Accurate mass for 115 + UniMod-description + + + Applied Biosystems iTRAQ(TM) multiplexed quantitation chemistry + UniMod-alternate + + + iTRAQ115 + UniMod-interim + + + iTRAQ115Y + OMSSA-label + + + iTRAQ4plex115 + PSI-MS-label + + + + DiffAvg + 144.10 + + + + DiffFormula + (12)C 6 (13)C 1 H 12 (14)N 1 (15)N 1 (18)O 1 + + + + DiffMono + 144.099599 + + + + Formula + (12)C 15 (13)C 1 H 21 (14)N 2 (15)N 1 (16)O 2 (18)O 1 + + + + MassAvg + 307.16 + + + + MassMono + 307.162928 + + + + Origin + Y + + + + Source + artifact + + + + TermSpec + none + + MOD:00919 + MOD:01492 + MOD:01713 + PSI-MOD + + + MOD:01496 + iTRAQ4plex-115 reporter+balance reagent N'-acylated histidine + + A protein modification that effectively replaces an N'-hydrogen atom of a histidine residue with the Applied Biosystems iTRAQ4plex-115 reporter+balance group. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a carbonyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + iTRAQ4plex115 + PSI-MS-label + + + + DiffAvg + 144.10 + + + + DiffFormula + (12)C 6 (13)C 1 H 12 (14)N 1 (15)N 1 (18)O 1 + + + + DiffMono + 144.099599 + + + + Formula + (12)C 12 (13)C 1 H 19 (14)N 4 (15)N 1 (16)O 1 (18)O 1 + + + + MassAvg + 281.16 + + + + MassMono + 281.158511 + + + + Origin + H + + + + Source + artifact + + + + TermSpec + none + + MOD:00909 + MOD:01492 + MOD:01709 + PSI-MOD + + + MOD:01497 + iTRAQ4plex-115 reporter+balance reagent O3-acylated serine + + A protein modification that effectively replaces an O3-hydrogen atom of a serine residue with the Applied Biosystems iTRAQ4plex-115 reporter+balance group. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a carbonyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + iTRAQ4plex115 + PSI-MS-label + + + + DiffAvg + 144.10 + + + + DiffFormula + (12)C 6 (13)C 1 H 12 (14)N 1 (15)N 1 (18)O 1 + + + + DiffMono + 144.099599 + + + + Formula + (12)C 9 (13)C 1 H 17 N 1 (14)N 1 (15)N 1 (16)O 2 (18)O 1 + + + + MassAvg + 231.13 + + + + MassMono + 231.131628 + + + + Origin + S + + + + Source + artifact + + + + TermSpec + none + + MOD:00916 + MOD:01492 + MOD:01713 + PSI-MOD + + + MOD:01498 + iTRAQ4plex-115 reporter+balance reagent O3-acylated threonine + + A protein modification that effectively replaces an O3-hydrogen atom of a threonine residue with the Applied Biosystems iTRAQ4plex-115 reporter+balance group. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a carbonyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + iTRAQ4plex115 + PSI-MS-label + + + + DiffAvg + 144.10 + + + + DiffFormula + (12)C 6 (13)C 1 H 12 (14)N 1 (15)N 1 (18)O 1 + + + + DiffMono + 144.099599 + + + + Formula + (12)C 10 (13)C 1 H 19 (14)N 2 (15)N 1 (16)O 2 (18)O 1 + + + + MassAvg + 245.15 + + + + MassMono + 245.147278 + + + + Origin + T + + + + Source + artifact + + + + TermSpec + none + + MOD:00917 + MOD:01492 + MOD:01713 + PSI-MOD + + + MOD:01499 + iTRAQ4plex-116 reporter+balance reagent acylated residue + + A protein modification that effectively replaces a hydrogen atom of a residue with the Applied Biosystems iTRAQ4plex-116 reporter+balance group. + + 214 + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a carbonyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + Applied Biosystems iTRAQ(TM) multiplexed quantitation chemistry + UniMod-alternate + + + iTRAQ + UniMod-interim + + + iTRAQ4plex + PSI-MS-label + + + Representative mass and accurate mass for 116 & 117 + UniMod-description + + + + DiffAvg + 144.10 + + + + DiffFormula + (12)C 4 (13)C 3 H 12 (14)N 1 (15)N 1 (16)O 1 + + + + DiffMono + 144.102062 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:01428 + MOD:01429 + MOD:01517 + MOD:01518 + PSI-MOD + + + MOD:01500 + iTRAQ4plex-116 reporter+balance reagent acylated N-terminal + + A protein modification that effectively replaces a hydrogen atom of a protein N-terminal with the Applied Biosystems iTRAQ4plex-116 reporter+balance group. + + 214#N-term + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a carbonyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + Applied Biosystems iTRAQ(TM) multiplexed quantitation chemistry + UniMod-alternate + + + iTRAQ + UniMod-interim + + + iTRAQ116nterm + OMSSA-label + + + iTRAQ4plex + PSI-MS-label + + + Representative mass and accurate mass for 116 & 117 + UniMod-description + + + + DiffAvg + 144.10 + + + + DiffFormula + (12)C 4 (13)C 3 H 12 (14)N 1 (15)N 1 (16)O 1 + + + + DiffMono + 144.102062 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + N-term + + MOD:01499 + MOD:01711 + PSI-MOD + + + MOD:01501 + iTRAQ4plex-116 reporter+balance reagent N6-acylated lysine + + A protein modification that effectively replaces the N6'-hydrogen atom of a lysine residue with the Applied Biosystems iTRAQ4plex-116 reporter+balance group. + + 214#K + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a carbonyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + Applied Biosystems iTRAQ(TM) multiplexed quantitation chemistry + UniMod-alternate + + + iTRAQ + UniMod-interim + + + iTRAQ116K + OMSSA-label + + + iTRAQ4plex + PSI-MS-label + + + Representative mass and accurate mass for 116 & 117 + UniMod-description + + + + DiffAvg + 144.10 + + + + DiffFormula + (12)C 4 (13)C 3 H 12 (14)N 1 (15)N 1 (16)O 1 + + + + DiffMono + 144.102062 + + + + Formula + (12)C 10 (13)C 3 H 24 N 2 (14)N 1 (15)N 1 O 1 (16)O 1 + + + + MassAvg + 272.20 + + + + MassMono + 272.197025 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:01499 + MOD:01709 + MOD:01875 + PSI-MOD + + + MOD:01502 + iTRAQ4plex-116 reporter+balance reagent O4'-acylated tyrosine + + A protein modification that effectively replaces the O4'-hydrogen atom of a tyrosine residue with the Applied Biosystems iTRAQ4plex-116 reporter+balance group. + + 214#Y + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a carbonyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + Applied Biosystems iTRAQ(TM) multiplexed quantitation chemistry + UniMod-alternate + + + iTRAQ + UniMod-interim + + + iTRAQ116Y + OMSSA-label + + + iTRAQ4plex + PSI-MS-label + + + Representative mass and accurate mass for 116 & 117 + UniMod-description + + + + DiffAvg + 144.10 + + + + DiffFormula + (12)C 4 (13)C 3 H 12 (14)N 1 (15)N 1 (16)O 1 + + + + DiffMono + 144.102062 + + + + Formula + (12)C 13 (13)C 3 H 21 N 1 (14)N 1 (15)N 1 O 2 (16)O 1 + + + + MassAvg + 307.17 + + + + MassMono + 307.165391 + + + + Origin + Y + + + + Source + artifact + + + + TermSpec + none + + MOD:00919 + MOD:01499 + MOD:01713 + PSI-MOD + + + MOD:01503 + iTRAQ4plex-116 reporter+balance reagent N'-acylated histidine + + A protein modification that effectively replaces an N'-hydrogen atom of a histidine residue with the Applied Biosystems iTRAQ4plex-116 reporter+balance group. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a carbonyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + iTRAQ4plex + PSI-MS-label + + + + DiffAvg + 144.10 + + + + DiffFormula + (12)C 4 (13)C 3 H 12 (14)N 1 (15)N 1 (16)O 1 + + + + DiffMono + 144.102062 + + + + Formula + (12)C 10 (13)C 3 H 19 N 3 (14)N 1 (15)N 1 (16)O 2 + + + + MassAvg + 281.16 + + + + MassMono + 281.160974 + + + + Origin + H + + + + Source + artifact + + + + TermSpec + none + + MOD:00909 + MOD:01499 + MOD:01709 + PSI-MOD + + + MOD:01504 + iTRAQ4plex-116 reporter+balance reagent O3-acylated serine + + A protein modification that effectively replaces an O3-hydrogen atom of a serine residue with the Applied Biosystems iTRAQ4plex-116 reporter+balance group. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a carbonyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + iTRAQ4plex + PSI-MS-label + + + + DiffAvg + 144.10 + + + + DiffFormula + (12)C 4 (13)C 3 H 12 (14)N 1 (15)N 1 (16)O 1 + + + + DiffMono + 144.102062 + + + + Formula + (12)C 7 (13)C 3 H 17 (14)N 2 (15)N 1 (16)O 3 + + + + MassAvg + 231.13 + + + + MassMono + 231.134091 + + + + Origin + S + + + + Source + artifact + + + + TermSpec + none + + MOD:00916 + MOD:01499 + MOD:01713 + PSI-MOD + + + MOD:01505 + iTRAQ4plex-116 reporter+balance reagent O3-acylated threonine + + A protein modification that effectively replaces an O3-hydrogen atom of a threonine residue with the Applied Biosystems iTRAQ4plex-116 reporter+balance group. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a carbonyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + iTRAQ4plex + PSI-MS-label + + + + DiffAvg + 144.10 + + + + DiffFormula + (12)C 4 (13)C 3 H 12 (14)N 1 (15)N 1 (16)O 1 + + + + DiffMono + 144.102062 + + + + Formula + (12)C 8 (13)C 3 H 19 (14)N 2 (15)N 1 (16)O 3 + + + + MassAvg + 245.15 + + + + MassMono + 245.149741 + + + + Origin + T + + + + Source + artifact + + + + TermSpec + none + + MOD:00917 + MOD:01499 + MOD:01713 + PSI-MOD + + + MOD:01506 + iTRAQ4plex-117, mTRAQ heavy, reporter+balance reagent acylated residue + + A protein modification that effectively replaces a hydrogen atom of a residue with the Applied Biosystems iTRAQ4plex-117 reporter+balance group. + + 214 + UniMod + + + 889 + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a carbonyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + Applied Biosystems iTRAQ(TM) multiplexed quantitation chemistry + UniMod-alternate + + + Applied Biosystems mTRAQ(TM) reagent + UniMod-alternate + + + iTRAQ + UniMod-interim + + + iTRAQ4plex + PSI-MS-label + + + mTRAQ heavy + UniMod-description + + + Representative mass and accurate mass for 116 & 117 + UniMod-description + + + + DiffAvg + 144.10 + + + + DiffFormula + (12)C 4 (13)C 3 H 12 (14)N 1 (15)N 1 (16)O 1 + + + + DiffMono + 144.102062 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:01428 + MOD:01429 + MOD:01517 + MOD:01518 + MOD:01863 + PSI-MOD + + + MOD:01507 + iTRAQ4plex-117, mTRAQ heavy, reporter+balance reagent acylated N-terminal + + A protein modification that effectively replaces a hydrogen atom of a protein N-terminal with the Applied Biosystems iTRAQ4plex-117 reporter+balance group. + + 214#N-term + UniMod + + + 889N-term + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a carbonyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + Applied Biosystems iTRAQ(TM) multiplexed quantitation chemistry + UniMod-alternate + + + Applied Biosystems mTRAQ(TM) reagent + UniMod-alternate + + + iTRAQ + UniMod-interim + + + iTRAQ117nterm + OMSSA-label + + + iTRAQ4plex + PSI-MS-label + + + mTRAQ heavy + UniMod-description + + + mTRAQ heavy on nterm + OMSSA-label + + + Representative mass and accurate mass for 116 & 117 + UniMod-description + + + + DiffAvg + 144.10 + + + + DiffFormula + (12)C 4 (13)C 3 H 12 (14)N 1 (15)N 1 (16)O 1 + + + + DiffMono + 144.102062 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + N-term + + MOD:01506 + MOD:01711 + PSI-MOD + + + MOD:01508 + iTRAQ4plex-117, mTRAQ heavy, reporter+balance reagent N6-acylated lysine + + A protein modification that effectively replaces the N6-hydrogen atom of a lysine residue with the Applied Biosystems iTRAQ4plex-117 reporter+balance group. + + 214#K + UniMod + + + 889#K + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a carbonyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + Applied Biosystems iTRAQ(TM) multiplexed quantitation chemistry + UniMod-alternate + + + Applied Biosystems mTRAQ(TM) reagent + UniMod-alternate + + + iTRAQ + UniMod-interim + + + iTRAQ117K + OMSSA-label + + + iTRAQ4plex + PSI-MS-label + + + mTRAQ heavy + UniMod-description + + + mTRAQ heavy on K + OMSSA-label + + + Representative mass and accurate mass for 116 & 117 + UniMod-description + + + + DiffAvg + 144.10 + + + + DiffFormula + (12)C 4 (13)C 3 H 12 (14)N 1 (15)N 1 (16)O 1 + + + + DiffMono + 144.102062 + + + + Formula + (12)C 10 (13)C 3 H 24 N 2 (14)N 1 (15)N 1 O 1 (16)O 1 + + + + MassAvg + 272.20 + + + + MassMono + 272.197025 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:01506 + MOD:01709 + MOD:01875 + PSI-MOD + + + MOD:01509 + iTRAQ4plex-117, mTRAQ heavy, reporter+balance reagent O4'-acylated tyrosine + + A protein modification that effectively replaces the O4'-hydrogen atom of a tyrosine residue with the Applied Biosystems iTRAQ4plex-117 reporter+balance group. + + 214#Y + UniMod + + + 889#Y + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a carbonyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + Applied Biosystems iTRAQ(TM) multiplexed quantitation chemistry + UniMod-alternate + + + Applied Biosystems mTRAQ(TM) reagent + UniMod-alternate + + + iTRAQ + UniMod-interim + + + iTRAQ117Y + OMSSA-label + + + iTRAQ4plex + PSI-MS-label + + + mTRAQ heavy + UniMod-description + + + mTRAQ heavy on Y + OMSSA-label + + + Representative mass and accurate mass for 116 & 117 + UniMod-description + + + + DiffAvg + 144.10 + + + + DiffFormula + (12)C 4 (13)C 3 H 12 (14)N 1 (15)N 1 (16)O 1 + + + + DiffMono + 144.102062 + + + + Formula + (12)C 13 (13)C 3 H 21 N 1 (14)N 1 (15)N 1 O 2 (16)O 1 + + + + MassAvg + 307.17 + + + + MassMono + 307.165391 + + + + Origin + Y + + + + Source + artifact + + + + TermSpec + none + + MOD:00919 + MOD:01506 + MOD:01713 + PSI-MOD + + + MOD:01510 + iTRAQ4plex-117 reporter+balance reagent N'-acylated histidine + + A protein modification that effectively replaces an N'-hydrogen atom of a histidine residue with the Applied Biosystems iTRAQ4plex-117 reporter+balance group. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a carbonyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + iTRAQ4plex + PSI-MS-label + + + + DiffAvg + 144.10 + + + + DiffFormula + (12)C 4 (13)C 3 H 12 (14)N 1 (15)N 1 (16)O 1 + + + + DiffMono + 144.102062 + + + + Formula + (12)C 10 (13)C 3 H 19 (14)N 4 (15)N 1 (16)O 2 + + + + MassAvg + 281.16 + + + + MassMono + 281.160974 + + + + Origin + H + + + + Source + artifact + + + + TermSpec + none + + MOD:00909 + MOD:01506 + MOD:01709 + PSI-MOD + + + MOD:01511 + iTRAQ4plex-117 reporter+balance reagent O3-acylated serine + + A protein modification that effectively replaces an O3-hydrogen atom of a serine residue with the Applied Biosystems iTRAQ4plex-117 reporter+balance group. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a carbonyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + iTRAQ4plex + PSI-MS-label + + + + DiffAvg + 144.10 + + + + DiffFormula + (12)C 4 (13)C 3 H 12 (14)N 1 (15)N 1 (16)O 1 + + + + DiffMono + 144.102062 + + + + Formula + (12)C 7 (13)C 3 H 17 (14)N 2 (15)N 1 (16)O 3 + + + + MassAvg + 231.13 + + + + MassMono + 231.134091 + + + + Origin + S + + + + Source + artifact + + + + TermSpec + none + + MOD:00916 + MOD:01506 + MOD:01713 + PSI-MOD + + + MOD:01512 + iTRAQ4plex-117 reporter+balance reagent O3-acylated threonine + + A protein modification that effectively replaces an O3-hydrogen atom of a threonine residue with the Applied Biosystems iTRAQ4plex-117 reporter+balance group. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a carbonyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + iTRAQ4plex + PSI-MS-label + + + + DiffAvg + 144.10 + + + + DiffFormula + (12)C 4 (13)C 3 H 12 (14)N 1 (15)N 1 (16)O 1 + + + + DiffMono + 144.102062 + + + + Formula + (12)C 8 (13)C 3 H 19 (14)N 2 (15)N 1 (16)O 3 + + + + MassAvg + 245.15 + + + + MassMono + 245.149741 + + + + Origin + T + + + + Source + artifact + + + + TermSpec + none + + MOD:00917 + MOD:01506 + MOD:01713 + PSI-MOD + + + MOD:01513 + modifications with monoisotopic mass differences that are nominally equal at a resolution below 0.1 Da + + Modifications that have monoisotopic mass differences from their respective origins that are nominally equal (sometimes called isobaric) at a resolution below 0.1 Da. + + 18688235 + PubMed + + + PSI-MOD-slim + MOD:00538 + PSI-MOD + + + MOD:01514 + modifications with monoisotopic mass differences that are nominally equal at a resolution below 0.01 Da + + Modifications that have monoisotopic mass differences from their respective origins that are nominally equal (sometimes called isobaric) at a resolution below 0.01 Da. + + 18688235 + PubMed + + + PSI-MOD-slim + MOD:01513 + PSI-MOD + + + MOD:01515 + modifications with monoisotopic mass differences that are nominally equal at a resolution below 0.000001 Da + + Modifications that have monoisotopic mass differences from their respective origins that are nominally equal (sometimes called isobaric) at a resolution below 0.000001 Da. + + 18688235 + PubMed + + + PSI-MOD-slim + MOD:01514 + PSI-MOD + + + MOD:01516 + modifications with monoisotopic mass diferences that are nominally equal at 144.099-144.106 Da. + + Modifications that have monoisotopic mass differences from their respective origins of 144.099-144.106 Da. + + 18688235 + PubMed + + + PSI-MOD-slim + MOD:01514 + PSI-MOD + + + MOD:01517 + modifications with monoisotopic mass differences that are nominally equal at 144.102062 Da + + Modifications that have monoisotopic mass differences from their respective origins of 144.102062 Da. + + 18688235 + PubMed + + + PSI-MOD-slim + MOD:01515 + MOD:01516 + PSI-MOD + + + MOD:01518 + iTRAQ4plex reporter+balance reagent acylated residue + + A protein modification that effectively replaces a hydrogen atom of a residue with one of the Applied Biosystems iTRAQ4plex reagent reporter+balance groups. + + 214 + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a carbonyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:01426 + MOD:01705 + PSI-MOD + + + MOD:01519 + reporter fragment + + A distinct molecular entity produced from a protein or a protein modification as the result of a fragmentation process. + + 18688235 + PubMed + + + The reporter fragment is either itself a modification consisting of atoms derived from the original amino acid residues, or its detection can be taken as evidence that particular modified residues had been present. + PSI-MOD-slim + MOD:01156 + PSI-MOD + + + MOD:01520 + modification reporter fragment + + A distinct molecular entity produced as the result of a fragmentation process performed on a particular modified residue. + + 18688235 + PubMed + + + PSI-MOD-slim + MOD:01519 + PSI-MOD + + + MOD:01521 + iTRAQ4plex reporter fragment + + A protein modification reporter fragment produced by an Applied Biosystems iTRAQ4plex reagent derivatized residue. + + 18688235 + PubMed + + + PSI-MOD-slim + MOD:01520 + PSI-MOD + + + MOD:01522 + iTRAQ4plex-114 reporter fragment + + The protein modification reporter fragment produced by an Applied Biosystems iTRAQ4plex 114 reagent derivatized residue. + + 18688235 + PubMed + + + PSI-MOD-slim + + 4-methyl-1-methylidenepiperazin-1-ium + PSI-MOD-alternate + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + FormalCharge + 1+ + + + + Formula + (12)C 5 (13)C 1 H 13 (14)N 2 + + + + MassAvg + 114.11 + + + + MassMono + 114.110680 + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:01521 + + derives_from + MOD:014850 + + PSI-MOD + + + MOD:01523 + iTRAQ4plex-115 reporter fragment + + The protein modification reporter fragment produced by an Applied Biosystems iTRAQ4plex 115 reagent derivatized residue. + + 18688235 + PubMed + + + PSI-MOD-slim + + 4-methyl-1-methylidenepiperazin-1-ium + PSI-MOD-alternate + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + FormalCharge + 1+ + + + + Formula + (12)C 5 (13)C 1 H 13 (14)N 1 (15)N 1 + + + + MassAvg + 115.11 + + + + MassMono + 115.107715 + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:01521 + + derives_from + MOD:014920 + + PSI-MOD + + + MOD:01524 + iTRAQ4plex-116 reporter fragment + + The protein modification reporter fragment produced by an Applied Biosystems iTRAQ4plex 116 reagent derivatized residue. + + 18688235 + PubMed + + + PSI-MOD-slim + + 4-methyl-1-methylidenepiperazin-1-ium + PSI-MOD-alternate + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + FormalCharge + 1+ + + + + Formula + (12)C 4 (13)C 2 H 13 (14)N 1 (15)N 1 + + + + MassAvg + 116.11 + + + + MassMono + 116.111069 + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:01521 + + derives_from + MOD:014990 + + PSI-MOD + + + MOD:01525 + iTRAQ4plex-117, mTRAQ heavy, reporter fragment + + The protein modification reporter fragment produced by an Applied Biosystems iTRAQ4plex 117 reagent derivatized residue. + + 18688235 + PubMed + + + PSI-MOD-slim + + 4-methyl-1-methylidenepiperazin-1-ium + PSI-MOD-alternate + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + FormalCharge + 1+ + + + + Formula + (12)C 3 (13)C 3 H 13 (14)N 1 (15)N 1 + + + + MassAvg + 117.11 + + + + MassMono + 117.114424 + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:01521 + MOD:01870 + + derives_from + MOD:015060 + + PSI-MOD + + + MOD:01526 + iTRAQ8plex reporter+balance reagent acylated residue + + A protein modification that effectively replaces a hydrogen atom of a residue with one of the Applied Biosystems iTRAQ8plex reagent reporter+balance groups. + + 730 + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:01426 + MOD:01705 + PSI-MOD + + + MOD:01527 + residue reporter fragment + + A distinct molecular entity produced from a particular amino acid residue as the result of a fragmentation process. + + 18688235 + PubMed + + + PSI-MOD-slim + MOD:01519 + PSI-MOD + + + MOD:01528 + iTRAQ8plex-113 reporter+balance reagent acylated residue + + A protein modification that effectively replaces a hydrogen atom of a residue with the Applied Biosystems iTRAQ8plex-113 reporter+balance group. + + 730 + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + Applied Biosystems iTRAQ(TM) multiplexed quantitation chemistry + UniMod-alternate + + + iTRAQ8plex + UniMod-interim + + + iTRAQ8plex:13C(7)15N(1) + UniMod-alternate + + + Representative mass and accurate mass for 113, 114, 116 & 117 + UniMod-description + + + + DiffAvg + 304.21 + + + + DiffFormula + (12)C 7 (13)C 7 H 24 (14)N 3 (15)N 1 (16)O 3 + + + + DiffMono + 304.205359 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:01428 + MOD:01429 + MOD:01526 + MOD:01591 + PSI-MOD + + + MOD:01529 + iTRAQ8plex-113 reporter+balance reagent acylated N-terminal + + A protein modification that effectively replaces a hydrogen atom of a protein N-terminal with the Applied Biosystems iTRAQ8plex-113 reporter+balance group. + + 730#N-term + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + Applied Biosystems iTRAQ(TM) multiplexed quantitation chemistry + UniMod-alternate + + + iTRAQ8plex + UniMod-interim + + + iTRAQ8plex:13C(7)15N(1) + UniMod-alternate + + + Representative mass and accurate mass for 113, 114, 116 & 117 + UniMod-description + + + + DiffAvg + 304.21 + + + + DiffFormula + (12)C 7 (13)C 7 H 24 (14)N 3 (15)N 1 (16)O 3 + + + + DiffMono + 304.205359 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + N-term + + MOD:01528 + MOD:01712 + PSI-MOD + + + MOD:01530 + iTRAQ8plex-113 reporter+balance reagent N6-acylated lysine + + A protein modification that effectively replaces the N6'-hydrogen atom of a lysine residue with the Applied Biosystems iTRAQ8plex-113 reporter+balance group. + + 730#K + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + Applied Biosystems iTRAQ(TM) multiplexed quantitation chemistry + UniMod-alternate + + + iTRAQ8plex + UniMod-interim + + + iTRAQ8plex:13C(7)15N(1) + UniMod-alternate + + + Representative mass and accurate mass for 113, 114, 116 & 117 + UniMod-description + + + + DiffAvg + 304.21 + + + + DiffFormula + (12)C 7 (13)C 7 H 24 (14)N 3 (15)N 1 (16)O 3 + + + + DiffMono + 304.205359 + + + + Formula + (12)C 13 (13)C 7 H 36 (14)N 5 (15)N 1 (16)O 4 + + + + MassAvg + 432.30 + + + + MassMono + 432.300322 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:01528 + MOD:01710 + MOD:01875 + PSI-MOD + + + MOD:01531 + iTRAQ8plex-113 reporter+balance reagent O4'-acylated tyrosine + + A protein modification that effectively replaces the O4'-hydrogen atom of a tyrosine residue with the Applied Biosystems iTRAQ8plex-113 reporter+balance group. + + 730#Y + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + Applied Biosystems iTRAQ(TM) multiplexed quantitation chemistry + UniMod-alternate + + + iTRAQ8plex + UniMod-interim + + + iTRAQ8plex:13C(7)15N(1) + UniMod-alternate + + + Representative mass and accurate mass for 113, 114, 116 & 117 + UniMod-description + + + + DiffAvg + 304.21 + + + + DiffFormula + (12)C 7 (13)C 7 H 24 (14)N 3 (15)N 1 (16)O 3 + + + + DiffMono + 304.205359 + + + + Formula + (12)C 16 (13)C 7 H 33 (14)N 4 (15)N 1 (16)O 5 + + + + MassAvg + 467.27 + + + + MassMono + 467.268688 + + + + Origin + Y + + + + Source + artifact + + + + TermSpec + none + + MOD:00919 + MOD:01528 + MOD:01714 + PSI-MOD + + + MOD:01532 + iTRAQ8plex-113 reporter+balance reagent N'-acylated histidine + + A protein modification that effectively replaces an N'-hydrogen atom of a histidine residue with the Applied Biosystems iTRAQ8plex-113 reporter+balance group. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + Applied Biosystems iTRAQ(TM) multiplexed quantitation chemistry + UniMod-alternate + + + iTRAQ8plex + UniMod-interim + + + iTRAQ8plex:13C(7)15N(1) + UniMod-alternate + + + Representative mass and accurate mass for 113, 114, 116 & 117 + UniMod-description + + + + DiffAvg + 304.21 + + + + DiffFormula + (12)C 7 (13)C 7 H 24 (14)N 3 (15)N 1 (16)O 3 + + + + DiffMono + 304.205359 + + + + Formula + (12)C 13 (13)C 7 H 31 (14)N 6 (15)N 1 (16)O 4 + + + + MassAvg + 441.26 + + + + MassMono + 441.264271 + + + + Origin + H + + + + Source + artifact + + + + TermSpec + none + + MOD:00909 + MOD:01528 + MOD:01710 + PSI-MOD + + + MOD:01533 + iTRAQ8plex-113 reporter+balance reagent O3-acylated serine + + A protein modification that effectively replaces an O3-hydrogen atom of a serine residue with the Applied Biosystems iTRAQ8plex-113 reporter+balance group. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + Applied Biosystems iTRAQ(TM) multiplexed quantitation chemistry + UniMod-alternate + + + iTRAQ8plex + UniMod-interim + + + iTRAQ8plex:13C(7)15N(1) + UniMod-alternate + + + Representative mass and accurate mass for 113, 114, 116 & 117 + UniMod-description + + + + DiffAvg + 304.21 + + + + DiffFormula + (12)C 7 (13)C 7 H 24 (14)N 3 (15)N 1 (16)O 3 + + + + DiffMono + 304.205359 + + + + Formula + (12)C 10 (13)C 7 H 29 (14)N 4 (15)N 1 (16)O 5 + + + + MassAvg + 391.24 + + + + MassMono + 391.237388 + + + + Origin + S + + + + Source + artifact + + + + TermSpec + none + + MOD:00916 + MOD:01528 + MOD:01714 + PSI-MOD + + + MOD:01534 + iTRAQ8plex-113 reporter+balance reagent O3-acylated threonine + + A protein modification that effectively replaces an O3-hydrogen atom of a threonine residue with the Applied Biosystems iTRAQ8plex-113 reporter+balance group. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + Applied Biosystems iTRAQ(TM) multiplexed quantitation chemistry + UniMod-alternate + + + iTRAQ8plex + UniMod-interim + + + iTRAQ8plex:13C(7)15N(1) + UniMod-alternate + + + Representative mass and accurate mass for 113, 114, 116 & 117 + UniMod-description + + + + DiffAvg + 304.21 + + + + DiffFormula + (12)C 7 (13)C 7 H 24 (14)N 3 (15)N 1 (16)O 3 + + + + DiffMono + 304.205359 + + + + Formula + (12)C 11 (13)C 7 H 31 (14)N 4 (15)N 1 (16)O 5 + + + + MassAvg + 405.25 + + + + MassMono + 405.253038 + + + + Origin + T + + + + Source + artifact + + + + TermSpec + none + + MOD:00917 + MOD:01528 + MOD:01714 + PSI-MOD + + + MOD:01535 + iTRAQ8plex-114 reporter+balance reagent acylated residue + + A protein modification that effectively replaces a hydrogen atom of a residue with the Applied Biosystems iTRAQ8plex-114 reporter+balance group. + + 730 + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + Applied Biosystems iTRAQ(TM) multiplexed quantitation chemistry + UniMod-alternate + + + iTRAQ8plex + UniMod-interim + + + iTRAQ8plex:13C(7)15N(1) + UniMod-alternate + + + Representative mass and accurate mass for 113, 114, 116 & 117 + UniMod-description + + + + DiffAvg + 304.21 + + + + DiffFormula + (12)C 7 (13)C 7 H 24 (14)N 3 (15)N 1 (16)O 3 + + + + DiffMono + 304.205359 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:01428 + MOD:01429 + MOD:01526 + MOD:01591 + PSI-MOD + + + MOD:01536 + iTRAQ8plex-114 reporter+balance reagent acylated N-terminal + + A protein modification that effectively replaces a hydrogen atom of a protein N-terminal with the Applied Biosystems iTRAQ8plex-114 reporter+balance group. + + 730#N-term + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + Applied Biosystems iTRAQ(TM) multiplexed quantitation chemistry + UniMod-alternate + + + iTRAQ8plex + UniMod-interim + + + iTRAQ8plex:13C(7)15N(1) + UniMod-alternate + + + Representative mass and accurate mass for 113, 114, 116 & 117 + UniMod-description + + + + DiffAvg + 304.21 + + + + DiffFormula + (12)C 7 (13)C 7 H 24 (14)N 3 (15)N 1 (16)O 3 + + + + DiffMono + 304.205359 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + N-term + + MOD:01535 + MOD:01712 + PSI-MOD + + + MOD:01537 + iTRAQ8plex-114 reporter+balance reagent N6-acylated lysine + + A protein modification that effectively replaces the N6'-hydrogen atom of a lysine residue with the Applied Biosystems iTRAQ8plex-114 reporter+balance group. + + 730#K + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + Applied Biosystems iTRAQ(TM) multiplexed quantitation chemistry + UniMod-alternate + + + iTRAQ8plex + UniMod-interim + + + iTRAQ8plex:13C(7)15N(1) + UniMod-alternate + + + Representative mass and accurate mass for 113, 114, 116 & 117 + UniMod-description + + + + DiffAvg + 304.21 + + + + DiffFormula + (12)C 7 (13)C 7 H 24 (14)N 3 (15)N 1 (16)O 3 + + + + DiffMono + 304.205359 + + + + Formula + (12)C 13 (13)C 7 H 36 (14)N 5 (15)N 1 (16)O 4 + + + + MassAvg + 432.30 + + + + MassMono + 432.300322 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:01535 + MOD:01710 + MOD:01875 + PSI-MOD + + + MOD:01538 + iTRAQ8plex-114 reporter+balance reagent O4'-acylated tyrosine + + A protein modification that effectively replaces the O4'-hydrogen atom of a tyrosine residue with the Applied Biosystems iTRAQ8plex-114 reporter+balance group. + + 730#Y + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + Applied Biosystems iTRAQ(TM) multiplexed quantitation chemistry + UniMod-alternate + + + iTRAQ8plex + UniMod-interim + + + iTRAQ8plex:13C(7)15N(1) + UniMod-alternate + + + Representative mass and accurate mass for 113, 114, 116 & 117 + UniMod-description + + + + DiffAvg + 304.21 + + + + DiffFormula + (12)C 7 (13)C 7 H 24 (14)N 3 (15)N 1 (16)O 3 + + + + DiffMono + 304.205359 + + + + Formula + (12)C 16 (13)C 7 H 33 (14)N 4 (15)N 1 (16)O 5 + + + + MassAvg + 467.27 + + + + MassMono + 467.268688 + + + + Origin + Y + + + + Source + artifact + + + + TermSpec + none + + MOD:00919 + MOD:01535 + MOD:01714 + PSI-MOD + + + MOD:01539 + iTRAQ8plex-114 reporter+balance reagent N'-acylated histidine + + A protein modification that effectively replaces an N'-hydrogen atom of a histidine residue with the Applied Biosystems iTRAQ8plex-114 reporter+balance group. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + Applied Biosystems iTRAQ(TM) multiplexed quantitation chemistry + UniMod-alternate + + + iTRAQ8plex + UniMod-interim + + + iTRAQ8plex:13C(7)15N(1) + UniMod-alternate + + + Representative mass and accurate mass for 113, 114, 116 & 117 + UniMod-description + + + + DiffAvg + 304.21 + + + + DiffFormula + (12)C 7 (13)C 7 H 24 (14)N 3 (15)N 1 (16)O 3 + + + + DiffMono + 304.205359 + + + + Formula + (12)C 13 (13)C 7 H 31 (14)N 6 (15)N 1 (16)O 4 + + + + MassAvg + 441.26 + + + + MassMono + 441.264271 + + + + Origin + H + + + + Source + artifact + + + + TermSpec + none + + MOD:00909 + MOD:01535 + MOD:01710 + PSI-MOD + + + MOD:01540 + iTRAQ8plex-114 reporter+balance reagent O3-acylated serine + + A protein modification that effectively replaces an O3-hydrogen atom of a serine residue with the Applied Biosystems iTRAQ8plex-114 reporter+balance group. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + + DiffAvg + 304.21 + + + + DiffFormula + (12)C 7 (13)C 7 H 24 (14)N 3 (15)N 1 (16)O 3 + + + + DiffMono + 304.205359 + + + + Formula + (12)C 10 (13)C 7 H 29 (14)N 4 (15)N 1 (16)O 5 + + + + MassAvg + 391.24 + + + + MassMono + 391.237388 + + + + Origin + S + + + + Source + artifact + + + + TermSpec + none + + MOD:00916 + MOD:01535 + MOD:01714 + PSI-MOD + + + MOD:01541 + iTRAQ8plex-114 reporter+balance reagent O3-acylated threonine + + A protein modification that effectively replaces an O3-hydrogen atom of a threonine residue with the Applied Biosystems iTRAQ8plex-114 reporter+balance group. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + + DiffAvg + 304.21 + + + + DiffFormula + (12)C 7 (13)C 7 H 24 (14)N 3 (15)N 1 (16)O 3 + + + + DiffMono + 304.205359 + + + + Formula + (12)C 11 (13)C 7 H 31 (14)N 4 (15)N 1 (16)O 5 + + + + MassAvg + 405.25 + + + + MassMono + 405.253038 + + + + Origin + T + + + + Source + artifact + + + + TermSpec + none + + MOD:00917 + MOD:01535 + MOD:01714 + PSI-MOD + + + MOD:01542 + iTRAQ8plex-115 reporter+balance reagent acylated residue + + A protein modification that effectively replaces a hydrogen atom of a residue with the Applied Biosystems iTRAQ8plex-115 reporter+balance group. + + 731 + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + Accurate mass for 115, 118, 119 & 121 + UniMod-description + + + Applied Biosystems iTRAQ(TM) multiplexed quantitation chemistry + UniMod-alternate + + + iTRAQ8plex:13C(6)15N(2) + UniMod-interim + + + + DiffAvg + 304.20 + + + + DiffFormula + (12)C 8 (13)C 6 H 24 (14)N 2 (15)N 2 (16)O 3 + + + + DiffMono + 304.199039 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:01428 + MOD:01429 + MOD:01526 + MOD:01584 + PSI-MOD + + + MOD:01543 + iTRAQ8plex-115 reporter+balance reagent acylated N-terminal + + A protein modification that effectively replaces a hydrogen atom of a protein N-terminal with the Applied Biosystems iTRAQ8plex-115 reporter+balance group. + + 731#N-term + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + Accurate mass for 115, 118, 119 & 121 + UniMod-description + + + Applied Biosystems iTRAQ(TM) multiplexed quantitation chemistry + UniMod-alternate + + + iTRAQ8plex:13C(6)15N(2) + UniMod-interim + + + + DiffAvg + 304.20 + + + + DiffFormula + (12)C 8 (13)C 6 H 24 (14)N 2 (15)N 2 (16)O 3 + + + + DiffMono + 304.199039 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + N-term + + MOD:01542 + MOD:01712 + PSI-MOD + + + MOD:01544 + iTRAQ8plex-115 reporter+balance reagent N6-acylated lysine + + A protein modification that effectively replaces the N6'-hydrogen atom of a lysine residue with the Applied Biosystems iTRAQ8plex-115 reporter+balance group. + + 731#K + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + Accurate mass for 115, 118, 119 & 121 + UniMod-description + + + Applied Biosystems iTRAQ(TM) multiplexed quantitation chemistry + UniMod-alternate + + + iTRAQ8plex:13C(6)15N(2) + UniMod-interim + + + + DiffAvg + 304.20 + + + + DiffFormula + (12)C 8 (13)C 6 H 24 (14)N 2 (15)N 2 (16)O 3 + + + + DiffMono + 304.199039 + + + + Formula + (12)C 14 (13)C 6 H 36 (14)N 4 (15)N 2 (16)O 4 + + + + MassAvg + 432.29 + + + + MassMono + 432.294002 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:01542 + MOD:01710 + MOD:01875 + PSI-MOD + + + MOD:01545 + iTRAQ8plex-115 reporter+balance reagent O4'-acylated tyrosine + + A protein modification that effectively replaces the O4'-hydrogen atom of a tyrosine residue with the Applied Biosystems iTRAQ8plex-115 reporter+balance group. + + 731#Y + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + Accurate mass for 115, 118, 119 & 121 + UniMod-description + + + Applied Biosystems iTRAQ(TM) multiplexed quantitation chemistry + UniMod-alternate + + + iTRAQ8plex:13C(6)15N(2) + UniMod-interim + + + + DiffAvg + 304.20 + + + + DiffFormula + (12)C 8 (13)C 6 H 24 (14)N 2 (15)N 2 (16)O 3 + + + + DiffMono + 304.199039 + + + + Formula + (12)C 17 (13)C 6 H 33 (14)N 3 (15)N 2 (16)O 5 + + + + MassAvg + 467.26 + + + + MassMono + 467.262368 + + + + Origin + Y + + + + Source + artifact + + + + TermSpec + none + + MOD:00919 + MOD:01542 + MOD:01714 + PSI-MOD + + + MOD:01546 + iTRAQ8plex-115 reporter+balance reagent N'-derivatized histidine + + A protein modification that effectively replaces an N'-hydrogen atom of a histidine residue with the Applied Biosystems iTRAQ8plex-115 reporter+balance group. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + + DiffAvg + 304.20 + + + + DiffFormula + (12)C 8 (13)C 6 H 24 (14)N 2 (15)N 2 (16)O 3 + + + + DiffMono + 304.199039 + + + + Formula + (12)C 14 (13)C 6 H 31 (14)N 5 (15)N 2 (16)O 4 + + + + MassAvg + 441.26 + + + + MassMono + 441.257951 + + + + Origin + H + + + + Source + artifact + + + + TermSpec + none + + MOD:00909 + MOD:01542 + MOD:01710 + PSI-MOD + + + MOD:01547 + iTRAQ8plex-115 reporter+balance reagent O3-acylated serine + + A protein modification that effectively replaces an O3-hydrogen atom of a serine residue with the Applied Biosystems iTRAQ8plex-115 reporter+balance group. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + + DiffAvg + 304.20 + + + + DiffFormula + (12)C 8 (13)C 6 H 24 (14)N 2 (15)N 2 (16)O 3 + + + + DiffMono + 304.199039 + + + + Formula + (12)C 11 (13)C 6 H 29 (14)N 3 (15)N 2 (16)O 5 + + + + MassAvg + 391.23 + + + + MassMono + 391.231068 + + + + Origin + S + + + + Source + artifact + + + + TermSpec + none + + MOD:00916 + MOD:01542 + MOD:01714 + PSI-MOD + + + MOD:01548 + iTRAQ8plex-115 reporter+balance reagent O3-acylated threonine + + A protein modification that effectively replaces an O3-hydrogen atom of a threonine residue with the Applied Biosystems iTRAQ8plex-115 reporter+balance group. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + + DiffAvg + 304.20 + + + + DiffFormula + (12)C 8 (13)C 6 H 24 (14)N 2 (15)N 2 (16)O 3 + + + + DiffMono + 304.199039 + + + + Formula + (12)C 12 (13)C 6 H 31 (14)N 3 (15)N 2 (16)O 5 + + + + MassAvg + 405.25 + + + + MassMono + 405.246718 + + + + Origin + T + + + + Source + artifact + + + + TermSpec + none + + MOD:00917 + MOD:01542 + MOD:01714 + PSI-MOD + + + MOD:01549 + iTRAQ8plex-116 reporter+balance reagent acylated residue + + A protein modification that effectively replaces a hydrogen atom of a residue with the Applied Biosystems iTRAQ8plex-116 reporter+balance group. + + 730 + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + Applied Biosystems iTRAQ(TM) multiplexed quantitation chemistry + UniMod-alternate + + + iTRAQ8plex + UniMod-interim + + + iTRAQ8plex:13C(7)15N(1) + UniMod-alternate + + + Representative mass and accurate mass for 113, 114, 116 & 117 + UniMod-description + + + + DiffAvg + 304.21 + + + + DiffFormula + (12)C 7 (13)C 7 H 24 (14)N 3 (15)N 1 (16)O 3 + + + + DiffMono + 304.205359 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:01428 + MOD:01429 + MOD:01526 + MOD:01591 + PSI-MOD + + + MOD:01550 + iTRAQ8plex-116 reporter+balance reagent acylated N-terminal + + A protein modification that effectively replaces a hydrogen atom of a protein N-terminal with the Applied Biosystems iTRAQ8plex-116 reporter+balance group. + + 730#N-term + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + Applied Biosystems iTRAQ(TM) multiplexed quantitation chemistry + UniMod-alternate + + + iTRAQ8plex + UniMod-interim + + + iTRAQ8plex:13C(7)15N(1) + UniMod-alternate + + + Representative mass and accurate mass for 113, 114, 116 & 117 + UniMod-description + + + + DiffAvg + 304.21 + + + + DiffFormula + (12)C 7 (13)C 7 H 24 (14)N 3 (15)N 1 (16)O 3 + + + + DiffMono + 304.205359 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + N-term + + MOD:01549 + MOD:01712 + PSI-MOD + + + MOD:01551 + iTRAQ8plex-116 reporter+balance reagent N6-acylated lysine + + A protein modification that effectively replaces the N6'-hydrogen atom of a lysine residue with the Applied Biosystems iTRAQ8plex-116 reporter+balance group. + + 730#K + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + Applied Biosystems iTRAQ(TM) multiplexed quantitation chemistry + UniMod-alternate + + + iTRAQ8plex + UniMod-interim + + + iTRAQ8plex:13C(7)15N(1) + UniMod-alternate + + + Representative mass and accurate mass for 113, 114, 116 & 117 + UniMod-description + + + + DiffAvg + 304.21 + + + + DiffFormula + (12)C 7 (13)C 7 H 24 (14)N 3 (15)N 1 (16)O 3 + + + + DiffMono + 304.205359 + + + + Formula + (12)C 13 (13)C 7 H 36 (14)N 5 (15)N 1 (16)O 4 + + + + MassAvg + 432.30 + + + + MassMono + 432.300322 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:01549 + MOD:01710 + MOD:01875 + PSI-MOD + + + MOD:01552 + iTRAQ8plex-116 reporter+balance reagent O4'-acylated tyrosine + + A protein modification that effectively replaces the O4'-hydrogen atom of a tyrosine residue with the Applied Biosystems iTRAQ8plex-116 reporter+balance group. + + 730#Y + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + Applied Biosystems iTRAQ(TM) multiplexed quantitation chemistry + UniMod-alternate + + + iTRAQ8plex + UniMod-interim + + + iTRAQ8plex:13C(7)15N(1) + UniMod-alternate + + + Representative mass and accurate mass for 113, 114, 116 & 117 + UniMod-description + + + + DiffAvg + 304.21 + + + + DiffFormula + (12)C 7 (13)C 7 H 24 (14)N 3 (15)N 1 (16)O 3 + + + + DiffMono + 304.205359 + + + + Formula + (12)C 16 (13)C 7 H 33 (14)N 4 (15)N 1 (16)O 5 + + + + MassAvg + 467.27 + + + + MassMono + 467.268688 + + + + Origin + Y + + + + Source + artifact + + + + TermSpec + none + + MOD:00919 + MOD:01549 + MOD:01714 + PSI-MOD + + + MOD:01553 + iTRAQ8plex-116 reporter+balance reagent N'-acylated histidine + + A protein modification that effectively replaces an N'-hydrogen atom of a histidine residue with the Applied Biosystems iTRAQ8plex-116 reporter+balance group. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + + DiffAvg + 304.21 + + + + DiffFormula + (12)C 7 (13)C 7 H 24 (14)N 3 (15)N 1 (16)O 3 + + + + DiffMono + 304.205359 + + + + Formula + (12)C 13 (13)C 7 H 31 (14)N 6 (15)N 1 (16)O 4 + + + + MassAvg + 441.26 + + + + MassMono + 441.264271 + + + + Origin + H + + + + Source + artifact + + + + TermSpec + none + + MOD:00909 + MOD:01549 + MOD:01710 + PSI-MOD + + + MOD:01554 + iTRAQ8plex-116 reporter+balance reagent O3-acylated serine + + A protein modification that effectively replaces an O3-hydrogen atom of a serine residue with the Applied Biosystems iTRAQ8plex-116 reporter+balance group. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + + DiffAvg + 304.21 + + + + DiffFormula + (12)C 7 (13)C 7 H 24 (14)N 3 (15)N 1 (16)O 3 + + + + DiffMono + 304.205359 + + + + Formula + (12)C 10 (13)C 7 H 29 (14)N 4 (15)N 1 (16)O 5 + + + + MassAvg + 391.24 + + + + MassMono + 391.237388 + + + + Origin + S + + + + Source + artifact + + + + TermSpec + none + + MOD:00916 + MOD:01549 + MOD:01714 + PSI-MOD + + + MOD:01555 + iTRAQ8plex-116 reporter+balance reagent O3-acylated threonine + + A protein modification that effectively replaces an O3-hydrogen atom of a threonine residue with the Applied Biosystems iTRAQ8plex-116 reporter+balance group. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + + DiffAvg + 304.21 + + + + DiffFormula + (12)C 7 (13)C 7 H 24 (14)N 3 (15)N 1 (16)O 3 + + + + DiffMono + 304.205359 + + + + Formula + (12)C 11 (13)C 7 H 31 (14)N 4 (15)N 1 (16)O 5 + + + + MassAvg + 405.25 + + + + MassMono + 405.253038 + + + + Origin + T + + + + Source + artifact + + + + TermSpec + none + + MOD:00917 + MOD:01549 + MOD:01714 + PSI-MOD + + + MOD:01556 + iTRAQ8plex-117 reporter+balance reagent acylated residue + + A protein modification that effectively replaces a hydrogen atom of a residue with the Applied Biosystems iTRAQ8plex-117 reporter+balance group. + + 730 + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + Applied Biosystems iTRAQ(TM) multiplexed quantitation chemistry + UniMod-alternate + + + iTRAQ8plex + UniMod-interim + + + iTRAQ8plex:13C(7)15N(1) + UniMod-alternate + + + Representative mass and accurate mass for 113, 114, 116 & 117 + UniMod-description + + + + DiffAvg + 304.21 + + + + DiffFormula + (12)C 7 (13)C 7 H 24 (14)N 3 (15)N 1 (16)O 3 + + + + DiffMono + 304.205359 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:01428 + MOD:01429 + MOD:01526 + MOD:01591 + PSI-MOD + + + MOD:01557 + iTRAQ8plex-117 reporter+balance reagent acylated N-terminal + + A protein modification that effectively replaces a hydrogen atom of a protein N-terminal with the Applied Biosystems iTRAQ8plex-117 reporter+balance group. + + 730#N-term + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + Applied Biosystems iTRAQ(TM) multiplexed quantitation chemistry + UniMod-alternate + + + iTRAQ8plex + UniMod-interim + + + iTRAQ8plex:13C(7)15N(1) + UniMod-alternate + + + Representative mass and accurate mass for 113, 114, 116 & 117 + UniMod-description + + + + DiffAvg + 304.21 + + + + DiffFormula + (12)C 7 (13)C 7 H 24 (14)N 3 (15)N 1 (16)O 3 + + + + DiffMono + 304.205359 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + N-term + + MOD:01556 + MOD:01712 + PSI-MOD + + + MOD:01558 + iTRAQ8plex-117 reporter+balance reagent N6-acylated lysine + + A protein modification that effectively replaces the N6'-hydrogen atom of a lysine residue with the Applied Biosystems iTRAQ8plex-117 reporter+balance group. + + 730#K + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + Applied Biosystems iTRAQ(TM) multiplexed quantitation chemistry + UniMod-alternate + + + iTRAQ8plex + UniMod-interim + + + iTRAQ8plex:13C(7)15N(1) + UniMod-alternate + + + Representative mass and accurate mass for 113, 114, 116 & 117 + UniMod-description + + + + DiffAvg + 304.21 + + + + DiffFormula + (12)C 7 (13)C 7 H 24 (14)N 3 (15)N 1 (16)O 3 + + + + DiffMono + 304.205359 + + + + Formula + (12)C 13 (13)C 7 H 36 (14)N 5 (15)N 1 (16)O 4 + + + + MassAvg + 432.30 + + + + MassMono + 432.300322 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:01556 + MOD:01710 + MOD:01875 + PSI-MOD + + + MOD:01559 + iTRAQ8plex-117 reporter+balance reagent O4'-acylated tyrosine + + A protein modification that effectively replaces the O4'-hydrogen atom of a tyrosine residue with the Applied Biosystems iTRAQ8plex-117 reporter+balance group. + + 730#Y + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + Applied Biosystems iTRAQ(TM) multiplexed quantitation chemistry + UniMod-alternate + + + iTRAQ8plex + UniMod-interim + + + iTRAQ8plex:13C(7)15N(1) + UniMod-alternate + + + Representative mass and accurate mass for 113, 114, 116 & 117 + UniMod-description + + + + DiffAvg + 304.21 + + + + DiffFormula + (12)C 7 (13)C 7 H 24 (14)N 3 (15)N 1 (16)O 3 + + + + DiffMono + 304.205359 + + + + Formula + (12)C 16 (13)C 7 H 33 (14)N 4 (15)N 1 (16)O 5 + + + + MassAvg + 467.27 + + + + MassMono + 467.268688 + + + + Origin + Y + + + + Source + artifact + + + + TermSpec + none + + MOD:00919 + MOD:01556 + MOD:01714 + PSI-MOD + + + MOD:01560 + iTRAQ8plex-117 reporter+balance reagent N'-acylated histidine + + A protein modification that effectively replaces an N'-hydrogen atom of a histidine residue with the Applied Biosystems iTRAQ8plex-117 reporter+balance group. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + + DiffAvg + 304.21 + + + + DiffFormula + (12)C 7 (13)C 7 H 24 (14)N 3 (15)N 1 (16)O 3 + + + + DiffMono + 304.205359 + + + + Formula + (12)C 13 (13)C 7 H 31 (14)N 6 (15)N 1 (16)O 4 + + + + MassAvg + 441.26 + + + + MassMono + 441.264271 + + + + Origin + H + + + + Source + artifact + + + + TermSpec + none + + MOD:00909 + MOD:01556 + MOD:01710 + PSI-MOD + + + MOD:01561 + iTRAQ8plex-117 reporter+balance reagent O3-acylated serine + + A protein modification that effectively replaces an O3-hydrogen atom of a serine residue with the Applied Biosystems iTRAQ8plex-117 reporter+balance group. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + + DiffAvg + 304.21 + + + + DiffFormula + (12)C 7 (13)C 7 H 24 (14)N 3 (15)N 1 (16)O 3 + + + + DiffMono + 304.205359 + + + + Formula + (12)C 10 (13)C 7 H 29 (14)N 4 (15)N 1 (16)O 5 + + + + MassAvg + 391.24 + + + + MassMono + 391.237388 + + + + Origin + S + + + + Source + artifact + + + + TermSpec + none + + MOD:00916 + MOD:01556 + MOD:01714 + PSI-MOD + + + MOD:01562 + iTRAQ8plex-117 reporter+balance reagent O3-acylated threonine + + A protein modification that effectively replaces an O3-hydrogen atom of a threonine residue with the Applied Biosystems iTRAQ8plex-117 reporter+balance group. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + + DiffAvg + 304.21 + + + + DiffFormula + (12)C 7 (13)C 7 H 24 (14)N 3 (15)N 1 (16)O 3 + + + + DiffMono + 304.205359 + + + + Formula + (12)C 11 (13)C 7 H 31 (14)N 4 (15)N 1 (16)O 5 + + + + MassAvg + 405.25 + + + + MassMono + 405.253038 + + + + Origin + T + + + + Source + artifact + + + + TermSpec + none + + MOD:00917 + MOD:01556 + MOD:01714 + PSI-MOD + + + MOD:01563 + iTRAQ8plex-118 reporter+balance reagent acylated residue + + A protein modification that effectively replaces a hydrogen atom of a residue with the Applied Biosystems iTRAQ8plex-118 reporter+balance group. + + 731 + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + Accurate mass for 115, 118, 119 & 121 + UniMod-description + + + Applied Biosystems iTRAQ(TM) multiplexed quantitation chemistry + UniMod-alternate + + + iTRAQ8plex:13C(6)15N(2) + UniMod-interim + + + + DiffAvg + 304.20 + + + + DiffFormula + (12)C 8 (13)C 6 H 24 (14)N 2 (15)N 2 (16)O 3 + + + + DiffMono + 304.199039 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:01428 + MOD:01429 + MOD:01526 + MOD:01584 + PSI-MOD + + + MOD:01564 + iTRAQ8plex-118 reporter+balance reagent acylated N-terminal + + A protein modification that effectively replaces a hydrogen atom of a protein N-terminal with the Applied Biosystems iTRAQ8plex-118 reporter+balance group. + + 731#N-term + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + Accurate mass for 115, 118, 119 & 121 + UniMod-description + + + Applied Biosystems iTRAQ(TM) multiplexed quantitation chemistry + UniMod-alternate + + + iTRAQ8plex:13C(6)15N(2) + UniMod-interim + + + + DiffAvg + 304.20 + + + + DiffFormula + (12)C 8 (13)C 6 H 24 (14)N 2 (15)N 2 (16)O 3 + + + + DiffMono + 304.199039 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + N-term + + MOD:01563 + MOD:01712 + PSI-MOD + + + MOD:01565 + iTRAQ8plex-118 reporter+balance reagent N6-acylated lysine + + A protein modification that effectively replaces the N6'-hydrogen atom of a lysine residue with the Applied Biosystems iTRAQ8plex-118 reporter+balance group. + + 731#K + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + Accurate mass for 115, 118, 119 & 121 + UniMod-description + + + Applied Biosystems iTRAQ(TM) multiplexed quantitation chemistry + UniMod-alternate + + + iTRAQ8plex:13C(6)15N(2) + UniMod-interim + + + + DiffAvg + 304.20 + + + + DiffFormula + (12)C 8 (13)C 6 H 24 (14)N 2 (15)N 2 (16)O 3 + + + + DiffMono + 304.199039 + + + + Formula + (12)C 14 (13)C 6 H 36 (14)N 4 (15)N 2 (16)O 4 + + + + MassAvg + 432.29 + + + + MassMono + 432.294002 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:01563 + MOD:01710 + MOD:01875 + PSI-MOD + + + MOD:01566 + iTRAQ8plex-118 reporter+balance reagent O4'-acylated tyrosine + + A protein modification that effectively replaces the O4'-hydrogen atom of a tyrosine residue with the Applied Biosystems iTRAQ8plex-118 reporter+balance group. + + 731#Y + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + Accurate mass for 115, 118, 119 & 121 + UniMod-description + + + Applied Biosystems iTRAQ(TM) multiplexed quantitation chemistry + UniMod-alternate + + + iTRAQ8plex:13C(6)15N(2) + UniMod-interim + + + + DiffAvg + 304.20 + + + + DiffFormula + (12)C 8 (13)C 6 H 24 (14)N 2 (15)N 2 (16)O 3 + + + + DiffMono + 304.199039 + + + + Formula + (12)C 17 (13)C 6 H 33 (14)N 3 (15)N 2 (16)O 5 + + + + MassAvg + 467.26 + + + + MassMono + 467.262368 + + + + Origin + Y + + + + Source + artifact + + + + TermSpec + none + + MOD:00919 + MOD:01563 + MOD:01714 + PSI-MOD + + + MOD:01567 + iTRAQ8plex-118 reporter+balance reagent N'-acylated histidine + + A protein modification that effectively replaces an N'-hydrogen atom of a histidine residue with the Applied Biosystems iTRAQ8plex-118 reporter+balance group. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + + DiffAvg + 304.20 + + + + DiffFormula + (12)C 8 (13)C 6 H 24 (14)N 2 (15)N 2 (16)O 3 + + + + DiffMono + 304.199039 + + + + Formula + (12)C 14 (13)C 6 H 31 (14)N 5 (15)N 2 (16)O 4 + + + + MassAvg + 441.26 + + + + MassMono + 441.257951 + + + + Origin + H + + + + Source + artifact + + + + TermSpec + none + + MOD:00909 + MOD:01563 + MOD:01710 + PSI-MOD + + + MOD:01568 + iTRAQ8plex-118 reporter+balance reagent O3-acylated serine + + A protein modification that effectively replaces an O3-hydrogen atom of a serine residue with the Applied Biosystems iTRAQ8plex-118 reporter+balance group. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + + DiffAvg + 304.20 + + + + DiffFormula + (12)C 8 (13)C 6 H 24 (14)N 2 (15)N 2 (16)O 3 + + + + DiffMono + 304.199039 + + + + Formula + (12)C 11 (13)C 6 H 29 (14)N 3 (15)N 2 (16)O 5 + + + + MassAvg + 391.23 + + + + MassMono + 391.231068 + + + + Origin + S + + + + Source + artifact + + + + TermSpec + none + + MOD:00916 + MOD:01563 + MOD:01714 + PSI-MOD + + + MOD:01569 + iTRAQ8plex-118 reporter+balance reagent O3-acylated threonine + + A protein modification that effectively replaces an O3-hydrogen atom of a threonine residue with the Applied Biosystems iTRAQ8plex-118 reporter+balance group. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + + DiffAvg + 304.20 + + + + DiffFormula + (12)C 8 (13)C 6 H 24 (14)N 2 (15)N 2 (16)O 3 + + + + DiffMono + 304.199039 + + + + Formula + (12)C 12 (13)C 6 H 31 (14)N 3 (15)N 2 (16)O 5 + + + + MassAvg + 405.25 + + + + MassMono + 405.246718 + + + + Origin + T + + + + Source + artifact + + + + TermSpec + none + + MOD:00917 + MOD:01563 + MOD:01714 + PSI-MOD + + + MOD:01570 + iTRAQ8plex-119 reporter+balance reagent acylated residue + + A protein modification that effectively replaces a hydrogen atom of a residue with the Applied Biosystems iTRAQ8plex-119 reporter+balance group. + + 731 + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + Accurate mass for 115, 118, 119 & 121 + UniMod-description + + + Applied Biosystems iTRAQ(TM) multiplexed quantitation chemistry + UniMod-alternate + + + iTRAQ8plex:13C(6)15N(2) + UniMod-interim + + + + DiffAvg + 304.20 + + + + DiffFormula + (12)C 8 (13)C 6 H 24 (14)N 2 (15)N 2 (16)O 3 + + + + DiffMono + 304.199039 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:01428 + MOD:01429 + MOD:01526 + MOD:01584 + PSI-MOD + + + MOD:01571 + iTRAQ8plex-119 reporter+balance reagent acylated N-terminal + + A protein modification that effectively replaces a hydrogen atom of a protein N-terminal with the Applied Biosystems iTRAQ8plex-119 reporter+balance group. + + 731#N-term + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + Accurate mass for 115, 118, 119 & 121 + UniMod-description + + + Applied Biosystems iTRAQ(TM) multiplexed quantitation chemistry + UniMod-alternate + + + iTRAQ8plex:13C(6)15N(2) + UniMod-interim + + + + DiffAvg + 304.20 + + + + DiffFormula + (12)C 8 (13)C 6 H 24 (14)N 2 (15)N 2 (16)O 3 + + + + DiffMono + 304.199039 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + N-term + + MOD:01570 + MOD:01712 + PSI-MOD + + + MOD:01572 + iTRAQ8plex-119 reporter+balance reagent N6-acylated lysine + + A protein modification that effectively replaces the N6'-hydrogen atom of a lysine residue with the Applied Biosystems iTRAQ8plex-119 reporter+balance group. + + 731#K + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + Accurate mass for 115, 118, 119 & 121 + UniMod-description + + + Applied Biosystems iTRAQ(TM) multiplexed quantitation chemistry + UniMod-alternate + + + iTRAQ8plex:13C(6)15N(2) + UniMod-interim + + + + DiffAvg + 304.20 + + + + DiffFormula + (12)C 8 (13)C 6 H 24 (14)N 2 (15)N 2 (16)O 3 + + + + DiffMono + 304.199039 + + + + Formula + (12)C 14 (13)C 6 H 36 (14)N 4 (15)N 2 (16)O 4 + + + + MassAvg + 432.29 + + + + MassMono + 432.294002 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:01570 + MOD:01710 + MOD:01875 + PSI-MOD + + + MOD:01573 + iTRAQ8plex-119 reporter+balance reagent O4'-acylated tyrosine + + A protein modification that effectively replaces the O4'-hydrogen atom of a tyrosine residue with the Applied Biosystems iTRAQ8plex-119 reporter+balance group. + + 731#Y + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + Accurate mass for 115, 118, 119 & 121 + UniMod-description + + + Applied Biosystems iTRAQ(TM) multiplexed quantitation chemistry + UniMod-alternate + + + iTRAQ8plex:13C(6)15N(2) + UniMod-interim + + + + DiffAvg + 304.20 + + + + DiffFormula + (12)C 8 (13)C 6 H 24 (14)N 2 (15)N 2 (16)O 3 + + + + DiffMono + 304.199039 + + + + Formula + (12)C 17 (13)C 6 H 33 (14)N 3 (15)N 2 (16)O 5 + + + + MassAvg + 467.26 + + + + MassMono + 467.262368 + + + + Origin + Y + + + + Source + artifact + + + + TermSpec + none + + MOD:00919 + MOD:01570 + MOD:01714 + PSI-MOD + + + MOD:01574 + iTRAQ8plex-119 reporter+balance reagent N'-acylated histidine + + A protein modification that effectively replaces an N'-hydrogen atom of a histidine residue with the Applied Biosystems iTRAQ8plex-119 reporter+balance group. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + + DiffAvg + 304.20 + + + + DiffFormula + (12)C 8 (13)C 6 H 24 (14)N 2 (15)N 2 (16)O 3 + + + + DiffMono + 304.199039 + + + + Formula + (12)C 14 (13)C 6 H 31 (14)N 5 (15)N 2 (16)O 4 + + + + MassAvg + 441.26 + + + + MassMono + 441.257951 + + + + Origin + H + + + + Source + artifact + + + + TermSpec + none + + MOD:00909 + MOD:01570 + MOD:01710 + PSI-MOD + + + MOD:01575 + iTRAQ8plex-119 reporter+balance reagent O3-acylated serine + + A protein modification that effectively replaces an O3-hydrogen atom of a serine residue with the Applied Biosystems iTRAQ8plex-119 reporter+balance group. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + + DiffAvg + 304.20 + + + + DiffFormula + (12)C 8 (13)C 6 H 24 (14)N 2 (15)N 2 (16)O 3 + + + + DiffMono + 304.199039 + + + + Formula + (12)C 11 (13)C 6 H 29 (14)N 3 (15)N 2 (16)O 5 + + + + MassAvg + 391.23 + + + + MassMono + 391.231068 + + + + Origin + S + + + + Source + artifact + + + + TermSpec + none + + MOD:00916 + MOD:01570 + MOD:01714 + PSI-MOD + + + MOD:01576 + iTRAQ8plex-119 reporter+balance reagent O3-acylated threonine + + A protein modification that effectively replaces an O3-hydrogen atom of a threonine residue with the Applied Biosystems iTRAQ8plex-119 reporter+balance group. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + + DiffAvg + 304.20 + + + + DiffFormula + (12)C 8 (13)C 6 H 24 (14)N 2 (15)N 2 (16)O 3 + + + + DiffMono + 304.199039 + + + + Formula + (12)C 12 (13)C 6 H 31 (14)N 3 (15)N 2 (16)O 5 + + + + MassAvg + 405.25 + + + + MassMono + 405.246718 + + + + Origin + T + + + + Source + artifact + + + + TermSpec + none + + MOD:00917 + MOD:01570 + MOD:01714 + PSI-MOD + + + MOD:01577 + iTRAQ8plex-121 reporter+balance reagent acylated residue + + A protein modification that effectively replaces a hydrogen atom of a residue with the Applied Biosystems iTRAQ8plex-121 reporter+balance group. + + 731 + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + Accurate mass for 115, 118, 119 & 121 + UniMod-description + + + Applied Biosystems iTRAQ(TM) multiplexed quantitation chemistry + UniMod-alternate + + + iTRAQ8plex:13C(6)15N(2) + UniMod-interim + + + + DiffAvg + 304.20 + + + + DiffFormula + (12)C 8 (13)C 6 H 24 (14)N 2 (15)N 2 (16)O 3 + + + + DiffMono + 304.199039 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:01428 + MOD:01429 + MOD:01526 + MOD:01584 + PSI-MOD + + + MOD:01578 + iTRAQ8plex-121 reporter+balance reagent acylated N-terminal + + A protein modification that effectively replaces a hydrogen atom of a protein N-terminal with the Applied Biosystems iTRAQ8plex-121 reporter+balance group. + + 731#N-term + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + Accurate mass for 115, 118, 119 & 121 + UniMod-description + + + Applied Biosystems iTRAQ(TM) multiplexed quantitation chemistry + UniMod-alternate + + + iTRAQ8plex:13C(6)15N(2) + UniMod-interim + + + + DiffAvg + 304.20 + + + + DiffFormula + (12)C 8 (13)C 6 H 24 (14)N 2 (15)N 2 (16)O 3 + + + + DiffMono + 304.199039 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + N-term + + MOD:01577 + MOD:01712 + PSI-MOD + + + MOD:01579 + iTRAQ8plex-121 reporter+balance reagent N6-acylated lysine + + A protein modification that effectively replaces the N6'-hydrogen atom of a lysine residue with the Applied Biosystems iTRAQ8plex-121 reporter+balance group. + + 731#K + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + Accurate mass for 115, 118, 119 & 121 + UniMod-description + + + Applied Biosystems iTRAQ(TM) multiplexed quantitation chemistry + UniMod-alternate + + + iTRAQ8plex:13C(6)15N(2) + UniMod-interim + + + + DiffAvg + 304.20 + + + + DiffFormula + (12)C 8 (13)C 6 H 24 (14)N 2 (15)N 2 (16)O 3 + + + + DiffMono + 304.199039 + + + + Formula + (12)C 14 (13)C 6 H 36 (14)N 4 (15)N 2 (16)O 4 + + + + MassAvg + 432.29 + + + + MassMono + 432.294002 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:01577 + MOD:01710 + MOD:01875 + PSI-MOD + + + MOD:01580 + iTRAQ8plex-121 reporter+balance reagent O4'-acylated tyrosine + + A protein modification that effectively replaces the O4'-hydrogen atom of a tyrosine residue with the Applied Biosystems iTRAQ8plex-121 reporter+balance group. + + 731#Y + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + Accurate mass for 115, 118, 119 & 121 + UniMod-description + + + Applied Biosystems iTRAQ(TM) multiplexed quantitation chemistry + UniMod-alternate + + + iTRAQ8plex:13C(6)15N(2) + UniMod-interim + + + + DiffAvg + 304.20 + + + + DiffFormula + (12)C 8 (13)C 6 H 24 (14)N 2 (15)N 2 (16)O 3 + + + + DiffMono + 304.199039 + + + + Formula + (12)C 17 (13)C 6 H 33 (14)N 3 (15)N 2 (16)O 5 + + + + MassAvg + 467.26 + + + + MassMono + 467.262368 + + + + Origin + Y + + + + Source + artifact + + + + TermSpec + none + + MOD:00919 + MOD:01577 + MOD:01714 + PSI-MOD + + + MOD:01581 + iTRAQ8plex-121 reporter+balance reagent N'-acylated histidine + + A protein modification that effectively replaces an N'-hydrogen atom of a histidine residue with the Applied Biosystems iTRAQ8plex-121 reporter+balance group. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + + DiffAvg + 304.20 + + + + DiffFormula + (12)C 8 (13)C 6 H 24 (14)N 2 (15)N 2 (16)O 3 + + + + DiffMono + 304.199039 + + + + Formula + (12)C 14 (13)C 6 H 31 (14)N 5 (15)N 2 (16)O 4 + + + + MassAvg + 441.26 + + + + MassMono + 441.257951 + + + + Origin + H + + + + Source + artifact + + + + TermSpec + none + + MOD:00909 + MOD:01577 + MOD:01710 + PSI-MOD + + + MOD:01582 + iTRAQ8plex-121 reporter+balance reagent O3-acylated serine + + A protein modification that effectively replaces an O3-hydrogen atom of a serine residue with the Applied Biosystems iTRAQ8plex-121 reporter+balance group. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + + DiffAvg + 304.20 + + + + DiffFormula + (12)C 8 (13)C 6 H 24 (14)N 2 (15)N 2 (16)O 3 + + + + DiffMono + 304.199039 + + + + Formula + (12)C 11 (13)C 6 H 29 (14)N 3 (15)N 2 (16)O 5 + + + + MassAvg + 391.23 + + + + MassMono + 391.231068 + + + + Origin + S + + + + Source + artifact + + + + TermSpec + none + + MOD:00916 + MOD:01577 + MOD:01714 + PSI-MOD + + + MOD:01583 + iTRAQ8plex-121 reporter+balance reagent O3-acylated threonine + + A protein modification that effectively replaces an O3-hydrogen atom of a threonine residue with the Applied Biosystems iTRAQ8plex-121 reporter+balance group. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + + DiffAvg + 304.20 + + + + DiffFormula + (12)C 8 (13)C 6 H 24 (14)N 2 (15)N 2 (16)O 3 + + + + DiffMono + 304.199039 + + + + Formula + (12)C 12 (13)C 6 H 31 (14)N 3 (15)N 2 (16)O 5 + + + + MassAvg + 405.25 + + + + MassMono + 405.246718 + + + + Origin + T + + + + Source + artifact + + + + TermSpec + none + + MOD:00917 + MOD:01577 + MOD:01714 + PSI-MOD + + + MOD:01584 + modifications with monoisotopic mass differences that are nominally equal at 304.199039 Da + + Modifications that have monoisotopic mass differences from their respective origins of 304.199039 Da. + + 18688235 + PubMed + + + PSI-MOD-slim + MOD:01515 + MOD:01592 + PSI-MOD + + + MOD:01585 + O-glycyl-L-serine + + A protein modification that effectively crosslinks an L-serine residue and a glycine residue by an ester bond to form O-glycyl-L-serine. + + 17502423 + PubMed + + + AA0495 + RESID + + + Cross-link 2. + + (2S)-2-amino-3-[(aminoacetyl)oxy]propanoic acid + RESID-systematic + + + O-(glycyl)-L-serine + RESID-name + + + O3-(aminoacetyl)serine + RESID-alternate + + + serine glycinate ester + RESID-alternate + + + + DiffAvg + -18.02 + + + + DiffFormula + C 0 H -2 N 0 O -1 + + + + DiffMono + -18.010565 + + + + Formula + C 5 H 7 N 2 O 3 + + + + MassAvg + 143.12 + + + + MassMono + 143.045667 + + + + Origin + G, S + + + + Source + natural + + + + TermSpec + C-term + + MOD:00885 + MOD:00908 + MOD:00916 + MOD:00954 + PSI-MOD + + + MOD:01586 + O-glycyl-L-threonine + + A protein modification that effectively crosslinks an L-threonine residue and a glycine residue by an ester bond to form O-glycyl-L-threonine. + + 17502423 + PubMed + + + AA0496 + RESID + + + Cross-link 2. + + (2S,3R)-2-amino-3-[(aminoacetyl)oxy]butanoic acid + RESID-systematic + + + O-(glycyl)-L-threonine + RESID-name + + + O3-(2-aminoacetyl)threonine + RESID-alternate + + + threonine glycinate ester + RESID-alternate + + + + DiffAvg + -18.02 + + + + DiffFormula + C 0 H -2 N 0 O -1 S 0 + + + + DiffMono + -18.010565 + + + + Formula + C 6 H 9 N 2 O 3 + + + + MassAvg + 157.15 + + + + MassMono + 157.061317 + + + + Origin + G, T + + + + Source + natural + + + + TermSpec + C-term + + MOD:00885 + MOD:00908 + MOD:00917 + MOD:00954 + PSI-MOD + + + MOD:01587 + O-(2-aminoethylphosphoryl)-L-serine + + A protein modification that effectively converts an L-serine residue to O-(2-aminoethylphosphoryl)-L-serine. + + 15249686 + PubMed + + + 16825186 + PubMed + + + 16949362 + PubMed + + + AA0497 + RESID + + + + (2S)-2-amino-3-([(2-aminoethoxy)(hydroxy)phosphoryl]oxy)propanoic acid + RESID-systematic + + + MOD_RES O-(2-aminoethylphosphoryl)serine + UniProt-feature + + + O-(2-aminoethylphosphoryl)-L-serine + RESID-name + + + O3-(2-aminoethylphosphoryl)-L-serine + RESID-alternate + + + O3-(phosphoethanolamine)-L-serine + RESID-alternate + + + serine ethanolamine phosphate + RESID-alternate + + + serine ethanolamine phosphodiester + RESID-alternate + + + + DiffAvg + 123.05 + + + + DiffFormula + C 2 H 6 N 1 O 3 P 1 + + + + DiffMono + 123.008530 + + + + Formula + C 5 H 11 N 2 O 5 P 1 + + + + MassAvg + 210.13 + + + + MassMono + 210.040558 + + + + Origin + S + + + + Source + natural + + + + TermSpec + none + + MOD:00861 + MOD:00916 + PSI-MOD + + + MOD:01588 + O-cholinephosphoryl-L-serine + + A protein modification that effectively converts an L-serine residue to O-cholinephosphoryl-L-serine. + + 15249686 + PubMed + + + 16825186 + PubMed + + + 16949362 + PubMed + + + AA0498 + RESID + + + + 2-[([(2S)-2-amino-2-carboxyethoxy][hydroxy]phosphoryl)oxy]-N,N,N-trimethylethanaminium + RESID-systematic + + + 2-[([(2S)-2-azanyl-2-carboxyethoxy][hydroxy]phosphoryl)oxy]-N,N,N-trimethylethanazanium + RESID-alternate + + + MOD_RES O-(2-cholinephosphoryl)serine + UniProt-feature + + + O-cholinephosphoryl-L-serine + RESID-name + + + O3-[(2-[trimethylammonio]ethyl)phosphoryl]-L-serine + RESID-alternate + + + O3-phosphocholine-L-serine + RESID-alternate + + + serine choline phosphate + RESID-alternate + + + serine choline phosphodiester + RESID-alternate + + + + DiffAvg + 166.14 + + + + DiffFormula + C 5 H 13 N 1 O 3 P 1 + + + + DiffMono + 166.062756 + + + + FormalCharge + 1+ + + + + Formula + C 8 H 18 N 2 O 5 P 1 + + + + MassAvg + 253.21 + + + + MassMono + 253.094785 + + + + Origin + S + + + + Source + natural + + + + TermSpec + none + + MOD:00861 + MOD:00916 + PSI-MOD + + + MOD:01589 + O-(2,4-diacetamido-2,4-dideoxyglucosyl)-L-serine + + A protein modification that effectively converts an L-serine residue to O-(2,4-diacetamido-2,4-dideoxyglucosyl)-L-serine. + + 15249686 + PubMed + + + 16949362 + PubMed + + + AA0499 + RESID + + + + (2S)-2-amino-3-[(2,4-diacetamido-2,4-dideoxy-beta-D-glucopyranosyl)oxy]propanoic acid + RESID-systematic + + + DADDGlc + RESID-alternate + + + O-(2,4-diacetamido-2,4-dideoxy-beta-D-glucopyranosyl)-L-serine + RESID-alternate + + + O-(2,4-diacetamido-2,4-dideoxy-D-glucosyl)-L-serine + RESID-name + + + O-[2,4-bis(acetylamino)]glucosyl-L-serine + RESID-alternate + + + O-seryl-beta-2,4-bis(acetylamino)glucoside + RESID-alternate + + + O3-(2,4-diacetamido-2,4-dideoxy-beta-D-glucopyranosyl)-L-serine + RESID-alternate + + + + DiffAvg + 244.25 + + + + DiffFormula + C 10 H 16 N 2 O 5 + + + + DiffMono + 244.105922 + + + + Formula + C 13 H 21 N 3 O 7 + + + + MassAvg + 331.33 + + + + MassMono + 331.137950 + + + + Origin + S + + + + Source + natural + + + + TermSpec + none + + MOD:00002 + PSI-MOD + + + MOD:01590 + 3'-farnesyl-2',3'-dihydro-2',N2-cyclo-L-tryptophan + + A protein modification that effectively converts an L-tryptophan residue to 3'-farnesyl-2',3'-dihydro-2',N2-cyclo-L-tryptophan. + + 52950 + ChEBI + + + 18323630 + PubMed + + + AA0500 + RESID + + + + (2S,3aR,8aS)-3a-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-yl]-1,2,3,3a,8,8a-hexahydropyrrolo[2,3-b]indole-2-carboxylic acid + RESID-systematic + + + 3'-farnesyl-2',3'-dihydro-2',N2-cyclo-L-tryptophan + RESID-name + + + LIPID 3'-farnesyl-2',N2-cyclotryptophan + UniProt-feature + + + + DiffAvg + 204.36 + + + + DiffFormula + C 15 H 24 N 0 O 0 + + + + DiffMono + 204.187801 + + + + Formula + C 26 H 34 N 2 O 1 + + + + MassAvg + 390.57 + + + + MassMono + 390.267114 + + + + Origin + W + + + + Source + natural + + + + TermSpec + none + + MOD:00437 + MOD:00601 + MOD:01115 + PSI-MOD + + + MOD:01591 + modifications with monoisotopic mass differences that are nominally equal at 304.205359 Da + + Modifications that have monoisotopic mass differences from their respective origins of 304.205359 Da. + + 18688235 + PubMed + + + PSI-MOD-slim + MOD:01515 + MOD:01592 + PSI-MOD + + + MOD:01592 + modifications with monoisotopic mass differences that are nominally equal at 304.199-304.206 Da + + Modifications that have monoisotopic mass differences from their respective origins of 304.199-304.206 Da. + + 18688235 + PubMed + + + PSI-MOD-slim + MOD:01514 + PSI-MOD + + + MOD:01593 + iTRAQ8plex reporter fragment + + A protein modification reporter fragment produced by an Applied Biosystems iTRAQ8plex reagent derivatized residue. + + 18688235 + PubMed + + + PSI-MOD-slim + + 4-methyl-1-methylidenepiperazin-1-ium + PSI-MOD-alternate + + MOD:01520 + PSI-MOD + + + MOD:01594 + iTRAQ8plex-113 reporter fragment + + The protein modification reporter fragment produced by an Applied Biosystems iTRAQ8plex-113 reagent derivatized residue. + + 18688235 + PubMed + + + PSI-MOD-slim + + 4-methyl-1-methylidenepiperazin-1-ium + PSI-MOD-alternate + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + FormalCharge + 1+ + + + + Formula + (12)C 6 H 13 (14)N 2 + + + + MassAvg + 113.11 + + + + MassMono + 113.107325 + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:01593 + + derives_from + MOD:015280 + + PSI-MOD + + + MOD:01595 + iTRAQ8plex-114 reporter fragment + + The protein modification reporter fragment produced by an Applied Biosystems iTRAQ8plex-114 reagent derivatized residue. + + 18688235 + PubMed + + + PSI-MOD-slim + + 4-methyl-1-methylidenepiperazin-1-ium + PSI-MOD-alternate + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + FormalCharge + 1+ + + + + Formula + (12)C 5 (13)C 1 H 13 (14)N 2 + + + + MassAvg + 114.11 + + + + MassMono + 114.110680 + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:01593 + + derives_from + MOD:015350 + + PSI-MOD + + + MOD:01596 + iTRAQ8plex-115 reporter fragment + + The protein modification reporter fragment produced by an Applied Biosystems iTRAQ8plex-115 reagent derivatized residue. + + 18688235 + PubMed + + + PSI-MOD-slim + + 4-methyl-1-methylidenepiperazin-1-ium + PSI-MOD-alternate + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + FormalCharge + 1+ + + + + Formula + (12)C 5 (13)C 1 H 13 (14)N 1 (15)N 1 + + + + MassAvg + 115.11 + + + + MassMono + 115.107715 + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:01593 + + derives_from + MOD:015420 + + PSI-MOD + + + MOD:01597 + iTRAQ8plex-116 reporter fragment + + The protein modification reporter fragment produced by an Applied Biosystems iTRAQ8plex-116 reagent derivatized residue. + + 18688235 + PubMed + + + PSI-MOD-slim + + 4-methyl-1-methylidenepiperazin-1-ium + PSI-MOD-alternate + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + FormalCharge + 1+ + + + + Formula + (12)C 4 (13)C 2 H 13 (14)N 1 (15)N 1 + + + + MassAvg + 116.11 + + + + MassMono + 116.111069 + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:01593 + + derives_from + MOD:015490 + + PSI-MOD + + + MOD:01598 + iTRAQ8plex-117 reporter fragment + + The protein modification reporter fragment produced by an Applied Biosystems iTRAQ8plex-117 reagent derivatized residue. + + 18688235 + PubMed + + + PSI-MOD-slim + + 4-methyl-1-methylidenepiperazin-1-ium + PSI-MOD-alternate + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + FormalCharge + 1+ + + + + Formula + (12)C 3 (13)C 3 H 13 (14)N 1 (15)N 1 + + + + MassAvg + 117.11 + + + + MassMono + 117.114424 + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:01593 + + derives_from + MOD:015560 + + PSI-MOD + + + MOD:01599 + iTRAQ8plex-118 reporter fragment + + The protein modification reporter fragment produced by an Applied Biosystems iTRAQ8plex-118 reagent derivatized residue. + + 18688235 + PubMed + + + PSI-MOD-slim + + 4-methyl-1-methylidenepiperazin-1-ium + PSI-MOD-alternate + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + FormalCharge + 1+ + + + + Formula + (12)C 3 (13)C 3 H 13 (15)N 2 + + + + MassAvg + 118.11 + + + + MassMono + 118.111459 + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:01593 + + derives_from + MOD:015630 + + PSI-MOD + + + MOD:01600 + iTRAQ8plex-119 reporter fragment + + The protein modification reporter fragment produced by an Applied Biosystems iTRAQ8plex-119 reagent derivatized residue. + + 18688235 + PubMed + + + PSI-MOD-slim + + 4-methyl-1-methylidenepiperazin-1-ium + PSI-MOD-alternate + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + FormalCharge + 1+ + + + + Formula + (12)C 2 (13)C 4 H 13 (15)N 2 + + + + MassAvg + 119.11 + + + + MassMono + 119.114814 + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:01593 + + derives_from + MOD:015700 + + PSI-MOD + + + MOD:01601 + iTRAQ8plex-121 reporter fragment + + The protein modification reporter fragment produced by an Applied Biosystems iTRAQ8plex-121 reagent derivatized residue. + + 18688235 + PubMed + + + PSI-MOD-slim + + 4-methyl-1-methylidenepiperazin-1-ium + PSI-MOD-alternate + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + FormalCharge + 1+ + + + + Formula + (13)C 6 H 13 (15)N 2 + + + + MassAvg + 121.12 + + + + MassMono + 121.121524 + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:01593 + + derives_from + MOD:015770 + + PSI-MOD + + + MOD:01602 + S-(L-lysyl)-L-methionine sulfilimine + + A protein modification that effectively converts an L-lysine residue, and an L-methionine residue to S-(L-lysyl)-L-methionine sulfilimine. + + 12011424 + PubMed + + + 15951440 + PubMed + + + 19729652 + PubMed + + + AA0501 + RESID + + + Cross-link 2. + + (2S)-2-amino-6-([(E)-[(3S)-3-amino-3-carboxypropyl](methyl)-lambda(4)-sulfanylidene]amino)hexanoic acid + RESID-systematic + + + (E)-N6-([(3S)-3-amino-3-carboxypropyl](methyl)-lambda(4)-sulfanylidene)-L-lysine + RESID-alternate + + + S-(L-lysyl)-L-methionine sulfilimine + RESID-name + + + S-lysyl-methionine + RESID-alternate + + + + DiffAvg + -2.02 + + + + DiffFormula + C 0 H -2 N 0 O 0 S 0 + + + + DiffMono + -2.015650 + + + + Formula + C 11 H 19 N 3 O 2 S 1 + + + + MassAvg + 257.35 + + + + MassMono + 257.119798 + + + + Origin + K, M + + + + Source + natural + + + + TermSpec + none + + MOD:00912 + MOD:00913 + PSI-MOD + + + MOD:01603 + 2x(15)N labeled L-lysine + + A protein modification that effectively converts an L-lysine residue to 2x(15)N labeled L-lysine. + + 18688235 + PubMed + + + PSI-MOD-slim + + + DiffAvg + 1.99 + + + + DiffFormula + (14)N -2 (15)N 2 + + + + DiffMono + 1.994070 + + + + Formula + C 6 H 12 (15)N 2 O 1 + + + + MassAvg + 130.09 + + + + MassMono + 130.089033 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00843 + MOD:00912 + PSI-MOD + + + MOD:01604 + 4x(15)N labeled L-arginine + + A protein modification that effectively converts an L-arginine residue to 4x(15)N labeled L-arginine. + + 18688235 + PubMed + + + PSI-MOD-slim + + + DiffAvg + 3.99 + + + + DiffFormula + (14)N -4 (15)N 4 + + + + DiffMono + 3.988140 + + + + Formula + C 6 H 12 (15)N 4 O 1 + + + + MassAvg + 160.09 + + + + MassMono + 160.089251 + + + + Origin + R + + + + Source + artifact + + + + TermSpec + none + + MOD:00843 + MOD:00902 + PSI-MOD + + + MOD:01605 + 5-glutamyl 2-aminoadipic acid + + A protein modification that effectively converts an L-glutamic acid residue to 5-glutamyl 2-aminoadipic acid. + + 19620981 + PubMed + + + AA0502 + RESID + + + + (2S)-2-([(4S)-4-amino-4-carboxybutanoyl]amino)hexanedioic acid + RESID-systematic + + + 5-glutamyl 2-aminoadipic acid + RESID-name + + + MOD_RES 5-glutamyl 2-aminoadipic acid + UniProt-feature + + + N2-(gamma-glutamyl)-2-aminoadipic acid + RESID-alternate + + + N2-(isoglutamyl)-2-aminoadipic acid + RESID-alternate + + + + DiffAvg + 143.14 + + + + DiffFormula + C 6 H 9 N 1 O 3 + + + + DiffMono + 143.058243 + + + + Formula + C 11 H 16 N 2 O 6 + + + + MassAvg + 272.26 + + + + MassMono + 272.100836 + + + + Origin + E + + + + Source + natural + + + + TermSpec + none + + MOD:00674 + MOD:00906 + PSI-MOD + + + MOD:01606 + 5-glutamyl 2-aminoadipic 6-phosphoric anhydride + + A protein modification that effectively converts an L-glutamic acid residue to 5-glutamyl 2-aminoadipic 6-phosphoric anhydride. + + 19620981 + PubMed + + + AA0503 + RESID + + + + (2S)-2-([(4S)-4-amino-4-carboxybutanoyl]amino)-6-oxo-6-(phosphonooxy)hexanoic acid + RESID-systematic + + + 5-glutamyl 2-aminoadipic 6-phosphoric anhydride + RESID-name + + + + DiffAvg + 223.12 + + + + DiffFormula + C 6 H 10 N 1 O 6 P 1 + + + + DiffMono + 223.024574 + + + + Formula + C 11 H 17 N 2 O 9 P 1 + + + + MassAvg + 352.24 + + + + MassMono + 352.067167 + + + + Origin + E + + + + Source + hypothetical + + + + TermSpec + none + + MOD:00674 + MOD:00861 + MOD:00906 + PSI-MOD + + + MOD:01607 + 5-glutamyl allysine + + A protein modification that effectively converts an L-glutamic acid residue to 5-glutamyl allysine. + + 19620981 + PubMed + + + AA0504 + RESID + + + + (2S)-2-([(4S)-4-amino-4-carboxybutanoyl]amino)-6-oxohexanoic acid + RESID-systematic + + + 2-(5-glutamyl)amino-6-oxohexanoic acid + RESID-alternate + + + 5-glutamyl allysine + RESID-name + + + alpha-(gamma-glutamyl)allysine + RESID-alternate + + + N2-(gamma-glutamyl)allysine + RESID-alternate + + + N2-(isoglutamyl)allysine + RESID-alternate + + + + DiffAvg + 127.14 + + + + DiffFormula + C 6 H 9 N 1 O 2 + + + + DiffMono + 127.063329 + + + + Formula + C 11 H 16 N 2 O 5 + + + + MassAvg + 256.26 + + + + MassMono + 256.105922 + + + + Origin + E + + + + Source + hypothetical + + + + TermSpec + none + + MOD:00674 + MOD:00906 + PSI-MOD + + + MOD:01608 + N2-(L-isoglutamyl)-L-lysine + + A protein modification that effectively converts an L-glutamic acid residue to N2-(L-isoglutamyl)-L-lysine. This is not an isopeptide cross-link. + + 19620981 + PubMed + + + AA0505 + RESID + + + + (2S)-6-amino-2-([(4S)-4-amino-4-carboxybutanoyl]amino)hexanoic acid + RESID-systematic + + + 5-glutamyl N2-lysine + RESID-alternate + + + alpha-(gamma-glutamyl)lysine + RESID-alternate + + + gamma-glutamyl N2-lysine + RESID-alternate + + + MOD_RES 5-glutamyl N2-lysine + UniProt-feature + + + N2-(gamma-glutamyl)lysine + RESID-alternate + + + N2-(L-isoglutamyl)-L-lysine + RESID-name + + + + DiffAvg + 128.18 + + + + DiffFormula + C 6 H 12 N 2 O 1 + + + + DiffMono + 128.094963 + + + + Formula + C 11 H 19 N 3 O 4 + + + + MassAvg + 257.29 + + + + MassMono + 257.137556 + + + + Origin + E + + + + Source + natural + + + + TermSpec + none + + MOD:00906 + PSI-MOD + + + MOD:01609 + 7'-hydroxy-2'-alpha-mannosyl-L-tryptophan + + A protein modification that effectively converts an L-tryptophan residue to 7'-hydroxy-2'-alpha-mannosyl-L-tryptophan. + + 19584055 + PubMed + + + AA0506 + RESID + + + + (2S)-2-amino-3-[7-hydroxy-2-(alpha-D-mannopyranosyl)-1H-indol-3-yl]propanoic acid + RESID-systematic + + + 7'-hydroxy-2'-alpha-mannosyl-L-tryptophan + RESID-name + + + MOD_RES 7'-hydroxytryptophan + UniProt-feature + + + + DiffAvg + 178.14 + + + + DiffFormula + C 6 H 10 N 0 O 6 + + + + DiffMono + 178.047738 + + + + Formula + C 17 H 20 N 2 O 7 + + + + MassAvg + 364.35 + + + + MassMono + 364.127051 + + + + Origin + W + + + + Source + natural + + + + TermSpec + none + + MOD:00918 + + has_functional_parent + MOD:002220 + + + has_functional_parent + MOD:016640 + + PSI-MOD + + + MOD:01610 + L-threonine methyl ester + + A protein modification that effectively converts an L-threonine residue to L-threonine methyl ester. + + 19745839 + PubMed + + + AA0507 + RESID + + + + L-threonine methyl ester + RESID-name + + + methyl (2S,3R)-2-amino-3-hydroxybutanoate + RESID-systematic + + + methyl L-threoninate + RESID-alternate + + + + DiffAvg + 14.03 + + + + DiffFormula + C 1 H 2 N 0 O 0 + + + + DiffMono + 14.015650 + + + + Formula + C 5 H 10 N 1 O 3 + + + + MassAvg + 132.14 + + + + MassMono + 132.066068 + + + + Origin + T + + + + Source + natural + + + + TermSpec + C-term + + MOD:01689 + MOD:01803 + PSI-MOD + + + MOD:01611 + 6-(S-L-cysteinyl)-8alpha-(-3'-L-histidino)-FMN + + A protein modification that crosslinks a cysteine and a histidine residue by forming the adduct 6-(S-L-cysteinyl)-8alpha-(-3'-L-histidino)-FMN. + + 17935335 + PubMed + + + AA0508 + RESID + + + Cross-link 2. + PSI-MOD-slim + + 6-((R)-2-amino-2-carboxyethyl)sulfanyl-8alpha-[4-((S)-2-amino-2-carboxyethyl)imidazol-3-yl]-riboflavin 5'-trihydrogen phosphate + RESID-systematic + + + 6-(S-cysteinyl)-8alpha-(N(delta)-histidyl)-FMN + RESID-alternate + + + 6-(S-cysteinyl)-8alpha-(N(pi)-histidyl)-FMN + RESID-alternate + + + 6-(S-cysteinyl)-8alpha-(N3'-histidyl)-FMN + RESID-alternate + + + 6-(S-cysteinyl)-8alpha-(pros-histidyl)-FMN + RESID-alternate + + + 6-(S-L-cysteinyl)-8alpha-(N3'-L-histidino)-FMN + RESID-name + + + BINDING FMN (covalent; via 2 links) + UniProt-feature + + + BINDING FMN (covalent; via 2 links, pros nitrogen) + UniProt-feature + + + + DiffAvg + 452.32 + + + + DiffFormula + C 17 H 17 N 4 O 9 P 1 S 0 + + + + DiffMono + 452.073315 + + + + Formula + C 26 H 29 N 8 O 11 P 1 S 1 + + + + MassAvg + 692.60 + + + + MassMono + 692.141411 + + + + Origin + C, H + + + + Source + natural + + + + TermSpec + none + + MOD:00896 + MOD:00905 + MOD:00909 + MOD:01621 + PSI-MOD + + + MOD:01612 + 3'-iodo-L-tyrosine + + A protein modification that effectively converts an L-tyrosine residue to 3'-iodo-L-tyrosine. + + 27847 + ChEBI + + + 8995307 + PubMed + + + AA0509 + RESID + + + PSI-MOD-slim + + (2S)-2-amino-3-(4-hydroxy-3-iodophenyl)propanoic acid + RESID-systematic + + + 3'-iodo-L-tyrosine + RESID-name + + + 3-iodo-L-tyrosine + RESID-alternate + + + 3-iodotyrosine + RESID-alternate + + + 4-hydroxy-3-iodo-phenylalanine + RESID-alternate + + + MIT + RESID-alternate + + + MOD_RES Iodotyrosine + UniProt-feature + + + + DiffAvg + 125.90 + + + + DiffFormula + C 0 H -1 I 1 N 0 O 0 + + + + DiffMono + 125.896648 + + + + Formula + C 9 H 8 I 1 N 1 O 2 + + + + MassAvg + 289.07 + + + + MassMono + 288.959976 + + + + Origin + Y + + + + Source + natural + + + + TermSpec + none + + MOD:01228 + PSI-MOD + + + MOD:01613 + 3',5'-diiodo-L-tyrosine + + A protein modification that effectively converts an L-tyrosine residue to 3',5'-diiodo-L-tyrosine. + + 15768 + ChEBI + + + 8995307 + PubMed + + + AA0510 + RESID + + + PSI-MOD-slim + + (2S)-2-amino-3-(4-hydroxy-3,5-diiodophenyl)propanoic acid + RESID-systematic + + + 3',5'-diiodo-L-tyrosine + RESID-name + + + 3,5-diiodo-L-tyrosine + RESID-alternate + + + 3,5-diiodotyrosine + RESID-alternate + + + DIT + RESID-alternate + + + iodogorgoic acid + RESID-alternate + + + MOD_RES Diiodotyrosine + UniProt-feature + + + + DiffAvg + 251.79 + + + + DiffFormula + C 0 H -2 I 2 N 0 O 0 + + + + DiffMono + 251.793295 + + + + Formula + C 9 H 7 I 2 N 1 O 2 + + + + MassAvg + 414.97 + + + + MassMono + 414.856624 + + + + Origin + Y + + + + Source + natural + + + + TermSpec + none + + MOD:01140 + PSI-MOD + + + MOD:01614 + glycyl phospho-5'-adenosine + + A protein modification that effectively converts a glycine residue to glycyl phospho-5'-adenosine. + + 16388576 + PubMed + + + 9632726 + PubMed + + + AA0511 + RESID + + + + (2-aminoacetyl)oxy-([(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxy-oxolan-2-yl]methoxy)phosphinic acid + RESID-alternate + + + ([(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxy-oxolan-2-yl]methoxy-hydroxy-phosphoryl)-2-aminoethanoate + RESID-alternate + + + 5'-adenylic-glyinate + RESID-alternate + + + aminoacetyl [5-(6-amino-9H-purin-9-yl)-3,4-dihydroxytetrahydrofuran-2-yl]methyl hydrogen phosphate + RESID-systematic + + + glycine monoanhydride with 5'-adenylic acid + RESID-alternate + + + glycyl 5'-adenylate + RESID-alternate + + + glycyl adenosine-5'-phosphate + RESID-alternate + + + glycyl phospho-5'-adenosine + RESID-name + + + glycyladenylate + RESID-alternate + + + MOD_RES Glycyl adenylate + UniProt-feature + + + + DiffAvg + 329.21 + + + + DiffFormula + C 10 H 12 N 5 O 6 P 1 + + + + DiffMono + 329.052520 + + + + Formula + C 12 H 16 N 6 O 8 P 1 + + + + MassAvg + 403.27 + + + + MassMono + 403.076723 + + + + Origin + G + + + + Source + natural + + + + TermSpec + C-term + + MOD:00908 + MOD:01165 + PSI-MOD + + + MOD:01615 + glycyl cysteine dithioester + + A protein modification that effectively crosslinks an L-cysteine residue and a glycine residue by a dithioester bond to form glycyl cysteine dithioester. + + 11438688 + PubMed + + + 16388576 + PubMed + + + AA0512 + RESID + + + Cross-link 2. + + (2R)-2-amino-3-[(aminoacetyl)disulfanyl]propanoic acid + RESID-systematic + + + 2-(glycyldithio)alanine + RESID-alternate + + + glycyl cysteine dithioester + RESID-name + + + S-glycyl cysteine persulfide + RESID-alternate + + + S-glycyl thiocysteine + RESID-alternate + + + thioglycine cysteine disulfide + RESID-alternate + + + + DiffAvg + 14.05 + + + + DiffFormula + C 0 H -2 N 0 O -1 S 1 + + + + DiffMono + 13.961506 + + + + Formula + C 5 H 7 N 2 O 2 S 2 + + + + MassAvg + 191.24 + + + + MassMono + 190.994894 + + + + Origin + C, G + + + + Source + hypothetical + + + + TermSpec + C-term + + MOD:00395 + MOD:00908 + MOD:00954 + PSI-MOD + + + MOD:01616 + trithiocystine + + A protein modification that effectively cross-links two L-cysteine residues and adds three sulfur atoms to form trithiocystine. + + 19438211 + PubMed + + + AA0513 + RESID + + + Cross-link 2. + + (2R,2'R)-3,3'-pentasulfane-1,5-diylbis(2-aminopropanoic acid) + RESID-systematic + + + 3,3'-pentathiobisalanine + RESID-alternate + + + bis(2-amino-2-carboxyethyl)pentasulfide + RESID-alternate + + + trithiocystine + RESID-name + + + + DiffAvg + 94.16 + + + + DiffFormula + C 0 H -2 N 0 O 0 S 3 + + + + DiffMono + 93.900563 + + + + Formula + C 6 H 8 N 2 O 2 S 5 + + + + MassAvg + 300.44 + + + + MassMono + 299.918933 + + + + Origin + C, C + + + + Source + natural + + + + TermSpec + none + + MOD:01620 + PSI-MOD + + + MOD:01617 + O-(6-phosphomannosyl)-L-threonine + + A protein modification that effectively converts an L-threonine residue to O-(6-phosphomannosyl)-L-threonine. + + 20044576 + PubMed + + + AA0514 + RESID + + + + (2S,3R)-2-amino-3-[6-phosphonooxy-alpha-D-mannopyranosyloxy]butanoic acid + RESID-systematic + + + O-(6-phosphomannosyl)-L-threonine + RESID-name + + + O3-(6-phosphomannosyl)threonine + RESID-alternate + + + + DiffAvg + 242.12 + + + + DiffFormula + C 6 H 11 N 0 O 8 P 1 + + + + DiffMono + 242.019154 + + + + Formula + C 10 H 18 N 1 O 10 P 1 + + + + MassAvg + 343.22 + + + + MassMono + 343.066832 + + + + Origin + T + + + + Source + natural + + + + TermSpec + none + + MOD:00005 + MOD:00595 + PSI-MOD + + + MOD:01618 + L-alanyl-L-isoaspartyl cyclopeptide + + A protein modification that effectively converts an L-alaine residue and an L-asparagine residue to L-alanyl-L-isoaspartyl cyclopeptide. + + 19928958 + PubMed + + + 3207697 + PubMed + + + AA0515 + RESID + + + Cross-link 2. + + (2S,5S)-2-methyl-3,7-dioxo-1,4-diazepane-5-carboxylic acid + RESID-systematic + + + 1,4.2-anhydro(L-alanyl-L-aspartic acid) + RESID-alternate + + + CROSSLNK Alanine isoaspartyl cyclopeptide (Ala-Asn) + UniProt-feature + + + L-alanyl-L-isoaspartyl cyclopeptide + RESID-name + + + + DiffAvg + -17.03 + + + + DiffFormula + C 0 H -3 N -1 O 0 + + + + DiffMono + -17.026549 + + + + Formula + C 7 H 9 N 2 O 3 + + + + MassAvg + 169.16 + + + + MassMono + 169.061317 + + + + Origin + A, N + + + + Source + natural + + + + TermSpec + N-term + + MOD:00688 + MOD:00901 + MOD:00903 + MOD:00946 + PSI-MOD + + + MOD:01619 + multisulfide crosslinked residues + + A protein modification that crosslinks two cysteine residues by formation of a chain of two or more bonded sulfur atoms. + + 18688235 + PubMed + + + PSI-MOD-slim + MOD:00033 + MOD:00905 + PSI-MOD + + + MOD:01620 + polysulfide crosslinked residues + + A protein modification that crosslinks two cysteine residues by formation of a chain of three or more bonded sulfur atoms. + + 18688235 + PubMed + + + MOD:00860 + MOD:01619 + PSI-MOD + + + MOD:01621 + flavin crosslinked residues + + A protein modification that crosslinks two or more amino acid residues by forming an adduct with a compound containing a flavin group. + + 18688235 + PubMed + + + PSI-MOD-slim + MOD:00033 + MOD:00697 + PSI-MOD + + + MOD:01622 + monohydroxylated tryptophan + + A protein modification that effectively converts an L-tryptophan residue to one of several monohydroxylated tryptophan residues, including 3-hydroxy-L-tryptophan and 7'-hydroxy-L-tryptophan. + + 35#W + UniMod + + + + Oxidation + PSI-MS-label + + + oxyw + OMSSA-label + + + + DiffAvg + 16.00 + + + + DiffFormula + C 0 H 0 N 0 O 1 + + + + DiffMono + 15.994915 + + + + Formula + C 11 H 10 N 2 O 2 + + + + MassAvg + 202.21 + + + + MassMono + 202.074228 + + + + Origin + W + + + + Source + natural + + + + TermSpec + none + + MOD:00425 + MOD:00918 + PSI-MOD + + + MOD:01623 + 1-thioglycine (C-terminal) + + A protein modification that effectively converts a glycine residue to a C-terminal 1-thioglycine. + + 11463785 + PubMed + + + 19145231 + PubMed + + + 9367957 + PubMed + + + AA0265#var + RESID + + + PSI-MOD-slim + + + DiffAvg + 16.06 + + + + DiffFormula + C 0 H 0 N 0 O -1 S 1 + + + + DiffMono + 15.977156 + + + + Formula + C 2 H 3 N 1 S 1 + + + + MassAvg + 73.11 + + + + MassMono + 72.998620 + + + + Origin + G + + + + Source + natural + + + + TermSpec + C-term + + MOD:01625 + PSI-MOD + + + MOD:01624 + (2-aminosuccinimidyl)acetic acid (Asn) + + A protein modification that crosslinks an asparagine and the following glycine residue with the formation of (2-aminosuccinimidyl)acetic acid and the release of ammonia. + + 10801322 + PubMed + + + 2015294 + PubMed + + + AA0441#ASN + RESID + + + Cross-link 2. + PSI-MOD-slim + + (2-aminosuccinimidyl)acetic acid + RESID-name + + + (3-amino-2,5-dioxo-1-pyrrolidinyl)acetic acid + RESID-alternate + + + [(3S)-3-amino-2,5-dioxopyrrolidin-1-yl]acetic acid + RESID-systematic + + + anhydroaspartyl glycine + RESID-alternate + + + aspartimide glycine + RESID-alternate + + + CROSSLNK (2-aminosuccinimidyl)acetic acid (Asn-Gly) + UniProt-feature + + + N-(2-aminosuccinyl)glycine + RESID-alternate + + + + DiffAvg + -17.03 + + + + DiffFormula + C 0 H -3 N -1 O 0 + + + + DiffMono + -17.026549 + + + + Formula + C 6 H 6 N 2 O 3 + + + + MassAvg + 154.13 + + + + MassMono + 154.037842 + + + + Origin + G, N + + + + Source + hypothetical + + + + TermSpec + none + + MOD:00903 + MOD:00946 + MOD:01628 + PSI-MOD + + + MOD:01625 + 1-thioglycine + + A protein modification that effectively converts a glycine residue to 1-thioglycine. + + 11463785 + PubMed + + + 9367957 + PubMed + + + AA0265 + RESID + + + This modification occurs naturally in two forms. At an interior peptide location (MOD:00270) it exists as aminoethanethionic acid, or aminoethanethioic O-acid. At the C-terminal (MOD:01623) it exists as aminoethanethiolic acid, or aminoethanethioic S-acid [JSG]. + PSI-MOD-slim + + 1-thioglycine + RESID-name + + + 2-amino-1-sulfanylethanone + RESID-alternate + + + aminoethanethioic acid + RESID-systematic + + + aminothioacetic acid + RESID-alternate + + + Carboxy->Thiocarboxy + PSI-MS-label + + + MOD_RES 1-thioglycine + UniProt-feature + + + S(O)Gly + PSI-MOD-label + + + thiocarboxylic acid + UniMod-description + + + + DiffAvg + 16.06 + + + + DiffFormula + C 0 H 0 N 0 O -1 S 1 + + + + DiffMono + 15.977156 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + G + + + + Source + natural + + MOD:00749 + MOD:00908 + PSI-MOD + + + MOD:01626 + L-cystine + + A protein modification that forms L-cystine by forming a disulfide bond that either cross-links two peptidyl L-cysteine residues, or modifies a peptidyl cysteine with a free cysteine. + + 16283 + ChEBI + + + 1988019 + PubMed + + + 2001356 + PubMed + + + 2076469 + PubMed + + + 3083866 + PubMed + + + 366603 + PubMed + + + 7918467 + PubMed + + + 8344916 + PubMed + + + AA0025 + RESID + + + This modification occurs naturally in two forms. It exists as a disulfide cross-link of two cysteine residues (MOD:00034), or as a disulfide cross-link of a cysteine residues and a free cysteine (MOD:00765). + PSI-MOD-slim + + (2R,2'R)-3,3'-disulfane-1,2-diylbis(2-aminopropanoic acid) + RESID-systematic + + + 2-amino-3-(2-amino-2-carboxy-ethyl)disulfanyl-propanoic acid + RESID-misnomer + + + 3,3'-disulfane-1,2-diylbis(2-azanylpropanoic acid) + RESID-alternate + + + 3,3'-dithiobis(2-aminopropanoic acid) + RESID-alternate + + + 3,3'-dithiobisalanine + RESID-alternate + + + 3,3'-dithiodialanine + RESID-alternate + + + beta,beta'-diamino-beta,beta'-dicarboxydiethyldisulfide + RESID-alternate + + + beta,beta'-dithiodialanine + RESID-alternate + + + bis(alpha-aminopropionic acid)-beta-disulfide + RESID-alternate + + + bis(beta-amino-beta-carboxyethyl)disulfide + RESID-alternate + + + Cys2 + PSI-MOD-label + + + Cystine ((Cys)2) + DeltaMass-label + + + dicysteine + RESID-alternate + + + L-cystine + RESID-name + + + + DiffAvg + -2.02 + + + + DiffFormula + C 0 H -2 N 0 O 0 S 0 + + + + DiffMono + -2.015650 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + none + + + + Source + natural + + + + TermSpec + none + + MOD:00905 + PSI-MOD + + + MOD:01627 + L-cysteinyl-L-selenocysteine + + A protein modification that forms L-cysteinyl-L-selenocysteine either by the natural process of cross-linking an L-cysteine residue and an L-selenocysteine residue, or by the hypothetical process of substituting a selenium for a sulfur atom in cystine. + + 12911312 + PubMed + + + 18688235 + PubMed + + + Cross-link 2. + PSI-MOD-slim + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + C 6 H 8 N 2 O 2 S 1 Se 1 + + + + MassAvg + 251.17 + + + + MassMono + 251.947170 + + + + Origin + C, X + + + + Source + natural + + + + TermSpec + none + + MOD:00692 + MOD:00859 + MOD:00905 + PSI-MOD + + + MOD:01628 + (2-aminosuccinimidyl)acetic acid + + A protein modification that forms (2-aminosuccinimidyl)acetic acid by crosslinking either an aspartic acid residue or an asparagine residue with the following glycine residue. + + 10801322 + PubMed + + + 18688235 + PubMed + + + Cross-link 2; this cross-link is formed by the condensation of an aspartic acid residue or an asparagine residue with the alpha-amido of the following residue. + PSI-MOD-slim + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + C 6 H 6 N 2 O 3 + + + + MassAvg + 154.13 + + + + MassMono + 154.037842 + + + + Origin + G, X + + + + Source + hypothetical + + + + TermSpec + none + + MOD:00908 + MOD:01944 + PSI-MOD + + + MOD:01629 + cyclo[(prolylserin)-O-yl] cysteinate + + A protein modification that forms cyclo[(prolylserin)-O-yl] cysteinate by the natural process of cross-linking an L-cysteine residue an L-proline residue, and an L-serine residue, or by effectively modifying a cysteine residue. + + 7961166 + PubMed + + + AA0489 + RESID + + + + (3,6-dioxopyrrolo[4,5-a]piperazin-2-yl)methyl cysteinate + RESID-alternate + + + [(3S,8aS)-1,4-dioxooctahydropyrrolo[1,2-a]pyrazin-3-yl]methyl (2R)-2-amino-3-sulfanylpropanoate + RESID-systematic + + + cyclo[(prolylserin)-O-yl] cysteinate + RESID-name + + + MOD_RES Cyclo[(prolylserin)-O-yl] cysteinate + UniProt-feature + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + C 11 H 16 N 3 O 4 S 1 + + + + MassAvg + 286.33 + + + + MassMono + 286.086152 + + + + Origin + X + + + + Source + natural + + + + TermSpec + C-term + + MOD:00859 + MOD:00905 + PSI-MOD + + + MOD:01630 + N6-(L-isoglutamyl)-L-lysine + + A protein modification that effectively crosslinks either an L-glutamine residue or an L-glutamic acid residue with an L-lysine residue by an isopeptide bond to form N6-(L-isoglutamyl)-L-lysine . + + 21863 + ChEBI + + + 0 + DeltaMass + + + 2461365 + PubMed + + + 5637041 + PubMed + + + 5656070 + PubMed + + + 8598899 + PubMed + + + AA0124 + RESID + + + Cross-link 2. + PSI-MOD-slim + + (2S)-2-amino-6-([(4S)-4-amino-4-carboxybutanoyl]amino)hexanoic acid + RESID-systematic + + + 2-azanyl-6-([4-azanyl-4-carboxybutanoyl]azanyl)hexanoic acid + RESID-alternate + + + 5-glutamyl N6-lysine + RESID-alternate + + + N alpha -(gamma-Glutamyl)-lysine + DeltaMass-label + + + N(epsilon)-(gamma-glutamyl)lysine + RESID-alternate + + + N6-(L-isoglutamyl)-L-lysine + RESID-name + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + C 11 H 17 N 3 O 3 + + + + MassAvg + 239.27 + + + + MassMono + 239.126991 + + + + Origin + K, X + + + + Source + natural + + + + TermSpec + none + + MOD:00688 + MOD:00859 + MOD:01875 + PSI-MOD + + + MOD:01631 + L-alanine removal + + A protein modification that effectively removes or replaces an L-alanine. + + 18688235 + PubMed + + + This represents the loss or replacement of an L-alanine residue in a polypeptide, and may be combined with the formula or mass of another entry that is the replacement residue to represent a mutation or substitution. + PSI-MOD-slim + + + DiffAvg + -71.08 + + + + DiffFormula + C -3 H -5 N -1 O -1 + + + + DiffMono + -71.037114 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + A + + + + Source + natural + + + + TermSpec + none + + MOD:00901 + MOD:01651 + PSI-MOD + + + MOD:01632 + L-arginine removal + + A protein modification that effectively removes or replaces an L-arginine. + + 18688235 + PubMed + + + This represents the loss or replacement of an L-arginine residue in a polypeptide, and may be combined with the formula or mass of another entry that is the replacement residue to represent a mutation or substitution. + PSI-MOD-slim + + + DiffAvg + -156.19 + + + + DiffFormula + C -6 H -12 N -4 O -1 + + + + DiffMono + -156.101111 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + R + + + + Source + natural + + + + TermSpec + none + + MOD:00902 + MOD:01651 + PSI-MOD + + + MOD:01633 + L-asparagine removal + + A protein modification that effectively removes or replaces an L-asparagine. + + 18688235 + PubMed + + + This represents the loss or replacement of an L-asparagine residue in a polypeptide, and may be combined with the formula or mass of another entry that is the replacement residue to represent a mutation or substitution. + PSI-MOD-slim + + + DiffAvg + -114.10 + + + + DiffFormula + C -4 H -6 N -2 O -2 + + + + DiffMono + -114.042927 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + N + + + + Source + natural + + + + TermSpec + none + + MOD:00903 + MOD:01651 + PSI-MOD + + + MOD:01634 + L-aspartic acid removal + + A protein modification that effectively removes or replaces an L-aspartic acid. + + 18688235 + PubMed + + + This represents the loss or replacement of an L-aspartic acid residue in a polypeptide, and may be combined with the formula or mass of another entry that is the replacement residue to represent a mutation or substitution. + PSI-MOD-slim + + + DiffAvg + -115.09 + + + + DiffFormula + C -4 H -5 N -1 O -3 + + + + DiffMono + -115.026943 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + D + + + + Source + natural + + + + TermSpec + none + + MOD:00904 + MOD:01651 + PSI-MOD + + + MOD:01635 + L-cysteine removal + + A protein modification that effectively removes or replaces an L-cysteine. + + 18688235 + PubMed + + + This represents the loss or replacement of an L-cysteine residue in a polypeptide, and may be combined with the formula or mass of another entry that is the replacement residue to represent a mutation or substitution. + PSI-MOD-slim + + + DiffAvg + -103.14 + + + + DiffFormula + C -3 H -5 N -1 O -1 S -1 + + + + DiffMono + -103.009185 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + C + + + + Source + natural + + + + TermSpec + none + + MOD:00905 + MOD:01651 + PSI-MOD + + + MOD:01636 + L-glutamic acid removal + + A protein modification that effectively removes or replaces an L-glutamic acid. + + 18688235 + PubMed + + + This represents the loss or replacement of an L-glutamic acid residue in a polypeptide, and may be combined with the formula or mass of another entry that is the replacement residue to represent a mutation or substitution. + PSI-MOD-slim + + + DiffAvg + -129.12 + + + + DiffFormula + C -5 H -7 N -1 O -3 + + + + DiffMono + -129.042593 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + E + + + + Source + natural + + + + TermSpec + none + + MOD:00906 + MOD:01651 + PSI-MOD + + + MOD:01637 + L-glutamine removal + + A protein modification that effectively removes or replaces an L-glutamine. + + 18688235 + PubMed + + + This represents the loss or replacement of an L-glutamine residue in a polypeptide, and may be combined with the formula or mass of another entry that is the replacement residue to represent a mutation or substitution. + PSI-MOD-slim + + + DiffAvg + -128.13 + + + + DiffFormula + C -5 H -8 N -2 O -2 + + + + DiffMono + -128.058578 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + Q + + + + Source + natural + + + + TermSpec + none + + MOD:00907 + MOD:01651 + PSI-MOD + + + MOD:01638 + glycine removal + + A protein modification that effectively removes or replaces a glycine. + + 18688235 + PubMed + + + This represents the loss or replacement of an glycine residue in a polypeptide, and may be combined with the formula or mass of another entry that is the replacement residue to represent a mutation or substitution. + PSI-MOD-slim + + + DiffAvg + -57.05 + + + + DiffFormula + C -2 H -3 N -1 O -1 + + + + DiffMono + -57.021464 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + G + + + + Source + natural + + + + TermSpec + none + + MOD:00908 + MOD:01651 + PSI-MOD + + + MOD:01639 + L-histidine removal + + A protein modification that effectively removes or replaces an L-histidine. + + 18688235 + PubMed + + + This represents the loss or replacement of an L-histidine residue in a polypeptide, and may be combined with the formula or mass of another entry that is the replacement residue to represent a mutation or substitution. + PSI-MOD-slim + + + DiffAvg + -137.14 + + + + DiffFormula + C -6 H -7 N -3 O -1 + + + + DiffMono + -137.058912 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + H + + + + Source + natural + + + + TermSpec + none + + MOD:00909 + MOD:01651 + PSI-MOD + + + MOD:01640 + L-isoleucine removal + + A protein modification that effectively removes or replaces an L-isoleucine. + + 18688235 + PubMed + + + This represents the loss or replacement of an L-isoleucine residue in a polypeptide, and may be combined with the formula or mass of another entry that is the replacement residue to represent a mutation or substitution. + PSI-MOD-slim + + + DiffAvg + -113.16 + + + + DiffFormula + C -6 H -11 N -1 O -1 + + + + DiffMono + -113.084064 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + I + + + + Source + natural + + + + TermSpec + none + + MOD:00910 + MOD:01651 + PSI-MOD + + + MOD:01641 + L-leucine removal + + A protein modification that effectively removes or replaces an L-leucine. + + 18688235 + PubMed + + + This represents the loss or replacement of an L-leucine residue in a polypeptide, and may be combined with the formula or mass of another entry that is the replacement residue to represent a mutation or substitution. + PSI-MOD-slim + + + DiffAvg + -113.16 + + + + DiffFormula + C -6 H -11 N -1 O -1 + + + + DiffMono + -113.084064 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + L + + + + Source + natural + + + + TermSpec + none + + MOD:00911 + MOD:01651 + PSI-MOD + + + MOD:01642 + L-lysine removal + + A protein modification that effectively removes or replaces an L-lysine. + + 18688235 + PubMed + + + This represents the loss or replacement of an L-lysine residue in a polypeptide, and may be combined with the formula or mass of another entry that is the replacement residue to represent a mutation or substitution. + PSI-MOD-slim + + + DiffAvg + -128.18 + + + + DiffFormula + C -6 H -12 N -2 O -1 + + + + DiffMono + -128.094963 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + K + + + + Source + natural + + + + TermSpec + none + + MOD:00912 + MOD:01651 + PSI-MOD + + + MOD:01643 + L-methionine removal + + A protein modification that effectively removes or replaces an L-methionine. + + 3327521 + PubMed + + + 765 + UniMod + + + This represents the loss or replacement of an L-methionine residue in a polypeptide, including initiator methionine removal in eukaryotes. It may be combined with the formula or mass of another entry that is the replacement residue to represent a mutation or substitution [JSG]. + PSI-MOD-slim + + Met-loss + UniMod-interim + + + ntermmcleave + OMSSA-label + + + + DiffAvg + -131.19 + + + + DiffFormula + C -5 H -9 N -1 O -1 S -1 + + + + DiffMono + -131.040485 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + M + + + + Source + natural + + + + TermSpec + none + + MOD:00913 + MOD:01651 + PSI-MOD + + + MOD:01644 + L-phenylalanine removal + + A protein modification that effectively removes or replaces an L-phenylalanine. + + 18688235 + PubMed + + + This represents the loss or replacement of an L-phenylalanine residue in a polypeptide, and may be combined with the formula or mass of another entry that is the replacement residue to represent a mutation or substitution. + PSI-MOD-slim + + + DiffAvg + -147.18 + + + + DiffFormula + C -9 H -9 N -1 O -1 + + + + DiffMono + -147.068414 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + F + + + + Source + natural + + + + TermSpec + none + + MOD:00914 + MOD:01651 + PSI-MOD + + + MOD:01645 + L-proline removal + + A protein modification that effectively removes or replaces an L-proline. + + 18688235 + PubMed + + + This represents the loss or replacement of an L-proline residue in a polypeptide, and may be combined with the formula or mass of another entry that is the replacement residue to represent a mutation or substitution. + PSI-MOD-slim + + + DiffAvg + -97.12 + + + + DiffFormula + C -5 H -7 N -1 O -1 + + + + DiffMono + -97.052764 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + P + + + + Source + natural + + + + TermSpec + none + + MOD:00915 + MOD:01651 + PSI-MOD + + + MOD:01646 + L-serine removal + + A protein modification that effectively removes or replaces an L-serine. + + 18688235 + PubMed + + + This represents the loss or replacement of an L-serine residue in a polypeptide, and may be combined with the formula or mass of another entry that is the replacement residue to represent a mutation or substitution. + PSI-MOD-slim + + + DiffAvg + -87.08 + + + + DiffFormula + C -3 H -5 N -1 O -2 + + + + DiffMono + -87.032028 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + S + + + + Source + natural + + + + TermSpec + none + + MOD:00916 + MOD:01651 + PSI-MOD + + + MOD:01647 + L-threonine removal + + A protein modification that effectively removes or replaces an L-threonine. + + 18688235 + PubMed + + + This represents the loss or replacement of an L-threonine residue in a polypeptide, and may be combined with the formula or mass of another entry that is the replacement residue to represent a mutation or substitution. + PSI-MOD-slim + + + DiffAvg + -101.10 + + + + DiffFormula + C -4 H -7 N -1 O -2 + + + + DiffMono + -101.047678 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + T + + + + Source + natural + + + + TermSpec + none + + MOD:00917 + MOD:01651 + PSI-MOD + + + MOD:01648 + L-tryptophan removal + + A protein modification that effectively removes or replaces an L-tryptophan. + + 18688235 + PubMed + + + This represents the loss or replacement of an L-tryptophan residue in a polypeptide, and may be combined with the formula or mass of another entry that is the replacement residue to represent a mutation or substitution. + PSI-MOD-slim + + + DiffAvg + -186.21 + + + + DiffFormula + C -11 H -10 N -2 O -1 + + + + DiffMono + -186.079313 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + W + + + + Source + natural + + + + TermSpec + none + + MOD:00918 + MOD:01651 + PSI-MOD + + + MOD:01649 + L-tyrosine removal + + A protein modification that effectively removes or replaces an L-tyrosine. + + 18688235 + PubMed + + + This represents the loss or replacement of an L-tyrosine residue in a polypeptide, and may be combined with the formula or mass of another entry that is the replacement residue to represent a mutation or substitution. + PSI-MOD-slim + + + DiffAvg + -163.18 + + + + DiffFormula + C -9 H -9 N -1 O -2 + + + + DiffMono + -163.063329 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + Y + + + + Source + natural + + + + TermSpec + none + + MOD:00919 + MOD:01651 + PSI-MOD + + + MOD:01650 + L-valine removal + + A protein modification that effectively removes or replaces an L-valine. + + 18688235 + PubMed + + + This represents the loss or replacement of an L-valine residue in a polypeptide, and may be combined with the formula or mass of another entry that is the replacement residue to represent a mutation or substitution. + PSI-MOD-slim + + + DiffAvg + -99.13 + + + + DiffFormula + C -5 H -9 N -1 O -1 + + + + DiffMono + -99.068414 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + V + + + + Source + natural + + + + TermSpec + none + + MOD:00920 + MOD:01651 + PSI-MOD + + + MOD:01651 + natural, standard, encoded residue removal + + A protein modification that effectively removes or replaces a natural, standard, encoded residue. + + 18688235 + PubMed + + + This represents the loss or replacement of an encoded residue in a polypeptide, and may be combined with the formula or mass of another entry that is the replacement residue to represent a mutation or substitution. + PSI-MOD-slim + + + Origin + X + + + + Source + natural + + + + TermSpec + none + + MOD:00009 + PSI-MOD + + + MOD:01652 + sulfonyl halide reagent derivatized residue + + A protein modification that is produced by formation of an adduct with a sulfonyl halide compound used as a reagent. + + 18688235 + PubMed + + + These reagents typically react with N6-amino group of lysine residues and a free alpha-amino group of a peptide. + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + PSI-MOD + + + MOD:01653 + dansyl chloride derivatized residue + + A protein modification that is produced by formation of an adduct with 5-dimethylaminonaphthalene-1-sulfonyl chloride, dansyl chloride. + + 0 + DeltaMass + + + 139 + UniMod + + + + 5-dimethylaminonaphthalene-1-sulfonyl + UniMod-description + + + Dansyl + PSI-MS-label + + + Dansyl (Dns) + DeltaMass-label + + + DansylRes + PSI-MOD-label + + + + DiffAvg + 233.29 + + + + DiffFormula + C 12 H 11 N 1 O 2 S 1 + + + + DiffMono + 233.051050 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:01652 + PSI-MOD + + + MOD:01654 + N6-Dansyl derivatized lysine + + A protein modification that is produced by reaction with 5-dimethylaminonaphthalene-1-sulfonyl chloride, dansyl chloride, to form N6-Dansyl-lysine. + + 139#K + UniMod + + + + 5-dimethylaminonaphthalene-1-sulfonyl + UniMod-description + + + Dansyl + PSI-MS-label + + + N6DansylLys + PSI-MOD-label + + + + DiffAvg + 233.29 + + + + DiffFormula + C 12 H 11 N 1 O 2 S 1 + + + + DiffMono + 233.051050 + + + + Formula + C 18 H 23 N 3 O 3 S 1 + + + + MassAvg + 361.46 + + + + MassMono + 361.146013 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00912 + MOD:01653 + PSI-MOD + + + MOD:01655 + alpha-amino-Dansyl derivatized residue + + A protein modification that is produced by reaction with 5-dimethylaminonaphthalene-1-sulfonyl chloride, dansyl chloride, to form an alpha-amino-Dansyl-derivatized residue. + + 139#N-term + UniMod + + + + 5-dimethylaminonaphthalene-1-sulfonyl + UniMod-description + + + Dansyl + PSI-MS-label + + + N2DansylRes + PSI-MOD-label + + + + DiffAvg + 233.29 + + + + DiffFormula + C 12 H 11 N 1 O 2 S 1 + + + + DiffMono + 233.051050 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:01653 + PSI-MOD + + + MOD:01656 + Dabsyl chloride derivatized residue + + A protein modification that is produced by formation of an adduct with 4-(4-dimethylaminophenylazo)benzenesulfonyl chloride, Dabsyl chloride. + + 18688235 + PubMed + + + + 4-([4-(dimethylamino)phenyl]diazenyl)benzenesulfonyl + PSI-MOD-alternate + + + DabsylRes + PSI-MOD-label + + + + DiffAvg + 287.34 + + + + DiffFormula + C 14 H 13 N 3 O 2 S 1 + + + + DiffMono + 287.072848 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:01652 + PSI-MOD + + + MOD:01657 + N6-Dabsyl derivatized lysine + + A protein modification that is produced by reaction with 4-(4-dimethylaminophenylazo)benzenesulfonyl chloride, dabsyl chloride, to form N6-Dabsyl-lysine. + + 18688235 + PubMed + + + + N6-[4-([4-(dimethylamino)phenyl]diazenyl)benzenesulfonyl]lysine + PSI-MOD-alternate + + + N6DabsylLys + PSI-MOD-label + + + + DiffAvg + 287.34 + + + + DiffFormula + C 14 H 13 N 3 O 2 S 1 + + + + DiffMono + 287.072848 + + + + Formula + C 20 H 25 N 5 O 3 S 1 + + + + MassAvg + 415.51 + + + + MassMono + 415.167811 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00912 + MOD:01656 + PSI-MOD + + + MOD:01658 + alpha-amino-Dabsyl derivatized residue + + A protein modification that is produced by reaction with 4-(4-dimethylaminophenylazo)benzenesulfonyl chloride, dabsyl chloride, to form an alpha-amino-Dabsyl-derivatized residue. + + 18688235 + PubMed + + + + N2DabsylRes + PSI-MOD-label + + + + DiffAvg + 287.34 + + + + DiffFormula + C 14 H 13 N 3 O 2 S 1 + + + + DiffMono + 287.072848 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + N-term + + MOD:01656 + PSI-MOD + + + MOD:01659 + Uniblue A derivatized residue + + A protein modification that is produced by formation of an adduct with 1-amino-4-{[3-(ethenylsulfonyl)phenyl]amino}-9,10-dioxo-9,10-dihydroanthracene-2-sulfonate, Uniblue A. + + 18688235 + PubMed + + + This reagent has a reactive sulfonyl vinyl and typically reacts with the free thiol group of cysteine residues. + + 1-amino-4-{[3-(ethenylsulfonyl)phenyl]amino}-9,10-dioxo-9,10-dihydroanthracene-2-sulfonic acid + PSI-MOD-alternate + + + 1-amino-9,10-dioxo-4-{[3-(vinylsulfonyl)phenyl]amino}-9,10-dihydroanthracene-2-sulfonic acid + PSI-MOD-alternate + + + Uniblue A + PSI-MOD-alternate + + + UniblueARes + PSI-MOD-label + + + + DiffAvg + 484.50 + + + + DiffFormula + C 22 H 16 N 2 O 7 S 2 + + + + DiffMono + 484.039893 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + PSI-MOD + + + MOD:01660 + Uniblue A derivatized cysteine + + A protein modification that is produced by reaction with 1-amino-4-{[3-(ethenylsulfonyl)phenyl]amino}-9,10-dioxo-9,10-dihydroanthracene-2-sulfonate, Uniblue A, to form Uniblue A cysteine adduct. + + 18688235 + PubMed + + + PSI-MOD-slim + + 1-amino-4-{[3-(ethenylsulfonyl)phenyl]amino}-9,10-dioxo-9,10-dihydroanthracene-2-sulfonate + PSI-MOD-alternate + + + 1-amino-9,10-dioxo-4-{[3-(vinylsulfonyl)phenyl]amino}-9,10-dihydroanthracene-2-sulfonate + PSI-MOD-alternate + + + SUniblueACys + PSI-MOD-label + + + Uniblue A + PSI-MOD-alternate + + + + DiffAvg + 484.50 + + + + DiffFormula + C 22 H 16 N 2 O 7 S 2 + + + + DiffMono + 484.039893 + + + + Formula + C 25 H 21 N 3 O 8 S 3 + + + + MassAvg + 587.64 + + + + MassMono + 587.049078 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:00905 + MOD:01659 + PSI-MOD + + + MOD:01661 + pyruvic acid (Tyr) + + A protein modification that effectively converts an L-tyrosine residue to pyruvic acid. + + 10085076 + PubMed + + + 3042771 + PubMed + + + 500639 + PubMed + + + 8464063 + PubMed + + + AA0127#TYR + RESID + + + + 2-oxopropanoic acid + RESID-systematic + + + MOD_RES Pyruvic acid (Tyr) + UniProt-feature + + + pyruvic acid + RESID-name + + + + DiffAvg + -93.13 + + + + DiffFormula + C -6 H -7 N -1 O 0 + + + + DiffMono + -93.057849 + + + + Formula + C 3 H 3 O 2 + + + + MassAvg + 71.06 + + + + MassMono + 71.013304 + + + + Origin + Y + + + + Source + natural + + + + TermSpec + N-term + + MOD:00919 + MOD:01154 + PSI-MOD + + + MOD:01662 + N5-(ADP-ribosyl)-L-glutamine + + A protein modification that effectively converts an L-glutamine residue to N5-(ADP-ribosyl)-L-glutamine. + + 20185726 + PubMed + + + AA0518 + RESID + + + + (S)-2-amino-4-([adenosine 5'-(trihydrogen diphosphate) 5'->5'-ester with alpha-D-ribofuranosyl]amino)-5-oxopentanoic acid + RESID-systematic + + + N5-(ADP-ribosyl)-L-glutamine + RESID-name + + + N5-[alpha-D-ribofuranoside 5'->5'-ester with adenosine 5'-(trihydrogen diphosphate)]-L-glutamine + RESID-alternate + + + N5-alpha-D-ribofuranosyl-L-glutamine 5'->5'-ester with adenosine 5'-(trihydrogen diphosphate) + RESID-alternate + + + + DiffAvg + 541.30 + + + + DiffFormula + C 15 H 21 N 5 O 13 P 2 + + + + DiffMono + 541.061109 + + + + Formula + C 20 H 29 N 7 O 15 P 2 + + + + MassAvg + 669.43 + + + + MassMono + 669.119687 + + + + Origin + Q + + + + Source + natural + + + + TermSpec + none + + MOD:00752 + MOD:00907 + PSI-MOD + + + MOD:01663 + O-(ADP-ribosyl)-L-threonine + + A protein modification that effectively converts an L-threonine residue to O-(ADP-ribosyl)-L-threonine. + + 20185726 + PubMed + + + AA0519 + RESID + + + + (S)-2-amino-3-([adenosine 5'-(trihydrogen diphosphate) 5'->5'-ester with alpha-D-ribofuranosyl]oxy)-butanoic acid + RESID-systematic + + + O-(ADP-ribosyl)-L-threonine + RESID-name + + + O3-(ADP-ribosyl)-L-threonine + RESID-alternate + + + O3-[alpha-D-ribofuranoside 5'->5'-ester with adenosine 5'-(trihydrogen diphosphate)]-L-threonine + RESID-alternate + + + O3-alpha-D-ribofuranosyl-L-threonine 5'->5'-ester with adenosine 5'-(trihydrogen diphosphate) + RESID-alternate + + + + DiffAvg + 541.30 + + + + DiffFormula + C 15 H 21 N 5 O 13 P 2 + + + + DiffMono + 541.061109 + + + + Formula + C 19 H 28 N 6 O 15 P 2 + + + + MassAvg + 642.41 + + + + MassMono + 642.108787 + + + + Origin + T + + + + Source + natural + + + + TermSpec + none + + MOD:00752 + MOD:00917 + PSI-MOD + + + MOD:01664 + 7'-hydroxy-L-tryptophan + + A protein modification that effectively converts an L-tryptophan residue to a 7'-hydroxy-L-tryptophan. + + 20223990 + PubMed + + + AA0520 + RESID + + + + (2S)-2-amino-3-(7-hydroxy-1H-indol-3-yl)propanoic acid + RESID-systematic + + + 7'-hydroxy-L-tryptophan + RESID-name + + + 7-hydroxy-L-tryptophan + RESID-alternate + + + + DiffAvg + 16.00 + + + + DiffFormula + C 0 H 0 N 0 O 1 + + + + DiffMono + 15.994915 + + + + Formula + C 11 H 10 N 2 O 2 + + + + MassAvg + 202.21 + + + + MassMono + 202.074228 + + + + Origin + W + + + + Source + natural + + + + TermSpec + none + + MOD:01622 + PSI-MOD + + + MOD:01665 + N-(DNA-1',2'-dideoxyribos-1'-ylidene)-L-valine + + A protein modification that effectively crosslinks an N-terminal L-valine residue and a strand of DNA at the C-1 of a ribose, freeing the nucleotide base and forming N-(DNA-1',2'-dideoxyribos-1'-ylidene)-L-valine. + + 20185759 + PubMed + + + AA0521 + RESID + + + + (2S)-2-[(3R,4R)-3,4-dihydroxy-5-(phosphonooxy)pentylidene]amino-3-methylbutanoic acid + RESID-systematic + + + ACT_SITE Schiff-base intermediate with DNA; via amino nitrogen + UniProt-feature + + + DNA glycosylase valine Schiff base intermediate + RESID-alternate + + + N-(DNA-1',2'-dideoxyribos-1'-ylidene)-L-valine + RESID-name + + + + DiffAvg + 178.08 + + + + DiffFormula + C 5 H 7 N 0 O 5 P 1 + + + + DiffMono + 178.003110 + + + + Formula + C 10 H 17 N 1 O 6 P 1 + + + + MassAvg + 278.22 + + + + MassMono + 278.079349 + + + + Origin + V + + + + Source + hypothetical + + + + TermSpec + N-term + + MOD:00750 + MOD:00920 + PSI-MOD + + + MOD:01666 + epicocconone derivatized residue + + A protein modification that is produced by formation of an adduct with epicocconone. + + 18688235 + PubMed + + + + (6S,9aS)-6-(hydroxymethyl)-3-[(1Z,4E,6E,8E)-1-hydroxy-3-oxodeca-1,4,6,8-tetraen-1-yl]-9a-methyl-5,6-dihydro-2H-furo[3,2-g]isochromene-2,9(9aH)-dione + PSI-MOD-alternate + + + Deep Purple + PSI-MOD-alternate + + + LavaPurple + PSI-MOD-alternate + + + Lightning Fast + PSI-MOD-alternate + + + + DiffAvg + 410.42 + + + + DiffFormula + C 23 H 22 O 7 + + + + DiffMono + 410.136553 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + PSI-MOD + + + MOD:01667 + N6-epicoccononyl lysine adduct + + A protein modification that is produced by formation of an adduct with epicocconone. + + 18688235 + PubMed + + + + (6Z,7aS)-3-[(1Z,4E,6E,8E)-1-hydroxy-3-oxodeca-1,4,6,8-tetraen-1-yl]-7a-methyl-6-[([(1S)-1-amino-1-carboxylpentyl]amino)methylidene]-5-[(2S)-2,3-dihydroxypropyl]-1-benzofuran-2,7(6H,7aH)-dione + PSI-MOD-alternate + + + DeepPurple + PSI-MOD-alternate + + + LavaPurple + PSI-MOD-alternate + + + Lightning Fast + PSI-MOD-alternate + + + + DiffAvg + 410.42 + + + + DiffFormula + C 23 H 22 O 7 + + + + DiffMono + 410.136553 + + + + Formula + C 29 H 34 N 2 O 8 + + + + MassAvg + 538.60 + + + + MassMono + 538.231516 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00912 + MOD:01666 + PSI-MOD + + + MOD:01668 + O4-(8alpha-FAD)-L-aspartate + + A protein modification that effectively converts an L-aspartic acid residue to O4-(8alpha-FAD)-L-aspartate. + + 20080101 + PubMed + + + AA0522 + RESID + + + PSI-MOD-slim + + (2S)-2-amino-4-oxo-4-[8alpha-riboflavin 5'-(trihydrogen diphosphate) 5'->5'-ester with adenosine]oxybutanoic acid + RESID-systematic + + + 8alpha-[(4-aspartyl)oxy]FAD + RESID-alternate + + + O4-(8alpha-FAD)-L-aspartate + RESID-name + + + + DiffAvg + 783.54 + + + + DiffFormula + C 27 H 31 N 9 O 15 P 2 + + + + DiffMono + 783.141485 + + + + Formula + C 31 H 36 N 10 O 18 P 2 + + + + MassAvg + 898.63 + + + + MassMono + 898.168428 + + + + Origin + D + + + + Source + natural + + + + TermSpec + none + + MOD:00895 + MOD:00904 + PSI-MOD + + + MOD:01669 + trimethyl-L-arginine + + A protein modification that effectively converts an L-arginine residue to N(omega),N(omega),N'(omega)-trimethyl-L-arginine. + + 11704273 + PubMed + + + 602668 + PubMed + + + AA0523 + RESID + + + 37#R + UniMod + + + + (2S)-2-amino-5-([(dimethylamino)(methylamino)methylidene]amino)pentanoic acid + RESID-systematic + + + (2S)-2-amino-5-([(dimethylamino)(methylimino)methyl]amino)pentanoic acid + RESID-alternate + + + 2-[(4S)-4-amino-5-oxopentyl]-1,1,3-trimethylguanidine + RESID-alternate + + + N(G)-trimethylarginine + RESID-alternate + + + N5-[(dimethylamino)(imino)methyl]ornithine + RESID-alternate + + + NoNoNo'Me3Arg + PSI-MOD-label + + + omega-N,omega-N,omega-N'-trimethyl-L-arginine + RESID-name + + + tri-Methylation + UniMod-description + + + Trimethyl + PSI-MS-label + + + trimethylationr + OMSSA-label + + + + DiffAvg + 42.08 + + + + DiffFormula + C 3 H 6 N 0 O 0 + + + + DiffMono + 42.046950 + + + + Formula + C 9 H 18 N 4 O 1 + + + + MassAvg + 198.27 + + + + MassMono + 198.148061 + + + + Origin + R + + + + Source + hypothetical + + + + TermSpec + none + + MOD:00430 + MOD:00602 + MOD:00658 + PSI-MOD + + + MOD:01670 + N6-chloro-L-lysine + + A protein modification that effectively converts an L-lysine residue to N6-methyl-L-lysine. + + 16091367 + PubMed + + + 16195462 + PubMed + + + 17260957 + PubMed + + + AA0524 + RESID + + + + (2S)-2-amino-6-(chloroamino)hexanoic acid + RESID-systematic + + + epsilon-chlorolysine + RESID-alternate + + + lysine chloramine + RESID-alternate + + + N(zeta)-chlorolysine + RESID-alternate + + + N6-chloro-L-lysine + RESID-name + + + N6ClLys + PSI-MOD-label + + + + DiffAvg + 34.44 + + + + DiffFormula + C 0 Cl 1 H -1 N 0 O 0 + + + + DiffMono + 33.961028 + + + + Formula + C 6 Cl 1 H 11 N 2 O 1 + + + + MassAvg + 162.62 + + + + MassMono + 162.055991 + + + + Origin + K + + + + Source + hypothetical + + + + TermSpec + none + + MOD:00912 + MOD:01672 + MOD:01911 + PSI-MOD + + + MOD:01671 + O-(L-isoaspartyl)-L-threonine (active site intermediate) + + A protein modification that effectively converts an L-threonine residue to O-(L-isoaspartyl)-L-threonine, using free L-asparagine and releasing ammonia. + + 8706862 + PubMed + + + AA0525#THR + RESID + + + This is a threonine active intermediate and not an ester cross-link of peptides [JSG]. + + (2S)-2-amino-4-([(1S,2R)-1-amino-1-carboxypropan-2-yl]oxy)-4-oxobutanoic acid + RESID-systematic + + + (2S,3R)-2-amino-3-([(4S)-3-amino-3-carboxypropanoyl]oxy)propanoic acid + RESID-alternate + + + ACT_SITE O-isoaspartyl threonine intermediate + UniProt-feature + + + O(beta)-(beta-aspartyl)threonine + RESID-alternate + + + O-(L-isoaspartyl)-L-threonine + RESID-name + + + O3-(isoaspartyl)-threonine + RESID-alternate + + + + DiffAvg + 115.09 + + + + DiffFormula + C 4 H 5 N 1 O 3 + + + + DiffMono + 115.026943 + + + + Formula + C 8 H 12 N 2 O 5 + + + + MassAvg + 216.19 + + + + MassMono + 216.074621 + + + + Origin + T + + + + Source + natural + + + + TermSpec + none + + MOD:00671 + MOD:01978 + PSI-MOD + + + MOD:01672 + halogenated lysine + + A protein modification that effectively substitutes a hydrogen atom of an L-lysine residue with a halogen atom. + + 18688235 + PubMed + + + + + Origin + K + + + + Source + none + + + + TermSpec + none + + MOD:00694 + PSI-MOD + + + MOD:01673 + N-acetylaminohexosylated residue + + A protein modification that effectively replaces a hydrogen atom with an N-acetylaminohexose group through a glycosidic bond. + + 43 + UniMod + + + PSI-MOD-slim + + HexNAc + PSI-MS-label + + + HexNAcRes + PSI-MOD-label + + + N-Acetylhexosamine + UniMod-description + + + + DiffAvg + 203.19 + + + + DiffFormula + C 8 H 13 N 1 O 5 + + + + DiffMono + 203.079373 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + none + + + + TermSpec + none + + MOD:00436 + PSI-MOD + + + MOD:01674 + N4-(N-acetylamino)hexosyl-L-asparagine + + A protein modification that effectively converts an L-asparagine residue to N4-(N-acetaminohexosyl)-L-asparagine. + + 43#N + UniMod + + + PSI-MOD-slim + + (S)-2-amino-4-(2-acetamido-2-deoxy-beta-D-hexopyranosyl)amino-4-oxobutanoic acid + PSI-MOD-alternate + + + HexNAc + PSI-MS-label + + + HexNAcAsn + PSI-MOD-label + + + hexNAcN + OMSSA-label + + + N-Acetylhexosamine + UniMod-description + + + N4-(2-acetamido-2-deoxy-beta-D-hexopyranosyl)-L-asparagine + PSI-MOD-alternate + + + N4-(2-acetylamino-2-deoxy-beta-D-hexopyranosyl)-L-asparagine + PSI-MOD-alternate + + + N4-(N-acetylhexosaminyl)asparagine + PSI-MOD-alternate + + + N4-asparagine-beta-N-acetylhexosaminide + PSI-MOD-alternate + + + N4-glycosyl-L-asparagine + PSI-MOD-alternate + + + N4-glycosylasparagine + PSI-MOD-alternate + + + N4HexNAcAsn + PSI-MOD-label + + + + DiffAvg + 203.19 + + + + DiffFormula + C 8 H 13 N 1 O 5 + + + + DiffMono + 203.079373 + + + + Formula + C 12 H 19 N 3 O 7 + + + + MassAvg + 317.30 + + + + MassMono + 317.122300 + + + + Origin + N + + + + Source + natural + + + + TermSpec + none + + MOD:00160 + MOD:01673 + PSI-MOD + + + MOD:01675 + O-(N-acetylamino)hexosyl-L-serine + + A protein modification that effectively converts an L-serine residue to O3-(N-acetylaminohexosyl)-L-serine. + + 43#S + UniMod + + + PSI-MOD-slim + + (S)-2-amino-3-(2-acetamido-2-deoxy-beta-D-hexopyranosyloxy)propanoic acid + PSI-MOD-alternate + + + HexNAc + PSI-MS-label + + + hexNAcS + OMSSA-label + + + N-Acetylhexosamine + UniMod-description + + + O-(2-acetylamino-2-deoxy-beta-D-hexopyranosyl)-L-serine + PSI-MOD-alternate + + + O-(N-acetylhexosaminyl)serine + PSI-MOD-alternate + + + O-glycosylserine + PSI-MOD-alternate + + + O-seryl-beta-N-acetylhexosaminide + PSI-MOD-alternate + + + O3-(2-acetamido-2-deoxy-beta-D-hexopyranosyl)-L-serine + PSI-MOD-alternate + + + OHexNAcSer + PSI-MOD-label + + + + DiffAvg + 203.19 + + + + DiffFormula + C 8 H 13 N 1 O 5 + + + + DiffMono + 203.079373 + + + + Formula + C 11 H 18 N 2 O 7 + + + + MassAvg + 290.27 + + + + MassMono + 290.111401 + + + + Origin + S + + + + Source + natural + + + + TermSpec + none + + MOD:00002 + MOD:01673 + PSI-MOD + + + MOD:01676 + O-(N-acetylamino)hexosyl-L-threonine + + A protein modification that effectively converts an L-threonine residue to O3-(N-acetylaminohexosyl)-L-threonine. + + 43#T + UniMod + + + PSI-MOD-slim + + (2S,3R)-2-amino-3-(alpha-D-2-acetamido-2-deoxyhexopyranosyloxy)butanoic acid + PSI-MOD-alternate + + + HexNAc + PSI-MS-label + + + hexNAcT + OMSSA-label + + + N-Acetylhexosamine + UniMod-description + + + O-(N-acetylhexcosaminyl)-L-threonine + PSI-MOD-alternate + + + O-glycosylthreonine + PSI-MOD-alternate + + + O3-(N-acetylhexosaminyl)threonine + PSI-MOD-alternate + + + OHexNAcThr + PSI-MOD-label + + + + DiffAvg + 203.19 + + + + DiffFormula + C 8 H 13 N 1 O 5 + + + + DiffMono + 203.079373 + + + + Formula + C 12 H 20 N 2 O 7 + + + + MassAvg + 304.30 + + + + MassMono + 304.127051 + + + + Origin + T + + + + Source + natural + + + + TermSpec + none + + MOD:00005 + MOD:01673 + PSI-MOD + + + MOD:01677 + O4-(N-acetylamino)hexosyl-L-hydroxyproline + + A protein modification that effectively converts an L-proline residue to O4-(N-acetylamino)hexosyl-L-hydroxyproline. + + 18688235 + PubMed + + + secondary to RESID:AA0030 + PSI-MOD-slim + + (2S,4R)-4-[2-acetamido-2-deoxy-alpha-D-hexopyranosyloxy]pyrrolidine-2-carboxylic acid + PSI-MOD-alternate + + + 4-(N-acetylhexosaminyloxy)proline + PSI-MOD-alternate + + + 4-[(2-N-acetylamino)-alpha-D-hexopyranosyl]oxyproline + PSI-MOD-alternate + + + alpha-2-(N-acetylamino)hexopyranosyl-4-hydroxyproline + PSI-MOD-alternate + + + HexNAc + PSI-MS-label + + + O4-glycosyl-hydroxyproline + PSI-MOD-alternate + + + O4HexNAcHyPro + PSI-MOD-label + + + + DiffAvg + 219.19 + + + + DiffFormula + C 8 H 13 N 1 O 6 + + + + DiffMono + 219.074287 + + + + Formula + C 13 H 20 N 2 O 7 + + + + MassAvg + 316.31 + + + + MassMono + 316.127051 + + + + Origin + P + + + + Source + natural + + + + TermSpec + none + + MOD:00915 + MOD:01673 + PSI-MOD + + + MOD:01678 + N6-carbamoyl-L-lysine + + A protein modification that effectively coverts L-lysine to N6-carbamoyl-L-lysine. + + 56 + DeltaMass + + + 10978403 + PubMed + + + 12203680 + PubMed + + + 5#K + UniMod + + + This modification can be produced by hydrogen cyanate, either as a reagent or as released by urea degradation in solution [JSG]. + PSI-MOD-slim + + 2-amino-6-ureido-hexanoic acid + PSI-MOD-alternate + + + Carbamyl + UniMod-interim + + + Carbamylation + UniMod-description + + + carbamylk + OMSSA-label + + + homocitrulline + PSI-MOD-alternate + + + N6-(aminocarbonyl)-L-lysine + PSI-MOD-alternate + + + N6CbmLys + PSI-MOD-label + + + + DiffAvg + 43.02 + + + + DiffFormula + C 1 H 1 N 1 O 1 + + + + DiffMono + 43.005814 + + + + Formula + C 7 H 13 N 3 O 2 + + + + MassAvg + 171.20 + + + + MassMono + 171.100777 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00398 + PSI-MOD + + + MOD:01679 + alpha-aminocarbamoylated residue + + A protein modification that effectively replaces a residue alpha amino or imino hydrogen with a carbamoyl group. + + 56 + DeltaMass + + + 10978403 + PubMed + + + 12203680 + PubMed + + + 5#N-term + UniMod + + + This modification can be produced by hydrogen cyanate, either as a reagent or as released by urea degradation. This modification effectively blocks Edman degradation, and because it can dehydrate to a cyanate group and react with another peptide N-terminal, it can effectively block two peptide molecules [JSG]. + PSI-MOD-slim + + Carbamyl + UniMod-interim + + + Carbamylation + UniMod-description + + + N2CbmRes + PSI-MOD-label + + + ntermcarbamyl + OMSSA-label + + + + DiffAvg + 43.02 + + + + DiffFormula + C 1 H 1 N 1 O 1 + + + + DiffMono + 43.005814 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + N-term + + MOD:00398 + PSI-MOD + + + MOD:01680 + alpha-amino monomethylated residue + + A protein modification that effectively replaces one residue alpha amino or imino hydrogen with one methyl group. + + 34#N-term + UniMod + + + Polypeptides with monomethylated amino terminals can undergo premature cleavage during the coupling step of an Edman degradation. This can result in "preview" with both a residue and the following residue being seen from the first step on through a sequence [JSG]. + PSI-MOD-slim + + Methyl + PSI-MS-label + + + Methylation + UniMod-description + + + N2Me1Res + PSI-MOD-label + + + ntermmethyl + OMSSA-label + + + ntermpepmethyl + OMSSA-label + + + + DiffAvg + 14.03 + + + + DiffFormula + C 1 H 2 N 0 O 0 + + + + DiffMono + 14.015650 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + natural + + + + TermSpec + N-term + + MOD:00599 + MOD:01460 + PSI-MOD + + + MOD:01681 + monomethylated L-aspartic acid + + A protein modification that effectively replaces one hydrogen atom of an L-aspartic acid residue with one methyl group. + + 34#D + UniMod + + + + Me1Asp + PSI-MOD-label + + + Methyl + PSI-MS-label + + + Methylation + UniMod-description + + + methyld + OMSSA-label + + + + DiffAvg + 14.03 + + + + DiffFormula + C 1 H 2 N 0 O 0 + + + + DiffMono + 14.015650 + + + + Formula + C 5 H 7 N 1 O 3 + + + + MassAvg + 129.12 + + + + MassMono + 129.042593 + + + + Origin + D + + + + Source + artifact + + + + TermSpec + none + + MOD:00599 + MOD:00887 + PSI-MOD + + + MOD:01682 + monomethylated L-cysteine + + A protein modification that effectively replaces one hydrogen atom of an L-cysteine residue with one methyl group. + + 34#C + UniMod + + + PSI-MOD-slim + + Me1Cys + PSI-MOD-label + + + Methyl + PSI-MS-label + + + Methylation + UniMod-description + + + methylc + OMSSA-label + + + + DiffAvg + 14.03 + + + + DiffFormula + C 1 H 2 N 0 O 0 + + + + DiffMono + 14.015650 + + + + Formula + C 4 H 7 N 1 O 1 S 1 + + + + MassAvg + 117.17 + + + + MassMono + 117.024835 + + + + Origin + C + + + + Source + natural + + + + TermSpec + none + + MOD:00599 + MOD:00660 + PSI-MOD + + + MOD:01683 + monomethylated L-lysine + + A protein modification that effectively replaces one hydrogen atom of an L-lysine residue with one methyl group. + + PSI-MOD-slim + + Me1Lys + PSI-MOD-label + + + Methyl + PSI-MS-label + + + Methylation + UniMod-description + + + methylk + OMSSA-label + + + + DiffAvg + 14.03 + + + + DiffFormula + C 1 H 2 N 0 O 0 + + + + DiffMono + 14.015650 + + + + Formula + C 7 H 15 N 2 O 2 + + + + MassAvg + 159.21 + + + + MassMono + 159.113353 + + + + Origin + K + + + + Source + natural + + + + TermSpec + none + + MOD:00599 + MOD:00663 + PSI-MOD + + + MOD:01684 + palmitoylated-L-cysteine + + A protein modification that effectively converts an L-cysteine residue to a palmitoylated-L-cysteine, such as N-palmitoyl-L-cysteine or S-palmitoyl-L-cysteine. + + 47 + UniMod + + + PSI-MOD-slim + + Palmitoyl + PSI-MS-label + + + Palmitoylation + UniMod-description + + + palmitoylationc + OMSSA-label + + + PamCys + PSI-MOD-label + + + + DiffAvg + 238.41 + + + + DiffFormula + C 16 H 30 N 0 O 1 S 0 + + + + DiffMono + 238.229666 + + + + Formula + C 19 H 35 N 1 O 2 S 1 + + + + MassAvg + 341.55 + + + + MassMono + 341.238850 + + + + Origin + C + + + + Source + natural + + + + TermSpec + none + + MOD:00440 + MOD:00905 + PSI-MOD + + + MOD:01685 + alpha-amino palmitoylated residue + + A protein modification that effectively replaces a residue alpha-amino group with a alpha-palmitoylamino group. + + 47#N-term + UniMod + + + PSI-MOD-slim + + N2PamRes + PSI-MOD-label + + + Palmitoyl + PSI-MS-label + + + Palmitoylation + UniMod-description + + + + DiffAvg + 238.41 + + + + DiffFormula + C 16 H 30 N 0 O 1 S 0 + + + + DiffMono + 238.229666 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + natural + + + + TermSpec + N-term + + MOD:00651 + MOD:01696 + PSI-MOD + + + MOD:01686 + alpha-amino dimethylated residue + + A protein modification that effectively replaces two alpha amino hydrogen atoms with two methyl group. + + 36#N-term + UniMod + + + For alpha-amino acids, both N-alpha-monomethylation and complete N-alpha protonation and trimethylation have been observed, but incomplete dimethylation has not been reported as a natural process. For N-terminal proline residues, dimethylation can only be effectively accomplished with a protonated imino group, whereas this process accounts only for dimethylation and not protonation. See MOD:00889. + + di-Methylation + UniMod-description + + + Dimethyl + PSI-MS-label + + + N2Me2Res + PSI-MOD-label + + + ntermpepdimethyl + OMSSA-label + + + + DiffAvg + 28.05 + + + + DiffFormula + C 2 H 4 + + + + DiffMono + 28.031300 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + none + + + + TermSpec + N-term + + MOD:00429 + MOD:01460 + PSI-MOD + + + MOD:01687 + alpha-amino trimethylated residue + + A protein modification that effectively replaces an alpha-aminium group with a trimethylaminium group. + + 37#N-term + UniMod + + + For amino acids residues, amine trimethylation can effectively only be accomplished with an aminium, protonated primary amino, group. This process accounts only for trimethylation and not protonation. The alternative N2Me3+Res process (MOD:01698) accounts for both protonation and trimethylation. + PSI-MOD-slim + + N2Me3Res + PSI-MOD-label + + + ntermtrimethyl + OMSSA-label + + + tri-Methylation + UniMod-description + + + Trimethyl + PSI-MS-label + + + + DiffAvg + 42.08 + + + + DiffFormula + C 3 H 6 N 0 O 0 + + + + DiffMono + 42.046402 + + + + FormalCharge + 1+ + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + natural + + + + TermSpec + N-term + + MOD:00430 + MOD:01460 + + derives_from + MOD:017000 + + PSI-MOD + + + MOD:01688 + 3-hydroxy-L-asparagine + + A protein modification that effectively converts an L-asparagine residue to one of the diastereomeric 3-hydroxy-L-asparagine residues. + + 35#N + UniMod + + + PSI-MOD-slim + + 3HyAsn + PSI-MOD-label + + + hydroxylationn + OMSSA-label + + + monohydroxylated asparagine + PSI-MOD-alternate + + + Oxidation + PSI-MS-label + + + + DiffAvg + 16.00 + + + + DiffFormula + C 0 H 0 N 0 O 1 + + + + DiffMono + 15.994915 + + + + Formula + C 4 H 6 N 2 O 3 + + + + MassAvg + 130.10 + + + + MassMono + 130.037842 + + + + Origin + N + + + + Source + natural + + + + TermSpec + none + + MOD:00425 + MOD:00903 + PSI-MOD + + + MOD:01689 + alpha-carboxyl methylated residue + + A protein modification that effectively converts a carboxyl-terminal residue to an alpha-carboxyl (1-carboxyl) methyl ester. + + 34#C-term + UniMod + + + PSI-MOD-slim + + C1OMeRes + PSI-MOD-label + + + ctermpepmeester + OMSSA-label + + + ctermpepmethyl + OMSSA-label + + + Methyl + PSI-MS-label + + + Methyl + UniMod-alternate + + + + DiffAvg + 14.03 + + + + DiffFormula + C 1 H 2 N 0 O 0 S 0 + + + + DiffMono + 14.015650 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + natural + + + + TermSpec + C-term + + MOD:00393 + PSI-MOD + + + MOD:01690 + N-[(12R)-12-hydroxymyristoyl]-L-cysteine + + A protein modification that effectively converts an L-cysteine residue to N-[(12R)-12-hydroxymyristoyl]-L-cysteine. + + AA0516 + RESID + + + + 2-[(12R)-12-hydroxytetradecanoyl]amino-3-sulfanylpropanoic acid + RESID-systematic + + + LIPID N-[(12R)-12-hydroxymyristoyl]cysteine + UniProt-feature + + + N-[(12R)-12-hydroxymyristoyl]-L-cysteine + RESID-name + + + N-[(12R)-12-hydroxytetradecanoyl]cysteine + RESID-alternate + + + + DiffAvg + 226.36 + + + + DiffFormula + C 14 H 26 N 0 O 2 S 0 + + + + DiffMono + 226.193280 + + + + Formula + C 17 H 32 N 1 O 3 S 1 + + + + MassAvg + 330.51 + + + + MassMono + 330.210290 + + + + Origin + C + + + + Source + natural + + + + TermSpec + N-term + + MOD:00905 + MOD:01696 + PSI-MOD + + + MOD:01691 + N-(12-ketomyristoyl)-L-cysteine + + A protein modification that effectively converts an L-cysteine residue to N-(12-ketomyristoyl)-L-cysteine. + + 19053188 + PubMed + + + AA0517 + RESID + + + + 2-(12-oxotetradecanoyl)amino-3-sulfanylpropanoic acid + RESID-systematic + + + LIPID N-(12-oxomyristoyl)cysteine + UniProt-feature + + + N-(12-ketomyristoyl)-L-cysteine + RESID-name + + + N-(12-oxotetradecanoyl)cysteine + RESID-alternate + + + + DiffAvg + 224.34 + + + + DiffFormula + C 14 H 24 N 0 O 2 S 0 + + + + DiffMono + 224.177630 + + + + Formula + C 17 H 30 N 1 O 3 S 1 + + + + MassAvg + 328.49 + + + + MassMono + 328.194640 + + + + Origin + C + + + + Source + natural + + + + TermSpec + N-term + + MOD:00905 + MOD:01696 + PSI-MOD + + + MOD:01692 + glutamyl semialdehyde (Glu) + + A protein modification that effectively converts an L-glutamic acid residue to L-glutamyl semialdehyde. + + 18688235 + PubMed + + + 743268 + PubMed + + + + Deoxy + PSI-MS-label + + + gamma-glutamyl semialdehyde + PSI-MOD-alternate + + + glutamyl 5-semialdehyde + PSI-MOD-alternate + + + glutamyl aldehyde + PSI-MOD-alternate + + + + DiffAvg + -16.00 + + + + DiffFormula + C 0 H 0 N 0 O -1 + + + + DiffMono + -15.994915 + + + + Formula + C 5 H 7 N 1 O 2 + + + + MassAvg + 113.12 + + + + MassMono + 113.047678 + + + + Origin + E + + + + Source + artifact + + + + TermSpec + none + + MOD:00906 + MOD:01161 + MOD:01440 + PSI-MOD + + + MOD:01693 + alpha-amino pyridylacetylated residue + + A protein modification that effectively replaces a residue alpha amino or imino hydrogen with a (pyrid-3-yl)acetyl group. + + 9276974 + PubMed + + + 25#N-term + UniMod + + + Produced by reaction with N-[(pyrid-3-yl)acetyl]oxy-succinimide [JSG]. + + ntermpeppyridyl + OMSSA-label + + + Pyridylacetyl + PSI-MS-label + + + pyridylacetyl + UniMod-description + + + + DiffAvg + 119.12 + + + + DiffFormula + C 7 H 5 N 1 O 1 + + + + DiffMono + 119.037114 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + N-term + + MOD:00418 + MOD:01696 + PSI-MOD + + + MOD:01694 + S-(coelenterazin-3a-yl)-L-cysteine + + A protein modification that effectively results from forming an adduct between an L-cysteine residue and the bioluminescent compound didehydrocoelenterazine to form S-(coelenterazin-3a-yl)-L-cysteine. + + 2311 + ChEBI + + + 18997450 + PubMed + + + AA0526 + RESID + + + + (2R)-2-amino-3-([(4-hydroxyphenyl)(8-benzyl-3-oxo-6-[4-hydroxyphenyl]-3,7-dihydroimidazo[1,2-a]pyrazin-2-yl)methyl]sulfanyl)propanoic acid + RESID-systematic + + + dehydrocoelenterazine cysteine adduct + RESID-alternate + + + MOD_RES S-(coelenterazin-3a-yl)cysteine + UniProt-feature + + + S-(coelenterazin-3a-yl)-L-cysteine + RESID-name + + + symplectin chromophore + RESID-alternate + + + + DiffAvg + 421.46 + + + + DiffFormula + C 26 H 19 N 3 O 3 S 0 + + + + DiffMono + 421.142641 + + + + Formula + C 29 H 24 N 4 O 4 S 1 + + + + MassAvg + 524.60 + + + + MassMono + 524.151826 + + + + Origin + C + + + + Source + natural + + + + TermSpec + none + + MOD:00905 + PSI-MOD + + + MOD:01695 + alpha-amino 3-(carboxamidomethylthio)propanoylated residue + + A protein modification that effectively replaces a residue alpha-amino- or alpha-imino-hydrogen with an 3-(carboxamidomethylthio)propanoyl group. + + 15121203 + PubMed + + + 293#N-term + UniMod + + + + 3-(carbamidomethylthio)propanoyl + UniMod-description + + + CAMthiopropanoyl + PSI-MS-label + + + + DiffAvg + 145.18 + + + + DiffFormula + C 5 H 7 N 1 O 2 S 1 + + + + DiffMono + 145.019749 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + N-term + + MOD:00612 + MOD:01696 + PSI-MOD + + + MOD:01696 + alpha-amino acylated residue + + A protein modification that effectively replaces a residue alpha-amino- or alpha-imino-hydrogen with an acyl group. + + 18688235 + PubMed + + + PSI-MOD-slim + + + Origin + X + + + + Source + natural + + + + TermSpec + N-term + + MOD:00670 + PSI-MOD + + + MOD:01697 + alpha-amino 4-(2-aminoethyl)benzenesulfonylated residue + + A protein modification that effectively replaces a residue alpha-amino- or alpha-imino-hydrogen with an 4-(2-aminoethyl)benzenesulfonyl group. + + 235 + DeltaMass + + + 8597590 + PubMed + + + 276#N-term + UniMod + + + See the comment for MOD:00596 [JSG]. + + AEBS + PSI-MS-label + + + Aminoethylbenzenesulfonylation + UniMod-description + + + + DiffAvg + 183.23 + + + + DiffFormula + C 8 H 9 N 1 O 2 S 1 + + + + DiffMono + 183.035400 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + N-term + + MOD:00596 + PSI-MOD + + + MOD:01698 + alpha-amino trimethylated protonated-residue + + A protein modification that effectively replaces an amino group with a trimethylaminium group. + + 18688235 + PubMed + + + PSI-MOD-slim + + N2Me3+Res + PSI-MOD-label + + + tri-Methylation + UniMod-description + + + Trimethyl + PSI-MS-label + + + + DiffAvg + 43.09 + + + + DiffFormula + C 3 H 7 N 0 O 0 S 0 + + + + DiffMono + 43.054227 + + + + FormalCharge + 1+ + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + natural + + + + TermSpec + N-term + + MOD:00711 + MOD:01460 + PSI-MOD + + + MOD:01699 + protonated residue + + A protein modification that effectively adds a hydrogen cation, a proton, forming a cationic residue. + + 18688235 + PubMed + + + PSI-MOD-slim + + H+NRes + PSI-MOD-label + + + + DiffAvg + 1.01 + + + + DiffFormula + C 0 H 1 N 0 O 0 + + + + DiffMono + 1.007276 + + + + FormalCharge + 1+ + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + natural + + + + TermSpec + none + + MOD:01156 + PSI-MOD + + + MOD:01700 + alpha-amino protonated residue + + A protein modification that effectively adds a proton to a residue alpha-amnino or alpha-imino group forming an alpha-aminium or alpha-iminium group, respectively. + + 18688235 + PubMed + + + PSI-MOD-slim + + N2H+NRes + PSI-MOD-label + + + + DiffAvg + 1.01 + + + + DiffFormula + C 0 H 1 N 0 O 0 + + + + DiffMono + 1.007276 + + + + FormalCharge + 1+ + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + natural + + + + TermSpec + N-term + + MOD:01699 + PSI-MOD + + + MOD:01701 + deprotonated residue + + A protein modification that effectively removes a hydrogen cation, a proton, forming an anionic residue. + + 18688235 + PubMed + + + PSI-MOD-slim + + H-NRes + PSI-MOD-label + + + + DiffAvg + -1.01 + + + + DiffFormula + C 0 H -1 N 0 O 0 + + + + DiffMono + -1.007276 + + + + FormalCharge + 1- + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + natural + + + + TermSpec + none + + MOD:01156 + PSI-MOD + + + MOD:01702 + alpha-carboxyl deprotonated residue + + A protein modification that effectively removes a proton from a residue 1-carboxyl group (referred to as the alpha-carboxyl), forming a carboxylate anion. + + 18688235 + PubMed + + + PSI-MOD-slim + + C1H-NRes + PSI-MOD-label + + + + DiffAvg + -1.01 + + + + DiffFormula + C 0 H -1 N 0 O 0 + + + + DiffMono + -1.007276 + + + + FormalCharge + 1- + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + natural + + + + TermSpec + C-term + + MOD:01701 + PSI-MOD + + + MOD:01703 + dehydrobutyrine + + A protein modification that effectively converts a source amino acid residue to dehydrobutyrine. + + 18688235 + PubMed + + + PSI-MOD-slim + + beta-elim-t + OMSSA-label + + + Dehydrated + PSI-MS-label + + + Dehydrated + UniMod-interim + + + Dehydration + UniMod-description + + + dehydro + OMSSA-label + + + Dehydroamino butyric acid + DeltaMass-label + + + dHAbu + PSI-MOD-label + + + phospholosst + OMSSA-label + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + C 4 H 5 N 1 O 1 + + + + MassAvg + 83.09 + + + + MassMono + 83.037114 + + + + Origin + X + + + + Source + none + + + + TermSpec + none + + MOD:00859 + PSI-MOD + + + MOD:01704 + dehydrobutyrine (Met) + + A protein modification that effectively converts an L-methionine residue to dehydrobutyrine, by neutral loss of methyl sulfide. + + 18688235 + PubMed + + + It is expected that this neutral loss will produce a mix of (E)- and (Z)-isomers [JSG]. + PSI-MOD-slim + + dHAbu(Met) + PSI-MOD-label + + + + DiffAvg + -48.10 + + + + DiffFormula + C -1 H -4 N 0 O 0 S -1 + + + + DiffMono + -48.003371 + + + + Formula + C 4 H 5 N 1 O 1 + + + + MassAvg + 83.09 + + + + MassMono + 83.037114 + + + + Origin + M + + + + Source + artifact + + + + TermSpec + none + + MOD:00913 + MOD:01703 + PSI-MOD + + + MOD:01705 + isotope tagged reagent acylated residue + + A protein modification that effectively replaces a residue hydrogen with an isotope tagged reagent acyl group. + + 18688235 + PubMed + + + PSI-MOD-slim + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00649 + PSI-MOD + + + MOD:01706 + isotope tagged reagent N-acylated residue + + A protein modification that effectively replaces a residue alpha-amino- or alpha-imino-hydrogen with an isotope tagged reagent acyl group. + + 18688235 + PubMed + + + PSI-MOD-slim + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00670 + PSI-MOD + + + MOD:01707 + isotope tagged reagent O-acylated residue + + A protein modification that effectively replaces a residue hydroxyl group with an isotope tagged reagent acyloxy group. + + 18688235 + PubMed + + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00671 + PSI-MOD + + + MOD:01708 + isotope tagged reagent alpha-amino acylated residue + + A protein modification that effectively replaces a residue alpha-amino- or alpha-imino-hydrogen with an isotope tagged reagent acyl group. + + 18688235 + PubMed + + + PSI-MOD-slim + + + Origin + X + + + + Source + artifact + + + + TermSpec + N-term + + MOD:01696 + MOD:01705 + MOD:01706 + PSI-MOD + + + MOD:01709 + iTRAQ4plex reporter+balance reagent N-acylated residue + + A protein modification that effectively replaces a residue amino- or imino-hydrogen with one of the Applied Biosystems iTRAQ4plex reagent reporter+balance groups. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a carbonyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:01706 + PSI-MOD + + + MOD:01710 + iTRAQ8plex reporter+balance reagent N-acylated residue + + A protein modification that effectively replaces a residue amino- or imino-hydrogen with one of the Applied Biosystems iTRAQ8plex reagent reporter+balance groups. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a carbonyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:01706 + PSI-MOD + + + MOD:01711 + iTRAQ4plex reporter+balance reagent acylated N-terminal + + A protein modification that effectively replaces a residue alpha-amino- or alpha-imino-hydrogen with one of the Applied Biosystems iTRAQ4plex reagent reporter+balance groups. + + 214#N-term + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a carbonyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + N-term + + MOD:01708 + MOD:01709 + PSI-MOD + + + MOD:01712 + iTRAQ8plex reporter+balance reagent acylated N-terminal + + A protein modification that effectively replaces a residue alpha-amino- or alpha-imino-hydrogen with one of the Applied Biosystems iTRAQ8plex reagent reporter+balance groups. + + 214#N-term + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a carbonyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + N-term + + MOD:01708 + MOD:01710 + PSI-MOD + + + MOD:01713 + iTRAQ4plex reporter+balance reagent O-acylated residue + + A protein modification that effectively replaces a residue hydroxyl with one of the Applied Biosystems iTRAQ4plex reagent reporter+balance acyloxy groups. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a carbonyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:01707 + PSI-MOD + + + MOD:01714 + iTRAQ8plex reporter+balance reagent O-acylated residue + + A protein modification that effectively replaces a residue hydroxyl with one of the Applied Biosystems iTRAQ8plex reagent reporter+balance acyloxy groups. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a carbonyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:01707 + PSI-MOD + + + MOD:01715 + TMT6plex reporter+balance reagent acylated residue + + A protein modification that effectively replaces a hydrogen atom of a residue with a Proteome Sciences TMT6plex reporter+balance group. + + 214 + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,2,6-trimethylpiperidine, is connected to a 3-(carbonylamino)propanoyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + 3-[(2,6-dimethylpiperidin-1-yl)acetyl]amino)propanoyl + PSI-MOD-alternate + + + Sixplex Tandem Mass Tag(TM) + UniMod-description + + + TMT6plex + UniMod-alternate + + + + DiffAvg + 229.16 + + + + DiffFormula + (12)C 8 (13)C 4 H 20 (14)N 1 (15)N 1 O 2 + + + + DiffMono + 229.162932 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:01426 + MOD:01428 + MOD:01429 + MOD:01705 + PSI-MOD + + + MOD:01716 + TMT6plex reporter fragment + + The protein modification reporter fragment produced by an Proteome Sciences TMT6plex-126 reagent acylated residue. + + 18688235 + PubMed + + + PSI-MOD-slim + + 2,6-dimethyl-1-methylidenepiperidinium + PSI-MOD-alternate + + + cysTMT6plex reporter fragment + PSI-MOD-alternate + + MOD:01520 + + derives_from + MOD:017150 + + + derives_from + MOD:018210 + + PSI-MOD + + + MOD:01717 + TMT6plex reporter+balance reagent N-acylated residue + + A protein modification that effectively replaces a residue amino- or imino-hydrogen with a Proteome Sciences TMT6plex reporter+balance group. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,2,6-trimethylpiperidine, is connected to a 3-(carbonylamino)propanoyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + 3-[(2,6-dimethylpiperidin-1-yl)acetyl]amino)propanoyl + PSI-MOD-alternate + + + Sixplex Tandem Mass Tag(TM) + UniMod-description + + + TMT6plex + UniMod-alternate + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:01706 + PSI-MOD + + + MOD:01718 + TMT6plex reporter+balance reagent acylated N-terminal + + A protein modification that effectively replaces a residue alpha-amino- or alpha-imino-hydrogen with a Proteome Sciences TMT6plex reporter+balance group. + + 214#N-term + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,2,6-trimethylpiperidine, is connected to a 3-(carbonylamino)propanoyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + 3-[(2,6-dimethylpiperidin-1-yl)acetyl]amino)propanoyl + PSI-MOD-alternate + + + Sixplex Tandem Mass Tag(TM) + UniMod-description + + + TMT6plex + UniMod-alternate + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + N-term + + MOD:01708 + MOD:01717 + PSI-MOD + + + MOD:01719 + TMT6plex reporter+balance reagent O-acylated residue + + A protein modification that effectively replaces a residue hydroxyl with one of the Proteome Sciences TMT6plex reagent reporter+balance acyloxy groups. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,2,6-trimethylpiperidine, is connected to a 3-(carbonylamino)propanoyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + 3-[(2,6-dimethylpiperidin-1-yl)acetyl]amino)propanoyl + PSI-MOD-alternate + + + Sixplex Tandem Mass Tag(TM) + UniMod-description + + + TMT6plex + UniMod-alternate + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:01707 + PSI-MOD + + + MOD:01720 + TMT6plex-126 reporter+balance reagent acylated residue + + A protein modification that effectively replaces a hydrogen atom of a residue with the Proteome Sciences TMT6plex-126 reporter+balance group. + + 737 + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,2,6-trimethylpiperidine, is connected to a 3-(carbonylamino)propanoyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + 3-[(2,6-dimethylpiperidin-1-yl)acetyl]amino)propanoyl + PSI-MOD-alternate + + + Sixplex Tandem Mass Tag(TM) + UniMod-description + + + TMT6plex + UniMod-alternate + + + + DiffAvg + 229.16 + + + + DiffFormula + (12)C 8 (13)C 4 H 20 (14)N 1 (15)N 1 O 2 + + + + DiffMono + 229.162932 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:01715 + PSI-MOD + + + MOD:01721 + TMT6plex-126 reporter+balance reagent acylated N-terminal + + A protein modification that effectively replaces a hydrogen atom of a protein N-terminal with the Proteome Sciences TMT6plex-126 reporter+balance group. + + 737#N-term + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,2,6-trimethylpiperidine, is connected to a 3-(carbonylamino)propanoyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + 3-[(2,6-dimethylpiperidin-1-yl)acetyl]amino)propanoyl + PSI-MOD-alternate + + + Sixplex Tandem Mass Tag(TM) + UniMod-description + + + TMT6plex + UniMod-alternate + + + + DiffAvg + 229.16 + + + + DiffFormula + (12)C 8 (13)C 4 H 20 (14)N 1 (15)N 1 O 2 + + + + DiffMono + 229.162932 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + N-term + + MOD:01718 + MOD:01720 + PSI-MOD + + + MOD:01722 + TMT6plex-126 reporter+balance reagent N6-acylated lysine + + A protein modification that effectively replaces the N6'-hydrogen atom of a lysine residue with the Proteome Sciences TMT6plex-126 reporter+balance group. + + 737#K + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,2,6-trimethylpiperidine, is connected to a 3-(carbonylamino)propanoyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + 3-[(2,6-dimethylpiperidin-1-yl)acetyl]amino)propanoyl + PSI-MOD-alternate + + + Sixplex Tandem Mass Tag(TM) + UniMod-description + + + TMT6plex + UniMod-alternate + + + + DiffAvg + 229.16 + + + + DiffFormula + (12)C 8 (13)C 4 H 20 (14)N 1 (15)N 1 O 2 + + + + DiffMono + 229.162932 + + + + Formula + (12)C 14 (13)C 4 H 32 (14)N 3 (15)N 1 O 3 + + + + MassAvg + 357.26 + + + + MassMono + 357.257895 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:01717 + MOD:01720 + MOD:01875 + PSI-MOD + + + MOD:01723 + TMT6plex-126 reporter+balance reagent O4'-acylated tyrosine + + A protein modification that effectively replaces the O4'-hydrogen atom of a tyrosine residue with the Proteome Sciences TMT6plex-126 reporter+balance group. + + 737#Y + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,2,6-trimethylpiperidine, is connected to a 3-(carbonylamino)propanoyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + 3-[(2,6-dimethylpiperidin-1-yl)acetyl]amino)propanoyl + PSI-MOD-alternate + + + Sixplex Tandem Mass Tag(TM) + UniMod-description + + + TMT6plex + UniMod-alternate + + + + DiffAvg + 229.16 + + + + DiffFormula + (12)C 8 (13)C 4 H 20 (14)N 1 (15)N 1 O 2 + + + + DiffMono + 229.162932 + + + + Formula + (12)C 17 (13)C 4 H 29 (14)N 2 (15)N 1 O 4 + + + + MassAvg + 392.23 + + + + MassMono + 392.226261 + + + + Origin + Y + + + + Source + artifact + + + + TermSpec + none + + MOD:00919 + MOD:01719 + MOD:01720 + PSI-MOD + + + MOD:01724 + TMT6plex-126 reporter+balance reagent N'-acylated histidine + + A protein modification that effectively replaces an N'-hydrogen atom of a histidine residue with the Proteome Sciences TMT6plex-126 reporter+balance group. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,2,6-trimethylpiperidine, is connected to a 3-(carbonylamino)propanoyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + 3-[(2,6-dimethylpiperidin-1-yl)acetyl]amino)propanoyl + PSI-MOD-alternate + + + Sixplex Tandem Mass Tag(TM) + UniMod-description + + + TMT6plex + UniMod-alternate + + + + DiffAvg + 229.16 + + + + DiffFormula + (12)C 8 (13)C 4 H 20 (14)N 1 (15)N 1 O 2 + + + + DiffMono + 229.162932 + + + + Formula + (12)C 14 (13)C 4 H 27 (14)N 4 (15)N 1 O 3 + + + + MassAvg + 366.22 + + + + MassMono + 366.221844 + + + + Origin + H + + + + Source + artifact + + + + TermSpec + none + + MOD:00909 + MOD:01717 + MOD:01720 + PSI-MOD + + + MOD:01725 + TMT6plex-126 reporter+balance reagent O3-acylated serine + + A protein modification that effectively replaces an O3-hydrogen atom of a serine residue with the Proteome Sciences TMT6plex-126 reporter+balance group. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,2,6-trimethylpiperidine, is connected to a 3-(carbonylamino)propanoyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + 3-[(2,6-dimethylpiperidin-1-yl)acetyl]amino)propanoyl + PSI-MOD-alternate + + + Sixplex Tandem Mass Tag(TM) + UniMod-description + + + TMT6plex + UniMod-alternate + + + + DiffAvg + 229.16 + + + + DiffFormula + (12)C 8 (13)C 4 H 20 (14)N 1 (15)N 1 O 2 + + + + DiffMono + 229.162932 + + + + Formula + (12)C 11 (13)C 4 H 25 (14)N 2 (15)N 1 O 4 + + + + MassAvg + 316.19 + + + + MassMono + 316.194961 + + + + Origin + S + + + + Source + artifact + + + + TermSpec + none + + MOD:00916 + MOD:01719 + MOD:01720 + PSI-MOD + + + MOD:01726 + TMT6plex-126 reporter+balance reagent O3-acylated threonine + + A protein modification that effectively replaces an O3-hydrogen atom of a threonine residue with the Proteome Sciences TMT6plex-126 reporter+balance group. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,2,6-trimethylpiperidine, is connected to a 3-(carbonylamino)propanoyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + 3-[(2,6-dimethylpiperidin-1-yl)acetyl]amino)propanoyl + PSI-MOD-alternate + + + Sixplex Tandem Mass Tag(TM) + UniMod-description + + + TMT6plex + UniMod-alternate + + + + DiffAvg + 229.16 + + + + DiffFormula + (12)C 8 (13)C 4 H 20 (14)N 1 (15)N 1 O 2 + + + + DiffMono + 229.162932 + + + + Formula + (12)C 12 (13)C 4 H 27 (14)N 2 (15)N 1 O 4 + + + + MassAvg + 330.21 + + + + MassMono + 330.210611 + + + + Origin + T + + + + Source + artifact + + + + TermSpec + none + + MOD:00917 + MOD:01719 + MOD:01720 + PSI-MOD + + + MOD:01727 + TMT6plex-126 reporter fragment + + The protein modification reporter fragment produced by an Proteome Sciences TMT6plex-126 reagent acylated residue. + + 18688235 + PubMed + + + PSI-MOD-slim + + 2,6-dimethyl-1-methylidenepiperidinium + PSI-MOD-alternate + + + cysTMT6plex-126 reporter fragment + PSI-MOD-alternate + + + Sixplex Tandem Mass Tag(TM) + UniMod-description + + + TMT6plex + UniMod-alternate + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + FormalCharge + 1+ + + + + Formula + (12)C 8 H 16 (14)N 1 + + + + MassAvg + 126.13 + + + + MassMono + 126.127726 + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:01716 + + derives_from + MOD:017200 + + + derives_from + MOD:018220 + + + derives_from + MOD:018230 + + PSI-MOD + + + MOD:01728 + TMT6plex-127 reporter+balance reagent acylated residue + + A protein modification that effectively replaces a hydrogen atom of a residue with the Proteome Sciences TMT6plex-127 reporter+balance group. + + 737 + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,2,6-trimethylpiperidine, is connected to a 3-(carbonylamino)propanoyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + 3-[(2,6-dimethylpiperidin-1-yl)acetyl]amino)propanoyl + PSI-MOD-alternate + + + Sixplex Tandem Mass Tag(TM) + UniMod-description + + + TMT6plex + UniMod-alternate + + + + DiffAvg + 229.16 + + + + DiffFormula + (12)C 8 (13)C 4 H 20 (14)N 1 (15)N 1 O 2 + + + + DiffMono + 229.162932 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:01715 + PSI-MOD + + + MOD:01729 + TMT6plex-127 reporter+balance reagent acylated N-terminal + + A protein modification that effectively replaces a hydrogen atom of a protein N-terminal with the Proteome Sciences TMT6plex-127 reporter+balance group. + + 737#N-term + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,2,6-trimethylpiperidine, is connected to a 3-(carbonylamino)propanoyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + 3-[(2,6-dimethylpiperidin-1-yl)acetyl]amino)propanoyl + PSI-MOD-alternate + + + Sixplex Tandem Mass Tag(TM) + UniMod-description + + + TMT6plex + UniMod-alternate + + + + DiffAvg + 229.16 + + + + DiffFormula + (12)C 8 (13)C 4 H 20 (14)N 1 (15)N 1 O 2 + + + + DiffMono + 229.162932 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + N-term + + MOD:01718 + MOD:01728 + PSI-MOD + + + MOD:01730 + TMT6plex-127 reporter+balance reagent N6-acylated lysine + + A protein modification that effectively replaces the N6'-hydrogen atom of a lysine residue with the Proteome Sciences TMT6plex-127 reporter+balance group. + + 737#K + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,2,6-trimethylpiperidine, is connected to a 3-(carbonylamino)propanoyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + 3-[(2,6-dimethylpiperidin-1-yl)acetyl]amino)propanoyl + PSI-MOD-alternate + + + Sixplex Tandem Mass Tag(TM) + UniMod-description + + + TMT6plex + UniMod-alternate + + + + DiffAvg + 229.16 + + + + DiffFormula + (12)C 8 (13)C 4 H 20 (14)N 1 (15)N 1 O 2 + + + + DiffMono + 229.162932 + + + + Formula + (12)C 14 (13)C 4 H 32 (14)N 3 (15)N 1 O 3 + + + + MassAvg + 357.26 + + + + MassMono + 357.257895 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:01717 + MOD:01728 + MOD:01875 + PSI-MOD + + + MOD:01731 + TMT6plex-127 reporter+balance reagent O4'-acylated tyrosine + + A protein modification that effectively replaces the O4'-hydrogen atom of a tyrosine residue with the Proteome Sciences TMT6plex-127 reporter+balance group. + + 737#Y + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,2,6-trimethylpiperidine, is connected to a 3-(carbonylamino)propanoyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + 3-[(2,6-dimethylpiperidin-1-yl)acetyl]amino)propanoyl + PSI-MOD-alternate + + + Sixplex Tandem Mass Tag(TM) + UniMod-description + + + TMT6plex + UniMod-alternate + + + + DiffAvg + 229.16 + + + + DiffFormula + (12)C 8 (13)C 4 H 20 (14)N 1 (15)N 1 O 2 + + + + DiffMono + 229.162932 + + + + Formula + (12)C 8 (13)C 4 H 20 (14)N 1 (15)N 1 O 2 + + + + MassAvg + 229.16 + + + + MassMono + 229.162932 + + + + Origin + Y + + + + Source + artifact + + + + TermSpec + none + + MOD:00919 + MOD:01719 + MOD:01728 + PSI-MOD + + + MOD:01732 + TMT6plex-127 reporter+balance reagent N'-acylated histidine + + A protein modification that effectively replaces an N'-hydrogen atom of a histidine residue with the Proteome Sciences TMT6plex-127 reporter+balance group. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,2,6-trimethylpiperidine, is connected to a 3-(carbonylamino)propanoyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + 3-[(2,6-dimethylpiperidin-1-yl)acetyl]amino)propanoyl + PSI-MOD-alternate + + + Sixplex Tandem Mass Tag(TM) + UniMod-description + + + TMT6plex + UniMod-alternate + + + + DiffAvg + 229.16 + + + + DiffFormula + (12)C 8 (13)C 4 H 20 (14)N 1 (15)N 1 O 2 + + + + DiffMono + 229.162932 + + + + Formula + (12)C 14 (13)C 4 H 27 (14)N 4 (15)N 1 O 3 + + + + MassAvg + 366.22 + + + + MassMono + 366.221844 + + + + Origin + H + + + + Source + artifact + + + + TermSpec + none + + MOD:00909 + MOD:01717 + MOD:01728 + PSI-MOD + + + MOD:01733 + TMT6plex-127 reporter+balance reagent O3-acylated serine + + A protein modification that effectively replaces an O3-hydrogen atom of a serine residue with the Proteome Sciences TMT6plex-127 reporter+balance group. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,2,6-trimethylpiperidine, is connected to a 3-(carbonylamino)propanoyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + 3-[(2,6-dimethylpiperidin-1-yl)acetyl]amino)propanoyl + PSI-MOD-alternate + + + Sixplex Tandem Mass Tag(TM) + UniMod-description + + + TMT6plex + UniMod-alternate + + + + DiffAvg + 229.16 + + + + DiffFormula + (12)C 8 (13)C 4 H 20 (14)N 1 (15)N 1 O 2 + + + + DiffMono + 229.162932 + + + + Formula + (12)C 11 (13)C 4 H 25 (14)N 2 (15)N 1 O 4 + + + + MassAvg + 316.19 + + + + MassMono + 316.194961 + + + + Origin + S + + + + Source + artifact + + + + TermSpec + none + + MOD:00916 + MOD:01719 + MOD:01728 + PSI-MOD + + + MOD:01734 + TMT6plex-127 reporter+balance reagent O3-acylated threonine + + A protein modification that effectively replaces an O3-hydrogen atom of a threonine residue with the Proteome Sciences TMT6plex-127 reporter+balance group. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,2,6-trimethylpiperidine, is connected to a 3-(carbonylamino)propanoyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + 3-[(2,6-dimethylpiperidin-1-yl)acetyl]amino)propanoyl + PSI-MOD-alternate + + + Sixplex Tandem Mass Tag(TM) + UniMod-description + + + TMT6plex + UniMod-alternate + + + + DiffAvg + 229.16 + + + + DiffFormula + (12)C 8 (13)C 4 H 20 (14)N 1 (15)N 1 O 2 + + + + DiffMono + 229.162932 + + + + Formula + (12)C 12 (13)C 4 H 27 (14)N 2 (15)N 1 O 4 + + + + MassAvg + 330.21 + + + + MassMono + 330.210611 + + + + Origin + T + + + + Source + artifact + + + + TermSpec + none + + MOD:00917 + MOD:01719 + MOD:01728 + PSI-MOD + + + MOD:01735 + TMT6plex-127 reporter fragment + + The protein modification reporter fragment produced by an Proteome Sciences TMT6plex-127 reagent acylated residue. + + 18688235 + PubMed + + + PSI-MOD-slim + + 2,6-dimethyl-1-methylidenepiperidinium + PSI-MOD-alternate + + + cysTMT6plex-127 reporter fragment + PSI-MOD-alternate + + + Sixplex Tandem Mass Tag(TM) + UniMod-description + + + TMT6plex + UniMod-alternate + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + FormalCharge + 1+ + + + + Formula + (12)C 7 (13)C 1 H 16 (14)N 1 + + + + MassAvg + 127.13 + + + + MassMono + 127.131081 + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:01716 + + derives_from + MOD:017280 + + + derives_from + MOD:018240 + + PSI-MOD + + + MOD:01736 + TMT6plex-128 reporter+balance reagent acylated residue + + A protein modification that effectively replaces a hydrogen atom of a residue with the Proteome Sciences TMT6plex-128 reporter+balance group. + + 737 + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,2,6-trimethylpiperidine, is connected to a 3-(carbonylamino)propanoyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + 3-[(2,6-dimethylpiperidin-1-yl)acetyl]amino)propanoyl + PSI-MOD-alternate + + + Sixplex Tandem Mass Tag(TM) + UniMod-description + + + TMT6plex + UniMod-alternate + + + + DiffAvg + 229.16 + + + + DiffFormula + (12)C 8 (13)C 4 H 20 (14)N 1 (15)N 1 O 2 + + + + DiffMono + 229.162932 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:01715 + PSI-MOD + + + MOD:01737 + TMT6plex-128 reporter+balance reagent acylated N-terminal + + A protein modification that effectively replaces a hydrogen atom of a protein N-terminal with the Proteome Sciences TMT6plex-128 reporter+balance group. + + 737#N-term + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,2,6-trimethylpiperidine, is connected to a 3-(carbonylamino)propanoyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + 3-[(2,6-dimethylpiperidin-1-yl)acetyl]amino)propanoyl + PSI-MOD-alternate + + + Sixplex Tandem Mass Tag(TM) + UniMod-description + + + TMT6plex + UniMod-alternate + + + + DiffAvg + 229.16 + + + + DiffFormula + (12)C 8 (13)C 4 H 20 (14)N 1 (15)N 1 O 2 + + + + DiffMono + 229.162932 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + N-term + + MOD:01718 + MOD:01736 + PSI-MOD + + + MOD:01738 + TMT6plex-128 reporter+balance reagent N6-acylated lysine + + A protein modification that effectively replaces the N6'-hydrogen atom of a lysine residue with the Proteome Sciences TMT6plex-128 reporter+balance group. + + 737#K + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,2,6-trimethylpiperidine, is connected to a 3-(carbonylamino)propanoyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + 3-[(2,6-dimethylpiperidin-1-yl)acetyl]amino)propanoyl + PSI-MOD-alternate + + + Sixplex Tandem Mass Tag(TM) + UniMod-description + + + TMT6plex + UniMod-alternate + + + + DiffAvg + 229.16 + + + + DiffFormula + (12)C 8 (13)C 4 H 20 (14)N 1 (15)N 1 O 2 + + + + DiffMono + 229.162932 + + + + Formula + (12)C 14 (13)C 4 H 32 (14)N 3 (15)N 1 O 3 + + + + MassAvg + 357.26 + + + + MassMono + 357.257895 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:01717 + MOD:01736 + MOD:01875 + PSI-MOD + + + MOD:01739 + TMT6plex-128 reporter+balance reagent O4'-acylated tyrosine + + A protein modification that effectively replaces the O4'-hydrogen atom of a tyrosine residue with the Proteome Sciences TMT6plex-128 reporter+balance group. + + 737#Y + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,2,6-trimethylpiperidine, is connected to a 3-(carbonylamino)propanoyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + 3-[(2,6-dimethylpiperidin-1-yl)acetyl]amino)propanoyl + PSI-MOD-alternate + + + Sixplex Tandem Mass Tag(TM) + UniMod-description + + + TMT6plex + UniMod-alternate + + + + DiffAvg + 229.16 + + + + DiffFormula + (12)C 8 (13)C 4 H 20 (14)N 1 (15)N 1 O 2 + + + + DiffMono + 229.162932 + + + + Formula + (12)C 17 (13)C 4 H 29 (14)N 2 (15)N 1 O 4 + + + + MassAvg + 392.23 + + + + MassMono + 392.226261 + + + + Origin + Y + + + + Source + artifact + + + + TermSpec + none + + MOD:00919 + MOD:01719 + MOD:01736 + PSI-MOD + + + MOD:01740 + TMT6plex-128 reporter+balance reagent N'-acylated histidine + + A protein modification that effectively replaces an N'-hydrogen atom of a histidine residue with the Proteome Sciences TMT6plex-128 reporter+balance group. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,2,6-trimethylpiperidine, is connected to a 3-(carbonylamino)propanoyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + 3-[(2,6-dimethylpiperidin-1-yl)acetyl]amino)propanoyl + PSI-MOD-alternate + + + Sixplex Tandem Mass Tag(TM) + UniMod-description + + + TMT6plex + UniMod-alternate + + + + DiffAvg + 229.16 + + + + DiffFormula + (12)C 8 (13)C 4 H 20 (14)N 1 (15)N 1 O 2 + + + + DiffMono + 229.162932 + + + + Formula + (12)C 14 (13)C 4 H 27 (14)N 4 (15)N 1 O 3 + + + + MassAvg + 366.22 + + + + MassMono + 366.221844 + + + + Origin + H + + + + Source + artifact + + + + TermSpec + none + + MOD:00909 + MOD:01717 + MOD:01736 + PSI-MOD + + + MOD:01741 + TMT6plex-128 reporter+balance reagent O3-acylated serine + + A protein modification that effectively replaces an O3-hydrogen atom of a serine residue with the Proteome Sciences TMT6plex-128 reporter+balance group. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,2,6-trimethylpiperidine, is connected to a 3-(carbonylamino)propanoyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + 3-[(2,6-dimethylpiperidin-1-yl)acetyl]amino)propanoyl + PSI-MOD-alternate + + + Sixplex Tandem Mass Tag(TM) + UniMod-description + + + TMT6plex + UniMod-alternate + + + + DiffAvg + 229.16 + + + + DiffFormula + (12)C 8 (13)C 4 H 20 (14)N 1 (15)N 1 O 2 + + + + DiffMono + 229.162932 + + + + Formula + (12)C 11 (13)C 4 H 25 (14)N 2 (15)N 1 O 4 + + + + MassAvg + 316.19 + + + + MassMono + 316.194961 + + + + Origin + S + + + + Source + artifact + + + + TermSpec + none + + MOD:00916 + MOD:01719 + MOD:01736 + PSI-MOD + + + MOD:01742 + TMT6plex-128 reporter+balance reagent O3-acylated threonine + + A protein modification that effectively replaces an O3-hydrogen atom of a threonine residue with the Proteome Sciences TMT6plex-128 reporter+balance group. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,2,6-trimethylpiperidine, is connected to a 3-(carbonylamino)propanoyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + 3-[(2,6-dimethylpiperidin-1-yl)acetyl]amino)propanoyl + PSI-MOD-alternate + + + Sixplex Tandem Mass Tag(TM) + UniMod-description + + + TMT6plex + UniMod-alternate + + + + DiffAvg + 229.16 + + + + DiffFormula + (12)C 8 (13)C 4 H 20 (14)N 1 (15)N 1 O 2 + + + + DiffMono + 229.162932 + + + + Formula + (12)C 12 (13)C 4 H 27 (14)N 2 (15)N 1 O 4 + + + + MassAvg + 330.21 + + + + MassMono + 330.210611 + + + + Origin + T + + + + Source + artifact + + + + TermSpec + none + + MOD:00917 + MOD:01719 + MOD:01736 + PSI-MOD + + + MOD:01743 + TMT6plex-128 reporter fragment + + The protein modification reporter fragment produced by an Proteome Sciences TMT6plex-128 reagent acylated residue. + + 18688235 + PubMed + + + PSI-MOD-slim + + 2,6-dimethyl-1-methylidenepiperidinium + PSI-MOD-alternate + + + cysTMT6plex-128 reporter fragment + PSI-MOD-alternate + + + Sixplex Tandem Mass Tag(TM) + UniMod-description + + + TMT6plex + UniMod-alternate + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + FormalCharge + 1+ + + + + Formula + (12)C 6 (13)C 2 H 16 (14)N 1 + + + + MassAvg + 128.13 + + + + MassMono + 128.134436 + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:01716 + + derives_from + MOD:017360 + + + derives_from + MOD:018250 + + PSI-MOD + + + MOD:01744 + TMT6plex-129 reporter+balance reagent acylated residue + + A protein modification that effectively replaces a hydrogen atom of a residue with the Proteome Sciences TMT6plex-129 reporter+balance group. + + 737 + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,2,6-trimethylpiperidine, is connected to a 3-(carbonylamino)propanoyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + 3-[(2,6-dimethylpiperidin-1-yl)acetyl]amino)propanoyl + PSI-MOD-alternate + + + Sixplex Tandem Mass Tag(TM) + UniMod-description + + + TMT6plex + UniMod-alternate + + + + DiffAvg + 229.16 + + + + DiffFormula + (12)C 8 (13)C 4 H 20 (14)N 1 (15)N 1 O 2 + + + + DiffMono + 229.162932 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:01715 + PSI-MOD + + + MOD:01745 + TMT6plex-129 reporter+balance reagent acylated N-terminal + + A protein modification that effectively replaces a hydrogen atom of a protein N-terminal with the Proteome Sciences TMT6plex-129 reporter+balance group. + + 737#N-term + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,2,6-trimethylpiperidine, is connected to a 3-(carbonylamino)propanoyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + 3-[(2,6-dimethylpiperidin-1-yl)acetyl]amino)propanoyl + PSI-MOD-alternate + + + Sixplex Tandem Mass Tag(TM) + UniMod-description + + + TMT6plex + UniMod-alternate + + + + DiffAvg + 229.16 + + + + DiffFormula + (12)C 8 (13)C 4 H 20 (14)N 1 (15)N 1 O 2 + + + + DiffMono + 229.162932 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + N-term + + MOD:01718 + MOD:01744 + PSI-MOD + + + MOD:01746 + TMT6plex-129 reporter+balance reagent N6-acylated lysine + + A protein modification that effectively replaces the N6'-hydrogen atom of a lysine residue with the Proteome Sciences TMT6plex-129 reporter+balance group. + + 737#K + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,2,6-trimethylpiperidine, is connected to a 3-(carbonylamino)propanoyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + 3-[(2,6-dimethylpiperidin-1-yl)acetyl]amino)propanoyl + PSI-MOD-alternate + + + Sixplex Tandem Mass Tag(TM) + UniMod-description + + + TMT6plex + UniMod-alternate + + + + DiffAvg + 229.16 + + + + DiffFormula + (12)C 8 (13)C 4 H 20 (14)N 1 (15)N 1 O 2 + + + + DiffMono + 229.162932 + + + + Formula + (12)C 14 (13)C 4 H 32 (14)N 3 (15)N 1 O 3 + + + + MassAvg + 357.26 + + + + MassMono + 357.257895 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:01717 + MOD:01744 + MOD:01875 + PSI-MOD + + + MOD:01747 + TMT6plex-129 reporter+balance reagent O4'-acylated tyrosine + + A protein modification that effectively replaces the O4'-hydrogen atom of a tyrosine residue with the Proteome Sciences TMT6plex-129 reporter+balance group. + + 737#Y + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,2,6-trimethylpiperidine, is connected to a 3-(carbonylamino)propanoyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + 3-[(2,6-dimethylpiperidin-1-yl)acetyl]amino)propanoyl + PSI-MOD-alternate + + + Sixplex Tandem Mass Tag(TM) + UniMod-description + + + TMT6plex + UniMod-alternate + + + + DiffAvg + 229.16 + + + + DiffFormula + (12)C 8 (13)C 4 H 20 (14)N 1 (15)N 1 O 2 + + + + DiffMono + 229.162932 + + + + Formula + (12)C 17 (13)C 4 H 29 (14)N 2 (15)N 1 O 4 + + + + MassAvg + 392.23 + + + + MassMono + 392.226261 + + + + Origin + Y + + + + Source + artifact + + + + TermSpec + none + + MOD:00919 + MOD:01719 + MOD:01744 + PSI-MOD + + + MOD:01748 + TMT6plex-129 reporter+balance reagent N'-acylated histidine + + A protein modification that effectively replaces an N'-hydrogen atom of a histidine residue with the Proteome Sciences TMT6plex-129 reporter+balance group. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,2,6-trimethylpiperidine, is connected to a 3-(carbonylamino)propanoyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + 3-[(2,6-dimethylpiperidin-1-yl)acetyl]amino)propanoyl + PSI-MOD-alternate + + + Sixplex Tandem Mass Tag(TM) + UniMod-description + + + TMT6plex + UniMod-alternate + + + + DiffAvg + 229.16 + + + + DiffFormula + (12)C 8 (13)C 4 H 20 (14)N 1 (15)N 1 O 2 + + + + DiffMono + 229.162932 + + + + Formula + (12)C 14 (13)C 4 H 27 (14)N 4 (15)N 1 O 3 + + + + MassAvg + 366.22 + + + + MassMono + 366.221844 + + + + Origin + H + + + + Source + artifact + + + + TermSpec + none + + MOD:00909 + MOD:01717 + MOD:01744 + PSI-MOD + + + MOD:01749 + TMT6plex-129 reporter+balance reagent O3-acylated serine + + A protein modification that effectively replaces an O3-hydrogen atom of a serine residue with the Proteome Sciences TMT6plex-129 reporter+balance group. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,2,6-trimethylpiperidine, is connected to a 3-(carbonylamino)propanoyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + 3-[(2,6-dimethylpiperidin-1-yl)acetyl]amino)propanoyl + PSI-MOD-alternate + + + Sixplex Tandem Mass Tag(TM) + UniMod-description + + + TMT6plex + UniMod-alternate + + + + DiffAvg + 229.16 + + + + DiffFormula + (12)C 8 (13)C 4 H 20 (14)N 1 (15)N 1 O 2 + + + + DiffMono + 229.162932 + + + + Formula + (12)C 11 (13)C 4 H 25 (14)N 2 (15)N 1 O 4 + + + + MassAvg + 316.19 + + + + MassMono + 316.194961 + + + + Origin + S + + + + Source + artifact + + + + TermSpec + none + + MOD:00916 + MOD:01719 + MOD:01744 + PSI-MOD + + + MOD:01750 + TMT6plex-129 reporter+balance reagent O3-acylated threonine + + A protein modification that effectively replaces an O3-hydrogen atom of a threonine residue with the Proteome Sciences TMT6plex-129 reporter+balance group. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,2,6-trimethylpiperidine, is connected to a 3-(carbonylamino)propanoyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + 3-[(2,6-dimethylpiperidin-1-yl)acetyl]amino)propanoyl + PSI-MOD-alternate + + + Sixplex Tandem Mass Tag(TM) + UniMod-description + + + TMT6plex + UniMod-alternate + + + + DiffAvg + 229.16 + + + + DiffFormula + (12)C 8 (13)C 4 H 20 (14)N 1 (15)N 1 O 2 + + + + DiffMono + 229.162932 + + + + Formula + (12)C 12 (13)C 4 H 27 (14)N 2 (15)N 1 O 4 + + + + MassAvg + 330.21 + + + + MassMono + 330.210611 + + + + Origin + T + + + + Source + artifact + + + + TermSpec + none + + MOD:00917 + MOD:01719 + MOD:01744 + PSI-MOD + + + MOD:01751 + TMT6plex-129 reporter fragment + + The protein modification reporter fragment produced by an Proteome Sciences TMT6plex-129 reagent acylated residue. + + 18688235 + PubMed + + + PSI-MOD-slim + + 2,6-dimethyl-1-methylidenepiperidinium + PSI-MOD-alternate + + + cysTMT6plex-129 reporter fragment + PSI-MOD-alternate + + + Sixplex Tandem Mass Tag(TM) + UniMod-description + + + TMT6plex + UniMod-alternate + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + FormalCharge + 1+ + + + + Formula + (12)C 5 (13)C 3 H 16 (14)N 1 + + + + MassAvg + 129.14 + + + + MassMono + 129.137790 + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:01716 + + derives_from + MOD:017440 + + + derives_from + MOD:018260 + + PSI-MOD + + + MOD:01752 + TMT6plex-130 reporter+balance reagent acylated residue + + A protein modification that effectively replaces a hydrogen atom of a residue with the Proteome Sciences TMT6plex-130 reporter+balance group. + + 737 + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,2,6-trimethylpiperidine, is connected to a 3-(carbonylamino)propanoyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + 3-[(2,6-dimethylpiperidin-1-yl)acetyl]amino)propanoyl + PSI-MOD-alternate + + + Sixplex Tandem Mass Tag(TM) + UniMod-description + + + TMT6plex + UniMod-alternate + + + + DiffAvg + 229.16 + + + + DiffFormula + (12)C 8 (13)C 4 H 20 (14)N 1 (15)N 1 O 2 + + + + DiffMono + 229.162932 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:01715 + + derives_from + MOD:018270 + + PSI-MOD + + + MOD:01753 + TMT6plex-130 reporter+balance reagent acylated N-terminal + + A protein modification that effectively replaces a hydrogen atom of a protein N-terminal with the Proteome Sciences TMT6plex-130 reporter+balance group. + + 737#N-term + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,2,6-trimethylpiperidine, is connected to a 3-(carbonylamino)propanoyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + 3-[(2,6-dimethylpiperidin-1-yl)acetyl]amino)propanoyl + PSI-MOD-alternate + + + Sixplex Tandem Mass Tag(TM) + UniMod-description + + + TMT6plex + UniMod-alternate + + + + DiffAvg + 229.16 + + + + DiffFormula + (12)C 8 (13)C 4 H 20 (14)N 1 (15)N 1 O 2 + + + + DiffMono + 229.162932 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + N-term + + MOD:01718 + MOD:01752 + PSI-MOD + + + MOD:01754 + TMT6plex-130 reporter+balance reagent N6-acylated lysine + + A protein modification that effectively replaces the N6'-hydrogen atom of a lysine residue with the Proteome Sciences TMT6plex-130 reporter+balance group. + + 737#K + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,2,6-trimethylpiperidine, is connected to a 3-(carbonylamino)propanoyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + 3-[(2,6-dimethylpiperidin-1-yl)acetyl]amino)propanoyl + PSI-MOD-alternate + + + Sixplex Tandem Mass Tag(TM) + UniMod-description + + + TMT6plex + UniMod-alternate + + + + DiffAvg + 229.16 + + + + DiffFormula + (12)C 8 (13)C 4 H 20 (14)N 1 (15)N 1 O 2 + + + + DiffMono + 229.162932 + + + + Formula + (12)C 14 (13)C 4 H 32 (14)N 3 (15)N 1 O 3 + + + + MassAvg + 357.26 + + + + MassMono + 357.257895 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:01717 + MOD:01752 + MOD:01875 + PSI-MOD + + + MOD:01755 + TMT6plex-130 reporter+balance reagent O4'-acylated tyrosine + + A protein modification that effectively replaces the O4'-hydrogen atom of a tyrosine residue with the Proteome Sciences TMT6plex-130 reporter+balance group. + + 737#Y + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,2,6-trimethylpiperidine, is connected to a 3-(carbonylamino)propanoyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + 3-[(2,6-dimethylpiperidin-1-yl)acetyl]amino)propanoyl + PSI-MOD-alternate + + + Sixplex Tandem Mass Tag(TM) + UniMod-description + + + TMT6plex + UniMod-alternate + + + + DiffAvg + 229.16 + + + + DiffFormula + (12)C 8 (13)C 4 H 20 (14)N 1 (15)N 1 O 2 + + + + DiffMono + 229.162932 + + + + Formula + (12)C 17 (13)C 4 H 29 (14)N 2 (15)N 1 O 4 + + + + MassAvg + 392.23 + + + + MassMono + 392.226261 + + + + Origin + Y + + + + Source + artifact + + + + TermSpec + none + + MOD:00919 + MOD:01719 + MOD:01752 + PSI-MOD + + + MOD:01756 + TMT6plex-130 reporter+balance reagent N'-acylated histidine + + A protein modification that effectively replaces an N'-hydrogen atom of a histidine residue with the Proteome Sciences TMT6plex-130 reporter+balance group. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,2,6-trimethylpiperidine, is connected to a 3-(carbonylamino)propanoyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + 3-[(2,6-dimethylpiperidin-1-yl)acetyl]amino)propanoyl + PSI-MOD-alternate + + + Sixplex Tandem Mass Tag(TM) + UniMod-description + + + TMT6plex + UniMod-alternate + + + + DiffAvg + 229.16 + + + + DiffFormula + (12)C 8 (13)C 4 H 20 (14)N 1 (15)N 1 O 2 + + + + DiffMono + 229.162932 + + + + Formula + (12)C 14 (13)C 4 H 27 (14)N 4 (15)N 1 O 3 + + + + MassAvg + 366.22 + + + + MassMono + 366.221844 + + + + Origin + H + + + + Source + artifact + + + + TermSpec + none + + MOD:00909 + MOD:01717 + MOD:01752 + PSI-MOD + + + MOD:01757 + TMT6plex-130 reporter+balance reagent O3-acylated serine + + A protein modification that effectively replaces an O3-hydrogen atom of a serine residue with the Proteome Sciences TMT6plex-130 reporter+balance group. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,2,6-trimethylpiperidine, is connected to a 3-(carbonylamino)propanoyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + 3-[(2,6-dimethylpiperidin-1-yl)acetyl]amino)propanoyl + PSI-MOD-alternate + + + Sixplex Tandem Mass Tag(TM) + UniMod-description + + + TMT6plex + UniMod-alternate + + + + DiffAvg + 229.16 + + + + DiffFormula + (12)C 8 (13)C 4 H 20 (14)N 1 (15)N 1 O 2 + + + + DiffMono + 229.162932 + + + + Formula + (12)C 11 (13)C 4 H 25 (14)N 2 (15)N 1 O 4 + + + + MassAvg + 316.19 + + + + MassMono + 316.194961 + + + + Origin + S + + + + Source + artifact + + + + TermSpec + none + + MOD:00916 + MOD:01719 + MOD:01752 + PSI-MOD + + + MOD:01758 + TMT6plex-130 reporter+balance reagent O3-acylated threonine + + A protein modification that effectively replaces an O3-hydrogen atom of a threonine residue with the Proteome Sciences TMT6plex-130 reporter+balance group. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,2,6-trimethylpiperidine, is connected to a 3-(carbonylamino)propanoyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + 3-[(2,6-dimethylpiperidin-1-yl)acetyl]amino)propanoyl + PSI-MOD-alternate + + + Sixplex Tandem Mass Tag(TM) + UniMod-description + + + TMT6plex + UniMod-alternate + + + + DiffAvg + 229.16 + + + + DiffFormula + (12)C 8 (13)C 4 H 20 (14)N 1 (15)N 1 O 2 + + + + DiffMono + 229.162932 + + + + Formula + (12)C 12 (13)C 4 H 27 (14)N 2 (15)N 1 O 4 + + + + MassAvg + 330.21 + + + + MassMono + 330.210611 + + + + Origin + T + + + + Source + artifact + + + + TermSpec + none + + MOD:00917 + MOD:01719 + MOD:01752 + PSI-MOD + + + MOD:01759 + TMT6plex-130 reporter fragment + + The protein modification reporter fragment produced by an Proteome Sciences TMT6plex-130 reagent acylated residue. + + 18688235 + PubMed + + + PSI-MOD-slim + + 2,6-dimethyl-1-methylidenepiperidinium + PSI-MOD-alternate + + + cysTMT6plex-130 reporter fragment + PSI-MOD-alternate + + + Sixplex Tandem Mass Tag(TM) + UniMod-description + + + TMT6plex + UniMod-alternate + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + FormalCharge + 1+ + + + + Formula + (12)C 4 (13)C 4 H 16 (14)N 1 + + + + MassAvg + 130.14 + + + + MassMono + 130.141145 + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:01716 + + derives_from + MOD:017520 + + PSI-MOD + + + MOD:01760 + TMT6plex-131 reporter+balance reagent acylated residue + + A protein modification that effectively replaces a hydrogen atom of a residue with the Proteome Sciences TMT6plex-131 reporter+balance group. + + 737 + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,2,6-trimethylpiperidine, is connected to a 3-(carbonylamino)propanoyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + 3-[(2,6-dimethylpiperidin-1-yl)acetyl]amino)propanoyl + PSI-MOD-alternate + + + cysTMT6plex-131 reporter fragment + PSI-MOD-alternate + + + Sixplex Tandem Mass Tag(TM) + UniMod-description + + + TMT6plex + UniMod-alternate + + + + DiffAvg + 229.16 + + + + DiffFormula + (12)C 8 (13)C 4 H 20 (14)N 1 (15)N 1 O 2 + + + + DiffMono + 229.162932 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:01715 + + derives_from + MOD:018280 + + PSI-MOD + + + MOD:01761 + TMT6plex-131 reporter+balance reagent acylated N-terminal + + A protein modification that effectively replaces a hydrogen atom of a protein N-terminal with the Proteome Sciences TMT6plex-131 reporter+balance group. + + 737#N-term + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,2,6-trimethylpiperidine, is connected to a 3-(carbonylamino)propanoyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + 3-[(2,6-dimethylpiperidin-1-yl)acetyl]amino)propanoyl + PSI-MOD-alternate + + + Sixplex Tandem Mass Tag(TM) + UniMod-description + + + TMT6plex + UniMod-alternate + + + + DiffAvg + 229.16 + + + + DiffFormula + (12)C 8 (13)C 4 H 20 (14)N 1 (15)N 1 O 2 + + + + DiffMono + 229.162932 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + N-term + + MOD:01718 + MOD:01760 + PSI-MOD + + + MOD:01762 + TMT6plex-131 reporter+balance reagent N6-acylated lysine + + A protein modification that effectively replaces the N6'-hydrogen atom of a lysine residue with the Proteome Sciences TMT6plex-131 reporter+balance group. + + 737#K + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,2,6-trimethylpiperidine, is connected to a 3-(carbonylamino)propanoyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + 3-[(2,6-dimethylpiperidin-1-yl)acetyl]amino)propanoyl + PSI-MOD-alternate + + + Sixplex Tandem Mass Tag(TM) + UniMod-description + + + TMT6plex + UniMod-alternate + + + + DiffAvg + 229.16 + + + + DiffFormula + (12)C 8 (13)C 4 H 20 (14)N 1 (15)N 1 O 2 + + + + DiffMono + 229.162932 + + + + Formula + (12)C 14 (13)C 4 H 32 (14)N 3 (15)N 1 O 3 + + + + MassAvg + 357.26 + + + + MassMono + 357.257895 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:01717 + MOD:01760 + MOD:01875 + PSI-MOD + + + MOD:01763 + TMT6plex-131 reporter+balance reagent O4'-acylated tyrosine + + A protein modification that effectively replaces the O4'-hydrogen atom of a tyrosine residue with the Proteome Sciences TMT6plex-131 reporter+balance group. + + 737#Y + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,2,6-trimethylpiperidine, is connected to a 3-(carbonylamino)propanoyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + 3-[(2,6-dimethylpiperidin-1-yl)acetyl]amino)propanoyl + PSI-MOD-alternate + + + Sixplex Tandem Mass Tag(TM) + UniMod-description + + + TMT6plex + UniMod-alternate + + + + DiffAvg + 229.16 + + + + DiffFormula + (12)C 8 (13)C 4 H 20 (14)N 1 (15)N 1 O 2 + + + + DiffMono + 229.162932 + + + + Formula + (12)C 17 (13)C 4 H 29 (14)N 2 (15)N 1 O 4 + + + + MassAvg + 392.23 + + + + MassMono + 392.226261 + + + + Origin + Y + + + + Source + artifact + + + + TermSpec + none + + MOD:00919 + MOD:01719 + MOD:01760 + PSI-MOD + + + MOD:01764 + TMT6plex-131 reporter+balance reagent N'-acylated histidine + + A protein modification that effectively replaces an N'-hydrogen atom of a histidine residue with the Proteome Sciences TMT6plex-131 reporter+balance group. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,2,6-trimethylpiperidine, is connected to a 3-(carbonylamino)propanoyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + 3-[(2,6-dimethylpiperidin-1-yl)acetyl]amino)propanoyl + PSI-MOD-alternate + + + Sixplex Tandem Mass Tag(TM) + UniMod-description + + + TMT6plex + UniMod-alternate + + + + DiffAvg + 229.16 + + + + DiffFormula + (12)C 8 (13)C 4 H 20 (14)N 1 (15)N 1 O 2 + + + + DiffMono + 229.162932 + + + + Formula + (12)C 14 (13)C 4 H 27 (14)N 4 (15)N 1 O 3 + + + + MassAvg + 366.22 + + + + MassMono + 366.221844 + + + + Origin + H + + + + Source + artifact + + + + TermSpec + none + + MOD:00909 + MOD:01717 + MOD:01760 + PSI-MOD + + + MOD:01765 + TMT6plex-131 reporter+balance reagent O3-acylated serine + + A protein modification that effectively replaces an O3-hydrogen atom of a serine residue with the Proteome Sciences TMT6plex-131 reporter+balance group. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,2,6-trimethylpiperidine, is connected to a 3-(carbonylamino)propanoyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + 3-[(2,6-dimethylpiperidin-1-yl)acetyl]amino)propanoyl + PSI-MOD-alternate + + + Sixplex Tandem Mass Tag(TM) + UniMod-description + + + TMT6plex + UniMod-alternate + + + + DiffAvg + 229.16 + + + + DiffFormula + (12)C 8 (13)C 4 H 20 (14)N 1 (15)N 1 O 2 + + + + DiffMono + 229.162932 + + + + Formula + (12)C 11 (13)C 4 H 25 (14)N 2 (15)N 1 O 4 + + + + MassAvg + 316.19 + + + + MassMono + 316.194961 + + + + Origin + S + + + + Source + artifact + + + + TermSpec + none + + MOD:00916 + MOD:01719 + MOD:01760 + PSI-MOD + + + MOD:01766 + TMT6plex-131 reporter+balance reagent O3-acylated threonine + + A protein modification that effectively replaces an O3-hydrogen atom of a threonine residue with the Proteome Sciences TMT6plex-131 reporter+balance group. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,2,6-trimethylpiperidine, is connected to a 3-(carbonylamino)propanoyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + 3-[(2,6-dimethylpiperidin-1-yl)acetyl]amino)propanoyl + PSI-MOD-alternate + + + Sixplex Tandem Mass Tag(TM) + UniMod-description + + + TMT6plex + UniMod-alternate + + + + DiffAvg + 229.16 + + + + DiffFormula + (12)C 8 (13)C 4 H 20 (14)N 1 (15)N 1 O 2 + + + + DiffMono + 229.162932 + + + + Formula + (12)C 12 (13)C 4 H 27 (14)N 2 (15)N 1 O 4 + + + + MassAvg + 330.21 + + + + MassMono + 330.210611 + + + + Origin + T + + + + Source + artifact + + + + TermSpec + none + + MOD:00917 + MOD:01719 + MOD:01760 + PSI-MOD + + + MOD:01767 + TMT6plex-131 reporter fragment + + The protein modification reporter fragment produced by an Proteome Sciences TMT6plex-131 reagent acylated residue. + + 18688235 + PubMed + + + + 2,6-dimethyl-1-methylidenepiperidinium + PSI-MOD-alternate + + + Sixplex Tandem Mass Tag(TM) + UniMod-description + + + TMT6plex + UniMod-alternate + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + FormalCharge + 1+ + + + + Formula + (12)C 4 (13)C 4 H 16 (15)N 1 + + + + MassAvg + 131.14 + + + + MassMono + 131.138180 + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:01716 + + derives_from + MOD:017600 + + PSI-MOD + + + MOD:01768 + O-palmitoleylated residue + + A protein modification that effectively replaces a residue hydroxyl group with a palmitoleyloxy group. + + 18688235 + PubMed + + + PSI-MOD-slim + + + DiffAvg + 236.40 + + + + DiffFormula + C 16 H 28 N 0 O 1 + + + + DiffMono + 236.214016 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + natural + + + + TermSpec + none + + MOD:00671 + MOD:01423 + PSI-MOD + + + MOD:01769 + O-palmitoleyl-L-threonine + + A protein modification that effectively converts an L-threonine residue to O-palmitoleyl-L-threonine. + + 6642431 + PubMed + + + 8413602 + PubMed + + + AA0079#var + RESID + + + 431#T + UniMod + + + PSI-MOD-slim + + (2S,3R)-2-amino-3-((Z)-9-hexadecenoyloxy)butanoic acid + PSI-MOD-alternate + + + L-threonine cis-9-hexadecenoate ester + PSI-MOD-alternate + + + mod188 + OMSSA-label + + + O-palmitoleylated L-threonine + PSI-MOD-alternate + + + O3-palmitoleyl-threonine + PSI-MOD-alternate + + + Palmitoleyl + PSI-MS-label + + + palmitoleyl + UniMod-description + + + + DiffAvg + 236.40 + + + + DiffFormula + C 16 H 28 N 0 O 1 + + + + DiffMono + 236.214016 + + + + Formula + C 20 H 35 N 1 O 3 + + + + MassAvg + 337.50 + + + + MassMono + 337.261694 + + + + Origin + T + + + + Source + natural + + + + TermSpec + none + + MOD:00917 + MOD:01768 + PSI-MOD + + + MOD:01770 + O-palmitoyl-L-threonine amide + + A protein modification that effectively converts an L-threonine residue to O-palmitoyl-L-threonine amide. + + 8413602 + PubMed + + + AA0079#var + RESID + + + AA0097#var + RESID + + + + (2S,3R)-2-amino-3-(hexadecanoyloxy)butanamide + PSI-MOD-alternate + + + OPamThrN + PSI-MOD-label + + + + DiffAvg + 254.44 + + + + DiffFormula + C 16 H 32 N 1 O 1 + + + + DiffMono + 254.248390 + + + + Formula + C 20 H 39 N 2 O 3 + + + + MassAvg + 355.54 + + + + MassMono + 355.296068 + + + + Origin + T + + + + Source + natural + + + + TermSpec + C-term + + MOD:00917 + + has_functional_parent + MOD:000880 + + + has_functional_parent + MOD:001060 + + PSI-MOD + + + MOD:01771 + farnesyl reporter fragment + + The farnesyl cation protein modification reporter fragment produced by fragmentation of some farnesyl modified residues. + + 15609361 + PubMed + + + 18688235 + PubMed + + + PSI-MOD-slim + + (2E,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-ylium + PSI-MOD-alternate + + + Farn+ + PSI-MOD-label + + + farnesyl cation + PSI-MOD-alternate + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + FormalCharge + 1+ + + + + Formula + C 15 H 25 + + + + MassAvg + 205.36 + + + + MassMono + 205.195077 + + + + Origin + X + + + + Source + natural + + + + TermSpec + none + + MOD:01520 + + derives_from + MOD:004370 + + PSI-MOD + + + MOD:01772 + palmityl reporter fragment + + The palmityl cation protein modification reporter fragment produced by fragmentation of some palmitoyl modified residues. + + 18688235 + PubMed + + + 8413602 + PubMed + + + PSI-MOD-slim + + palmityl cation + PSI-MS-label + + + Pam+ + PSI-MOD-label + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + FormalCharge + 1+ + + + + Formula + C 16 H 31 O 1 + + + + MassAvg + 239.42 + + + + MassMono + 239.236942 + + + + Origin + X + + + + Source + natural + + + + TermSpec + none + + MOD:01520 + + derives_from + MOD:004400 + + PSI-MOD + + + MOD:01773 + N6,N6,N6-trimethyl-L-lysine with neutral loss of trimethylamine + + Covalent modification of a trimethyllysine residue with secondary loss of a neutral trimethylamine molecular fragment. + + 17205979 + PubMed + + + 18688235 + PubMed + + + PSI-MOD-slim + + dMe3N6Me3+Lys + PSI-MOD-label + + + + DiffAvg + -59.11 + + + + DiffFormula + C -3 H -9 N -1 O 0 + + + + DiffMono + -59.074048 + + + + FormalCharge + 1+ + + + + Formula + C 6 H 10 N 1 O 1 + + + + MassAvg + 112.15 + + + + MassMono + 112.075690 + + + + Origin + MOD:00083 + + + + Source + artifact + + + + TermSpec + none + + MOD:00431 + MOD:00912 + + derives_from + MOD:000830 + + PSI-MOD + + + MOD:01774 + N6-octanoyl-L-lysine + + A protein modification that effectively converts an L-lysine residue to N6-octanoyl-L-lysine. + + 12591875 + PubMed + + + 2215217 + PubMed + + + AA0527 + RESID + + + PSI-MOD-slim + + (2S)-2-amino-6-(octanoylamino)hexanoic acid + RESID-systematic + + + epsilon-octanoyllysine + RESID-alternate + + + N(zeta)-octanoyllysine + RESID-alternate + + + N6-(1-oxooctyl)-L-lysine + RESID-alternate + + + N6-octanoyl-L-lysine + RESID-name + + + + DiffAvg + 126.20 + + + + DiffFormula + C 8 H 14 N 0 O 1 + + + + DiffMono + 126.104465 + + + + Formula + C 14 H 26 N 2 O 2 + + + + MassAvg + 254.37 + + + + MassMono + 254.199428 + + + + Origin + K + + + + Source + natural + + + + TermSpec + none + + MOD:00666 + MOD:01875 + PSI-MOD + + + MOD:01775 + 5-glutamyl serotonin + + A protein modification that effectively converts an L-glutamine residue to 5-glutamyl serotonin. + + 11805836 + PubMed + + + 14697203 + PubMed + + + AA0528 + RESID + + + + (2S)-2-amino-5-([2-(5-hydroxy-1H-indol-3-yl)ethyl]amino)-5-oxopentanoic acid + RESID-systematic + + + 5-glutamyl serotonin + RESID-name + + + N2-(gamma-glutamyl)-5-hydoxytryptamine + RESID-alternate + + + N5-[2-(5-hydroxy-3-indolyl)ethyl]glutamine + RESID-alternate + + + + DiffAvg + 159.19 + + + + DiffFormula + C 10 H 9 N 1 O 1 + + + + DiffMono + 159.068414 + + + + Formula + C 15 H 17 N 3 O 3 + + + + MassAvg + 287.32 + + + + MassMono + 287.126991 + + + + Origin + Q + + + + Source + natural + + + + TermSpec + none + + MOD:00907 + PSI-MOD + + + MOD:01776 + S-methylthiocarbonylaminoethylcysteine (Cys) + + A protein modification that effectively converts an L-cysteine residue to S-methylthiocarbonylaminoethylcysteine. + + 18688235 + PubMed + + + 20608637 + PubMed + + + This modified residue is a chemical analog of N6-acetyl-L-lysine produced from L-cysteine by methylthiocarbonylaziridine (MTCA, S-methyl aziridine-1-carbothioate). + + (2R)-2-amino-3-([2-([(methylsulfanyl)carbonyl]amino)ethyl]sulfanyl)propanoic acid + PSI-MOD-alternate + + + L-cysteine N-(methylthiocarbonyl)aziridine adduct + PSI-MOD-alternate + + + MTCTK + PSI-MOD-alternate + + + N6-methylthiocarbonyl-4-thialysine + PSI-MOD-alternate + + + S-[2-([(methylthio)carbonyl]amino)ethyl]-L-cysteine + PSI-MOD-alternate + + + + DiffAvg + 117.17 + + + + DiffFormula + C 4 H 7 N 1 O 1 S 1 + + + + DiffMono + 117.024835 + + + + Formula + C 7 H 12 N 2 O 2 S 2 + + + + MassAvg + 220.31 + + + + MassMono + 220.034020 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + MOD:00905 + PSI-MOD + + + MOD:01777 + S-(glycyl)-L-cysteine (Gly) + + A protein modification that effectively converts a C-terminal glycine residue to S-(glycyl)-L-cysteine by forming a thioester bond with a free L-cysteine. + + 22050 + ChEBI + + + 17726030 + PubMed + + + 18359941 + PubMed + + + 18771296 + PubMed + + + 18799456 + PubMed + + + 18842002 + PubMed + + + 3306404 + PubMed + + + AA0206 + RESID + + + This is not the cross-linking of two peptides, but the modification of a C-terminal glycine by formation of an thioester bond with a free cysteine. For the cross-linking of two peptide see MOD:00211 [JSG]. + + (2R)-2-amino-3-[(aminoacetyl)sulfanyl]propanoic acid + RESID-systematic + + + 1-(cystein-S-yl)-glycinate + RESID-alternate + + + glycine cysteine thioester + RESID-alternate + + + MOD_RES CysO-cysteine adduct + UniProt-feature + + + S-(2-amino-1-oxoethyl)cysteine + RESID-alternate + + + S-(glycyl)-L-cysteine + RESID-name + + + + DiffAvg + 103.14 + + + + DiffFormula + C 3 H 5 N 1 O 1 S 1 + + + + DiffMono + 103.009185 + + + + Formula + C 5 H 9 N 2 O 3 S 1 + + + + MassAvg + 177.20 + + + + MassMono + 177.033388 + + + + Origin + G + + + + Source + natural + + + + TermSpec + C-term + + MOD:00908 + PSI-MOD + + + MOD:01778 + N-(glycyl)-L-cysteine + + A protein modification that effectively converts a C-terminal glycine residue to N-(glycyl)-L-cysteine by forming a peptide bond with a free L-cysteine. + + 18771296 + PubMed + + + 18799456 + PubMed + + + 18842002 + PubMed + + + AA0529 + RESID + + + + (2R)-2-[(aminoacetyl)amino]-3-sulfanylpropanoic acid + RESID-systematic + + + MOD_RES CysO-cysteine adduct + UniProt-feature + + + N-(2-amino-1-oxoethyl)cysteine + RESID-alternate + + + N-(glycyl)-L-cysteine + RESID-name + + + + DiffAvg + 103.14 + + + + DiffFormula + C 3 H 5 N 1 O 1 S 1 + + + + DiffMono + 103.009185 + + + + Formula + C 5 H 9 N 2 O 3 S 1 + + + + MassAvg + 177.20 + + + + MassMono + 177.033388 + + + + Origin + G + + + + Source + hypothetical + + + + TermSpec + C-term + + MOD:00908 + PSI-MOD + + + MOD:01779 + N6-(L-lysyl)-L-lysine + + A protein modification that effectively converts an L-lysine residue to N6-(L-lysyl)-L-lysine by formation of an isopeptide bond between the carboxyl group of a free lysine and the N6-amino group of the peptidyl L-lysine. + + 18201202 + PubMed + + + 20729861 + PubMed + + + AA0530 + RESID + + + This is not the cross-linking of two peptides, but the modification of a peptidyl lysine by formation of an isopeptide bond with a free lysine [JSG]. + + (2S)-2-amino-6-([(2S)-2,6-diaminohexanoyl]amino)hexanoic acid + RESID-systematic + + + N6-(alpha-lysyl)-lysine + RESID-alternate + + + N6-(L-lysyl)-L-lysine + RESID-name + + + + DiffAvg + 128.18 + + + + DiffFormula + C 6 H 12 N 2 O 1 + + + + DiffMono + 128.094963 + + + + Formula + C 12 H 24 N 4 O 2 + + + + MassAvg + 256.35 + + + + MassMono + 256.189926 + + + + Origin + K + + + + Source + natural + + + + TermSpec + none + + MOD:01875 + PSI-MOD + + + MOD:01780 + N6-(beta-lysyl)-L-5-hydroxylysine + + A protein modification that effectively converts an L-lysine residue to N6-(beta-lysyl)-L-5-hydroxylysine by formation of an isopeptide bond between the carboxyl group of a free beta-lysine and the N6-amino group of a peptidyl L-lysine. + + 18201202 + PubMed + + + 20729861 + PubMed + + + AA0531 + RESID + + + + (2S)-2-amino-6-([(3R)-3,6-diaminohexanoyl]amino)-5-hydroxyhexanoic acid + RESID-systematic + + + 5-hydroxy-N6-(beta-lysyl)-L-lysine + RESID-name + + + 5-hydroxy-N6-[(3R)-beta-lysyl]lysine + RESID-alternate + + + EF-P lysine derivative + RESID-alternate + + + lysyl spermidine derivative [misidentification] + RESID-alternate + + + MOD_RES N6-(3,6-diaminohexanoyl)-5-hydroxylysine + UniProt-feature + + + N6-[(3R)-3,6-diaminohexanoyl]-L-5-hydroxylysine + RESID-alternate + + + + DiffAvg + 144.17 + + + + DiffFormula + C 6 H 12 N 2 O 2 + + + + DiffMono + 144.089878 + + + + Formula + C 12 H 24 N 4 O 3 + + + + MassAvg + 272.35 + + + + MassMono + 272.184841 + + + + Origin + K + + + + Source + hypothetical + + + + TermSpec + none + + MOD:00037 + MOD:01875 + PSI-MOD + + + MOD:01781 + N6-butanoyl-L-lysine + + A protein modification that effectively converts an L-lysine residue to N6-butanoyl-L-lysine. + + 17267393 + PubMed + + + 20715035 + PubMed + + + AA0532 + RESID + + + 1289 + UniMod + + + The binding of histone peptides with butanoylated lysine to nuclear bromodomain proteins is non-specific and weaker than binding to the corresponding acetylated lysine peptides [JSG]. + + (2S)-2-amino-6-(butanoylamino)hexanoic acid + RESID-systematic + + + (2S)-2-azanyl-6-(butanoylamino)hexanoic acid + RESID-alternate + + + 2-amino-6-butyrylaminocaproic acid + RESID-alternate + + + epsilon-butanoyl-L-lysine + RESID-alternate + + + epsilon-butyryl-L-lysine + RESID-alternate + + + N(zeta)-butanoyllysine + RESID-alternate + + + N6-(1-oxobutyl)-L-lysine + RESID-alternate + + + N6-butanoyl-L-lysine + RESID-name + + + N6-butyryllysine + RESID-alternate + + + + DiffAvg + 70.09 + + + + DiffFormula + C 4 H 6 N 0 O 1 + + + + DiffMono + 70.041865 + + + + Formula + C 10 H 18 N 2 O 2 + + + + MassAvg + 198.27 + + + + MassMono + 198.136828 + + + + Origin + K + + + + Source + hypothetical + + + + TermSpec + none + + MOD:01875 + MOD:01997 + PSI-MOD + + + MOD:01782 + N-methyl-L-serine + + A protein modification that effectively converts an L-serine residue to N-methyl-L-serine. + + 20668449 + PubMed + + + AA0533 + RESID + + + PSI-MOD-slim + + (2S)-3-hydroxy-2-(methylamino)propanoic acid + RESID-systematic + + + MOD_RES N-methylserine + UniProt-feature + + + N-methyl-L-serine + RESID-name + + + N-methylserine + RESID-alternate + + + + DiffAvg + 14.03 + + + + DiffFormula + C 1 H 2 N 0 O 0 + + + + DiffMono + 14.015650 + + + + Formula + C 4 H 7 N 1 O 2 + + + + MassAvg + 101.10 + + + + MassMono + 101.047678 + + + + Origin + S + + + + Source + natural + + + + TermSpec + none + + MOD:01680 + MOD:01800 + PSI-MOD + + + MOD:01783 + N,N-dimethyl-L-serine + + A protein modification that effectively converts an L-serine residue to N,N-dimethyl-L-serine. + + 20668449 + PubMed + + + AA0534 + RESID + + + + (2S)-2-(dimethylamino)propanoic acid + RESID-systematic + + + MOD_RES N,N-dimethylserine + UniProt-feature + + + N,N-dimethyl-L-serine + RESID-name + + + N,N-dimethylserine + RESID-alternate + + + + DiffAvg + 28.05 + + + + DiffFormula + C 2 H 4 N 0 O 0 + + + + DiffMono + 28.031300 + + + + Formula + C 5 H 10 N 1 O 2 + + + + MassAvg + 116.14 + + + + MassMono + 116.071154 + + + + Origin + S + + + + Source + natural + + + + TermSpec + N-term + + MOD:01686 + MOD:01800 + PSI-MOD + + + MOD:01784 + N,N,N-trimethyl-L-serine + + A protein modification that effectively converts an L-serine residue to N,N,N-trimethyl-L-serine. + + 20668449 + PubMed + + + 3979397 + PubMed + + + AA0535 + RESID + + + PSI-MOD-slim + + (1S)-1-carboxy-2-hydroxy-N,N,N-trimethylethanaminium + RESID-systematic + + + (1S)-1-carboxy-2-hydroxy-N,N,N-trimethylethanazanium + RESID-alternate + + + (2S)-2-trimethylammonio-3-hydroxypropanoic acid + RESID-alternate + + + MOD_RES N,N,N-trimethylserine + UniProt-feature + + + N,N,N-trimethyl-L-serine + RESID-name + + + N,N,N-trimethylserine cation + RESID-alternate + + + N,N,N-trimethylserinium + RESID-alternate + + + + DiffAvg + 43.09 + + + + DiffFormula + C 3 H 7 N 0 O 0 + + + + DiffMono + 43.054227 + + + + FormalCharge + 1+ + + + + Formula + C 6 H 13 N 1 O 2 + + + + MassAvg + 131.17 + + + + MassMono + 131.094080 + + + + Origin + S + + + + Source + natural + + + + TermSpec + N-term + + MOD:01698 + MOD:01800 + PSI-MOD + + + MOD:01785 + O-(L-isoglutamyl)-L-threonine (active site intermediate) + + A protein modification that effectively converts an L-threonine residue to O-(L-isoglutamyl)-L-threonine, using free L-glutamine and releasing ammonia. + + 8706862 + PubMed + + + AA0536#THR + RESID + + + This is not an ester cross-link of peptides [JSG]. + + (2S)-2-amino-5-([(1S,2R)-1-amino-1-carboxypropan-2-yl]oxy)-5-oxopentanoic acid + RESID-systematic + + + (2S,3R)-2-amino-3-([(4S)-4-amino-4-carboxybutanoyl]oxy)-propanoic acid + RESID-alternate + + + 5-(threon-O3-yl)glutamate + RESID-alternate + + + O(beta)-(gamma-glutamyl)threonine + RESID-alternate + + + O-(L-isoglutamyl)-L-threonine + RESID-name + + + O3-(isoglutamyl)threonine + RESID-alternate + + + + DiffAvg + 129.12 + + + + DiffFormula + C 5 H 7 N 1 O 3 + + + + DiffMono + 129.042593 + + + + Formula + C 9 H 14 N 2 O 5 + + + + MassAvg + 230.22 + + + + MassMono + 230.090272 + + + + Origin + T + + + + Source + hypothetical + + + + TermSpec + none + + MOD:00671 + MOD:01979 + PSI-MOD + + + MOD:01786 + 3'-nitro-L-tyrosine + + A protein modification that effectively converts an L-tyrosine residue to 3'-nitro-L-tyrosine. + + 44454 + ChEBI + + + 16944230 + PubMed + + + 5339594 + PubMed + + + AA0537 + RESID + + + PSI-MOD-slim + + (2S)-2-amino-3-(4-hydroxy-3-nitrophenyl)propanoic acid + RESID-systematic + + + 3'-nitro-L-tyrosine + RESID-name + + + 3-nitro-L-tyrosine + RESID-alternate + + + 3-nitrotyrosine + RESID-alternate + + + m-nitrotyrosine + RESID-alternate + + + meta-nitrotyrosine + RESID-alternate + + + MOD_RES 3'-Nitrotyrosine + UniProt-feature + + + + DiffAvg + 45.00 + + + + DiffFormula + C 0 H -1 N 1 O 2 + + + + DiffMono + 44.985078 + + + + Formula + C 9 H 8 N 2 O 4 + + + + MassAvg + 208.17 + + + + MassMono + 208.048407 + + + + Origin + Y + + + + Source + natural + + + + TermSpec + none + + MOD:01352 + PSI-MOD + + + MOD:01787 + 5'-(L-tyros-5'-yl)amino-L-tyrosine + + A protein modification that effectively cross-links two L-tyrosine residues through their 5' positions by amine nitrogen to form 5'-(L-tyros-5'-yl)amino-L-tyrosine. + + 18781570 + PubMed + + + AA0459 + RESID + + + Cross-link 2. + + (2S,2'S)-3,3'-[iminobis(4-hydroxybenzene-3,1-diyl)]bis(2-aminopropanoic acid) + RESID-systematic + + + 5'-(L-tyros-5'-yl)amino-L-tyrosine + RESID-name + + + 5'-[(tyros-5'-yl)amino]tyrosine + RESID-alternate + + + 5'-tyrosyl-5'-aminotyrosine + RESID-alternate + + + bis(LTQ) linkage + RESID-alternate + + + CROSSLNK 5'-tyrosyl-5'-aminotyrosine (Tyr-Tyr) (interchain) + UniProt-feature + + + + DiffAvg + 13.00 + + + + DiffFormula + C 0 H -1 N 1 O 0 + + + + DiffMono + 12.995249 + + + + Formula + C 18 H 17 N 3 O 4 + + + + MassAvg + 339.35 + + + + MassMono + 339.121906 + + + + Origin + Y, Y + + + + Source + hypothetical + + + + TermSpec + none + + MOD:00692 + MOD:00919 + PSI-MOD + + + MOD:01788 + histidine immonium ion + + A protein modification that effectively converts an N-terminal L-histidine residue to histidine immonium ion. + + 17074506 + PubMed + + + 18688235 + PubMed + + + This fragment corresponds to the first ion in an a+ series. + PSI-MOD-slim + + 2-(1H-imidazolyl)ethaniminium + PSI-MOD-alternate + + + + DiffAvg + -27.00 + + + + DiffFormula + C -1 H 1 N 0 O -1 + + + + DiffMono + -26.987638 + + + + FormalCharge + 1+ + + + + Formula + C 5 H 8 N 3 O 0 + + + + MassAvg + 110.14 + + + + MassMono + 110.071274 + + + + Origin + H + + + + Source + artifact + + + + TermSpec + none + + MOD:00909 + MOD:01527 + PSI-MOD + + + MOD:01789 + phenylalanine immonium ion + + A protein modification that effectively converts an N-terminal L-phenylalanine residue to phenylalanine immonium ion. + + 17074506 + PubMed + + + 18688235 + PubMed + + + This fragment corresponds to the first ion in an a+ series. + PSI-MOD-slim + + 2-phenylethaniminium + PSI-MOD-alternate + + + + DiffAvg + -27.00 + + + + DiffFormula + C -1 H 1 N 0 O -1 + + + + DiffMono + -26.987638 + + + + FormalCharge + 1+ + + + + Formula + C 8 H 10 N 1 O 0 + + + + MassAvg + 120.17 + + + + MassMono + 120.080776 + + + + Origin + F + + + + Source + artifact + + + + TermSpec + none + + MOD:00914 + MOD:01527 + PSI-MOD + + + MOD:01790 + tyrosine immonium ion + + A protein modification that effectively converts an an N-terminal L-tyrosine residue to tyrosine immonium ion. + + 17074506 + PubMed + + + 18688235 + PubMed + + + This fragment corresponds to the first ion in an a+ series. + PSI-MOD-slim + + 2-(4-hydroxyphenyl)ethaniminium + PSI-MOD-alternate + + + + DiffAvg + -27.00 + + + + DiffFormula + C -1 H 1 N 0 O -1 + + + + DiffMono + -26.987638 + + + + FormalCharge + 1+ + + + + Formula + C 8 H 10 N 1 O 1 + + + + MassAvg + 136.17 + + + + MassMono + 136.075690 + + + + Origin + Y + + + + Source + artifact + + + + TermSpec + none + + MOD:00919 + MOD:01527 + PSI-MOD + + + MOD:01791 + phosphohistidine immonium ion + + A protein modification that effectively converts an N-terminal phosphohistidine residue to phosphohistidine immonium ion. + + 17690871 + PubMed + + + 18688235 + PubMed + + + 20847263 + PubMed + + + This fragment corresponds to the first ion in an a+ series. + PSI-MOD-slim + + 2-(1H-imidazolyl)ethaniminium + PSI-MOD-alternate + + + + DiffAvg + -27.00 + + + + DiffFormula + C -1 H 1 N 0 O -1 + + + + DiffMono + -26.987638 + + + + FormalCharge + 1+ + + + + Formula + C 5 H 9 N 3 O 3 P 1 + + + + MassAvg + 190.12 + + + + MassMono + 190.037604 + + + + Origin + MOD:00890 + + + + Source + artifact + + + + TermSpec + none + + MOD:00909 + MOD:01527 + + derives_from + MOD:008900 + + PSI-MOD + + + MOD:01792 + phosphotyrosine immonium ion + + A protein modification that effectively converts an N-terminal O4'-phospho-L-tyrosine residue to tyrosine immonium ion. + + 17690871 + PubMed + + + 18688235 + PubMed + + + This fragment corresponds to the first ion in an a+ series. + PSI-MOD-slim + + 2-(4-phosphonoxyphenyl)ethaniminium + PSI-MOD-alternate + + + + DiffAvg + -27.00 + + + + DiffFormula + C -1 H 1 N 0 O -1 + + + + DiffMono + -26.987638 + + + + FormalCharge + 1+ + + + + Formula + C 8 H 11 N 1 O 4 P 1 + + + + MassAvg + 216.15 + + + + MassMono + 216.042021 + + + + Origin + MOD:00048 + + + + Source + artifact + + + + TermSpec + none + + MOD:00919 + MOD:01527 + + derives_from + MOD:000480 + + PSI-MOD + + + MOD:01793 + S-carboxamidomethyl-L-cysteine sulfoxide + + A protein modification that effectively converts an L-cysteine residue to S-carboxamidomethyl-L-cysteine sulfoxide. + + 11212008 + PubMed + + + 17689096 + PubMed + + + 18306178 + PubMed + + + 18688235 + PubMed + + + + CamCO + PSI-MOD-alternate + + + S-carbamoylmethyl-L-cysteine sulfoxide + PSI-MOD-alternate + + + + DiffAvg + 73.05 + + + + DiffFormula + C 2 H 3 N 1 O 2 + + + + DiffMono + 73.016378 + + + + Formula + C 5 H 8 N 2 O 3 S 1 + + + + MassAvg + 176.19 + + + + MassMono + 176.025563 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:00397 + MOD:00708 + MOD:01854 + + derives_from + MOD:010600 + + PSI-MOD + + + MOD:01794 + 1x(13)C,3x(2)H labeled monomethylated residue + + A protein modification that effectively replaces the methyl group of a residue containing common isotopes with a 1x(13)C,3x(2)H labeled monomethylated residue. + + 18688235 + PubMed + + + + Methyl:2H(3)13C(1) + PSI-MS-label + + + + DiffAvg + 18.04 + + + + DiffFormula + (13)C 1 (1)H -1 (2)H 3 + + + + DiffMono + 18.037835 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00839 + MOD:00842 + PSI-MOD + + + MOD:01795 + 1x(13)C,3x(2)H C(6)-labeled L-methionine + + A protein modification that effectively converts an L-methionine residue containing common isotopes to 1x(13)C,3x(2)H C(6)-labeled L-methionine. + + 15782174 + PubMed + + + 18688235 + PubMed + + + + Methyl:2H(3)13C(1) + PSI-MS-label + + + + DiffAvg + 4.02 + + + + DiffFormula + (12)C -1 (13)C 1 (1)H -3 (2)H 3 + + + + DiffMono + 4.022185 + + + + Formula + (12)C 4 (13)C 1 (1)H 6 (2)H 3 N 1 O 1 S 1 + + + + MassAvg + 135.06 + + + + MassMono + 135.062670 + + + + Origin + M + + + + Source + artifact + + + + TermSpec + none + + MOD:00839 + MOD:00913 + MOD:01794 + PSI-MOD + + + MOD:01796 + 1x(13)C,3x(2)H C(6)-labeled L-methionine sulfoxide + + A protein modification that effectively converts an L-methionine residue containing common isotopes to 1x(13)C,3x(2)H C(6)-labeled L-methionine sulfoxide. + + 15782174 + PubMed + + + 18688235 + PubMed + + + + + DiffAvg + 20.02 + + + + DiffFormula + (12)C -1 (13)C 1 (1)H -3 (2)H 3 O 1 + + + + DiffMono + 20.017100 + + + + Formula + (12)C 4 (13)C 1 (1)H 6 (2)H 3 N 1 O 2 S 1 + + + + MassAvg + 151.06 + + + + MassMono + 151.057585 + + + + Origin + M + + + + Source + artifact + + + + TermSpec + none + + MOD:00839 + MOD:00913 + MOD:01794 + PSI-MOD + + + MOD:01797 + 1'-phosphohistidine immonium ion + + A protein modification that effectively converts an N-terminal 1'-phosphohistidine residue to 1'-phosphohistidine immonium ion. + + 17690871 + PubMed + + + 18688235 + PubMed + + + 20847263 + PubMed + + + This fragment corresponds to the first ion in an a+ series. + + 2-((1-phosphono-1H-imidazol-4-yl)ethaniminium + PSI-MOD-alternate + + + Ntau-phosphorylated L-histidine + PSI-MOD-alternate + + + + DiffAvg + -27.00 + + + + DiffFormula + C -1 H 1 N 0 O -1 + + + + DiffMono + -26.987638 + + + + FormalCharge + 1+ + + + + Formula + C 5 H 9 N 3 O 3 P 1 + + + + MassAvg + 190.12 + + + + MassMono + 190.037604 + + + + Origin + MOD:00044 + + + + Source + artifact + + + + TermSpec + none + + MOD:01791 + + derives_from + MOD:000440 + + PSI-MOD + + + MOD:01798 + 3'-phosphohistidine immonium ion + + A protein modification that effectively converts an N-terminal 3'-phosphohistidine residue to 3'-phosphohistidine immonium ion. + + 18688235 + PubMed + + + This fragment corresponds to the first ion in an a+ series. + + 2-(1-phosphono-1H-imidazol-5-yl)ethaniminium + PSI-MOD-alternate + + + Npi-phosphorylated L-histidine + PSI-MOD-alternate + + + + DiffAvg + -27.00 + + + + DiffFormula + C -1 H 1 N 0 O -1 + + + + DiffMono + -26.987638 + + + + FormalCharge + 1+ + + + + Formula + C 5 H 9 N 3 O 3 P 1 + + + + MassAvg + 190.12 + + + + MassMono + 190.037604 + + + + Origin + MOD:00045 + + + + Source + artifact + + + + TermSpec + none + + MOD:01791 + + derives_from + MOD:000450 + + PSI-MOD + + + MOD:01799 + methylated serine + + A protein modification that effectively converts an L-alanine residue to a methylated serine, such as N-methylserine, N,N-dimethylserine, or N,N,N-trimethylserine. + + 18688235 + PubMed + + + PSI-MOD-slim + + MeSer + PSI-MOD-label + + + + Origin + S + + MOD:00427 + MOD:00916 + PSI-MOD + + + MOD:01800 + N-methylated serine + + A protein modification that effectively replaces an L-serine alpha amino hydrogen with a methyl group. + + 18688235 + PubMed + + + PSI-MOD-slim + + + Origin + S + + + + Source + natural + + + + TermSpec + N-term + + MOD:01460 + MOD:01799 + PSI-MOD + + + MOD:01801 + protonated L-serine (L-serinium) residue + + A protein modification that effectively converts an L-serine residue to an L-serinium (protonated L-serine). + + 18688235 + PubMed + + + PSI-MOD-slim + + + DiffAvg + 1.01 + + + + DiffFormula + C 0 H 1 N 0 O 0 + + + + DiffMono + 1.007276 + + + + FormalCharge + 1+ + + + + Formula + C 3 H 7 N 1 O 2 + + + + MassAvg + 89.09 + + + + MassMono + 89.047130 + + + + Origin + S + + + + Source + natural + + + + TermSpec + N-term + + MOD:00916 + MOD:01700 + PSI-MOD + + + MOD:01802 + N,N,N-trimethyl-L-serine (from L-serinium) + + A protein modification that effectively converts an L-serinium (protonated L-serine) residue to an N,N,N-trimethyl-L-serine. + + 18688235 + PubMed + + + For amino acids residues, amine trimethylation can effectively only be accomplished with an aminium, protonated primary amino, group. This process accounts only for trimethylation and not protonation. The alternative N2Me3+Ser process (MOD:00071) accounts for both protonation and trimethylation. + PSI-MOD-slim + + N2Me3Ala + PSI-MOD-label + + + + DiffAvg + 42.08 + + + + DiffFormula + C 3 H 6 N 0 O 0 + + + + DiffMono + 42.046402 + + + + FormalCharge + 1+ + + + + Formula + C 6 H 13 N 1 O 2 + + + + MassAvg + 131.17 + + + + MassMono + 131.094080 + + + + Origin + MOD:01801 + + + + Source + natural + + + + TermSpec + N-term + + MOD:01687 + + derives_from + MOD:018010 + + PSI-MOD + + + MOD:01803 + O-methylated threonine + + A protein modification that effectively converts an L-threonine residue to a methylated threonine, such as O-methyl-L-threonine or L-threonine methyl ester. + + 18688235 + PubMed + + + + OMeThr + PSI-MOD-label + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + T + + + + Source + natural + + + + TermSpec + none + + MOD:00393 + MOD:01418 + PSI-MOD + + + MOD:01804 + glycosylphosphorylated residue + + A protein modification that effectively results from forming an adduct with a glycosylphosphate through a phosphodiester bond. + + 18688235 + PubMed + + + MOD:00764 + MOD:00861 + PSI-MOD + + + MOD:01805 + N-(L-isoaspartyl)-glycine (Asp) + + A protein modification that effectively crosslinks an L-aspartic acid residue and a glycine residue by an isopeptide bond with formation of N-(L-isoaspartyl)-glycine and the release of water. + + 21479 + ChEBI + + + 1826288 + PubMed + + + 18671394 + PubMed + + + AA0126 + RESID + + + Cross-link 2. + + (2S)-2-amino-4-(carboxymethyl)amino-4-oxobutanoic acid + RESID-systematic + + + 2-amino-N4-(carboxymethyl)-butanediamic acid + RESID-alternate + + + CROSSLNK Isoaspartyl glycine isopeptide (Asp-Gly) + UniProt-feature + + + CROSSLNK Isoaspartyl glycine isopeptide (Gly-Asp) + UniProt-feature + + + isoaspartyl glycine + RESID-alternate + + + N-(L-isoaspartyl)-glycine + RESID-name + + + N-beta-aspartylglycine + RESID-alternate + + + N4-(carboxymethyl)-asparagine + RESID-alternate + + + + DiffAvg + -18.02 + + + + DiffFormula + C 0 H -2 N 0 O -1 + + + + DiffMono + -18.010565 + + + + Formula + C 6 H 7 N 2 O 3 + + + + MassAvg + 155.13 + + + + MassMono + 155.045667 + + + + Origin + D, G + + + + Source + natural + + + + TermSpec + N-term + + MOD:00904 + MOD:00954 + MOD:01928 + PSI-MOD + + + MOD:01806 + N,N-dimethyl-L-leucine + + A protein modification that effectively converts an L-leucine residue to N,N-dimethyl-L-leucine. + + 19522542 + PubMed + + + AA0538 + RESID + + + + (2S)-2-(dimethylamino)-4-methylpentanoic acid + RESID-systematic + + + 2-(dimethylamino)-4-methylvaleric acid + RESID-alternate + + + 2-(dimethylazanyl)-4-methylpentanoic acid + RESID-alternate + + + MOD_RES N,N-dimethylleucine + UniProt-feature + + + N,N-dimethyl-L-leucine + RESID-name + + + N,N-dimethylleucine + RESID-alternate + + + + DiffAvg + 28.05 + + + + DiffFormula + C 2 H 4 N 0 O 0 + + + + DiffMono + 28.031300 + + + + Formula + C 8 H 16 N 1 O 1 + + + + MassAvg + 142.22 + + + + MassMono + 142.123189 + + + + Origin + L + + + + Source + hypothetical + + + + TermSpec + N-term + + MOD:01686 + MOD:01808 + PSI-MOD + + + MOD:01807 + N-formyl-L-glutamic acid + + A protein modification that effectively converts an L-glutamic acid residue to N-formyl-L-glutamic acid. + + 18001127 + PubMed + + + AA0539 + RESID + + + + (2S)-2-(formylamino)pentanedioic acid + RESID-systematic + + + 2-(formylazanyl)pentanedioic acid + RESID-alternate + + + 2-formamidopentanedioic acid + RESID-alternate + + + 2-formylaminopentanedioic acid + RESID-alternate + + + N-formyl-L-glutamic acid + RESID-name + + + + DiffAvg + 28.01 + + + + DiffFormula + C 1 H 0 N 0 O 1 + + + + DiffMono + 27.994915 + + + + Formula + C 6 H 8 N 1 O 4 + + + + MassAvg + 158.13 + + + + MassMono + 158.045333 + + + + Origin + E + + + + Source + artifact + + + + TermSpec + N-term + + MOD:00409 + MOD:00906 + PSI-MOD + + + MOD:01808 + N-methylated leucine + + A protein modification that effectively replaces an L-leucine alpha amino hydrogen with a methyl group. + + 18688235 + PubMed + + + PSI-MOD-slim + + MeLeu + PSI-MOD-label + + + + Origin + L + + MOD:00662 + MOD:01460 + PSI-MOD + + + MOD:01809 + 5x(13)C,1x(15)N labeled residue + + A protein modification that effectively converts a residue containing common isotopes to a 5x(13)C,1x(15)N labeled residue. + + 12771378 + PubMed + + + 268 + UniMod + + + + 13C(5) 15N(1) Silac label + UniMod-description + + + Label:13C(5)15N(1) + PSI-MS-label + + + + DiffAvg + 6.01 + + + + DiffFormula + (12)C -5 (13)C 5 (14)N -1 (15)N 1 + + + + DiffMono + 6.013809 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00842 + MOD:00843 + PSI-MOD + + + MOD:01810 + 5x(13)C,1x(15)N labeled L-proline + + A protein modification that effectively converts an L-proline residue to 5x(13)C,1x(15)N labeled L-proline. + + 12771378 + PubMed + + + 268#P + UniMod + + + + 13C(5) 15N(1) Silac label + UniMod-description + + + Label:13C(5)15N(1) + PSI-MS-label + + + + DiffAvg + 6.01 + + + + DiffFormula + (12)C -5 (13)C 5 (14)N -1 (15)N 1 + + + + DiffMono + 6.013809 + + + + Formula + (13)C 5 H 7 (15)N 1 O 1 + + + + MassAvg + 103.07 + + + + MassMono + 103.066573 + + + + Origin + P + + + + Source + artifact + + + + TermSpec + none + + MOD:00915 + MOD:01809 + PSI-MOD + + + MOD:01811 + 5x(13)C,1x(15)N labeled L-methionine + + A protein modification that effectively converts an L-methionine residue to 5x(13)C,1x(15)N labeled L-methionine. + + 12771378 + PubMed + + + 268#M + UniMod + + + + 13C(5) 15N(1) Silac label + UniMod-description + + + Label:13C(5)15N(1) + PSI-MS-label + + + + DiffAvg + 6.01 + + + + DiffFormula + (12)C -5 (13)C 5 (14)N -1 (15)N 1 + + + + DiffMono + 6.013809 + + + + Formula + (13)C 5 H 9 (15)N 1 O 1 S 1 + + + + MassAvg + 137.05 + + + + MassMono + 137.054294 + + + + Origin + M + + + + Source + artifact + + + + TermSpec + none + + MOD:00913 + MOD:01809 + PSI-MOD + + + MOD:01812 + 5x(13)C,1x(15)N labeled L-methionine sulfoxide + + A protein modification that effectively converts an L-methionine residue to 5x(13)C,1x(15)N labeled L-methionine sulfoxide. + + 12771378 + PubMed + + + 268#M + UniMod + + + + 13C(5) 15N(1) Silac label + UniMod-description + + + Label:13C(5)15N(1) + PSI-MS-label + + + + DiffAvg + 6.01 + + + + DiffFormula + (12)C -5 (13)C 5 (14)N -1 (15)N 1 + + + + DiffMono + 6.013809 + + + + Formula + (13)C 5 H 9 (15)N 1 O 2 S 1 + + + + MassAvg + 153.05 + + + + MassMono + 153.049209 + + + + Origin + M + + + + Source + artifact + + + + TermSpec + none + + MOD:00719 + MOD:01809 + PSI-MOD + + + MOD:01813 + morpholine-2-acetylated residue + + A protein modification that effectively substitutes a morpholine-2-acetyl group for a hydrogen atom. + + 10446193 + PubMed + + + 29 + UniMod + + + The UniMod name "N-Succinimidyl-3-morpholine acetate" appears to have been a typographical error [JSG]. + + N-Succinimidyl-2-morpholine acetate + UniMod-description + + + N-succinimidylmorpholine-2-acetate derivative + PSI-MOD-alternate + + + SMA + PSI-MS-label + + + + DiffAvg + 127.14 + + + + DiffFormula + C 6 H 9 N 1 O 2 + + + + DiffMono + 127.063329 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + MOD:00649 + MOD:00848 + PSI-MOD + + + MOD:01814 + L-cysteine 3-hydroxy-2,5-pyridinedicarboxylic acid + + A protein modification that effectively cross-links a cysteine and two serine residues to form L-cysteine 3-hydroxy-2,5-pyridinedicarboxylic acid. + + 18406324 + PubMed + + + 19678698 + PubMed + + + 893891 + PubMed + + + AA0540 + RESID + + + Cross-link 3. + + 6-[(1R)-1-amino-2-sulfanylethyl]-3-hydroxypyridine-2,5-dicarboxylic acid + RESID-systematic + + + 6-[1-azanyl-2-sulfanylethyl]-3-hydroxypyridine-2,5-dicarboxylic acid + RESID-alternate + + + L-cysteine 3-hydroxy-2,5-pyridinedicarboxylic acid + RESID-name + + + + DiffAvg + -54.07 + + + + DiffFormula + C 0 H -8 N -1 O -2 S 0 + + + + DiffMono + -54.055504 + + + + Formula + C 9 H 7 N 2 O 3 S 1 + + + + MassAvg + 223.23 + + + + MassMono + 223.017738 + + + + Origin + C, S, S + + + + Source + natural + + + + TermSpec + none + + MOD:01425 + PSI-MOD + + + MOD:01815 + L-glutamate thiazole-4-carboxylic acid + + A protein modification that effectively crosslinks an L-cysteine residue and an L-glutamic acid residue to form L-glutamate thiazole-4-carboxylic acid. + + 18406324 + PubMed + + + 19678698 + PubMed + + + 893891 + PubMed + + + AA0541 + RESID + + + Cross-link 2. + + 2-[(1S)-1-amino-3-carboxypropyl]-1,3-thiazole-4-carboxylic acid + RESID-systematic + + + 2-[-1-azanyl-3-carboxypropyl]-1,3-thiazole-4-carboxylic acid + RESID-alternate + + + CROSSLNK Thiazole-4-carboxylic acid (Glu-Cys) + UniProt-feature + + + L-glutamate thiazole-4-carboxylic acid + RESID-name + + + + DiffAvg + -20.03 + + + + DiffFormula + C 0 H -4 N 0 O -1 S 0 + + + + DiffMono + -20.026215 + + + + Formula + C 8 H 8 N 2 O 3 S 1 + + + + MassAvg + 212.22 + + + + MassMono + 212.025563 + + + + Origin + C, E + + + + Source + natural + + + + TermSpec + none + + MOD:00906 + MOD:01420 + MOD:01888 + PSI-MOD + + + MOD:01816 + 2'-hydroxy-L-tryptophan + + A protein modification that effectively converts an L-tryptophan residue to a 2'-hydroxy-L-tryptophan. + + 11714714 + PubMed + + + AA0542 + RESID + + + + (2S)-2-amino-3-(2-hydroxy-1H-indol-3-yl)propanoic acid + RESID-systematic + + + 2'-hydroxy-L-tryptophan + RESID-name + + + 2-azanyl-3-(2-hydroxy-1H-indol-3-yl)propanoic acid + RESID-alternate + + + 2-hydroxy-L-tryptophan + RESID-alternate + + + 2-hydroxy-tryptophan + RESID-alternate + + + + DiffAvg + 16.00 + + + + DiffFormula + C 0 H 0 N 0 O 1 + + + + DiffMono + 15.994915 + + + + Formula + C 11 H 10 N 2 O 2 + + + + MassAvg + 202.21 + + + + MassMono + 202.074228 + + + + Origin + W + + + + Source + artifact + + + + TermSpec + none + + MOD:01622 + PSI-MOD + + + MOD:01817 + oxidation of tryptophan to 2'-oxo-L-tryptophan + + A protein modification that effectively converts an L-tryptophan residue to a 2'-oxo-L-tryptophan. + + 9461080 + PubMed + + + AA0543 + RESID + + + + (2S)-2-amino-3-[(3S)-2-oxo-2,3-dihydro-1H-indol-3-yl]propanoic acid + RESID-systematic + + + 2'-oxo-L-tryptophan + RESID-name + + + 2-azanyl-3-[(3S)-2-oxo-2,3-dihydro-1H-indol-3-yl]propanoic acid + RESID-alternate + + + 2-oxo-L-tryptophan + RESID-alternate + + + 2-oxotryptophan + RESID-alternate + + + + DiffAvg + 16.00 + + + + DiffFormula + C 0 H 0 N 0 O 1 + + + + DiffMono + 15.994915 + + + + Formula + C 11 H 10 N 2 O 2 + + + + MassAvg + 202.21 + + + + MassMono + 202.074228 + + + + Origin + W + + + + Source + artifact + + + + TermSpec + none + + MOD:00679 + MOD:00918 + PSI-MOD + + + MOD:01818 + 1'-(L-tryptophan-3'-yl)-L-tryptophan + + A protein modification that effectively cross-links two tryptophan residues to form 1'-(L-tryptophan-3'-yl)-L-tryptophan. + + 20600836 + PubMed + + + AA0544 + RESID + + + Cross-link 2. + + (2S,2'S)-3,3'-(3'H-1,3'-biindole-3,3'-diyl)bis(2-aminopropanoic acid) + RESID-alternate + + + 1-(L-tryptophan-3-yl)-L-tryptophan + RESID-name + + + 2-amino-3-[2-[2-amino-3-(2-carboxyethyl)-1H-indol-4-yl]-1H-indol-3-yl]propanoic acid + RESID-alternate + + + 3-[(2S)-2-amino-2-carboxyethyl]-3-(3-[(2S)-2-amino-2-carboxyethyl]-1H-indol-2-yl)-1H-indole + RESID-systematic + + + 3-[2-azanyl-2-carboxyethyl]-3-(3-[2-azanyl-2-carboxyethyl]-1H-indol-2-yl)-1H-indole + RESID-alternate + + + ditryptophan + RESID-alternate + + + + DiffAvg + -2.02 + + + + DiffFormula + C 0 H -2 N 0 O 0 + + + + DiffMono + -2.015650 + + + + Formula + C 22 H 18 N 4 O 2 + + + + MassAvg + 370.41 + + + + MassMono + 370.142976 + + + + Origin + W, W + + + + Source + natural + + + + TermSpec + none + + MOD:00692 + MOD:00918 + PSI-MOD + + + MOD:01819 + N6-succinyl-L-lysine + + A protein modification that effectively converts an L-lysine residue to N6-succinyl-L-lysine. + + 16582421 + PubMed + + + 21151122 + PubMed + + + AA0545 + RESID + + + PSI-MOD-slim + + (2S)-2-amino-6-[(3-carboxypropanoyl)amino]hexanoic acid + RESID-systematic + + + 2-azanyl-6-[(3-carboxypropanoyl)azanyl]hexanoic acid + RESID-alternate + + + 4-[[(5S)-5-amino-6-hydroxy-6-oxohexyl]amino]-4-oxobutanoate + RESID-alternate + + + MOD_RES N6-succinyllysine + UniProt-feature + + + N(epsilon)-(succinyl)lysine + RESID-alternate + + + N6-succinyl-L-lysine + RESID-name + + + succinyllysine + RESID-alternate + + + + DiffAvg + 100.07 + + + + DiffFormula + C 4 H 4 N 0 O 3 + + + + DiffMono + 100.016044 + + + + Formula + C 10 H 16 N 2 O 4 + + + + MassAvg + 228.25 + + + + MassMono + 228.111007 + + + + Origin + K + + + + Source + natural + + + + TermSpec + none + + MOD:01029 + MOD:01875 + PSI-MOD + + + MOD:01820 + isotope tagged sufhydryl reagent modified cysteine + + A protein modification that effectively replaces a cysteine sulhydryl hydrogen with an isotope tagged sulfhydryl reagent group. + + 18688235 + PubMed + + + PSI-MOD-slim + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:00905 + MOD:01426 + PSI-MOD + + + MOD:01821 + cysTMT6plex reporter+balance reagent cysteine disulfide + + A protein modification that effectively replaces a residue sulfhydryl hydrogen with a Thermo Scientific cysTMT6plex reporter+balance group. + + 985 + UniMod + + + The reagent consists of a reporter group, a balance group and a protein sulfhydryl reactive pyridine disulfanyl group. The reporter group, an isotopically labeled 1,2,6-trimethylpiperidine, is connected to a 3-(carbonylamino)propanoyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + cysteine-reactive Sixplex Tandem Mass Tag(TM) + UniMod-description + + + cysTMT6plex + UniMod-interim + + + S-(2-{3-[2-(2,6-dimethylpiperidin-1-yl)acetamido]propanamido}ethyl)sulfanyl + PSI-MOD-alternate + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:01428 + MOD:01429 + MOD:01820 + PSI-MOD + + + MOD:01822 + cysTMT6plex-zero reporter+balance reagent cysteine disulfide + + A protein modification that effectively replaces a residue sulfhydryl hydrogen with a Thermo Scientific cysTMT6plex-zero reporter+balance group. + + 984 + UniMod + + + The reagent consists of a reporter group, a balance group and a protein sulfhydryl reactive pyridine disulfanyl group. The reporter group, an isotopically labeled 1,2,6-trimethylpiperidine, is connected to a 3-(carbonylamino)propanoyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + cysTMT + UniMod-interim + + + Native cysteine-reactive Tandem Mass Tag(TM) + UniMod-description + + + S-(2-{3-[2-(2,6-dimethylpiperidin-1-yl)acetamido]propanamido}ethyl)sulfanyl + PSI-MOD-alternate + + + + DiffAvg + 299.17 + + + + DiffFormula + (12)C 14 H 25 (14)N 3 O 2 S 1 + + + + DiffMono + 299.166748 + + + + Formula + (12)C 17 H 32 (14)N 4 O 4 S 2 + + + + MassAvg + 420.19 + + + + MassMono + 420.186498 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:01821 + PSI-MOD + + + MOD:01823 + cysTMT6plex-126 reporter+balance reagent cysteine disulfide + + A protein modification that effectively replaces a residue sulfhydryl hydrogen with a Thermo Scientific cysTMT6plex-126 reporter+balance group. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein sulfhydryl reactive pyridine disulfanyl group. The reporter group, an isotopically labeled 1,2,6-trimethylpiperidine, is connected to a 3-(carbonylamino)propanoyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + cysteine-reactive Sixplex Tandem Mass Tag(TM) + UniMod-description + + + cysTMT6plex + UniMod-interim + + + S-(2-{3-[2-(2,6-dimethylpiperidin-1-yl)acetamido]propanamido}ethyl)sulfanyl + PSI-MOD-alternate + + + + DiffAvg + 304.18 + + + + DiffFormula + (12)C 10 (13)C 4 H 25 (14)N 2 (15)N 1 O 2 S 1 + + + + DiffMono + 304.177202 + + + + Formula + (12)C 13 (13)C 4 H 32 (14)N 3 (15)N 1 O 4 S 2 + + + + MassAvg + 425.20 + + + + MassMono + 425.196952 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:01821 + PSI-MOD + + + MOD:01824 + cysTMT6plex-127 reporter+balance reagent cysteine disulfide + + A protein modification that effectively replaces a residue sulfhydryl hydrogen with a Thermo Scientific cysTMT6plex-127 reporter+balance group. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein sulfhydryl reactive pyridine disulfanyl group. The reporter group, an isotopically labeled 1,2,6-trimethylpiperidine, is connected to a 3-(carbonylamino)propanoyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + cysteine-reactive Sixplex Tandem Mass Tag(TM) + UniMod-description + + + cysTMT6plex + UniMod-interim + + + S-(2-{3-[2-(2,6-dimethylpiperidin-1-yl)acetamido]propanamido}ethyl)sulfanyl + PSI-MOD-alternate + + + + DiffAvg + 304.18 + + + + DiffFormula + (12)C 10 (13)C 4 H 25 (14)N 2 (15)N 1 O 2 S 1 + + + + DiffMono + 304.177202 + + + + Formula + (12)C 13 (13)C 4 H 32 (14)N 3 (15)N 1 O 4 S 2 + + + + MassAvg + 425.20 + + + + MassMono + 425.196952 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:01821 + PSI-MOD + + + MOD:01825 + cysTMT6plex-128 reporter+balance reagent cysteine disulfide + + A protein modification that effectively replaces a residue sulfhydryl hydrogen with a Thermo Scientific cysTMT6plex-128 reporter+balance group. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein sulfhydryl reactive pyridine disulfanyl group. The reporter group, an isotopically labeled 1,2,6-trimethylpiperidine, is connected to a 3-(carbonylamino)propanoyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + cysteine-reactive Sixplex Tandem Mass Tag(TM) + UniMod-description + + + cysTMT6plex + UniMod-interim + + + S-(2-{3-[2-(2,6-dimethylpiperidin-1-yl)acetamido]propanamido}ethyl)sulfanyl + PSI-MOD-alternate + + + + DiffAvg + 304.18 + + + + DiffFormula + (12)C 10 (13)C 4 H 25 (14)N 2 (15)N 1 O 2 S 1 + + + + DiffMono + 304.177202 + + + + Formula + (12)C 13 (13)C 4 H 32 (14)N 3 (15)N 1 O 4 S 2 + + + + MassAvg + 425.20 + + + + MassMono + 425.196952 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:01821 + PSI-MOD + + + MOD:01826 + cysTMT6plex-129 reporter+balance reagent cysteine disulfide + + A protein modification that effectively replaces a residue sulfhydryl hydrogen with a Thermo Scientific cysTMT6plex-129 reporter+balance group. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein sulfhydryl reactive pyridine disulfanyl group. The reporter group, an isotopically labeled 1,2,6-trimethylpiperidine, is connected to a 3-(carbonylamino)propanoyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + cysteine-reactive Sixplex Tandem Mass Tag(TM) + UniMod-description + + + cysTMT6plex + UniMod-interim + + + S-(2-{3-[2-(2,6-dimethylpiperidin-1-yl)acetamido]propanamido}ethyl)sulfanyl + PSI-MOD-alternate + + + + DiffAvg + 304.18 + + + + DiffFormula + (12)C 10 (13)C 4 H 25 (14)N 2 (15)N 1 O 2 S 1 + + + + DiffMono + 304.177202 + + + + Formula + (12)C 13 (13)C 4 H 32 (14)N 3 (15)N 1 O 4 S 2 + + + + MassAvg + 425.20 + + + + MassMono + 425.196952 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:01821 + PSI-MOD + + + MOD:01827 + cysTMT6plex-130 reporter+balance reagent cysteine disulfide + + A protein modification that effectively replaces a residue sulfhydryl hydrogen with a Thermo Scientific cysTMT6plex-130 reporter+balance group. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein sulfhydryl reactive pyridine disulfanyl group. The reporter group, an isotopically labeled 1,2,6-trimethylpiperidine, is connected to a 3-(carbonylamino)propanoyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + cysteine-reactive Sixplex Tandem Mass Tag(TM) + UniMod-description + + + cysTMT6plex + UniMod-interim + + + S-(2-{3-[2-(2,6-dimethylpiperidin-1-yl)acetamido]propanamido}ethyl)sulfanyl + PSI-MOD-alternate + + + + DiffAvg + 304.18 + + + + DiffFormula + (12)C 10 (13)C 4 H 25 (14)N 2 (15)N 1 O 2 S 1 + + + + DiffMono + 304.177202 + + + + Formula + (12)C 13 (13)C 4 H 32 (14)N 3 (15)N 1 O 4 S 2 + + + + MassAvg + 425.20 + + + + MassMono + 425.196952 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:01821 + PSI-MOD + + + MOD:01828 + cysTMT6plex-131 reporter+balance reagent cysteine disulfide + + A protein modification that effectively replaces a residue sulfhydryl hydrogen with a Thermo Scientific cysTMT6plex-131 reporter+balance group. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein sulfhydryl reactive pyridine disulfanyl group. The reporter group, an isotopically labeled 1,2,6-trimethylpiperidine, is connected to a 3-(carbonylamino)propanoyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + cysteine-reactive Sixplex Tandem Mass Tag(TM) + UniMod-description + + + cysTMT6plex + UniMod-interim + + + S-(2-{3-[2-(2,6-dimethylpiperidin-1-yl)acetamido]propanamido}ethyl)sulfanyl + PSI-MOD-alternate + + + + DiffAvg + 304.18 + + + + DiffFormula + (12)C 10 (13)C 4 H 25 (14)N 2 (15)N 1 O 2 S 1 + + + + DiffMono + 304.177202 + + + + Formula + (12)C 13 (13)C 4 H 32 (14)N 3 (15)N 1 O 4 S 2 + + + + MassAvg + 425.20 + + + + MassMono + 425.196952 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:01821 + PSI-MOD + + + MOD:01829 + S-carboxymethyl-L-cysteine sulfoxide + + A protein modification that effectively converts an L-cysteine residue to S-carboxymethyl-L-cysteine sulfoxide. + + 17689096 + PubMed + + + 18688235 + PubMed + + + + CmCO + PSI-MOD-alternate + + + + DiffAvg + 58.04 + + + + DiffFormula + C 2 H 2 N 0 O 2 S 0 + + + + DiffMono + 58.005479 + + + + Formula + C 5 H 7 N 1 O 3 S 1 + + + + MassAvg + 161.18 + + + + MassMono + 161.014664 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:00399 + MOD:00708 + MOD:01854 + + derives_from + MOD:010610 + + PSI-MOD + + + MOD:01830 + S-carboxymethyl-L-cysteine sulfone + + A protein modification that effectively converts an L-cysteine residue to S-carboxymethyl-L-cysteine sulfone. + + 18688235 + PubMed + + + + CmCO2 + PSI-MOD-label + + + + DiffAvg + 74.03 + + + + DiffFormula + C 2 H 2 N 0 O 3 S 0 + + + + DiffMono + 74.000394 + + + + Formula + C 5 H 7 N 1 O 4 S 1 + + + + MassAvg + 177.17 + + + + MassMono + 177.009579 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:00399 + MOD:00708 + MOD:01855 + + derives_from + MOD:010610 + + PSI-MOD + + + MOD:01831 + S-carboxamidomethyl-L-cysteine sulfone + + A protein modification that effectively converts an L-cysteine residue to S-carboxamidomethyl-L-cysteine sulfone. + + 18688235 + PubMed + + + + CamCO2 + PSI-MOD-label + + + S-carbamoylmethyl-L-cysteine sulfone + PSI-MOD-alternate + + + + DiffAvg + 89.05 + + + + DiffFormula + C 2 H 3 N 1 O 3 + + + + DiffMono + 89.011293 + + + + Formula + C 5 H 8 N 2 O 4 S 1 + + + + MassAvg + 192.19 + + + + MassMono + 192.020478 + + + + Origin + C + + + + Source + artifact + + + + TermSpec + none + + MOD:00397 + MOD:00708 + MOD:01855 + + derives_from + MOD:010600 + + PSI-MOD + + + MOD:01832 + 5x(13)C-labeled residue + + A protein modification that effectively converts a residue containing common isotopes to a 5x(13)C-labeled residue. + + 12771378 + PubMed + + + 772 + UniMod + + + + 13C(5) Silac label + UniMod-description + + + Label:13C(5) + PSI-MS-label + + + + DiffAvg + 5.02 + + + + DiffFormula + (12)C -5 (13)C 5 + + + + DiffMono + 5.016774 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00842 + PSI-MOD + + + MOD:01833 + 5x(13)C-labeled L-methionine + + A protein modification that effectively converts an L-methionine residue containing common isotopes to 5x(13)C-labeled L-methionine. + + 18688235 + PubMed + + + + + DiffAvg + 5.02 + + + + DiffFormula + (12)C -5 (13)C 5 H 0 N 0 O 0 S 0 + + + + DiffMono + 5.016774 + + + + Formula + (13)C 5 H 9 N 1 O 1 S 1 + + + + MassAvg + 136.06 + + + + MassMono + 136.057259 + + + + Origin + M + + + + Source + artifact + + + + TermSpec + none + + MOD:00913 + MOD:01832 + PSI-MOD + + + MOD:01834 + 5x(13)C-labeled L-methionine sulfoxide + + A protein modification that effectively converts an L-methionine residue containing common isotopes to 5x(13)C-labeled L-methionine sulfoxide. + + 18688235 + PubMed + + + + + DiffAvg + 21.01 + + + + DiffFormula + (12)C -5 (13)C 5 H 0 N 0 O 1 S 0 + + + + DiffMono + 21.011689 + + + + Formula + (13)C 5 H 9 N 1 O 2 S 1 + + + + MassAvg + 152.05 + + + + MassMono + 152.052174 + + + + Origin + M + + + + Source + artifact + + + + TermSpec + none + + MOD:00719 + MOD:01832 + PSI-MOD + + + MOD:01835 + 5x(13)C-labeled L-methionine sulfone + + A protein modification that effectively converts an L-methionine residue containing common isotopes to 5x(13)C-labeled L-methionine sulfone. + + 18688235 + PubMed + + + + + DiffAvg + 37.01 + + + + DiffFormula + (12)C -5 (13)C 5 H 0 N 0 O 2 S 0 + + + + DiffMono + 37.006603 + + + + Formula + (13)C 5 H 9 N 1 O 3 S 1 + + + + MassAvg + 168.05 + + + + MassMono + 168.047088 + + + + Origin + M + + + + Source + artifact + + + + TermSpec + none + + MOD:00256 + MOD:01832 + PSI-MOD + + + MOD:01836 + N6-[([1-(6-nitro-2H-1,3-benzodioxol-5-yl)ethoxy]carbonyl]lysine + + A protein modification that effectively converts an L-lysine residue to N6-[([1-(6-nitro-2H-1,3-benzodioxol-5-yl)ethoxy]carbonyl]lysine. + + 18688235 + PubMed + + + 20218600 + PubMed + + + 21271704 + PubMed + + + + (2S)-2-amino-6-[([1-(6-nitro-1,3-benzodioxol-5-yl)ethoxy]carbonyl)amino]hexanoic acid + PSI-MOD-alternate + + + [(alpha-methyl-6-nitro-piperonyloxy)carbonyl]lysine + PSI-MOD-alternate + + + + DiffAvg + 237.17 + + + + DiffFormula + C 10 H 7 N 1 O 6 + + + + DiffMono + 237.027337 + + + + Formula + C 16 H 19 N 3 O 7 + + + + MassAvg + 365.34 + + + + MassMono + 365.122300 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00848 + MOD:01875 + PSI-MOD + + + MOD:01837 + L-lanthionine (Cys-Cys) + + A protein modification that effectively cross-links two L-cysteine residues with a thioether bond to form L-lanthionine. + + 21347 + ChEBI + + + 20805503 + PubMed + + + 6007887 + PubMed + + + AA0110#CYS2 + RESID + + + Cross-link 2. + + (2R,2'R)-3,3'-sulfanediylbis(2-aminopropanoic acid) + RESID-systematic + + + (R)-S-(2-amino-2-carboxyethyl)-L-cysteine + RESID-alternate + + + (R,R)-2,6-diamino-4-thiaheptanedioic acid + RESID-alternate + + + (R,R)-3,3'-thiobis-(2-aminopropanoic acid) + RESID-alternate + + + (R,R)-bis(2-amino-2-carboxyethyl)sulfide + RESID-alternate + + + 2-amino-3-(2-amino-2-carboxyethyl)sulfanylpropanoic acid + RESID-alternate + + + 3,3'-thiobis-L-alanine + RESID-alternate + + + L-lanthionine + RESID-name + + + + DiffAvg + -34.08 + + + + DiffFormula + C 0 H -2 N 0 O 0 S -1 + + + + DiffMono + -33.987721 + + + + Formula + C 6 H 8 N 2 O 2 S 1 + + + + MassAvg + 172.20 + + + + MassMono + 172.030649 + + + + Origin + C, C + + + + Source + hypothetical + + + + TermSpec + none + + MOD:01839 + PSI-MOD + + + MOD:01838 + L-lysinoalanine (Lys) + + A protein modification that effectively converts an L-lysine residue to L-lysinoalanine. + + 19155267 + PubMed + + + 2544544 + PubMed + + + AA0123#LYS + RESID + + + This entry is for the modification of peptidyl lysine by a free serine. For the crosslink of peptidyl serine and peptidyl lysine see MOD:00132. + + (2R,9S)-lysinoalanine + RESID-alternate + + + (2S)-2-amino-6-([(2R)-2-amino-2-carboxyethyl]amino)hexanoic acid + RESID-systematic + + + alaninolysine + RESID-alternate + + + L-lysinoalanine + RESID-name + + + LAL + RESID-alternate + + + lysino-D-alanine + RESID-alternate + + + MOD_RES Lysino-D-alanine (Lys) + UniProt-feature + + + N-epsilon-(2-amino-2-carboxyethyl)-L-lysine + RESID-alternate + + + N6-(2-amino-2-carboxyethyl)-L-lysine + RESID-alternate + + + + DiffAvg + 87.08 + + + + DiffFormula + C 3 H 5 N 1 O 2 + + + + DiffMono + 87.032028 + + + + Formula + C 9 H 17 N 3 O 3 + + + + MassAvg + 215.25 + + + + MassMono + 215.126991 + + + + Origin + K + + + + Source + natural + + + + TermSpec + none + + MOD:01853 + PSI-MOD + + + MOD:01839 + L-lanthionine + + A protein modification that effectively cross-links either two L-cysteine residues, or an L-cysteine residue and an L-serine residue by a thioether bond to form L-lanthionine. + + 18688235 + PubMed + + + Cross-link 2. For the natural form of the lanthionine cross-link see MOD:00120 meso-lanthionine [JSG]. + + + DiffAvg + -18.02 + + + + DiffFormula + C 0 H -2 N 0 O -1 S 0 + + + + DiffMono + -18.010565 + + + + Formula + C 6 H 8 N 2 O 2 S 1 + + + + MassAvg + 172.20 + + + + MassMono + 172.030649 + + + + Origin + C, X + + + + Source + artifact + + + + TermSpec + none + + MOD:00859 + MOD:01841 + PSI-MOD + + + MOD:01840 + L-allo-isoleucine + + A protein modification that effectively converts an L-isoleucine residue to L-allo-isoleucine. + + 43433 + ChEBI + + + 20805503 + PubMed + + + AA0546 + RESID + + + + (2S,3R)-2-amino-3-methylpentanoic acid + RESID-systematic + + + 2-azanyl-3-methylpentanoic acid + RESID-alternate + + + 3-methyl-norvaline + RESID-alternate + + + allo-L-isoleucine + RESID-alternate + + + alpha-amino-beta-methylvaleric acid + RESID-alternate + + + L-allo-isoleucine + RESID-name + + + L-threo-isoleucine + RESID-alternate + + + MOD_RES L-allo-isoleucine + UniProt-feature + + + + DiffAvg + 0.00 + + + + DiffFormula + C 0 H 0 N 0 O 0 + + + + DiffMono + 0.000000 + + + + Formula + C 6 H 11 N 1 O 1 + + + + MassAvg + 113.16 + + + + MassMono + 113.084064 + + + + Origin + I + + + + Source + natural + + + + TermSpec + none + + MOD:00664 + MOD:00910 + PSI-MOD + + + MOD:01841 + lanthionine + + A protein modification that effectively cross-links either two or an L-cysteine residue and an L-serine residue by a thioether bond to form a lanthionine, either D- or L- or meso-lanthionine. + + 18688235 + PubMed + + + Cross-link 2. [JSG]. + + 2,6-diamino-4-thiaheptanedioic acid + PSI-MOD-alternate + + + 2-amino-3-(2-amino-2-carboxyethyl)sulfanylpropanoic acid + PSI-MOD-alternate + + + 3,3'-thiobis-(2-aminopropanoic acid) + PSI-MOD-alternate + + + 3,3'-thiobis-L-alanine + PSI-MOD-alternate + + + bis(2-amino-2-carboxyethyl)sulfanediyl + PSI-MOD-alternate + + + bis(2-amino-2-carboxyethyl)sulfide + PSI-MOD-alternate + + + S-(2-amino-2-carboxyethyl)-L-cysteine + PSI-MOD-alternate + + + + DiffAvg + -18.02 + + + + DiffFormula + C 0 H -2 N 0 O -1 S 0 + + + + DiffMono + -18.010565 + + + + Formula + C 6 H 8 N 2 O 2 S 1 + + + + MassAvg + 172.20 + + + + MassMono + 172.030649 + + + + Origin + C, X + + + + Source + artifact + + + + TermSpec + none + + MOD:01993 + PSI-MOD + + + MOD:01842 + S-(2-aminovinyl)-L-cysteine + + A protein modification that effectively converts two L-cysteine residues to S-(2-aminovinyl)-L-cysteine. + + 20805503 + PubMed + + + AA0548 + RESID + + + Cross-link 2. + + (2R)-2-amino-3-([(Z)-2-aminoethenyl]sulfanyl)propanoic acid + RESID-systematic + + + (R,Z)-S-(2-aminovinyl)cysteine + RESID-alternate + + + S-(2-aminovinyl)-L-cysteine + RESID-name + + + + DiffAvg + -80.10 + + + + DiffFormula + C -1 H -4 N 0 O -2 S -1 + + + + DiffMono + -79.993200 + + + + Formula + C 5 H 7 N 2 O 1 S 1 + + + + MassAvg + 143.18 + + + + MassMono + 143.027909 + + + + Origin + C, C + + + + Source + natural + + + + TermSpec + C-term + + MOD:01851 + PSI-MOD + + + MOD:01843 + 5'-chloro-L-tryptophan + + A protein modification that effectively converts an L-tryptophan residue to 5'-chloro-L-tryptophan. + + 18215770 + PubMed + + + AA0549 + RESID + + + + (2S)-2-amino-3-(5-chloro-1H-indol-3-yl)propanoic acid + RESID-systematic + + + 5'-chloro-L-tryptophan + RESID-name + + + MOD_RES 5'-chlorotryptophan + UniProt-feature + + + + DiffAvg + 34.44 + + + + DiffFormula + C 0 Cl 1 H -1 N 0 O 0 + + + + DiffMono + 33.961028 + + + + Formula + C 11 Cl 1 H 9 N 2 O 1 + + + + MassAvg + 220.66 + + + + MassMono + 220.040341 + + + + Origin + W + + + + Source + natural + + + + TermSpec + none + + MOD:01913 + PSI-MOD + + + MOD:01844 + 2-(3-methylbutanoyl)-5-hydroxyoxazole-4-carbothionic acid + + A protein modification that effectively converts an L-cysteine residue and an L-leucine residue to 2-(3-methylbutanoyl)-5-hydroxyoxazole-4-carbothionic acid. + + 15361623 + PubMed + + + 18729522 + PubMed + + + 20961038 + PubMed + + + 21254756 + PubMed + + + AA0550 + RESID + + + Cross-link 2. + + (4Z)-4-[hydroxy(sulfanyl)methylidene]-2-(3-methylbutanoyl)-1,3-oxazol-5(4H)-one [tautomer] + RESID-alternate + + + 2-(3-methylbutanoyl)-5-hydroxyoxazole-4-carbothionic acid + RESID-name + + + 5-hydroxy-2-(3-methylbutanoyl)-1,3-oxazole-4-carbothioic O-acid + RESID-systematic + + + MOD_RES 2-(3-methylbutanoyl)-5-hydroxyoxazole-4-carbothionic acid (Leu-Cys) + UniProt-feature + + + + DiffAvg + -5.06 + + + + DiffFormula + C 0 H -7 N -1 O 1 S 0 + + + + DiffMono + -5.062935 + + + + Formula + C 9 H 10 N 1 O 3 S 1 + + + + MassAvg + 212.24 + + + + MassMono + 212.038139 + + + + Origin + C, L + + + + Source + natural + + + + TermSpec + N-term + + MOD:00905 + MOD:00911 + MOD:01856 + PSI-MOD + + + MOD:01845 + L-proline 5-hydroxyoxazole-4-carbothionic acid + + A protein modification that effectively converts an L-cysteine residue and an L-proline residue to L-proline 5-hydroxyoxazole-4-carbothionic acid. + + 15361623 + PubMed + + + 18729522 + PubMed + + + 20961038 + PubMed + + + 21254756 + PubMed + + + AA0551 + RESID + + + Cross-link 2. + + (4Z)-4-[hydroxy(sulfanyl)methylidene]-2-[(2S)-pyrrolidin-2-yl]-1,3-oxazol-5(4H)-one [tautomer] + RESID-alternate + + + 5-hydroxy-2-[(2S)-pyrrolidin-2-yl]-1,3-oxazole-4-carbothioic O-acid + RESID-systematic + + + CROSSLNK Proline 5-hydroxy-oxazole-4-carbothionic acid (Pro-Cys) + UniProt-feature + + + L-proline 5-hydroxy-oxazole-4-carbothionic acid + RESID-name + + + + DiffAvg + -4.03 + + + + DiffFormula + C 0 H -4 N 0 O 0 S 0 + + + + DiffMono + -4.031300 + + + + Formula + C 8 H 8 N 2 O 2 S 1 + + + + MassAvg + 196.22 + + + + MassMono + 196.030649 + + + + Origin + C, P + + + + Source + natural + + + + TermSpec + none + + MOD:00905 + MOD:00915 + MOD:01856 + PSI-MOD + + + MOD:01846 + methanobactin OB3b copper complex + + A protein modification that effectively converts two L-cysteine residues, and a copper atom to the methanobactin OB3b copper complex. + + 15361623 + PubMed + + + 18729522 + PubMed + + + 20961038 + PubMed + + + 21254756 + PubMed + + + AA0552 + RESID + + + Cross-link 2. + + bis[4-(hydroxy[sulfanyl-kappaS]methylidene)-1,3-oxazol-5(4H)-onato-kappaN]copper + RESID-systematic + + + METAL copper [Cu-methanobactin OB3b complex] + UniProt-feature + + + methanobactin OB3b copper complex + RESID-name + + + + DiffAvg + 85.46 + + + + DiffFormula + C 0 Cu 1 H -10 N 0 O 2 S 0 + + + + DiffMono + 84.841176 + + + + Formula + C 6 Cu 1 H 0 N 2 O 4 S 2 + + + + MassAvg + 291.74 + + + + MassMono + 290.859546 + + + + Origin + C, C + + + + Source + natural + + + + TermSpec + N-term + + MOD:00742 + MOD:00905 + PSI-MOD + + + MOD:01847 + L-cysteine sulfinyl phosphate + + A protein modification that effectively converts an L-cysteine residue to L-cysteine sulfinyl phosphate. + + 16565085 + PubMed + + + AA0557 + RESID + + + + (2R)-2-amino-3-[(phosphonooxy)sulfinyl]propanoic acid + RESID-systematic + + + cysteine sulfinic phosphoryl ester + RESID-alternate + + + L-cysteine sulfinyl phosphate + RESID-name + + + + DiffAvg + 111.98 + + + + DiffFormula + C 0 H 1 N 0 O 5 P 1 S 0 + + + + DiffMono + 111.956160 + + + + Formula + C 3 H 6 N 1 O 6 P 1 S 1 + + + + MassAvg + 215.12 + + + + MassMono + 214.965345 + + + + Origin + C + + + + Source + hypothetical + + + + TermSpec + none + + MOD:00708 + MOD:00861 + PSI-MOD + + + MOD:01848 + S-(spermidinoglutathion-S-yl)-L-cysteine + + A protein modification that effectively converts an L-cysteine residue to S-(spermidinoglutathion-S-yl)-L-cysteine. + + 16613 + ChEBI + + + 20530482 + PubMed + + + AA0558 + RESID + + + + (2R)-2-amino-3-([(2R)-2-([(4S)-4-amino-4-carboxybutanoyl]amino)-2-([2-([3-([4-aminobutyl]amino)propyl]carbamoyl)methyl]carbamoyl)ethyl]disulfanyl)propanoic acid + RESID-systematic + + + cysteine glutathionylspermidine disulfide + RESID-alternate + + + L-gamma-glutamyl-[S-(L-cystein-S-yl)]-L-cysteinyl-N-{3-[(4-aminobutyl)amino]propyl}glycinamide + RESID-alternate + + + S-(spermidinoglutathion-S-yl)-L-cysteine + RESID-name + + + + DiffAvg + 432.54 + + + + DiffFormula + C 17 H 32 N 6 O 5 S 1 + + + + DiffMono + 432.215489 + + + + Formula + C 20 H 37 N 7 O 6 S 2 + + + + MassAvg + 535.68 + + + + MassMono + 535.224674 + + + + Origin + C + + + + Source + natural + + + + TermSpec + none + + MOD:00905 + MOD:01862 + PSI-MOD + + + MOD:01849 + S-(2-aminovinyl)-D-cysteine (Cys-Cys) + + A protein modification that effectively cross-links two L-cysteine residues by a thioether bond to form S-(2-aminovinyl)-D-cysteine. + + 20805503 + PubMed + + + AA0204#CYS2 + RESID + + + Cross-link 2. + + (2S)-2-amino-3-([(Z)-2-aminoethenyl]sulfanyl)propanoic acid + RESID-systematic + + + (S,Z)-S-(2-aminovinyl)cysteine + RESID-alternate + + + CROSSLNK S-(2-aminovinyl)-D-cysteine (Cys-Cys) + UniProt-feature + + + S-(2-aminovinyl)-D-cysteine + RESID-name + + + + DiffAvg + -80.10 + + + + DiffFormula + C -1 H -4 N 0 O -2 S -1 + + + + DiffMono + -79.993200 + + + + Formula + C 5 H 7 N 2 O 1 S 1 + + + + MassAvg + 143.18 + + + + MassMono + 143.027909 + + + + Origin + C, C + + + + Source + natural + + + + TermSpec + C-term + + MOD:01850 + PSI-MOD + + + MOD:01850 + S-(2-aminovinyl)-D-cysteine + + A protein modification that effectively cross-links either two L-cysteine residues, or an L-cysteine residue and an L-serine residue by a thioether bond to form S-(2-aminovinyl)-D-cysteine. + + AA0204 + RESID + + + Cross-link 2. + + (2S)-2-amino-3-([(Z)-2-aminoethenyl]sulfanyl)propanoic acid + RESID-systematic + + + (S,Z)-S-(2-aminovinyl)cysteine + RESID-alternate + + + S-(2-aminovinyl)-D-cysteine + RESID-name + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + C 5 H 7 N 2 O 1 S 1 + + + + MassAvg + 143.18 + + + + MassMono + 143.027909 + + + + Origin + C, X + + + + Source + natural + + + + TermSpec + C-term + + MOD:01851 + PSI-MOD + + + MOD:01851 + S-(2-aminovinyl)-cysteine + + A protein modification that effectively cross-links either two L-cysteine residues, or an L-cysteine residue and an L-serine residue by a thioether bond to form S-(2-aminovinyl)-cysteine. + + 18688235 + PubMed + + + Cross-link 2. + + 2-amino-3-([2-aminoethenyl]sulfanyl)propanoic acid + PSI-MOD-alternate + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + C 5 H 7 N 2 O 1 S 1 + + + + MassAvg + 143.18 + + + + MassMono + 143.027909 + + + + Origin + C, X + + + + Source + natural + + + + TermSpec + C-term + + MOD:00687 + MOD:00859 + PSI-MOD + + + MOD:01852 + L-lysinoalanine (Lys-Cys) + + A protein modification that effectively crosslinks an L-cysteine residue and an L-lysine residue to release hydrogen sulfide and form 2-amino-6-(2-amino-2-carboxyethylamino)hexanoic acid. + + 0 + DeltaMass + + + Cross-link 2. This entry is for a crosslink of peptidyl cysteine and peptidyl lysine. For the modification of peptidyl lysine by a free serine see MOD:01838. From DeltaMass: Average Mass: -34 with no citation or formula. [JSG] + + Lysinoalanine (from Cysteine) + DeltaMass-label + + + + DiffAvg + -34.08 + + + + DiffFormula + C 0 H -2 N 0 O 0 S -1 + + + + DiffMono + -33.987721 + + + + Formula + C 9 H 15 N 3 O 2 + + + + MassAvg + 197.24 + + + + MassMono + 197.116427 + + + + Origin + C, K + + + + Source + hypothetical + + + + TermSpec + none + + MOD:00692 + MOD:00905 + MOD:01853 + PSI-MOD + + + MOD:01853 + L-lysinoalanine + + A protein modification that effectively converts an L-lysine residue to L-lysinoalanine either by forming a cross-link with peptidyl-cysteine or peptidyl-serine, or by condensation with free serine. + + 18688235 + PubMed + + + + + Origin + K + + + + Source + natural + + + + TermSpec + none + + MOD:00859 + MOD:00912 + PSI-MOD + + + MOD:01854 + sulfur monooxygenated residue + + A protein modification that effectively adds one oxygen atom to a sulfur atom of a residue without removing hydrogen atoms. + + 18688235 + PubMed + + + PSI-MOD-slim + MOD:00680 + PSI-MOD + + + MOD:01855 + sulfur dioxygenated residue + + A protein modification that effectively adds two oxygen atoms to a sulfur atom of a residue without removing hydrogen atoms. + + 18688235 + PubMed + + + PSI-MOD-slim + MOD:00680 + PSI-MOD + + + MOD:01856 + oxazole/oxazoline ring crosslinked residues (Cys) + + A protein modification that crosslinks two residues by rearrangement and condensation of a cysteine with the carbonyl of the preceding residue to form a 1,3-oxazole-4-carbothionic acid. + + 18688235 + PubMed + + + MOD:01419 + PSI-MOD + + + MOD:01857 + 2-(L-cystein-S-yl)-methionine + + A protein modification that effectively cross-links an L-cysteine residue and an L-methionine residue by a thioether bond to form 2-(L-cystein-S-yl)-methionine. + + 20805502 + PubMed + + + AA0559 + RESID + + + Cross-link 2. The chirality around the methionine alpha-carbon has not been determined. + + (2R)-2-amino-2-([2-amino-2-carboxyethyl]sulfanyl)-4-(methylsulfanyl)butanoic acid + RESID-systematic + + + 2-(L-cystein-S-yl)-methionine + RESID-name + + + CROSSLNK 2-(S-cysteinyl)-methionine (Cys-Met) + UniProt-feature + + + + DiffAvg + -2.02 + + + + DiffFormula + C 0 H -2 N 0 O 0 S 0 + + + + DiffMono + -2.015650 + + + + Formula + C 8 H 12 N 2 O 2 S 2 + + + + MassAvg + 232.32 + + + + MassMono + 232.034020 + + + + Origin + C, M + + + + Source + natural + + + + TermSpec + none + + MOD:00905 + MOD:00913 + MOD:01992 + PSI-MOD + + + MOD:01858 + S-(N-acetylamino)glucosyl-L-cysteine + + A protein modification that effectively converts an L-cysteine residue to S-(N-acetylamino)glucosyl-L-cysteine. + + 61631 + ChEBI + + + 21251913 + PubMed + + + 21395300 + PubMed + + + AA0560 + RESID + + + + (2R)-2-amino-3-(2-acetamido-2-deoxy-beta-D-glucopyranosylsulfanyl)propanoic acid + RESID-systematic + + + CARBOHYD S-linked (GlcNAc) + UniProt-feature + + + S-(N-acetylamino)glucosyl-L-cysteine + RESID-name + + + S-[(N-acetylamino)glycosyl]cysteine + RESID-alternate + + + S-[beta-D-(N-acetylamino)glucopyranosyl]cysteine + RESID-alternate + + + + DiffAvg + 203.19 + + + + DiffFormula + C 8 H 13 N 1 O 5 S 0 + + + + DiffMono + 203.079373 + + + + Formula + C 11 H 18 N 2 O 6 S 1 + + + + MassAvg + 306.33 + + + + MassMono + 306.088557 + + + + Origin + C + + + + Source + natural + + + + TermSpec + none + + MOD:00426 + MOD:00448 + MOD:00905 + PSI-MOD + + + MOD:01859 + 4-amino-3-isothiazolidinone-L-phenylalanine + + A protein modification that effectively crosslinks an L-cysteine residue and an L-phenylalanine residue to form 4-amino-3-isothiazolidinone-L-phenylalanine. + + 17502599 + PubMed + + + AA0562 + RESID + + + Cross-link 2. + + (2S)-2-[(4R)-4-amino-3-oxo-1,2-thiazolidin-2-yl]-3-phenylpropanoic acid + RESID-systematic + + + 2-(4-amino-3-oxo-isothiazolidin-2-yl)-3-phenylpropanoic acid + RESID-alternate + + + 4-amino-3-isothiazolidinone-L-phenylalanine + RESID-alternate + + + CROSSLNK N,N-(cysteine-1,S-diyl)phenylalanine (Cys-Phe) + UniProt-feature + + + cysteinyl phenylalanine sulfenamide + RESID-alternate + + + N,N-(L-cysteine-1,S-diyl)-L-phenylalanine + RESID-name + + + phenylalanine-cysteine sulfenyl amide cross-link + RESID-alternate + + + phenylalanine-cysteine sulphenyl amide cross-link + RESID-alternate + + + + DiffAvg + -2.02 + + + + DiffFormula + C 0 H -2 N 0 O 0 S 0 + + + + DiffMono + -2.015650 + + + + Formula + C 12 H 12 N 2 O 2 S 1 + + + + MassAvg + 248.30 + + + + MassMono + 248.061949 + + + + Origin + C, F + + + + Source + hypothetical + + + + TermSpec + none + + MOD:00905 + MOD:00914 + MOD:01861 + PSI-MOD + + + MOD:01860 + L-cysteine bacillithiol disulfide + + A protein modification that effectively converts an L-cysteine residue to L-cysteine bacillithiol disulfide. + + 61338 + ChEBI + + + 19578333 + PubMed + + + AA0563 + RESID + + + + (2S)-(2-[S-(L-cystein-S-yl)-L-cysteinyl]amino-2-deoxy-alpha-D-glucopyranosyloxy)-butanedioic acid + RESID-systematic + + + BSH + RESID-alternate + + + L-cysteine bacillithiol disulfide + RESID-name + + + MOD_RES S-bacillithiol cysteine disulfide + UniProt-feature + + + + DiffAvg + 396.37 + + + + DiffFormula + C 13 H 20 N 2 O 10 S 1 + + + + DiffMono + 396.083866 + + + + Formula + C 16 H 25 N 3 O 11 S 2 + + + + MassAvg + 499.51 + + + + MassMono + 499.093051 + + + + Origin + C + + + + Source + natural + + + + TermSpec + none + + MOD:00905 + MOD:01862 + PSI-MOD + + + MOD:01861 + isothiazolidinone ring crosslinked residues + + A protein modification that crosslinks two residues by condensation of a cysteine thiol with the amido nitrogen of the following residue to form an isothiazolidinone ring. + + 18688235 + PubMed + + + The isothiazolidinone ring is usually formed by the reaction of a cysteine sulfenic acid with the amido nitrogen releasing water. + MOD:00033 + PSI-MOD + + + MOD:01862 + disulfide conjugated residue + + A protein modification that effectively replaces the hydrogen atom of a cysteine sulfanyl group with a substituted sulfanyl group, forming a disulfide bond that does not cross-link two encoded peptide chains. + + 18688235 + PubMed + + + PSI-MOD-slim + + S-thiolation + PSI-MOD-alternate + + + + Origin + C + + + + TermSpec + none + + MOD:01886 + PSI-MOD + + + MOD:01863 + mTRAQ reporter+balance reagent acylated residue + + A protein modification that effectively replaces a hydrogen atom of a residue with one of the Applied Biosystems mTRAQ reagent reporter+balance groups. + + 18688235 + PubMed + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a carbonyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + Applied Biosystems mTRAQ(TM) reagent + UniMod-alternate + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:01426 + MOD:01705 + PSI-MOD + + + MOD:01864 + mTRAQ light reporter+balance reagent acylated residue + + A protein modification that effectively replaces a hydrogen atom of a residue with the Applied Biosystems mTRAQ light reporter+balance group. + + 888 + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a carbonyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + Applied Biosystems mTRAQ(TM) reagent + UniMod-alternate + + + mTRAQ heavy + UniMod-description + + + + DiffAvg + 140.09 + + + + DiffFormula + (12)C 7 H 12 (14)N 2 (16)O 1 + + + + DiffMono + 140.094963 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:01863 + MOD:01868 + PSI-MOD + + + MOD:01865 + mTRAQ light reporter+balance reagent acylated N-terminal + + A protein modification that effectively replaces a hydrogen atom of a protein N-terminal with the Applied Biosystems mTRAQ light reporter+balance group. + + 888#N-term + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a carbonyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + Applied Biosystems mTRAQ(TM) reagent + UniMod-alternate + + + mTRAQ light + UniMod-description + + + mTRAQ light on nterm + OMSSA-label + + + + DiffAvg + 140.09 + + + + DiffFormula + (12)C 7 H 12 (14)N 2 (16)O 1 + + + + DiffMono + 140.094963 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + N-term + + MOD:01864 + PSI-MOD + + + MOD:01866 + mTRAQ light reporter+balance reagent N6-acylated lysine + + A protein modification that effectively replaces the N6-amino hydrogen atom of a lysine residue with the Applied Biosystems mTRAQ light reporter+balance group. + + 888#K + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a carbonyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + PSI-MOD-slim + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + Applied Biosystems mTRAQ(TM) reagent + UniMod-alternate + + + mTRAQ light + UniMod-description + + + mTRAQ light on K + OMSSA-label + + + + DiffAvg + 140.09 + + + + DiffFormula + (12)C 7 H 12 (14)N 2 (16)O 1 + + + + DiffMono + 140.094963 + + + + Formula + (12)C 13 H 24 N 2 (14)N 2 O 1 (16)O 1 + + + + MassAvg + 268.19 + + + + MassMono + 268.189926 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:01864 + MOD:01875 + PSI-MOD + + + MOD:01867 + mTRAQ light reporter+balance reagent O4'-acylated tyrosine + + A protein modification that effectively replaces the O4'-hydrogen atom of a tyrosine residue with the Applied Biosystems mTRAQ light reporter+balance group. + + 888#Y + UniMod + + + The reagent consists of a reporter group, a balance group and a protein reactive N-oxysuccinimide group. The reporter group, an isotopically labeled 1,4-dimethylpiperazine, is connected to a carbonyl balance group that is isotopically labeled to produce a nominally isobaric combined modification. + + (4-methylpiperazin-1-yl)acetyl + PSI-MOD-alternate + + + Applied Biosystems mTRAQ(TM) reagent + UniMod-alternate + + + mTRAQ light + UniMod-description + + + mTRAQ light on Y + OMSSA-label + + + + DiffAvg + 140.09 + + + + DiffFormula + (12)C 7 H 12 (14)N 2 (16)O 1 + + + + DiffMono + 140.094963 + + + + Formula + (12)C 16 H 21 (14)N 3 O 2 (16)O 1 + + + + MassAvg + 303.16 + + + + MassMono + 303.158292 + + + + Origin + Y + + + + Source + artifact + + + + TermSpec + none + + MOD:00919 + MOD:01864 + PSI-MOD + + + MOD:01868 + modifications with monoisotopic mass differences that are nominally equal at 140.094963 Da + + Modifications that have monoisotopic mass differences from their respective origins of 140.094963 Da. + + 18688235 + PubMed + + + PSI-MOD-slim + MOD:01515 + PSI-MOD + + + MOD:01869 + mTRAQ light reporter fragment + + The protein modification reporter fragment produced by an Applied Biosystems mTRAQ light reagent derivatized residue. + + 18688235 + PubMed + + + PSI-MOD-slim + + 4-methyl-1-methylidenepiperazin-1-ium + PSI-MOD-alternate + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + FormalCharge + 1+ + + + + Formula + (12)C 6 H 13 (14)N 2 + + + + MassAvg + 113.11 + + + + MassMono + 113.107325 + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:01870 + + derives_from + MOD:018640 + + PSI-MOD + + + MOD:01870 + mTRAQ reporter fragment + + A protein modification reporter fragment produced by an Applied Biosystems mTRAQ reagent derivatized residue. + + 18688235 + PubMed + + + PSI-MOD-slim + MOD:01520 + PSI-MOD + + + MOD:01871 + cyclized N-terminal S-carboxamidomethyl-L-cysteine + + A protein modification that effectively cyclizes an S-carboxamidomethyl-L-cysteine residue to (R)-5-oxo-1,4-tetrahydrothiazine-3-carboxylic acid with the loss of ammonia. + + 336 + DeltaMass + + + 12643538 + PubMed + + + 26 + UniMod + + + PSI-MOD-slim + + (R)-5-oxoperhydro-1,4-thiazine-3-carboxylic acid + DeltaMass-label + + + 5-oxothiomorpholine-3-carboxylic acid + PSI-MOD-alternate + + + Otc + DeltaMass-label + + + Pyro-carbamidomethyl + UniMod-interim + + + S-carbamoylmethylcysteine cyclization (N-terminus) + UniMod-description + + + + DiffAvg + -17.03 + + + + DiffFormula + C 0 H -3 N -1 O 0 S 0 + + + + DiffMono + -17.026549 + + + + Formula + C 5 H 6 N 1 O 2 S 1 + + + + MassAvg + 144.17 + + + + MassMono + 144.011924 + + + + Origin + MOD:01060 + + + + Source + artifact + + + + TermSpec + N-term + + MOD:00397 + MOD:00419 + + derives_from + MOD:010600 + + PSI-MOD + + + MOD:01872 + cyclized N-terminal S-carboxymethyl-L-cysteine + + A protein modification that effectively cyclizes an S-carboxymethyl-L-cysteine residue to (R)-5-oxo-1,4-tetrahydrothiazine-3-carboxylic acid with the loss of water. + + 12643538 + PubMed + + + 26 + UniMod + + + Contrary to the impression given in UniMod entry 26, the cyclization of N-terminal S-carboxymethyl-L-cysteine is not reported in PubMed:1263538. The cyclization would be expected to proceed under strongly acidic conditions [JSG]. + PSI-MOD-slim + + (R)-5-oxoperhydro-1,4-thiazine-3-carboxylic acid + DeltaMass-label + + + 5-oxothiomorpholine-3-carboxylic acid + PSI-MOD-alternate + + + Otc + DeltaMass-label + + + Pyro-carbamidomethyl + UniMod-interim + + + S-carbamoylmethylcysteine cyclization (N-terminus) + UniMod-description + + + + DiffAvg + -18.02 + + + + DiffFormula + C 0 H -2 N 0 O -1 S 0 + + + + DiffMono + -18.010565 + + + + Formula + C 5 H 6 N 1 O 2 S 1 + + + + MassAvg + 144.17 + + + + MassMono + 144.011924 + + + + Origin + MOD:01061 + + + + Source + artifact + + + + TermSpec + N-term + + MOD:00399 + MOD:00419 + + derives_from + MOD:010610 + + PSI-MOD + + + MOD:01873 + N-carboxy-L-alanine + + A protein modification that effectively converts an L-alanine residue to N-carboxy-L-alanine. + + 18688235 + PubMed + + + 4593770 + PubMed + + + 4647257 + PubMed + + + 8312270 + PubMed + + + This metastable modification can be formed by a protein N-terminal in solutions with a high concentration of dissolved carbon dioxide [JSG]. + + (S)-2-carboxyamino-propanoic acid + PSI-MOD-alternate + + + 2-carbamic-propanoic acid + PSI-MOD-alternate + + + N-carboxymethionine + PSI-MOD-alternate + + + + DiffAvg + 44.01 + + + + DiffFormula + C 1 H 0 N 0 O 2 + + + + DiffMono + 43.989829 + + + + Formula + C 4 H 6 N 1 O 3 + + + + MassAvg + 116.10 + + + + MassMono + 116.034768 + + + + Origin + A + + + + Source + natural + + + + TermSpec + N-term + + MOD:00901 + MOD:01152 + PSI-MOD + + + MOD:01874 + N-carboxy-L-valine + + A protein modification that effectively converts an L-alanine residue to N-carboxy-L-valine. + + 18688235 + PubMed + + + 4593770 + PubMed + + + 4647257 + PubMed + + + 8312270 + PubMed + + + This metastable modification can be formed by a protein N-terminal in solutions with a high concentration of dissolved carbon dioxide [JSG]. + + (S)-2-carboxyamino-propanoic acid + PSI-MOD-alternate + + + 2-carbamic-propanoic acid + PSI-MOD-alternate + + + N-carboxymethionine + PSI-MOD-alternate + + + + DiffAvg + 44.01 + + + + DiffFormula + C 1 H 0 N 0 O 2 + + + + DiffMono + 43.989829 + + + + Formula + C 6 H 10 N 1 O 3 + + + + MassAvg + 144.15 + + + + MassMono + 144.066068 + + + + Origin + V + + + + Source + natural + + + + TermSpec + N-term + + MOD:00920 + MOD:01152 + PSI-MOD + + + MOD:01875 + N6-acylated L-lysine + + A protein modification that effectively replaces an N6-amino hydrogen atom of L-lysine with an acyl group. + + 18688235 + PubMed + + + PSI-MOD-slim + + N6AcylLys + PSI-MOD-label + + + + Origin + K + + + + Source + natural + + + + TermSpec + none + + MOD:00670 + MOD:00912 + PSI-MOD + + + MOD:01876 + 4x(1)H,4x(12)C-labeled alpha-amino succinylated residue + + A protein modification that effectively replaces a residue alpha-amino- or alpha-imino-hydrogen with a 4x(12)C labeled succinyl group. + + 11857757 + PubMed + + + 12175151 + PubMed + + + 12716131 + PubMed + + + 64 + UniMod + + + + Succinic anhydride labeling reagent, light form (+4amu, 4H2) site N-term + UniMod-description + + + Succinyl + PSI-MS-label + + + + DiffAvg + 100.02 + + + + DiffFormula + (12)C 4 (1)H 4 O 3 + + + + DiffMono + 100.016044 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + N-term + + MOD:00457 + MOD:01426 + PSI-MOD + + + MOD:01877 + 2-(4-guanidinobutanoyl)-5-hydroxyimidazole-4-carbothionic acid + + A protein modification that effectively converts an L-cysteine residue and an L-arginine residue to 2-(4-guanidinobutanoyl)-5-hydroxyimidazole-4-carbothionic acid. + + 20961038 + PubMed + + + AA0553 + RESID + + + Cross-link 2. + + (4Z)-2-(4-guanidinobutanoyl)-5-oxo-4-(sulfanylmethylidene)-4,5-dihydro-1H-imidazole + RESID-alternate + + + 2-(4-guanidinobutanoyl)-5-hydroxy-1H-imidazole-4-carbothioic O-acid + RESID-systematic + + + 2-(4-guanidinobutanoyl)-5-hydroxy-4-thioformyl-1H-imidazole [tautomer] + RESID-alternate + + + 2-(4-guanidinobutanoyl)-5-hydroxyimidazole-4-carbothionic acid + RESID-name + + + CROSSLNK 2-(4-guanidinobutanoyl)-5-hydroxyimidazole-4-carbothionic acid (Arg-Cys) + UniProt-feature + + + + DiffAvg + -6.05 + + + + DiffFormula + C 0 H -6 N 0 O 0 S 0 + + + + DiffMono + -6.046950 + + + + Formula + C 9 H 12 N 5 O 2 S 1 + + + + MassAvg + 254.29 + + + + MassMono + 254.071171 + + + + Origin + C, R + + + + Source + natural + + + + TermSpec + N-term + + MOD:00902 + MOD:00905 + MOD:01883 + PSI-MOD + + + MOD:01878 + L-threonine 5-hydroxyoxazole-4-carbonthionic acid + + A protein modification that effectively converts an L-cysteine residue and an L-threonine residue to L-threonine 5-hydroxyoxazole-4-carbothionic acid. + + 20961038 + PubMed + + + AA0554 + RESID + + + Cross-link 2. + + (4Z)-2-[(1S,2R)-1-amino-2-hydroxypropyl]-4-(sulfanylmethylidene)-1,3-oxazol-5(4H)-one [tautomer] + RESID-alternate + + + 2-[(1S,2R)-1-amino-2-hydroxypropyl]-5-hydroxy-1,3-oxazole-4-carbothioic O-acid + RESID-systematic + + + CROSSLNK Threonine 5-hydroxy-oxazole-4-carbonthionic acid (Thr-Cys) + UniProt-feature + + + L-threonine 5-hydroxy-oxazole-4-carbonthionic acid + RESID-name + + + + DiffAvg + -4.03 + + + + DiffFormula + C 0 H -4 N 0 O 0 S 0 + + + + DiffMono + -4.031300 + + + + Formula + C 7 H 8 N 2 O 3 S 1 + + + + MassAvg + 200.21 + + + + MassMono + 200.025563 + + + + Origin + C, T + + + + Source + natural + + + + TermSpec + none + + MOD:00905 + MOD:00917 + MOD:01856 + PSI-MOD + + + MOD:01879 + methanobactin SB2 copper complex + + A protein modification that effectively converts two L-cysteine residues, an L-arginine residue, an L-threonine residue and a copper atom to the methanobactin SB2 copper complex. + + 20961038 + PubMed + + + AA0555 + RESID + + + Cross-link 2. + + [5-(hydroxy[sulfanyl-kappaS]methylene)-3,5-dihydro-4H-imidazol-4-onato-kappaN1][4-(hydroxy[sulfanyl-kappaS]methylene)-1,3-oxazol-5(4H)-onato-kappaN]copper + RESID-systematic + + + METAL copper [Cu-methanobactin SB2 complex] + UniProt-feature + + + methanobactin SB2 copper complex + RESID-name + + + + DiffAvg + 84.48 + + + + DiffFormula + C 0 Cu 1 H -9 N 1 O 1 S 0 + + + + DiffMono + 83.857161 + + + + Formula + C 6 Cu 1 H 1 N 3 O 3 S 2 + + + + MassAvg + 290.76 + + + + MassMono + 289.875530 + + + + Origin + C, C, R, T + + + + Source + natural + + + + TermSpec + N-term + + MOD:00742 + MOD:00905 + PSI-MOD + + + MOD:01880 + L-deoxyhypusine + + modification from RESID + + 50038 + ChEBI + + + 16452303 + PubMed + + + AA0564 + RESID + + + + (2S)-2-amino-6-[(4-aminobutyl)amino]hexanoic acid + RESID-systematic + + + deoxyhypusine + RESID-alternate + + + L-deoxyhypusine + RESID-name + + + N6-(4-aminobutyl)lysine + RESID-alternate + + + + DiffAvg + 71.12 + + + + DiffFormula + C 4 H 9 N 1 O 0 + + + + DiffMono + 71.073499 + + + + Formula + C 10 H 21 N 3 O 1 + + + + MassAvg + 199.30 + + + + MassMono + 199.168462 + + + + Origin + K + + + + Source + natural + + + + TermSpec + none + + MOD:00912 + MOD:01884 + PSI-MOD + + + MOD:01881 + 3-(L-phenylalan-2'-yl)-L-valine + + A protein modification that effectively crosslinks an L-phenylalanine residue and an L-valine residue by a free radical process effectively releasing a hydrogen molecule and forming 3-(L-phenylalan-2'-yl)-L-valine. + + 21596985 + PubMed + + + AA0565 + RESID + + + Cross-link 2. + + (2S)-2-amino-4-(2-[(2S)-2-amino-2-carboxyethyl]phenyl)-3-methylbutanoic acid + RESID-systematic + + + 3-(L-phenylalan-2'-yl)-L-valine + RESID-name + + + symerythrin valine-phenylalanine cross-link + RESID-alternate + + + + DiffAvg + -2.02 + + + + DiffFormula + C 0 H -2 N 0 O 0 + + + + DiffMono + -2.015650 + + + + Formula + C 14 H 16 N 2 O 2 + + + + MassAvg + 244.29 + + + + MassMono + 244.121178 + + + + Origin + F, V + + + + Source + natural + + + + TermSpec + none + + MOD:00692 + MOD:00914 + MOD:00920 + PSI-MOD + + + MOD:01882 + 5-imidazolinone ring crosslinked residues (Gly) + + A protein modification that effectively crosslinks the carbonyl of an amino acid residue at position n with the alpha amino of a glycine residue at position n+2 to form a 5-imidazolinone ring. + + 18688235 + PubMed + + + MOD:00691 + PSI-MOD + + + MOD:01883 + 5-imidazolinone ring crosslinked residues (Cys) + + A protein modification that crosslinks two residues by rearrangement and condensation of a cysteine with the carbonyl of the preceding residue to form a 5-imidazolinone ring. + + 18688235 + PubMed + + + MOD:00691 + PSI-MOD + + + MOD:01884 + 4-aminobutylated residue + + A protein modification that effectively replaces a hydrogen atom with a 4-aminobutyl group, usually derived from spermidine. + + 18688235 + PubMed + + + PSI-MOD-slim + + + Origin + X + + + + TermSpec + none + + MOD:00001 + PSI-MOD + + + MOD:01885 + biotinylated residue + + A protein modification that effectively replaces a hydrogen atom with a biotinyl group. + + 18688235 + PubMed + + + PSI-MOD-slim + + 5-((3aS,4S,6aR)-hexahydro-2-oxo-1H-thieno[3,4-d]imidazol-4-yl)-1-oxopentyl + PSI-MOD-alternate + + + Biotinylation + PSI-MOD-alternate + + + BtnRes + PSI-MOD-label + + + + DiffAvg + 226.29 + + + + DiffFormula + C 10 H 14 N 2 O 2 S 1 + + + + DiffMono + 226.077599 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + natural + + + + TermSpec + none + + MOD:00649 + PSI-MOD + + + MOD:01886 + thiolated residue + + A protein modification that effectively replaces a hydrogen atom with an sulfanyl or substituted sulfanyl group. + + 18688235 + PubMed + + + PSI-MOD-slim + + + Origin + X + + + + TermSpec + none + + MOD:00860 + PSI-MOD + + + MOD:01887 + Uniblue A derivatized lysine + + A protein modification that is produced by reaction with 1-amino-4-{[3-(ethenylsulfonyl)phenyl]amino}-9,10-dioxo-9,10-dihydroanthracene-2-sulfonate, Uniblue A, to form Uniblue A lysine adduct. + + 18688235 + PubMed + + + PSI-MOD-slim + + 1-amino-4-{[3-(ethenylsulfonyl)phenyl]amino}-9,10-dioxo-9,10-dihydroanthracene-2-sulfonate + PSI-MOD-alternate + + + 1-amino-9,10-dioxo-4-{[3-(vinylsulfonyl)phenyl]amino}-9,10-dihydroanthracene-2-sulfonate + PSI-MOD-alternate + + + N6UniblueALys + PSI-MOD-label + + + Uniblue A + PSI-MOD-alternate + + + + DiffAvg + 484.50 + + + + DiffFormula + C 22 H 16 N 2 O 7 S 2 + + + + DiffMono + 484.039893 + + + + Formula + C 28 H 28 N 4 O 8 S 2 + + + + MassAvg + 612.67 + + + + MassMono + 612.134856 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00912 + MOD:01659 + PSI-MOD + + + MOD:01888 + didehydrogenated residue + + A protein modification that effectively removes two neutral hydrogen atoms (proton and electron) from a residue. + + 401 + UniMod + + + PSI-MOD-slim + + 2dHRes + PSI-MOD-label + + + + DiffAvg + -2.02 + + + + DiffFormula + C 0 H -2 N 0 O 0 + + + + DiffMono + -2.015650 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + none + + + + TermSpec + none + + MOD:00683 + PSI-MOD + + + MOD:01889 + S-(2-succinyl)-L-cysteine + + A protein modification that effectively converts an L-cysteine residue to S-(2-succinyl)-L-cysteine, by addition of either fumaric acid or maleic acid. + + 16624247 + PubMed + + + 18448829 + PubMed + + + 20677745 + PubMed + + + AA0561 + RESID + + + 957 + UniMod + + + + (2R)-2-amino-3-([(1R)-1,2-dicarboxyethyl]sulfanyl)propanoic acid + RESID-systematic + + + (2R)-2-{[(2R)-2-amino-2-carboxyethyl]sulfanyl}butanedioic acid + RESID-alternate + + + 2-((2-amino-2-carboxyethyl)thio)butanedioic acid + RESID-alternate + + + 2-amino-3-(1,2-dicarboxyethylthio)propanoic acid + RESID-alternate + + + S-(1,2-dicarboxyethyl)cysteine + RESID-alternate + + + S-(2-succinyl)-L-cysteine + RESID-name + + + S-(2-succinyl)cysteine + RESID-alternate + + + S-[(2R)-2-succinyl]-L-cysteine + RESID-alternate + + + + DiffAvg + 116.07 + + + + DiffFormula + C 4 H 4 N 0 O 4 S 0 + + + + DiffMono + 116.010959 + + + + Formula + C 7 H 9 N 1 O 5 S 1 + + + + MassAvg + 219.21 + + + + MassMono + 219.020143 + + + + Origin + C + + + + Source + natural + + + + TermSpec + none + + MOD:00001 + MOD:00905 + PSI-MOD + + + MOD:01890 + N-[(L-histidin-1'-yl)methyl]-L-methionine (fMet) + + A protein modification that effectively crosslinks an N-formyl-L-methionine residue and an L-histidine residue to form N-[(L-histidin-1'-yl)methyl]-L-methionine. + + 19622680 + PubMed + + + AA0566#FMET + RESID + + + Cross-link 2. + + (2S)-2-([(4-[(2S)-2-amino-2-carboxyethyl]-1H-imidazol-1-yl)methyl]amino)-4-(methylsulfanyl)butanoic acid + RESID-systematic + + + N-[(L-histidin-1'-yl)methyl]-L-methionine + RESID-name + + + + DiffAvg + -16.00 + + + + DiffFormula + C 0 H 0 N 0 O -1 S 0 + + + + DiffMono + -15.994915 + + + + Formula + C 12 H 17 N 4 O 2 S 1 + + + + MassAvg + 281.35 + + + + MassMono + 281.107222 + + + + Origin + H, MOD:00030 + + + + Source + hypothetical + + + + TermSpec + N-term + + MOD:00909 + MOD:01450 + PSI-MOD + + + MOD:01891 + N-[(L-histidin-1'-yl)methyl]-L-methionine (Met) + + A protein modification that effectively crosslinks an L-methionine residue and an L-histidine residue to form N-[(L-histidin-1'-yl)methyl]-L-methionine. + + 19622680 + PubMed + + + AA0566#MET + RESID + + + Cross-link 2. + + (2S)-2-([(4-[(2S)-2-amino-2-carboxyethyl]-1H-imidazol-1-yl)methyl]amino)-4-(methylsulfanyl)butanoic acid + RESID-systematic + + + N-[(L-histidin-1'-yl)methyl]-L-methionine + RESID-name + + + + DiffAvg + 12.01 + + + + DiffFormula + C 1 H 0 N 0 O 0 S 0 + + + + DiffMono + 12.000000 + + + + Formula + C 12 H 17 N 4 O 2 S 1 + + + + MassAvg + 281.35 + + + + MassMono + 281.107222 + + + + Origin + H, M + + + + Source + hypothetical + + + + TermSpec + N-term + + MOD:00909 + MOD:00913 + PSI-MOD + + + MOD:01892 + N6-crotonyl-L-lysine + + A protein modification that effectively converts an L-lysine residue to N6-crotonyl-L-lysine. + + 21925322 + PubMed + + + AA0567 + RESID + + + + (2S)-2-amino-6-[(2E)-but-2-enamido]hexanoic acid + RESID-alternate + + + (2S)-2-amino-6-[(2E)-but-2-enoylamino]hexanoic acid + RESID-systematic + + + (2S)-2-azanyl-6-[(2E)-but-2-enoylazanyl]hexanoic acid + RESID-alternate + + + MOD_RES N6-crotonyl-L-lysine + UniProt-feature + + + N(epsilon)-crotonyllysine + RESID-alternate + + + N6-(E)-crotonyllysine + RESID-alternate + + + N6-[(2E)-2-butenoyl]-L-lysine + RESID-alternate + + + N6-crotonyl-L-lysine + RESID-name + + + N6-crotonyllysine + RESID-alternate + + + N6-trans-crotonyllysine + RESID-alternate + + + + DiffAvg + 68.07 + + + + DiffFormula + C 4 H 4 N 0 O 1 + + + + DiffMono + 68.026215 + + + + Formula + C 10 H 16 N 2 O 2 + + + + MassAvg + 196.25 + + + + MassMono + 196.121178 + + + + Origin + K + + + + Source + hypothetical + + + + TermSpec + none + + MOD:01875 + PSI-MOD + + + MOD:01893 + N6-malonyl-L-lysine + + A protein modification that effectively converts an L-lysine residue to N6-malonyl-L-lysine. + + 21908771 + PubMed + + + 8349414 + PubMed + + + AA0568 + RESID + + + + (2S)-2-amino-6-[(carboxyacetyl)amino]hexanoic acid + RESID-systematic + + + 2-azanyl-6-[(carboxyacetyl)azanyl]hexanoic acid + RESID-alternate + + + malonyllysine + RESID-alternate + + + MOD_RES N6-malonyllysine + UniProt-feature + + + N(epsilon)-(malonyl)lysine + RESID-alternate + + + N6-(carboxyacetyl)lysine + RESID-alternate + + + N6-malonyl-L-lysine + RESID-name + + + N6-malonyllysine + RESID-alternate + + + + DiffAvg + 86.05 + + + + DiffFormula + C 3 H 2 N 0 O 3 + + + + DiffMono + 86.000394 + + + + Formula + C 9 H 14 N 2 O 4 + + + + MassAvg + 214.22 + + + + MassMono + 214.095357 + + + + Origin + K + + + + Source + hypothetical + + + + TermSpec + none + + MOD:01875 + PSI-MOD + + + MOD:01894 + propanoylated residue + + A protein modification that effectively replaces a hydrogen atom with an propanoyl group. + + 11857757 + PubMed + + + 11999733 + PubMed + + + 12175151 + PubMed + + + 58 + UniMod + + + + Propionate labeling reagent light form (N-term & K) + UniMod-description + + + Propionyl + PSI-MS-label + + + + DiffAvg + 56.06 + + + + DiffFormula + C 3 H 4 O 1 + + + + DiffMono + 56.026215 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00649 + PSI-MOD + + + MOD:01895 + alpha-amino 3x(12)C-labeled propanoylated residue + + A protein modification that effectively replaces a residue alpha-amino- or alpha-imino-hydrogen with a 3x(12)C-labeled propanoyl group. + + 11857757 + PubMed + + + 11999733 + PubMed + + + 12175151 + PubMed + + + 58#N-term + UniMod + + + + Propionate labeling reagent light form (N-term & K) + UniMod-description + + + Propionyl + PSI-MS-label + + + + DiffAvg + 56.03 + + + + DiffFormula + (12)C 3 H 4 O 1 + + + + DiffMono + 56.026215 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00451 + PSI-MOD + + + MOD:01896 + trifluoroacetic acid adduct + + A protein modification produced by trifluoroacetic acid forming an adduct, either a salt or a hydrogen bonded carboxylic acid dimer, with an amino acid residue. + + 18688235 + PubMed + + + Trifluoroacetic acid has been observed to form adducts in both negative and positive mode analysis (Mark Collins, private communication) [JSG]. + + TFA + DeltaMass-label + + + + DiffAvg + 114.02 + + + + DiffFormula + C 2 F 3 H 1 O 2 + + + + DiffMono + 113.992864 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00498 + MOD:00848 + PSI-MOD + + + MOD:01897 + 5-hydroxy-3-methyl-L-proline (Ile) + + A protein modification that effectively converts an L-isoleucine residue to 5-hydroxy-3-methyl-L-proline. + + 21788474 + PubMed + + + 7592021 + PubMed + + + 8557573 + PubMed + + + AA0473 + RESID + + + + (2S,3S,5Xi)-5-hydroxy-3-methylpyrrolidine-2-carboxylic acid + RESID-systematic + + + 5-hydroxy-3-methyl-L-proline + RESID-name + + + 5-hydroxy-3-methylproline + RESID-alternate + + + 5Hy3MePro(Ile) + PSI-MOD-label + + + beta-methyl-delta-hydroxyproline + RESID-alternate + + + MOD_RES 5-hydroxy-3-methylproline (Ile) + UniProt-feature + + + + DiffAvg + 13.98 + + + + DiffFormula + C 0 H -2 N 0 O 1 + + + + DiffMono + 13.979265 + + + + Formula + C 6 H 9 N 1 O 2 + + + + MassAvg + 127.14 + + + + MassMono + 127.063329 + + + + Origin + I + + + + Source + natural + + + + TermSpec + none + + MOD:00601 + MOD:00679 + MOD:00910 + MOD:01888 + MOD:01905 + PSI-MOD + + + MOD:01898 + N2,N2-dimethyl-L-arginine + + modification from RESID + + 21568297 + PubMed + + + 21950656 + PubMed + + + AA0569 + RESID + + + + (2S)-5-[(diaminomethylidene)amino]-2-(dimethylamino)pentanoic acid + RESID-systematic + + + (2S)-5-carbamimidamido-2-(dimethylamino)pentanoic acid [tautomer] + RESID-alternate + + + MOD_RES N2,N2-dimethylarginine + UniProt-feature + + + N(alpha),N(alpha)-dimethylarginine + RESID-alternate + + + N2,N2-dimethyl-L-arginine + RESID-name + + + N2,N2-dimethylarginine + RESID-alternate + + + + DiffAvg + 28.05 + + + + DiffFormula + C 2 H 4 N 0 O 0 + + + + DiffMono + 28.031300 + + + + Formula + C 8 H 17 N 4 O 1 + + + + MassAvg + 185.25 + + + + MassMono + 185.140236 + + + + Origin + R + + + + Source + natural + + + + TermSpec + N-term + + MOD:00783 + PSI-MOD + + + MOD:01899 + L-arginine thiazole-4-carboxylic acid + + A protein modification that effectively crosslinks an L-arginine residue and an L-cysteine residue to form arginine thiazole-4-carboxylic acid. + + 21568297 + PubMed + + + 21950656 + PubMed + + + AA0570 + RESID + + + Cross-link 2. + + 2-[(1S)-1-amino-4-([diaminomethylidene]amino)butyl]-1,3-thiazole-4-carboxylic acid + RESID-systematic + + + CROSSLNK Thiazole-4-carboxylic acid (Arg-Cys) + UniProt-feature + + + L-arginine thiazole-4-carboxylic acid + RESID-name + + + + DiffAvg + -20.03 + + + + DiffFormula + C 0 H -4 N 0 O -1 S 0 + + + + DiffMono + -20.026215 + + + + Formula + C 9 H 13 N 5 O 1 S 1 + + + + MassAvg + 239.30 + + + + MassMono + 239.084081 + + + + Origin + C, R + + + + Source + natural + + + + TermSpec + none + + MOD:00902 + MOD:01420 + MOD:01888 + PSI-MOD + + + MOD:01900 + L-cysteine 5-methyloxazole-4-carboxylic acid + + A protein modification that effectively crosslinks an L-cysteine residue and an L-threonine residue to form L-cysteine 5-methyloxazole-4-carboxylic acid. + + 21568297 + PubMed + + + 21950656 + PubMed + + + AA0571 + RESID + + + Cross-link 2. + + 2-[(1R)-1-amino-2-sulfanylethyl]-5-methyl-1,3-oxazole-4-carboxylic acid + RESID-systematic + + + 2-[(1R)-1-azanyl-2-sulfanylethyl]-5-methyl-1,3-oxazole-4-carboxylic acid + RESID-alternate + + + CROSSLNK 5-methyloxazole-4-carboxylic acid (Cys-Thr) + UniProt-feature + + + L-cysteine 5-methyloxazole-4-carboxylic acid + RESID-name + + + + DiffAvg + -20.03 + + + + DiffFormula + C 0 H -4 N 0 O -1 S 0 + + + + DiffMono + -20.026215 + + + + Formula + C 7 H 8 N 2 O 2 S 1 + + + + MassAvg + 184.21 + + + + MassMono + 184.030649 + + + + Origin + C, T + + + + Source + natural + + + + TermSpec + none + + MOD:00905 + MOD:01422 + MOD:01888 + PSI-MOD + + + MOD:01901 + L-threonine 5-methyloxazole-4-carboxylic acid + + A protein modification that effectively crosslinks two L-threonine residues to form L-threonine 5-methyloxazole-4-carboxylic acid. + + 21568297 + PubMed + + + 21950656 + PubMed + + + AA0572 + RESID + + + Cross-link 2. + + 2-[(1S,2R)-1-amino-2-hydroxypropyl]-5-methyl-1,3-oxazole-4-carboxylic acid + RESID-systematic + + + 2-[(1S,2R)-1-azanyl-2-hydroxypropyl]-5-methyl-1,3-oxazole-4-carboxylic acid + RESID-alternate + + + CROSSLNK 5-methyloxazole-4-carboxylic acid (Thr-Thr) + UniProt-feature + + + L-threonine 5-methyloxazole-4-carboxylic acid + RESID-name + + + + DiffAvg + -20.03 + + + + DiffFormula + C 0 H -4 N 0 O -1 + + + + DiffMono + -20.026215 + + + + Formula + C 8 H 10 N 2 O 3 + + + + MassAvg + 182.18 + + + + MassMono + 182.069142 + + + + Origin + T, T + + + + Source + natural + + + + TermSpec + none + + MOD:01422 + MOD:01888 + PSI-MOD + + + MOD:01902 + L-isoleucine oxazole-4-carboxylic acid + + A protein modification that effectively crosslinks an L-isoleucine residue and an L-serine residue to form L-cysteine oxazole-4-carboxylic acid. + + 21568297 + PubMed + + + 21950656 + PubMed + + + AA0573 + RESID + + + Cross-link 2. + + 2-[(1S,2S)-1-amino-2-methylbutyl]-1,3-oxazole-4-carboxylic acid + RESID-systematic + + + 2-[(1S,2S)-1-azanyl-2-methylbutyl]-1,3-oxazole-4-carboxylic acid + RESID-alternate + + + CROSSLNK Oxazole-4-carboxylic acid (Ile-Ser) + UniProt-feature + + + L-isoleucine oxazole-4-carboxylic acid + RESID-name + + + + DiffAvg + -20.03 + + + + DiffFormula + C 0 H -4 N 0 O -1 + + + + DiffMono + -20.026215 + + + + Formula + C 9 H 12 N 2 O 2 + + + + MassAvg + 180.21 + + + + MassMono + 180.089878 + + + + Origin + I, S + + + + Source + natural + + + + TermSpec + none + + MOD:00910 + MOD:01421 + MOD:01888 + PSI-MOD + + + MOD:01903 + L-serine oxazole-4-carboxylic acid + + A protein modification that effectively crosslinks two L-serine residues to form serine oxazole-4-carboxylic acid. + + 21568297 + PubMed + + + 21950656 + PubMed + + + AA0574 + RESID + + + Cross-link 2. + + 2-[(1S)-1-amino-2-hydroxyethyl]-1,3-oxazole-4-carboxylic acid + RESID-systematic + + + 2-[(1S)-1-azanyl-2-hydroxyethyl]-1,3-oxazole-4-carboxylic acid + RESID-alternate + + + CROSSLNK Oxazole-4-carboxylic acid (Ser-Ser) + UniProt-feature + + + L-serine oxazole-4-carboxylic acid + RESID-name + + + + DiffAvg + -20.03 + + + + DiffFormula + C 0 H -4 N 0 O -1 + + + + DiffMono + -20.026215 + + + + Formula + C 6 H 6 N 2 O 3 + + + + MassAvg + 154.13 + + + + MassMono + 154.037842 + + + + Origin + S, S + + + + Source + natural + + + + TermSpec + none + + MOD:01421 + MOD:01888 + PSI-MOD + + + MOD:01904 + L-serine 5-methyloxazoline-4-carboxylic acid + + A protein modification that effectively crosslinks an L-serine residue and an L-threonine residue to form L-serine 5-methyloxazoline-4-carboxylic acid. + + 21568297 + PubMed + + + 21950656 + PubMed + + + AA0575 + RESID + + + Cross-link 2. + + 2-[(1S)-1-amino-2-hydroxyethyl]-5-methyl-1,3-oxazoline-4-carboxylic acid + RESID-alternate + + + 2-[(1S)-1-amino-2-hydroxyethyl]-5-methyl-4,5-dihydro-1,3-oxazole-4-carboxylic acid + RESID-systematic + + + 2-[(1S)-1-azanyl-2-hydroxyethyl]-5-methyl-4,5-dihydro-1,3-oxazole-4-carboxylic acid + RESID-alternate + + + CROSSLNK 5-methyloxazoline-4-carboxylic acid (Ser-Thr) + UniProt-feature + + + L-serine 5-methyloxazoline-4-carboxylic acid + RESID-name + + + + DiffAvg + -18.02 + + + + DiffFormula + C 0 H -2 N 0 O -1 + + + + DiffMono + -18.010565 + + + + Formula + C 7 H 10 N 2 O 3 + + + + MassAvg + 170.17 + + + + MassMono + 170.069142 + + + + Origin + S, T + + + + Source + natural + + + + TermSpec + none + + MOD:00916 + MOD:01422 + PSI-MOD + + + MOD:01905 + 5-hydroxy-3-methyl-L-proline + + A protein modification that effectively converts a source amino acid residue to 5-hydroxy-3-methyl-L-proline. + + 7592021 + PubMed + + + 8557573 + PubMed + + + AA0473 + RESID + + + + (2S,3S,5Xi)-5-hydroxy-3-methylpyrrolidine-2-carboxylic acid + RESID-systematic + + + 5-hydroxy-3-methyl-L-proline + RESID-name + + + 5-hydroxy-3-methylproline + RESID-alternate + + + 5Hy3MePro + PSI-MOD-label + + + beta-methyl-delta-hydroxyproline + RESID-alternate + + + MOD_RES 5-hydroxy-3-methylproline (Ile) + UniProt-feature + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + C 6 H 9 N 1 O 2 + + + + MassAvg + 127.14 + + + + MassMono + 127.063329 + + + + Origin + X + + + + Source + natural + + + + TermSpec + none + + MOD:00859 + + has_functional_parent + MOD:010240 + + PSI-MOD + + + MOD:01906 + dehydromethionine + + A protein modification that effectively converts an L-methionine residue to dehydromethionine. + + 18688235 + PubMed + + + 19775156 + PubMed + + + + (3S)-3-carboxy-1-methylisothiazolidin-1-ium + PSI-MOD-alternate + + + L-dehydromethionine + PSI-MOD-alternate + + + + DiffAvg + -1.01 + + + + DiffFormula + C 0 H -1 N 0 O 0 S 0 + + + + DiffMono + -1.008374 + + + + FormalCharge + 1+ + + + + Formula + C 5 H 9 N 1 O 1 S 1 + + + + MassAvg + 131.19 + + + + MassMono + 131.039936 + + + + Origin + M + + + + Source + artifact + + + + TermSpec + N-term + + MOD:00601 + MOD:00913 + PSI-MOD + + + MOD:01907 + dehydromethionine (from L-methioninium) + + A protein modification that effectively converts an L-methioninium (protonated L-methionine) residue to dehydromethionine. + + 18688235 + PubMed + + + 19775156 + PubMed + + + This process accounts only for cyclizaation and not protonation. The alternative process (MOD:01906) accounts for both protonation and cyclization. + + (3S)-3-carboxy-1-methylisothiazolidin-1-ium + PSI-MOD-alternate + + + L-dehydromethionine + PSI-MOD-alternate + + + + DiffAvg + -2.02 + + + + DiffFormula + C 0 H -2 N 0 O 0 S 0 + + + + DiffMono + -2.016199 + + + + FormalCharge + 1+ + + + + Formula + C 5 H 9 N 1 O 1 S 1 + + + + MassAvg + 131.19 + + + + MassMono + 131.039936 + + + + Origin + MOD:001464 + + + + Source + artifact + + + + TermSpec + N-term + + MOD:00601 + MOD:00913 + + derives_from + MOD:014640 + + PSI-MOD + + + MOD:01908 + 4-sulfophenyl isothiocyanate alpha-amino derivatized residue + + A protein modification that effectively converts a residue to the 4-sulfophenyl isothiocyanate adduct, alpha-amino-[(4-sulfophenyl)carbamothioyl] residue. + + 14689565 + PubMed + + + 14745769 + PubMed + + + 15549660 + PubMed + + + 16526082 + PubMed + + + 261#N-term + UniMod + + + + 4-sulfophenyl isothiocyanate + UniMod-description + + + alpha-amino-[(4-sulfophenyl)carbamothioyl] residue + PSI-MOD-alternate + + + SPITC + PSI-MS-label + + + + DiffAvg + 215.24 + + + + DiffFormula + C 7 H 5 N 1 O 3 S 2 + + + + DiffMono + 214.971085 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00584 + PSI-MOD + + + MOD:01909 + 6x(13)C labeled 4-sulfophenyl isothiocyanate alpha-amino derivatized residue + + A protein modification that effectively converts a residue to the 6x(13)C labeled 4-sulfophenyl isothiocyanate adduct, alpha-amino-[(4-sulfophenyl)carbamothioyl] residue. + + 11467524 + PubMed + + + 16526082 + PubMed + + + 464#N-term + UniMod + + + + 4-sulfophenyl isothiocyanate (Heavy C13) + UniMod-description + + + SPITC:13C(6) + PSI-MS-label + + + + DiffAvg + 220.99 + + + + DiffFormula + (12)C 1 (13)C 6 H 5 N 1 O 3 S 2 + + + + DiffMono + 220.991214 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00880 + PSI-MOD + + + MOD:01910 + monofluorinated residue + + A protein modification that effectively substitutes one hydrogen atom of a residue with one fluorine atom. + + 127 + UniMod + + + + F1Res + PSI-MOD-label + + + + DiffAvg + 17.99 + + + + DiffFormula + C 0 F 1 H -1 N 0 O 0 + + + + DiffMono + 17.990578 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00498 + PSI-MOD + + + MOD:01911 + monochlorinated residue + + A protein modification that effectively substitutes one hydrogen atom of a residue with one chlorine atom. + + 936 + UniMod + + + + Cl1Res + PSI-MOD-label + + + + DiffAvg + 34.44 + + + + DiffFormula + C 0 Cl 1 H -1 N 0 O 0 + + + + DiffMono + 33.961028 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00753 + PSI-MOD + + + MOD:01912 + monobrominated residue + + A protein modification that effectively substitutes one hydrogen atom of a residue with one bromine atom. + + 340 + UniMod + + + + Br1Res + PSI-MOD-label + + + + DiffAvg + 78.90 + + + + DiffFormula + Br 1 C 0 H -1 N 0 O 0 + + + + DiffMono + 77.910512 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + none + + MOD:00754 + PSI-MOD + + + MOD:01913 + monochlorinated L-tryptophan + + A protein modification that effectively substitutes one hydrogen atom of an L-tryptophan residue with one chlorine atom. + + 18688235 + PubMed + + + + Cl1Trp + PSI-MOD-label + + + + DiffAvg + 34.44 + + + + DiffFormula + C 0 Cl 1 H -1 N 0 O 0 + + + + DiffMono + 33.961028 + + + + Formula + C 11 Cl 1 H 9 N 2 O 1 + + + + MassAvg + 220.66 + + + + MassMono + 220.040341 + + + + Origin + W + + + + Source + artifact + + + + TermSpec + none + + MOD:01068 + MOD:01911 + PSI-MOD + + + MOD:01914 + O5-galactosyl-L-hydroxylysine + + A protein modification that effectively converts an L-lysine residue to O5-galactosyl-L-hydroxylysine. + + 17516569 + PubMed + + + 907 + UniMod + + + Secondary to RESID:AA0028. This intermediate is rarely observed [JSG]. + PSI-MOD-slim + + Galactosyl hydroxylysine + UniMod-description + + + OGal5HyLys + PSI-MOD-label + + + + DiffAvg + 178.14 + + + + DiffFormula + C 6 H 10 N 0 O 6 + + + + DiffMono + 178.047738 + + + + Formula + C 16 H 22 N 2 O 7 + + + + MassAvg + 354.36 + + + + MassMono + 354.142701 + + + + Origin + K + + + + Source + natural + + + + TermSpec + none + + MOD:00037 + MOD:00396 + MOD:00476 + PSI-MOD + + + MOD:01915 + N-formyl-L-alanine + + A protein modification that effectively converts an L-alanine residue to N-formyl-L-alanine. + + 9334739 + PubMed + + + AA0576 + RESID + + + + (2S)-2-(formylamino)propanoic acid + RESID-systematic + + + 2-formamidopropanoic acid + RESID-alternate + + + 2-formamidopropionic acid + RESID-alternate + + + N-formyl-L-alanine + RESID-name + + + + DiffAvg + 28.01 + + + + DiffFormula + C 1 H 0 N 0 O 1 + + + + DiffMono + 27.994915 + + + + Formula + C 4 H 6 N 1 O 2 + + + + MassAvg + 100.10 + + + + MassMono + 100.039853 + + + + Origin + A + + + + Source + hypothetical + + + + TermSpec + N-term + + MOD:00409 + MOD:00901 + PSI-MOD + + + MOD:01916 + O4'-(N-acetylamino)galactosyl-L-tyrosine + + A protein modification that effectively converts an L-tyrosine residue to O4'-(N-acetylamino)galactosyl-L-tyrosine. + + 21712440 + PubMed + + + 21983924 + PubMed + + + AA0577 + RESID + + + + (2S)-2-amino-3-(D-2-acetamido-2-deoxygalactopyranosyloxy)phenylpropanoic acid + RESID-systematic + + + CARBOHYD O-linked (GalNAc) + UniProt-feature + + + mucin type O-glycosyltyrosine + RESID-alternate + + + O4'-(N-acetylamino)galactosyl-L-tyrosine + RESID-name + + + O4'-(N-acetylgalactosaminyl)tyrosine + RESID-alternate + + + O4'-glycosyl-L-tyrosine + RESID-alternate + + + + DiffAvg + 203.19 + + + + DiffFormula + C 8 H 13 N 1 O 5 + + + + DiffMono + 203.079373 + + + + Formula + C 17 H 22 N 2 O 7 + + + + MassAvg + 366.37 + + + + MassMono + 366.142701 + + + + Origin + Y + + + + Source + natural + + + + TermSpec + none + + MOD:00563 + MOD:01927 + PSI-MOD + + + MOD:01917 + N6-(L-isoaspartyl)-L-lysine (Asp) + + A protein modification that effectively crosslinks an L-aspartic acid residue and an L-lysine residue by an isopeptide bond with the formation of N6-(L-isoaspartyl)-L-lysine and the release of water. + + 21862 + ChEBI + + + 11000116 + PubMed + + + 15044436 + PubMed + + + 18063798 + PubMed + + + 6503713 + PubMed + + + AA0294#ASP + RESID + + + Cross-link 2. + + (2S)-2-amino-6-([(3S)-3-amino-3-carboxypropanoyl]amino)hexanoic acid + RESID-systematic + + + beta-(N6-lysyl)aspartyl acid + RESID-alternate + + + CROSSLNK Isoaspartyl lysine isopeptide (Lys-Asn) + UniProt-feature + + + isoaspartyl N6-lysine + RESID-alternate + + + N(epsilon)-(beta-aspartyl)lysine + RESID-alternate + + + N6-(L-isoaspartyl)-L-lysine + RESID-name + + + XLNK-4Asp-N6Lys(Asp) + PSI-MOD-label + + + + DiffAvg + -18.02 + + + + DiffFormula + C 0 H -2 N 0 O -1 + + + + DiffMono + -18.010565 + + + + Formula + C 10 H 15 N 3 O 3 + + + + MassAvg + 225.25 + + + + MassMono + 225.111341 + + + + Origin + D, K + + + + Source + natural + + + + TermSpec + none + + MOD:00904 + MOD:01929 + PSI-MOD + + + MOD:01918 + (2S,5S)-5-hydroxylysine + + A protein modification that effectively converts an L-lysine residue to (2S,5S)-5-hydroxylysine. + + 19574390 + PubMed + + + 22238144 + PubMed + + + AA0578 + RESID + + + PSI-MOD-slim + + (2S,5S)-2,6-diamino-5-hydroxyhexanoic acid + RESID-systematic + + + (2S,5S)-5-hydroxylysine + RESID-name + + + 2,6-bisazanyl-5-hydroxyhexanoic acid + RESID-alternate + + + 2,6-diamino-2,3,4,6-tetradeoxyhexonic acid + RESID-alternate + + + alpha,epsilon-diamino-delta-hydroxycaproic acid + RESID-alternate + + + L-allo-delta-hydroxylysine + RESID-alternate + + + L-threo-delta-hydroxylysine + RESID-alternate + + + MOD_RES (5S)-5-hydroxylysine + UniProt-feature + + + + DiffAvg + 16.00 + + + + DiffFormula + C 0 H 0 N 0 O 1 + + + + DiffMono + 15.994915 + + + + Formula + C 6 H 12 N 2 O 2 + + + + MassAvg + 144.17 + + + + MassMono + 144.089878 + + + + Origin + K + + + + Source + natural + + + + TermSpec + none + + MOD:00037 + PSI-MOD + + + MOD:01919 + (2S,3S)-3-hydroxyaspartic acid + + A protein modification that effectively converts an L-aspartic acid residue to (2S,3S)-3-hydroxyaspartic acid. + + 10696 + ChEBI + + + 21177872 + PubMed + + + AA0579 + RESID + + + PSI-MOD-slim + + (2S,3S)-2-amino-3-hydroxybutanedioic acid + RESID-systematic + + + (2S,3S)-3-hydroxyaspartic acid + RESID-name + + + (3S)-3-hydroxy-L-aspartic acid + RESID-alternate + + + 2-amino-3-hydroxysuccinic acid + RESID-alternate + + + 2-azanyl-3-hydroxybutanedioic acid + RESID-alternate + + + 3-hydroxyaspartic acid + RESID-alternate + + + L-threo-3-hydroxyaspartic acid + RESID-alternate + + + L-threo-beta-hydroxyaspartic acid + RESID-alternate + + + MOD_RES (3S)-3-hydroxyaspartate + UniProt-feature + + + + DiffAvg + 16.00 + + + + DiffFormula + C 0 H 0 N 0 O 1 + + + + DiffMono + 15.994915 + + + + Formula + C 4 H 5 N 1 O 4 + + + + MassAvg + 131.09 + + + + MassMono + 131.021858 + + + + Origin + D + + + + Source + natural + + + + TermSpec + none + + MOD:01926 + PSI-MOD + + + MOD:01920 + 3-hydroxy-L-histidine + + A protein modification that effectively converts an L-histidine residue to 3-hydroxy-L-histidine. + + 21251231 + PubMed + + + AA0580 + RESID + + + + (2S)-2-amino-3-hydroxy-3-(1H-imidazol-4-yl)propanoic acid + RESID-systematic + + + 3-hydroxy-L-histidine + RESID-name + + + MOD_RES 3-hydroxyhistidine + UniProt-feature + + + + DiffAvg + 16.00 + + + + DiffFormula + C 0 H 0 N 0 O 1 + + + + DiffMono + 15.994915 + + + + Formula + C 6 H 7 N 3 O 2 + + + + MassAvg + 153.14 + + + + MassMono + 153.053826 + + + + Origin + H + + + + Source + natural + + + + TermSpec + none + + MOD:00677 + PSI-MOD + + + MOD:01921 + D-aspartic acid (Asp) + + A protein modification that effectively converts an L-aspartic acid residue to D-aspartic acid. + + 48094 + ChEBI + + + 9384562 + PubMed + + + AA0190#ASP + RESID + + + + (2R)-2-aminobutanedioic acid + RESID-systematic + + + 2-azanylbutanedioic acid + RESID-alternate + + + aminosuccinic acid + RESID-alternate + + + D-aspartic acid + RESID-name + + + + DiffAvg + 0.00 + + + + DiffFormula + C 0 H 0 N 0 O 0 + + + + DiffMono + 0.000000 + + + + Formula + C 4 H 5 N 1 O 3 + + + + MassAvg + 115.09 + + + + MassMono + 115.026943 + + + + Origin + D + + + + Source + artifactual + + + + TermSpec + none + + MOD:00904 + MOD:01942 + PSI-MOD + + + MOD:01922 + 3-methoxydehydroalanine + + A protein modification that effectively converts an L-serine residue to 3-methoxydehydroalanine. + + 19745839 + PubMed + + + AA0582 + RESID + + + + 2-amino-3-methoxyprop-2-enoic acid + RESID-systematic + + + 3-methoxydehydroalanine + RESID-name + + + 3-methoxydidehydroalanine + RESID-alternate + + + + DiffAvg + 12.01 + + + + DiffFormula + C 1 H 0 N 0 O 0 + + + + DiffMono + 12.000000 + + + + Formula + C 4 H 5 N 1 O 2 + + + + MassAvg + 99.09 + + + + MassMono + 99.032028 + + + + Origin + S + + + + Source + natural + + + + TermSpec + none + + MOD:00916 + + has_functional_parent + MOD:001890 + + PSI-MOD + + + MOD:01923 + N6-(L-aspartyl)-L-lysine + + A protein modification that effectively crosslinks an L-aspartic acid residue and an L-lysine residue by an isopeptide bond to form N6-(L-aspartyl)-L-lysine and the release of water. + + 15044436 + PubMed + + + AA0583 + RESID + + + Cross-link 2. + + (2S)-2-amino-6-([(2S)-2-amino-3-carboxypropanoyl]amino)hexanoic acid + RESID-systematic + + + alpha-(N6-lysyl)aspartyl acid + RESID-alternate + + + aspartyl N6-lysine + RESID-alternate + + + N(epsilon)-(alpha-aspartyl)lysine + RESID-alternate + + + N6-(L-aspartyl)-L-lysine + RESID-name + + + XLNK-4Asp-N6Lys(Asp) + PSI-MOD-label + + + + DiffAvg + -18.02 + + + + DiffFormula + C 0 H -2 N 0 O -1 + + + + DiffMono + -18.010565 + + + + Formula + C 10 H 16 N 3 O 4 + + + + MassAvg + 242.26 + + + + MassMono + 242.114081 + + + + Origin + D, K + + + + Source + natural + + + + TermSpec + C-term + + MOD:00688 + MOD:00904 + MOD:00954 + MOD:01875 + PSI-MOD + + + MOD:01924 + S-octanoyl-L-cysteine + + A protein modification that effectively converts an L-cysteine residue to S-octanoyl-L-cysteine. + + 12591875 + PubMed + + + 16342964 + PubMed + + + AA0584 + RESID + + + + (2S)-2-amino-3-(octanoylsulfanyl)propanoic acid + RESID-systematic + + + 2-amino-3-(octanoylthio)propanoic acid + RESID-alternate + + + ACT_SITE Acyl-thioester intermediate + UniProt-feature + + + cysteine octanoate thioester + RESID-alternate + + + S-octanoyl-L-cysteine + RESID-name + + + + DiffAvg + 126.20 + + + + DiffFormula + C 8 H 14 N 0 O 1 S 0 + + + + DiffMono + 126.104465 + + + + Formula + C 11 H 19 N 1 O 2 S 1 + + + + MassAvg + 229.34 + + + + MassMono + 229.113650 + + + + Origin + C + + + + Source + natural + + + + TermSpec + none + + MOD:00666 + MOD:00672 + MOD:00905 + PSI-MOD + + + MOD:01925 + (2S,5R)-5-hydroxylysine + + A protein modification that effectively converts an L-lysine residue to (2S,5R)-5-hydroxylysine. + + 18040 + ChEBI + + + 13375629 + PubMed + + + 15504407 + PubMed + + + 16101297 + PubMed + + + 2857489 + PubMed + + + AA0028 + RESID + + + PSI-MOD-slim + + (2S,5R)-2,6-diamino-5-hydroxyhexanoic acid + RESID-systematic + + + (2S,5R)-5-hydroxylysine + RESID-name + + + 2,6-bisazanyl-5-hydroxyhexanoic acid + RESID-alternate + + + 2,6-diamino-2,3,4,6-tetradeoxyhexonic acid + RESID-alternate + + + 5-hydroxylated L-lysine + PSI-MOD-alternate + + + 5HyLys + PSI-MOD-label + + + alpha,epsilon-diamino-delta-hydroxycaproic acid + RESID-alternate + + + L-erythro-delta-hydroxylysine + RESID-alternate + + + MOD_RES (2S,5R)-5-hydroxylysine + UniProt-feature + + + + DiffAvg + 16.00 + + + + DiffFormula + C 0 H 0 N 0 O 1 + + + + DiffMono + 15.994915 + + + + Formula + C 6 H 12 N 2 O 2 + + + + MassAvg + 144.17 + + + + MassMono + 144.089878 + + + + Origin + K + + + + Source + natural + + + + TermSpec + none + + MOD:00037 + PSI-MOD + + + MOD:01926 + 3-hydroxy-L-aspartic acid + + A protein modification that effectively converts an L-aspartic acid residue to one of the diastereomeric 3-hydroxy-L-aspartic acid residues. + + 35#D + UniMod + + + PSI-MOD-slim + + (2S)-2-amino-3-hydroxybutanedioic acid + PSI-MOD-alternate + + + (2S)-3-hydroxyaspartic acid + PSI-MOD-alternate + + + 3HyAsp + PSI-MOD-label + + + erythro-beta-hydroxylated L-aspartic acid + PSI-MOD-alternate + + + hydroxylationd + OMSSA-label + + + monohydroxylated aspartic acid + PSI-MOD-alternate + + + Oxidation + PSI-MS-label + + + + DiffAvg + 16.00 + + + + DiffFormula + C 0 H 0 N 0 O 1 + + + + DiffMono + 15.994915 + + + + Formula + C 4 H 5 N 1 O 4 + + + + MassAvg + 131.09 + + + + MassMono + 131.021858 + + + + Origin + D + + + + Source + natural + + + + TermSpec + none + + MOD:00425 + MOD:00904 + PSI-MOD + + + MOD:01927 + O-glycosyl-L-tyrosine + + A protein modification that effectively converts an L-tyrosine residue to O4'-glycosyltyrosine. + + 18688235 + PubMed + + + PSI-MOD-slim + + OGlycoTyr + PSI-MOD-label + + + + Origin + Y + + + + Source + natural + + + + TermSpec + none + + MOD:00396 + MOD:00919 + PSI-MOD + + + MOD:01928 + N-(L-isoaspartyl)-glycine + + A protein modification that effectively crosslinks either an L-asparagine residue or an L-aspartic acid residue with a glycine residue by an isopeptide bond with formation of N-(L-isoaspartyl)glycine. + + 21479 + ChEBI + + + 1826288 + PubMed + + + AA0126 + RESID + + + Cross-link 2. + + (2S)-2-amino-4-(carboxymethyl)amino-4-oxobutanoic acid + RESID-systematic + + + 2-amino-N4-(carboxymethyl)-butanediamic acid + RESID-alternate + + + isoaspartyl glycine + RESID-alternate + + + N-(L-isoaspartyl)-glycine + RESID-name + + + N-beta-aspartylglycine + RESID-alternate + + + N4-(carboxymethyl)-asparagine + RESID-alternate + + + XLNK-4Asp-NGly + PSI-MOD-label + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + C 6 H 7 N 2 O 3 + + + + MassAvg + 155.13 + + + + MassMono + 155.045667 + + + + Origin + G + + + + Source + natural + + + + TermSpec + N-term + + MOD:00688 + MOD:00908 + PSI-MOD + + + MOD:01929 + N6-(L-isoaspartyl)-L-lysine + + A protein modification that effectively crosslinks an either an L-asparagine residue or an L-aspartic acid residue with an L-lysine residue by an isopeptide bond with the formation of N6-(L-isoaspartyl)-L-lysine. + + 21862 + ChEBI + + + 0 + DeltaMass + + + 11000116 + PubMed + + + 6503713 + PubMed + + + AA0294 + RESID + + + Cross-link 2. + + (2S)-2-amino-6-([(3S)-3-amino-3-carboxypropanoyl]amino)hexanoic acid + RESID-systematic + + + beta-(N6-lysyl)aspartyl acid + RESID-alternate + + + CROSSLNK Isoaspartyl lysine isopeptide (Lys-Asn) + UniProt-feature + + + isoaspartyl N6-lysine + RESID-alternate + + + N(epsilon)-(beta-aspartyl)lysine + RESID-alternate + + + N-(beta-Aspartyl)-Lysine (Crosslink) + DeltaMass-label + + + N6-(L-isoaspartyl)-L-lysine + RESID-name + + + XLNK-4Asp-N6Lys + PSI-MOD-label + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + C 10 H 15 N 3 O 3 + + + + MassAvg + 225.25 + + + + MassMono + 225.111341 + + + + Origin + K + + + + Source + natural + + + + TermSpec + none + + MOD:00688 + MOD:01875 + PSI-MOD + + + MOD:01930 + D-aspartic acid (Asn) + + A protein modification that effectively converts an L-asparagine residue to D-aspartic acid. + + 48094 + ChEBI + + + 9384562 + PubMed + + + AA0190#ASN + RESID + + + + (2R)-2-aminobutanedioic acid + RESID-systematic + + + 2-azanylbutanedioic acid + RESID-alternate + + + aminosuccinic acid + RESID-alternate + + + D-aspartic acid + RESID-name + + + + DiffAvg + 0.98 + + + + DiffFormula + C 0 H -1 N -1 O 1 + + + + DiffMono + 0.984016 + + + + Formula + C 4 H 5 N 1 O 3 + + + + MassAvg + 115.09 + + + + MassMono + 115.026943 + + + + Origin + N + + + + Source + artifactual + + + + TermSpec + none + + MOD:00903 + MOD:01942 + PSI-MOD + + + MOD:01931 + N6-phospho-L-lysine + + A protein modification that effectively converts an L-lysine residue to N6-phospho-L-lysine. + + 20144148 + PubMed + + + AA0585 + RESID + + + + (2S)-2-amino-6-(phosphonoamino)hexanoic acid + RESID-systematic + + + (2S)-2-azanyl-6-(phosphonoamino)hexanoic acid + RESID-alternate + + + 6-phospholysine + RESID-alternate + + + N(6)-phosphonolysine + RESID-alternate + + + N(epsilon)-phospholysine + RESID-alternate + + + N(epsilon)-phosphonolysine + RESID-alternate + + + N(epsilon)-phosphonyllysine + RESID-alternate + + + N(epsilon)-phosphoryllysine + RESID-alternate + + + N6-phospho-L-lysine + RESID-name + + + + DiffAvg + 79.98 + + + + DiffFormula + C 0 H 1 N 0 O 3 P 1 + + + + DiffMono + 79.966331 + + + + Formula + C 6 H 13 N 2 O 4 P 1 + + + + MassAvg + 208.15 + + + + MassMono + 208.061294 + + + + Origin + K + + + + Source + hypothetical + + + + TermSpec + none + + MOD:00912 + MOD:01456 + PSI-MOD + + + MOD:01932 + L-lysinonorleucine + + A protein modification that effectively cross-links two lysine residues with a carbon-nitrogen bond to form L-lysinonorleucine.. + + 5117030 + PubMed + + + 5817620 + PubMed + + + 5879466 + PubMed + + + 6030254 + PubMed + + + AA0586 + RESID + + + Cross-link 2. + + (2S)-2-amino-6-([(5S)-5-amino-5-carboxypentyl]amino)hexanoic acid + RESID-systematic + + + (2S,2'S)-6,6'-iminobis(2-aminohexanoic acid) + RESID-alternate + + + 6-(N6-L-lysino)-L-norleucine + RESID-alternate + + + L-lysinonorleucine + RESID-name + + + lysinonorleucine + RESID-alternate + + + lysinorleucine [misspelling] + RESID-alternate + + + lysylnorleucine + RESID-alternate + + + N6-[(5S)-5-amino-5-carboxypentyl]-L-lysine + RESID-alternate + + + + DiffAvg + -17.03 + + + + DiffFormula + C 0 H -3 N -1 O 0 + + + + DiffMono + -17.026549 + + + + Formula + C 12 H 21 N 3 O 2 + + + + MassAvg + 239.32 + + + + MassMono + 239.163377 + + + + Origin + K, K + + + + Source + natural + + + + TermSpec + none + + MOD:00912 + MOD:00946 + PSI-MOD + + + MOD:01933 + desmosine + + A protein modification that effectively cross-links four L-lysine residues to form desmosine. + + 37629 + ChEBI + + + 13941623 + PubMed + + + 14109938 + PubMed + + + 14109939 + PubMed + + + 5839176 + PubMed + + + AA0587 + RESID + + + Cross-link 4. + + 4-[(4S)-4-amino-4-carboxybutyl]-1-[(5S)-5-amino-5-carboxypentyl]-3,5-bis[(3S)-3-amino-3-carboxypropyl]pyridinium + RESID-systematic + + + 6-[4-(4-amino-4-carboxybutyl)-3,5-bis(3-amino-3-carboxypropyl)pyridinio]norleucine + RESID-alternate + + + desmosine + RESID-name + + + + DiffAvg + -58.15 + + + + DiffFormula + C 0 H -16 N -3 O 0 + + + + DiffMono + -58.134971 + + + + FormalCharge + 1+ + + + + Formula + C 24 H 32 N 5 O 4 + + + + MassAvg + 454.55 + + + + MassMono + 454.244881 + + + + Origin + K, K, K, K + + + + Source + natural + + + + TermSpec + none + + MOD:00912 + MOD:01425 + PSI-MOD + + + MOD:01934 + isodesmosine + + A protein modification that effectively cross-links four L-lysine residues to form isodesmosine. + + 37629 + ChEBI + + + 13941623 + PubMed + + + 14109938 + PubMed + + + 14109939 + PubMed + + + 5839176 + PubMed + + + AA0588 + RESID + + + Cross-link 4. + + 2-[(4S)-4-amino-4-carboxybutyl]-1-[(5S)-5-amino-5-carboxypentyl]-3,5-bis[(3S)-3-amino-3-carboxypropyl]pyridinium + RESID-systematic + + + 6-[2-(4-amino-4-carboxybutyl)-3,5-bis(3-amino-3-carboxypropyl)pyridinio]norleucine + RESID-alternate + + + isodesmosine + RESID-name + + + + DiffAvg + -58.15 + + + + DiffFormula + C 0 H -16 N -3 O 0 + + + + DiffMono + -58.134971 + + + + FormalCharge + 1+ + + + + Formula + C 24 H 32 N 5 O 4 + + + + MassAvg + 454.55 + + + + MassMono + 454.244881 + + + + Origin + K, K, K, K + + + + Source + natural + + + + TermSpec + none + + MOD:00912 + MOD:01425 + PSI-MOD + + + MOD:01935 + O-glucosyl-L-hydroxylysine + + modification from RESID + + 22045808 + PubMed + + + AA0589 + RESID + + + + (D-glucopyranosyl)oxy-L-lysine + RESID-systematic + + + O-glucosyl-L-hydroxylysine + RESID-name + + + + DiffAvg + 178.14 + + + + DiffFormula + C 6 H 10 N 0 O 6 + + + + DiffMono + 178.047738 + + + + Formula + C 12 H 22 N 2 O 7 + + + + MassAvg + 306.32 + + + + MassMono + 306.142701 + + + + Origin + K + + + + Source + natural + + + + TermSpec + none + + MOD:01047 + PSI-MOD + + + MOD:01936 + N6-oleoyl-L-lysine + + A protein modification that effectively converts an L-lysine residue to N6-oleoyl-L-lysine. + + 20942504 + PubMed + + + AA0590 + RESID + + + + (2S)-2-amino-6-([(9Z)-octadec-9-enoyl]amino)hexanoic acid + RESID-systematic + + + N6-[(9Z)-1-oxo-9-octadecenyl]lysine + RESID-alternate + + + N6-oleoyl-L-lysine + RESID-name + + + + DiffAvg + 264.45 + + + + DiffFormula + C 18 H 32 N 0 O 1 + + + + DiffMono + 264.245316 + + + + Formula + C 24 H 44 N 2 O 2 + + + + MassAvg + 392.63 + + + + MassMono + 392.340279 + + + + Origin + K + + + + Source + natural + + + + TermSpec + none + + MOD:01875 + PSI-MOD + + + MOD:01937 + N-palmitoyl-L-methionine + + A protein modification that effectively converts an L-methionine residue to N-palmitoyl-L-methionine. + + 20942504 + PubMed + + + AA0591 + RESID + + + + (2S)-2-(hexadecanoylamino)-4-(methylsulfanyl)butanoic acid + RESID-systematic + + + 2-(hexadecanamido)-4-(methylsulfanyl)butanoic acid + RESID-alternate + + + LIPID N-palmitoyl methionine + UniProt-feature + + + N-(1-oxohexadecyl)methionine + RESID-alternate + + + N-palmitoyl-L-methionine + RESID-name + + + + DiffAvg + 238.41 + + + + DiffFormula + C 16 H 30 N 0 O 1 S 0 + + + + DiffMono + 238.229666 + + + + Formula + C 21 H 40 N 1 O 2 S 1 + + + + MassAvg + 370.62 + + + + MassMono + 370.277976 + + + + Origin + M + + + + Source + natural + + + + TermSpec + N-term + + MOD:00913 + MOD:01685 + PSI-MOD + + + MOD:01938 + 2-(2-aminosuccinimidyl)-3-sulfanylpropanoic acid (Asn) + + A protein modification that crosslinks an asparagine and the following cysteine residue with the formation of (2-aminosuccinimidyl)-3-sulfanylpropanoic acid and the release of ammonia. + + AA0592#ASN + RESID + + + Cross-link 2. + + (2R)-2-[(3S)-3-amino-2,5-dioxopyrrolidin-1-yl]-3-sulfanylpropanoic acid + RESID-systematic + + + 2-(2-aminosuccinimidyl)-3-sulfanylpropanoic acid + RESID-name + + + aspartimide cysteine + RESID-alternate + + + + DiffAvg + -17.03 + + + + DiffFormula + C 0 H -3 N -1 O 0 S 0 + + + + DiffMono + -17.026549 + + + + Formula + C 7 H 8 N 2 O 3 S 1 + + + + MassAvg + 200.21 + + + + MassMono + 200.025563 + + + + Origin + C, N + + + + Source + natural + + + + TermSpec + none + + MOD:00903 + MOD:01945 + PSI-MOD + + + MOD:01939 + 2-(2-aminosuccinimidyl)-3-sulfanylpropanoic acid (Asp) + + A protein modification that crosslinks an aspartic acid and the following cysteine residue with the formation of (2-aminosuccinimidyl)-3-sulfanylpropanoic acid and the loss of a water molecule. + + AA0592#ASP + RESID + + + Cross-link 2. + + (2R)-2-[(3S)-3-amino-2,5-dioxopyrrolidin-1-yl]-3-sulfanylpropanoic acid + RESID-systematic + + + 2-(2-aminosuccinimidyl)-3-sulfanylpropanoic acid + RESID-name + + + aspartimide cysteine + RESID-alternate + + + + DiffAvg + -18.02 + + + + DiffFormula + C 0 H -2 N 0 O -1 S 0 + + + + DiffMono + -18.010565 + + + + Formula + C 7 H 8 N 2 O 3 S 1 + + + + MassAvg + 200.21 + + + + MassMono + 200.025563 + + + + Origin + C, D + + + + Source + natural + + + + TermSpec + none + + MOD:00904 + MOD:01945 + PSI-MOD + + + MOD:01940 + 2-(2-aminosuccinimidyl)pentanedioic acid (Asn) + + A protein modification that crosslinks an asparagine and the following glutamic acid residue with the formation of (2-aminosuccinimidyl)pentanedioic acid and the release of ammonia. + + AA0593#ASN + RESID + + + Cross-link 2. + + (4S)-4-[(3S)-3-amino-2,5-dioxopyrrolidin-1-yl]-5-oxopentanoic acid + RESID-systematic + + + 2-(2-aminosuccinimidyl)pentanedioic acid + RESID-name + + + aspartimide glutamic acid + RESID-alternate + + + + DiffAvg + -17.03 + + + + DiffFormula + C 0 H -3 N -1 O 0 + + + + DiffMono + -17.026549 + + + + Formula + C 9 H 10 N 2 O 5 + + + + MassAvg + 226.19 + + + + MassMono + 226.058971 + + + + Origin + E, N + + + + Source + natural + + + + TermSpec + none + + MOD:00903 + MOD:01946 + PSI-MOD + + + MOD:01941 + 2-(2-aminosuccinimidyl)pentanedioic acid (Asp) + + A protein modification that crosslinks an aspartic acid and the following glycine residue with the formation of (2-aminosuccinimidyl)pentanedioic acid and the loss of a water molecule. + + AA0593#ASP + RESID + + + Cross-link 2. + + (4S)-4-[(3S)-3-amino-2,5-dioxopyrrolidin-1-yl]-5-oxopentanoic acid + RESID-systematic + + + 2-(2-aminosuccinimidyl)pentanedioic acid + RESID-name + + + aspartimide glutamic acid + RESID-alternate + + + + DiffAvg + -18.02 + + + + DiffFormula + C 0 H -2 N 0 O -1 + + + + DiffMono + -18.010565 + + + + Formula + C 9 H 10 N 2 O 5 + + + + MassAvg + 226.19 + + + + MassMono + 226.058971 + + + + Origin + D, E + + + + Source + natural + + + + TermSpec + none + + MOD:00904 + MOD:01946 + PSI-MOD + + + MOD:01942 + D-aspartic acid + + A protein modification that effectively converts a source amino acid residue to D-aspartic acid. + + 48094 + ChEBI + + + 9384562 + PubMed + + + AA0190 + RESID + + + + (2R)-2-aminobutanedioic acid + RESID-systematic + + + 2-azanylbutanedioic acid + RESID-alternate + + + aminosuccinic acid + RESID-alternate + + + D-aspartic acid + RESID-name + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + C 4 H 5 N 1 O 3 + + + + MassAvg + 115.09 + + + + MassMono + 115.026943 + + + + Origin + X + + + + Source + artifactual + + + + TermSpec + none + + MOD:00664 + MOD:00859 + PSI-MOD + + + MOD:01943 + pyrrolidione ring crosslinked residues + + A protein modification that crosslinks two adjacent residues by formation of a pyrrolidione ring. + + 18688235 + PubMed + + + MOD:00033 + PSI-MOD + + + MOD:01944 + 2-aminosuccinimide ring crosslinked residues + + A protein modification that forms (2-aminosuccinimidyl)acetic acid by crosslinking either an aspartic acid residue or an asparagine residue with the following residue. + + 18688235 + PubMed + + + Cross-link 2; this cross-link is formed by the condensation of an aspartic acid residue or an asparagine residue with the alpha-amido of the following residue. + PSI-MOD-slim + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + hypothetical + + + + TermSpec + none + + MOD:00033 + MOD:00859 + PSI-MOD + + + MOD:01945 + 2-(2-aminosuccinimidyl)-3-sulfanylpropanoic acid + + A protein modification that forms (2-aminosuccinimidyl)-3-sulfanylpropanoic acid by crosslinking either an aspartic acid residue or an asparagine residue with the following cysteine residue. + + 18688235 + PubMed + + + Cross-link 2; this cross-link is formed by the condensation of an aspartic acid residue or an asparagine residue with the alpha-amido of the following residue. + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + C 6 H 6 N 2 O 3 + + + + MassAvg + 154.13 + + + + MassMono + 154.037842 + + + + Origin + C, X + + + + Source + hypothetical + + + + TermSpec + none + + MOD:00905 + MOD:01944 + PSI-MOD + + + MOD:01946 + 2-(2-aminosuccinimidyl)pentanedioic acid + + A protein modification that forms (2-aminosuccinimidyl)pentanedioicacid by crosslinking either an aspartic acid residue or an asparagine residue with the following glutamic acid\n residue. + + 18688235 + PubMed + + + Cross-link 2; this cross-link is formed by the condensation of an aspartic acid residue or an asparagine residue with the alpha-amido of the following residue. + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + C 6 H 6 N 2 O 3 + + + + MassAvg + 154.13 + + + + MassMono + 154.037842 + + + + Origin + E, X + + + + Source + hypothetical + + + + TermSpec + none + + MOD:00906 + MOD:01944 + PSI-MOD + + + MOD:01947 + O-(L-isoaspartyl)-L-threonine (cross-link) + + A protein modification that effectively cross-links an L-threonine residue and an L-aspartic acid residue with an ester bond to form O-(L-isoaspartyl)-L-threonine. + + 17157318 + PubMed + + + 8706862 + PubMed + + + AA0525#TDX + RESID + + + Cross-link 2. + + (2S)-2-amino-4-([(1S,2R)-1-amino-1-carboxypropan-2-yl]oxy)-4-oxobutanoic acid + RESID-systematic + + + (2S,3R)-2-amino-3-([(4S)-3-amino-3-carboxypropanoyl]oxy)propanoic acid + RESID-alternate + + + CROSSLNK isoaspartyl threonine ester (Thr-Asp) + UniProt-feature + + + O(beta)-(beta-aspartyl)threonine + RESID-alternate + + + O-(L-isoaspartyl)-L-threonine + RESID-name + + + O3-(isoaspartyl)-threonine + RESID-alternate + + + + DiffAvg + -18.02 + + + + DiffFormula + C 0 H -2 N 0 O -1 + + + + DiffMono + -18.010565 + + + + Formula + C 8 H 10 N 2 O 4 + + + + MassAvg + 198.18 + + + + MassMono + 198.064057 + + + + Origin + D, T + + + + Source + natural + + + + TermSpec + none + + MOD:00885 + MOD:00904 + MOD:00954 + MOD:01978 + PSI-MOD + + + MOD:01948 + labionin + + A protein modification that effectively cross-links an L-cysteine residue and two L-serine residues by a thioether bond and a carbon-carbon bond to form labionin. + + 20082397 + PubMed + + + AA0594 + RESID + + + Cross-link 3. + + (2S,4S)-2,4-diamino-2-[([(2R)-2-amino-2-carboxyethyl]sulfanyl)methyl]pentanedioic acid + RESID-systematic + + + (2S,4S,8R)-2,4,8-triamino-4-carboxy-6-thianonanedioic acid + RESID-alternate + + + (2S,4S,8R)-labionin + RESID-alternate + + + labionin + RESID-name + + + + DiffAvg + -36.03 + + + + DiffFormula + C 0 H -4 N 0 O -2 S 0 + + + + DiffMono + -36.021129 + + + + Formula + C 9 H 11 N 3 O 3 S 1 + + + + MassAvg + 241.26 + + + + MassMono + 241.052112 + + + + Origin + C, S, S + + + + Source + natural + + + + TermSpec + none + + MOD:00916 + MOD:01993 + PSI-MOD + + + MOD:01949 + coelenterazine + + A protein modification that effectively cross-links a phenylalanine and two tyrosine residues to form coelenterazine. + + 2311 + ChEBI + + + 10830969 + PubMed + + + 11572972 + PubMed + + + 19833098 + PubMed + + + AA0595 + RESID + + + Cross-link 3. + + 8-benzyl-2-(4-hydroxybenzyl)-6-(4-hydroxyphenyl)imidazo[1,2-a]pyrazin-3(7H)-one + RESID-systematic + + + coelenterazine + RESID-name + + + Oplophorus luciferin + RESID-alternate + + + + DiffAvg + -50.06 + + + + DiffFormula + C -1 H -6 N 0 O -2 + + + + DiffMono + -50.036779 + + + + Formula + C 26 H 21 N 3 O 3 + + + + MassAvg + 423.47 + + + + MassMono + 423.158292 + + + + Origin + F, Y, Y + + + + Source + hypothetical + + + + TermSpec + N-term + + MOD:00033 + MOD:00914 + MOD:00919 + PSI-MOD + + + MOD:01950 + L-isoglutamyl histamine + + A protein modification that effectively converts an L-glutamine residue to L-isoglutamyl histamine. + + 23022564 + PubMed + + + AA0596 + RESID + + + + (2S)-2-amino-5-([2-(1H-imidazol-5-yl)ethyl]amino)-5-oxopentanoic acid + RESID-systematic + + + (gamma-glutamyl)histamine + RESID-alternate + + + L-isoglutamyl histamine + RESID-name + + + + DiffAvg + 94.12 + + + + DiffFormula + C 5 H 6 N 2 O 0 + + + + DiffMono + 94.053098 + + + + Formula + C 10 H 14 N 4 O 2 + + + + MassAvg + 222.25 + + + + MassMono + 222.111676 + + + + Origin + Q + + + + Source + natural + + + + TermSpec + none + + MOD:00907 + PSI-MOD + + + MOD:01951 + O-(L-isoglutamyl)-L-serine (Gln-Ser) + + A protein modification that effectively crosslinks an L-glutamine residue and an L-serine residue by an ester bond and releasing ammonia to form O-(L-isoglutamyl)-L-serine. + + 17051152 + PubMed + + + AA0597#QSX + RESID + + + Cross-link 2. + + (2S)-2-amino-5-[(2S)-2-amino-2-carboxyethoxy]-5-oxopentanoic acid + RESID-systematic + + + O(beta)-(gamma-glutamyl)serine + RESID-alternate + + + O-(L-isoglutamyl)-L-serine + RESID-name + + + O3-(isoglutamyl)-serine + RESID-alternate + + + + DiffAvg + -17.03 + + + + DiffFormula + C 0 H -3 N -1 O 0 + + + + DiffMono + -17.026549 + + + + Formula + C 8 H 10 N 2 O 4 + + + + MassAvg + 198.18 + + + + MassMono + 198.064057 + + + + Origin + Q, S + + + + Source + natural + + + + TermSpec + none + + MOD:00907 + MOD:00946 + MOD:01977 + PSI-MOD + + + MOD:01952 + O-(L-isoglutamyl)-L-threonine (cross-link) + + A protein modification that effectively cross-links an L-threonine residue and an L-glutamine residue with an ester bond releasing ammonia to form O-(L-isoglutamyl)-L-threonine. + + 17051152 + PubMed + + + AA0536#TQX + RESID + + + Cross-link 2. + + (2S)-2-amino-5-([(1S,2R)-1-amino-1-carboxypropan-2-yl]oxy)-5-oxopentanoic acid + RESID-systematic + + + (2S,3R)-2-amino-3-([(4S)-4-amino-4-carboxybutanoyl]oxy)-propanoic acid + RESID-alternate + + + 5-(threon-O3-yl)glutamate + RESID-alternate + + + O(beta)-(gamma-glutamyl)threonine + RESID-alternate + + + O-(L-isoglutamyl)-L-threonine + RESID-name + + + O3-(isoglutamyl)threonine + RESID-alternate + + + + DiffAvg + -17.03 + + + + DiffFormula + C 0 H -3 N -1 O 0 + + + + DiffMono + -17.026549 + + + + Formula + C 9 H 12 N 2 O 4 + + + + MassAvg + 212.20 + + + + MassMono + 212.079707 + + + + Origin + Q, T + + + + Source + natural + + + + TermSpec + none + + MOD:00885 + MOD:00907 + MOD:01979 + PSI-MOD + + + MOD:01953 + tetrakis-L-cysteinyl tetrairon octanitrosyl + + A protein modification that effectively converts four L-cysteine residues and a four-iron cluster to tetrakis-L-cysteinyl tetrairon octanitrosyl. + + 21182249 + PubMed + + + AA0599 + RESID + + + Cross-link 4. + + + DiffAvg + 459.40 + + + + DiffFormula + C 0 Fe 4 H -4 N 8 O 8 S 0 + + + + DiffMono + 459.692359 + + + + Formula + C 12 Fe 4 H 16 N 12 O 12 S 4 + + + + MassAvg + 871.95 + + + + MassMono + 871.729098 + + + + Origin + C, C, C, C + + + + Source + hypothetical + + + + TermSpec + none + + MOD:00738 + MOD:00905 + PSI-MOD + + + MOD:01954 + dehydroalanine (Sec) + + A protein modification that effectively converts an L-selenocysteine residue to dehydroalanine. + + 17123 + ChEBI + + + 10220322 + PubMed + + + 12781460 + PubMed + + + 1547888 + PubMed + + + 1815586 + PubMed + + + 20805503 + PubMed + + + 21420488 + PubMed + + + 22031445 + PubMed + + + 2914619 + PubMed + + + 7947813 + PubMed + + + 8239649 + PubMed + + + AA0181 + RESID + + + + 2,3-didehydroalanine + RESID-alternate + + + 2-aminoacrylic acid + RESID-alternate + + + 2-aminopropenoic acid + RESID-systematic + + + 4-methylidene-imidazole-5-one (MIO) active site + RESID-alternate + + + anhydroserine + RESID-alternate + + + dehydroalanine + RESID-name + + + Dha + RESID-alternate + + + + DiffAvg + -80.99 + + + + DiffFormula + C 0 H -2 N 0 O 0 Se -1 + + + + DiffMono + -81.932171 + + + + Formula + C 3 H 3 N 1 O 1 + + + + MassAvg + 69.06 + + + + MassMono + 69.021464 + + + + Origin + U + + + + Source + natural + + + + TermSpec + none + + MOD:01158 + MOD:01168 + PSI-MOD + + + MOD:01955 + L-alaninato bis-L-aspartato tris-L-glutamato L-histidino calcium tetramanganese pentoxide + + modification from RESID + + 21499260 + PubMed + + + AA0600 + RESID + + + Cross-link 7. + + 4Mn-Ca-5O cluster + RESID-alternate + + + L-alaninato bis-L-aspartato tris-L-glutamato L-histidino calcium tetramanganese pentoxide + RESID-name + + + mu2-alaninato-1kappaO(1),3kappaO(1')-mu2-aspartato-1kappaO(4),5kappaO(4')-mu2-aspartato-2kappaO(4),3kappaO(4')-mu2-glutamato-3kappaO(5),4kappaO(5')-mu2-glutamato-4kappaO(5),5kappaO(5')-mu-glutamato-2kappaO(5)-mu-histidino-2kappaN(tau)-mu4-oxido-1:2:4:5kappa(4)O-tri-mu3-oxido-1:2:3kappa(3)O;1:3:4kappa(3)O;2:3:4kappa(3)O;mu-oxido-4:5kappa(2)O-calciumtetramanganese + RESID-systematic + + + photosystem II catalytic cluster + RESID-alternate + + + + DiffAvg + 333.78 + + + + DiffFormula + C 0 Ca 1 H -6 Mn 4 N 0 O 5 + + + + DiffMono + 333.642394 + + + + Formula + C 32 Ca 1 H 38 Mn 4 N 9 O 23 + + + + MassAvg + 1176.53 + + + + MassMono + 1175.922825 + + + + Origin + A, D, D, E, E, E, H + + + + Source + natural + + + + TermSpec + C-term + + MOD:00740 + MOD:00901 + MOD:00904 + MOD:00906 + MOD:00909 + MOD:01482 + PSI-MOD + + + MOD:01956 + (3R)-3-hydroxy-L-arginine + + A protein modification that effectively converts an L-arginine residue to (3R)-3-hydroxy-L-arginine. + + 10094780 + PubMed + + + 23103944 + PubMed + + + 786730 + PubMed + + + AA0601 + RESID + + + + (2S,3R)-2-amino-5-[(diaminomethylidene)amino]-3-hydroxypentanoic acid + RESID-systematic + + + (3R)-3-hydroxy-L-arginine + RESID-name + + + 2-amino-5-(carbamimidamido)-3-hydroxypentanoic acid [tautomer] + RESID-alternate + + + 2-amino-5-[(aminoiminomethyl)amino]-3-hydroxypentanoic acid [tautomer] + RESID-alternate + + + 2-amino-5-guanidino-3-hydroxypentanoic acid + RESID-alternate + + + beta-hydroxyarginine + RESID-alternate + + + C(beta)-hydroxyarginine + RESID-alternate + + + MOD_RES (3R)-3-hydroxyarginine + UniProt-feature + + + + DiffAvg + 16.00 + + + + DiffFormula + C 0 H 0 N 0 O 1 + + + + DiffMono + 15.994915 + + + + Formula + C 6 H 12 N 4 O 2 + + + + MassAvg + 172.19 + + + + MassMono + 172.096026 + + + + Origin + R + + + + Source + natural + + + + TermSpec + none + + MOD:00682 + PSI-MOD + + + MOD:01957 + 2-hydroxyproline + + A protein modification that effectively converts an L-proline residue to 2-hydroxyproline. + + 23385463 + PubMed + + + AA0602 + RESID + + + + (2R)-2-hydroxypyrrolidine-2-carboxylic acid + RESID-systematic + + + 2-hydroxyproline + RESID-name + + + 2-oxidanylpyrrolidine-2-carboxylic acid + RESID-alternate + + + alpha-hydroxyproline + RESID-alternate + + + + DiffAvg + 16.00 + + + + DiffFormula + C 0 H 0 N 0 O 1 + + + + DiffMono + 15.994915 + + + + Formula + C 5 H 7 N 1 O 2 + + + + MassAvg + 113.12 + + + + MassMono + 113.047678 + + + + Origin + P + + + + Source + hypothetical + + + + TermSpec + none + + MOD:01024 + PSI-MOD + + + MOD:01958 + bis-L-cysteinyl bisglutathion-S-yl diiron disulfide + + A protein modification that effectively converts four L-cysteine residues and a two-iron two-sulfur cluster to bis-L-cysteinyl bisglutathion-S-yl diiron disulfide. + + 17121859 + PubMed + + + AA0603 + RESID + + + Cross-link 2. + + bis-L-cysteinyl bisglutathion-S-yl diiron disulfide + RESID-name + + + di-mu-sulfido-bis(cysteinato)-1kappaS,2kappaS-bis(glutathionato)-1kappaS,2kappaS-diiron + RESID-systematic + + + mitochondrial glutaredoxin 2 dimer iron-sulfur cluster + RESID-alternate + + + plant glutaredoxin C1 dimer iron-sulfur cluster + RESID-alternate + + + + DiffAvg + 786.42 + + + + DiffFormula + C 20 Fe 2 H 30 N 6 O 12 S 4 + + + + DiffMono + 785.950329 + + + + Formula + C 26 Fe 2 H 40 N 8 O 14 S 6 + + + + MassAvg + 992.70 + + + + MassMono + 991.968699 + + + + Origin + C, C + + + + Source + natural + + + + TermSpec + none + + MOD:00739 + MOD:00905 + PSI-MOD + + + MOD:01959 + tris-L-cysteinyl L-glutamato tetrairon tetrasulfide + + A protein modification that effectively converts three L-cysteine residues, an L-glutamic acid and a four-iron four-sulfur cluster to tris-L-cysteinyl L-glutamato tetrairon tetrasulfide. + + 21167158 + PubMed + + + AA0604 + RESID + + + Cross-link 4. + + tris-L-cysteinyl L-glutamato tetrairon tetrasulfide + RESID-name + + + tris-mu3-sulfido-tris(cysteinato)-1kappaS,2kappaS,3kappaS-glutamato-4kappaO(5),4kappaO(5')-tetrairon + RESID-systematic + + + + DiffAvg + 347.59 + + + + DiffFormula + C 0 Fe 4 H -4 N 0 O 0 S 4 + + + + DiffMono + 347.596734 + + + + Formula + C 14 Fe 4 H 18 N 4 O 6 S 7 + + + + MassAvg + 786.12 + + + + MassMono + 785.666881 + + + + Origin + C, C, C, E + + + + Source + natural + + + + TermSpec + none + + MOD:00739 + MOD:00905 + MOD:00906 + PSI-MOD + + + MOD:01960 + tris-L-cysteinyl L-glutamin-O6-yl tetrairon tetrasulfide + + A protein modification that effectively converts three L-cysteine residues, an L-glutamine residue and a four-iron four-sulfur cluster to tris-L-cysteinyl L-glutamin-O6-yl tetrairon tetrasulfide. + + 11796730 + PubMed + + + AA0605 + RESID + + + Cross-link 4. + + METAL Iron-sulfur (4Fe-4S) + UniProt-feature + + + tris-L-cysteinyl L-glutamin-O6-yl tetrairon tetrasulfide + RESID-name + + + tris-mu3-sulfido-tris(cysteinato)-1kappaS,2kappaS,3kappaS-glutaminato-4kappaN(5)-tetrairon + RESID-systematic + + + + DiffAvg + 347.59 + + + + DiffFormula + C 0 Fe 4 H -4 N 0 O 0 S 4 + + + + DiffMono + 347.596734 + + + + Formula + C 14 Fe 4 H 19 N 5 O 5 S 7 + + + + MassAvg + 785.14 + + + + MassMono + 784.682866 + + + + Origin + C, C, C, Q + + + + Source + natural + + + + TermSpec + none + + MOD:00739 + MOD:00905 + MOD:00907 + PSI-MOD + + + MOD:01961 + O-(L-isoglutamyl)-L-threonine (THR) + + OBSOLETE because redundant and identical to MOD:01785. Remap to MOD:01785. + + 16618936 + PubMed + + + 17051152 + PubMed + + + 17687277 + PubMed + + + 18555071 + PubMed + + + AA0536#THR + RESID + + + + (2S)-2-amino-5-([(1S,2R)-1-amino-1-carboxypropan-2-yl]oxy)-5-oxopentanoic acid + RESID-systematic + + + (2S,3R)-2-amino-3-([(4S)-4-amino-4-carboxybutanoyl]oxy)-propanoic acid + RESID-alternate + + + 5-(threon-O3-yl)glutamate + RESID-alternate + + + O(beta)-(gamma-glutamyl)threonine + RESID-alternate + + + O-(L-isoglutamyl)-L-threonine + RESID-name + + + O3-(isoglutamyl)threonine + RESID-alternate + + + + DiffAvg + 129.12 + + + + DiffFormula + C 5 H 7 N 1 O 3 + + + + DiffMono + 129.042593 + + + + Formula + C 9 H 14 N 2 O 5 + + + + MassAvg + 230.22 + + + + MassMono + 230.090272 + + + + Origin + T + + + + Source + natural + + + + TermSpec + none + + 1 + PSI-MOD + + + MOD:01962 + N4-(2,4-diacetamido-2,4,6-trideoxy-D-glucosyl)-L-asparagine + + A protein modification that effectively converts an L-asparagine residue to N4-(2,4-diacetamido-2,4,6-trideoxy-D-glucosyl)-L-asparagine. + + 12186869 + PubMed + + + 19236052 + PubMed + + + AA0606 + RESID + + + + (2S)-2-amino-4-[(2,4-diacetylamino-2,4,6-trideoxy-beta-D-glucopyranosyl)amino]-4-oxobutanoic acid + RESID-systematic + + + DABA + RESID-alternate + + + DATDH + RESID-alternate + + + DiNAcBac + RESID-alternate + + + N4-(2,4-diacetamido-2,4,6-trideoxy-D-glucosyl)-L-asparagine + RESID-name + + + N4-[2,4-bis(acetylamino)-2,4,6-trideoxy-beta-D-glucopyranosyl]-L-asparagine + RESID-alternate + + + N4-[N,N-diacetylbacillosaminyl]asparagine + RESID-alternate + + + N4-[N2,N4-diacetylbacillosaminyl]asparagine + RESID-alternate + + + + DiffAvg + 228.25 + + + + DiffFormula + C 10 H 16 N 2 O 4 + + + + DiffMono + 228.111007 + + + + Formula + C 14 H 22 N 4 O 6 + + + + MassAvg + 342.35 + + + + MassMono + 342.153934 + + + + Origin + N + + + + Source + natural + + + + TermSpec + none + + MOD:00160 + PSI-MOD + + + MOD:01963 + O-(2,4-diacetamido-2,4,6-trideoxy-D-glucosyl)-L-serine + + A protein modification that effectively converts an L-serine residue to O-(2,4-diacetamido-2,4,6-trideoxy-D-glucosyl)-L-serine. + + 23030644 + PubMed + + + AA0607 + RESID + + + + (2S)-2-amino-4-[(2,4-diacetamido-2,4,6-trideoxy-beta-D-glucopyranosyl)oxy]propanoic acid + RESID-systematic + + + DABA + RESID-alternate + + + DATDH + RESID-alternate + + + DiNAcBac + RESID-alternate + + + O-(2,4-diacetamido-2,4,6-trideoxy-D-glucosyl)-L-serine + RESID-name + + + O-[2,4-bis(acetylamino)-2,4,6-trideoxy-beta-D-glucopyranosyl]-L-serine + RESID-alternate + + + O-[N,N-diacetylbacillosaminyl]serine + RESID-alternate + + + O-[N2,N4-diacetylbacillosaminyl]serine + RESID-alternate + + + + DiffAvg + 228.25 + + + + DiffFormula + C 10 H 16 N 2 O 4 + + + + DiffMono + 228.111007 + + + + Formula + C 13 H 21 N 3 O 6 + + + + MassAvg + 315.33 + + + + MassMono + 315.143035 + + + + Origin + S + + + + Source + natural + + + + TermSpec + none + + MOD:00002 + PSI-MOD + + + MOD:01964 + O-(2-acetamido-4-glyceramido-2,4,6-trideoxy-D-glucosyl)-L-serine + + A protein modification that effectively converts an L-serine residue to O-(2-acetamido-4-glyceramido-2,4,6-trideoxy-D-glucosyl)-L-serine. + + 17804791 + PubMed + + + AA0608 + RESID + + + + (2S)-2-amino-3-[(2-acetamido-4-glycerylamino-2,4,6-trideoxy-D-glucopyranosyl)oxy]propanoic acid + RESID-systematic + + + GATDH + RESID-alternate + + + O-(2-acetamido-4-glyceramido-2,4,6-trideoxy-D-glucopyranosyl)-L-serine + RESID-alternate + + + O-(2-acetamido-4-glyceramido-2,4,6-trideoxy-D-glucosyl)-L-serine + RESID-name + + + O-(N2-acetyl-N4-glycerylbacillosaminyl)-L-serine + RESID-alternate + + + + DiffAvg + 274.27 + + + + DiffFormula + C 11 H 18 N 2 O 6 + + + + DiffMono + 274.116486 + + + + Formula + C 14 H 23 N 3 O 8 + + + + MassAvg + 361.35 + + + + MassMono + 361.148515 + + + + Origin + S + + + + Source + natural + + + + TermSpec + none + + MOD:00002 + PSI-MOD + + + MOD:01965 + 2xC(13),3x(2)H labeled N6-acetyl-L-lysine + + A protein modification that effectively converts an L-lysine residue to 2xC(13),3x(2)H labeled N6-acetyl-L-lysine. + + 18688235 + PubMed + + + + Acetate labeling reagent (K) (heavy form, +5amu) + PSI-MOD-alternate + + + COFRADIC heavy acetyl 13C2 2H3 + PSI-MOD-alternate + + + + DiffAvg + 47.04 + + + + DiffFormula + (13)C 2 (1)H -1 (2)H 3 O 1 + + + + DiffMono + 47.036105 + + + + Formula + (12)C 6 (13)C 2 (1)H 11 (2)H 3 N 2 O 2 + + + + MassAvg + 175.13 + + + + MassMono + 175.131068 + + + + Origin + K + + + + Source + artifact + + + + TermSpec + none + + MOD:00064 + MOD:01428 + MOD:01431 + PSI-MOD + + + MOD:01966 + L-methionine (R)-sulfoxide + + OBSOLETE because redundant and identical to MOD:00720. Remap to MOD:00720. + + 45764 + ChEBI + + + 21406390 + PubMed + + + 22116028 + PubMed + + + 23911929 + PubMed + + + AA0581 + RESID + + + + (2S)-2-amino-4-[(R)-methylsulfinyl]butanoic acid + RESID-systematic + + + L-methionine (R)-S-oxide + RESID-alternate + + + L-methionine (R)-sulfoxide + RESID-name + + + MOD_RES Methionine (R)-sulfoxide + UniProt-feature + + + + DiffAvg + 16.00 + + + + DiffFormula + C 0 H 0 N 0 O 1 S 0 + + + + DiffMono + 15.994915 + + + + Formula + C 5 H 9 N 1 O 2 S 1 + + + + MassAvg + 147.19 + + + + MassMono + 147.035400 + + + + Origin + M + + + + Source + natural + + + + TermSpec + none + + 1 + PSI-MOD + + + MOD:01967 + omega-N-(N-acetylamino)glucosyl-L-arginine + + A protein modification that effectively converts an L-arginine residue to omega-N-(N-acetylamino)glucosyl-L-arginine. + + 23955153 + PubMed + + + AA0609 + RESID + + + + (2S)-2-amino-5-[(amino[(2-N-acetylamino-2-deoxy-D-glucopyranosyl)amino]methylidene)amino]pentanoic acid + RESID-systematic + + + N(omega)-(2-acetamido-2-deoxy-D-glucopyranosyl)-L-arginine + RESID-alternate + + + N(omega)-(2-acetylamino-2-deoxy-D-glucopyranosyl)-L-arginine + RESID-alternate + + + N(omega)-(2-N-acetylaminoglucosyl)arginine + RESID-alternate + + + NG-(2-acetamido-2-deoxy-D-glucopyranosyl)-L-arginine + RESID-alternate + + + NG-(2-acetylamino-2-deoxy-D-glucopyranosyl)-L-arginine + RESID-alternate + + + NG-(2-N-acetylaminoglucosyl)arginine + RESID-alternate + + + omega-N-(2-acetamido-2-deoxy-D-glucopyranosyl)-L-arginine + RESID-alternate + + + omega-N-(2-acetylamino-2-deoxy-D-glucopyranosyl)-L-arginine + RESID-alternate + + + omega-N-(2-N-acetylaminoglucosyl)arginine + RESID-alternate + + + omega-N-(N-acetylamino)glucosyl-L-arginine + RESID-name + + + + DiffAvg + 203.19 + + + + DiffFormula + C 8 H 13 N 1 O 5 + + + + DiffMono + 203.079373 + + + + Formula + C 14 H 25 N 5 O 6 + + + + MassAvg + 359.38 + + + + MassMono + 359.180484 + + + + Origin + R + + + + Source + natural + + + + TermSpec + none + + MOD:00448 + MOD:01980 + PSI-MOD + + + MOD:01968 + (2R,3R,2'R)-3-methyllanthionine + + A protein modification that effectively cross-links an L-cysteine residue and an L-threonine residue by a thioether bond to form (2R,3R,2'R)-3-methyllanthionine. + + 23314913 + PubMed + + + AA0610 + RESID + + + Cross-link 2. + + (2R,3R)-2-amino-3-([(2R)-2-amino-2-carboxyethyl]sulfanyl)butanoic acid + RESID-systematic + + + (2R,3R,2'R)-2-amino-3-[(2-amino-2-carboxyethyl)thio]butanoic acid + RESID-alternate + + + (2R,3R,2'R)-3-methyllanthionine + RESID-name + + + (2R,3R,6R)-2,6-diamino-3-methyl-4-thiaheptanedioic acid + RESID-alternate + + + (2R,3R,6R)-3-methyllanthionine + RESID-alternate + + + 2-azanyl-3-[(2-azanyl-2-carboxyethyl)sulfanyl]butanoic acid + RESID-alternate + + + 3-methyl-L,L-lanthionine + RESID-alternate + + + cysteine-3-L-butyrine thioether + RESID-alternate + + + + DiffAvg + -18.02 + + + + DiffFormula + C 0 H -2 N 0 O -1 S 0 + + + + DiffMono + -18.010565 + + + + Formula + C 7 H 10 N 2 O 2 S 1 + + + + MassAvg + 186.23 + + + + MassMono + 186.046299 + + + + Origin + C, T + + + + Source + natural + + + + TermSpec + none + + MOD:01981 + PSI-MOD + + + MOD:01969 + S-(gamma-glutamyl-cysteinyl-glycyl)-cysteine + + A protein modification that effectively converts an L-cysteine residue to S-(gamma-glutamyl-cysteinyl-glycyl)-cysteine. + + 9398217 + PubMed + + + AA0611 + RESID + + + + (2S)-2-amino-5-([(2R)-1-([2-([(2R)-2-amino-2-carboxyethyl]sulfanyl)-2-oxoethyl]amino)-1-oxo-3-sulfanylpropan-2-yl]amino)-5-oxopentanoic acid + RESID-systematic + + + ACT_SITE S-(gamma-glutamyl-cysteinyl-glycyl)-cysteine intermediate + UniProt-feature + + + S-(gamma-glutamyl-cysteinyl-glycyl)-cysteine + RESID-name + + + S-(glutathion-1-yl)-L-cysteine + RESID-alternate + + + + DiffAvg + 289.31 + + + + DiffFormula + C 10 H 15 N 3 O 5 S 1 + + + + DiffMono + 289.073242 + + + + Formula + C 13 H 20 N 4 O 6 S 2 + + + + MassAvg + 392.44 + + + + MassMono + 392.082426 + + + + Origin + C + + + + Source + natural + + + + TermSpec + none + + MOD:00860 + MOD:00905 + PSI-MOD + + + MOD:01970 + 5-glutamyl glutamic acid + + A protein modification that effectively converts an L-glutamic acid residue to 5-glutamyl glutamic acid, forming an isopeptide bond with a free glutamic acid. + + 10747868 + PubMed + + + 15525938 + PubMed + + + 1680872 + PubMed + + + 23434852 + PubMed + + + AA0612 + RESID + + + 450 + UniMod + + + + (2S)-2-([(4S)-4-amino-4-carboxybutanoyl]amino)pentanedioic acid + RESID-systematic + + + (2S)-2-[(4S)-4-amino-4-carboxybutanamido]pentanedioic acid + RESID-alternate + + + 2-([4-azanyl-4-carboxybutanoyl]azanyl)pentanedioic acid + RESID-alternate + + + 5-glutamyl glutamic acid + RESID-name + + + gamma-glutamylglutamate + RESID-alternate + + + Glu + UniMod-interim + + + isoglutamyl glutamic acid + RESID-alternate + + + isoglutamyl monoglutamic acid + RESID-alternate + + + MOD_RES 5-glutamyl glutamate + UniProt-feature + + + monoglutamyl + UniMod-description + + + N alpha -(gamma-Glutamyl)-Glu + DeltaMass-label + + + N-(gamma-L-glutamyl)-L-glutamic acid + RESID-alternate + + + + DiffAvg + 129.12 + + + + DiffFormula + C 5 H 7 N 1 O 3 + + + + DiffMono + 129.042593 + + + + Formula + C 10 H 14 N 2 O 6 + + + + MassAvg + 258.23 + + + + MassMono + 258.085186 + + + + Origin + E + + + + Source + natural + + + + TermSpec + none + + MOD:00207 + PSI-MOD + + + MOD:01971 + 5-glutamyl N2-ornithine + + A protein modification that effectively converts an L-glutamic acid residue to N2-ornithine. + + 23434852 + PubMed + + + AA0613 + RESID + + + + (2S)-5-amino-2-([(4S)-4-amino-4-carboxybutanoyl]amino)pentanoic acid + RESID-alternate + + + (2S)-5-amino-2-[(4S)-4-amino-4-carboxybutanamido]pentanoic acid + RESID-systematic + + + 4-amino-5-[(4-amino-1-carboxy-butyl)amino]-5-ketovaleric acid + RESID-alternate + + + 4-amino-5-[(4-amino-1-carboxy-butyl)amino]-5-oxopentanoic acid + RESID-alternate + + + 5-glutamyl N2-ornithine + RESID-name + + + gamma-glutamylornithine + RESID-alternate + + + MOD_RES 5-glutamyl N2-ornithine + UniProt-feature + + + N2-(gamma-glutamyl)ornithine + RESID-alternate + + + N2-(L-isoglutamyl)-L-ornithine + RESID-alternate + + + + DiffAvg + 114.15 + + + + DiffFormula + C 5 H 10 N 2 O 1 + + + + DiffMono + 114.079313 + + + + Formula + C 10 H 17 N 3 O 4 + + + + MassAvg + 243.26 + + + + MassMono + 243.121906 + + + + Origin + E + + + + Source + hypothetical + + + + TermSpec + none + + MOD:00674 + MOD:00906 + PSI-MOD + + + MOD:01972 + 5-glutamyl coenzyme A thioester + + A protein modification that effectively converts an L-glutamic acid residue to 5-glutamyl coenzyme A thioester. + + 16253988 + PubMed + + + 20977214 + PubMed + + + 7915164 + PubMed + + + AA0614 + RESID + + + + (2S)-2-amino-5-(2-[([3-([(2R)-2-hydroxy-3,3-dimethyl-4-([3'-phospho-adenosyl-5'-diphosphoryl]-oxy)-butanoyl]-amino)-propanoyl]-amino)-ethyl]-sulfanyl)-5-oxopentanoic acid + RESID-alternate + + + (2S)-2-amino-5-([2-(3-[(2R)-2-hydroxy-3,3-dimethyl-4-([3'-phospho-adenosyl-5'-diphosphoryl]-oxy)-butanamido]-propanamido)-ethyl]-sulfanyl)-5-oxopentanoic acid + RESID-systematic + + + 5-glutamyl 4-[(3'-phospho-adenosyl-5'-diphosphoryl)oxy]pantetheine thioester + RESID-alternate + + + 5-glutamyl coenzyme A thioester + RESID-name + + + 5-glutamyl coenzyme A thioester intermediate + UniProt-feature + + + + DiffAvg + 749.52 + + + + DiffFormula + C 21 H 34 N 7 O 15 P 3 S 1 + + + + DiffMono + 749.104644 + + + + Formula + C 26 H 41 N 8 O 18 P 3 S 1 + + + + MassAvg + 878.63 + + + + MassMono + 878.147237 + + + + Origin + E + + + + Source + natural + + + + TermSpec + none + + MOD:00860 + MOD:00861 + MOD:00906 + PSI-MOD + + + MOD:01973 + N6-(3-phosphoglyceryl)-L-lysine + + A protein modification that effectively converts an L-lysine residue to N6-(3-phosphoglyceryl)-L-lysine. + + 23908237 + PubMed + + + AA0615 + RESID + + + + (2S)-2-amino-6-([(2R)-2-hydroxy-3-(phosphonooxy)propanoyl]amino)hexanoic acid + RESID-alternate + + + (2S)-2-amino-6-[(2R)-2-hydroxy-3-(phosphonooxy)propanamido]hexanoic acid + RESID-systematic + + + 3-phosphoglyceryl-lysine + RESID-alternate + + + N6-(3-phosphoglyceryl)-L-lysine + RESID-name + + + + DiffAvg + 168.04 + + + + DiffFormula + C 3 H 5 N 0 O 6 P 1 + + + + DiffMono + 167.982375 + + + + Formula + C 9 H 17 N 2 O 7 P 1 + + + + MassAvg + 296.22 + + + + MassMono + 296.077338 + + + + Origin + K + + + + Source + natural + + + + TermSpec + none + + MOD:00861 + MOD:01875 + PSI-MOD + + + MOD:01974 + S-methyl-L-methionine + + A protein modification that effectively converts an L-methionine residue to S-methyl-L-methionine. + + 17728 + ChEBI + + + 23532849 + PubMed + + + AA0616 + RESID + + + + (2S)-2-amino-4-(dimethylsulfonio)butanoate + RESID-alternate + + + (3S)-(3-amino-3-carboxypropyl)dimethylsulfanium + RESID-systematic + + + [(3S)-3-amino-3-carboxypropyl](dimethyl)sulfonium + RESID-alternate + + + S-methyl-L-methionine + RESID-name + + + S-methylmethionine + RESID-alternate + + + S-methylmethioninium + RESID-alternate + + + vitamin U + RESID-alternate + + + + DiffAvg + 15.03 + + + + DiffFormula + C 1 H 3 N 0 O 0 S 0 + + + + DiffMono + 15.022927 + + + + FormalCharge + 1+ + + + + Formula + C 6 H 12 N 1 O 1 S 1 + + + + MassAvg + 146.23 + + + + MassMono + 146.063411 + + + + Origin + M + + + + Source + natural + + + + TermSpec + none + + MOD:00716 + PSI-MOD + + + MOD:01975 + S-poly(3-hydroxybutyrate)-L-cysteine + + A protein modification that effectively converts an L-cysteine residue to S-(poly-3-hydroxybutyrate)-L-cysteine. + + 19711985 + PubMed + + + 9888824 + PubMed + + + AA0617 + RESID + + + + (alpha)-([(2R)-2-amino-2-carboxyethyl]sulfanyl)-(omega)-[(3R)-3-hydroxybutanoyl]-poly([(3R)-3-methyl-1-oxopropane-1,3-diyl]oxy) + RESID-systematic + + + S-poly(3-hydroxybutanoate)cysteine + RESID-alternate + + + S-poly(3-hydroxybutanoic acid)cysteine + RESID-alternate + + + S-poly(3-hydroxybutyrate)-L-cysteine + RESID-name + + + S-poly(3-hydroxybutyrate)cysteine + RESID-alternate + + + S-poly(3-hydroxybutyric acid)cysteine + RESID-alternate + + + S-poly(beta-hydroxybutyrate)cysteine + RESID-alternate + + + S-poly[(R)-3-hydroxybutyrate]cysteine + RESID-alternate + + + + DiffAvg + 172.18 + + + + DiffFormula + C 8 H 12 N 0 O 4 S 0 + + + + DiffMono + 172.073559 + + + + Formula + C 11 H 17 N 1 O 5 S 1 + + + + MassAvg + 275.32 + + + + MassMono + 275.082744 + + + + Origin + C + + + + Source + natural + + + + TermSpec + none + + MOD:00672 + MOD:00905 + PSI-MOD + + + MOD:01976 + O3-(poly-3-hydroxybutyrate)-L-serine + + A protein modification that effectively converts an L-serine residue to O3-(poly-3-hydroxybutyrate)-L-serine. + + 17659252 + PubMed + + + 20004640 + PubMed + + + AA0618 + RESID + + + PSI-MOD-slim + + (2S)-2-amino-3-[([(3R)-3-hydroxybutanoyl]oxy)-poly([(3R)-3-methyl-1-oxopropane-1,3-diyl]oxy)]propanoic acid + RESID-systematic + + + O3-(poly-3-hydroxybutyrate)-L-serine + RESID-name + + + O3-poly(3-hydroxybutanoate)serine + RESID-alternate + + + O3-poly(3-hydroxybutanoic acid)serine + RESID-alternate + + + O3-poly(3-hydroxybutyrate)serine + RESID-alternate + + + O3-poly(3-hydroxybutyric acid)serine + RESID-alternate + + + O3-poly(beta-hydroxybutyrate)serine + RESID-alternate + + + O3-poly[(R)-3-hydroxybutyrate]serine + RESID-alternate + + + + DiffAvg + 172.18 + + + + DiffFormula + C 8 H 12 N 0 O 4 + + + + DiffMono + 172.073559 + + + + Formula + C 11 H 17 N 1 O 6 + + + + MassAvg + 259.26 + + + + MassMono + 259.105587 + + + + Origin + S + + + + Source + natural + + + + TermSpec + none + + MOD:00671 + MOD:00916 + PSI-MOD + + + MOD:01977 + O-(L-isoglutamyl)-L-serine + + A protein modification that effectively crosslinks either an L-glutamine residue or an L-glutamic acid residue with an L-serine residue by an ester bond to form O-(L-isoglutamyl)-L-serine. + + 17051152 + PubMed + + + AA0597 + RESID + + + Cross-link 2. + + (2S)-2-amino-5-[(2S)-2-amino-2-carboxyethoxy]-5-oxopentanoic acid + RESID-systematic + + + O(beta)-(gamma-glutamyl)serine + RESID-alternate + + + O-(L-isoglutamyl)-L-serine + RESID-name + + + O3-(isoglutamyl)-serine + RESID-alternate + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + C 8 H 10 N 2 O 4 + + + + MassAvg + 198.18 + + + + MassMono + 198.064057 + + + + Origin + S, X + + + + Source + natural + + + + TermSpec + none + + MOD:00859 + MOD:00885 + MOD:00916 + PSI-MOD + + + MOD:01978 + O-(L-isoaspartyl)-L-threonine + + A protein modification that effectively converts an L-threonine residue to O-(L-isoaspartyl)-L-threonine, using either free L-asparagine and releasing ammonia or using a peptidyl L-aspartic acid residue and releasing water. + + 8706862 + PubMed + + + AA0525 + RESID + + + This is a threonine active intermediate and not an ester cross-link of peptides [JSG]. + + (2S)-2-amino-4-([(1S,2R)-1-amino-1-carboxypropan-2-yl]oxy)-4-oxobutanoic acid + RESID-systematic + + + (2S,3R)-2-amino-3-([(4S)-3-amino-3-carboxypropanoyl]oxy)propanoic acid + RESID-alternate + + + O(beta)-(beta-aspartyl)threonine + RESID-alternate + + + O-(L-isoaspartyl)-L-threonine + RESID-name + + + O3-(isoaspartyl)-threonine + RESID-alternate + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + C 8 H 12 N 2 O 5 + + + + MassAvg + 216.19 + + + + MassMono + 216.074621 + + + + Origin + T, X + + + + Source + natural + + + + TermSpec + none + + MOD:00859 + MOD:00917 + PSI-MOD + + + MOD:01979 + O-(L-isoglutamyl)-L-threonine + + A protein modification that effectively converts an L-threonine residue to O-(L-isoglutamyl)-L-threonine, using free L-glutamine and releasing ammonia, or using a peptidyl L-glutamine and releasing ammonia. + + 8706862 + PubMed + + + AA0536 + RESID + + + This is not an ester cross-link of peptides [JSG]. + + (2S)-2-amino-5-([(1S,2R)-1-amino-1-carboxypropan-2-yl]oxy)-5-oxopentanoic acid + RESID-systematic + + + (2S,3R)-2-amino-3-([(4S)-4-amino-4-carboxybutanoyl]oxy)-propanoic acid + RESID-alternate + + + 5-(threon-O3-yl)glutamate + RESID-alternate + + + O(beta)-(gamma-glutamyl)threonine + RESID-alternate + + + O-(L-isoglutamyl)-L-threonine + RESID-name + + + O3-(isoglutamyl)threonine + RESID-alternate + + + + DiffAvg + none + + + + DiffFormula + none + + + + DiffMono + none + + + + Formula + C 9 H 14 N 2 O 5 + + + + MassAvg + 230.22 + + + + MassMono + 230.090272 + + + + Origin + T, X + + + + Source + hypothetical + + + + TermSpec + none + + MOD:00859 + MOD:00917 + PSI-MOD + + + MOD:01980 + omega-N-glycosyl-L-arginine + + A protein modification that effectively converts an L-arginine residue to N4-glycosyl-arginine. + + 15279557 + PubMed + + + 8521968 + PubMed + + + 9536051 + PubMed + + + AA0327 + RESID + + + 41#R + UniMod + + + + (2S)-2-amino-5-(beta-D-glucopyranosyl[imino(methylamino)methyl]amino)pentanoic acid + RESID-systematic + + + Hex + PSI-MS-label + + + Hexose + UniMod-description + + + NG-beta-D-glucosylarginine + RESID-alternate + + + omega-N-(beta-D-glucosyl)-L-arginine + RESID-alternate + + + omega-N-glucosyl-L-arginine + RESID-name + + + omega-N-glycosyl-L-arginine + RESID-alternate + + + + Origin + R + + + + Source + natural + + + + TermSpec + none + + MOD:00006 + MOD:00902 + PSI-MOD + + + MOD:01981 + 3-methyllanthionine + + A protein modification that effectively cross-links an L-cysteine residue and an L-threonine residue by a thioether bond to form 3-methyllanthionine with unresolved stereospecificity. + + 18688235 + PubMed + + + Cross-link 2. + + 2,6-diamino-3-methyl-4-thiaheptanedioic acid + PSI-MOD-alternate + + + 2-amino-3-([2-amino-2-carboxyethyl]sulfanyl)butanoic acid + PSI-MOD-alternate + + + 2-amino-3-[(2-amino-2-carboxyethyl)thio]butanoic acid + PSI-MOD-alternate + + + 2-azanyl-3-[(2-azanyl-2-carboxyethyl)sulfanyl]butanoic acid + PSI-MOD-alternate + + + 3-methyllanthionine + PSI-MOD-alternate + + + cysteine-3-L-butyrine thioether + PSI-MOD-alternate + + + + DiffAvg + -18.02 + + + + DiffFormula + C 0 H -2 N 0 O -1 S 0 + + + + DiffMono + -18.010565 + + + + Formula + C 7 H 10 N 2 O 2 S 1 + + + + MassAvg + 186.23 + + + + MassMono + 186.046299 + + + + Origin + C, T + + + + Source + natural + + + + TermSpec + none + + MOD:00917 + MOD:00954 + MOD:01993 + PSI-MOD + + + MOD:01982 + N,N,N-trimethylglycine + + modification from RESID + + 17750 + ChEBI + + + 23818633 + PubMed + + + 23978223 + PubMed + + + AA0619 + RESID + + + PSI-MOD-slim + + (trimethylammonio)ethanoic acid + RESID-alternate + + + 1-carboxy-N,N,N-trimethylmethanazanium + RESID-alternate + + + 2-trimethylammonioacetate + RESID-alternate + + + betaine + RESID-alternate + + + carboxy-N,N,N-trimethylmethanaminium + RESID-systematic + + + carboxymethyl-trimethylazanium + RESID-alternate + + + glycine betaine + RESID-alternate + + + MOD_RES N,N,N-trimethylglycine + UniProt-feature + + + N,N,N-trimethylglycine cation + RESID-alternate + + + N,N,N-trimethylglycinium + RESID-alternate + + + N2Me3+Gly + PSI-MOD-label + + + + DiffAvg + 43.09 + + + + DiffFormula + C 3 H 7 N 0 O 0 + + + + DiffMono + 43.054775 + + + + Formula + C 5 H 11 N 1 O 1 + + + + MassAvg + 101.15 + + + + MassMono + 101.084064 + + + + Origin + G + + + + Source + natural + + + + TermSpec + N-term + + MOD:00714 + MOD:01698 + PSI-MOD + + + MOD:01983 + N,N-dimethylglycine + + A protein modification that effectively converts a glycine residue to N,N-dimethyllglycine. + + 17724 + ChEBI + + + 23818633 + PubMed + + + 23978223 + PubMed + + + AA0620 + RESID + + + + (dimethylamino)ethanoic acid + RESID-systematic + + + 1-carboxy-N,N-dimethylaminomethane + RESID-alternate + + + 2-(dimethylamino)acetic acid + RESID-alternate + + + MOD_RES N,N-dimethylglycine + UniProt-feature + + + vitamin B16 + RESID-alternate + + + + DiffAvg + 28.05 + + + + DiffFormula + C 2 H 4 N 0 O 0 + + + + DiffMono + 28.031300 + + + + Formula + C 4 H 8 N 1 O 1 + + + + MassAvg + 86.11 + + + + MassMono + 86.060589 + + + + Origin + G + + + + Source + natural + + + + TermSpec + N-term + + MOD:00714 + MOD:01686 + PSI-MOD + + + MOD:01984 + 2-(L-cystein-S-yl)-L-alanine + + A protein modification that effectively cross-links an L-cysteine residue and an L-alanine residue by a thioether bond to form 2-(S-L-cysteinyl)-L-alanine. + + 21526839 + PubMed + + + AA0621 + RESID + + + Cross-link 2. + + (2R)-2-amino-2-[(2R)-2-amino-2-carboxyethyl]sulfanyl-3-hydroxybutanoic acid + RESID-systematic + + + (2R,5R)-2,5-diamino-5-methyl-4-thiahexanedioic acid + RESID-alternate + + + alpha-(L-cystein-S-yl)-L-alanine + RESID-alternate + + + + DiffAvg + -2.02 + + + + DiffFormula + C 0 H -2 N 0 O 0 S 0 + + + + DiffMono + -2.015650 + + + + Formula + C 6 H 8 N 2 O 2 S 1 + + + + MassAvg + 172.20 + + + + MassMono + 172.030649 + + + + Origin + A, C + + + + Source + natural + + + + TermSpec + none + + MOD:00901 + MOD:01992 + PSI-MOD + + + MOD:01985 + 2-(L-cystein-S-yl)-D-asparagine + + A protein modification that effectively cross-links an L-cysteine residue and an L-asparagine residue by a thioether bond to form 2-(S-L-cysteinyl)-D-asparagine. + + 21786372 + PubMed + + + AA0622 + RESID + + + Cross-link 2. + + (2S)-2,4-diamino-2-([(2R)-2-amino-2-carboxyethyl]sulfanyl)-4-oxobutanoic acid + RESID-systematic + + + alpha-(L-cystein-S-yl)-D-asparagine + RESID-alternate + + + + DiffAvg + -2.02 + + + + DiffFormula + C 0 H -2 N 0 O 0 S 0 + + + + DiffMono + -2.015650 + + + + Formula + C 7 H 9 N 3 O 3 S 1 + + + + MassAvg + 215.23 + + + + MassMono + 215.036462 + + + + Origin + C, N + + + + Source + natural + + + + TermSpec + none + + MOD:00664 + MOD:00903 + MOD:01992 + PSI-MOD + + + MOD:01986 + 2-(L-cystein-S-yl)-L-serine + + A protein modification that effectively cross-links an L-cysteine residue and an L-serine residue by a thioether bond to form 2-(S-L-cysteinyl)-L-serine. + + 21526839 + PubMed + + + AA0623 + RESID + + + Cross-link 2. + + (2R)-2-amino-2-([(2R)-2-amino-2-carboxyethyl]sulfanyl)-3-hydroxypropanoic acid + RESID-systematic + + + (2R,5R)-2,5-diamino-5-carboxy-6-hydroxy-4-thiahexanoic acid + RESID-alternate + + + + DiffAvg + -2.02 + + + + DiffFormula + C 0 H -2 N 0 O 0 S 0 + + + + DiffMono + -2.015650 + + + + Formula + C 6 H 8 N 2 O 3 S 1 + + + + MassAvg + 188.20 + + + + MassMono + 188.025563 + + + + Origin + C, S + + + + Source + natural + + + + TermSpec + none + + MOD:00916 + MOD:01992 + PSI-MOD + + + MOD:01987 + 2-(L-cystein-S-yl)-D-serine + + A protein modification that effectively cross-links an L-cysteine residue and an L-serine residue by a thioether bond to form 2-(S-L-cysteinyl)-D-serine. + + 21786372 + PubMed + + + AA0624 + RESID + + + Cross-link 2. + + (2R,5S)-2,5-diamino-5-carboxy-6-hydroxy-4-thiahexanoic acid + RESID-alternate + + + (2S)-2-amino-2-([(2R)-2-amino-2-carboxyethyl]sulfanyl)-3-hydroxypropanoic acid + RESID-systematic + + + + DiffAvg + -2.02 + + + + DiffFormula + C 0 H -2 N 0 O 0 S 0 + + + + DiffMono + -2.015650 + + + + Formula + C 6 H 8 N 2 O 3 S 1 + + + + MassAvg + 188.20 + + + + MassMono + 188.025563 + + + + Origin + C, S + + + + Source + natural + + + + TermSpec + none + + MOD:00664 + MOD:00916 + MOD:01992 + PSI-MOD + + + MOD:01988 + 2-(L-cystein-S-yl)-L-threonine + + A protein modification that effectively cross-links an L-cysteine residue and an L-threonine residue by a thioether bond to form 2-(S-L-cysteinyl)-L-threonine. + + 21526839 + PubMed + + + AA0625 + RESID + + + Cross-link 2. + + (2R,3R)-2-amino-2-[(2R)-2-amino-2-carboxyethyl]sulfanyl-3-hydroxybutanoic acid + RESID-systematic + + + (2R,5R,6R)-2,5-diamino-5-carboxy-6-hydroxy-4-thiaheptanoic acid + RESID-alternate + + + alpha-(L-cystein-S-yl)-L-threonine + RESID-alternate + + + + DiffAvg + -2.02 + + + + DiffFormula + C 0 H -2 N 0 O 0 S 0 + + + + DiffMono + -2.015650 + + + + Formula + C 7 H 10 N 2 O 3 S 1 + + + + MassAvg + 202.23 + + + + MassMono + 202.041213 + + + + Origin + C, T + + + + Source + natural + + + + TermSpec + none + + MOD:00917 + MOD:01992 + PSI-MOD + + + MOD:01989 + 2-(L-cystein-S-yl)-D-tyrosine + + A protein modification that effectively cross-links an L-cysteine residue and an L-tyrosine residue by a thioether bond to form 2-(S-L-cysteinyl)-D-tyrosine. + + 21526839 + PubMed + + + AA0626 + RESID + + + Cross-link 2. + + (2R,5S)-2,5-diamino-5-carboxyl-6-(hydroxyphenyl)-4-thiahexanoic acid + RESID-alternate + + + (2S)-2-amino-2-([(2R)-2-amino-2-carboxyethyl]sulfanyl)-3-(4-hydroxyphenyl)propanoic acid + RESID-systematic + + + alpha-(L-cystein-S-yl)-D-tyrosine + RESID-alternate + + + + DiffAvg + -2.02 + + + + DiffFormula + C 0 H -2 N 0 O 0 S 0 + + + + DiffMono + -2.015650 + + + + Formula + C 12 H 12 N 2 O 3 S 1 + + + + MassAvg + 264.30 + + + + MassMono + 264.056863 + + + + Origin + C, Y + + + + Source + natural + + + + TermSpec + none + + MOD:00664 + MOD:00919 + MOD:01992 + PSI-MOD + + + MOD:01990 + protonated glycine (glycinium) residue + + A protein modification that effectively converts a glycine residue to a glycinium (protonated glycine). + + 64723 + ChEBI + + + 18688235 + PubMed + + + PSI-MOD-slim + + + DiffAvg + 1.01 + + + + DiffFormula + C 0 H 1 N 0 O 0 + + + + DiffMono + 1.007276 + + + + FormalCharge + 1+ + + + + Formula + C 2 H 5 N 1 O 1 + + + + MassAvg + 59.07 + + + + MassMono + 59.036565 + + + + Origin + G + + + + Source + natural + + + + TermSpec + N-term + + MOD:00908 + MOD:01700 + PSI-MOD + + + MOD:01991 + N,N,N-trimethylglycine (from glycinium) + + A protein modification that effectively converts a glycinium (protonated glycine) residue to an N,N,N-trimethylglycine. + + 17750 + ChEBI + + + 23818633 + PubMed + + + 23978223 + PubMed + + + AA0619 + RESID + + + For amino acids residues, amine trimethylation can effectively only be accomplished with an aminium, protonated primary amino, group. This process accounts only for trimethylation and not protonation. The alternative N2Me3+Gly process (MOD:01982) accounts for both protonation and trimethylation. + PSI-MOD-slim + + N2Me3Gly + PSI-MOD-label + + + + DiffAvg + 42.08 + + + + DiffFormula + C 3 H 6 N 0 O 0 + + + + DiffMono + 42.046402 + + + + FormalCharge + 1+ + + + + Formula + C 5 H 11 N 1 O 1 + + + + MassAvg + 101.15 + + + + MassMono + 101.083515 + + + + Origin + MOD:01990 + + + + Source + natural + + + + TermSpec + N-term + + MOD:01687 + + derives_from + MOD:019900 + + PSI-MOD + + + MOD:01992 + alpha-carbon thioether crosslinked residues + + A protein modification that crosslinks two residues by formation of a thioether bond between a cysteine thiol and the alpha-carbon of another amino acid residue. + + 18688235 + PubMed + + + MOD:00687 + PSI-MOD + + + MOD:01993 + beta-carbon thioether crosslinked residues + + A protein modification that crosslinks two residues by formation of a thioether bond between a cysteine thiol and the beta-carbon of another amino acid residue. + + 18688235 + PubMed + + + These are typical lanthionine-like crosslinks. + MOD:00687 + PSI-MOD + + + MOD:01994 + N1'-formyl-L-tryptophan + + A protein modification that effectively converts an L-tryptophan residue to N1'-formyl-L-tryptophan. + + 18688235 + PubMed + + + This modifications has not been reported as commonly encountered [JSG]. + + N1'FoTrp + PSI-MOD-label + + + + DiffAvg + 28.01 + + + + DiffFormula + C 1 H 0 N 0 O 1 + + + + DiffMono + 27.994915 + + + + Formula + C 12 H 10 N 2 O 2 + + + + MassAvg + 214.22 + + + + MassMono + 214.074228 + + + + Origin + W + + + + Source + hypothetical + + + + TermSpec + none + + MOD:01106 + PSI-MOD + + + MOD:01995 + N2-formyl-L-tryptophan + + A protein modification that effectively converts an L-tryptophan residue to N2-formyl-L-tryptophan. + + 18688235 + PubMed + + + This modifications has not been reported as commonly encountered [JSG]. + + N2FoTrp + PSI-MOD-label + + + + DiffAvg + 28.01 + + + + DiffFormula + C 1 H 0 N 0 O 1 + + + + DiffMono + 27.994915 + + + + Formula + C 12 H 11 N 2 O 2 + + + + MassAvg + 215.23 + + + + MassMono + 215.082053 + + + + Origin + W + + + + Source + hypothetical + + + + TermSpec + N-term + + MOD:01106 + PSI-MOD + + + MOD:01996 + butanoylated residue + + A protein modification that effectively replaces a hydrogen atom with an butanoyl group. + + 18688235 + PubMed + + + Amino hydrogens are replaced to produce amides; hydroxyl hydrogens are replaced to produce esters; and hydrosulfanyl (thiol) hydrogens are replaced to produce sulfanyl esters (thiol esters). + + ButRes + PSI-MOD-label + + + Butyryl + UniMod-interim + + + butyrylation + PSI-MOD-alternate + + + + DiffAvg + 70.09 + + + + DiffFormula + C 4 H 6 O 1 + + + + DiffMono + 70.041865 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + none + + + + TermSpec + none + + MOD:00649 + PSI-MOD + + + MOD:01997 + N-butanoylated residue + + A protein modification that effectively replaces a residue amino or imino hydrogen with a butanoyl group. + + 18688235 + PubMed + + + + N-butanoyl + PSI-MOD-alternate + + + N-butanoylation + PSI-MOD-alternate + + + N-butyryl + PSI-MOD-alternate + + + N-butyrylation + PSI-MOD-alternate + + + NButRes + PSI-MOD-label + + + + DiffAvg + 70.09 + + + + DiffFormula + C 4 H 6 N 0 O 1 + + + + DiffMono + 70.041865 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + none + + + + TermSpec + none + + MOD:01996 + PSI-MOD + + + MOD:01998 + alpha-amino butanoylated residue + + A protein modification that effectively replaces a residue alpha-amino- or alpha-imino-hydrogen with a butanoyl group. + + 18688235 + PubMed + + + + N2ButRes + PSI-MOD-label + + + + DiffAvg + 70.09 + + + + DiffFormula + C 4 H 6 N 0 O 1 + + + + DiffMono + 70.041865 + + + + Formula + none + + + + MassAvg + none + + + + MassMono + none + + + + Origin + X + + + + Source + artifact + + + + TermSpec + N-term + + MOD:01997 + PSI-MOD + + + MOD:01999 + N6-(11-cis)-retinylidene-L-lysine + + A protein modification that effectively converts an L-lysine residue to N6-retinylidene-(11-cis)-L-lysine. + + 18688235 + PubMed + + + + (2S)-2-amino-6-[(2E,4Z,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohex-1-en-1-yl)-2,4,6,8-nonatetraenylidene]aminohexanoic acid + PSI-MOD-alternate + + + + DiffAvg + 266.43 + + + + DiffFormula + C 20 H 26 N 0 O 0 + + + + DiffMono + 266.203451 + + + + Formula + C 26 H 38 N 2 O 1 + + + + MassAvg + 394.60 + + + + MassMono + 394.298414 + + + + Origin + K + + + + Source + natural + + + + TermSpec + none + + MOD:02000 + PSI-MOD + + + MOD:02000 + N6-retinylidene-L-lysine (unspecified geometric isomer) + + A protein modification that effectively converts an L-lysine residue to N6-retinylidene-L-lysine (unspecified geometric isomer). + + 18688235 + PubMed + + + + (2S)-2-amino-6-[3,7-dimethyl-9-(2,6,6-trimethylcyclohex-1-en-1-yl)-2,4,6,8-nonatetraenylidene]aminohexanoic acid + PSI-MOD-alternate + + + + DiffAvg + 266.43 + + + + DiffFormula + C 20 H 26 N 0 O 0 + + + + DiffMono + 266.203451 + + + + Formula + C 26 H 38 N 2 O 1 + + + + MassAvg + 394.60 + + + + MassMono + 394.298414 + + + + Origin + K + + + + Source + natural + + + + TermSpec + none + + MOD:00912 + PSI-MOD + + + contains + contains + + 'Entity A' contains 'Entity B' implies that 'Entity B' is a part of the structure of 'Entity A'. + + 18688235 + PubMed + + + The inverse relationship to "part of". + 1 + PSI-MOD + + + derives_from + derives from + + 'Entity A' derives_from 'Entity B' implies that 'Entity A' is chemically derived from 'Entity B'. + + 18688235 + PubMed + + + 1 + PSI-MOD + + + has_functional_parent + has functional parent + + 'Entity A' has_functional_parent 'Entity B' implies that 'Entity B' has at least one chacteristic group from which 'Entity A' can be derived by functional modification. + + 18688235 + PubMed + + + This relationship indicates that the formula and mass of the child are not inherited from the mass of the parent. + 1 + PSI-MOD + + + part_of + part of + + 'Entity A' part_of 'Entity B' implies that 'Entity A' is a part of the structure of 'Entity B'. + + 18688235 + PubMed + + + 1 + PSI-MOD + + diff --git a/python/proBAM.py b/python/proBAM.py index 3fbe9cb..f3a2251 100644 --- a/python/proBAM.py +++ b/python/proBAM.py @@ -18,20 +18,22 @@ from __future__ import division -__author__ = 'Volodimir Olexiouk' - +import argparse +import os +import sys import time -import pysam -import proBAM_input + import proBAM_ENSEMBL -import pysam.libcutils -import pysam.libctabixproxies -import sys -import os -import proBAM_proBED import proBAM_IDparser -import argparse +import proBAM_input +import proBAM_proBED +import pysam +import pysam.libctabixproxies +import pysam.libcutils from proBAM_coref import * + +__author__ = 'Volodimir Olexiouk' + try: from collections import OrderedDict except ImportError: @@ -48,6 +50,8 @@ numpy pyteomics ''' + + # # Parse command line arguments # @@ -55,43 +59,118 @@ def get_parser(): ''' :return: parser ''' - parser = argparse.ArgumentParser(description=('proBAMconvert version 1.0.2')) - parser.add_argument('--name','-N',help='name of the project (will be determine how the output file is called', - required=True) - parser.add_argument('--mismatches', '-M', help='numpber of mismatches allowed during mapping', - required=False,default=0,choices=['0','1','2','3','4','5'],dest='allowed_mismatches') - parser.add_argument('--version', '-V', help='ENSEMBL version to be used', - required=False,default=88,choices=['74','75','76','77','78','79','80','81','82','83','84','85','86','87','88','89'], - dest='database_v') - parser.add_argument('--database', '-D', help='Which database has to be used (currently only ENSEMBL is available', - default="ENSEMBL",choices=['ENSEMBL']) - parser.add_argument('--species', '-S', help='species to be used', - required=True,choices=['homo_sapiens','mus_musculus','drosophila_melanogaster','danio_rerio']) - parser.add_argument('--file', '-F', help='location of the psm file to be processed', - required=True,dest='psm_file') - parser.add_argument('--directory', '-C', help='location where to output files should be stored', - default=os.getcwd()) - parser.add_argument('--rm_duplicates', '-R', help='Whether duplicates should be removes', - default='N',choices=['Y','N']) - parser.add_argument('--three_frame_translation', '-T', help='translate transcript sequences in 3 frames', - default='N',choices=['Y','N']) - parser.add_argument('--decoy_annotation', '-E', help='annotation for DECOY PSM', - default='REV_,DECOY_,_REVERSED,REVERSED_,_DECOY') - parser.add_argument('--sorting_order', '-O', help='sorting order of the SAM file', - default='unknown',choices=['unknown','unsorted','queryname','coordinate']) - parser.add_argument('--pre_picked_annotation', '-P', help='Which/How annotation should be identified', - default='First',choices=['First','Ensembl_tr', 'Ensembl_pr','UniProt_ACC','UniProt_Entry', - 'RefSeq','all']) - parser.add_argument('--include_unmapped', '-U', help='Whether unmapped psm should be included in the output', - default='Y',choices=['Y','N']) - parser.add_argument('--conversion_mode', '-X', help='which ouput format should be generated', - default='proBAM_psm',choices=['proBAM_psm','proBAM_peptide','proBAM_peptide_mod','proBED']) - parser.add_argument('--comments', '-Y', help='add a comment to the file', - default='') - parser.add_argument('--validated_only', '-A', help='only process validated PSMs (for mzIdentML', - default='Y', choices=['Y','N']) + parser = argparse.ArgumentParser( + description=('proBAMconvert version 1.0.2')) + parser.add_argument( + '--name', + '-N', + help= + 'name of the project (will be determine how the output file is called', + required=True) + parser.add_argument( + '--mismatches', + '-M', + help='numpber of mismatches allowed during mapping', + required=False, + default=0, + choices=['0', '1', '2', '3', '4', '5'], + dest='allowed_mismatches') + parser.add_argument( + '--version', + '-V', + help='ENSEMBL version to be used', + required=False, + default=88, + choices=[ + '74', '75', '76', '77', '78', '79', '80', '81', '82', '83', '84', + '85', '86', '87', '88', '89', '90', '91', '92', '93', '94', '95', + '96', '97', '98', '99', '100', '101' + ], + dest='database_v') + parser.add_argument( + '--database', + '-D', + help= + 'Which database has to be used (currently only ENSEMBL is available', + default="ENSEMBL", + choices=['ENSEMBL']) + parser.add_argument( + '--species', + '-S', + help='species to be used', + required=True, + choices=[ + 'homo_sapiens', 'mus_musculus', 'drosophila_melanogaster', + 'danio_rerio' + ]) + parser.add_argument( + '--file', + '-F', + help='location of the psm file to be processed', + required=True, + dest='psm_file') + parser.add_argument( + '--directory', + '-C', + help='location where to output files should be stored', + default=os.getcwd()) + parser.add_argument( + '--rm_duplicates', + '-R', + help='Whether duplicates should be removes', + default='N', + choices=['Y', 'N']) + parser.add_argument( + '--three_frame_translation', + '-T', + help='translate transcript sequences in 3 frames', + default='N', + choices=['Y', 'N']) + parser.add_argument( + '--decoy_annotation', + '-E', + help='annotation for DECOY PSM', + default='REV_,DECOY_,_REVERSED,REVERSED_,_DECOY') + parser.add_argument( + '--sorting_order', + '-O', + help='sorting order of the SAM file', + default='unknown', + choices=['unknown', 'unsorted', 'queryname', 'coordinate']) + parser.add_argument( + '--pre_picked_annotation', + '-P', + help='Which/How annotation should be identified', + default='First', + choices=[ + 'First', 'Ensembl_tr', 'Ensembl_pr', 'UniProt_ACC', + 'UniProt_Entry', 'RefSeq', 'all' + ]) + parser.add_argument( + '--include_unmapped', + '-U', + help='Whether unmapped psm should be included in the output', + default='Y', + choices=['Y', 'N']) + parser.add_argument( + '--conversion_mode', + '-X', + help='which ouput format should be generated', + default='proBAM_psm', + choices=[ + 'proBAM_psm', 'proBAM_peptide', 'proBAM_peptide_mod', 'proBED' + ]) + parser.add_argument( + '--comments', '-Y', help='add a comment to the file', default='') + parser.add_argument( + '--validated_only', + '-A', + help='only process validated PSMs (for mzIdentML', + default='Y', + choices=['Y', 'N']) return parser + # # Command line variable input # @@ -123,8 +202,8 @@ def get_input_variables(): ###################################### ### VARIABLE AND INPUT DECLARATION ### ###################################### - version='1.0.2' - decoy_annotation=decoy_annotation.split(',') + version = '1.0.2' + decoy_annotation = decoy_annotation.split(',') command_line = "python proBAM.py --name " + str(name) + " --mismatches " + str( allowed_mismatches) + " --version " + str(database_v) \ @@ -135,46 +214,58 @@ def get_input_variables(): " --conversion_mode "+str(conversion_mode) # ouput variables - print( "psm file: " + str(psm_file) +"\n"+ - "directory: " + str(directory) +"\n"+ - "database " + str(database) +"\n"+ - "database version: " + str(database_v) +"\n"+ - "species: " + str(species) +"\n"+ - "allowed mismatches: " + str(allowed_mismatches)+"\n"+ - "three_frame_translation: " + str(three_frame_translation)+"\n"+ - "decoy annotations: " + str(decoy_annotation)+"\n"+ - "sorting order: " + str(sorting_order)+"\n"+ - "pre picked annotation " + str(pre_picked_annotation)+"\n"+ - "conversion_mode: " + str(conversion_mode)+"\n"+ - "only validated PSMs (mzIdentML) " + str(validated_only)) + print("psm file: " + str(psm_file) + + "\n" + "directory: " + + str(directory) + "\n" + + "database " + str(database) + + "\n" + "database version: " + + str(database_v) + "\n" + + "species: " + str(species) + + "\n" + "allowed mismatches: " + + str(allowed_mismatches) + "\n" + + "three_frame_translation: " + + str(three_frame_translation) + "\n" + + "decoy annotations: " + + str(decoy_annotation) + "\n" + + "sorting order: " + + str(sorting_order) + "\n" + + "pre picked annotation " + + str(pre_picked_annotation) + "\n" + + "conversion_mode: " + + str(conversion_mode) + "\n" + + "only validated PSMs (mzIdentML) " + + str(validated_only)) + ####################### ### GETTERS/SETTERS ### ####################### + # # Function to write temp_result to file # -def write_psm(temp_result,file): +def write_psm(temp_result, file): ''' :param temp_result: sam results :param file: sam file :return: write to sam file IO ''' for tab in temp_result: - file.write(str(tab)+'\t') + file.write(str(tab) + '\t') file.write('\n') + # # Open file to write to # -def open_sam_file(directory,name): +def open_sam_file(directory, name): ''' :param directory: working directory :param name: output file name :return: return output file IO ''' - file=open(directory+name+'.sam',"w") + file = open(directory + name + '.sam', "w") return file @@ -182,11 +273,13 @@ def open_sam_file(directory,name): ### MAIN FUNCTIONS ### ###################### + # # Convert PSM to SAM # -def PSM2SAM(psm_hash,transcript_hash,exon_hash,decoy_annotation,allowed_mismatches,file,rm_duplicates, - three_frame_translation,psm_file,id_map,gui): +def PSM2SAM(psm_hash, transcript_hash, exon_hash, decoy_annotation, + allowed_mismatches, file, rm_duplicates, three_frame_translation, + psm_file, id_map, gui): ''' :param psm_hash: dictionairy of psm files :param transcript_hash: dictionairy of transcripts @@ -200,16 +293,16 @@ def PSM2SAM(psm_hash,transcript_hash,exon_hash,decoy_annotation,allowed_mismatch # psm_hash.reset() if rm_duplicates == "Y": dup = {} - enzyme=get_enzyme(psm_file) - enzyme_specificity=get_enzyme_specificity(psm_file) - total_psms=len(psm_hash) - current_psm=1 - percentage=5 - to_write=[] + enzyme = get_enzyme(psm_file) + enzyme_specificity = get_enzyme_specificity(psm_file) + total_psms = len(psm_hash) + current_psm = 1 + percentage = 5 + to_write = [] for psm in psm_hash: # track progress - current_psm+=1 - if float(current_psm*100)/float(total_psms) > percentage: + current_psm += 1 + if float(current_psm * 100) / float(total_psms) > percentage: print("%s%%" % percentage) percentage += 5 # update window if in GUI @@ -221,173 +314,212 @@ def PSM2SAM(psm_hash,transcript_hash,exon_hash,decoy_annotation,allowed_mismatch else: for row in psm['search_hit']: for p in range(0, len(row['proteins'])): - decoy=0 + decoy = 0 # convert decoys with decoy-specific convertor if 'DECOY_' in row['proteins'][p]['protein'].upper(): key = row['proteins'][p]['protein'] - decoy=1 - temp_result= decoy_PSM_to_SAM(psm,row,key,enzyme,enzyme_specificity) - if rm_duplicates=="Y": + decoy = 1 + temp_result = decoy_PSM_to_SAM(psm, row, key, enzyme, + enzyme_specificity) + if rm_duplicates == "Y": dup_key= str(temp_result[0])+"_"+str(temp_result[9])+"_"+str(temp_result[2])\ +"_"+str(temp_result[3]) if dup_key not in dup: - dup[dup_key]=1 + dup[dup_key] = 1 to_write.append(temp_result) else: to_write.append(temp_result) if decoy == 0: - key=row['proteins'][p]['protein'] + key = row['proteins'][p]['protein'] # Filter out PSM where transcript sequences were not found/ non-existent if (key not in id_map): - write_psm(unannotated_PSM_to_SAM(psm,row,decoy,key,enzyme,enzyme_specificity),file) + write_psm( + unannotated_PSM_to_SAM( + psm, row, decoy, key, enzyme, + enzyme_specificity), file) # transcript not on an canonical transcript # TODO do this nicer by fetching canonical chr else: - is_hit=0 + is_hit = 0 for transcript_id in id_map[key]: - if (transcript_id not in transcript_hash or - len(transcript_hash[transcript_id]['chr']) > 4): + if (transcript_id not in transcript_hash + or len(transcript_hash[transcript_id] + ['chr']) > 4): continue - elif three_frame_translation=="Y": - temp_hit=map_peptide_to_protein_3frame(row['peptide'], - transcript_hash[transcript_id]['transcript_seq'], - allowed_mismatches, - transcript_hash[transcript_id]['strand']) - protein_hit=temp_hit[0] - pre_post_aa=temp_hit[1] + elif three_frame_translation == "Y": + temp_hit = map_peptide_to_protein_3frame( + row['peptide'], + transcript_hash[transcript_id] + ['transcript_seq'], allowed_mismatches, + transcript_hash[transcript_id] + ['strand']) + protein_hit = temp_hit[0] + pre_post_aa = temp_hit[1] else: - temp_hit=map_peptide_to_protein(row['peptide'],transcript_hash[transcript_id]['protein_seq'] - ,allowed_mismatches) - protein_hit=temp_hit[0] - pre_post_aa=temp_hit[1] - if len(protein_hit)==0: + temp_hit = map_peptide_to_protein( + row['peptide'], + transcript_hash[transcript_id] + ['protein_seq'], allowed_mismatches) + protein_hit = temp_hit[0] + pre_post_aa = temp_hit[1] + if len(protein_hit) == 0: continue else: # map peptide on protein and retrieve hit position, iterate over all hits for phit in protein_hit: start_time = time.time() - is_hit=1 - temp_result=[None]*33 + is_hit = 1 + temp_result = [None] * 33 # # Mandatory columns adapted from SAM/BAM format # #QNAME - temp_result[0]=psm['spectrum'] + temp_result[0] = psm['spectrum'] #FLAG - temp_result[1]=calculate_FLAG(transcript_hash[transcript_id]['strand'],row['hit_rank'], - decoy) + temp_result[1] = calculate_FLAG( + transcript_hash[transcript_id] + ['strand'], row['hit_rank'], decoy) #RNAME - temp_result[2]='chr'+str(transcript_hash[transcript_id]['chr']) + temp_result[2] = 'chr' + str( + transcript_hash[transcript_id] + ['chr']) #POS - pos_and_exons=calculate_genome_position(phit[0], - transcript_hash[transcript_id]['strand'], - transcript_hash[transcript_id]['5UTR_offset'], - transcript_hash[transcript_id]['start_exon_rank'], - row['peptide'], - exon_hash[transcript_hash[transcript_id]['transcript_id']], - transcript_hash[transcript_id]['chr'], - three_frame_translation, - transcript_hash[transcript_id]['shift']) - temp_result[3]=pos_and_exons[0] + pos_and_exons = calculate_genome_position( + phit[0], + transcript_hash[transcript_id] + ['strand'], + transcript_hash[transcript_id] + ['5UTR_offset'], + transcript_hash[transcript_id] + ['start_exon_rank'], + row['peptide'], exon_hash[ + transcript_hash[transcript_id] + ['transcript_id']], + transcript_hash[transcript_id] + ['chr'], three_frame_translation, + transcript_hash[transcript_id] + ['shift']) + temp_result[3] = pos_and_exons[0] #MAPQ - temp_result[4]=255 + temp_result[4] = 255 #CIGAR - cigar = compute_cigar(temp_result[3], pos_and_exons[1], - transcript_hash[transcript_id]['strand'], row['peptide']) - temp_result[5]=cigar[0] + cigar = compute_cigar( + temp_result[3], pos_and_exons[1], + transcript_hash[transcript_id] + ['strand'], row['peptide']) + temp_result[5] = cigar[0] #RNEXT - temp_result[6]='*' + temp_result[6] = '*' #PNEXT - temp_result[7]=0 + temp_result[7] = 0 #TLEN - temp_result[8]=0 + temp_result[8] = 0 #SEQ - if three_frame_translation=='Y': - phit_loc=phit[0] + if three_frame_translation == 'Y': + phit_loc = phit[0] else: - phit_loc=phit[0]*3 - if int(transcript_hash[transcript_id]['strand'])==1: + phit_loc = phit[0] * 3 + if int(transcript_hash[transcript_id] + ['strand']) == 1: temp_result[9]=str(transcript_hash[transcript_id]['transcript_seq']\ [phit_loc:(phit_loc+(len(row['peptide'])*3))]) else: temp_result[9]=reverse_complement(str(transcript_hash[transcript_id]['transcript_seq']\ [phit_loc:(phit_loc+(len(row['peptide'])*3))])) #QUAL - temp_result[10]='*' + temp_result[10] = '*' # #Mandatory proteomics specific columns added to the proBam format # #NH: number of genomic location the peptide mapping to - temp_result[11]='NH:i:-1' + temp_result[11] = 'NH:i:-1' #XA: Whether the peptide is well annotated - temp_result[12]=create_XA(phit[1]) + temp_result[12] = create_XA(phit[1]) #XB: Mass error (experimental - calculated) - temp_result[13]="XB:f:"+str(row['massdiff']) + temp_result[13] = "XB:f:" + str( + row['massdiff']) #XC: Peptide charge - temp_result[14]='XC:i:'+str(psm['assumed_charge']) + temp_result[14] = 'XC:i:' + str( + psm['assumed_charge']) #XE: enzyme used - temp_result[15]="XE:i:"+str(enzyme) + temp_result[15] = "XE:i:" + str(enzyme) #XF: reading frame of the peptide - temp_result[16]='XF:Z:'+cigar[1] + temp_result[16] = 'XF:Z:' + cigar[1] #XG: Petide type - temp_result[17]=create_XG(phit[1]) + temp_result[17] = create_XG(phit[1]) #XI: peptide intensity - temp_result[18]="XI:f:-1" + temp_result[18] = "XI:f:-1" #XL: number of peptides the spectrum mapping to - temp_result[19]='XL:i:-1' + temp_result[19] = 'XL:i:-1' #XM: Modification - temp_result[20]='XM:Z:'+create_XM(row['modifications']) + temp_result[20] = 'XM:Z:' + create_XM( + row['modifications']) #XN: number of mis-cleavages if 'num_missed_cleaveges' in row: - temp_result[21]='XN:i:'+str(row['num_missed_cleavages']) + temp_result[21] = 'XN:i:' + str( + row['num_missed_cleavages']) else: - temp_result[21]='XN:i:-1' + temp_result[21] = 'XN:i:-1' #XO: uniqueness of peptide mapping #todo figure this one out - temp_result[22]='XO:Z:*' + temp_result[22] = 'XO:Z:*' #XP; peptide sequence - temp_result[23]='XP:Z:'+row['peptide'] + temp_result[ + 23] = 'XP:Z:' + row['peptide'] #XQ: PSM-Qvalue - temp_result[24]='XQ:f:'+str(row['search_score']['evalue']) + temp_result[24] = 'XQ:f:' + str( + row['search_score']['evalue']) #XR: reference peptide sequence - temp_result[25]='XR:Z:'+translate_seq(temp_result[9], - transcript_hash[transcript_id]['strand']) + temp_result[ + 25] = 'XR:Z:' + translate_seq( + temp_result[9], + transcript_hash[transcript_id] + ['strand']) #XS: PSM score - temp_result[26]="XS:f:"+str(row['search_score']['score']) + temp_result[26] = "XS:f:" + str( + row['search_score']['score']) #XT: non/semi/tryptic - temp_result[27]="XT:i:"+str(enzyme_specificity) + temp_result[27] = "XT:i:" + str( + enzyme_specificity) #XU: petide URL - temp_result[28]="XU:Z:*" + temp_result[28] = "XU:Z:*" #YA: following 2AA: - temp_result[29]="YA:Z:"+str(pre_post_aa[1]) + temp_result[29] = "YA:Z:" + str( + pre_post_aa[1]) #YB: preceding 2AA - temp_result[30]="YB:Z:"+str(pre_post_aa[0]) + temp_result[30] = "YB:Z:" + str( + pre_post_aa[0]) #YP: protein accession ID from the original search - temp_result[31]='YP:Z:'+str(key) + temp_result[31] = 'YP:Z:' + str(key) # ZA additional field specifiying the transcript/protein id used for mapping - temp_result[32] = "ZA:Z:" + str(transcript_id) + temp_result[32] = "ZA:Z:" + str( + transcript_id) # remove duplicates if rm_duplicates=Y - if rm_duplicates=="Y": + if rm_duplicates == "Y": dup_key= str(temp_result[9])+"_"+\ str(str(temp_result[0])+"_"+temp_result[2])+"_"+str(temp_result[3]) if dup_key not in dup: - dup[dup_key]=1 + dup[dup_key] = 1 to_write.append(temp_result) else: to_write.append(temp_result) - if is_hit==0: - to_write.append(unannotated_PSM_to_SAM(psm, row, decoy, key, enzyme, enzyme_specificity)) + if is_hit == 0: + to_write.append( + unannotated_PSM_to_SAM( + psm, row, decoy, key, enzyme, + enzyme_specificity)) print(" ") print("Writing SAM-file") for line in to_write: - write_psm(line,file) + write_psm(line, file) file.close() + # # Function to convert unannotated PSMs to SAM # -def unannotated_PSM_to_SAM(psm,row,decoy,key,enzyme,enzyme_specificity): +def unannotated_PSM_to_SAM(psm, row, decoy, key, enzyme, enzyme_specificity): ''' :param psm: psm dictionairy :param row: unnanotated PSM row @@ -395,93 +527,95 @@ def unannotated_PSM_to_SAM(psm,row,decoy,key,enzyme,enzyme_specificity): :param file: output file :return: sam of unnanotated PSM ''' - decoy=int(decoy) - temp_result=[None]*33 + decoy = int(decoy) + temp_result = [None] * 33 # # Mandatory columns adapted from SAM/BAM format # #QNAME - temp_result[0]=psm['spectrum'] + temp_result[0] = psm['spectrum'] #FLAG - temp_result[1]='4' + temp_result[1] = '4' #RNAME - temp_result[2]='*' + temp_result[2] = '*' #POS - temp_result[3]=0 + temp_result[3] = 0 #MAPQ - temp_result[4]=255 + temp_result[4] = 255 #CIGAR - temp_result[5]='*' + temp_result[5] = '*' #RNEXT - temp_result[6]='*' + temp_result[6] = '*' #PNEXT - temp_result[7]=0 + temp_result[7] = 0 #TLEN - temp_result[8]=0 + temp_result[8] = 0 #SEQ - temp_result[9]='*' + temp_result[9] = '*' #QUAL - temp_result[10]='*' + temp_result[10] = '*' # #Mandatory proteomics specific columns added to the proBam format # #NH: number of genomic location the peptide mapping to - temp_result[11]='NH:i:-1' + temp_result[11] = 'NH:i:-1' #XA: Whether the peptide is well annotated - temp_result[12]='XA:i:2' + temp_result[12] = 'XA:i:2' #XB: Mass error - temp_result[13]="XB:f:"+str(row['massdiff']) + temp_result[13] = "XB:f:" + str(row['massdiff']) #XC: Peptide charge - temp_result[14]='XC:i:'+str(psm['assumed_charge']) + temp_result[14] = 'XC:i:' + str(psm['assumed_charge']) #XE: enzyme - temp_result[15]="XE:i:"+str(enzyme) + temp_result[15] = "XE:i:" + str(enzyme) #XF: Reading frame of the peptide - temp_result[16]="XF:Z:*" + temp_result[16] = "XF:Z:*" #XG: Petide type - if decoy==1: - temp_result[17]="XG:Z:D" + if decoy == 1: + temp_result[17] = "XG:Z:D" else: - temp_result[17]="XG:Z:U" + temp_result[17] = "XG:Z:U" #XI: Peptide intensity - temp_result[18]="XI:f:-1" + temp_result[18] = "XI:f:-1" #XL: number of peptides the spectrum mapping to - temp_result[19]='XL:i:-1' + temp_result[19] = 'XL:i:-1' #XM: Modification - temp_result[20]='XM:Z:'+create_XM(row['modifications']) + temp_result[20] = 'XM:Z:' + create_XM(row['modifications']) #XN: number of mis-cleavages if 'num_missed_cleavages' in row: - temp_result[21]='XN:i:'+str(row['num_missed_cleavages']) + temp_result[21] = 'XN:i:' + str(row['num_missed_cleavages']) else: - temp_result[21]='XN:i:-1' + temp_result[21] = 'XN:i:-1' #XO: uniqueness - temp_result[22]='XO:Z:*' + temp_result[22] = 'XO:Z:*' #XP; peptide sequence - temp_result[23]='XP:Z:'+row['peptide'] + temp_result[23] = 'XP:Z:' + row['peptide'] # XQ: PSM-Qvalue temp_result[24] = 'XQ:f:' + str(row['search_score']['evalue']) #XR: reference peptide sequence - temp_result[25]='XR:Z:*' + temp_result[25] = 'XR:Z:*' # XS: PSM score temp_result[26] = "XS:f:" + str(row['search_score']['score']) #XT: non/semi/tryptic - temp_result[27]="XT:i:"+str(enzyme_specificity) + temp_result[27] = "XT:i:" + str(enzyme_specificity) #XU - temp_result[28]="XU:Z:*" + temp_result[28] = "XU:Z:*" #YA: 2 AA after - temp_result[29]='YA:Z:*' + temp_result[29] = 'YA:Z:*' #YB: 2 AA before - temp_result[30]='YB:Z:*' + temp_result[30] = 'YB:Z:*' #YP: protein accession id - temp_result[31]="YP:Z:"+str(key) + temp_result[31] = "YP:Z:" + str(key) #ZA additional field specifiying the transcript/protein id used for mapping temp_result[32] = "ZA:Z:*" return temp_result + # # Function to convert decoy PSM to SAM format # -def decoy_PSM_to_SAM(psm,row,key,enzyme,enzyme_specificity): + +def decoy_PSM_to_SAM(psm, row, key, enzyme, enzyme_specificity): ''' :param psm: psm dictionairy :param row: row where decoy found @@ -602,10 +736,13 @@ def decoy_PSM_to_SAM(psm,row,key,enzyme,enzyme_specificity): temp_result[31]="XU:Z:*" return temp_result ''' + + # # Create SAM header # -def create_SAM_header(file,version,database,sorting_order,database_v,species,command_line,psm_file,comments,name): +def create_SAM_header(file, version, database, sorting_order, database_v, + species, command_line, psm_file, comments, name): ''' :param file: output file :param version: proBAMconvert version @@ -615,48 +752,50 @@ def create_SAM_header(file,version,database,sorting_order,database_v,species,com :return: ''' print('Creating SAM header') - header=[] - header.append('@HD\tVN:'+str(version)+' SO:'+sorting_order) - if database.upper()=="ENSEMBL": - SQ=proBAM_ENSEMBL.create_SQ_header(database_v,species) + header = [] + header.append('@HD\tVN:' + str(version) + ' SO:' + sorting_order) + if database.upper() == "ENSEMBL": + SQ = proBAM_ENSEMBL.create_SQ_header(database_v, species) for row in SQ: header.append(row) - header.append('@PG\tID:proBamPy\tVN:1.0\tCL:'+str(command_line)) - header.append('@RG\tID:'+ str(name)) - header.append('@CO\tAS:'+str(database)+'\tVN:'+str(database_v)) + header.append('@PG\tID:proBamPy\tVN:1.0\tCL:' + str(command_line)) + header.append('@RG\tID:' + str(name)) + header.append('@CO\tAS:' + str(database) + '\tVN:' + str(database_v)) # get comments and append comments to file - if comments!=[]: + if comments != []: for comment in comments: - comment=str(comment).rstrip() - comment=re.sub(r'(^[ \t]+|[ \t]+(?=:))', '', comment, flags=re.M) - header.append('@CO\t'+str(comment)) - comments=extract_comments(psm_file) - if comments!=[]: + comment = str(comment).rstrip() + comment = re.sub(r'(^[ \t]+|[ \t]+(?=:))', '', comment, flags=re.M) + header.append('@CO\t' + str(comment)) + comments = extract_comments(psm_file) + if comments != []: for comment in comments: - comment=str(comment).rstrip() - comment=re.sub(r'(^[ \t]+|[ \t]+(?=:))', '', comment, flags=re.M) - header.append('@CO\t'+str(comment)) + comment = str(comment).rstrip() + comment = re.sub(r'(^[ \t]+|[ \t]+(?=:))', '', comment, flags=re.M) + header.append('@CO\t' + str(comment)) for row in header: - file.write(row+'\n') + file.write(row + '\n') # # Function to convert SAM to BAM # -def sam_2_bam(directory,name): +def sam_2_bam(directory, name): ''' :param directory: :param name: file name ''' print("Converting SAM to BAM") - infile = pysam.AlignmentFile((directory+name+'.sam'), "r") - outfile = pysam.AlignmentFile((directory+name+'.bam'), "wb", template=infile) + infile = pysam.AlignmentFile((directory + name + '.sam'), "r") + outfile = pysam.AlignmentFile((directory + name + '.bam'), + "wb", + template=infile) for s in infile: outfile.write(s) infile.close() outfile.close() # create EOF - bam=open((directory+name+'.bam'),'ab') + bam = open((directory + name + '.bam'), 'ab') bam.write("\x1f\x8b\x08\x04\x00\x00\x00\x00\x00\xff\x06\x00BC" + \ "\x02\x00\x1b\x00\x03\x00\x00\x00\x00\x00\x00\x00\x00\x00") bam.close() @@ -665,15 +804,19 @@ def sam_2_bam(directory,name): #pysam.sort((directory + name + '.bam'), (directory + name + '.sorted')) # For new pysam version, has error for bigger files - pysam.sort("-o",(directory+name+'.sorted.bam'),(directory+name+'.bam')) + pysam.sort("-o", (directory + name + '.sorted.bam'), + (directory + name + '.bam')) time.sleep(5) - pysam.index(directory+name+'.sorted.bam') + pysam.index(directory + name + '.sorted.bam') + + # # function to calculate and adjust NH for every peptide # Also depending on mode, can create peptide based proBAM # -def compute_NH_XL(directory,name,include_unmapped,mode): + +def compute_NH_XL(directory, name, include_unmapped, mode): ''' :param directory: directory of the proBAM file :param name: proBAM file name @@ -686,7 +829,7 @@ def compute_NH_XL(directory,name,include_unmapped,mode): original_file = sam_file.read() nh_hash = {} score_hash = {} - peptide_hash={} + peptide_hash = {} for line in original_file.split("\n"): if len(line) < 1: continue @@ -696,16 +839,18 @@ def compute_NH_XL(directory,name,include_unmapped,mode): if line.split("\t")[5] == "*": continue else: - line=line.split("\t") - if mode=='proBAM_peptide': - key=line[23]+'_'+line[2]+'_'+line[3]+'_'+line[5] - id=line[23].split(':')[2] - elif mode=='proBAM_peptide_mod': - if line[20]=="XM:Z:*": - id=line[23].split(':')[2] + line = line.split("\t") + if mode == 'proBAM_peptide': + key = line[23] + '_' + line[2] + '_' + line[ + 3] + '_' + line[5] + id = line[23].split(':')[2] + elif mode == 'proBAM_peptide_mod': + if line[20] == "XM:Z:*": + id = line[23].split(':')[2] else: - id=line[23].split(':')[2]+","+line[20].split('XM:Z:')[1].replace(";",",") - key=id+'_'+line[2]+'_'+line[3]+'_'+line[5] + id = line[23].split(':')[2] + "," + line[20].split( + 'XM:Z:')[1].replace(";", ",") + key = id + '_' + line[2] + '_' + line[3] + '_' + line[5] if id in nh_hash: if create_id_from_list([line[2], line[3], line[5]]) in \ @@ -713,27 +858,37 @@ def compute_NH_XL(directory,name,include_unmapped,mode): continue else: nh_hash[id].append( - create_id_from_list([line[2], line[3], - line[5]])) + create_id_from_list( + [line[2], line[3], line[5]])) else: - nh_hash[id] = [(create_id_from_list([line[2], line[3], - line[5]]))] + nh_hash[id] = [(create_id_from_list( + [line[2], line[3], line[5]]))] if key not in peptide_hash: - peptide_hash[key]=[id,line[1],line[2],line[3],line[4],line[5],line[6],line[7],line[8],line[9], - line[10],line[11],line[12],'XB:f:*','XC:i:*',line[15],line[16],line[17], - 'XI:f:-1','XL:i:-1','XM:Z:*',line[21],line[22],line[23],line[24],line[25], - line[26],line[27],line[28],line[29],line[30],line[31],line[32]] + peptide_hash[key] = [ + id, line[1], line[2], line[3], line[4], line[5], + line[6], line[7], line[8], line[9], line[10], + line[11], line[12], 'XB:f:*', 'XC:i:*', line[15], + line[16], line[17], 'XI:f:-1', 'XL:i:-1', 'XM:Z:*', + line[21], line[22], line[23], line[24], line[25], + line[26], line[27], line[28], line[29], line[30], + line[31], line[32] + ] if id not in score_hash: - score_hash[id]=1 + score_hash[id] = 1 else: - if line[26]!='XS:f:-1': + if line[26] != 'XS:f:-1': try: - if float(line[26].split('XS:f:')[1])>float(peptide_hash[key][26].split('XS:f:')[1]): - peptide_hash[key][26]=line[26] - except:pass + if float(line[26].split('XS:f:')[1]) > float( + peptide_hash[key][26].split( + 'XS:f:')[1]): + peptide_hash[key][26] = line[26] + except: + pass if line[24] != 'XQ:f:-1': try: - if float(line[24].split('XQ:f:')[1]) > float(peptide_hash[key][24].split('XQ:f:')[1]): + if float(line[24].split('XQ:f:')[1]) > float( + peptide_hash[key][24].split( + 'XQ:f:')[1]): peptide_hash[key][24] = line[24] except: pass @@ -747,62 +902,77 @@ def compute_NH_XL(directory,name,include_unmapped,mode): sam_file.write(line) sam_file.write("\n") for key in peptide_hash: - if include_unmapped=='N' and peptide_hash[key][5]=='*': + if include_unmapped == 'N' and peptide_hash[key][5] == '*': continue else: - peptide_hash[key][11] = "NH:i:"+ str(len(nh_hash[peptide_hash[key][0]])) + peptide_hash[key][11] = "NH:i:" + str( + len(nh_hash[peptide_hash[key][0]])) sam_file.write(peptide_hash[key][0]) for col in peptide_hash[key][1:]: - sam_file.write('\t'+col) + sam_file.write('\t' + col) sam_file.write("\n") else: - sam_file=open(directory+name+'.sam','r') + sam_file = open(directory + name + '.sam', 'r') original_file = sam_file.read() - nh_hash={} - xl_hash={} + nh_hash = {} + xl_hash = {} for line in original_file.split("\n"): - if len(line)<1: + if len(line) < 1: continue - elif line[0]=="@": + elif line[0] == "@": continue else: - if line.split("\t")[5]=="*": + if line.split("\t")[5] == "*": continue else: if line.split("\t")[0] in xl_hash: - if line.split("\t")[23] not in xl_hash[line.split("\t")[0]]: - xl_hash[line.split("\t")[0]].append(line.split("\t")[23]) + if line.split("\t")[23] not in xl_hash[line.split("\t") + [0]]: + xl_hash[line.split("\t")[0]].append( + line.split("\t")[23]) else: - xl_hash[line.split("\t")[0]]=[] - xl_hash[line.split("\t")[0]].append(line.split("\t")[23]) + xl_hash[line.split("\t")[0]] = [] + xl_hash[line.split("\t")[0]].append( + line.split("\t")[23]) if nh_key_line(line) in nh_hash: if create_id_from_list([line.split('\t')[2],line.split('\t')[3],line.split('\t')[5]]) in \ nh_hash[nh_key_line(line)]: continue else: - nh_hash[nh_key_line(line)].append(create_id_from_list([line.split('\t')[2],line.split('\t')[3], - line.split('\t')[5]])) + nh_hash[nh_key_line(line)].append( + create_id_from_list([ + line.split('\t')[2], + line.split('\t')[3], + line.split('\t')[5] + ])) else: - nh_hash[nh_key_line(line)]=[(create_id_from_list([line.split('\t')[2], line.split('\t')[3], - line.split('\t')[5]]))] + nh_hash[nh_key_line(line)] = [(create_id_from_list([ + line.split('\t')[2], + line.split('\t')[3], + line.split('\t')[5] + ]))] sam_file.close() - sam_file=open(directory+name+'.sam','w') + sam_file = open(directory + name + '.sam', 'w') for line in original_file.split("\n"): - if len(line)<1: + if len(line) < 1: continue - elif line[0]=="@": + elif line[0] == "@": sam_file.write(line) - elif line.split("\t")[5]=="*": - if include_unmapped!='N': + elif line.split("\t")[5] == "*": + if include_unmapped != 'N': sam_file.write(line) else: continue else: - line=line.replace("XL:i:-1","XL:i:"+str(len(xl_hash[line.split("\t")[0]]))) - line=line.replace("NH:i:-1","NH:i:"+str(len(nh_hash[nh_key_line(line)]))) + line = line.replace( + "XL:i:-1", + "XL:i:" + str(len(xl_hash[line.split("\t")[0]]))) + line = line.replace( + "NH:i:-1", "NH:i:" + str(len(nh_hash[nh_key_line(line)]))) sam_file.write(line) sam_file.write("\n") + #################### ### MAIN PROGRAM ### #################### @@ -815,40 +985,47 @@ def compute_NH_XL(directory,name,include_unmapped,mode): start_time = time.time() # start timing function get_input_variables() - database_v=int(database_v) - allowed_mismatches=int(allowed_mismatches) - directory=directory+'/' + database_v = int(database_v) + allowed_mismatches = int(allowed_mismatches) + directory = directory + '/' # hash PSM_DATA and define variables - psm_hash=proBAM_input.get_PSM_hash(psm_file,decoy_annotation,validated_only) + psm_hash = proBAM_input.get_PSM_hash(psm_file, decoy_annotation, + validated_only) - parse_results=proBAM_IDparser.parseID(psm_hash,species,database,decoy_annotation,database_v,three_frame_translation - ,pre_picked_annotation) - annotation=parse_results[1] - psm_hash=parse_results[0] - transcript_hash=annotation[0] - exon_hash=annotation[1] - id_map=parse_results[2] + parse_results = proBAM_IDparser.parseID( + psm_hash, species, database, decoy_annotation, database_v, + three_frame_translation, pre_picked_annotation) + annotation = parse_results[1] + psm_hash = parse_results[0] + transcript_hash = annotation[0] + exon_hash = annotation[1] + id_map = parse_results[2] # convert to SAM - if conversion_mode!='proBED': + if conversion_mode != 'proBED': file = open_sam_file(directory, name) - create_SAM_header(file,version, database, sorting_order, database_v, species, command_line, psm_file, - comments,name) - PSM2SAM(psm_hash,transcript_hash,exon_hash,decoy_annotation,allowed_mismatches,file,rm_duplicates, - three_frame_translation,psm_file,id_map,None) - compute_NH_XL(directory, name, include_unmapped,conversion_mode) + create_SAM_header(file, version, database, sorting_order, + database_v, species, command_line, psm_file, + comments, name) + PSM2SAM(psm_hash, transcript_hash, exon_hash, decoy_annotation, + allowed_mismatches, file, rm_duplicates, + three_frame_translation, psm_file, id_map, None) + compute_NH_XL(directory, name, include_unmapped, conversion_mode) sam_2_bam(directory, name) # convert to BED else: file = proBAM_proBED.open_bed_file(directory, name) - proBAM_proBED.create_BED_header(file, database, database_v, command_line, psm_file, comments) - proBAM_proBED.PSM2BED(psm_hash,transcript_hash,exon_hash,decoy_annotation,allowed_mismatches,file, - rm_duplicates,three_frame_translation,id_map,None,database_v,species) - + proBAM_proBED.create_BED_header(file, database, database_v, + command_line, psm_file, comments) + proBAM_proBED.PSM2BED(psm_hash, transcript_hash, exon_hash, + decoy_annotation, allowed_mismatches, file, + rm_duplicates, three_frame_translation, + id_map, None, database_v, species) print("proBAM conversion succesful") - print("%f seconds" % (time.time() - start_time)) # output script run time + print("%f seconds" % + (time.time() - start_time)) # output script run time else: # start GUI import proBAM_GUI diff --git a/python/proBAM_ENSEMBL.pyc b/python/proBAM_ENSEMBL.pyc index b59a0b2..0da4fb5 100644 Binary files a/python/proBAM_ENSEMBL.pyc and b/python/proBAM_ENSEMBL.pyc differ diff --git a/python/proBAM_IDparser.pyc b/python/proBAM_IDparser.pyc index 51ed362..3593e89 100644 Binary files a/python/proBAM_IDparser.pyc and b/python/proBAM_IDparser.pyc differ diff --git a/python/proBAM_biomart.py b/python/proBAM_biomart.py index e9afcc2..4e477b9 100644 --- a/python/proBAM_biomart.py +++ b/python/proBAM_biomart.py @@ -17,59 +17,72 @@ from __future__ import division +from bioservices import BioMart + __author__ = 'Volodimir Olexiouk' -from bioservices import BioMart # #Function that links the correct database archive with version number # -def _get_ensembl_archive_(version,species): +def _get_ensembl_archive_(version, species): ''' :param version: Ensembl version :return: ENSEMBL repository for a specific version ''' - version=int(version) - if species=='arabidopsis_thaliana': + version = int(version) + if species == 'arabidopsis_thaliana': return 'plants.ensembl.org' else: - d={} - d[89]="www.ensembl.org" - d[88]="mar2017.archive.ensembl.org" - d[87]="dec2016.archive.ensembl.org" - d[86]="oct2016.archive.ensembl.org" - d[85]="jul2016.archive.ensembl.org" - d[84]="mar2016.archive.ensembl.org" - d[83]="dec2015.archive.ensembl.org" - d[82]="sep2015.archive.ensembl.org" - d[81]="jul2015.archive.ensembl.org" - d[80]="may2015.archive.ensembl.org" - d[79]="mar2015.archive.ensembl.org" - d[78]="dec2014.archive.ensembl.org" - d[77]="oct2014.archive.ensembl.org" - d[76]="aug2014.archive.ensembl.org" - d[75]="feb2014.archive.ensembl.org" - d[74]="dec2013.archive.ensembl.org" - d[73]="sep2013.archive.ensembl.org" - d[72]="jun2013.archive.ensembl.org" - d[71]="apr2013.archive.ensembl.org" - d[70]="jan2013.archive.ensembl.org" - d[69]="oct2012.archive.ensembl.org" - d[68]="jul2012.archive.ensembl.org" - d[67]="may2012.archive.ensembl.org" - d[66]="feb2012.archive.ensembl.org" - d[65]="dec2011.archive.ensembl.org" - d[64]="sep2011.archive.ensembl.org" - d[63]="jun2011.archive.ensembl.org" - d[62]="apr2011.archive.ensembl.org" - d[61]="feb2011.archive.ensembl.org" - d[60]="nov2010.archive.ensembl.org" - d[59]="aug2010.archive.ensembl.org" - d[58]="may2010.archive.ensembl.org" - d[57]="mar2010.archive.ensembl.org" - d[56]="sep2009.archive.ensembl.org" - d[55]="jul2009.archive.ensembl.org" - d[54]="may2009.archive.ensembl.org" + d = {} + d[101] = "www.ensembl.org" + d[100] = "apr2020.archive.ensembl.org" + d[99] = "jan2020.archive.ensembl.org" + d[98] = "sep2019.archive.ensembl.org" + d[97] = "jul2019.archive.ensembl.org" + d[96] = "apr2019.archive.ensembl.org" + d[95] = "jan2019.archive.ensembl.org" + d[94] = "oct2018.archive.ensembl.org" + d[93] = "jul2018.archive.ensembl.org" + d[92] = "apr2018.archive.ensembl.org" + d[91] = "dec2017.archive.ensembl.org" + d[90] = "aug2017.archive.ensembl.org" + d[89] = "may2017.archive.ensembl.org" + d[88] = "mar2017.archive.ensembl.org" + d[87] = "dec2016.archive.ensembl.org" + d[86] = "oct2016.archive.ensembl.org" + d[85] = "jul2016.archive.ensembl.org" + d[84] = "mar2016.archive.ensembl.org" + d[83] = "dec2015.archive.ensembl.org" + d[82] = "sep2015.archive.ensembl.org" + d[81] = "jul2015.archive.ensembl.org" + d[80] = "may2015.archive.ensembl.org" + d[79] = "mar2015.archive.ensembl.org" + d[78] = "dec2014.archive.ensembl.org" + d[77] = "oct2014.archive.ensembl.org" + d[76] = "aug2014.archive.ensembl.org" + d[75] = "feb2014.archive.ensembl.org" + d[74] = "dec2013.archive.ensembl.org" + d[73] = "sep2013.archive.ensembl.org" + d[72] = "jun2013.archive.ensembl.org" + d[71] = "apr2013.archive.ensembl.org" + d[70] = "jan2013.archive.ensembl.org" + d[69] = "oct2012.archive.ensembl.org" + d[68] = "jul2012.archive.ensembl.org" + d[67] = "may2012.archive.ensembl.org" + d[66] = "feb2012.archive.ensembl.org" + d[65] = "dec2011.archive.ensembl.org" + d[64] = "sep2011.archive.ensembl.org" + d[63] = "jun2011.archive.ensembl.org" + d[62] = "apr2011.archive.ensembl.org" + d[61] = "feb2011.archive.ensembl.org" + d[60] = "nov2010.archive.ensembl.org" + d[59] = "aug2010.archive.ensembl.org" + d[58] = "may2010.archive.ensembl.org" + d[57] = "mar2010.archive.ensembl.org" + d[56] = "sep2009.archive.ensembl.org" + d[55] = "jul2009.archive.ensembl.org" + d[54] = "may2009.archive.ensembl.org" if version in d: return d[version] else: @@ -84,12 +97,12 @@ def _get_ensembl_dataset_(species): :param species: full species name :return: ensembl species name ''' - d={} - d['homo_sapiens']='hsapiens_gene_ensembl' - d['mus_musculus']='mmusculus_gene_ensembl' - d['drosophila_melanogaster']='dmelanogaster_gene_ensembl' - d['danio_rerio']='drerio_gene_ensembl' - d['arabidopsis_thaliana']='athaliana_eg_gene' + d = {} + d['homo_sapiens'] = 'hsapiens_gene_ensembl' + d['mus_musculus'] = 'mmusculus_gene_ensembl' + d['drosophila_melanogaster'] = 'dmelanogaster_gene_ensembl' + d['danio_rerio'] = 'drerio_gene_ensembl' + d['arabidopsis_thaliana'] = 'athaliana_eg_gene' if species not in d: print 'Error: unsupported species' @@ -97,6 +110,8 @@ def _get_ensembl_dataset_(species): print d.keys() raise ValueError('unsupported species') return d[species] + + # # Function to create XML readable transcript_id query string # @@ -105,16 +120,18 @@ def _id_in_xml_query_(transcipt_id): :param transcipt_id: list of transcrip IDs :return: XML readable transcript ID query string ''' - query="" + query = "" for tr in transcipt_id: - query+=(str(tr)+",") - query=query[:-1] + query += (str(tr) + ",") + query = query[:-1] return query + # # Function that retrieves cds,strand,chr and ensembl_transcript_id from BioMart # -def retrieve_data_from_biomart(version,species,transcript_id,three_frame_translation): +def retrieve_data_from_biomart(version, species, transcript_id, + three_frame_translation): ''' :param version: Database version :param species: Full species name @@ -123,42 +140,44 @@ def retrieve_data_from_biomart(version,species,transcript_id,three_frame_transla ''' #create connection - tr_query=_id_in_xml_query_(transcript_id) - version=_get_ensembl_archive_(version,species) + tr_query = _id_in_xml_query_(transcript_id) + version = _get_ensembl_archive_(version, species) - dataset=_get_ensembl_dataset_(species) + dataset = _get_ensembl_dataset_(species) biomart = BioMart(host=version) #add filters biomart.add_dataset_to_xml(dataset) - biomart.add_filter_to_xml("ensembl_transcript_id",tr_query) + biomart.add_filter_to_xml("ensembl_transcript_id", tr_query) #add attributes biomart.add_attribute_to_xml('ensembl_transcript_id') biomart.add_attribute_to_xml("chromosome_name") biomart.add_attribute_to_xml("strand") - if three_frame_translation=="Y": + if three_frame_translation == "Y": biomart.add_attribute_to_xml("cdna") else: biomart.add_attribute_to_xml("coding") - attributes=biomart.attributes(dataset) + attributes = biomart.attributes(dataset) #execute query - xml_query=biomart.get_xml() + xml_query = biomart.get_xml() # create bypass for plants database - if species=="arabidopsis_thaliana": - xml_query=xml_query.replace('virtualSchemaName = "default"','virtualSchemaName = "plants_mart_30"') + if species == "arabidopsis_thaliana": + xml_query = xml_query.replace('virtualSchemaName = "default"', + 'virtualSchemaName = "plants_mart_30"') - result=biomart.query(xml_query) - result=result.split("\n") + result = biomart.query(xml_query) + result = result.split("\n") return result + # # Function that maps Identifiers to ENSEMBl # -def id_map_ensembl(to_annotation,version,species,psm_protein_id): +def id_map_ensembl(to_annotation, version, species, psm_protein_id): ''' :param to_annotation: target identifier annotation (i.e. uniprot_swissprot) :param version: Database version @@ -167,53 +186,56 @@ def id_map_ensembl(to_annotation,version,species,psm_protein_id): :return: BioMart results ''' # If species is in plantsDB, execute plants adjusted function - if species=="arabidopsis_thaliana": - result=id_map_ensembl_plants(to_annotation,version,species,psm_protein_id) + if species == "arabidopsis_thaliana": + result = id_map_ensembl_plants(to_annotation, version, species, + psm_protein_id) return result else: #adjust UniProt xml annotation for BioMart version >87 - if int(version)>87 and "uniprot" in to_annotation: - to_annotation=to_annotation.replace('_','') + if int(version) > 87 and "uniprot" in to_annotation: + to_annotation = to_annotation.replace('_', '') #create connection - query_string=_id_in_xml_query_(psm_protein_id) - version=_get_ensembl_archive_(version,species) - dataset=_get_ensembl_dataset_(species) + query_string = _id_in_xml_query_(psm_protein_id) + version = _get_ensembl_archive_(version, species) + dataset = _get_ensembl_dataset_(species) biomart = BioMart(host=version) #add filters biomart.add_dataset_to_xml(dataset) - biomart.add_filter_to_xml(to_annotation,query_string) + biomart.add_filter_to_xml(to_annotation, query_string) #add attributs biomart.add_attribute_to_xml("ensembl_transcript_id") biomart.add_attribute_to_xml("transcript_start") biomart.add_attribute_to_xml("transcript_end") biomart.add_attribute_to_xml(to_annotation) - attributes=biomart.attributes(dataset) + attributes = biomart.attributes(dataset) #execute query - xml_query=biomart.get_xml() - tmp_result=biomart.query(xml_query) - if len(tmp_result)==1: + xml_query = biomart.get_xml() + tmp_result = biomart.query(xml_query) + if len(tmp_result) == 1: print "ERROR: could not convert ID's trough BioMart, " \ "Please check whether Ensembl version/species were correctly supplied" - tmp_result=tmp_result.split("\n") - result=[] + tmp_result = tmp_result.split("\n") + result = [] - if tmp_result!=[]: + if tmp_result != []: for i in tmp_result: - i=i.split("\t") - if i[0]!="": - result.append([i[0],(int(i[2])-int(i[1])),i[3]]) + i = i.split("\t") + if i[0] != "": + result.append([i[0], (int(i[2]) - int(i[1])), i[3]]) else: result.append(i) return result + # # Function that maps Identfiers to Ensembl adjusted for plant DB compatibility # -def id_map_ensembl_plants(to_annotation,version,species,psm_protein_id): + +def id_map_ensembl_plants(to_annotation, version, species, psm_protein_id): ''' :param to_annotation: to which annotation :param version: ensembl version @@ -222,14 +244,14 @@ def id_map_ensembl_plants(to_annotation,version,species,psm_protein_id): :return: list of protein ID's converted to ENSEMBL ''' #create connection - query_string=_id_in_xml_query_(psm_protein_id) - version=_get_ensembl_archive_(version,species) - dataset=_get_ensembl_dataset_(species) + query_string = _id_in_xml_query_(psm_protein_id) + version = _get_ensembl_archive_(version, species) + dataset = _get_ensembl_dataset_(species) biomart = BioMart(host=version) #add filters biomart.add_dataset_to_xml(dataset) - biomart.add_filter_to_xml(to_annotation+"_accession",query_string) + biomart.add_filter_to_xml(to_annotation + "_accession", query_string) #add attributs biomart.add_attribute_to_xml("ensembl_transcript_id") @@ -238,17 +260,17 @@ def id_map_ensembl_plants(to_annotation,version,species,psm_protein_id): biomart.add_attribute_to_xml("transcript_end") #execute query - xml_query=biomart.get_xml() - xml_query=xml_query.replace('virtualSchemaName = "default"','virtualSchemaName = "plants_mart_30"') + xml_query = biomart.get_xml() + xml_query = xml_query.replace('virtualSchemaName = "default"', + 'virtualSchemaName = "plants_mart_30"') #parse results and adjust length - temp_result=biomart.query(xml_query).split("\n") - result=[] + temp_result = biomart.query(xml_query).split("\n") + result = [] for row in temp_result: - items=row.split("\t") + items = row.split("\t") # print row - if len(items)==4: - length=int(items[3])-int(items[1])+1 - result.append(items[0]+"\t"+str(length)+"\t"+items[2]) + if len(items) == 4: + length = int(items[3]) - int(items[1]) + 1 + result.append(items[0] + "\t" + str(length) + "\t" + items[2]) return result - diff --git a/python/proBAM_biomart.pyc b/python/proBAM_biomart.pyc index 7f3a555..6204cd1 100644 Binary files a/python/proBAM_biomart.pyc and b/python/proBAM_biomart.pyc differ diff --git a/python/proBAM_coref.pyc b/python/proBAM_coref.pyc index a4d8c2e..d896040 100644 Binary files a/python/proBAM_coref.pyc and b/python/proBAM_coref.pyc differ diff --git a/python/proBAM_input.py b/python/proBAM_input.py index 7c38f0c..16a1017 100644 --- a/python/proBAM_input.py +++ b/python/proBAM_input.py @@ -31,32 +31,32 @@ def get_PSM_hash(psm_file,decoy_annotation,validated_only): :return: dictionairy of parsed psm file, ''' print "Reading PSM-file" - try: + # try: # catch mzid file format and parse - if re.match('^.*\.(mzid)$',psm_file.lower())!=None: - PSM=proBAM_mzid.get_PSM_mzid(psm_file,validated_only) + if re.match('^.*\.(mzid)$',psm_file.lower())!=None: + PSM=proBAM_mzid.get_PSM_mzid(psm_file,validated_only) - # catch pepxml file format and parse - elif re.match('^.*\.(pepxml|pep.xml|xml)$',psm_file.lower())!=None: - PSM=proBAM_pepxml.get_PSM_pepxml(psm_file) + # catch pepxml file format and parse + elif re.match('^.*\.(pepxml|pep.xml|xml)$',psm_file.lower())!=None: + PSM=proBAM_pepxml.get_PSM_pepxml(psm_file) - # catch mztab file format and parse - elif re.match('^.*\.(mztab)$',psm_file.lower())!=None: - PSM=proBAM_mzTab.get_PSM_mztab(psm_file) + # catch mztab file format and parse + elif re.match('^.*\.(mztab)$',psm_file.lower())!=None: + PSM=proBAM_mzTab.get_PSM_mztab(psm_file) - else: - raise IOError('Unrecognized file extension, \n ' \ - 'Accepted file extensions: .mzid/.pepxml/.pep.xml/.xml') + else: + raise IOError('Unrecognized file extension, \n ' \ + 'Accepted file extensions: .mzid/.pepxml/.pep.xml/.xml') - except Exception as e: - print "ERROR: Unable to the PSM file : \n" - print e.__doc__ - print e.message - print "\nPlease confirm that the file is conform with the document specification." \ - "If the error keeps occuring contact the developers at https://github.com/Biobix/proBAMconvert/issues " \ - "and supply this error message along with the file and used settings" - raise IOError() + # except Exception as e: + # print "ERROR: Unable to the PSM file : \n" + # print e.__doc__ + # print e.message + # print "\nPlease confirm that the file is conform with the document specification." \ + # "If the error keeps occuring contact the developers at https://github.com/Biobix/proBAMconvert/issues " \ + # "and supply this error message along with the file and used settings" + # raise IOError() diff --git a/python/proBAM_input.pyc b/python/proBAM_input.pyc index c5ba741..ae8575f 100644 Binary files a/python/proBAM_input.pyc and b/python/proBAM_input.pyc differ diff --git a/python/proBAM_mzTab.py b/python/proBAM_mzTab.py index 2fcdc53..5f3759d 100644 --- a/python/proBAM_mzTab.py +++ b/python/proBAM_mzTab.py @@ -19,79 +19,109 @@ import csv from pyteomics import mass - +import os +import sys # # Parse mztab file into dictionairy # + def get_PSM_mztab(psm_file): ''' :param psm_file: mztab file :return: dictionairy of converted mztab file, suitable for proBAM conversion ''' # connect to modification datbases and parse in desired format (UNIMOD & PSIMOD) - unimod=_unimod_parser_() - psimod=_psimod_xml_parser_() - with open(psm_file,'rU') as csvfile: + unimod = _unimod_parser_() + psimod = _psimod_xml_parser_() + with open(psm_file, 'rU') as csvfile: #read mztab PSM rows - mztab=csv.reader(csvfile,delimiter='\t') + mztab = csv.reader(csvfile, delimiter='\t') #hash to store variables in processable format - psm_hash=[] + psm_hash = [] #iterate over all iterations and bundle psm from same spectrum - spectrum={} - column_id={} + spectrum = {} + column_id = {} for row in mztab: - psh_passed=False - if row!="" and row!="\n" and len(row)!=0: - if psh_passed==False and row[0]=="PSH": - for pos in range(0,len(row)): - column_id[row[pos]]=pos + psh_passed = False + if row != "" and row != "\n" and len(row) != 0: + if psh_passed == False and row[0] == "PSH": + for pos in range(0, len(row)): + column_id[row[pos]] = pos for key in column_id.keys(): if "rank" in key.lower(): - column_id['rank']=int(column_id[key]) + column_id['rank'] = int(column_id[key]) if "xcorr" in key.lower() or 'expectation' in key.lower() or 'confidence' in key.lower() \ or "e_value" in key.lower().replace("-","_") or 'evalue' in key.lower() or 'fdr' in key.lower(): column_id['fdr'] = int(column_id[key]) - psh_passed=True + psh_passed = True - if row[0]=="PSM": + if row[0] == "PSM": if row[column_id['spectra_ref']] not in spectrum: - spectrum[row[column_id['spectra_ref']]]=[row] + spectrum[row[column_id['spectra_ref']]] = [row] else: spectrum[row[column_id['spectra_ref']]].append(row) #iterate over all spectrum to store in processable dictionairy for key in spectrum.keys(): if 'charge' in column_id: - temp_hash={"assumed_charge":spectrum[key][0][column_id['charge']],"spectrum":key,"search_hit":[]} + temp_hash = { + "assumed_charge": spectrum[key][0][column_id['charge']], + "spectrum": key, + "search_hit": [] + } else: - temp_hash={"assumed_charge":0,"spectrum":key,"search_hit":[]} + temp_hash = { + "assumed_charge": 0, + "spectrum": key, + "search_hit": [] + } for psm in spectrum[key]: - proteins=[] - proteins.append({"protein":psm[column_id["accession"]],'peptide_prev_aa':psm[column_id["pre"]], - "peptide_next_aa":psm[column_id["post"]]}) - modifications=_get_modifications_(psm[column_id["modifications"]]) + proteins = [] + proteins.append({ + "protein": psm[column_id["accession"]], + 'peptide_prev_aa': psm[column_id["pre"]], + "peptide_next_aa": psm[column_id["post"]] + }) + modifications = _get_modifications_( + psm[column_id["modifications"]]) #modified_sequence=_get_modified_sequence_(psm[column_id["sequence"]],psm[column_id["modifications"]], # unimod,psimod) - temp_hash['search_hit'].append({"hit_rank":_get_hit_rank_(psm,column_id),"modifications":modifications, - "calc_neutral_pep_mass":psm[column_id['exp_mass_to_charge']], - "precursor_neutral_mass": psm[column_id['calc_mass_to_charge']], - #"modified_peptide":modified_sequence, - "peptide":psm[column_id['sequence']], - "massdiff":_calc_massdiff_(psm[column_id['exp_mass_to_charge']], - psm[column_id['calc_mass_to_charge']]), - "search_score":{"score":psm[column_id['search_engine_score[1]']], - "evalue":_get_evalue_(psm,column_id)}, - "proteins":proteins,"num_missed_cleavages":"-1"}) + temp_hash['search_hit'].append({ + "hit_rank": + _get_hit_rank_(psm, column_id), + "modifications": + modifications, + "calc_neutral_pep_mass": + psm[column_id['exp_mass_to_charge']], + "precursor_neutral_mass": + psm[column_id['calc_mass_to_charge']], + # "modified_peptide":modified_sequence, + "peptide": + psm[column_id['sequence']], + "massdiff": + _calc_massdiff_(psm[column_id['exp_mass_to_charge']], + psm[column_id['calc_mass_to_charge']]), + "search_score": { + "score": psm[column_id['search_engine_score[1]']], + "evalue": _get_evalue_(psm, column_id) + }, + "proteins": + proteins, + "num_missed_cleavages": + "-1" + }) if 'uri' in column_id.keys(): - temp_hash['search_hit']['uri']=psm[column_id['uri']] + temp_hash['search_hit']['uri'] = psm[column_id['uri']] psm_hash.append(temp_hash) return psm_hash + + # # retrieve hit rank for a psm # -def _get_hit_rank_(psm,column_id): +def _get_hit_rank_(psm, column_id): ''' :param psm: psm :param column_id:column number of rank @@ -101,10 +131,12 @@ def _get_hit_rank_(psm,column_id): return psm[column_id['rank']] else: return "*" + + # # retrieve evalue from psm # -def _get_evalue_(psm,column_id): +def _get_evalue_(psm, column_id): ''' :param psm: psm :param column_id: column number for evalue @@ -114,19 +146,24 @@ def _get_evalue_(psm,column_id): return psm[column_id['fdr']] else: return '-1' + + # # calculates massdiff # -def _calc_massdiff_(exp_mass,calc_mass): +def _calc_massdiff_(exp_mass, calc_mass): ''' :param exp_mass: experimental mass :param calc_mass: calculated mass :return: mass difference ''' - if exp_mass=="" and calc_mass=="": + if exp_mass == "" and calc_mass == "": return "*" else: - return str(float(exp_mass)-float(calc_mass))+';'+str(exp_mass)+';'+str(calc_mass) + return str(float(exp_mass) - float(calc_mass)) + ';' + str( + exp_mass) + ';' + str(calc_mass) + + # # connect to unimod DB, parse and store in dict # @@ -135,11 +172,11 @@ def _unimod_parser_(): :return: dictionairy with unimod IDs as keys and avg mass as value ''' # create UNIMOD dictionairy (record_id->avg mass) - unimod_dict={} + unimod_dict = {} # connect UNIMOD database - unimod_db=mass.Unimod(source='http://www.unimod.org/xml/unimod.xml') - for mod in unimod_db.mods: - unimod_dict[(mod['record_id'])]=mod['avge_mass'] + unimod_db = mass.Unimod(source='http://www.unimod.org/xml/unimod.xml') + for mod in unimod_db.mods: + unimod_dict[(mod['record_id'])] = mod['avge_mass'] return unimod_dict @@ -155,34 +192,42 @@ def _get_modifications_(mods): :return: list of modification dictionairies for this peptide ''' # seperate modification string into list of modifications - mods=mods.replace(', ',';') - mod_list=mods.split(',') - for i in range(0,len(mod_list)): - mod_list[i].replace(';',', ') + mods = mods.replace(', ', ';') + mod_list = mods.split(',') + for i in range(0, len(mod_list)): + mod_list[i].replace(';', ', ') # create variable to store results - modification=[] + modification = [] #iterate over all modifications for mod in mod_list: - if mod=="0" or mod.upper()=='NULL': + if mod == "0" or mod.upper() == 'NULL': break #partition unimod variable, separating position from unimod ID - mod_partitions=mod.split('-',1) + mod_partitions = mod.split('-', 1) #calculate mass - if "UNIMOD" in mod_partitions[1].upper() : + if "UNIMOD" in mod_partitions[1].upper(): #look up avg mass in unimod dict and store modification array - modification.append({"position":mod_partitions[0],"mass":str(mod_partitions[1])}) + modification.append({ + "position": mod_partitions[0], + "mass": str(mod_partitions[1]) + }) elif "MOD" in mod_partitions[1].upper(): - modification.append({"position":mod_partitions[0],"mass":str(mod_partitions[1])}) + modification.append({ + "position": mod_partitions[0], + "mass": str(mod_partitions[1]) + }) return modification + + # # Parse modifications (from UNIMOD/PSIMOD to neutral loss) # -def _get_modified_sequence_(peptide,mods,unimod,psimod): +def _get_modified_sequence_(peptide, mods, unimod, psimod): ''' :param peptide: peptide sequence :param mods: peptide modification in unimod or psimod format @@ -191,41 +236,43 @@ def _get_modified_sequence_(peptide,mods,unimod,psimod): :return: list of modification dictionairies for this peptide ''' # seperate modification string into list of modifications - mod_list=mods.split(',') - mod_sequence=peptide + mod_list = mods.split(',') + mod_sequence = peptide # create variable to store results - modification=[] + modification = [] #iterate over all modifications for mod in mod_list: - if mod=="0" or mod.upper()=='NULL': + if mod == "0" or mod.upper() == 'NULL': break #partition unimod variable, separating position from unimod ID - mod_partitions=mod.split("-") + mod_partitions = mod.split("-") #calculate mass - db_type=mod_partitions[1].split(':')[0] - if db_type=="UNIMOD": + db_type = mod_partitions[1].split(':')[0] + if db_type == "UNIMOD": #look up avg mass in unimod dict and store modification array - mass=unimod[int(mod_partitions[1].split(':')[1])] - modification.append([mod_partitions[0],mass]) - elif db_type=="MOD": - mass=psimod[mod_partitions[1]] - modification.append([mod_partitions[0],mass]) - modification=sorted(modification) - shift=0 + mass = unimod[int(mod_partitions[1].split(':')[1])] + modification.append([mod_partitions[0], mass]) + elif db_type == "MOD": + mass = psimod[mod_partitions[1]] + modification.append([mod_partitions[0], mass]) + modification = sorted(modification) + shift = 0 for mod in modification: - pos=int(mod[0])+shift+1 - mod_bracketed="["+str(mod[1])+"]" - mod_sequence=mod_sequence[:pos]+mod_bracketed+mod_sequence[pos:] - shift+=len(mod_bracketed) + pos = int(mod[0]) + shift + 1 + mod_bracketed = "[" + str(mod[1]) + "]" + mod_sequence = mod_sequence[:pos] + mod_bracketed + mod_sequence[pos:] + shift += len(mod_bracketed) return mod_sequence + + # # Parse modifications (from UNIMOD/PSIMOD to neutral loss) # -def _get_modifications_neutral_(peptide,mods,unimod,psimod): +def _get_modifications_neutral_(peptide, mods, unimod, psimod): ''' :param peptide: peptide sequence :param mods: peptide modification in unimod or psimod format @@ -234,53 +281,61 @@ def _get_modifications_neutral_(peptide,mods,unimod,psimod): :return: list of modification dictionairies for this peptide ''' # seperate modification string into list of modifications - mod_list=mods.split(',') + mod_list = mods.split(',') # create variable to store results - modification=[] + modification = [] #iterate over all modifications for mod in mod_list: - if mod=="0" or mod.upper()=='NULL': + if mod == "0" or mod.upper() == 'NULL': break #partition unimod variable, separating position from unimod ID - mod_partitions=mod.split("-") + mod_partitions = mod.split("-") #calculate mass - db_type=mod_partitions[1].split(':')[0] - if db_type=="UNIMOD": + db_type = mod_partitions[1].split(':')[0] + if db_type == "UNIMOD": #look up avg mass in unimod dict and store modification array - mass=unimod[int(mod_partitions[1].split(':')[1])] - modification.append({"position":mod_partitions[0],"mass":mass}) - elif db_type=="MOD": - mass=psimod[mod_partitions[1]] - modification.append({"position":mod_partitions[0],"mass":mass}) + mass = unimod[int(mod_partitions[1].split(':')[1])] + modification.append({"position": mod_partitions[0], "mass": mass}) + elif db_type == "MOD": + mass = psimod[mod_partitions[1]] + modification.append({"position": mod_partitions[0], "mass": mass}) return modification + + # # extract comments from mzTAB # def extract_comments_from_mztab(psm_file): - f=open(psm_file,'r') - comments=[] + f = open(psm_file, 'r') + comments = [] for line in f: - if line[0:3]=="COM" or line[0:3]=="MTD": + if line[0:3] == "COM" or line[0:3] == "MTD": comments.append(line) else: return comments break return comments + + # # Extract enzyme specificity from mzTab # def get_enzyme_specificity_mztab(psm_file): return 3 + + # # Extract enzyme specificity from mzTab # def get_enzyme_mztab(psm_file): return "-1" + + # # Connect to psimod, parse IDs and store in dict # @@ -289,11 +344,11 @@ def _psimod_xml_parser_(): :return: dictionairy with psimod IDs as key and avg mass as value ''' # create dictionairy to store id/avg difference mass - psimod={} + psimod = {} # parse and store psimod data import urllib2 from lxml import etree - data=urllib2.urlopen("http://psidev.cvs.sourceforge.net/viewvc/psidev/psi/mod/data/PSI-MOD.obo.xml") + data = open(os.path.join(sys.path[0], "PSI-MOD.obo.xml"), "r") root = etree.parse(data) root2 = etree.tostring(root) for term in root.xpath('//term'): @@ -301,9 +356,10 @@ def _psimod_xml_parser_(): id = id.text for xref in term.xpath('./xref_analog'): for dbname in xref.xpath('./dbname'): - if dbname.text=="DiffAvg": - avg_diff_mass=xref.xpath('./name/text()') - psimod[id]=avg_diff_mass[0] + if dbname.text == "DiffAvg": + avg_diff_mass = xref.xpath('./name/text()') + psimod[id] = avg_diff_mass[0] return psimod -#get_PSM_mztab("/home/vladie/Desktop/proBAMconvert/HCT116_NtermCofr.mztab") \ No newline at end of file + +#get_PSM_mztab("/home/vladie/Desktop/proBAMconvert/HCT116_NtermCofr.mztab") diff --git a/python/proBAM_mzTab.pyc b/python/proBAM_mzTab.pyc index 81975cd..3a0fb7a 100644 Binary files a/python/proBAM_mzTab.pyc and b/python/proBAM_mzTab.pyc differ diff --git a/python/proBAM_mzid.pyc b/python/proBAM_mzid.pyc index 2834ad5..8db0b3d 100644 Binary files a/python/proBAM_mzid.pyc and b/python/proBAM_mzid.pyc differ diff --git a/python/proBAM_pepxml.py b/python/proBAM_pepxml.py index 89753aa..55620da 100644 --- a/python/proBAM_pepxml.py +++ b/python/proBAM_pepxml.py @@ -16,6 +16,9 @@ ############################################################################## from pyteomics import pepxml from fnmatch import fnmatch +from lxml import etree + + # # Reads pepXML and stores variables in an hash # @@ -32,10 +35,14 @@ def get_PSM_pepxml(psm_file): # adjust search scores if 'search_hit' in row.keys(): for search_hit in row['search_hit']: - search_hit['massdiff']=str(search_hit['massdiff'])+';'+str(search_hit['calc_neutral_pep_mass'])+';'+str(row['precursor_neutral_mass']) - search_hit['search_score']={'score':_get_score_(search_hit['search_score']), - 'evalue':_get_evalue_(search_hit['search_score'])} - + search_hit['massdiff'] = str( + search_hit['massdiff']) + ';' + str( + search_hit['calc_neutral_pep_mass']) + ';' + str( + row['precursor_neutral_mass']) + search_hit['search_score'] = { + 'score': _get_score_(search_hit['search_score']), + 'evalue': _get_evalue_(search_hit['search_score']) + } # if count==5500: # break @@ -43,6 +50,8 @@ def get_PSM_pepxml(psm_file): # count+=1 del PEP return PSM + + # # Attempts to extract enzyme information from the pepXML file # @@ -51,51 +60,40 @@ def get_enzyme_pepxml(psm_file): :param psm_file: psm_file :return: enzyme ''' - f=open(psm_file,'r') - count=0 - while count <100: - line=f.readline() - if "enzyme" not in line: - continue - else: - line=line.replace('-','_') - line=line.lower() - if fnmatch(line,'*trypsin?p*'): - return 2 - break - elif fnmatch(line,'*trypsin*'): - return 1 - break - elif fnmatch(line, '*lys?c*'): - return 3 - break - elif fnmatch(line, '*lys?n*'): - return 4 - break - elif fnmatch(line, '*arg?c*'): - return 5 - break - elif fnmatch(line, '*asp?n*'): - return 6 - break - elif fnmatch(line, '*cnbr*'): - return 7 - break - elif fnmatch(line, '*glu?c*'): - return 8 - break - elif fnmatch(line, '*pepsina*'): - return 9 - break - elif fnmatch(line, '*chymotrypsin*'): - return 10 - break - elif fnmatch(line, '*no?enzyme*'): - return 0 - break - return "-1" + try: + root = etree.parse(psm_file).getroot() + namespace = root.nsmap.items()[0][1] + line = root.xpath( + "//ns:sample_enzyme", namespaces={'ns': namespace})[0].get("name") + line = line.replace('-', '_') + line = line.lower() + if fnmatch(line, '*trypsin?p*'): + return 2 + elif fnmatch(line, '*trypsin*'): + return 1 + elif fnmatch(line, '*lys?c*'): + return 3 + elif fnmatch(line, '*lys?n*'): + return 4 + elif fnmatch(line, '*arg?c*'): + return 5 + elif fnmatch(line, '*asp?n*'): + return 6 + elif fnmatch(line, '*cnbr*'): + return 7 + elif fnmatch(line, '*glu?c*'): + return 8 + elif fnmatch(line, '*pepsina*'): + return 9 + elif fnmatch(line, '*chymotrypsin*'): + return 10 + elif fnmatch(line, '*no?enzyme*'): + return 0 + return "-1" + except: + return "-1" + -# # Attempts to extract enzyme specificity information from the pepXML file # def get_enzyme_specificity_pepxml(psm_file): @@ -103,26 +101,23 @@ def get_enzyme_specificity_pepxml(psm_file): :param psm_file: psm file :return: enzyme specificity ''' - f=open(psm_file,'r') - count=0 - while count <100: - count+=1 - line=f.readline() - if "enzyme" not in line: - continue - else: - line=line.replace('-','_') - line=line.lower() - if fnmatch(line,'*non*enzy*'): - return 0 - break - elif fnmatch(line,'*semi*enzy*'): - return 1 - break - elif fnmatch(line, '*fully*enzy*'): - return 2 - break - return 3 + try: + root = etree.parse(psm_file).getroot() + namespace = root.nsmap.items()[0][1] + line = root.xpath( + "//ns:specificity", namespaces={'ns': namespace})[0].get("cut") + line = line.replace('-', '_') + line = line.lower() + if fnmatch(line, '*non*enzy*'): + return 0 + elif fnmatch(line, '*semi*enzy*'): + return 1 + elif fnmatch(line, '*fully*enzy*'): + return 2 + return 3 + except: + return 3 + # # extract search summary information from pepXML @@ -132,18 +127,20 @@ def extract_comments_from_pepxml(psm_file): :param psm_file: psm_file :return: comments array ''' - f=open(psm_file,'r') - count=0 - comments=[] - while count <200: - count+=1 - line=f.readline() + f = open(psm_file, 'r') + count = 0 + comments = [] + while count < 200: + count += 1 + line = f.readline() if "search_summary" in line: while "/search_summary" not in line: comments.append(line) - line=f.readline() + line = f.readline() return comments return comments + + # # retrieve score for a psm # @@ -161,9 +158,11 @@ def _get_score_(search_score): hit = 1 hit_key = key if hit == 1: - return search_score[hit_key] + return search_score[hit_key] else: return "-1" + + # # retrieve the evalue for a psm # @@ -185,4 +184,4 @@ def _get_evalue_(search_score): if hit == 1: return search_score[hit_key] else: - return "-1" \ No newline at end of file + return "-1" diff --git a/python/proBAM_pepxml.pyc b/python/proBAM_pepxml.pyc index 10a7225..7d81393 100644 Binary files a/python/proBAM_pepxml.pyc and b/python/proBAM_pepxml.pyc differ diff --git a/python/proBAM_proBED.pyc b/python/proBAM_proBED.pyc index 6fe3e80..150c776 100644 Binary files a/python/proBAM_proBED.pyc and b/python/proBAM_proBED.pyc differ