diff --git a/.github/workflows/e2e.yaml b/.github/workflows/e2e.yaml index da07b7eee..2704f6b5d 100644 --- a/.github/workflows/e2e.yaml +++ b/.github/workflows/e2e.yaml @@ -36,7 +36,7 @@ jobs: with: enable_workaround_docker_io: 'false' branch: ${{ matrix.openstack_version }} - enabled_services: "openstack-cli-server" + enabled_services: "openstack-cli-server,neutron-trunk" - name: Deploy a Kind Cluster uses: helm/kind-action@92086f6be054225fa813e0a4b13787fc9088faab diff --git a/PROJECT b/PROJECT index 8d6e2c12d..3d09e3c30 100644 --- a/PROJECT +++ b/PROJECT @@ -144,6 +144,14 @@ resources: kind: Subnet path: github.com/k-orc/openstack-resource-controller/api/v1alpha1 version: v1alpha1 +- api: + crdVersion: v1 + namespaced: true + domain: k-orc.cloud + group: openstack + kind: Trunk + path: github.com/k-orc/openstack-resource-controller/api/v1alpha1 + version: v1alpha1 - api: crdVersion: v1 namespaced: true diff --git a/README.md b/README.md index 17597fdbb..268234e94 100644 --- a/README.md +++ b/README.md @@ -83,6 +83,7 @@ kubectl delete -f $ORC_RELEASE | server group | | ✔ | ✔ | | service | | ✔ | ✔ | | subnet | | ◐ | ◐ | +| trunk | | ✔ | ✔ | | volume | | ◐ | ◐ | | volume type | | ◐ | ◐ | diff --git a/api/v1alpha1/trunk_types.go b/api/v1alpha1/trunk_types.go new file mode 100644 index 000000000..2e48103e1 --- /dev/null +++ b/api/v1alpha1/trunk_types.go @@ -0,0 +1,179 @@ +/* +Copyright 2025 The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +package v1alpha1 + +// TrunkSubportSpec represents a subport to attach to a trunk. +// It maps to gophercloud's trunks.Subport. +type TrunkSubportSpec struct { + // portRef is a reference to the ORC Port that will be attached as a subport. + // +required + PortRef KubernetesNameRef `json:"portRef,omitempty"` + + // segmentationID is the segmentation ID for the subport (e.g. VLAN ID). + // +required + // +kubebuilder:validation:Minimum:=1 + // +kubebuilder:validation:Maximum:=4094 + SegmentationID int32 `json:"segmentationID,omitempty"` + + // segmentationType is the segmentation type for the subport (e.g. vlan). + // +required + // +kubebuilder:validation:MinLength:=1 + // +kubebuilder:validation:MaxLength:=32 + // +kubebuilder:validation:Enum:=inherit;vlan + SegmentationType string `json:"segmentationType,omitempty"` +} + +// TrunkSubportStatus represents an attached subport on a trunk. +// It maps to gophercloud's trunks.Subport. +type TrunkSubportStatus struct { + // portID is the OpenStack ID of the Port attached as a subport. + // +kubebuilder:validation:MaxLength=1024 + // +optional + PortID string `json:"portID,omitempty"` + + // segmentationID is the segmentation ID for the subport (e.g. VLAN ID). + // +optional + SegmentationID int32 `json:"segmentationID,omitempty"` + + // segmentationType is the segmentation type for the subport (e.g. vlan). + // +kubebuilder:validation:MaxLength=1024 + // +optional + SegmentationType string `json:"segmentationType,omitempty"` +} + +// TrunkResourceSpec contains the desired state of the resource. +type TrunkResourceSpec struct { + // name will be the name of the created resource. If not specified, the + // name of the ORC object will be used. + // +optional + Name *OpenStackName `json:"name,omitempty"` + + // description is a human-readable description for the resource. + // +optional + Description *NeutronDescription `json:"description,omitempty"` + + // portRef is a reference to the ORC Port which this resource is associated with. + // +required + // +kubebuilder:validation:XValidation:rule="self == oldSelf",message="portRef is immutable" + PortRef KubernetesNameRef `json:"portRef,omitempty"` + + // projectRef is a reference to the ORC Project which this resource is associated with. + // +optional + // +kubebuilder:validation:XValidation:rule="self == oldSelf",message="projectRef is immutable" + ProjectRef *KubernetesNameRef `json:"projectRef,omitempty"` + + // adminStateUp is the administrative state of the trunk. If false (down), + // the trunk does not forward packets. + // +optional + AdminStateUp *bool `json:"adminStateUp,omitempty"` + + // subports is the list of ports to attach to the trunk. + // +optional + // +kubebuilder:validation:MaxItems:=1024 + // +listType=atomic + Subports []TrunkSubportSpec `json:"subports,omitempty"` + + // tags is a list of Neutron tags to apply to the trunk. + // +kubebuilder:validation:MaxItems:=64 + // +listType=set + // +optional + Tags []NeutronTag `json:"tags,omitempty"` +} + +// TrunkFilter defines an existing resource by its properties +// +kubebuilder:validation:MinProperties:=1 +type TrunkFilter struct { + // name of the existing resource + // +optional + Name *OpenStackName `json:"name,omitempty"` + + // description of the existing resource + // +optional + Description *NeutronDescription `json:"description,omitempty"` + + // portRef is a reference to the ORC Port which this resource is associated with. + // +optional + PortRef *KubernetesNameRef `json:"portRef,omitempty"` + + // projectRef is a reference to the ORC Project which this resource is associated with. + // +optional + ProjectRef *KubernetesNameRef `json:"projectRef,omitempty"` + + // status indicates whether the trunk is currently operational. Possible values include + // `ACTIVE', `DOWN', `BUILD', `DEGRADED' or `ERROR'. Plug-ins might define additional values. + // +optional + // +kubebuilder:validation:MaxLength:=1024 + Status *string `json:"status,omitempty"` + + // adminStateUp is the administrative state of the trunk. + // +optional + AdminStateUp *bool `json:"adminStateUp,omitempty"` + + FilterByNeutronTags `json:",inline"` +} + +// TrunkResourceStatus represents the observed state of the resource. +type TrunkResourceStatus struct { + // name is a Human-readable name for the resource. Might not be unique. + // +kubebuilder:validation:MaxLength=1024 + // +optional + Name string `json:"name,omitempty"` + + // description is a human-readable description for the resource. + // +kubebuilder:validation:MaxLength=1024 + // +optional + Description string `json:"description,omitempty"` + + // portID is the ID of the Port to which the resource is associated. + // +kubebuilder:validation:MaxLength=1024 + // +optional + PortID string `json:"portID,omitempty"` + + // projectID is the ID of the Project to which the resource is associated. + // +kubebuilder:validation:MaxLength=1024 + // +optional + ProjectID string `json:"projectID,omitempty"` + + // tenantID is the project owner of the trunk (alias of projectID in some deployments). + // +kubebuilder:validation:MaxLength=1024 + // +optional + TenantID string `json:"tenantID,omitempty"` + + // status indicates whether the trunk is currently operational. + // +kubebuilder:validation:MaxLength=1024 + // +optional + Status string `json:"status,omitempty"` + + // tags is the list of tags on the resource. + // +kubebuilder:validation:MaxItems=64 + // +kubebuilder:validation:items:MaxLength=1024 + // +listType=atomic + // +optional + Tags []string `json:"tags,omitempty"` + + NeutronStatusMetadata `json:",inline"` + + // adminStateUp is the administrative state of the trunk. + // +optional + AdminStateUp *bool `json:"adminStateUp,omitempty"` + + // subports is a list of ports associated with the trunk. + // +kubebuilder:validation:MaxItems=1024 + // +listType=atomic + // +optional + Subports []TrunkSubportStatus `json:"subports,omitempty"` +} diff --git a/api/v1alpha1/zz_generated.deepcopy.go b/api/v1alpha1/zz_generated.deepcopy.go index 1b90b21c1..f59e61a43 100644 --- a/api/v1alpha1/zz_generated.deepcopy.go +++ b/api/v1alpha1/zz_generated.deepcopy.go @@ -4969,6 +4969,305 @@ func (in *SubnetStatus) DeepCopy() *SubnetStatus { return out } +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *Trunk) DeepCopyInto(out *Trunk) { + *out = *in + out.TypeMeta = in.TypeMeta + in.ObjectMeta.DeepCopyInto(&out.ObjectMeta) + in.Spec.DeepCopyInto(&out.Spec) + in.Status.DeepCopyInto(&out.Status) +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new Trunk. +func (in *Trunk) DeepCopy() *Trunk { + if in == nil { + return nil + } + out := new(Trunk) + in.DeepCopyInto(out) + return out +} + +// DeepCopyObject is an autogenerated deepcopy function, copying the receiver, creating a new runtime.Object. +func (in *Trunk) DeepCopyObject() runtime.Object { + if c := in.DeepCopy(); c != nil { + return c + } + return nil +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *TrunkFilter) DeepCopyInto(out *TrunkFilter) { + *out = *in + if in.Name != nil { + in, out := &in.Name, &out.Name + *out = new(OpenStackName) + **out = **in + } + if in.Description != nil { + in, out := &in.Description, &out.Description + *out = new(NeutronDescription) + **out = **in + } + if in.PortRef != nil { + in, out := &in.PortRef, &out.PortRef + *out = new(KubernetesNameRef) + **out = **in + } + if in.ProjectRef != nil { + in, out := &in.ProjectRef, &out.ProjectRef + *out = new(KubernetesNameRef) + **out = **in + } + if in.Status != nil { + in, out := &in.Status, &out.Status + *out = new(string) + **out = **in + } + if in.AdminStateUp != nil { + in, out := &in.AdminStateUp, &out.AdminStateUp + *out = new(bool) + **out = **in + } + in.FilterByNeutronTags.DeepCopyInto(&out.FilterByNeutronTags) +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new TrunkFilter. +func (in *TrunkFilter) DeepCopy() *TrunkFilter { + if in == nil { + return nil + } + out := new(TrunkFilter) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *TrunkImport) DeepCopyInto(out *TrunkImport) { + *out = *in + if in.ID != nil { + in, out := &in.ID, &out.ID + *out = new(string) + **out = **in + } + if in.Filter != nil { + in, out := &in.Filter, &out.Filter + *out = new(TrunkFilter) + (*in).DeepCopyInto(*out) + } +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new TrunkImport. +func (in *TrunkImport) DeepCopy() *TrunkImport { + if in == nil { + return nil + } + out := new(TrunkImport) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *TrunkList) DeepCopyInto(out *TrunkList) { + *out = *in + out.TypeMeta = in.TypeMeta + in.ListMeta.DeepCopyInto(&out.ListMeta) + if in.Items != nil { + in, out := &in.Items, &out.Items + *out = make([]Trunk, len(*in)) + for i := range *in { + (*in)[i].DeepCopyInto(&(*out)[i]) + } + } +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new TrunkList. +func (in *TrunkList) DeepCopy() *TrunkList { + if in == nil { + return nil + } + out := new(TrunkList) + in.DeepCopyInto(out) + return out +} + +// DeepCopyObject is an autogenerated deepcopy function, copying the receiver, creating a new runtime.Object. +func (in *TrunkList) DeepCopyObject() runtime.Object { + if c := in.DeepCopy(); c != nil { + return c + } + return nil +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *TrunkResourceSpec) DeepCopyInto(out *TrunkResourceSpec) { + *out = *in + if in.Name != nil { + in, out := &in.Name, &out.Name + *out = new(OpenStackName) + **out = **in + } + if in.Description != nil { + in, out := &in.Description, &out.Description + *out = new(NeutronDescription) + **out = **in + } + if in.ProjectRef != nil { + in, out := &in.ProjectRef, &out.ProjectRef + *out = new(KubernetesNameRef) + **out = **in + } + if in.AdminStateUp != nil { + in, out := &in.AdminStateUp, &out.AdminStateUp + *out = new(bool) + **out = **in + } + if in.Subports != nil { + in, out := &in.Subports, &out.Subports + *out = make([]TrunkSubportSpec, len(*in)) + copy(*out, *in) + } + if in.Tags != nil { + in, out := &in.Tags, &out.Tags + *out = make([]NeutronTag, len(*in)) + copy(*out, *in) + } +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new TrunkResourceSpec. +func (in *TrunkResourceSpec) DeepCopy() *TrunkResourceSpec { + if in == nil { + return nil + } + out := new(TrunkResourceSpec) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *TrunkResourceStatus) DeepCopyInto(out *TrunkResourceStatus) { + *out = *in + if in.Tags != nil { + in, out := &in.Tags, &out.Tags + *out = make([]string, len(*in)) + copy(*out, *in) + } + in.NeutronStatusMetadata.DeepCopyInto(&out.NeutronStatusMetadata) + if in.AdminStateUp != nil { + in, out := &in.AdminStateUp, &out.AdminStateUp + *out = new(bool) + **out = **in + } + if in.Subports != nil { + in, out := &in.Subports, &out.Subports + *out = make([]TrunkSubportStatus, len(*in)) + copy(*out, *in) + } +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new TrunkResourceStatus. +func (in *TrunkResourceStatus) DeepCopy() *TrunkResourceStatus { + if in == nil { + return nil + } + out := new(TrunkResourceStatus) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *TrunkSpec) DeepCopyInto(out *TrunkSpec) { + *out = *in + if in.Import != nil { + in, out := &in.Import, &out.Import + *out = new(TrunkImport) + (*in).DeepCopyInto(*out) + } + if in.Resource != nil { + in, out := &in.Resource, &out.Resource + *out = new(TrunkResourceSpec) + (*in).DeepCopyInto(*out) + } + if in.ManagedOptions != nil { + in, out := &in.ManagedOptions, &out.ManagedOptions + *out = new(ManagedOptions) + **out = **in + } + out.CloudCredentialsRef = in.CloudCredentialsRef +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new TrunkSpec. +func (in *TrunkSpec) DeepCopy() *TrunkSpec { + if in == nil { + return nil + } + out := new(TrunkSpec) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *TrunkStatus) DeepCopyInto(out *TrunkStatus) { + *out = *in + if in.Conditions != nil { + in, out := &in.Conditions, &out.Conditions + *out = make([]v1.Condition, len(*in)) + for i := range *in { + (*in)[i].DeepCopyInto(&(*out)[i]) + } + } + if in.ID != nil { + in, out := &in.ID, &out.ID + *out = new(string) + **out = **in + } + if in.Resource != nil { + in, out := &in.Resource, &out.Resource + *out = new(TrunkResourceStatus) + (*in).DeepCopyInto(*out) + } +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new TrunkStatus. +func (in *TrunkStatus) DeepCopy() *TrunkStatus { + if in == nil { + return nil + } + out := new(TrunkStatus) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *TrunkSubportSpec) DeepCopyInto(out *TrunkSubportSpec) { + *out = *in +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new TrunkSubportSpec. +func (in *TrunkSubportSpec) DeepCopy() *TrunkSubportSpec { + if in == nil { + return nil + } + out := new(TrunkSubportSpec) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *TrunkSubportStatus) DeepCopyInto(out *TrunkSubportStatus) { + *out = *in +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new TrunkSubportStatus. +func (in *TrunkSubportStatus) DeepCopy() *TrunkSubportStatus { + if in == nil { + return nil + } + out := new(TrunkSubportStatus) + in.DeepCopyInto(out) + return out +} + // DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. func (in *UserDataSpec) DeepCopyInto(out *UserDataSpec) { *out = *in diff --git a/api/v1alpha1/zz_generated.trunk-resource.go b/api/v1alpha1/zz_generated.trunk-resource.go new file mode 100644 index 000000000..305ac1878 --- /dev/null +++ b/api/v1alpha1/zz_generated.trunk-resource.go @@ -0,0 +1,177 @@ +// Code generated by resource-generator. DO NOT EDIT. +/* +Copyright The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +package v1alpha1 + +import ( + metav1 "k8s.io/apimachinery/pkg/apis/meta/v1" +) + +// TrunkImport specifies an existing resource which will be imported instead of +// creating a new one +// +kubebuilder:validation:MinProperties:=1 +// +kubebuilder:validation:MaxProperties:=1 +type TrunkImport struct { + // id contains the unique identifier of an existing OpenStack resource. Note + // that when specifying an import by ID, the resource MUST already exist. + // The ORC object will enter an error state if the resource does not exist. + // +optional + // +kubebuilder:validation:Format:=uuid + ID *string `json:"id,omitempty"` + + // filter contains a resource query which is expected to return a single + // result. The controller will continue to retry if filter returns no + // results. If filter returns multiple results the controller will set an + // error state and will not continue to retry. + // +optional + Filter *TrunkFilter `json:"filter,omitempty"` +} + +// TrunkSpec defines the desired state of an ORC object. +// +kubebuilder:validation:XValidation:rule="self.managementPolicy == 'managed' ? has(self.resource) : true",message="resource must be specified when policy is managed" +// +kubebuilder:validation:XValidation:rule="self.managementPolicy == 'managed' ? !has(self.__import__) : true",message="import may not be specified when policy is managed" +// +kubebuilder:validation:XValidation:rule="self.managementPolicy == 'unmanaged' ? !has(self.resource) : true",message="resource may not be specified when policy is unmanaged" +// +kubebuilder:validation:XValidation:rule="self.managementPolicy == 'unmanaged' ? has(self.__import__) : true",message="import must be specified when policy is unmanaged" +// +kubebuilder:validation:XValidation:rule="has(self.managedOptions) ? self.managementPolicy == 'managed' : true",message="managedOptions may only be provided when policy is managed" +type TrunkSpec struct { + // import refers to an existing OpenStack resource which will be imported instead of + // creating a new one. + // +optional + Import *TrunkImport `json:"import,omitempty"` + + // resource specifies the desired state of the resource. + // + // resource may not be specified if the management policy is `unmanaged`. + // + // resource must be specified if the management policy is `managed`. + // +optional + Resource *TrunkResourceSpec `json:"resource,omitempty"` + + // managementPolicy defines how ORC will treat the object. Valid values are + // `managed`: ORC will create, update, and delete the resource; `unmanaged`: + // ORC will import an existing resource, and will not apply updates to it or + // delete it. + // +kubebuilder:validation:XValidation:rule="self == oldSelf",message="managementPolicy is immutable" + // +kubebuilder:default:=managed + // +optional + ManagementPolicy ManagementPolicy `json:"managementPolicy,omitempty"` + + // managedOptions specifies options which may be applied to managed objects. + // +optional + ManagedOptions *ManagedOptions `json:"managedOptions,omitempty"` + + // cloudCredentialsRef points to a secret containing OpenStack credentials + // +required + CloudCredentialsRef CloudCredentialsReference `json:"cloudCredentialsRef"` +} + +// TrunkStatus defines the observed state of an ORC resource. +type TrunkStatus struct { + // conditions represents the observed status of the object. + // Known .status.conditions.type are: "Available", "Progressing" + // + // Available represents the availability of the OpenStack resource. If it is + // true then the resource is ready for use. + // + // Progressing indicates whether the controller is still attempting to + // reconcile the current state of the OpenStack resource to the desired + // state. Progressing will be False either because the desired state has + // been achieved, or because some terminal error prevents it from ever being + // achieved and the controller is no longer attempting to reconcile. If + // Progressing is True, an observer waiting on the resource should continue + // to wait. + // + // +kubebuilder:validation:MaxItems:=32 + // +patchMergeKey=type + // +patchStrategy=merge + // +listType=map + // +listMapKey=type + // +optional + Conditions []metav1.Condition `json:"conditions,omitempty" patchStrategy:"merge" patchMergeKey:"type"` + + // id is the unique identifier of the OpenStack resource. + // +optional + ID *string `json:"id,omitempty"` + + // resource contains the observed state of the OpenStack resource. + // +optional + Resource *TrunkResourceStatus `json:"resource,omitempty"` +} + +var _ ObjectWithConditions = &Trunk{} + +func (i *Trunk) GetConditions() []metav1.Condition { + return i.Status.Conditions +} + +// +genclient +// +kubebuilder:object:root=true +// +kubebuilder:resource:categories=openstack +// +kubebuilder:subresource:status +// +kubebuilder:printcolumn:name="ID",type="string",JSONPath=".status.id",description="Resource ID" +// +kubebuilder:printcolumn:name="Available",type="string",JSONPath=".status.conditions[?(@.type=='Available')].status",description="Availability status of resource" +// +kubebuilder:printcolumn:name="Message",type="string",JSONPath=".status.conditions[?(@.type=='Progressing')].message",description="Message describing current progress status" + +// Trunk is the Schema for an ORC resource. +type Trunk struct { + metav1.TypeMeta `json:",inline"` + + // metadata contains the object metadata + // +optional + metav1.ObjectMeta `json:"metadata,omitempty"` + + // spec specifies the desired state of the resource. + // +optional + Spec TrunkSpec `json:"spec,omitempty"` + + // status defines the observed state of the resource. + // +optional + Status TrunkStatus `json:"status,omitempty"` +} + +// +kubebuilder:object:root=true + +// TrunkList contains a list of Trunk. +type TrunkList struct { + metav1.TypeMeta `json:",inline"` + + // metadata contains the list metadata + // +optional + metav1.ListMeta `json:"metadata,omitempty"` + + // items contains a list of Trunk. + // +required + Items []Trunk `json:"items"` +} + +func (l *TrunkList) GetItems() []Trunk { + return l.Items +} + +func init() { + SchemeBuilder.Register(&Trunk{}, &TrunkList{}) +} + +func (i *Trunk) GetCloudCredentialsRef() (*string, *CloudCredentialsReference) { + if i == nil { + return nil, nil + } + + return &i.Namespace, &i.Spec.CloudCredentialsRef +} + +var _ CloudCredentialsRefProvider = &Trunk{} diff --git a/cmd/manager/main.go b/cmd/manager/main.go index 293aa2bab..bf9bc38ca 100644 --- a/cmd/manager/main.go +++ b/cmd/manager/main.go @@ -45,6 +45,7 @@ import ( "github.com/k-orc/openstack-resource-controller/v2/internal/controllers/servergroup" "github.com/k-orc/openstack-resource-controller/v2/internal/controllers/service" "github.com/k-orc/openstack-resource-controller/v2/internal/controllers/subnet" + "github.com/k-orc/openstack-resource-controller/v2/internal/controllers/trunk" "github.com/k-orc/openstack-resource-controller/v2/internal/controllers/volume" "github.com/k-orc/openstack-resource-controller/v2/internal/controllers/volumetype" internalmanager "github.com/k-orc/openstack-resource-controller/v2/internal/manager" @@ -113,6 +114,7 @@ func main() { router.New(scopeFactory), routerinterface.New(scopeFactory), port.New(scopeFactory), + trunk.New(scopeFactory), floatingip.New(scopeFactory), flavor.New(scopeFactory), securitygroup.New(scopeFactory), diff --git a/cmd/models-schema/zz_generated.openapi.go b/cmd/models-schema/zz_generated.openapi.go index 80dc9b6c6..a365fd3e3 100644 --- a/cmd/models-schema/zz_generated.openapi.go +++ b/cmd/models-schema/zz_generated.openapi.go @@ -199,6 +199,16 @@ func GetOpenAPIDefinitions(ref common.ReferenceCallback) map[string]common.OpenA "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.SubnetResourceStatus": schema_openstack_resource_controller_v2_api_v1alpha1_SubnetResourceStatus(ref), "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.SubnetSpec": schema_openstack_resource_controller_v2_api_v1alpha1_SubnetSpec(ref), "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.SubnetStatus": schema_openstack_resource_controller_v2_api_v1alpha1_SubnetStatus(ref), + "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.Trunk": schema_openstack_resource_controller_v2_api_v1alpha1_Trunk(ref), + "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.TrunkFilter": schema_openstack_resource_controller_v2_api_v1alpha1_TrunkFilter(ref), + "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.TrunkImport": schema_openstack_resource_controller_v2_api_v1alpha1_TrunkImport(ref), + "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.TrunkList": schema_openstack_resource_controller_v2_api_v1alpha1_TrunkList(ref), + "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.TrunkResourceSpec": schema_openstack_resource_controller_v2_api_v1alpha1_TrunkResourceSpec(ref), + "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.TrunkResourceStatus": schema_openstack_resource_controller_v2_api_v1alpha1_TrunkResourceStatus(ref), + "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.TrunkSpec": schema_openstack_resource_controller_v2_api_v1alpha1_TrunkSpec(ref), + "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.TrunkStatus": schema_openstack_resource_controller_v2_api_v1alpha1_TrunkStatus(ref), + "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.TrunkSubportSpec": schema_openstack_resource_controller_v2_api_v1alpha1_TrunkSubportSpec(ref), + "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.TrunkSubportStatus": schema_openstack_resource_controller_v2_api_v1alpha1_TrunkSubportStatus(ref), "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.UserDataSpec": schema_openstack_resource_controller_v2_api_v1alpha1_UserDataSpec(ref), "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.Volume": schema_openstack_resource_controller_v2_api_v1alpha1_Volume(ref), "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.VolumeAttachmentStatus": schema_openstack_resource_controller_v2_api_v1alpha1_VolumeAttachmentStatus(ref), @@ -9618,6 +9628,651 @@ func schema_openstack_resource_controller_v2_api_v1alpha1_SubnetStatus(ref commo } } +func schema_openstack_resource_controller_v2_api_v1alpha1_Trunk(ref common.ReferenceCallback) common.OpenAPIDefinition { + return common.OpenAPIDefinition{ + Schema: spec.Schema{ + SchemaProps: spec.SchemaProps{ + Description: "Trunk is the Schema for an ORC resource.", + Type: []string{"object"}, + Properties: map[string]spec.Schema{ + "kind": { + SchemaProps: spec.SchemaProps{ + Description: "Kind is a string value representing the REST resource this object represents. Servers may infer this from the endpoint the client submits requests to. Cannot be updated. In CamelCase. More info: https://git.k8s.io/community/contributors/devel/sig-architecture/api-conventions.md#types-kinds", + Type: []string{"string"}, + Format: "", + }, + }, + "apiVersion": { + SchemaProps: spec.SchemaProps{ + Description: "APIVersion defines the versioned schema of this representation of an object. Servers should convert recognized schemas to the latest internal value, and may reject unrecognized values. More info: https://git.k8s.io/community/contributors/devel/sig-architecture/api-conventions.md#resources", + Type: []string{"string"}, + Format: "", + }, + }, + "metadata": { + SchemaProps: spec.SchemaProps{ + Description: "metadata contains the object metadata", + Default: map[string]interface{}{}, + Ref: ref("k8s.io/apimachinery/pkg/apis/meta/v1.ObjectMeta"), + }, + }, + "spec": { + SchemaProps: spec.SchemaProps{ + Description: "spec specifies the desired state of the resource.", + Default: map[string]interface{}{}, + Ref: ref("github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.TrunkSpec"), + }, + }, + "status": { + SchemaProps: spec.SchemaProps{ + Description: "status defines the observed state of the resource.", + Default: map[string]interface{}{}, + Ref: ref("github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.TrunkStatus"), + }, + }, + }, + }, + }, + Dependencies: []string{ + "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.TrunkSpec", "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.TrunkStatus", "k8s.io/apimachinery/pkg/apis/meta/v1.ObjectMeta"}, + } +} + +func schema_openstack_resource_controller_v2_api_v1alpha1_TrunkFilter(ref common.ReferenceCallback) common.OpenAPIDefinition { + return common.OpenAPIDefinition{ + Schema: spec.Schema{ + SchemaProps: spec.SchemaProps{ + Description: "TrunkFilter defines an existing resource by its properties", + Type: []string{"object"}, + Properties: map[string]spec.Schema{ + "name": { + SchemaProps: spec.SchemaProps{ + Description: "name of the existing resource", + Type: []string{"string"}, + Format: "", + }, + }, + "description": { + SchemaProps: spec.SchemaProps{ + Description: "description of the existing resource", + Type: []string{"string"}, + Format: "", + }, + }, + "portRef": { + SchemaProps: spec.SchemaProps{ + Description: "portRef is a reference to the ORC Port which this resource is associated with.", + Type: []string{"string"}, + Format: "", + }, + }, + "projectRef": { + SchemaProps: spec.SchemaProps{ + Description: "projectRef is a reference to the ORC Project which this resource is associated with.", + Type: []string{"string"}, + Format: "", + }, + }, + "status": { + SchemaProps: spec.SchemaProps{ + Description: "status indicates whether the trunk is currently operational. Possible values include `ACTIVE', `DOWN', `BUILD', `DEGRADED' or `ERROR'. Plug-ins might define additional values.", + Type: []string{"string"}, + Format: "", + }, + }, + "adminStateUp": { + SchemaProps: spec.SchemaProps{ + Description: "adminStateUp is the administrative state of the trunk.", + Type: []string{"boolean"}, + Format: "", + }, + }, + "tags": { + VendorExtensible: spec.VendorExtensible{ + Extensions: spec.Extensions{ + "x-kubernetes-list-type": "set", + }, + }, + SchemaProps: spec.SchemaProps{ + Description: "tags is a list of tags to filter by. If specified, the resource must have all of the tags specified to be included in the result.", + Type: []string{"array"}, + Items: &spec.SchemaOrArray{ + Schema: &spec.Schema{ + SchemaProps: spec.SchemaProps{ + Default: "", + Type: []string{"string"}, + Format: "", + }, + }, + }, + }, + }, + "tagsAny": { + VendorExtensible: spec.VendorExtensible{ + Extensions: spec.Extensions{ + "x-kubernetes-list-type": "set", + }, + }, + SchemaProps: spec.SchemaProps{ + Description: "tagsAny is a list of tags to filter by. If specified, the resource must have at least one of the tags specified to be included in the result.", + Type: []string{"array"}, + Items: &spec.SchemaOrArray{ + Schema: &spec.Schema{ + SchemaProps: spec.SchemaProps{ + Default: "", + Type: []string{"string"}, + Format: "", + }, + }, + }, + }, + }, + "notTags": { + VendorExtensible: spec.VendorExtensible{ + Extensions: spec.Extensions{ + "x-kubernetes-list-type": "set", + }, + }, + SchemaProps: spec.SchemaProps{ + Description: "notTags is a list of tags to filter by. If specified, resources which contain all of the given tags will be excluded from the result.", + Type: []string{"array"}, + Items: &spec.SchemaOrArray{ + Schema: &spec.Schema{ + SchemaProps: spec.SchemaProps{ + Default: "", + Type: []string{"string"}, + Format: "", + }, + }, + }, + }, + }, + "notTagsAny": { + VendorExtensible: spec.VendorExtensible{ + Extensions: spec.Extensions{ + "x-kubernetes-list-type": "set", + }, + }, + SchemaProps: spec.SchemaProps{ + Description: "notTagsAny is a list of tags to filter by. If specified, resources which contain any of the given tags will be excluded from the result.", + Type: []string{"array"}, + Items: &spec.SchemaOrArray{ + Schema: &spec.Schema{ + SchemaProps: spec.SchemaProps{ + Default: "", + Type: []string{"string"}, + Format: "", + }, + }, + }, + }, + }, + }, + }, + }, + } +} + +func schema_openstack_resource_controller_v2_api_v1alpha1_TrunkImport(ref common.ReferenceCallback) common.OpenAPIDefinition { + return common.OpenAPIDefinition{ + Schema: spec.Schema{ + SchemaProps: spec.SchemaProps{ + Description: "TrunkImport specifies an existing resource which will be imported instead of creating a new one", + Type: []string{"object"}, + Properties: map[string]spec.Schema{ + "id": { + SchemaProps: spec.SchemaProps{ + Description: "id contains the unique identifier of an existing OpenStack resource. Note that when specifying an import by ID, the resource MUST already exist. The ORC object will enter an error state if the resource does not exist.", + Type: []string{"string"}, + Format: "", + }, + }, + "filter": { + SchemaProps: spec.SchemaProps{ + Description: "filter contains a resource query which is expected to return a single result. The controller will continue to retry if filter returns no results. If filter returns multiple results the controller will set an error state and will not continue to retry.", + Ref: ref("github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.TrunkFilter"), + }, + }, + }, + }, + }, + Dependencies: []string{ + "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.TrunkFilter"}, + } +} + +func schema_openstack_resource_controller_v2_api_v1alpha1_TrunkList(ref common.ReferenceCallback) common.OpenAPIDefinition { + return common.OpenAPIDefinition{ + Schema: spec.Schema{ + SchemaProps: spec.SchemaProps{ + Description: "TrunkList contains a list of Trunk.", + Type: []string{"object"}, + Properties: map[string]spec.Schema{ + "kind": { + SchemaProps: spec.SchemaProps{ + Description: "Kind is a string value representing the REST resource this object represents. Servers may infer this from the endpoint the client submits requests to. Cannot be updated. In CamelCase. More info: https://git.k8s.io/community/contributors/devel/sig-architecture/api-conventions.md#types-kinds", + Type: []string{"string"}, + Format: "", + }, + }, + "apiVersion": { + SchemaProps: spec.SchemaProps{ + Description: "APIVersion defines the versioned schema of this representation of an object. Servers should convert recognized schemas to the latest internal value, and may reject unrecognized values. More info: https://git.k8s.io/community/contributors/devel/sig-architecture/api-conventions.md#resources", + Type: []string{"string"}, + Format: "", + }, + }, + "metadata": { + SchemaProps: spec.SchemaProps{ + Description: "metadata contains the list metadata", + Default: map[string]interface{}{}, + Ref: ref("k8s.io/apimachinery/pkg/apis/meta/v1.ListMeta"), + }, + }, + "items": { + SchemaProps: spec.SchemaProps{ + Description: "items contains a list of Trunk.", + Type: []string{"array"}, + Items: &spec.SchemaOrArray{ + Schema: &spec.Schema{ + SchemaProps: spec.SchemaProps{ + Default: map[string]interface{}{}, + Ref: ref("github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.Trunk"), + }, + }, + }, + }, + }, + }, + Required: []string{"items"}, + }, + }, + Dependencies: []string{ + "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.Trunk", "k8s.io/apimachinery/pkg/apis/meta/v1.ListMeta"}, + } +} + +func schema_openstack_resource_controller_v2_api_v1alpha1_TrunkResourceSpec(ref common.ReferenceCallback) common.OpenAPIDefinition { + return common.OpenAPIDefinition{ + Schema: spec.Schema{ + SchemaProps: spec.SchemaProps{ + Description: "TrunkResourceSpec contains the desired state of the resource.", + Type: []string{"object"}, + Properties: map[string]spec.Schema{ + "name": { + SchemaProps: spec.SchemaProps{ + Description: "name will be the name of the created resource. If not specified, the name of the ORC object will be used.", + Type: []string{"string"}, + Format: "", + }, + }, + "description": { + SchemaProps: spec.SchemaProps{ + Description: "description is a human-readable description for the resource.", + Type: []string{"string"}, + Format: "", + }, + }, + "portRef": { + SchemaProps: spec.SchemaProps{ + Description: "portRef is a reference to the ORC Port which this resource is associated with.", + Type: []string{"string"}, + Format: "", + }, + }, + "projectRef": { + SchemaProps: spec.SchemaProps{ + Description: "projectRef is a reference to the ORC Project which this resource is associated with.", + Type: []string{"string"}, + Format: "", + }, + }, + "adminStateUp": { + SchemaProps: spec.SchemaProps{ + Description: "adminStateUp is the administrative state of the trunk. If false (down), the trunk does not forward packets.", + Type: []string{"boolean"}, + Format: "", + }, + }, + "subports": { + VendorExtensible: spec.VendorExtensible{ + Extensions: spec.Extensions{ + "x-kubernetes-list-type": "atomic", + }, + }, + SchemaProps: spec.SchemaProps{ + Description: "subports is the list of ports to attach to the trunk.", + Type: []string{"array"}, + Items: &spec.SchemaOrArray{ + Schema: &spec.Schema{ + SchemaProps: spec.SchemaProps{ + Default: map[string]interface{}{}, + Ref: ref("github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.TrunkSubportSpec"), + }, + }, + }, + }, + }, + "tags": { + VendorExtensible: spec.VendorExtensible{ + Extensions: spec.Extensions{ + "x-kubernetes-list-type": "set", + }, + }, + SchemaProps: spec.SchemaProps{ + Description: "tags is a list of Neutron tags to apply to the trunk.", + Type: []string{"array"}, + Items: &spec.SchemaOrArray{ + Schema: &spec.Schema{ + SchemaProps: spec.SchemaProps{ + Default: "", + Type: []string{"string"}, + Format: "", + }, + }, + }, + }, + }, + }, + Required: []string{"portRef"}, + }, + }, + Dependencies: []string{ + "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.TrunkSubportSpec"}, + } +} + +func schema_openstack_resource_controller_v2_api_v1alpha1_TrunkResourceStatus(ref common.ReferenceCallback) common.OpenAPIDefinition { + return common.OpenAPIDefinition{ + Schema: spec.Schema{ + SchemaProps: spec.SchemaProps{ + Description: "TrunkResourceStatus represents the observed state of the resource.", + Type: []string{"object"}, + Properties: map[string]spec.Schema{ + "name": { + SchemaProps: spec.SchemaProps{ + Description: "name is a Human-readable name for the resource. Might not be unique.", + Type: []string{"string"}, + Format: "", + }, + }, + "description": { + SchemaProps: spec.SchemaProps{ + Description: "description is a human-readable description for the resource.", + Type: []string{"string"}, + Format: "", + }, + }, + "portID": { + SchemaProps: spec.SchemaProps{ + Description: "portID is the ID of the Port to which the resource is associated.", + Type: []string{"string"}, + Format: "", + }, + }, + "projectID": { + SchemaProps: spec.SchemaProps{ + Description: "projectID is the ID of the Project to which the resource is associated.", + Type: []string{"string"}, + Format: "", + }, + }, + "tenantID": { + SchemaProps: spec.SchemaProps{ + Description: "tenantID is the project owner of the trunk (alias of projectID in some deployments).", + Type: []string{"string"}, + Format: "", + }, + }, + "status": { + SchemaProps: spec.SchemaProps{ + Description: "status indicates whether the trunk is currently operational.", + Type: []string{"string"}, + Format: "", + }, + }, + "tags": { + VendorExtensible: spec.VendorExtensible{ + Extensions: spec.Extensions{ + "x-kubernetes-list-type": "atomic", + }, + }, + SchemaProps: spec.SchemaProps{ + Description: "tags is the list of tags on the resource.", + Type: []string{"array"}, + Items: &spec.SchemaOrArray{ + Schema: &spec.Schema{ + SchemaProps: spec.SchemaProps{ + Default: "", + Type: []string{"string"}, + Format: "", + }, + }, + }, + }, + }, + "createdAt": { + SchemaProps: spec.SchemaProps{ + Description: "createdAt shows the date and time when the resource was created. The date and time stamp format is ISO 8601", + Ref: ref("k8s.io/apimachinery/pkg/apis/meta/v1.Time"), + }, + }, + "updatedAt": { + SchemaProps: spec.SchemaProps{ + Description: "updatedAt shows the date and time when the resource was updated. The date and time stamp format is ISO 8601", + Ref: ref("k8s.io/apimachinery/pkg/apis/meta/v1.Time"), + }, + }, + "revisionNumber": { + SchemaProps: spec.SchemaProps{ + Description: "revisionNumber optionally set via extensions/standard-attr-revisions", + Type: []string{"integer"}, + Format: "int64", + }, + }, + "adminStateUp": { + SchemaProps: spec.SchemaProps{ + Description: "adminStateUp is the administrative state of the trunk.", + Type: []string{"boolean"}, + Format: "", + }, + }, + "subports": { + VendorExtensible: spec.VendorExtensible{ + Extensions: spec.Extensions{ + "x-kubernetes-list-type": "atomic", + }, + }, + SchemaProps: spec.SchemaProps{ + Description: "subports is a list of ports associated with the trunk.", + Type: []string{"array"}, + Items: &spec.SchemaOrArray{ + Schema: &spec.Schema{ + SchemaProps: spec.SchemaProps{ + Default: map[string]interface{}{}, + Ref: ref("github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.TrunkSubportStatus"), + }, + }, + }, + }, + }, + }, + }, + }, + Dependencies: []string{ + "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.TrunkSubportStatus", "k8s.io/apimachinery/pkg/apis/meta/v1.Time"}, + } +} + +func schema_openstack_resource_controller_v2_api_v1alpha1_TrunkSpec(ref common.ReferenceCallback) common.OpenAPIDefinition { + return common.OpenAPIDefinition{ + Schema: spec.Schema{ + SchemaProps: spec.SchemaProps{ + Description: "TrunkSpec defines the desired state of an ORC object.", + Type: []string{"object"}, + Properties: map[string]spec.Schema{ + "import": { + SchemaProps: spec.SchemaProps{ + Description: "import refers to an existing OpenStack resource which will be imported instead of creating a new one.", + Ref: ref("github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.TrunkImport"), + }, + }, + "resource": { + SchemaProps: spec.SchemaProps{ + Description: "resource specifies the desired state of the resource.\n\nresource may not be specified if the management policy is `unmanaged`.\n\nresource must be specified if the management policy is `managed`.", + Ref: ref("github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.TrunkResourceSpec"), + }, + }, + "managementPolicy": { + SchemaProps: spec.SchemaProps{ + Description: "managementPolicy defines how ORC will treat the object. Valid values are `managed`: ORC will create, update, and delete the resource; `unmanaged`: ORC will import an existing resource, and will not apply updates to it or delete it.", + Type: []string{"string"}, + Format: "", + }, + }, + "managedOptions": { + SchemaProps: spec.SchemaProps{ + Description: "managedOptions specifies options which may be applied to managed objects.", + Ref: ref("github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.ManagedOptions"), + }, + }, + "cloudCredentialsRef": { + SchemaProps: spec.SchemaProps{ + Description: "cloudCredentialsRef points to a secret containing OpenStack credentials", + Default: map[string]interface{}{}, + Ref: ref("github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.CloudCredentialsReference"), + }, + }, + }, + Required: []string{"cloudCredentialsRef"}, + }, + }, + Dependencies: []string{ + "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.CloudCredentialsReference", "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.ManagedOptions", "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.TrunkImport", "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.TrunkResourceSpec"}, + } +} + +func schema_openstack_resource_controller_v2_api_v1alpha1_TrunkStatus(ref common.ReferenceCallback) common.OpenAPIDefinition { + return common.OpenAPIDefinition{ + Schema: spec.Schema{ + SchemaProps: spec.SchemaProps{ + Description: "TrunkStatus defines the observed state of an ORC resource.", + Type: []string{"object"}, + Properties: map[string]spec.Schema{ + "conditions": { + VendorExtensible: spec.VendorExtensible{ + Extensions: spec.Extensions{ + "x-kubernetes-list-map-keys": []interface{}{ + "type", + }, + "x-kubernetes-list-type": "map", + "x-kubernetes-patch-merge-key": "type", + "x-kubernetes-patch-strategy": "merge", + }, + }, + SchemaProps: spec.SchemaProps{ + Description: "conditions represents the observed status of the object. Known .status.conditions.type are: \"Available\", \"Progressing\"\n\nAvailable represents the availability of the OpenStack resource. If it is true then the resource is ready for use.\n\nProgressing indicates whether the controller is still attempting to reconcile the current state of the OpenStack resource to the desired state. Progressing will be False either because the desired state has been achieved, or because some terminal error prevents it from ever being achieved and the controller is no longer attempting to reconcile. If Progressing is True, an observer waiting on the resource should continue to wait.", + Type: []string{"array"}, + Items: &spec.SchemaOrArray{ + Schema: &spec.Schema{ + SchemaProps: spec.SchemaProps{ + Default: map[string]interface{}{}, + Ref: ref("k8s.io/apimachinery/pkg/apis/meta/v1.Condition"), + }, + }, + }, + }, + }, + "id": { + SchemaProps: spec.SchemaProps{ + Description: "id is the unique identifier of the OpenStack resource.", + Type: []string{"string"}, + Format: "", + }, + }, + "resource": { + SchemaProps: spec.SchemaProps{ + Description: "resource contains the observed state of the OpenStack resource.", + Ref: ref("github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.TrunkResourceStatus"), + }, + }, + }, + }, + }, + Dependencies: []string{ + "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.TrunkResourceStatus", "k8s.io/apimachinery/pkg/apis/meta/v1.Condition"}, + } +} + +func schema_openstack_resource_controller_v2_api_v1alpha1_TrunkSubportSpec(ref common.ReferenceCallback) common.OpenAPIDefinition { + return common.OpenAPIDefinition{ + Schema: spec.Schema{ + SchemaProps: spec.SchemaProps{ + Description: "TrunkSubportSpec represents a subport to attach to a trunk. It maps to gophercloud's trunks.Subport.", + Type: []string{"object"}, + Properties: map[string]spec.Schema{ + "portRef": { + SchemaProps: spec.SchemaProps{ + Description: "portRef is a reference to the ORC Port that will be attached as a subport.", + Type: []string{"string"}, + Format: "", + }, + }, + "segmentationID": { + SchemaProps: spec.SchemaProps{ + Description: "segmentationID is the segmentation ID for the subport (e.g. VLAN ID).", + Type: []string{"integer"}, + Format: "int32", + }, + }, + "segmentationType": { + SchemaProps: spec.SchemaProps{ + Description: "segmentationType is the segmentation type for the subport (e.g. vlan).", + Type: []string{"string"}, + Format: "", + }, + }, + }, + Required: []string{"portRef", "segmentationID", "segmentationType"}, + }, + }, + } +} + +func schema_openstack_resource_controller_v2_api_v1alpha1_TrunkSubportStatus(ref common.ReferenceCallback) common.OpenAPIDefinition { + return common.OpenAPIDefinition{ + Schema: spec.Schema{ + SchemaProps: spec.SchemaProps{ + Description: "TrunkSubportStatus represents an attached subport on a trunk. It maps to gophercloud's trunks.Subport.", + Type: []string{"object"}, + Properties: map[string]spec.Schema{ + "portID": { + SchemaProps: spec.SchemaProps{ + Description: "portID is the OpenStack ID of the Port attached as a subport.", + Type: []string{"string"}, + Format: "", + }, + }, + "segmentationID": { + SchemaProps: spec.SchemaProps{ + Description: "segmentationID is the segmentation ID for the subport (e.g. VLAN ID).", + Type: []string{"integer"}, + Format: "int32", + }, + }, + "segmentationType": { + SchemaProps: spec.SchemaProps{ + Description: "segmentationType is the segmentation type for the subport (e.g. vlan).", + Type: []string{"string"}, + Format: "", + }, + }, + }, + }, + }, + } +} + func schema_openstack_resource_controller_v2_api_v1alpha1_UserDataSpec(ref common.ReferenceCallback) common.OpenAPIDefinition { return common.OpenAPIDefinition{ Schema: spec.Schema{ diff --git a/cmd/resource-generator/main.go b/cmd/resource-generator/main.go index b3f4ece76..45e9d364b 100644 --- a/cmd/resource-generator/main.go +++ b/cmd/resource-generator/main.go @@ -144,6 +144,10 @@ var resources []templateFields = []templateFields{ Name: "Subnet", ExistingOSClient: true, }, + { + Name: "Trunk", + ExistingOSClient: true, + }, { Name: "Volume", }, diff --git a/config/crd/bases/openstack.k-orc.cloud_trunks.yaml b/config/crd/bases/openstack.k-orc.cloud_trunks.yaml new file mode 100644 index 000000000..13a72f5b3 --- /dev/null +++ b/config/crd/bases/openstack.k-orc.cloud_trunks.yaml @@ -0,0 +1,508 @@ +--- +apiVersion: apiextensions.k8s.io/v1 +kind: CustomResourceDefinition +metadata: + annotations: + controller-gen.kubebuilder.io/version: v0.17.1 + name: trunks.openstack.k-orc.cloud +spec: + group: openstack.k-orc.cloud + names: + categories: + - openstack + kind: Trunk + listKind: TrunkList + plural: trunks + singular: trunk + scope: Namespaced + versions: + - additionalPrinterColumns: + - description: Resource ID + jsonPath: .status.id + name: ID + type: string + - description: Availability status of resource + jsonPath: .status.conditions[?(@.type=='Available')].status + name: Available + type: string + - description: Message describing current progress status + jsonPath: .status.conditions[?(@.type=='Progressing')].message + name: Message + type: string + name: v1alpha1 + schema: + openAPIV3Schema: + description: Trunk is the Schema for an ORC resource. + properties: + apiVersion: + description: |- + APIVersion defines the versioned schema of this representation of an object. + Servers should convert recognized schemas to the latest internal value, and + may reject unrecognized values. + More info: https://git.k8s.io/community/contributors/devel/sig-architecture/api-conventions.md#resources + type: string + kind: + description: |- + Kind is a string value representing the REST resource this object represents. + Servers may infer this from the endpoint the client submits requests to. + Cannot be updated. + In CamelCase. + More info: https://git.k8s.io/community/contributors/devel/sig-architecture/api-conventions.md#types-kinds + type: string + metadata: + type: object + spec: + description: spec specifies the desired state of the resource. + properties: + cloudCredentialsRef: + description: cloudCredentialsRef points to a secret containing OpenStack + credentials + properties: + cloudName: + description: cloudName specifies the name of the entry in the + clouds.yaml file to use. + maxLength: 256 + minLength: 1 + type: string + secretName: + description: |- + secretName is the name of a secret in the same namespace as the resource being provisioned. + The secret must contain a key named `clouds.yaml` which contains an OpenStack clouds.yaml file. + The secret may optionally contain a key named `cacert` containing a PEM-encoded CA certificate. + maxLength: 253 + minLength: 1 + type: string + required: + - cloudName + - secretName + type: object + import: + description: |- + import refers to an existing OpenStack resource which will be imported instead of + creating a new one. + maxProperties: 1 + minProperties: 1 + properties: + filter: + description: |- + filter contains a resource query which is expected to return a single + result. The controller will continue to retry if filter returns no + results. If filter returns multiple results the controller will set an + error state and will not continue to retry. + minProperties: 1 + properties: + adminStateUp: + description: adminStateUp is the administrative state of the + trunk. + type: boolean + description: + description: description of the existing resource + maxLength: 255 + minLength: 1 + type: string + name: + description: name of the existing resource + maxLength: 255 + minLength: 1 + pattern: ^[^,]+$ + type: string + notTags: + description: |- + notTags is a list of tags to filter by. If specified, resources which + contain all of the given tags will be excluded from the result. + items: + description: |- + NeutronTag represents a tag on a Neutron resource. + It may not be empty and may not contain commas. + maxLength: 255 + minLength: 1 + type: string + maxItems: 64 + type: array + x-kubernetes-list-type: set + notTagsAny: + description: |- + notTagsAny is a list of tags to filter by. If specified, resources + which contain any of the given tags will be excluded from the result. + items: + description: |- + NeutronTag represents a tag on a Neutron resource. + It may not be empty and may not contain commas. + maxLength: 255 + minLength: 1 + type: string + maxItems: 64 + type: array + x-kubernetes-list-type: set + portRef: + description: portRef is a reference to the ORC Port which + this resource is associated with. + maxLength: 253 + minLength: 1 + type: string + projectRef: + description: projectRef is a reference to the ORC Project + which this resource is associated with. + maxLength: 253 + minLength: 1 + type: string + status: + description: |- + status indicates whether the trunk is currently operational. Possible values include + `ACTIVE', `DOWN', `BUILD', `DEGRADED' or `ERROR'. Plug-ins might define additional values. + maxLength: 1024 + type: string + tags: + description: |- + tags is a list of tags to filter by. If specified, the resource must + have all of the tags specified to be included in the result. + items: + description: |- + NeutronTag represents a tag on a Neutron resource. + It may not be empty and may not contain commas. + maxLength: 255 + minLength: 1 + type: string + maxItems: 64 + type: array + x-kubernetes-list-type: set + tagsAny: + description: |- + tagsAny is a list of tags to filter by. If specified, the resource + must have at least one of the tags specified to be included in the + result. + items: + description: |- + NeutronTag represents a tag on a Neutron resource. + It may not be empty and may not contain commas. + maxLength: 255 + minLength: 1 + type: string + maxItems: 64 + type: array + x-kubernetes-list-type: set + type: object + id: + description: |- + id contains the unique identifier of an existing OpenStack resource. Note + that when specifying an import by ID, the resource MUST already exist. + The ORC object will enter an error state if the resource does not exist. + format: uuid + type: string + type: object + managedOptions: + description: managedOptions specifies options which may be applied + to managed objects. + properties: + onDelete: + default: delete + description: |- + onDelete specifies the behaviour of the controller when the ORC + object is deleted. Options are `delete` - delete the OpenStack resource; + `detach` - do not delete the OpenStack resource. If not specified, the + default is `delete`. + enum: + - delete + - detach + type: string + type: object + managementPolicy: + default: managed + description: |- + managementPolicy defines how ORC will treat the object. Valid values are + `managed`: ORC will create, update, and delete the resource; `unmanaged`: + ORC will import an existing resource, and will not apply updates to it or + delete it. + enum: + - managed + - unmanaged + type: string + x-kubernetes-validations: + - message: managementPolicy is immutable + rule: self == oldSelf + resource: + description: |- + resource specifies the desired state of the resource. + + resource may not be specified if the management policy is `unmanaged`. + + resource must be specified if the management policy is `managed`. + properties: + adminStateUp: + description: |- + adminStateUp is the administrative state of the trunk. If false (down), + the trunk does not forward packets. + type: boolean + description: + description: description is a human-readable description for the + resource. + maxLength: 255 + minLength: 1 + type: string + name: + description: |- + name will be the name of the created resource. If not specified, the + name of the ORC object will be used. + maxLength: 255 + minLength: 1 + pattern: ^[^,]+$ + type: string + portRef: + description: portRef is a reference to the ORC Port which this + resource is associated with. + maxLength: 253 + minLength: 1 + type: string + x-kubernetes-validations: + - message: portRef is immutable + rule: self == oldSelf + projectRef: + description: projectRef is a reference to the ORC Project which + this resource is associated with. + maxLength: 253 + minLength: 1 + type: string + x-kubernetes-validations: + - message: projectRef is immutable + rule: self == oldSelf + subports: + description: subports is the list of ports to attach to the trunk. + items: + description: |- + TrunkSubportSpec represents a subport to attach to a trunk. + It maps to gophercloud's trunks.Subport. + properties: + portRef: + description: portRef is a reference to the ORC Port that + will be attached as a subport. + maxLength: 253 + minLength: 1 + type: string + segmentationID: + description: segmentationID is the segmentation ID for the + subport (e.g. VLAN ID). + format: int32 + maximum: 4094 + minimum: 1 + type: integer + segmentationType: + description: segmentationType is the segmentation type for + the subport (e.g. vlan). + enum: + - inherit + - vlan + maxLength: 32 + minLength: 1 + type: string + required: + - portRef + - segmentationID + - segmentationType + type: object + maxItems: 1024 + type: array + x-kubernetes-list-type: atomic + tags: + description: tags is a list of Neutron tags to apply to the trunk. + items: + description: |- + NeutronTag represents a tag on a Neutron resource. + It may not be empty and may not contain commas. + maxLength: 255 + minLength: 1 + type: string + maxItems: 64 + type: array + x-kubernetes-list-type: set + required: + - portRef + type: object + required: + - cloudCredentialsRef + type: object + x-kubernetes-validations: + - message: resource must be specified when policy is managed + rule: 'self.managementPolicy == ''managed'' ? has(self.resource) : true' + - message: import may not be specified when policy is managed + rule: 'self.managementPolicy == ''managed'' ? !has(self.__import__) + : true' + - message: resource may not be specified when policy is unmanaged + rule: 'self.managementPolicy == ''unmanaged'' ? !has(self.resource) + : true' + - message: import must be specified when policy is unmanaged + rule: 'self.managementPolicy == ''unmanaged'' ? has(self.__import__) + : true' + - message: managedOptions may only be provided when policy is managed + rule: 'has(self.managedOptions) ? self.managementPolicy == ''managed'' + : true' + status: + description: status defines the observed state of the resource. + properties: + conditions: + description: |- + conditions represents the observed status of the object. + Known .status.conditions.type are: "Available", "Progressing" + + Available represents the availability of the OpenStack resource. If it is + true then the resource is ready for use. + + Progressing indicates whether the controller is still attempting to + reconcile the current state of the OpenStack resource to the desired + state. Progressing will be False either because the desired state has + been achieved, or because some terminal error prevents it from ever being + achieved and the controller is no longer attempting to reconcile. If + Progressing is True, an observer waiting on the resource should continue + to wait. + items: + description: Condition contains details for one aspect of the current + state of this API Resource. + properties: + lastTransitionTime: + description: |- + lastTransitionTime is the last time the condition transitioned from one status to another. + This should be when the underlying condition changed. If that is not known, then using the time when the API field changed is acceptable. + format: date-time + type: string + message: + description: |- + message is a human readable message indicating details about the transition. + This may be an empty string. + maxLength: 32768 + type: string + observedGeneration: + description: |- + observedGeneration represents the .metadata.generation that the condition was set based upon. + For instance, if .metadata.generation is currently 12, but the .status.conditions[x].observedGeneration is 9, the condition is out of date + with respect to the current state of the instance. + format: int64 + minimum: 0 + type: integer + reason: + description: |- + reason contains a programmatic identifier indicating the reason for the condition's last transition. + Producers of specific condition types may define expected values and meanings for this field, + and whether the values are considered a guaranteed API. + The value should be a CamelCase string. + This field may not be empty. + maxLength: 1024 + minLength: 1 + pattern: ^[A-Za-z]([A-Za-z0-9_,:]*[A-Za-z0-9_])?$ + type: string + status: + description: status of the condition, one of True, False, Unknown. + enum: + - "True" + - "False" + - Unknown + type: string + type: + description: type of condition in CamelCase or in foo.example.com/CamelCase. + maxLength: 316 + pattern: ^([a-z0-9]([-a-z0-9]*[a-z0-9])?(\.[a-z0-9]([-a-z0-9]*[a-z0-9])?)*/)?(([A-Za-z0-9][-A-Za-z0-9_.]*)?[A-Za-z0-9])$ + type: string + required: + - lastTransitionTime + - message + - reason + - status + - type + type: object + maxItems: 32 + type: array + x-kubernetes-list-map-keys: + - type + x-kubernetes-list-type: map + id: + description: id is the unique identifier of the OpenStack resource. + type: string + resource: + description: resource contains the observed state of the OpenStack + resource. + properties: + adminStateUp: + description: adminStateUp is the administrative state of the trunk. + type: boolean + createdAt: + description: createdAt shows the date and time when the resource + was created. The date and time stamp format is ISO 8601 + format: date-time + type: string + description: + description: description is a human-readable description for the + resource. + maxLength: 1024 + type: string + name: + description: name is a Human-readable name for the resource. Might + not be unique. + maxLength: 1024 + type: string + portID: + description: portID is the ID of the Port to which the resource + is associated. + maxLength: 1024 + type: string + projectID: + description: projectID is the ID of the Project to which the resource + is associated. + maxLength: 1024 + type: string + revisionNumber: + description: revisionNumber optionally set via extensions/standard-attr-revisions + format: int64 + type: integer + status: + description: status indicates whether the trunk is currently operational. + maxLength: 1024 + type: string + subports: + description: subports is a list of ports associated with the trunk. + items: + description: |- + TrunkSubportStatus represents an attached subport on a trunk. + It maps to gophercloud's trunks.Subport. + properties: + portID: + description: portID is the OpenStack ID of the Port attached + as a subport. + maxLength: 1024 + type: string + segmentationID: + description: segmentationID is the segmentation ID for the + subport (e.g. VLAN ID). + format: int32 + type: integer + segmentationType: + description: segmentationType is the segmentation type for + the subport (e.g. vlan). + maxLength: 1024 + type: string + type: object + maxItems: 1024 + type: array + x-kubernetes-list-type: atomic + tags: + description: tags is the list of tags on the resource. + items: + maxLength: 1024 + type: string + maxItems: 64 + type: array + x-kubernetes-list-type: atomic + tenantID: + description: tenantID is the project owner of the trunk (alias + of projectID in some deployments). + maxLength: 1024 + type: string + updatedAt: + description: updatedAt shows the date and time when the resource + was updated. The date and time stamp format is ISO 8601 + format: date-time + type: string + type: object + type: object + type: object + served: true + storage: true + subresources: + status: {} diff --git a/config/crd/kustomization.yaml b/config/crd/kustomization.yaml index 33b8c85e2..b73dcac05 100644 --- a/config/crd/kustomization.yaml +++ b/config/crd/kustomization.yaml @@ -20,6 +20,7 @@ resources: - bases/openstack.k-orc.cloud_servergroups.yaml - bases/openstack.k-orc.cloud_services.yaml - bases/openstack.k-orc.cloud_subnets.yaml +- bases/openstack.k-orc.cloud_trunks.yaml - bases/openstack.k-orc.cloud_volumes.yaml - bases/openstack.k-orc.cloud_volumetypes.yaml # +kubebuilder:scaffold:crdkustomizeresource diff --git a/config/rbac/role.yaml b/config/rbac/role.yaml index 5a0a7443b..5545c52a6 100644 --- a/config/rbac/role.yaml +++ b/config/rbac/role.yaml @@ -34,6 +34,7 @@ rules: - servers - services - subnets + - trunks - volumes - volumetypes verbs: @@ -64,6 +65,7 @@ rules: - servers/status - services/status - subnets/status + - trunks/status - volumes/status - volumetypes/status verbs: diff --git a/config/samples/kustomization.yaml b/config/samples/kustomization.yaml index dac467c69..aa2a75e43 100644 --- a/config/samples/kustomization.yaml +++ b/config/samples/kustomization.yaml @@ -18,6 +18,7 @@ resources: - openstack_v1alpha1_servergroup.yaml - openstack_v1alpha1_service.yaml - openstack_v1alpha1_subnet.yaml +- openstack_v1alpha1_trunk.yaml - openstack_v1alpha1_volume.yaml - openstack_v1alpha1_volumetype.yaml # +kubebuilder:scaffold:manifestskustomizesamples diff --git a/config/samples/openstack_v1alpha1_trunk.yaml b/config/samples/openstack_v1alpha1_trunk.yaml new file mode 100644 index 000000000..7019315f1 --- /dev/null +++ b/config/samples/openstack_v1alpha1_trunk.yaml @@ -0,0 +1,24 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Trunk +metadata: + name: trunk-sample +spec: + cloudCredentialsRef: + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + resource: + description: Sample Trunk + name: trunk-sample-name + portRef: my-port + subPorts: + - portRef: sub-port-1 + segmentationID: 101 + segmentationType: vlan + - portRef: sub-port-2 + segmentationID: 102 + segmentationType: vlan + tags: + - tag1 + - tag2 diff --git a/examples/components/kustomizeconfig/kustomizeconfig.yaml b/examples/components/kustomizeconfig/kustomizeconfig.yaml index 90866d4e5..c8439d33b 100644 --- a/examples/components/kustomizeconfig/kustomizeconfig.yaml +++ b/examples/components/kustomizeconfig/kustomizeconfig.yaml @@ -25,6 +25,8 @@ nameReference: kind: Subnet - path: spec/cloudCredentialsRef/secretName kind: KeyPair + - path: spec/cloudCredentialsRef/secretName + kind: Trunk - kind: Network fieldSpecs: @@ -77,6 +79,12 @@ nameReference: kind: FloatingIP - path: spec/resource/ports[]/portRef kind: Server + - path: spec/resource/portRef + kind: Trunk + - path: spec/resource/subports[]/portRef + kind: Trunk + - path: spec/import/filter/portRef + kind: Trunk - kind: Project fieldSpecs: @@ -90,3 +98,7 @@ nameReference: kind: Port - path: spec/resource/projectRef kind: SecurityGroup + - path: spec/resource/projectRef + kind: Trunk + - path: spec/import/filter/projectRef + kind: Trunk diff --git a/go.mod b/go.mod index 419ce1cbe..48ca03591 100644 --- a/go.mod +++ b/go.mod @@ -5,6 +5,7 @@ go 1.24.0 require ( github.com/davecgh/go-spew v1.1.2-0.20180830191138-d8f796af33cc github.com/go-logr/logr v1.4.3 + github.com/google/go-cmp v0.7.0 github.com/gophercloud/gophercloud/v2 v2.10.0 github.com/gophercloud/utils/v2 v2.0.0-20241220104409-2e0af06694a1 github.com/onsi/ginkgo/v2 v2.27.3 @@ -49,7 +50,6 @@ require ( github.com/google/btree v1.1.3 // indirect github.com/google/cel-go v0.26.0 // indirect github.com/google/gnostic-models v0.7.0 // indirect - github.com/google/go-cmp v0.7.0 // indirect github.com/google/pprof v0.0.0-20250403155104-27863c87afa6 // indirect github.com/google/uuid v1.6.0 // indirect github.com/grpc-ecosystem/grpc-gateway/v2 v2.26.3 // indirect diff --git a/internal/controllers/trunk/actuator.go b/internal/controllers/trunk/actuator.go new file mode 100644 index 000000000..f0a6d1c2b --- /dev/null +++ b/internal/controllers/trunk/actuator.go @@ -0,0 +1,483 @@ +/* +Copyright 2025 The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +package trunk + +import ( + "context" + "fmt" + "iter" + + "github.com/gophercloud/gophercloud/v2/openstack/networking/v2/extensions/trunks" + corev1 "k8s.io/api/core/v1" + apierrors "k8s.io/apimachinery/pkg/api/errors" + "k8s.io/utils/ptr" + ctrl "sigs.k8s.io/controller-runtime" + "sigs.k8s.io/controller-runtime/pkg/client" + + orcv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1" + "github.com/k-orc/openstack-resource-controller/v2/internal/controllers/generic/interfaces" + "github.com/k-orc/openstack-resource-controller/v2/internal/controllers/generic/progress" + "github.com/k-orc/openstack-resource-controller/v2/internal/logging" + "github.com/k-orc/openstack-resource-controller/v2/internal/osclients" + orcerrors "github.com/k-orc/openstack-resource-controller/v2/internal/util/errors" + "github.com/k-orc/openstack-resource-controller/v2/internal/util/tags" +) + +// OpenStack resource types +type ( + osResourceT = trunks.Trunk + + createResourceActuator = interfaces.CreateResourceActuator[orcObjectPT, orcObjectT, filterT, osResourceT] + deleteResourceActuator = interfaces.DeleteResourceActuator[orcObjectPT, orcObjectT, osResourceT] + resourceReconciler = interfaces.ResourceReconciler[orcObjectPT, osResourceT] + helperFactory = interfaces.ResourceHelperFactory[orcObjectPT, orcObjectT, resourceSpecT, filterT, osResourceT] +) + +type trunkActuator struct { + networkClient osclients.NetworkClient + k8sClient client.Client +} + +var _ createResourceActuator = trunkActuator{} +var _ deleteResourceActuator = trunkActuator{} + +func (trunkActuator) GetResourceID(osResource *osResourceT) string { + return osResource.ID +} + +func (actuator trunkActuator) GetOSResourceByID(ctx context.Context, id string) (*osResourceT, progress.ReconcileStatus) { + resource, err := actuator.networkClient.GetTrunk(ctx, id) + if err != nil { + return nil, progress.WrapError(err) + } + return resource, nil +} + +// sliceToIter converts a slice of trunks to an iterator +func sliceToIter(trunks []trunks.Trunk, err error) iter.Seq2[*osResourceT, error] { + return func(yield func(*osResourceT, error) bool) { + if err != nil { + yield(nil, err) + return + } + for i := range trunks { + if !yield(&trunks[i], nil) { + return + } + } + } +} + +func (actuator trunkActuator) ListOSResourcesForAdoption(ctx context.Context, orcObject orcObjectPT) (iter.Seq2[*osResourceT, error], bool) { + resourceSpec := orcObject.Spec.Resource + if resourceSpec == nil { + return nil, false + } + + listOpts := trunks.ListOpts{ + Name: getResourceName(orcObject), + Description: string(ptr.Deref(resourceSpec.Description, "")), + } + + trunkList, err := actuator.networkClient.ListTrunk(ctx, listOpts) + return sliceToIter(trunkList, err), true +} + +func (actuator trunkActuator) ListOSResourcesForImport(ctx context.Context, obj orcObjectPT, filter filterT) (iter.Seq2[*osResourceT, error], progress.ReconcileStatus) { + var reconcileStatus progress.ReconcileStatus + + port := &orcv1alpha1.Port{} + if filter.PortRef != nil { + portKey := client.ObjectKey{Name: string(*filter.PortRef), Namespace: obj.Namespace} + if err := actuator.k8sClient.Get(ctx, portKey, port); err != nil { + if apierrors.IsNotFound(err) { + reconcileStatus = reconcileStatus.WithReconcileStatus( + progress.WaitingOnObject("Port", portKey.Name, progress.WaitingOnCreation)) + } else { + reconcileStatus = reconcileStatus.WithReconcileStatus( + progress.WrapError(fmt.Errorf("fetching port %s: %w", portKey.Name, err))) + } + } else { + if !orcv1alpha1.IsAvailable(port) || port.Status.ID == nil { + reconcileStatus = reconcileStatus.WithReconcileStatus( + progress.WaitingOnObject("Port", portKey.Name, progress.WaitingOnReady)) + } + } + } + + project := &orcv1alpha1.Project{} + if filter.ProjectRef != nil { + projectKey := client.ObjectKey{Name: string(*filter.ProjectRef), Namespace: obj.Namespace} + if err := actuator.k8sClient.Get(ctx, projectKey, project); err != nil { + if apierrors.IsNotFound(err) { + reconcileStatus = reconcileStatus.WithReconcileStatus( + progress.WaitingOnObject("Project", projectKey.Name, progress.WaitingOnCreation)) + } else { + reconcileStatus = reconcileStatus.WithReconcileStatus( + progress.WrapError(fmt.Errorf("fetching project %s: %w", projectKey.Name, err))) + } + } else { + if !orcv1alpha1.IsAvailable(project) || project.Status.ID == nil { + reconcileStatus = reconcileStatus.WithReconcileStatus( + progress.WaitingOnObject("Project", projectKey.Name, progress.WaitingOnReady)) + } + } + } + + if needsReschedule, _ := reconcileStatus.NeedsReschedule(); needsReschedule { + return nil, reconcileStatus + } + + listOpts := trunks.ListOpts{ + Name: string(ptr.Deref(filter.Name, "")), + Description: string(ptr.Deref(filter.Description, "")), + PortID: ptr.Deref(port.Status.ID, ""), + ProjectID: ptr.Deref(project.Status.ID, ""), + AdminStateUp: filter.AdminStateUp, + Tags: tags.Join(filter.Tags), + TagsAny: tags.Join(filter.TagsAny), + NotTags: tags.Join(filter.NotTags), + NotTagsAny: tags.Join(filter.NotTagsAny), + } + + trunkList, err := actuator.networkClient.ListTrunk(ctx, listOpts) + return sliceToIter(trunkList, err), nil +} + +func (actuator trunkActuator) CreateResource(ctx context.Context, obj orcObjectPT) (*osResourceT, progress.ReconcileStatus) { + resource := obj.Spec.Resource + + if resource == nil { + // Should have been caught by API validation + return nil, progress.WrapError( + orcerrors.Terminal(orcv1alpha1.ConditionReasonInvalidConfiguration, "Creation requested, but spec.resource is not set")) + } + var reconcileStatus progress.ReconcileStatus + + var portID string + port, portDepRS := portDependency.GetDependency( + ctx, actuator.k8sClient, obj, func(dep *orcv1alpha1.Port) bool { + return orcv1alpha1.IsAvailable(dep) && dep.Status.ID != nil + }, + ) + reconcileStatus = reconcileStatus.WithReconcileStatus(portDepRS) + if port != nil { + portID = ptr.Deref(port.Status.ID, "") + } + + var projectID string + if resource.ProjectRef != nil { + project, projectDepRS := projectDependency.GetDependency( + ctx, actuator.k8sClient, obj, func(dep *orcv1alpha1.Project) bool { + return orcv1alpha1.IsAvailable(dep) && dep.Status.ID != nil + }, + ) + reconcileStatus = reconcileStatus.WithReconcileStatus(projectDepRS) + if project != nil { + projectID = ptr.Deref(project.Status.ID, "") + } + } + + // Resolve subport port dependencies + var subports []trunks.Subport + if len(resource.Subports) > 0 { + subportPortMap, subportPortDepRS := subportPortDependency.GetDependencies( + ctx, actuator.k8sClient, obj, func(dep *orcv1alpha1.Port) bool { + return orcv1alpha1.IsAvailable(dep) && dep.Status.ID != nil + }, + ) + reconcileStatus = reconcileStatus.WithReconcileStatus(subportPortDepRS) + if needsReschedule, _ := subportPortDepRS.NeedsReschedule(); !needsReschedule { + subports = make([]trunks.Subport, len(resource.Subports)) + for i := range resource.Subports { + subportSpec := &resource.Subports[i] + port, ok := subportPortMap[string(subportSpec.PortRef)] + if !ok { + return nil, reconcileStatus.WithError(fmt.Errorf("unable to resolve required subport port reference: %s", subportSpec.PortRef)) + } + subports[i] = trunks.Subport{ + PortID: ptr.Deref(port.Status.ID, ""), + SegmentationID: int(subportSpec.SegmentationID), + SegmentationType: subportSpec.SegmentationType, + } + } + } + } + + if needsReschedule, _ := reconcileStatus.NeedsReschedule(); needsReschedule { + return nil, reconcileStatus + } + createOpts := trunks.CreateOpts{ + Name: getResourceName(obj), + Description: string(ptr.Deref(resource.Description, "")), + PortID: portID, + ProjectID: projectID, + AdminStateUp: resource.AdminStateUp, + Subports: subports, + } + + osResource, err := actuator.networkClient.CreateTrunk(ctx, createOpts) + if err != nil { + // We should require the spec to be updated before retrying a create which returned a conflict + if !orcerrors.IsRetryable(err) { + err = orcerrors.Terminal(orcv1alpha1.ConditionReasonInvalidConfiguration, "invalid configuration creating resource: "+err.Error(), err) + } + return nil, progress.WrapError(err) + } + + return osResource, nil +} + +func (actuator trunkActuator) DeleteResource(ctx context.Context, _ orcObjectPT, resource *osResourceT) progress.ReconcileStatus { + return progress.WrapError(actuator.networkClient.DeleteTrunk(ctx, resource.ID)) +} + +func (actuator trunkActuator) updateResource(ctx context.Context, obj orcObjectPT, osResource *osResourceT) progress.ReconcileStatus { + log := ctrl.LoggerFrom(ctx) + resource := obj.Spec.Resource + if resource == nil { + // Should have been caught by API validation + return progress.WrapError( + orcerrors.Terminal(orcv1alpha1.ConditionReasonInvalidConfiguration, "Update requested, but spec.resource is not set")) + } + + updateOpts := trunks.UpdateOpts{} + + handleNameUpdate(&updateOpts, obj, osResource) + handleDescriptionUpdate(&updateOpts, resource, osResource) + handleAdminStateUpUpdate(&updateOpts, resource, osResource) + + needsUpdate, err := needsUpdate(updateOpts) + if err != nil { + return progress.WrapError( + orcerrors.Terminal(orcv1alpha1.ConditionReasonInvalidConfiguration, "invalid configuration updating resource: "+err.Error(), err)) + } + if !needsUpdate { + log.V(logging.Debug).Info("No changes") + return nil + } + + _, err = actuator.networkClient.UpdateTrunk(ctx, osResource.ID, updateOpts) + + // We should require the spec to be updated before retrying an update which returned a conflict + if orcerrors.IsConflict(err) { + err = orcerrors.Terminal(orcv1alpha1.ConditionReasonInvalidConfiguration, "invalid configuration updating resource: "+err.Error(), err) + } + + if err != nil { + return progress.WrapError(err) + } + + return progress.NeedsRefresh() +} + +func needsUpdate(updateOpts trunks.UpdateOpts) (bool, error) { + updateOptsMap, err := updateOpts.ToTrunkUpdateMap() + if err != nil { + return false, err + } + + updateMap, ok := updateOptsMap["trunk"].(map[string]any) + if !ok { + updateMap = make(map[string]any) + } + + return len(updateMap) > 0, nil +} + +func handleNameUpdate(updateOpts *trunks.UpdateOpts, obj orcObjectPT, osResource *osResourceT) { + name := getResourceName(obj) + if osResource.Name != name { + updateOpts.Name = &name + } +} + +func handleDescriptionUpdate(updateOpts *trunks.UpdateOpts, resource *resourceSpecT, osResource *osResourceT) { + description := string(ptr.Deref(resource.Description, "")) + if osResource.Description != description { + updateOpts.Description = &description + } +} + +func handleAdminStateUpUpdate(updateOpts *trunks.UpdateOpts, resource *resourceSpecT, osResource *osResourceT) { + // Default is true + adminStateUp := ptr.Deref(resource.AdminStateUp, true) + if osResource.AdminStateUp != adminStateUp { + updateOpts.AdminStateUp = &adminStateUp + } +} + +func (actuator trunkActuator) reconcileSubports(ctx context.Context, obj orcObjectPT, osResource *osResourceT) progress.ReconcileStatus { + log := ctrl.LoggerFrom(ctx) + resource := obj.Spec.Resource + if resource == nil { + return nil + } + + var reconcileStatus progress.ReconcileStatus + + // Build desired subports map: portID -> subport spec + desiredSubports := make(map[string]*orcv1alpha1.TrunkSubportSpec) + if len(resource.Subports) > 0 { + subportPortMap, subportPortDepRS := subportPortDependency.GetDependencies( + ctx, actuator.k8sClient, obj, func(dep *orcv1alpha1.Port) bool { + return orcv1alpha1.IsAvailable(dep) && dep.Status.ID != nil + }, + ) + reconcileStatus = reconcileStatus.WithReconcileStatus(subportPortDepRS) + if needsReschedule, _ := subportPortDepRS.NeedsReschedule(); needsReschedule { + return reconcileStatus + } + + for i := range resource.Subports { + subportSpec := &resource.Subports[i] + port, ok := subportPortMap[string(subportSpec.PortRef)] + if !ok { + return reconcileStatus.WithError(fmt.Errorf("unable to resolve required subport port reference: %s", subportSpec.PortRef)) + } + portID := ptr.Deref(port.Status.ID, "") + if portID == "" { + return reconcileStatus.WithError(fmt.Errorf("subport port %s does not have an ID", subportSpec.PortRef)) + } + desiredSubports[portID] = subportSpec + } + } + + // Build actual subports map: portID -> subport + actualSubports := make(map[string]trunks.Subport, len(osResource.Subports)) + for i := range osResource.Subports { + sp := osResource.Subports[i] + actualSubports[sp.PortID] = sp + } + + // Determine subports to add and remove + var subportsToAdd []trunks.Subport + var subportsToRemove []trunks.RemoveSubport + + // Find subports to add (in desired but not in actual, or different segmentation) + for portID, desiredSpec := range desiredSubports { + actual, exists := actualSubports[portID] + if !exists { + // Need to add this subport + subportsToAdd = append(subportsToAdd, trunks.Subport{ + PortID: portID, + SegmentationID: int(desiredSpec.SegmentationID), + SegmentationType: desiredSpec.SegmentationType, + }) + } else if actual.SegmentationID != int(desiredSpec.SegmentationID) || actual.SegmentationType != desiredSpec.SegmentationType { + // Segmentation changed - need to remove and re-add + subportsToRemove = append(subportsToRemove, trunks.RemoveSubport{PortID: portID}) + subportsToAdd = append(subportsToAdd, trunks.Subport{ + PortID: portID, + SegmentationID: int(desiredSpec.SegmentationID), + SegmentationType: desiredSpec.SegmentationType, + }) + } + } + + // Find subports to remove (in actual but not in desired) + for portID := range actualSubports { + if _, exists := desiredSubports[portID]; !exists { + subportsToRemove = append(subportsToRemove, trunks.RemoveSubport{PortID: portID}) + } + } + + // Apply changes - remove first, then add + // This ensures that if we're updating a subport (remove + add), the remove happens first + if len(subportsToRemove) > 0 { + log.V(logging.Debug).Info("Removing subports", "count", len(subportsToRemove)) + removeOpts := trunks.RemoveSubportsOpts{ + Subports: subportsToRemove, + } + if err := actuator.networkClient.RemoveSubports(ctx, osResource.ID, removeOpts); err != nil { + if orcerrors.IsConflict(err) { + err = orcerrors.Terminal(orcv1alpha1.ConditionReasonInvalidConfiguration, "invalid configuration removing subports: "+err.Error(), err) + } + return reconcileStatus.WithError(err) + } + // Always refresh after removing subports, especially if we're also adding some + reconcileStatus = reconcileStatus.WithReconcileStatus(progress.NeedsRefresh()) + } + + if len(subportsToAdd) > 0 { + log.V(logging.Debug).Info("Adding subports", "count", len(subportsToAdd)) + addOpts := trunks.AddSubportsOpts{ + Subports: subportsToAdd, + } + if _, err := actuator.networkClient.AddSubports(ctx, osResource.ID, addOpts); err != nil { + if orcerrors.IsConflict(err) { + err = orcerrors.Terminal(orcv1alpha1.ConditionReasonInvalidConfiguration, "invalid configuration adding subports: "+err.Error(), err) + } + return reconcileStatus.WithError(err) + } + reconcileStatus = reconcileStatus.WithReconcileStatus(progress.NeedsRefresh()) + } + + if len(subportsToAdd) == 0 && len(subportsToRemove) == 0 { + log.V(logging.Debug).Info("No subport changes") + } + + return reconcileStatus +} + +func (actuator trunkActuator) GetResourceReconcilers(ctx context.Context, orcObject orcObjectPT, osResource *osResourceT, controller interfaces.ResourceController) ([]resourceReconciler, progress.ReconcileStatus) { + return []resourceReconciler{ + tags.ReconcileTags[orcObjectPT, osResourceT](orcObject.Spec.Resource.Tags, osResource.Tags, tags.NewNeutronTagReplacer(actuator.networkClient, "trunks", osResource.ID)), + actuator.updateResource, + actuator.reconcileSubports, + }, nil +} + +type trunkHelperFactory struct{} + +var _ helperFactory = trunkHelperFactory{} + +func newActuator(ctx context.Context, orcObject *orcv1alpha1.Trunk, controller interfaces.ResourceController) (trunkActuator, progress.ReconcileStatus) { + log := ctrl.LoggerFrom(ctx) + + // Ensure credential secrets exist and have our finalizer + _, reconcileStatus := credentialsDependency.GetDependencies(ctx, controller.GetK8sClient(), orcObject, func(*corev1.Secret) bool { return true }) + if needsReschedule, _ := reconcileStatus.NeedsReschedule(); needsReschedule { + return trunkActuator{}, reconcileStatus + } + + clientScope, err := controller.GetScopeFactory().NewClientScopeFromObject(ctx, controller.GetK8sClient(), log, orcObject) + if err != nil { + return trunkActuator{}, progress.WrapError(err) + } + networkClient, err := clientScope.NewNetworkClient() + if err != nil { + return trunkActuator{}, progress.WrapError(err) + } + + return trunkActuator{ + networkClient: networkClient, + k8sClient: controller.GetK8sClient(), + }, nil +} + +func (trunkHelperFactory) NewAPIObjectAdapter(obj orcObjectPT) adapterI { + return trunkAdapter{obj} +} + +func (trunkHelperFactory) NewCreateActuator(ctx context.Context, orcObject orcObjectPT, controller interfaces.ResourceController) (createResourceActuator, progress.ReconcileStatus) { + return newActuator(ctx, orcObject, controller) +} + +func (trunkHelperFactory) NewDeleteActuator(ctx context.Context, orcObject orcObjectPT, controller interfaces.ResourceController) (deleteResourceActuator, progress.ReconcileStatus) { + return newActuator(ctx, orcObject, controller) +} diff --git a/internal/controllers/trunk/actuator_test.go b/internal/controllers/trunk/actuator_test.go new file mode 100644 index 000000000..8bb2e8fa0 --- /dev/null +++ b/internal/controllers/trunk/actuator_test.go @@ -0,0 +1,332 @@ +/* +Copyright 2025 The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +package trunk + +import ( + "slices" + "testing" + + "github.com/google/go-cmp/cmp" + "github.com/gophercloud/gophercloud/v2/openstack/networking/v2/extensions/trunks" + orcv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1" + "k8s.io/utils/ptr" +) + +func TestNeedsUpdate(t *testing.T) { + testCases := []struct { + name string + updateOpts trunks.UpdateOpts + expectChange bool + }{ + { + name: "Empty base opts", + updateOpts: trunks.UpdateOpts{}, + expectChange: false, + }, + { + name: "Updated opts", + updateOpts: trunks.UpdateOpts{Name: ptr.To("updated")}, + expectChange: true, + }, + { + name: "RevisionNumber only should not require update", + updateOpts: trunks.UpdateOpts{RevisionNumber: ptr.To(10)}, + expectChange: false, + }, + { + name: "Name + RevisionNumber should require update", + updateOpts: trunks.UpdateOpts{Name: ptr.To("updated"), RevisionNumber: ptr.To(10)}, + expectChange: true, + }, + } + + for _, tt := range testCases { + t.Run(tt.name, func(t *testing.T) { + got, _ := needsUpdate(tt.updateOpts) + if got != tt.expectChange { + t.Errorf("Expected change: %v, got: %v", tt.expectChange, got) + } + }) + } +} + +func TestHandleNameUpdate(t *testing.T) { + ptrToName := ptr.To[orcv1alpha1.OpenStackName] + testCases := []struct { + name string + newValue *orcv1alpha1.OpenStackName + existingValue string + expectChange bool + }{ + {name: "Identical", newValue: ptrToName("name"), existingValue: "name", expectChange: false}, + {name: "Different", newValue: ptrToName("new-name"), existingValue: "name", expectChange: true}, + {name: "No value provided, existing is identical to object name", newValue: nil, existingValue: "object-name", expectChange: false}, + {name: "No value provided, existing is different from object name", newValue: nil, existingValue: "different-from-object-name", expectChange: true}, + } + + for _, tt := range testCases { + t.Run(tt.name, func(t *testing.T) { + resource := &orcv1alpha1.Trunk{} + resource.Name = "object-name" + resource.Spec = orcv1alpha1.TrunkSpec{ + Resource: &orcv1alpha1.TrunkResourceSpec{Name: tt.newValue}, + } + osResource := &osResourceT{Name: tt.existingValue} + + updateOpts := trunks.UpdateOpts{} + handleNameUpdate(&updateOpts, resource, osResource) + + got, _ := needsUpdate(updateOpts) + if got != tt.expectChange { + t.Errorf("Expected change: %v, got: %v", tt.expectChange, got) + } + }) + + } +} + +func TestHandleDescriptionUpdate(t *testing.T) { + ptrToDescription := ptr.To[orcv1alpha1.NeutronDescription] + testCases := []struct { + name string + newValue *orcv1alpha1.NeutronDescription + existingValue string + expectChange bool + }{ + {name: "Identical", newValue: ptrToDescription("desc"), existingValue: "desc", expectChange: false}, + {name: "Different", newValue: ptrToDescription("new-desc"), existingValue: "desc", expectChange: true}, + {name: "No value provided, existing is set", newValue: nil, existingValue: "desc", expectChange: true}, + {name: "No value provided, existing is empty", newValue: nil, existingValue: "", expectChange: false}, + } + + for _, tt := range testCases { + t.Run(tt.name, func(t *testing.T) { + resource := &orcv1alpha1.TrunkResourceSpec{Description: tt.newValue} + osResource := &osResourceT{Description: tt.existingValue} + + updateOpts := trunks.UpdateOpts{} + handleDescriptionUpdate(&updateOpts, resource, osResource) + + got, _ := needsUpdate(updateOpts) + if got != tt.expectChange { + t.Errorf("Expected change: %v, got: %v", tt.expectChange, got) + } + }) + + } +} + +func TestHandleAdminStateUpUpdate(t *testing.T) { + ptrToBool := ptr.To[bool] + testCases := []struct { + name string + newValue *bool + existingValue bool + expectChange bool + }{ + {name: "Identical true", newValue: ptrToBool(true), existingValue: true, expectChange: false}, + {name: "Identical false", newValue: ptrToBool(false), existingValue: false, expectChange: false}, + {name: "Different (true -> false)", newValue: ptrToBool(false), existingValue: true, expectChange: true}, + {name: "Different (false -> true)", newValue: ptrToBool(true), existingValue: false, expectChange: true}, + {name: "Nil means default true (existing true)", newValue: nil, existingValue: true, expectChange: false}, + {name: "Nil means default true (existing false)", newValue: nil, existingValue: false, expectChange: true}, + } + + for _, tt := range testCases { + t.Run(tt.name, func(t *testing.T) { + resource := &orcv1alpha1.TrunkResourceSpec{AdminStateUp: tt.newValue} + osResource := &osResourceT{AdminStateUp: tt.existingValue} + + updateOpts := trunks.UpdateOpts{} + handleAdminStateUpUpdate(&updateOpts, resource, osResource) + + got, _ := needsUpdate(updateOpts) + if got != tt.expectChange { + t.Errorf("Expected change: %v, got: %v", tt.expectChange, got) + } + }) + } +} + +func TestReconcileSubportsLogic(t *testing.T) { + testCases := []struct { + name string + desiredSubports map[string]*orcv1alpha1.TrunkSubportSpec + actualSubports map[string]trunks.Subport + expectedSubportsToAdd []trunks.Subport + expectedSubportsRemove []trunks.Subport + }{ + { + name: "No changes needed", + desiredSubports: map[string]*orcv1alpha1.TrunkSubportSpec{ + "port1": {SegmentationID: 100, SegmentationType: "vlan"}, + }, + actualSubports: map[string]trunks.Subport{ + "port1": {PortID: "port1", SegmentationID: 100, SegmentationType: "vlan"}, + }, + expectedSubportsToAdd: []trunks.Subport{}, + expectedSubportsRemove: []trunks.Subport{}, + }, + { + name: "Add new subport", + desiredSubports: map[string]*orcv1alpha1.TrunkSubportSpec{ + "port1": {SegmentationID: 100, SegmentationType: "vlan"}, + "port2": {SegmentationID: 200, SegmentationType: "vlan"}, + }, + actualSubports: map[string]trunks.Subport{ + "port1": {PortID: "port1", SegmentationID: 100, SegmentationType: "vlan"}, + }, + expectedSubportsToAdd: []trunks.Subport{ + {PortID: "port2", SegmentationID: 200, SegmentationType: "vlan"}, + }, + expectedSubportsRemove: []trunks.Subport{}, + }, + { + name: "Remove subport", + desiredSubports: map[string]*orcv1alpha1.TrunkSubportSpec{ + "port1": {SegmentationID: 100, SegmentationType: "vlan"}, + }, + actualSubports: map[string]trunks.Subport{ + "port1": {PortID: "port1", SegmentationID: 100, SegmentationType: "vlan"}, + "port2": {PortID: "port2", SegmentationID: 200, SegmentationType: "vlan"}, + }, + expectedSubportsToAdd: []trunks.Subport{}, + expectedSubportsRemove: []trunks.Subport{ + {PortID: "port2"}, + }, + }, + { + name: "Update segmentation", + desiredSubports: map[string]*orcv1alpha1.TrunkSubportSpec{ + "port1": {SegmentationID: 150, SegmentationType: "vlan"}, + }, + actualSubports: map[string]trunks.Subport{ + "port1": {PortID: "port1", SegmentationID: 100, SegmentationType: "vlan"}, + }, + expectedSubportsToAdd: []trunks.Subport{ + {PortID: "port1", SegmentationID: 150, SegmentationType: "vlan"}, + }, + expectedSubportsRemove: []trunks.Subport{ + {PortID: "port1"}, + }, + }, + { + name: "Update segmentation type", + desiredSubports: map[string]*orcv1alpha1.TrunkSubportSpec{ + "port1": {SegmentationID: 100, SegmentationType: "inherit"}, + }, + actualSubports: map[string]trunks.Subport{ + "port1": {PortID: "port1", SegmentationID: 100, SegmentationType: "vlan"}, + }, + expectedSubportsToAdd: []trunks.Subport{ + {PortID: "port1", SegmentationID: 100, SegmentationType: "inherit"}, + }, + expectedSubportsRemove: []trunks.Subport{ + {PortID: "port1"}, + }, + }, + { + name: "Remove all subports", + desiredSubports: map[string]*orcv1alpha1.TrunkSubportSpec{}, + actualSubports: map[string]trunks.Subport{ + "port1": {PortID: "port1", SegmentationID: 100, SegmentationType: "vlan"}, + "port2": {PortID: "port2", SegmentationID: 200, SegmentationType: "vlan"}, + }, + expectedSubportsToAdd: []trunks.Subport{}, + expectedSubportsRemove: []trunks.Subport{ + {PortID: "port1"}, + {PortID: "port2"}, + }, + }, + { + name: "Complex update: add, remove, and modify", + desiredSubports: map[string]*orcv1alpha1.TrunkSubportSpec{ + "port1": {SegmentationID: 150, SegmentationType: "vlan"}, // modified + "port3": {SegmentationID: 300, SegmentationType: "vlan"}, // new + }, + actualSubports: map[string]trunks.Subport{ + "port1": {PortID: "port1", SegmentationID: 100, SegmentationType: "vlan"}, + "port2": {PortID: "port2", SegmentationID: 200, SegmentationType: "vlan"}, // removed + }, + expectedSubportsToAdd: []trunks.Subport{ + {PortID: "port1", SegmentationID: 150, SegmentationType: "vlan"}, // modified + {PortID: "port3", SegmentationID: 300, SegmentationType: "vlan"}, // new + }, + expectedSubportsRemove: []trunks.Subport{ + {PortID: "port1"}, // for modification + {PortID: "port2"}, // removed + }, + }, + } + + for _, tt := range testCases { + t.Run(tt.name, func(t *testing.T) { + subportsToAdd := []trunks.Subport{} + subportsToRemove := []trunks.Subport{} + + // Find subports to add (in desired but not in actual, or different segmentation) + for portID, desiredSpec := range tt.desiredSubports { + actual, exists := tt.actualSubports[portID] + if !exists { + // Need to add this subport + subportsToAdd = append(subportsToAdd, trunks.Subport{ + PortID: portID, + SegmentationID: int(desiredSpec.SegmentationID), + SegmentationType: desiredSpec.SegmentationType, + }) + } else if actual.SegmentationID != int(desiredSpec.SegmentationID) || actual.SegmentationType != desiredSpec.SegmentationType { + // Segmentation changed - need to remove and re-add + subportsToRemove = append(subportsToRemove, trunks.Subport{PortID: portID}) + subportsToAdd = append(subportsToAdd, trunks.Subport{ + PortID: portID, + SegmentationID: int(desiredSpec.SegmentationID), + SegmentationType: desiredSpec.SegmentationType, + }) + } + } + + // Find subports to remove (in actual but not in desired) + for portID := range tt.actualSubports { + if _, exists := tt.desiredSubports[portID]; !exists { + subportsToRemove = append(subportsToRemove, trunks.Subport{PortID: portID}) + } + } + + // Sort slices by PortID for deterministic comparison + sortByPortID := func(a, b trunks.Subport) int { + if a.PortID < b.PortID { + return -1 + } + if a.PortID > b.PortID { + return 1 + } + return 0 + } + slices.SortFunc(subportsToAdd, sortByPortID) + slices.SortFunc(subportsToRemove, sortByPortID) + slices.SortFunc(tt.expectedSubportsToAdd, sortByPortID) + slices.SortFunc(tt.expectedSubportsRemove, sortByPortID) + + if diff := cmp.Diff(tt.expectedSubportsToAdd, subportsToAdd); diff != "" { + t.Errorf("Subports to add mismatch (-want +got):\n%s", diff) + } + if diff := cmp.Diff(tt.expectedSubportsRemove, subportsToRemove); diff != "" { + t.Errorf("Subports to remove mismatch (-want +got):\n%s", diff) + } + }) + } +} diff --git a/internal/controllers/trunk/controller.go b/internal/controllers/trunk/controller.go new file mode 100644 index 000000000..db7156a28 --- /dev/null +++ b/internal/controllers/trunk/controller.go @@ -0,0 +1,187 @@ +/* +Copyright 2025 The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +package trunk + +import ( + "context" + "errors" + + ctrl "sigs.k8s.io/controller-runtime" + "sigs.k8s.io/controller-runtime/pkg/builder" + "sigs.k8s.io/controller-runtime/pkg/controller" + + orcv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1" + + "github.com/k-orc/openstack-resource-controller/v2/internal/controllers/generic/interfaces" + "github.com/k-orc/openstack-resource-controller/v2/internal/controllers/generic/reconciler" + "github.com/k-orc/openstack-resource-controller/v2/internal/scope" + "github.com/k-orc/openstack-resource-controller/v2/internal/util/credentials" + "github.com/k-orc/openstack-resource-controller/v2/internal/util/dependency" + orcstrings "github.com/k-orc/openstack-resource-controller/v2/internal/util/strings" + "github.com/k-orc/openstack-resource-controller/v2/pkg/predicates" +) + +const controllerName = "trunk" + +// +kubebuilder:rbac:groups=openstack.k-orc.cloud,resources=trunks,verbs=get;list;watch;create;update;patch;delete +// +kubebuilder:rbac:groups=openstack.k-orc.cloud,resources=trunks/status,verbs=get;update;patch + +type trunkReconcilerConstructor struct { + scopeFactory scope.Factory +} + +func New(scopeFactory scope.Factory) interfaces.Controller { + return trunkReconcilerConstructor{scopeFactory: scopeFactory} +} + +func (trunkReconcilerConstructor) GetName() string { + return controllerName +} + +var portDependency = dependency.NewDeletionGuardDependency[*orcv1alpha1.TrunkList, *orcv1alpha1.Port]( + "spec.resource.portRef", + func(trunk *orcv1alpha1.Trunk) []string { + resource := trunk.Spec.Resource + if resource == nil { + return nil + } + return []string{string(resource.PortRef)} + }, + finalizer, externalObjectFieldOwner, +) + +var projectDependency = dependency.NewDeletionGuardDependency[*orcv1alpha1.TrunkList, *orcv1alpha1.Project]( + "spec.resource.projectRef", + func(trunk *orcv1alpha1.Trunk) []string { + resource := trunk.Spec.Resource + if resource == nil || resource.ProjectRef == nil { + return nil + } + return []string{string(*resource.ProjectRef)} + }, + finalizer, externalObjectFieldOwner, +) + +var portImportDependency = dependency.NewDependency[*orcv1alpha1.TrunkList, *orcv1alpha1.Port]( + "spec.import.filter.portRef", + func(trunk *orcv1alpha1.Trunk) []string { + resource := trunk.Spec.Import + if resource == nil || resource.Filter == nil || resource.Filter.PortRef == nil { + return nil + } + return []string{string(*resource.Filter.PortRef)} + }, +) + +var projectImportDependency = dependency.NewDependency[*orcv1alpha1.TrunkList, *orcv1alpha1.Project]( + "spec.import.filter.projectRef", + func(trunk *orcv1alpha1.Trunk) []string { + resource := trunk.Spec.Import + if resource == nil || resource.Filter == nil || resource.Filter.ProjectRef == nil { + return nil + } + return []string{string(*resource.Filter.ProjectRef)} + }, +) + +var subportPortDependency = dependency.NewDeletionGuardDependency[*orcv1alpha1.TrunkList, *orcv1alpha1.Port]( + "spec.resource.subports[].portRef", + func(trunk *orcv1alpha1.Trunk) []string { + resource := trunk.Spec.Resource + if resource == nil { + return nil + } + if len(resource.Subports) == 0 { + return nil + } + portRefs := make([]string, 0, len(resource.Subports)) + for i := range resource.Subports { + portRefs = append(portRefs, string(resource.Subports[i].PortRef)) + } + return portRefs + }, + orcstrings.GetFinalizerName("trunk-subport"), externalObjectFieldOwner, + dependency.OverrideDependencyName("subport_port"), +) + +// SetupWithManager sets up the controller with the Manager. +func (c trunkReconcilerConstructor) SetupWithManager(ctx context.Context, mgr ctrl.Manager, options controller.Options) error { + log := ctrl.LoggerFrom(ctx) + k8sClient := mgr.GetClient() + + portWatchEventHandler, err := portDependency.WatchEventHandler(log, k8sClient) + if err != nil { + return err + } + + projectWatchEventHandler, err := projectDependency.WatchEventHandler(log, k8sClient) + if err != nil { + return err + } + + portImportWatchEventHandler, err := portImportDependency.WatchEventHandler(log, k8sClient) + if err != nil { + return err + } + + projectImportWatchEventHandler, err := projectImportDependency.WatchEventHandler(log, k8sClient) + if err != nil { + return err + } + + subportPortWatchEventHandler, err := subportPortDependency.WatchEventHandler(log, k8sClient) + if err != nil { + return err + } + + builder := ctrl.NewControllerManagedBy(mgr). + WithOptions(options). + Watches(&orcv1alpha1.Port{}, portWatchEventHandler, + builder.WithPredicates(predicates.NewBecameAvailable(log, &orcv1alpha1.Port{})), + ). + Watches(&orcv1alpha1.Project{}, projectWatchEventHandler, + builder.WithPredicates(predicates.NewBecameAvailable(log, &orcv1alpha1.Project{})), + ). + // A second watch is necessary because we need a different handler that omits deletion guards + Watches(&orcv1alpha1.Port{}, portImportWatchEventHandler, + builder.WithPredicates(predicates.NewBecameAvailable(log, &orcv1alpha1.Port{})), + ). + // A second watch is necessary because we need a different handler that omits deletion guards + Watches(&orcv1alpha1.Project{}, projectImportWatchEventHandler, + builder.WithPredicates(predicates.NewBecameAvailable(log, &orcv1alpha1.Project{})), + ). + // Watch for subport port changes + Watches(&orcv1alpha1.Port{}, subportPortWatchEventHandler, + builder.WithPredicates(predicates.NewBecameAvailable(log, &orcv1alpha1.Port{})), + ). + For(&orcv1alpha1.Trunk{}) + + if err := errors.Join( + portDependency.AddToManager(ctx, mgr), + projectDependency.AddToManager(ctx, mgr), + portImportDependency.AddToManager(ctx, mgr), + projectImportDependency.AddToManager(ctx, mgr), + subportPortDependency.AddToManager(ctx, mgr), + credentialsDependency.AddToManager(ctx, mgr), + credentials.AddCredentialsWatch(log, mgr.GetClient(), builder, credentialsDependency), + ); err != nil { + return err + } + + r := reconciler.NewController(controllerName, mgr.GetClient(), c.scopeFactory, trunkHelperFactory{}, trunkStatusWriter{}) + return builder.Complete(&r) +} diff --git a/internal/controllers/trunk/status.go b/internal/controllers/trunk/status.go new file mode 100644 index 000000000..f95d59e74 --- /dev/null +++ b/internal/controllers/trunk/status.go @@ -0,0 +1,92 @@ +/* +Copyright 2025 The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +package trunk + +import ( + "github.com/go-logr/logr" + metav1 "k8s.io/apimachinery/pkg/apis/meta/v1" + + orcv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1" + "github.com/k-orc/openstack-resource-controller/v2/internal/controllers/generic/interfaces" + "github.com/k-orc/openstack-resource-controller/v2/internal/controllers/generic/progress" + orcapplyconfigv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/pkg/clients/applyconfiguration/api/v1alpha1" +) + +type trunkStatusWriter struct{} + +type objectApplyT = orcapplyconfigv1alpha1.TrunkApplyConfiguration +type statusApplyT = orcapplyconfigv1alpha1.TrunkStatusApplyConfiguration + +var _ interfaces.ResourceStatusWriter[*orcv1alpha1.Trunk, *osResourceT, *objectApplyT, *statusApplyT] = trunkStatusWriter{} + +func (trunkStatusWriter) GetApplyConfig(name, namespace string) *objectApplyT { + return orcapplyconfigv1alpha1.Trunk(name, namespace) +} + +func (trunkStatusWriter) ResourceAvailableStatus(orcObject *orcv1alpha1.Trunk, osResource *osResourceT) (metav1.ConditionStatus, progress.ReconcileStatus) { + if osResource == nil { + if orcObject.Status.ID == nil { + return metav1.ConditionFalse, nil + } else { + return metav1.ConditionUnknown, nil + } + } + return metav1.ConditionTrue, nil +} + +func (trunkStatusWriter) ApplyResourceStatus(_ logr.Logger, osResource *osResourceT, statusApply *statusApplyT) { + resourceStatus := orcapplyconfigv1alpha1.TrunkResourceStatus(). + WithPortID(osResource.PortID). + WithProjectID(osResource.ProjectID). + WithName(osResource.Name). + WithAdminStateUp(osResource.AdminStateUp). + WithRevisionNumber(int64(osResource.RevisionNumber)). + WithCreatedAt(metav1.NewTime(osResource.CreatedAt)). + WithUpdatedAt(metav1.NewTime(osResource.UpdatedAt)) + + if osResource.Status != "" { + resourceStatus.WithStatus(osResource.Status) + } + + if osResource.TenantID != "" { + resourceStatus.WithTenantID(osResource.TenantID) + } + + if len(osResource.Tags) > 0 { + resourceStatus.WithTags(osResource.Tags...) + } + + if len(osResource.Subports) > 0 { + subports := make([]*orcapplyconfigv1alpha1.TrunkSubportStatusApplyConfiguration, 0, len(osResource.Subports)) + for i := range osResource.Subports { + sp := osResource.Subports[i] + subports = append(subports, + orcapplyconfigv1alpha1.TrunkSubportStatus(). + WithPortID(sp.PortID). + WithSegmentationID(int32(sp.SegmentationID)). + WithSegmentationType(sp.SegmentationType), + ) + } + resourceStatus.WithSubports(subports...) + } + + if osResource.Description != "" { + resourceStatus.WithDescription(osResource.Description) + } + + statusApply.WithResource(resourceStatus) +} diff --git a/internal/controllers/trunk/tests/trunk-create-full/00-assert.yaml b/internal/controllers/trunk/tests/trunk-create-full/00-assert.yaml new file mode 100644 index 000000000..424396df9 --- /dev/null +++ b/internal/controllers/trunk/tests/trunk-create-full/00-assert.yaml @@ -0,0 +1,51 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Trunk +metadata: + name: trunk-create-full +status: + resource: + name: trunk-create-full-override + description: Trunk from "create full" test + adminStateUp: true + status: ACTIVE + tags: + - tag1 + - tag2 + conditions: + - type: Available + status: "True" + reason: Success + - type: Progressing + status: "False" + reason: Success +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestAssert +resourceRefs: + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: Trunk + name: trunk-create-full + ref: trunk + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: Port + name: trunk-create-full + ref: port + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: Port + name: trunk-create-full-subport1 + ref: subport1 + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: Port + name: trunk-create-full-subport2 + ref: subport2 +assertAll: + - celExpr: "trunk.status.id != ''" + - celExpr: "trunk.status.resource.portID == port.status.id" + - celExpr: "trunk.status.resource.projectID != ''" + - celExpr: "trunk.status.resource.createdAt != ''" + - celExpr: "trunk.status.resource.updatedAt != ''" + - celExpr: "trunk.status.resource.revisionNumber > 0" + - celExpr: "trunk.status.resource.subports.size() == 2" + - celExpr: "trunk.status.resource.subports.exists(s, s.portID == subport1.status.id && s.segmentationID == 100 && s.segmentationType == 'vlan')" + - celExpr: "trunk.status.resource.subports.exists(s, s.portID == subport2.status.id && s.segmentationID == 200 && s.segmentationType == 'vlan')" diff --git a/internal/controllers/trunk/tests/trunk-create-full/00-create-resource.yaml b/internal/controllers/trunk/tests/trunk-create-full/00-create-resource.yaml new file mode 100644 index 000000000..20c2bc0a7 --- /dev/null +++ b/internal/controllers/trunk/tests/trunk-create-full/00-create-resource.yaml @@ -0,0 +1,89 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Network +metadata: + name: trunk-create-full +spec: + cloudCredentialsRef: + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + resource: + name: trunk-create-full +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Subnet +metadata: + name: trunk-create-full +spec: + cloudCredentialsRef: + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + resource: + networkRef: trunk-create-full + ipVersion: 4 + cidr: 192.168.158.0/24 +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Port +metadata: + name: trunk-create-full +spec: + cloudCredentialsRef: + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + resource: + networkRef: trunk-create-full + addresses: + - subnetRef: trunk-create-full +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Port +metadata: + name: trunk-create-full-subport1 +spec: + cloudCredentialsRef: + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + resource: + networkRef: trunk-create-full +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Port +metadata: + name: trunk-create-full-subport2 +spec: + cloudCredentialsRef: + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + resource: + networkRef: trunk-create-full +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Trunk +metadata: + name: trunk-create-full +spec: + cloudCredentialsRef: + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + resource: + name: trunk-create-full-override + description: Trunk from "create full" test + adminStateUp: true + portRef: trunk-create-full + tags: + - tag1 + - tag2 + subports: + - portRef: trunk-create-full-subport1 + segmentationID: 100 + segmentationType: vlan + - portRef: trunk-create-full-subport2 + segmentationID: 200 + segmentationType: vlan diff --git a/internal/controllers/trunk/tests/trunk-create-full/00-secret.yaml b/internal/controllers/trunk/tests/trunk-create-full/00-secret.yaml new file mode 100644 index 000000000..045711ee7 --- /dev/null +++ b/internal/controllers/trunk/tests/trunk-create-full/00-secret.yaml @@ -0,0 +1,6 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestStep +commands: + - command: kubectl create secret generic openstack-clouds --from-file=clouds.yaml=${E2E_KUTTL_OSCLOUDS} ${E2E_KUTTL_CACERT_OPT} + namespaced: true diff --git a/internal/controllers/trunk/tests/trunk-create-full/README.md b/internal/controllers/trunk/tests/trunk-create-full/README.md new file mode 100644 index 000000000..45eabc565 --- /dev/null +++ b/internal/controllers/trunk/tests/trunk-create-full/README.md @@ -0,0 +1,11 @@ +# Create a Trunk with all the options + +## Step 00 + +Create a Trunk using all available fields, and verify that the observed state corresponds to the spec. + +Also validate that the OpenStack resource uses the name from the spec when it is specified. + +## Reference + +https://k-orc.cloud/development/writing-tests/#create-full diff --git a/internal/controllers/trunk/tests/trunk-create-minimal/00-assert.yaml b/internal/controllers/trunk/tests/trunk-create-minimal/00-assert.yaml new file mode 100644 index 000000000..d869d27ec --- /dev/null +++ b/internal/controllers/trunk/tests/trunk-create-minimal/00-assert.yaml @@ -0,0 +1,31 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Trunk +metadata: + name: trunk-create-minimal +status: + resource: + name: trunk-create-minimal + conditions: + - type: Available + status: "True" + reason: Success + - type: Progressing + status: "False" + reason: Success +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestAssert +resourceRefs: + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: Trunk + name: trunk-create-minimal + ref: trunk + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: Port + name: trunk-create-minimal + ref: port +assertAll: + - celExpr: "trunk.status.id != ''" + - celExpr: "trunk.status.resource.portID == port.status.id" + - celExpr: "!has(trunk.status.resource.description)" diff --git a/internal/controllers/trunk/tests/trunk-create-minimal/00-create-resource.yaml b/internal/controllers/trunk/tests/trunk-create-minimal/00-create-resource.yaml new file mode 100644 index 000000000..c3cc20990 --- /dev/null +++ b/internal/controllers/trunk/tests/trunk-create-minimal/00-create-resource.yaml @@ -0,0 +1,52 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Network +metadata: + name: trunk-create-minimal +spec: + cloudCredentialsRef: + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + resource: + name: trunk-create-minimal +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Subnet +metadata: + name: trunk-create-minimal +spec: + cloudCredentialsRef: + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + resource: + networkRef: trunk-create-minimal + ipVersion: 4 + cidr: 192.168.156.0/24 +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Port +metadata: + name: trunk-create-minimal +spec: + cloudCredentialsRef: + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + resource: + networkRef: trunk-create-minimal + addresses: + - subnetRef: trunk-create-minimal +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Trunk +metadata: + name: trunk-create-minimal +spec: + cloudCredentialsRef: + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + resource: + portRef: trunk-create-minimal diff --git a/internal/controllers/trunk/tests/trunk-create-minimal/00-secret.yaml b/internal/controllers/trunk/tests/trunk-create-minimal/00-secret.yaml new file mode 100644 index 000000000..6717de4aa --- /dev/null +++ b/internal/controllers/trunk/tests/trunk-create-minimal/00-secret.yaml @@ -0,0 +1,7 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestStep +commands: + - command: kubectl create secret generic openstack-clouds --from-file=clouds.yaml=${E2E_KUTTL_OSCLOUDS} ${E2E_KUTTL_CACERT_OPT} + namespaced: true + diff --git a/internal/controllers/trunk/tests/trunk-create-minimal/01-assert.yaml b/internal/controllers/trunk/tests/trunk-create-minimal/01-assert.yaml new file mode 100644 index 000000000..35eab2add --- /dev/null +++ b/internal/controllers/trunk/tests/trunk-create-minimal/01-assert.yaml @@ -0,0 +1,11 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestAssert +resourceRefs: + - apiVersion: v1 + kind: Secret + name: openstack-clouds + ref: secret +assertAll: + - celExpr: "secret.metadata.deletionTimestamp != 0" + - celExpr: "'openstack.k-orc.cloud/trunk' in secret.metadata.finalizers" diff --git a/internal/controllers/trunk/tests/trunk-create-minimal/01-delete-secret.yaml b/internal/controllers/trunk/tests/trunk-create-minimal/01-delete-secret.yaml new file mode 100644 index 000000000..1620791b9 --- /dev/null +++ b/internal/controllers/trunk/tests/trunk-create-minimal/01-delete-secret.yaml @@ -0,0 +1,7 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestStep +commands: + # We expect the deletion to hang due to the finalizer, so use --wait=false + - command: kubectl delete secret openstack-clouds --wait=false + namespaced: true diff --git a/internal/controllers/trunk/tests/trunk-create-minimal/README.md b/internal/controllers/trunk/tests/trunk-create-minimal/README.md new file mode 100644 index 000000000..49a8df75e --- /dev/null +++ b/internal/controllers/trunk/tests/trunk-create-minimal/README.md @@ -0,0 +1,15 @@ +# Create a Trunk with the minimum options + +## Step 00 + +Create a minimal Trunk, that sets only the required fields, and verify that the observed state corresponds to the spec. + +Also validate that the OpenStack resource uses the name of the ORC object when no name is explicitly specified. + +## Step 01 + +Try deleting the secret and ensure that it is not deleted thanks to the finalizer. + +## Reference + +https://k-orc.cloud/development/writing-tests/#create-minimal diff --git a/internal/controllers/trunk/tests/trunk-dependency/00-assert.yaml b/internal/controllers/trunk/tests/trunk-dependency/00-assert.yaml new file mode 100644 index 000000000..b5b6be241 --- /dev/null +++ b/internal/controllers/trunk/tests/trunk-dependency/00-assert.yaml @@ -0,0 +1,45 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Trunk +metadata: + name: trunk-dependency-no-secret +status: + conditions: + - type: Available + message: Waiting for Secret/trunk-dependency to be created + status: "False" + reason: Progressing + - type: Progressing + message: Waiting for Secret/trunk-dependency to be created + status: "True" + reason: Progressing +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Trunk +metadata: + name: trunk-dependency-no-port +status: + conditions: + - type: Available + message: Waiting for Port/trunk-dependency-pending to be created + status: "False" + reason: Progressing + - type: Progressing + message: Waiting for Port/trunk-dependency-pending to be created + status: "True" + reason: Progressing +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Trunk +metadata: + name: trunk-dependency-no-project +status: + conditions: + - type: Available + message: Waiting for Project/trunk-dependency to be created + status: "False" + reason: Progressing + - type: Progressing + message: Waiting for Project/trunk-dependency to be created + status: "True" + reason: Progressing diff --git a/internal/controllers/trunk/tests/trunk-dependency/00-create-resources-missing-deps.yaml b/internal/controllers/trunk/tests/trunk-dependency/00-create-resources-missing-deps.yaml new file mode 100644 index 000000000..68031da6e --- /dev/null +++ b/internal/controllers/trunk/tests/trunk-dependency/00-create-resources-missing-deps.yaml @@ -0,0 +1,91 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Network +metadata: + name: trunk-dependency +spec: + cloudCredentialsRef: + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + resource: + name: trunk-dependency +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Subnet +metadata: + name: trunk-dependency +spec: + cloudCredentialsRef: + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + resource: + cidr: 192.168.160.0/24 + ipVersion: 4 + networkRef: trunk-dependency +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Port +metadata: + name: trunk-dependency-parent-no-project +spec: + cloudCredentialsRef: + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + resource: + networkRef: trunk-dependency + addresses: + - subnetRef: trunk-dependency +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Port +metadata: + name: trunk-dependency-parent-no-secret +spec: + cloudCredentialsRef: + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + resource: + networkRef: trunk-dependency + addresses: + - subnetRef: trunk-dependency +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Trunk +metadata: + name: trunk-dependency-no-port +spec: + cloudCredentialsRef: + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + resource: + portRef: trunk-dependency-pending +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Trunk +metadata: + name: trunk-dependency-no-project +spec: + cloudCredentialsRef: + cloudName: openstack-admin + secretName: openstack-clouds + managementPolicy: managed + resource: + portRef: trunk-dependency-parent-no-project + projectRef: trunk-dependency +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Trunk +metadata: + name: trunk-dependency-no-secret +spec: + cloudCredentialsRef: + cloudName: openstack + secretName: trunk-dependency + managementPolicy: managed + resource: + portRef: trunk-dependency-parent-no-secret diff --git a/internal/controllers/trunk/tests/trunk-dependency/00-secret.yaml b/internal/controllers/trunk/tests/trunk-dependency/00-secret.yaml new file mode 100644 index 000000000..045711ee7 --- /dev/null +++ b/internal/controllers/trunk/tests/trunk-dependency/00-secret.yaml @@ -0,0 +1,6 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestStep +commands: + - command: kubectl create secret generic openstack-clouds --from-file=clouds.yaml=${E2E_KUTTL_OSCLOUDS} ${E2E_KUTTL_CACERT_OPT} + namespaced: true diff --git a/internal/controllers/trunk/tests/trunk-dependency/01-assert.yaml b/internal/controllers/trunk/tests/trunk-dependency/01-assert.yaml new file mode 100644 index 000000000..c2a36dd02 --- /dev/null +++ b/internal/controllers/trunk/tests/trunk-dependency/01-assert.yaml @@ -0,0 +1,45 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Trunk +metadata: + name: trunk-dependency-no-secret +status: + conditions: + - type: Available + message: OpenStack resource is available + status: "True" + reason: Success + - type: Progressing + message: OpenStack resource is up to date + status: "False" + reason: Success +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Trunk +metadata: + name: trunk-dependency-no-port +status: + conditions: + - type: Available + message: OpenStack resource is available + status: "True" + reason: Success + - type: Progressing + message: OpenStack resource is up to date + status: "False" + reason: Success +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Trunk +metadata: + name: trunk-dependency-no-project +status: + conditions: + - type: Available + message: OpenStack resource is available + status: "True" + reason: Success + - type: Progressing + message: OpenStack resource is up to date + status: "False" + reason: Success diff --git a/internal/controllers/trunk/tests/trunk-dependency/01-create-dependencies.yaml b/internal/controllers/trunk/tests/trunk-dependency/01-create-dependencies.yaml new file mode 100644 index 000000000..db4b6d3b7 --- /dev/null +++ b/internal/controllers/trunk/tests/trunk-dependency/01-create-dependencies.yaml @@ -0,0 +1,31 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestStep +commands: + - command: kubectl create secret generic trunk-dependency --from-file=clouds.yaml=${E2E_KUTTL_OSCLOUDS} ${E2E_KUTTL_CACERT_OPT} + namespaced: true +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Port +metadata: + name: trunk-dependency-pending +spec: + cloudCredentialsRef: + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + resource: + networkRef: trunk-dependency + addresses: + - subnetRef: trunk-dependency +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Project +metadata: + name: trunk-dependency +spec: + cloudCredentialsRef: + cloudName: openstack-admin + secretName: openstack-clouds + managementPolicy: managed + resource: {} diff --git a/internal/controllers/trunk/tests/trunk-dependency/02-assert.yaml b/internal/controllers/trunk/tests/trunk-dependency/02-assert.yaml new file mode 100644 index 000000000..979c28247 --- /dev/null +++ b/internal/controllers/trunk/tests/trunk-dependency/02-assert.yaml @@ -0,0 +1,29 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestAssert +resourceRefs: + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: Port + name: trunk-dependency-parent-no-project + ref: portNoProject + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: Port + name: trunk-dependency-parent-no-secret + ref: portNoSecret + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: Project + name: trunk-dependency + ref: project + - apiVersion: v1 + kind: Secret + name: trunk-dependency + ref: secret +assertAll: + - celExpr: "portNoProject.metadata.deletionTimestamp != 0" + - celExpr: "'openstack.k-orc.cloud/trunk' in portNoProject.metadata.finalizers" + - celExpr: "portNoSecret.metadata.deletionTimestamp != 0" + - celExpr: "'openstack.k-orc.cloud/trunk' in portNoSecret.metadata.finalizers" + - celExpr: "project.metadata.deletionTimestamp != 0" + - celExpr: "'openstack.k-orc.cloud/trunk' in project.metadata.finalizers" + - celExpr: "secret.metadata.deletionTimestamp != 0" + - celExpr: "'openstack.k-orc.cloud/trunk' in secret.metadata.finalizers" diff --git a/internal/controllers/trunk/tests/trunk-dependency/02-delete-dependencies.yaml b/internal/controllers/trunk/tests/trunk-dependency/02-delete-dependencies.yaml new file mode 100644 index 000000000..cf779d817 --- /dev/null +++ b/internal/controllers/trunk/tests/trunk-dependency/02-delete-dependencies.yaml @@ -0,0 +1,11 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestStep +commands: + # We expect the deletion to hang due to the finalizer, so use --wait=false + - command: kubectl delete port trunk-dependency-pending trunk-dependency-parent-no-project trunk-dependency-parent-no-secret --wait=false + namespaced: true + - command: kubectl delete project trunk-dependency --wait=false + namespaced: true + - command: kubectl delete secret trunk-dependency --wait=false + namespaced: true diff --git a/internal/controllers/trunk/tests/trunk-dependency/03-assert.yaml b/internal/controllers/trunk/tests/trunk-dependency/03-assert.yaml new file mode 100644 index 000000000..066b783c7 --- /dev/null +++ b/internal/controllers/trunk/tests/trunk-dependency/03-assert.yaml @@ -0,0 +1,11 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestAssert +commands: +# Dependencies that were prevented deletion before should now be gone +- script: "! kubectl get port trunk-dependency --namespace $NAMESPACE" + skipLogOutput: true +- script: "! kubectl get project trunk-dependency --namespace $NAMESPACE" + skipLogOutput: true +- script: "! kubectl get secret trunk-dependency --namespace $NAMESPACE" + skipLogOutput: true diff --git a/internal/controllers/trunk/tests/trunk-dependency/03-delete-resources.yaml b/internal/controllers/trunk/tests/trunk-dependency/03-delete-resources.yaml new file mode 100644 index 000000000..25f2a80c5 --- /dev/null +++ b/internal/controllers/trunk/tests/trunk-dependency/03-delete-resources.yaml @@ -0,0 +1,13 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestStep +delete: +- apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: Trunk + name: trunk-dependency-no-secret +- apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: Trunk + name: trunk-dependency-no-port +- apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: Trunk + name: trunk-dependency-no-project diff --git a/internal/controllers/trunk/tests/trunk-dependency/README.md b/internal/controllers/trunk/tests/trunk-dependency/README.md new file mode 100644 index 000000000..14d0a8ec4 --- /dev/null +++ b/internal/controllers/trunk/tests/trunk-dependency/README.md @@ -0,0 +1,21 @@ +# Creation and deletion dependencies + +## Step 00 + +Create Trunks referencing non-existing resources. Each Trunk is dependent on other non-existing resource. Verify that the Trunks are waiting for the needed resources to be created externally. + +## Step 01 + +Create the missing dependencies and verify all the Trunks are available. + +## Step 02 + +Delete all the dependencies and check that ORC prevents deletion since there is still a resource that depends on them. + +## Step 03 + +Delete the Trunks and validate that all resources are gone. + +## Reference + +https://k-orc.cloud/development/writing-tests/#dependency diff --git a/internal/controllers/trunk/tests/trunk-import-dependency/00-assert.yaml b/internal/controllers/trunk/tests/trunk-import-dependency/00-assert.yaml new file mode 100644 index 000000000..f6904cc7b --- /dev/null +++ b/internal/controllers/trunk/tests/trunk-import-dependency/00-assert.yaml @@ -0,0 +1,19 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Trunk +metadata: + name: trunk-import-dependency +status: + conditions: + - type: Available + message: |- + Waiting for Port/trunk-import-dependency to be ready + Waiting for Project/trunk-import-dependency to be ready + status: "False" + reason: Progressing + - type: Progressing + message: |- + Waiting for Port/trunk-import-dependency to be ready + Waiting for Project/trunk-import-dependency to be ready + status: "True" + reason: Progressing diff --git a/internal/controllers/trunk/tests/trunk-import-dependency/00-import-resource.yaml b/internal/controllers/trunk/tests/trunk-import-dependency/00-import-resource.yaml new file mode 100644 index 000000000..4f8c0bc59 --- /dev/null +++ b/internal/controllers/trunk/tests/trunk-import-dependency/00-import-resource.yaml @@ -0,0 +1,40 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Port +metadata: + name: trunk-import-dependency +spec: + cloudCredentialsRef: + cloudName: openstack + secretName: openstack-clouds + managementPolicy: unmanaged + import: + filter: + name: trunk-import-dependency-external +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Project +metadata: + name: trunk-import-dependency +spec: + cloudCredentialsRef: + cloudName: openstack-admin + secretName: openstack-clouds + managementPolicy: unmanaged + import: + filter: + name: trunk-import-dependency-external +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Trunk +metadata: + name: trunk-import-dependency +spec: + cloudCredentialsRef: + cloudName: openstack-admin + secretName: openstack-clouds + managementPolicy: unmanaged + import: + filter: + portRef: trunk-import-dependency + projectRef: trunk-import-dependency diff --git a/internal/controllers/trunk/tests/trunk-import-dependency/00-secret.yaml b/internal/controllers/trunk/tests/trunk-import-dependency/00-secret.yaml new file mode 100644 index 000000000..045711ee7 --- /dev/null +++ b/internal/controllers/trunk/tests/trunk-import-dependency/00-secret.yaml @@ -0,0 +1,6 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestStep +commands: + - command: kubectl create secret generic openstack-clouds --from-file=clouds.yaml=${E2E_KUTTL_OSCLOUDS} ${E2E_KUTTL_CACERT_OPT} + namespaced: true diff --git a/internal/controllers/trunk/tests/trunk-import-dependency/01-assert.yaml b/internal/controllers/trunk/tests/trunk-import-dependency/01-assert.yaml new file mode 100644 index 000000000..8190ecc75 --- /dev/null +++ b/internal/controllers/trunk/tests/trunk-import-dependency/01-assert.yaml @@ -0,0 +1,34 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Trunk +metadata: + name: trunk-import-dependency-not-this-one +status: + conditions: + - type: Available + message: OpenStack resource is available + status: "True" + reason: Success + - type: Progressing + message: OpenStack resource is up to date + status: "False" + reason: Success +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Trunk +metadata: + name: trunk-import-dependency +status: + conditions: + - type: Available + message: |- + Waiting for Port/trunk-import-dependency to be ready + Waiting for Project/trunk-import-dependency to be ready + status: "False" + reason: Progressing + - type: Progressing + message: |- + Waiting for Port/trunk-import-dependency to be ready + Waiting for Project/trunk-import-dependency to be ready + status: "True" + reason: Progressing diff --git a/internal/controllers/trunk/tests/trunk-import-dependency/01-create-trap-resource.yaml b/internal/controllers/trunk/tests/trunk-import-dependency/01-create-trap-resource.yaml new file mode 100644 index 000000000..f441a0b7b --- /dev/null +++ b/internal/controllers/trunk/tests/trunk-import-dependency/01-create-trap-resource.yaml @@ -0,0 +1,65 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Network +metadata: + name: trunk-import-dependency +spec: + cloudCredentialsRef: + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + resource: + name: trunk-import-dependency +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Subnet +metadata: + name: trunk-import-dependency +spec: + cloudCredentialsRef: + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + resource: + networkRef: trunk-import-dependency + ipVersion: 4 + cidr: 192.168.161.0/24 +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Port +metadata: + name: trunk-import-dependency-not-this-one +spec: + cloudCredentialsRef: + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + resource: + networkRef: trunk-import-dependency + addresses: + - subnetRef: trunk-import-dependency +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Project +metadata: + name: trunk-import-dependency-not-this-one +spec: + cloudCredentialsRef: + cloudName: openstack-admin + secretName: openstack-clouds + managementPolicy: managed + resource: {} +--- +# This `trunk-import-dependency-not-this-one` should not be picked by the import filter +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Trunk +metadata: + name: trunk-import-dependency-not-this-one +spec: + cloudCredentialsRef: + cloudName: openstack-admin + secretName: openstack-clouds + managementPolicy: managed + resource: + portRef: trunk-import-dependency-not-this-one + projectRef: trunk-import-dependency-not-this-one diff --git a/internal/controllers/trunk/tests/trunk-import-dependency/02-assert.yaml b/internal/controllers/trunk/tests/trunk-import-dependency/02-assert.yaml new file mode 100644 index 000000000..a57266e42 --- /dev/null +++ b/internal/controllers/trunk/tests/trunk-import-dependency/02-assert.yaml @@ -0,0 +1,39 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestAssert +resourceRefs: + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: Trunk + name: trunk-import-dependency + ref: trunk1 + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: Trunk + name: trunk-import-dependency-not-this-one + ref: trunk2 + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: Port + name: trunk-import-dependency + ref: port + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: Project + name: trunk-import-dependency + ref: project +assertAll: + - celExpr: "trunk1.status.id != trunk2.status.id" + - celExpr: "trunk1.status.resource.portID == port.status.id" + - celExpr: "trunk1.status.resource.projectID == project.status.id" +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Trunk +metadata: + name: trunk-import-dependency +status: + conditions: + - type: Available + message: OpenStack resource is available + status: "True" + reason: Success + - type: Progressing + message: OpenStack resource is up to date + status: "False" + reason: Success diff --git a/internal/controllers/trunk/tests/trunk-import-dependency/02-create-resource.yaml b/internal/controllers/trunk/tests/trunk-import-dependency/02-create-resource.yaml new file mode 100644 index 000000000..18ca511fb --- /dev/null +++ b/internal/controllers/trunk/tests/trunk-import-dependency/02-create-resource.yaml @@ -0,0 +1,38 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Port +metadata: + name: trunk-import-dependency-external +spec: + cloudCredentialsRef: + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + resource: + networkRef: trunk-import-dependency + addresses: + - subnetRef: trunk-import-dependency +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Project +metadata: + name: trunk-import-dependency-external +spec: + cloudCredentialsRef: + cloudName: openstack-admin + secretName: openstack-clouds + managementPolicy: managed + resource: {} +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Trunk +metadata: + name: trunk-import-dependency-external +spec: + cloudCredentialsRef: + cloudName: openstack-admin + secretName: openstack-clouds + managementPolicy: managed + resource: + portRef: trunk-import-dependency-external + projectRef: trunk-import-dependency-external diff --git a/internal/controllers/trunk/tests/trunk-import-dependency/03-assert.yaml b/internal/controllers/trunk/tests/trunk-import-dependency/03-assert.yaml new file mode 100644 index 000000000..88388e78f --- /dev/null +++ b/internal/controllers/trunk/tests/trunk-import-dependency/03-assert.yaml @@ -0,0 +1,8 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestAssert +commands: +- script: "! kubectl get port trunk-import-dependency --namespace $NAMESPACE" + skipLogOutput: true +- script: "! kubectl get project trunk-import-dependency --namespace $NAMESPACE" + skipLogOutput: true diff --git a/internal/controllers/trunk/tests/trunk-import-dependency/03-delete-import-dependencies.yaml b/internal/controllers/trunk/tests/trunk-import-dependency/03-delete-import-dependencies.yaml new file mode 100644 index 000000000..c17489455 --- /dev/null +++ b/internal/controllers/trunk/tests/trunk-import-dependency/03-delete-import-dependencies.yaml @@ -0,0 +1,9 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestStep +commands: + # We should be able to delete the import dependencies + - command: kubectl delete port trunk-import-dependency + namespaced: true + - command: kubectl delete project trunk-import-dependency + namespaced: true diff --git a/internal/controllers/trunk/tests/trunk-import-dependency/04-assert.yaml b/internal/controllers/trunk/tests/trunk-import-dependency/04-assert.yaml new file mode 100644 index 000000000..cf9454e52 --- /dev/null +++ b/internal/controllers/trunk/tests/trunk-import-dependency/04-assert.yaml @@ -0,0 +1,6 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestAssert +commands: +- script: "! kubectl get trunk trunk-import-dependency --namespace $NAMESPACE" + skipLogOutput: true diff --git a/internal/controllers/trunk/tests/trunk-import-dependency/04-delete-resource.yaml b/internal/controllers/trunk/tests/trunk-import-dependency/04-delete-resource.yaml new file mode 100644 index 000000000..10b0d3c75 --- /dev/null +++ b/internal/controllers/trunk/tests/trunk-import-dependency/04-delete-resource.yaml @@ -0,0 +1,7 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestStep +delete: + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: Trunk + name: trunk-import-dependency diff --git a/internal/controllers/trunk/tests/trunk-import-dependency/README.md b/internal/controllers/trunk/tests/trunk-import-dependency/README.md new file mode 100644 index 000000000..386f4830a --- /dev/null +++ b/internal/controllers/trunk/tests/trunk-import-dependency/README.md @@ -0,0 +1,29 @@ +# Check dependency handling for imported Trunk + +## Step 00 + +Import a Trunk that references other imported resources. The referenced imported resources have no matching resources yet. +Verify the Trunk is waiting for the dependency to be ready. + +## Step 01 + +Create a Trunk matching the import filter, except for referenced resources, and verify that it's not being imported. + +## Step 02 + +Create the referenced resources and a Trunk matching the import filters. + +Verify that the observed status on the imported Trunk corresponds to the spec of the created Trunk. + +## Step 03 + +Delete the referenced resources and check that ORC does not prevent deletion. The OpenStack resources still exist because they +were imported resources and we only deleted the ORC representation of it. + +## Step 04 + +Delete the Trunk and validate that all resources are gone. + +## Reference + +https://k-orc.cloud/development/writing-tests/#import-dependency diff --git a/internal/controllers/trunk/tests/trunk-import-error/00-assert.yaml b/internal/controllers/trunk/tests/trunk-import-error/00-assert.yaml new file mode 100644 index 000000000..6e538ab91 --- /dev/null +++ b/internal/controllers/trunk/tests/trunk-import-error/00-assert.yaml @@ -0,0 +1,30 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Trunk +metadata: + name: trunk-import-error-external-1 +status: + conditions: + - type: Available + message: OpenStack resource is available + status: "True" + reason: Success + - type: Progressing + message: OpenStack resource is up to date + status: "False" + reason: Success +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Trunk +metadata: + name: trunk-import-error-external-2 +status: + conditions: + - type: Available + message: OpenStack resource is available + status: "True" + reason: Success + - type: Progressing + message: OpenStack resource is up to date + status: "False" + reason: Success diff --git a/internal/controllers/trunk/tests/trunk-import-error/00-create-resources.yaml b/internal/controllers/trunk/tests/trunk-import-error/00-create-resources.yaml new file mode 100644 index 000000000..664ac9638 --- /dev/null +++ b/internal/controllers/trunk/tests/trunk-import-error/00-create-resources.yaml @@ -0,0 +1,80 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Network +metadata: + name: trunk-import-error +spec: + cloudCredentialsRef: + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + resource: + name: trunk-import-error +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Subnet +metadata: + name: trunk-import-error +spec: + cloudCredentialsRef: + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + resource: + networkRef: trunk-import-error + ipVersion: 4 + cidr: 192.168.157.0/24 +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Port +metadata: + name: trunk-import-error-1 +spec: + cloudCredentialsRef: + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + resource: + networkRef: trunk-import-error + addresses: + - subnetRef: trunk-import-error +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Port +metadata: + name: trunk-import-error-2 +spec: + cloudCredentialsRef: + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + resource: + networkRef: trunk-import-error + addresses: + - subnetRef: trunk-import-error +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Trunk +metadata: + name: trunk-import-error-external-1 +spec: + cloudCredentialsRef: + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + resource: + description: Trunk from "import error" test + portRef: trunk-import-error-1 +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Trunk +metadata: + name: trunk-import-error-external-2 +spec: + cloudCredentialsRef: + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + resource: + description: Trunk from "import error" test + portRef: trunk-import-error-2 diff --git a/internal/controllers/trunk/tests/trunk-import-error/00-secret.yaml b/internal/controllers/trunk/tests/trunk-import-error/00-secret.yaml new file mode 100644 index 000000000..045711ee7 --- /dev/null +++ b/internal/controllers/trunk/tests/trunk-import-error/00-secret.yaml @@ -0,0 +1,6 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestStep +commands: + - command: kubectl create secret generic openstack-clouds --from-file=clouds.yaml=${E2E_KUTTL_OSCLOUDS} ${E2E_KUTTL_CACERT_OPT} + namespaced: true diff --git a/internal/controllers/trunk/tests/trunk-import-error/01-assert.yaml b/internal/controllers/trunk/tests/trunk-import-error/01-assert.yaml new file mode 100644 index 000000000..1f48b6bb9 --- /dev/null +++ b/internal/controllers/trunk/tests/trunk-import-error/01-assert.yaml @@ -0,0 +1,15 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Trunk +metadata: + name: trunk-import-error +status: + conditions: + - type: Available + message: found more than one matching OpenStack resource during import + status: "False" + reason: InvalidConfiguration + - type: Progressing + message: found more than one matching OpenStack resource during import + status: "False" + reason: InvalidConfiguration diff --git a/internal/controllers/trunk/tests/trunk-import-error/01-import-resource.yaml b/internal/controllers/trunk/tests/trunk-import-error/01-import-resource.yaml new file mode 100644 index 000000000..d3d922853 --- /dev/null +++ b/internal/controllers/trunk/tests/trunk-import-error/01-import-resource.yaml @@ -0,0 +1,13 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Trunk +metadata: + name: trunk-import-error +spec: + cloudCredentialsRef: + cloudName: openstack + secretName: openstack-clouds + managementPolicy: unmanaged + import: + filter: + description: Trunk from "import error" test diff --git a/internal/controllers/trunk/tests/trunk-import-error/README.md b/internal/controllers/trunk/tests/trunk-import-error/README.md new file mode 100644 index 000000000..ce3ec498f --- /dev/null +++ b/internal/controllers/trunk/tests/trunk-import-error/README.md @@ -0,0 +1,13 @@ +# Import Trunk with more than one matching resources + +## Step 00 + +Create two Trunks with identical specs. + +## Step 01 + +Ensure that an imported Trunk with a filter matching the resources returns an error. + +## Reference + +https://k-orc.cloud/development/writing-tests/#import-error diff --git a/internal/controllers/trunk/tests/trunk-import/00-assert.yaml b/internal/controllers/trunk/tests/trunk-import/00-assert.yaml new file mode 100644 index 000000000..36e2678b2 --- /dev/null +++ b/internal/controllers/trunk/tests/trunk-import/00-assert.yaml @@ -0,0 +1,63 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Trunk +metadata: + name: trunk-import-external +status: + conditions: + - type: Available + message: OpenStack resource is available + status: "True" + reason: Success + - type: Progressing + message: OpenStack resource is up to date + status: "False" + reason: Success + resource: + name: trunk-import-external + description: Trunk trunk-import-external from "trunk-import" test + adminStateUp: true + status: ACTIVE + tags: + - trunk-import-tag +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Trunk +metadata: + name: trunk-import +status: + conditions: + - type: Available + message: OpenStack resource is available + status: "True" + reason: Success + - type: Progressing + message: OpenStack resource is up to date + status: "False" + reason: Success + resource: + name: trunk-import-external + description: Trunk trunk-import-external from "trunk-import" test + adminStateUp: true + status: ACTIVE + tags: + - trunk-import-tag +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestAssert +resourceRefs: + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: Trunk + name: trunk-import-external + ref: trunkExternal + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: Trunk + name: trunk-import + ref: trunkImport + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: Project + name: trunk-import + ref: project +assertAll: + - celExpr: "trunkExternal.status.id == trunkImport.status.id" + - celExpr: "trunkImport.status.resource.projectID == project.status.id" diff --git a/internal/controllers/trunk/tests/trunk-import/00-import-resource.yaml b/internal/controllers/trunk/tests/trunk-import/00-import-resource.yaml new file mode 100644 index 000000000..58f110917 --- /dev/null +++ b/internal/controllers/trunk/tests/trunk-import/00-import-resource.yaml @@ -0,0 +1,86 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Network +metadata: + name: trunk-import +spec: + cloudCredentialsRef: + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + resource: + name: trunk-import +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Subnet +metadata: + name: trunk-import +spec: + cloudCredentialsRef: + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + resource: + networkRef: trunk-import + ipVersion: 4 + cidr: 192.168.159.0/24 +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Port +metadata: + name: trunk-import +spec: + cloudCredentialsRef: + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + resource: + networkRef: trunk-import + addresses: + - subnetRef: trunk-import +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Project +metadata: + name: trunk-import +spec: + cloudCredentialsRef: + cloudName: openstack-admin + secretName: openstack-clouds + managementPolicy: managed + resource: {} +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Trunk +metadata: + name: trunk-import-external +spec: + cloudCredentialsRef: + cloudName: openstack-admin + secretName: openstack-clouds + managementPolicy: managed + resource: + description: Trunk trunk-import-external from "trunk-import" test + portRef: trunk-import + projectRef: trunk-import + adminStateUp: true + tags: + - trunk-import-tag +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Trunk +metadata: + name: trunk-import +spec: + cloudCredentialsRef: + cloudName: openstack-admin + secretName: openstack-clouds + managementPolicy: unmanaged + import: + filter: + name: trunk-import-external + description: Trunk trunk-import-external from "trunk-import" test + projectRef: trunk-import + adminStateUp: true + tags: + - trunk-import-tag diff --git a/internal/controllers/trunk/tests/trunk-import/00-secret.yaml b/internal/controllers/trunk/tests/trunk-import/00-secret.yaml new file mode 100644 index 000000000..045711ee7 --- /dev/null +++ b/internal/controllers/trunk/tests/trunk-import/00-secret.yaml @@ -0,0 +1,6 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestStep +commands: + - command: kubectl create secret generic openstack-clouds --from-file=clouds.yaml=${E2E_KUTTL_OSCLOUDS} ${E2E_KUTTL_CACERT_OPT} + namespaced: true diff --git a/internal/controllers/trunk/tests/trunk-import/01-assert.yaml b/internal/controllers/trunk/tests/trunk-import/01-assert.yaml new file mode 100644 index 000000000..6bc45bb4b --- /dev/null +++ b/internal/controllers/trunk/tests/trunk-import/01-assert.yaml @@ -0,0 +1,35 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Trunk +metadata: + name: trunk-import-external-not-this-one +status: + conditions: + - type: Available + message: OpenStack resource is available + status: "True" + reason: Success + - type: Progressing + message: OpenStack resource is up to date + status: "False" + reason: Success + resource: + name: trunk-import-external-not-this-one + description: Trunk trunk-import-external from "trunk-import" test +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Trunk +metadata: + name: trunk-import +status: + conditions: + - type: Available + message: OpenStack resource is available + status: "True" + reason: Success + - type: Progressing + message: OpenStack resource is up to date + status: "False" + reason: Success + resource: + name: trunk-import-external diff --git a/internal/controllers/trunk/tests/trunk-import/01-create-trap-resource.yaml b/internal/controllers/trunk/tests/trunk-import/01-create-trap-resource.yaml new file mode 100644 index 000000000..6354e198d --- /dev/null +++ b/internal/controllers/trunk/tests/trunk-import/01-create-trap-resource.yaml @@ -0,0 +1,30 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Port +metadata: + name: trunk-import-external-not-this-one +spec: + cloudCredentialsRef: + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + resource: + networkRef: trunk-import + addresses: + - subnetRef: trunk-import +--- +# This `trunk-import-external-not-this-one` resource serves two purposes: +# - ensure that we can successfully create another resource which name is a substring of it (i.e. it's not being adopted) +# - ensure that importing a resource which name is a substring of it will not pick this one. +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Trunk +metadata: + name: trunk-import-external-not-this-one +spec: + cloudCredentialsRef: + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + resource: + description: Trunk trunk-import-external from "trunk-import" test + portRef: trunk-import-external-not-this-one diff --git a/internal/controllers/trunk/tests/trunk-import/02-assert.yaml b/internal/controllers/trunk/tests/trunk-import/02-assert.yaml new file mode 100644 index 000000000..9bd9c508c --- /dev/null +++ b/internal/controllers/trunk/tests/trunk-import/02-assert.yaml @@ -0,0 +1,32 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestAssert +resourceRefs: + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: Trunk + name: trunk-import-external + ref: trunk1 + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: Trunk + name: trunk-import-external-not-this-one + ref: trunk2 +assertAll: + - celExpr: "trunk1.status.id != trunk2.status.id" +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Trunk +metadata: + name: trunk-import +status: + conditions: + - type: Available + message: OpenStack resource is available + status: "True" + reason: Success + - type: Progressing + message: OpenStack resource is up to date + status: "False" + reason: Success + resource: + name: trunk-import-external + description: Trunk trunk-import-external from "trunk-import" test diff --git a/internal/controllers/trunk/tests/trunk-import/02-create-resource.yaml b/internal/controllers/trunk/tests/trunk-import/02-create-resource.yaml new file mode 100644 index 000000000..0161836ec --- /dev/null +++ b/internal/controllers/trunk/tests/trunk-import/02-create-resource.yaml @@ -0,0 +1,7 @@ +# Step 02 is now a no-op since the resources were created in step 00. +# This step exists to maintain the test structure and verify that +# the import still works correctly after a trap resource was created. +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestStep +commands: [] diff --git a/internal/controllers/trunk/tests/trunk-import/README.md b/internal/controllers/trunk/tests/trunk-import/README.md new file mode 100644 index 000000000..d27c0287c --- /dev/null +++ b/internal/controllers/trunk/tests/trunk-import/README.md @@ -0,0 +1,19 @@ +# Import Trunk + +## Step 00 + +Create the required dependencies (Network, Subnet, Port) and the external trunk to be imported. +Import the trunk that matches all fields in the filter and verify it is successfully imported. + +## Step 01 + +Create a trunk whose name is a superstring of the one specified in the import filter, otherwise matching the filter, and verify that it's not being imported. + +## Step 02 + +Verify that the observed status on the imported trunk corresponds to the spec of the created trunk. +Also, confirm that it does not adopt any trunk whose name is a superstring of its own. + +## Reference + +https://k-orc.cloud/development/writing-tests/#import diff --git a/internal/controllers/trunk/tests/trunk-update/00-assert.yaml b/internal/controllers/trunk/tests/trunk-update/00-assert.yaml new file mode 100644 index 000000000..d9a7b0f3e --- /dev/null +++ b/internal/controllers/trunk/tests/trunk-update/00-assert.yaml @@ -0,0 +1,29 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Trunk +metadata: + name: trunk-update +status: + resource: + name: trunk-update + adminStateUp: true + status: ACTIVE + conditions: + - type: Available + status: "True" + reason: Success + - type: Progressing + status: "False" + reason: Success +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestAssert +resourceRefs: + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: Trunk + name: trunk-update + ref: trunk +assertAll: + - celExpr: "!has(trunk.status.resource.description)" + - celExpr: "!has(trunk.status.resource.tags) || trunk.status.resource.tags.size() == 0" + - celExpr: "!has(trunk.status.resource.subports) || trunk.status.resource.subports.size() == 0" diff --git a/internal/controllers/trunk/tests/trunk-update/00-create-resource.yaml b/internal/controllers/trunk/tests/trunk-update/00-create-resource.yaml new file mode 100644 index 000000000..ce776e9a5 --- /dev/null +++ b/internal/controllers/trunk/tests/trunk-update/00-create-resource.yaml @@ -0,0 +1,77 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Network +metadata: + name: trunk-update +spec: + cloudCredentialsRef: + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + resource: + name: trunk-update +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Subnet +metadata: + name: trunk-update +spec: + cloudCredentialsRef: + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + resource: + networkRef: trunk-update + cidr: 192.168.158.0/24 + ipVersion: 4 + enableDHCP: false +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Port +metadata: + name: trunk-update +spec: + cloudCredentialsRef: + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + resource: + networkRef: trunk-update + addresses: + - subnetRef: trunk-update +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Port +metadata: + name: trunk-update-subport1 +spec: + cloudCredentialsRef: + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + resource: + networkRef: trunk-update +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Port +metadata: + name: trunk-update-subport2 +spec: + cloudCredentialsRef: + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + resource: + networkRef: trunk-update +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Port +metadata: + name: trunk-update-subport3 +spec: + cloudCredentialsRef: + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + resource: + networkRef: trunk-update diff --git a/internal/controllers/trunk/tests/trunk-update/00-minimal-resource.yaml b/internal/controllers/trunk/tests/trunk-update/00-minimal-resource.yaml new file mode 100644 index 000000000..99de2965d --- /dev/null +++ b/internal/controllers/trunk/tests/trunk-update/00-minimal-resource.yaml @@ -0,0 +1,12 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Trunk +metadata: + name: trunk-update +spec: + cloudCredentialsRef: + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + resource: + portRef: trunk-update diff --git a/internal/controllers/trunk/tests/trunk-update/00-secret.yaml b/internal/controllers/trunk/tests/trunk-update/00-secret.yaml new file mode 100644 index 000000000..6717de4aa --- /dev/null +++ b/internal/controllers/trunk/tests/trunk-update/00-secret.yaml @@ -0,0 +1,7 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestStep +commands: + - command: kubectl create secret generic openstack-clouds --from-file=clouds.yaml=${E2E_KUTTL_OSCLOUDS} ${E2E_KUTTL_CACERT_OPT} + namespaced: true + diff --git a/internal/controllers/trunk/tests/trunk-update/01-assert.yaml b/internal/controllers/trunk/tests/trunk-update/01-assert.yaml new file mode 100644 index 000000000..4ff4349c2 --- /dev/null +++ b/internal/controllers/trunk/tests/trunk-update/01-assert.yaml @@ -0,0 +1,39 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Trunk +metadata: + name: trunk-update +status: + resource: + name: trunk-update-updated + description: trunk-update-updated + adminStateUp: true + tags: + - trunk-update-updated + conditions: + - type: Available + status: "True" + reason: Success + - type: Progressing + status: "False" + reason: Success +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestAssert +resourceRefs: + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: Trunk + name: trunk-update + ref: trunk + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: Port + name: trunk-update-subport1 + ref: subport1 + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: Port + name: trunk-update-subport2 + ref: subport2 +assertAll: + - celExpr: "trunk.status.resource.subports.size() == 2" + - celExpr: "trunk.status.resource.subports.exists(s, s.portID == subport1.status.id && s.segmentationID == 100 && s.segmentationType == 'vlan')" + - celExpr: "trunk.status.resource.subports.exists(s, s.portID == subport2.status.id && s.segmentationID == 200 && s.segmentationType == 'vlan')" diff --git a/internal/controllers/trunk/tests/trunk-update/01-updated-resource.yaml b/internal/controllers/trunk/tests/trunk-update/01-updated-resource.yaml new file mode 100644 index 000000000..0d65e5510 --- /dev/null +++ b/internal/controllers/trunk/tests/trunk-update/01-updated-resource.yaml @@ -0,0 +1,19 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Trunk +metadata: + name: trunk-update +spec: + resource: + name: trunk-update-updated + description: trunk-update-updated + adminStateUp: true + tags: + - trunk-update-updated + subports: + - portRef: trunk-update-subport1 + segmentationID: 100 + segmentationType: vlan + - portRef: trunk-update-subport2 + segmentationID: 200 + segmentationType: vlan diff --git a/internal/controllers/trunk/tests/trunk-update/02-assert.yaml b/internal/controllers/trunk/tests/trunk-update/02-assert.yaml new file mode 100644 index 000000000..049bb8f3e --- /dev/null +++ b/internal/controllers/trunk/tests/trunk-update/02-assert.yaml @@ -0,0 +1,40 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Trunk +metadata: + name: trunk-update +status: + resource: + adminStateUp: true + conditions: + - type: Available + status: "True" + reason: Success + - type: Progressing + status: "False" + reason: Success +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestAssert +resourceRefs: + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: Trunk + name: trunk-update + ref: trunk + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: Port + name: trunk-update-subport1 + ref: subport1 + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: Port + name: trunk-update-subport2 + ref: subport2 + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: Port + name: trunk-update-subport3 + ref: subport3 +assertAll: + - celExpr: "trunk.status.resource.subports.size() == 2" + - celExpr: "trunk.status.resource.subports.exists(s, s.portID == subport1.status.id && s.segmentationID == 150)" + - celExpr: "trunk.status.resource.subports.exists(s, s.portID == subport3.status.id && s.segmentationID == 300)" + - celExpr: "!trunk.status.resource.subports.exists(s, s.portID == subport2.status.id)" diff --git a/internal/controllers/trunk/tests/trunk-update/02-reverted-resource.yaml b/internal/controllers/trunk/tests/trunk-update/02-reverted-resource.yaml new file mode 100644 index 000000000..968376f50 --- /dev/null +++ b/internal/controllers/trunk/tests/trunk-update/02-reverted-resource.yaml @@ -0,0 +1,16 @@ +# Update subports: remove subport2, add subport3, change subport1 segmentation +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Trunk +metadata: + name: trunk-update +spec: + resource: + adminStateUp: true + subports: + - portRef: trunk-update-subport1 + segmentationID: 150 + segmentationType: vlan + - portRef: trunk-update-subport3 + segmentationID: 300 + segmentationType: vlan diff --git a/internal/controllers/trunk/tests/trunk-update/03-assert.yaml b/internal/controllers/trunk/tests/trunk-update/03-assert.yaml new file mode 100644 index 000000000..65d7a375c --- /dev/null +++ b/internal/controllers/trunk/tests/trunk-update/03-assert.yaml @@ -0,0 +1,30 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Trunk +metadata: + name: trunk-update +status: + resource: + name: trunk-update + adminStateUp: true + status: ACTIVE + conditions: + - type: Available + status: "True" + reason: Success + - type: Progressing + status: "False" + reason: Success +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestAssert +resourceRefs: + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: Trunk + name: trunk-update + ref: trunk +assertAll: + - celExpr: "!has(trunk.status.resource.description)" + - celExpr: "!has(trunk.status.resource.tags) || trunk.status.resource.tags.size() == 0" + - celExpr: "!has(trunk.status.resource.subports) || trunk.status.resource.subports.size() == 0" + diff --git a/internal/controllers/trunk/tests/trunk-update/03-reverted-resource.yaml b/internal/controllers/trunk/tests/trunk-update/03-reverted-resource.yaml new file mode 100644 index 000000000..7d866900e --- /dev/null +++ b/internal/controllers/trunk/tests/trunk-update/03-reverted-resource.yaml @@ -0,0 +1,8 @@ +# NOTE: kuttl only does patch updates, which means we can't delete a field. +# We have to use a kubectl replace command instead. +apiVersion: kuttl.dev/v1beta1 +kind: TestStep +commands: + - command: kubectl replace -f 00-minimal-resource.yaml + namespaced: true + diff --git a/internal/controllers/trunk/tests/trunk-update/04-delete-resources.yaml b/internal/controllers/trunk/tests/trunk-update/04-delete-resources.yaml new file mode 100644 index 000000000..cf958e7ea --- /dev/null +++ b/internal/controllers/trunk/tests/trunk-update/04-delete-resources.yaml @@ -0,0 +1,26 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestStep +delete: + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: Trunk + name: trunk-update + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: Port + name: trunk-update + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: Port + name: trunk-update-subport1 + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: Port + name: trunk-update-subport2 + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: Port + name: trunk-update-subport3 + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: Subnet + name: trunk-update + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: Network + name: trunk-update + diff --git a/internal/controllers/trunk/tests/trunk-update/README.md b/internal/controllers/trunk/tests/trunk-update/README.md new file mode 100644 index 000000000..574c575f6 --- /dev/null +++ b/internal/controllers/trunk/tests/trunk-update/README.md @@ -0,0 +1,21 @@ +# Update Trunk + +## Step 00 + +Create a Trunk using only mandatory fields (portRef only). + +## Step 01 + +Update all mutable fields: name, description, tags, and add subports. + +## Step 02 + +Update subports: remove subport2, add subport3, change subport1 segmentation. + +## Step 03 + +Revert the resource to its original value and verify that the resulting object matches its state when first created (no description, no tags, no subports, adminStateUp true). + +## Reference + +https://k-orc.cloud/development/writing-tests/#update diff --git a/internal/controllers/trunk/zz_generated.adapter.go b/internal/controllers/trunk/zz_generated.adapter.go new file mode 100644 index 000000000..ef7e54457 --- /dev/null +++ b/internal/controllers/trunk/zz_generated.adapter.go @@ -0,0 +1,88 @@ +// Code generated by resource-generator. DO NOT EDIT. +/* +Copyright The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +package trunk + +import ( + orcv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1" + "github.com/k-orc/openstack-resource-controller/v2/internal/controllers/generic/interfaces" +) + +// Fundamental types +type ( + orcObjectT = orcv1alpha1.Trunk + orcObjectListT = orcv1alpha1.TrunkList + resourceSpecT = orcv1alpha1.TrunkResourceSpec + filterT = orcv1alpha1.TrunkFilter +) + +// Derived types +type ( + orcObjectPT = *orcObjectT + adapterI = interfaces.APIObjectAdapter[orcObjectPT, resourceSpecT, filterT] + adapterT = trunkAdapter +) + +type trunkAdapter struct { + *orcv1alpha1.Trunk +} + +var _ adapterI = &adapterT{} + +func (f adapterT) GetObject() orcObjectPT { + return f.Trunk +} + +func (f adapterT) GetManagementPolicy() orcv1alpha1.ManagementPolicy { + return f.Spec.ManagementPolicy +} + +func (f adapterT) GetManagedOptions() *orcv1alpha1.ManagedOptions { + return f.Spec.ManagedOptions +} + +func (f adapterT) GetStatusID() *string { + return f.Status.ID +} + +func (f adapterT) GetResourceSpec() *resourceSpecT { + return f.Spec.Resource +} + +func (f adapterT) GetImportID() *string { + if f.Spec.Import == nil { + return nil + } + return f.Spec.Import.ID +} + +func (f adapterT) GetImportFilter() *filterT { + if f.Spec.Import == nil { + return nil + } + return f.Spec.Import.Filter +} + +// getResourceName returns the name of the OpenStack resource we should use. +// This method is not implemented as part of APIObjectAdapter as it is intended +// to be used by resource actuators, which don't use the adapter. +func getResourceName(orcObject orcObjectPT) string { + if orcObject.Spec.Resource.Name != nil { + return string(*orcObject.Spec.Resource.Name) + } + return orcObject.Name +} diff --git a/internal/controllers/trunk/zz_generated.controller.go b/internal/controllers/trunk/zz_generated.controller.go new file mode 100644 index 000000000..6b36c15cc --- /dev/null +++ b/internal/controllers/trunk/zz_generated.controller.go @@ -0,0 +1,45 @@ +// Code generated by resource-generator. DO NOT EDIT. +/* +Copyright The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +package trunk + +import ( + corev1 "k8s.io/api/core/v1" + + "github.com/k-orc/openstack-resource-controller/v2/internal/util/dependency" + orcstrings "github.com/k-orc/openstack-resource-controller/v2/internal/util/strings" +) + +var ( + // NOTE: controllerName must be defined in any controller using this template + + // finalizer is the string this controller adds to an object's Finalizers + finalizer = orcstrings.GetFinalizerName(controllerName) + + // externalObjectFieldOwner is the field owner we use when using + // server-side-apply on objects we don't control + externalObjectFieldOwner = orcstrings.GetSSAFieldOwner(controllerName) + + credentialsDependency = dependency.NewDeletionGuardDependency[*orcObjectListT, *corev1.Secret]( + "spec.cloudCredentialsRef.secretName", + func(obj orcObjectPT) []string { + return []string{obj.Spec.CloudCredentialsRef.SecretName} + }, + finalizer, externalObjectFieldOwner, + dependency.OverrideDependencyName("credentials"), + ) +) diff --git a/internal/osclients/mock/networking.go b/internal/osclients/mock/networking.go index ceab233d2..26888bc13 100644 --- a/internal/osclients/mock/networking.go +++ b/internal/osclients/mock/networking.go @@ -34,6 +34,7 @@ import ( routers "github.com/gophercloud/gophercloud/v2/openstack/networking/v2/extensions/layer3/routers" groups "github.com/gophercloud/gophercloud/v2/openstack/networking/v2/extensions/security/groups" rules "github.com/gophercloud/gophercloud/v2/openstack/networking/v2/extensions/security/rules" + trunks "github.com/gophercloud/gophercloud/v2/openstack/networking/v2/extensions/trunks" networks "github.com/gophercloud/gophercloud/v2/openstack/networking/v2/networks" ports "github.com/gophercloud/gophercloud/v2/openstack/networking/v2/ports" subnets "github.com/gophercloud/gophercloud/v2/openstack/networking/v2/subnets" @@ -80,6 +81,21 @@ func (mr *MockNetworkClientMockRecorder) AddRouterInterface(ctx, id, opts any) * return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "AddRouterInterface", reflect.TypeOf((*MockNetworkClient)(nil).AddRouterInterface), ctx, id, opts) } +// AddSubports mocks base method. +func (m *MockNetworkClient) AddSubports(ctx context.Context, id string, opts trunks.AddSubportsOptsBuilder) (*trunks.Trunk, error) { + m.ctrl.T.Helper() + ret := m.ctrl.Call(m, "AddSubports", ctx, id, opts) + ret0, _ := ret[0].(*trunks.Trunk) + ret1, _ := ret[1].(error) + return ret0, ret1 +} + +// AddSubports indicates an expected call of AddSubports. +func (mr *MockNetworkClientMockRecorder) AddSubports(ctx, id, opts any) *gomock.Call { + mr.mock.ctrl.T.Helper() + return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "AddSubports", reflect.TypeOf((*MockNetworkClient)(nil).AddSubports), ctx, id, opts) +} + // CreateFloatingIP mocks base method. func (m *MockNetworkClient) CreateFloatingIP(ctx context.Context, opts floatingips.CreateOptsBuilder) (*floatingips.FloatingIP, error) { m.ctrl.T.Helper() @@ -185,6 +201,21 @@ func (mr *MockNetworkClientMockRecorder) CreateSubnet(ctx, opts any) *gomock.Cal return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "CreateSubnet", reflect.TypeOf((*MockNetworkClient)(nil).CreateSubnet), ctx, opts) } +// CreateTrunk mocks base method. +func (m *MockNetworkClient) CreateTrunk(ctx context.Context, opts trunks.CreateOptsBuilder) (*trunks.Trunk, error) { + m.ctrl.T.Helper() + ret := m.ctrl.Call(m, "CreateTrunk", ctx, opts) + ret0, _ := ret[0].(*trunks.Trunk) + ret1, _ := ret[1].(error) + return ret0, ret1 +} + +// CreateTrunk indicates an expected call of CreateTrunk. +func (mr *MockNetworkClientMockRecorder) CreateTrunk(ctx, opts any) *gomock.Call { + mr.mock.ctrl.T.Helper() + return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "CreateTrunk", reflect.TypeOf((*MockNetworkClient)(nil).CreateTrunk), ctx, opts) +} + // DeleteFloatingIP mocks base method. func (m *MockNetworkClient) DeleteFloatingIP(ctx context.Context, id string) error { m.ctrl.T.Helper() @@ -283,6 +314,20 @@ func (mr *MockNetworkClientMockRecorder) DeleteSubnet(ctx, id any) *gomock.Call return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "DeleteSubnet", reflect.TypeOf((*MockNetworkClient)(nil).DeleteSubnet), ctx, id) } +// DeleteTrunk mocks base method. +func (m *MockNetworkClient) DeleteTrunk(ctx context.Context, id string) error { + m.ctrl.T.Helper() + ret := m.ctrl.Call(m, "DeleteTrunk", ctx, id) + ret0, _ := ret[0].(error) + return ret0 +} + +// DeleteTrunk indicates an expected call of DeleteTrunk. +func (mr *MockNetworkClientMockRecorder) DeleteTrunk(ctx, id any) *gomock.Call { + mr.mock.ctrl.T.Helper() + return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "DeleteTrunk", reflect.TypeOf((*MockNetworkClient)(nil).DeleteTrunk), ctx, id) +} + // GetFloatingIP mocks base method. func (m *MockNetworkClient) GetFloatingIP(ctx context.Context, id string) (*floatingips.FloatingIP, error) { m.ctrl.T.Helper() @@ -388,6 +433,21 @@ func (mr *MockNetworkClientMockRecorder) GetSubnet(ctx, id any) *gomock.Call { return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "GetSubnet", reflect.TypeOf((*MockNetworkClient)(nil).GetSubnet), ctx, id) } +// GetTrunk mocks base method. +func (m *MockNetworkClient) GetTrunk(ctx context.Context, id string) (*trunks.Trunk, error) { + m.ctrl.T.Helper() + ret := m.ctrl.Call(m, "GetTrunk", ctx, id) + ret0, _ := ret[0].(*trunks.Trunk) + ret1, _ := ret[1].(error) + return ret0, ret1 +} + +// GetTrunk indicates an expected call of GetTrunk. +func (mr *MockNetworkClientMockRecorder) GetTrunk(ctx, id any) *gomock.Call { + mr.mock.ctrl.T.Helper() + return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "GetTrunk", reflect.TypeOf((*MockNetworkClient)(nil).GetTrunk), ctx, id) +} + // ListFloatingIP mocks base method. func (m *MockNetworkClient) ListFloatingIP(ctx context.Context, opts floatingips.ListOptsBuilder) iter.Seq2[*floatingips.FloatingIP, error] { m.ctrl.T.Helper() @@ -487,6 +547,36 @@ func (mr *MockNetworkClientMockRecorder) ListSubnet(ctx, opts any) *gomock.Call return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "ListSubnet", reflect.TypeOf((*MockNetworkClient)(nil).ListSubnet), ctx, opts) } +// ListTrunk mocks base method. +func (m *MockNetworkClient) ListTrunk(ctx context.Context, opts trunks.ListOptsBuilder) ([]trunks.Trunk, error) { + m.ctrl.T.Helper() + ret := m.ctrl.Call(m, "ListTrunk", ctx, opts) + ret0, _ := ret[0].([]trunks.Trunk) + ret1, _ := ret[1].(error) + return ret0, ret1 +} + +// ListTrunk indicates an expected call of ListTrunk. +func (mr *MockNetworkClientMockRecorder) ListTrunk(ctx, opts any) *gomock.Call { + mr.mock.ctrl.T.Helper() + return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "ListTrunk", reflect.TypeOf((*MockNetworkClient)(nil).ListTrunk), ctx, opts) +} + +// ListTrunkSubports mocks base method. +func (m *MockNetworkClient) ListTrunkSubports(ctx context.Context, trunkID string) ([]trunks.Subport, error) { + m.ctrl.T.Helper() + ret := m.ctrl.Call(m, "ListTrunkSubports", ctx, trunkID) + ret0, _ := ret[0].([]trunks.Subport) + ret1, _ := ret[1].(error) + return ret0, ret1 +} + +// ListTrunkSubports indicates an expected call of ListTrunkSubports. +func (mr *MockNetworkClientMockRecorder) ListTrunkSubports(ctx, trunkID any) *gomock.Call { + mr.mock.ctrl.T.Helper() + return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "ListTrunkSubports", reflect.TypeOf((*MockNetworkClient)(nil).ListTrunkSubports), ctx, trunkID) +} + // RemoveRouterInterface mocks base method. func (m *MockNetworkClient) RemoveRouterInterface(ctx context.Context, id string, opts routers.RemoveInterfaceOptsBuilder) (*routers.InterfaceInfo, error) { m.ctrl.T.Helper() @@ -502,6 +592,20 @@ func (mr *MockNetworkClientMockRecorder) RemoveRouterInterface(ctx, id, opts any return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "RemoveRouterInterface", reflect.TypeOf((*MockNetworkClient)(nil).RemoveRouterInterface), ctx, id, opts) } +// RemoveSubports mocks base method. +func (m *MockNetworkClient) RemoveSubports(ctx context.Context, id string, opts trunks.RemoveSubportsOptsBuilder) error { + m.ctrl.T.Helper() + ret := m.ctrl.Call(m, "RemoveSubports", ctx, id, opts) + ret0, _ := ret[0].(error) + return ret0 +} + +// RemoveSubports indicates an expected call of RemoveSubports. +func (mr *MockNetworkClientMockRecorder) RemoveSubports(ctx, id, opts any) *gomock.Call { + mr.mock.ctrl.T.Helper() + return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "RemoveSubports", reflect.TypeOf((*MockNetworkClient)(nil).RemoveSubports), ctx, id, opts) +} + // ReplaceAllAttributesTags mocks base method. func (m *MockNetworkClient) ReplaceAllAttributesTags(ctx context.Context, resourceType, resourceID string, opts attributestags.ReplaceAllOptsBuilder) ([]string, error) { m.ctrl.T.Helper() @@ -606,3 +710,18 @@ func (mr *MockNetworkClientMockRecorder) UpdateSubnet(ctx, id, opts any) *gomock mr.mock.ctrl.T.Helper() return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "UpdateSubnet", reflect.TypeOf((*MockNetworkClient)(nil).UpdateSubnet), ctx, id, opts) } + +// UpdateTrunk mocks base method. +func (m *MockNetworkClient) UpdateTrunk(ctx context.Context, id string, opts trunks.UpdateOptsBuilder) (*trunks.Trunk, error) { + m.ctrl.T.Helper() + ret := m.ctrl.Call(m, "UpdateTrunk", ctx, id, opts) + ret0, _ := ret[0].(*trunks.Trunk) + ret1, _ := ret[1].(error) + return ret0, ret1 +} + +// UpdateTrunk indicates an expected call of UpdateTrunk. +func (mr *MockNetworkClientMockRecorder) UpdateTrunk(ctx, id, opts any) *gomock.Call { + mr.mock.ctrl.T.Helper() + return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "UpdateTrunk", reflect.TypeOf((*MockNetworkClient)(nil).UpdateTrunk), ctx, id, opts) +} diff --git a/internal/osclients/networking.go b/internal/osclients/networking.go index 99156d64e..9e25c2f66 100644 --- a/internal/osclients/networking.go +++ b/internal/osclients/networking.go @@ -102,6 +102,15 @@ type NetworkClient interface { GetSubnet(ctx context.Context, id string) (*subnets.Subnet, error) UpdateSubnet(ctx context.Context, id string, opts subnets.UpdateOptsBuilder) (*subnets.Subnet, error) + ListTrunk(ctx context.Context, opts trunks.ListOptsBuilder) ([]trunks.Trunk, error) + GetTrunk(ctx context.Context, id string) (*trunks.Trunk, error) + CreateTrunk(ctx context.Context, opts trunks.CreateOptsBuilder) (*trunks.Trunk, error) + UpdateTrunk(ctx context.Context, id string, opts trunks.UpdateOptsBuilder) (*trunks.Trunk, error) + DeleteTrunk(ctx context.Context, id string) error + ListTrunkSubports(ctx context.Context, trunkID string) ([]trunks.Subport, error) + AddSubports(ctx context.Context, id string, opts trunks.AddSubportsOptsBuilder) (*trunks.Trunk, error) + RemoveSubports(ctx context.Context, id string, opts trunks.RemoveSubportsOptsBuilder) error + ReplaceAllAttributesTags(ctx context.Context, resourceType string, resourceID string, opts attributestags.ReplaceAllOptsBuilder) ([]string, error) } @@ -214,10 +223,18 @@ func (c networkClient) UpdatePort(ctx context.Context, id string, opts ports.Upd return &portExt, nil } +func (c networkClient) GetTrunk(ctx context.Context, id string) (*trunks.Trunk, error) { + return trunks.Get(ctx, c.serviceClient, id).Extract() +} + func (c networkClient) CreateTrunk(ctx context.Context, opts trunks.CreateOptsBuilder) (*trunks.Trunk, error) { return trunks.Create(ctx, c.serviceClient, opts).Extract() } +func (c networkClient) UpdateTrunk(ctx context.Context, id string, opts trunks.UpdateOptsBuilder) (*trunks.Trunk, error) { + return trunks.Update(ctx, c.serviceClient, id, opts).Extract() +} + func (c networkClient) DeleteTrunk(ctx context.Context, id string) error { return trunks.Delete(ctx, c.serviceClient, id).ExtractErr() } @@ -226,11 +243,6 @@ func (c networkClient) ListTrunkSubports(ctx context.Context, trunkID string) ([ return trunks.GetSubports(ctx, c.serviceClient, trunkID).Extract() } -func (c networkClient) RemoveSubports(ctx context.Context, id string, opts trunks.RemoveSubportsOpts) error { - _, err := trunks.RemoveSubports(ctx, c.serviceClient, id, opts).Extract() - return err -} - func (c networkClient) ListTrunk(ctx context.Context, opts trunks.ListOptsBuilder) ([]trunks.Trunk, error) { allPages, err := trunks.List(c.serviceClient, opts).AllPages(ctx) if err != nil { @@ -239,6 +251,15 @@ func (c networkClient) ListTrunk(ctx context.Context, opts trunks.ListOptsBuilde return trunks.ExtractTrunks(allPages) } +func (c networkClient) AddSubports(ctx context.Context, id string, opts trunks.AddSubportsOptsBuilder) (*trunks.Trunk, error) { + return trunks.AddSubports(ctx, c.serviceClient, id, opts).Extract() +} + +func (c networkClient) RemoveSubports(ctx context.Context, id string, opts trunks.RemoveSubportsOptsBuilder) error { + _, err := trunks.RemoveSubports(ctx, c.serviceClient, id, opts).Extract() + return err +} + func (c networkClient) CreateRouter(ctx context.Context, opts routers.CreateOptsBuilder) (*routers.Router, error) { return routers.Create(ctx, c.serviceClient, opts).Extract() } diff --git a/kuttl-test.yaml b/kuttl-test.yaml index d499782e6..67828d420 100644 --- a/kuttl-test.yaml +++ b/kuttl-test.yaml @@ -19,6 +19,7 @@ testDirs: - ./internal/controllers/servergroup/tests/ - ./internal/controllers/service/tests/ - ./internal/controllers/subnet/tests/ +- ./internal/controllers/trunk/tests/ - ./internal/controllers/volume/tests/ - ./internal/controllers/volumetype/tests/ timeout: 240 diff --git a/pkg/clients/applyconfiguration/api/v1alpha1/trunk.go b/pkg/clients/applyconfiguration/api/v1alpha1/trunk.go new file mode 100644 index 000000000..60ee92b13 --- /dev/null +++ b/pkg/clients/applyconfiguration/api/v1alpha1/trunk.go @@ -0,0 +1,281 @@ +/* +Copyright The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +// Code generated by applyconfiguration-gen. DO NOT EDIT. + +package v1alpha1 + +import ( + apiv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1" + internal "github.com/k-orc/openstack-resource-controller/v2/pkg/clients/applyconfiguration/internal" + metav1 "k8s.io/apimachinery/pkg/apis/meta/v1" + types "k8s.io/apimachinery/pkg/types" + managedfields "k8s.io/apimachinery/pkg/util/managedfields" + v1 "k8s.io/client-go/applyconfigurations/meta/v1" +) + +// TrunkApplyConfiguration represents a declarative configuration of the Trunk type for use +// with apply. +type TrunkApplyConfiguration struct { + v1.TypeMetaApplyConfiguration `json:",inline"` + *v1.ObjectMetaApplyConfiguration `json:"metadata,omitempty"` + Spec *TrunkSpecApplyConfiguration `json:"spec,omitempty"` + Status *TrunkStatusApplyConfiguration `json:"status,omitempty"` +} + +// Trunk constructs a declarative configuration of the Trunk type for use with +// apply. +func Trunk(name, namespace string) *TrunkApplyConfiguration { + b := &TrunkApplyConfiguration{} + b.WithName(name) + b.WithNamespace(namespace) + b.WithKind("Trunk") + b.WithAPIVersion("openstack.k-orc.cloud/v1alpha1") + return b +} + +// ExtractTrunk extracts the applied configuration owned by fieldManager from +// trunk. If no managedFields are found in trunk for fieldManager, a +// TrunkApplyConfiguration is returned with only the Name, Namespace (if applicable), +// APIVersion and Kind populated. It is possible that no managed fields were found for because other +// field managers have taken ownership of all the fields previously owned by fieldManager, or because +// the fieldManager never owned fields any fields. +// trunk must be a unmodified Trunk API object that was retrieved from the Kubernetes API. +// ExtractTrunk provides a way to perform a extract/modify-in-place/apply workflow. +// Note that an extracted apply configuration will contain fewer fields than what the fieldManager previously +// applied if another fieldManager has updated or force applied any of the previously applied fields. +// Experimental! +func ExtractTrunk(trunk *apiv1alpha1.Trunk, fieldManager string) (*TrunkApplyConfiguration, error) { + return extractTrunk(trunk, fieldManager, "") +} + +// ExtractTrunkStatus is the same as ExtractTrunk except +// that it extracts the status subresource applied configuration. +// Experimental! +func ExtractTrunkStatus(trunk *apiv1alpha1.Trunk, fieldManager string) (*TrunkApplyConfiguration, error) { + return extractTrunk(trunk, fieldManager, "status") +} + +func extractTrunk(trunk *apiv1alpha1.Trunk, fieldManager string, subresource string) (*TrunkApplyConfiguration, error) { + b := &TrunkApplyConfiguration{} + err := managedfields.ExtractInto(trunk, internal.Parser().Type("com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.Trunk"), fieldManager, b, subresource) + if err != nil { + return nil, err + } + b.WithName(trunk.Name) + b.WithNamespace(trunk.Namespace) + + b.WithKind("Trunk") + b.WithAPIVersion("openstack.k-orc.cloud/v1alpha1") + return b, nil +} +func (b TrunkApplyConfiguration) IsApplyConfiguration() {} + +// WithKind sets the Kind field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Kind field is set to the value of the last call. +func (b *TrunkApplyConfiguration) WithKind(value string) *TrunkApplyConfiguration { + b.TypeMetaApplyConfiguration.Kind = &value + return b +} + +// WithAPIVersion sets the APIVersion field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the APIVersion field is set to the value of the last call. +func (b *TrunkApplyConfiguration) WithAPIVersion(value string) *TrunkApplyConfiguration { + b.TypeMetaApplyConfiguration.APIVersion = &value + return b +} + +// WithName sets the Name field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Name field is set to the value of the last call. +func (b *TrunkApplyConfiguration) WithName(value string) *TrunkApplyConfiguration { + b.ensureObjectMetaApplyConfigurationExists() + b.ObjectMetaApplyConfiguration.Name = &value + return b +} + +// WithGenerateName sets the GenerateName field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the GenerateName field is set to the value of the last call. +func (b *TrunkApplyConfiguration) WithGenerateName(value string) *TrunkApplyConfiguration { + b.ensureObjectMetaApplyConfigurationExists() + b.ObjectMetaApplyConfiguration.GenerateName = &value + return b +} + +// WithNamespace sets the Namespace field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Namespace field is set to the value of the last call. +func (b *TrunkApplyConfiguration) WithNamespace(value string) *TrunkApplyConfiguration { + b.ensureObjectMetaApplyConfigurationExists() + b.ObjectMetaApplyConfiguration.Namespace = &value + return b +} + +// WithUID sets the UID field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the UID field is set to the value of the last call. +func (b *TrunkApplyConfiguration) WithUID(value types.UID) *TrunkApplyConfiguration { + b.ensureObjectMetaApplyConfigurationExists() + b.ObjectMetaApplyConfiguration.UID = &value + return b +} + +// WithResourceVersion sets the ResourceVersion field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the ResourceVersion field is set to the value of the last call. +func (b *TrunkApplyConfiguration) WithResourceVersion(value string) *TrunkApplyConfiguration { + b.ensureObjectMetaApplyConfigurationExists() + b.ObjectMetaApplyConfiguration.ResourceVersion = &value + return b +} + +// WithGeneration sets the Generation field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Generation field is set to the value of the last call. +func (b *TrunkApplyConfiguration) WithGeneration(value int64) *TrunkApplyConfiguration { + b.ensureObjectMetaApplyConfigurationExists() + b.ObjectMetaApplyConfiguration.Generation = &value + return b +} + +// WithCreationTimestamp sets the CreationTimestamp field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the CreationTimestamp field is set to the value of the last call. +func (b *TrunkApplyConfiguration) WithCreationTimestamp(value metav1.Time) *TrunkApplyConfiguration { + b.ensureObjectMetaApplyConfigurationExists() + b.ObjectMetaApplyConfiguration.CreationTimestamp = &value + return b +} + +// WithDeletionTimestamp sets the DeletionTimestamp field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the DeletionTimestamp field is set to the value of the last call. +func (b *TrunkApplyConfiguration) WithDeletionTimestamp(value metav1.Time) *TrunkApplyConfiguration { + b.ensureObjectMetaApplyConfigurationExists() + b.ObjectMetaApplyConfiguration.DeletionTimestamp = &value + return b +} + +// WithDeletionGracePeriodSeconds sets the DeletionGracePeriodSeconds field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the DeletionGracePeriodSeconds field is set to the value of the last call. +func (b *TrunkApplyConfiguration) WithDeletionGracePeriodSeconds(value int64) *TrunkApplyConfiguration { + b.ensureObjectMetaApplyConfigurationExists() + b.ObjectMetaApplyConfiguration.DeletionGracePeriodSeconds = &value + return b +} + +// WithLabels puts the entries into the Labels field in the declarative configuration +// and returns the receiver, so that objects can be build by chaining "With" function invocations. +// If called multiple times, the entries provided by each call will be put on the Labels field, +// overwriting an existing map entries in Labels field with the same key. +func (b *TrunkApplyConfiguration) WithLabels(entries map[string]string) *TrunkApplyConfiguration { + b.ensureObjectMetaApplyConfigurationExists() + if b.ObjectMetaApplyConfiguration.Labels == nil && len(entries) > 0 { + b.ObjectMetaApplyConfiguration.Labels = make(map[string]string, len(entries)) + } + for k, v := range entries { + b.ObjectMetaApplyConfiguration.Labels[k] = v + } + return b +} + +// WithAnnotations puts the entries into the Annotations field in the declarative configuration +// and returns the receiver, so that objects can be build by chaining "With" function invocations. +// If called multiple times, the entries provided by each call will be put on the Annotations field, +// overwriting an existing map entries in Annotations field with the same key. +func (b *TrunkApplyConfiguration) WithAnnotations(entries map[string]string) *TrunkApplyConfiguration { + b.ensureObjectMetaApplyConfigurationExists() + if b.ObjectMetaApplyConfiguration.Annotations == nil && len(entries) > 0 { + b.ObjectMetaApplyConfiguration.Annotations = make(map[string]string, len(entries)) + } + for k, v := range entries { + b.ObjectMetaApplyConfiguration.Annotations[k] = v + } + return b +} + +// WithOwnerReferences adds the given value to the OwnerReferences field in the declarative configuration +// and returns the receiver, so that objects can be build by chaining "With" function invocations. +// If called multiple times, values provided by each call will be appended to the OwnerReferences field. +func (b *TrunkApplyConfiguration) WithOwnerReferences(values ...*v1.OwnerReferenceApplyConfiguration) *TrunkApplyConfiguration { + b.ensureObjectMetaApplyConfigurationExists() + for i := range values { + if values[i] == nil { + panic("nil value passed to WithOwnerReferences") + } + b.ObjectMetaApplyConfiguration.OwnerReferences = append(b.ObjectMetaApplyConfiguration.OwnerReferences, *values[i]) + } + return b +} + +// WithFinalizers adds the given value to the Finalizers field in the declarative configuration +// and returns the receiver, so that objects can be build by chaining "With" function invocations. +// If called multiple times, values provided by each call will be appended to the Finalizers field. +func (b *TrunkApplyConfiguration) WithFinalizers(values ...string) *TrunkApplyConfiguration { + b.ensureObjectMetaApplyConfigurationExists() + for i := range values { + b.ObjectMetaApplyConfiguration.Finalizers = append(b.ObjectMetaApplyConfiguration.Finalizers, values[i]) + } + return b +} + +func (b *TrunkApplyConfiguration) ensureObjectMetaApplyConfigurationExists() { + if b.ObjectMetaApplyConfiguration == nil { + b.ObjectMetaApplyConfiguration = &v1.ObjectMetaApplyConfiguration{} + } +} + +// WithSpec sets the Spec field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Spec field is set to the value of the last call. +func (b *TrunkApplyConfiguration) WithSpec(value *TrunkSpecApplyConfiguration) *TrunkApplyConfiguration { + b.Spec = value + return b +} + +// WithStatus sets the Status field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Status field is set to the value of the last call. +func (b *TrunkApplyConfiguration) WithStatus(value *TrunkStatusApplyConfiguration) *TrunkApplyConfiguration { + b.Status = value + return b +} + +// GetKind retrieves the value of the Kind field in the declarative configuration. +func (b *TrunkApplyConfiguration) GetKind() *string { + return b.TypeMetaApplyConfiguration.Kind +} + +// GetAPIVersion retrieves the value of the APIVersion field in the declarative configuration. +func (b *TrunkApplyConfiguration) GetAPIVersion() *string { + return b.TypeMetaApplyConfiguration.APIVersion +} + +// GetName retrieves the value of the Name field in the declarative configuration. +func (b *TrunkApplyConfiguration) GetName() *string { + b.ensureObjectMetaApplyConfigurationExists() + return b.ObjectMetaApplyConfiguration.Name +} + +// GetNamespace retrieves the value of the Namespace field in the declarative configuration. +func (b *TrunkApplyConfiguration) GetNamespace() *string { + b.ensureObjectMetaApplyConfigurationExists() + return b.ObjectMetaApplyConfiguration.Namespace +} diff --git a/pkg/clients/applyconfiguration/api/v1alpha1/trunkfilter.go b/pkg/clients/applyconfiguration/api/v1alpha1/trunkfilter.go new file mode 100644 index 000000000..3b7021cee --- /dev/null +++ b/pkg/clients/applyconfiguration/api/v1alpha1/trunkfilter.go @@ -0,0 +1,129 @@ +/* +Copyright The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +// Code generated by applyconfiguration-gen. DO NOT EDIT. + +package v1alpha1 + +import ( + apiv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1" +) + +// TrunkFilterApplyConfiguration represents a declarative configuration of the TrunkFilter type for use +// with apply. +type TrunkFilterApplyConfiguration struct { + Name *apiv1alpha1.OpenStackName `json:"name,omitempty"` + Description *apiv1alpha1.NeutronDescription `json:"description,omitempty"` + PortRef *apiv1alpha1.KubernetesNameRef `json:"portRef,omitempty"` + ProjectRef *apiv1alpha1.KubernetesNameRef `json:"projectRef,omitempty"` + Status *string `json:"status,omitempty"` + AdminStateUp *bool `json:"adminStateUp,omitempty"` + FilterByNeutronTagsApplyConfiguration `json:",inline"` +} + +// TrunkFilterApplyConfiguration constructs a declarative configuration of the TrunkFilter type for use with +// apply. +func TrunkFilter() *TrunkFilterApplyConfiguration { + return &TrunkFilterApplyConfiguration{} +} + +// WithName sets the Name field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Name field is set to the value of the last call. +func (b *TrunkFilterApplyConfiguration) WithName(value apiv1alpha1.OpenStackName) *TrunkFilterApplyConfiguration { + b.Name = &value + return b +} + +// WithDescription sets the Description field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Description field is set to the value of the last call. +func (b *TrunkFilterApplyConfiguration) WithDescription(value apiv1alpha1.NeutronDescription) *TrunkFilterApplyConfiguration { + b.Description = &value + return b +} + +// WithPortRef sets the PortRef field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the PortRef field is set to the value of the last call. +func (b *TrunkFilterApplyConfiguration) WithPortRef(value apiv1alpha1.KubernetesNameRef) *TrunkFilterApplyConfiguration { + b.PortRef = &value + return b +} + +// WithProjectRef sets the ProjectRef field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the ProjectRef field is set to the value of the last call. +func (b *TrunkFilterApplyConfiguration) WithProjectRef(value apiv1alpha1.KubernetesNameRef) *TrunkFilterApplyConfiguration { + b.ProjectRef = &value + return b +} + +// WithStatus sets the Status field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Status field is set to the value of the last call. +func (b *TrunkFilterApplyConfiguration) WithStatus(value string) *TrunkFilterApplyConfiguration { + b.Status = &value + return b +} + +// WithAdminStateUp sets the AdminStateUp field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the AdminStateUp field is set to the value of the last call. +func (b *TrunkFilterApplyConfiguration) WithAdminStateUp(value bool) *TrunkFilterApplyConfiguration { + b.AdminStateUp = &value + return b +} + +// WithTags adds the given value to the Tags field in the declarative configuration +// and returns the receiver, so that objects can be build by chaining "With" function invocations. +// If called multiple times, values provided by each call will be appended to the Tags field. +func (b *TrunkFilterApplyConfiguration) WithTags(values ...apiv1alpha1.NeutronTag) *TrunkFilterApplyConfiguration { + for i := range values { + b.FilterByNeutronTagsApplyConfiguration.Tags = append(b.FilterByNeutronTagsApplyConfiguration.Tags, values[i]) + } + return b +} + +// WithTagsAny adds the given value to the TagsAny field in the declarative configuration +// and returns the receiver, so that objects can be build by chaining "With" function invocations. +// If called multiple times, values provided by each call will be appended to the TagsAny field. +func (b *TrunkFilterApplyConfiguration) WithTagsAny(values ...apiv1alpha1.NeutronTag) *TrunkFilterApplyConfiguration { + for i := range values { + b.FilterByNeutronTagsApplyConfiguration.TagsAny = append(b.FilterByNeutronTagsApplyConfiguration.TagsAny, values[i]) + } + return b +} + +// WithNotTags adds the given value to the NotTags field in the declarative configuration +// and returns the receiver, so that objects can be build by chaining "With" function invocations. +// If called multiple times, values provided by each call will be appended to the NotTags field. +func (b *TrunkFilterApplyConfiguration) WithNotTags(values ...apiv1alpha1.NeutronTag) *TrunkFilterApplyConfiguration { + for i := range values { + b.FilterByNeutronTagsApplyConfiguration.NotTags = append(b.FilterByNeutronTagsApplyConfiguration.NotTags, values[i]) + } + return b +} + +// WithNotTagsAny adds the given value to the NotTagsAny field in the declarative configuration +// and returns the receiver, so that objects can be build by chaining "With" function invocations. +// If called multiple times, values provided by each call will be appended to the NotTagsAny field. +func (b *TrunkFilterApplyConfiguration) WithNotTagsAny(values ...apiv1alpha1.NeutronTag) *TrunkFilterApplyConfiguration { + for i := range values { + b.FilterByNeutronTagsApplyConfiguration.NotTagsAny = append(b.FilterByNeutronTagsApplyConfiguration.NotTagsAny, values[i]) + } + return b +} diff --git a/pkg/clients/applyconfiguration/api/v1alpha1/trunkimport.go b/pkg/clients/applyconfiguration/api/v1alpha1/trunkimport.go new file mode 100644 index 000000000..960ff678d --- /dev/null +++ b/pkg/clients/applyconfiguration/api/v1alpha1/trunkimport.go @@ -0,0 +1,48 @@ +/* +Copyright The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +// Code generated by applyconfiguration-gen. DO NOT EDIT. + +package v1alpha1 + +// TrunkImportApplyConfiguration represents a declarative configuration of the TrunkImport type for use +// with apply. +type TrunkImportApplyConfiguration struct { + ID *string `json:"id,omitempty"` + Filter *TrunkFilterApplyConfiguration `json:"filter,omitempty"` +} + +// TrunkImportApplyConfiguration constructs a declarative configuration of the TrunkImport type for use with +// apply. +func TrunkImport() *TrunkImportApplyConfiguration { + return &TrunkImportApplyConfiguration{} +} + +// WithID sets the ID field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the ID field is set to the value of the last call. +func (b *TrunkImportApplyConfiguration) WithID(value string) *TrunkImportApplyConfiguration { + b.ID = &value + return b +} + +// WithFilter sets the Filter field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Filter field is set to the value of the last call. +func (b *TrunkImportApplyConfiguration) WithFilter(value *TrunkFilterApplyConfiguration) *TrunkImportApplyConfiguration { + b.Filter = value + return b +} diff --git a/pkg/clients/applyconfiguration/api/v1alpha1/trunkresourcespec.go b/pkg/clients/applyconfiguration/api/v1alpha1/trunkresourcespec.go new file mode 100644 index 000000000..5dbdf2846 --- /dev/null +++ b/pkg/clients/applyconfiguration/api/v1alpha1/trunkresourcespec.go @@ -0,0 +1,104 @@ +/* +Copyright The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +// Code generated by applyconfiguration-gen. DO NOT EDIT. + +package v1alpha1 + +import ( + apiv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1" +) + +// TrunkResourceSpecApplyConfiguration represents a declarative configuration of the TrunkResourceSpec type for use +// with apply. +type TrunkResourceSpecApplyConfiguration struct { + Name *apiv1alpha1.OpenStackName `json:"name,omitempty"` + Description *apiv1alpha1.NeutronDescription `json:"description,omitempty"` + PortRef *apiv1alpha1.KubernetesNameRef `json:"portRef,omitempty"` + ProjectRef *apiv1alpha1.KubernetesNameRef `json:"projectRef,omitempty"` + AdminStateUp *bool `json:"adminStateUp,omitempty"` + Subports []TrunkSubportSpecApplyConfiguration `json:"subports,omitempty"` + Tags []apiv1alpha1.NeutronTag `json:"tags,omitempty"` +} + +// TrunkResourceSpecApplyConfiguration constructs a declarative configuration of the TrunkResourceSpec type for use with +// apply. +func TrunkResourceSpec() *TrunkResourceSpecApplyConfiguration { + return &TrunkResourceSpecApplyConfiguration{} +} + +// WithName sets the Name field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Name field is set to the value of the last call. +func (b *TrunkResourceSpecApplyConfiguration) WithName(value apiv1alpha1.OpenStackName) *TrunkResourceSpecApplyConfiguration { + b.Name = &value + return b +} + +// WithDescription sets the Description field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Description field is set to the value of the last call. +func (b *TrunkResourceSpecApplyConfiguration) WithDescription(value apiv1alpha1.NeutronDescription) *TrunkResourceSpecApplyConfiguration { + b.Description = &value + return b +} + +// WithPortRef sets the PortRef field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the PortRef field is set to the value of the last call. +func (b *TrunkResourceSpecApplyConfiguration) WithPortRef(value apiv1alpha1.KubernetesNameRef) *TrunkResourceSpecApplyConfiguration { + b.PortRef = &value + return b +} + +// WithProjectRef sets the ProjectRef field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the ProjectRef field is set to the value of the last call. +func (b *TrunkResourceSpecApplyConfiguration) WithProjectRef(value apiv1alpha1.KubernetesNameRef) *TrunkResourceSpecApplyConfiguration { + b.ProjectRef = &value + return b +} + +// WithAdminStateUp sets the AdminStateUp field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the AdminStateUp field is set to the value of the last call. +func (b *TrunkResourceSpecApplyConfiguration) WithAdminStateUp(value bool) *TrunkResourceSpecApplyConfiguration { + b.AdminStateUp = &value + return b +} + +// WithSubports adds the given value to the Subports field in the declarative configuration +// and returns the receiver, so that objects can be build by chaining "With" function invocations. +// If called multiple times, values provided by each call will be appended to the Subports field. +func (b *TrunkResourceSpecApplyConfiguration) WithSubports(values ...*TrunkSubportSpecApplyConfiguration) *TrunkResourceSpecApplyConfiguration { + for i := range values { + if values[i] == nil { + panic("nil value passed to WithSubports") + } + b.Subports = append(b.Subports, *values[i]) + } + return b +} + +// WithTags adds the given value to the Tags field in the declarative configuration +// and returns the receiver, so that objects can be build by chaining "With" function invocations. +// If called multiple times, values provided by each call will be appended to the Tags field. +func (b *TrunkResourceSpecApplyConfiguration) WithTags(values ...apiv1alpha1.NeutronTag) *TrunkResourceSpecApplyConfiguration { + for i := range values { + b.Tags = append(b.Tags, values[i]) + } + return b +} diff --git a/pkg/clients/applyconfiguration/api/v1alpha1/trunkresourcestatus.go b/pkg/clients/applyconfiguration/api/v1alpha1/trunkresourcestatus.go new file mode 100644 index 000000000..1904b9fa4 --- /dev/null +++ b/pkg/clients/applyconfiguration/api/v1alpha1/trunkresourcestatus.go @@ -0,0 +1,147 @@ +/* +Copyright The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +// Code generated by applyconfiguration-gen. DO NOT EDIT. + +package v1alpha1 + +import ( + v1 "k8s.io/apimachinery/pkg/apis/meta/v1" +) + +// TrunkResourceStatusApplyConfiguration represents a declarative configuration of the TrunkResourceStatus type for use +// with apply. +type TrunkResourceStatusApplyConfiguration struct { + Name *string `json:"name,omitempty"` + Description *string `json:"description,omitempty"` + PortID *string `json:"portID,omitempty"` + ProjectID *string `json:"projectID,omitempty"` + TenantID *string `json:"tenantID,omitempty"` + Status *string `json:"status,omitempty"` + Tags []string `json:"tags,omitempty"` + NeutronStatusMetadataApplyConfiguration `json:",inline"` + AdminStateUp *bool `json:"adminStateUp,omitempty"` + Subports []TrunkSubportStatusApplyConfiguration `json:"subports,omitempty"` +} + +// TrunkResourceStatusApplyConfiguration constructs a declarative configuration of the TrunkResourceStatus type for use with +// apply. +func TrunkResourceStatus() *TrunkResourceStatusApplyConfiguration { + return &TrunkResourceStatusApplyConfiguration{} +} + +// WithName sets the Name field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Name field is set to the value of the last call. +func (b *TrunkResourceStatusApplyConfiguration) WithName(value string) *TrunkResourceStatusApplyConfiguration { + b.Name = &value + return b +} + +// WithDescription sets the Description field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Description field is set to the value of the last call. +func (b *TrunkResourceStatusApplyConfiguration) WithDescription(value string) *TrunkResourceStatusApplyConfiguration { + b.Description = &value + return b +} + +// WithPortID sets the PortID field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the PortID field is set to the value of the last call. +func (b *TrunkResourceStatusApplyConfiguration) WithPortID(value string) *TrunkResourceStatusApplyConfiguration { + b.PortID = &value + return b +} + +// WithProjectID sets the ProjectID field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the ProjectID field is set to the value of the last call. +func (b *TrunkResourceStatusApplyConfiguration) WithProjectID(value string) *TrunkResourceStatusApplyConfiguration { + b.ProjectID = &value + return b +} + +// WithTenantID sets the TenantID field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the TenantID field is set to the value of the last call. +func (b *TrunkResourceStatusApplyConfiguration) WithTenantID(value string) *TrunkResourceStatusApplyConfiguration { + b.TenantID = &value + return b +} + +// WithStatus sets the Status field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Status field is set to the value of the last call. +func (b *TrunkResourceStatusApplyConfiguration) WithStatus(value string) *TrunkResourceStatusApplyConfiguration { + b.Status = &value + return b +} + +// WithTags adds the given value to the Tags field in the declarative configuration +// and returns the receiver, so that objects can be build by chaining "With" function invocations. +// If called multiple times, values provided by each call will be appended to the Tags field. +func (b *TrunkResourceStatusApplyConfiguration) WithTags(values ...string) *TrunkResourceStatusApplyConfiguration { + for i := range values { + b.Tags = append(b.Tags, values[i]) + } + return b +} + +// WithCreatedAt sets the CreatedAt field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the CreatedAt field is set to the value of the last call. +func (b *TrunkResourceStatusApplyConfiguration) WithCreatedAt(value v1.Time) *TrunkResourceStatusApplyConfiguration { + b.NeutronStatusMetadataApplyConfiguration.CreatedAt = &value + return b +} + +// WithUpdatedAt sets the UpdatedAt field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the UpdatedAt field is set to the value of the last call. +func (b *TrunkResourceStatusApplyConfiguration) WithUpdatedAt(value v1.Time) *TrunkResourceStatusApplyConfiguration { + b.NeutronStatusMetadataApplyConfiguration.UpdatedAt = &value + return b +} + +// WithRevisionNumber sets the RevisionNumber field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the RevisionNumber field is set to the value of the last call. +func (b *TrunkResourceStatusApplyConfiguration) WithRevisionNumber(value int64) *TrunkResourceStatusApplyConfiguration { + b.NeutronStatusMetadataApplyConfiguration.RevisionNumber = &value + return b +} + +// WithAdminStateUp sets the AdminStateUp field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the AdminStateUp field is set to the value of the last call. +func (b *TrunkResourceStatusApplyConfiguration) WithAdminStateUp(value bool) *TrunkResourceStatusApplyConfiguration { + b.AdminStateUp = &value + return b +} + +// WithSubports adds the given value to the Subports field in the declarative configuration +// and returns the receiver, so that objects can be build by chaining "With" function invocations. +// If called multiple times, values provided by each call will be appended to the Subports field. +func (b *TrunkResourceStatusApplyConfiguration) WithSubports(values ...*TrunkSubportStatusApplyConfiguration) *TrunkResourceStatusApplyConfiguration { + for i := range values { + if values[i] == nil { + panic("nil value passed to WithSubports") + } + b.Subports = append(b.Subports, *values[i]) + } + return b +} diff --git a/pkg/clients/applyconfiguration/api/v1alpha1/trunkspec.go b/pkg/clients/applyconfiguration/api/v1alpha1/trunkspec.go new file mode 100644 index 000000000..c744fe03f --- /dev/null +++ b/pkg/clients/applyconfiguration/api/v1alpha1/trunkspec.go @@ -0,0 +1,79 @@ +/* +Copyright The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +// Code generated by applyconfiguration-gen. DO NOT EDIT. + +package v1alpha1 + +import ( + apiv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1" +) + +// TrunkSpecApplyConfiguration represents a declarative configuration of the TrunkSpec type for use +// with apply. +type TrunkSpecApplyConfiguration struct { + Import *TrunkImportApplyConfiguration `json:"import,omitempty"` + Resource *TrunkResourceSpecApplyConfiguration `json:"resource,omitempty"` + ManagementPolicy *apiv1alpha1.ManagementPolicy `json:"managementPolicy,omitempty"` + ManagedOptions *ManagedOptionsApplyConfiguration `json:"managedOptions,omitempty"` + CloudCredentialsRef *CloudCredentialsReferenceApplyConfiguration `json:"cloudCredentialsRef,omitempty"` +} + +// TrunkSpecApplyConfiguration constructs a declarative configuration of the TrunkSpec type for use with +// apply. +func TrunkSpec() *TrunkSpecApplyConfiguration { + return &TrunkSpecApplyConfiguration{} +} + +// WithImport sets the Import field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Import field is set to the value of the last call. +func (b *TrunkSpecApplyConfiguration) WithImport(value *TrunkImportApplyConfiguration) *TrunkSpecApplyConfiguration { + b.Import = value + return b +} + +// WithResource sets the Resource field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Resource field is set to the value of the last call. +func (b *TrunkSpecApplyConfiguration) WithResource(value *TrunkResourceSpecApplyConfiguration) *TrunkSpecApplyConfiguration { + b.Resource = value + return b +} + +// WithManagementPolicy sets the ManagementPolicy field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the ManagementPolicy field is set to the value of the last call. +func (b *TrunkSpecApplyConfiguration) WithManagementPolicy(value apiv1alpha1.ManagementPolicy) *TrunkSpecApplyConfiguration { + b.ManagementPolicy = &value + return b +} + +// WithManagedOptions sets the ManagedOptions field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the ManagedOptions field is set to the value of the last call. +func (b *TrunkSpecApplyConfiguration) WithManagedOptions(value *ManagedOptionsApplyConfiguration) *TrunkSpecApplyConfiguration { + b.ManagedOptions = value + return b +} + +// WithCloudCredentialsRef sets the CloudCredentialsRef field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the CloudCredentialsRef field is set to the value of the last call. +func (b *TrunkSpecApplyConfiguration) WithCloudCredentialsRef(value *CloudCredentialsReferenceApplyConfiguration) *TrunkSpecApplyConfiguration { + b.CloudCredentialsRef = value + return b +} diff --git a/pkg/clients/applyconfiguration/api/v1alpha1/trunkstatus.go b/pkg/clients/applyconfiguration/api/v1alpha1/trunkstatus.go new file mode 100644 index 000000000..ffd42aeb8 --- /dev/null +++ b/pkg/clients/applyconfiguration/api/v1alpha1/trunkstatus.go @@ -0,0 +1,66 @@ +/* +Copyright The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +// Code generated by applyconfiguration-gen. DO NOT EDIT. + +package v1alpha1 + +import ( + v1 "k8s.io/client-go/applyconfigurations/meta/v1" +) + +// TrunkStatusApplyConfiguration represents a declarative configuration of the TrunkStatus type for use +// with apply. +type TrunkStatusApplyConfiguration struct { + Conditions []v1.ConditionApplyConfiguration `json:"conditions,omitempty"` + ID *string `json:"id,omitempty"` + Resource *TrunkResourceStatusApplyConfiguration `json:"resource,omitempty"` +} + +// TrunkStatusApplyConfiguration constructs a declarative configuration of the TrunkStatus type for use with +// apply. +func TrunkStatus() *TrunkStatusApplyConfiguration { + return &TrunkStatusApplyConfiguration{} +} + +// WithConditions adds the given value to the Conditions field in the declarative configuration +// and returns the receiver, so that objects can be build by chaining "With" function invocations. +// If called multiple times, values provided by each call will be appended to the Conditions field. +func (b *TrunkStatusApplyConfiguration) WithConditions(values ...*v1.ConditionApplyConfiguration) *TrunkStatusApplyConfiguration { + for i := range values { + if values[i] == nil { + panic("nil value passed to WithConditions") + } + b.Conditions = append(b.Conditions, *values[i]) + } + return b +} + +// WithID sets the ID field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the ID field is set to the value of the last call. +func (b *TrunkStatusApplyConfiguration) WithID(value string) *TrunkStatusApplyConfiguration { + b.ID = &value + return b +} + +// WithResource sets the Resource field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Resource field is set to the value of the last call. +func (b *TrunkStatusApplyConfiguration) WithResource(value *TrunkResourceStatusApplyConfiguration) *TrunkStatusApplyConfiguration { + b.Resource = value + return b +} diff --git a/pkg/clients/applyconfiguration/api/v1alpha1/trunksubportspec.go b/pkg/clients/applyconfiguration/api/v1alpha1/trunksubportspec.go new file mode 100644 index 000000000..16625b28b --- /dev/null +++ b/pkg/clients/applyconfiguration/api/v1alpha1/trunksubportspec.go @@ -0,0 +1,61 @@ +/* +Copyright The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +// Code generated by applyconfiguration-gen. DO NOT EDIT. + +package v1alpha1 + +import ( + apiv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1" +) + +// TrunkSubportSpecApplyConfiguration represents a declarative configuration of the TrunkSubportSpec type for use +// with apply. +type TrunkSubportSpecApplyConfiguration struct { + PortRef *apiv1alpha1.KubernetesNameRef `json:"portRef,omitempty"` + SegmentationID *int32 `json:"segmentationID,omitempty"` + SegmentationType *string `json:"segmentationType,omitempty"` +} + +// TrunkSubportSpecApplyConfiguration constructs a declarative configuration of the TrunkSubportSpec type for use with +// apply. +func TrunkSubportSpec() *TrunkSubportSpecApplyConfiguration { + return &TrunkSubportSpecApplyConfiguration{} +} + +// WithPortRef sets the PortRef field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the PortRef field is set to the value of the last call. +func (b *TrunkSubportSpecApplyConfiguration) WithPortRef(value apiv1alpha1.KubernetesNameRef) *TrunkSubportSpecApplyConfiguration { + b.PortRef = &value + return b +} + +// WithSegmentationID sets the SegmentationID field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the SegmentationID field is set to the value of the last call. +func (b *TrunkSubportSpecApplyConfiguration) WithSegmentationID(value int32) *TrunkSubportSpecApplyConfiguration { + b.SegmentationID = &value + return b +} + +// WithSegmentationType sets the SegmentationType field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the SegmentationType field is set to the value of the last call. +func (b *TrunkSubportSpecApplyConfiguration) WithSegmentationType(value string) *TrunkSubportSpecApplyConfiguration { + b.SegmentationType = &value + return b +} diff --git a/pkg/clients/applyconfiguration/api/v1alpha1/trunksubportstatus.go b/pkg/clients/applyconfiguration/api/v1alpha1/trunksubportstatus.go new file mode 100644 index 000000000..b782fa334 --- /dev/null +++ b/pkg/clients/applyconfiguration/api/v1alpha1/trunksubportstatus.go @@ -0,0 +1,57 @@ +/* +Copyright The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +// Code generated by applyconfiguration-gen. DO NOT EDIT. + +package v1alpha1 + +// TrunkSubportStatusApplyConfiguration represents a declarative configuration of the TrunkSubportStatus type for use +// with apply. +type TrunkSubportStatusApplyConfiguration struct { + PortID *string `json:"portID,omitempty"` + SegmentationID *int32 `json:"segmentationID,omitempty"` + SegmentationType *string `json:"segmentationType,omitempty"` +} + +// TrunkSubportStatusApplyConfiguration constructs a declarative configuration of the TrunkSubportStatus type for use with +// apply. +func TrunkSubportStatus() *TrunkSubportStatusApplyConfiguration { + return &TrunkSubportStatusApplyConfiguration{} +} + +// WithPortID sets the PortID field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the PortID field is set to the value of the last call. +func (b *TrunkSubportStatusApplyConfiguration) WithPortID(value string) *TrunkSubportStatusApplyConfiguration { + b.PortID = &value + return b +} + +// WithSegmentationID sets the SegmentationID field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the SegmentationID field is set to the value of the last call. +func (b *TrunkSubportStatusApplyConfiguration) WithSegmentationID(value int32) *TrunkSubportStatusApplyConfiguration { + b.SegmentationID = &value + return b +} + +// WithSegmentationType sets the SegmentationType field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the SegmentationType field is set to the value of the last call. +func (b *TrunkSubportStatusApplyConfiguration) WithSegmentationType(value string) *TrunkSubportStatusApplyConfiguration { + b.SegmentationType = &value + return b +} diff --git a/pkg/clients/applyconfiguration/internal/internal.go b/pkg/clients/applyconfiguration/internal/internal.go index 6a989754e..030d36692 100644 --- a/pkg/clients/applyconfiguration/internal/internal.go +++ b/pkg/clients/applyconfiguration/internal/internal.go @@ -2861,6 +2861,216 @@ var schemaYAML = typed.YAMLObject(`types: - name: resource type: namedType: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.SubnetResourceStatus +- name: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.Trunk + map: + fields: + - name: apiVersion + type: + scalar: string + - name: kind + type: + scalar: string + - name: metadata + type: + namedType: io.k8s.apimachinery.pkg.apis.meta.v1.ObjectMeta + default: {} + - name: spec + type: + namedType: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.TrunkSpec + default: {} + - name: status + type: + namedType: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.TrunkStatus + default: {} +- name: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.TrunkFilter + map: + fields: + - name: adminStateUp + type: + scalar: boolean + - name: description + type: + scalar: string + - name: name + type: + scalar: string + - name: notTags + type: + list: + elementType: + scalar: string + elementRelationship: associative + - name: notTagsAny + type: + list: + elementType: + scalar: string + elementRelationship: associative + - name: portRef + type: + scalar: string + - name: projectRef + type: + scalar: string + - name: status + type: + scalar: string + - name: tags + type: + list: + elementType: + scalar: string + elementRelationship: associative + - name: tagsAny + type: + list: + elementType: + scalar: string + elementRelationship: associative +- name: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.TrunkImport + map: + fields: + - name: filter + type: + namedType: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.TrunkFilter + - name: id + type: + scalar: string +- name: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.TrunkResourceSpec + map: + fields: + - name: adminStateUp + type: + scalar: boolean + - name: description + type: + scalar: string + - name: name + type: + scalar: string + - name: portRef + type: + scalar: string + - name: projectRef + type: + scalar: string + - name: subports + type: + list: + elementType: + namedType: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.TrunkSubportSpec + elementRelationship: atomic + - name: tags + type: + list: + elementType: + scalar: string + elementRelationship: associative +- name: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.TrunkResourceStatus + map: + fields: + - name: adminStateUp + type: + scalar: boolean + - name: createdAt + type: + namedType: io.k8s.apimachinery.pkg.apis.meta.v1.Time + - name: description + type: + scalar: string + - name: name + type: + scalar: string + - name: portID + type: + scalar: string + - name: projectID + type: + scalar: string + - name: revisionNumber + type: + scalar: numeric + - name: status + type: + scalar: string + - name: subports + type: + list: + elementType: + namedType: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.TrunkSubportStatus + elementRelationship: atomic + - name: tags + type: + list: + elementType: + scalar: string + elementRelationship: atomic + - name: tenantID + type: + scalar: string + - name: updatedAt + type: + namedType: io.k8s.apimachinery.pkg.apis.meta.v1.Time +- name: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.TrunkSpec + map: + fields: + - name: cloudCredentialsRef + type: + namedType: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.CloudCredentialsReference + default: {} + - name: import + type: + namedType: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.TrunkImport + - name: managedOptions + type: + namedType: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.ManagedOptions + - name: managementPolicy + type: + scalar: string + - name: resource + type: + namedType: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.TrunkResourceSpec +- name: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.TrunkStatus + map: + fields: + - name: conditions + type: + list: + elementType: + namedType: io.k8s.apimachinery.pkg.apis.meta.v1.Condition + elementRelationship: associative + keys: + - type + - name: id + type: + scalar: string + - name: resource + type: + namedType: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.TrunkResourceStatus +- name: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.TrunkSubportSpec + map: + fields: + - name: portRef + type: + scalar: string + - name: segmentationID + type: + scalar: numeric + - name: segmentationType + type: + scalar: string +- name: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.TrunkSubportStatus + map: + fields: + - name: portID + type: + scalar: string + - name: segmentationID + type: + scalar: numeric + - name: segmentationType + type: + scalar: string - name: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.UserDataSpec map: fields: diff --git a/pkg/clients/applyconfiguration/utils.go b/pkg/clients/applyconfiguration/utils.go index 478b73a00..f3e7ece4e 100644 --- a/pkg/clients/applyconfiguration/utils.go +++ b/pkg/clients/applyconfiguration/utils.go @@ -336,6 +336,24 @@ func ForKind(kind schema.GroupVersionKind) interface{} { return &apiv1alpha1.SubnetSpecApplyConfiguration{} case v1alpha1.SchemeGroupVersion.WithKind("SubnetStatus"): return &apiv1alpha1.SubnetStatusApplyConfiguration{} + case v1alpha1.SchemeGroupVersion.WithKind("Trunk"): + return &apiv1alpha1.TrunkApplyConfiguration{} + case v1alpha1.SchemeGroupVersion.WithKind("TrunkFilter"): + return &apiv1alpha1.TrunkFilterApplyConfiguration{} + case v1alpha1.SchemeGroupVersion.WithKind("TrunkImport"): + return &apiv1alpha1.TrunkImportApplyConfiguration{} + case v1alpha1.SchemeGroupVersion.WithKind("TrunkResourceSpec"): + return &apiv1alpha1.TrunkResourceSpecApplyConfiguration{} + case v1alpha1.SchemeGroupVersion.WithKind("TrunkResourceStatus"): + return &apiv1alpha1.TrunkResourceStatusApplyConfiguration{} + case v1alpha1.SchemeGroupVersion.WithKind("TrunkSpec"): + return &apiv1alpha1.TrunkSpecApplyConfiguration{} + case v1alpha1.SchemeGroupVersion.WithKind("TrunkStatus"): + return &apiv1alpha1.TrunkStatusApplyConfiguration{} + case v1alpha1.SchemeGroupVersion.WithKind("TrunkSubportSpec"): + return &apiv1alpha1.TrunkSubportSpecApplyConfiguration{} + case v1alpha1.SchemeGroupVersion.WithKind("TrunkSubportStatus"): + return &apiv1alpha1.TrunkSubportStatusApplyConfiguration{} case v1alpha1.SchemeGroupVersion.WithKind("UserDataSpec"): return &apiv1alpha1.UserDataSpecApplyConfiguration{} case v1alpha1.SchemeGroupVersion.WithKind("Volume"): diff --git a/pkg/clients/clientset/clientset/typed/api/v1alpha1/api_client.go b/pkg/clients/clientset/clientset/typed/api/v1alpha1/api_client.go index 4317c8aa6..91ee2fdb4 100644 --- a/pkg/clients/clientset/clientset/typed/api/v1alpha1/api_client.go +++ b/pkg/clients/clientset/clientset/typed/api/v1alpha1/api_client.go @@ -45,6 +45,7 @@ type OpenstackV1alpha1Interface interface { ServerGroupsGetter ServicesGetter SubnetsGetter + TrunksGetter VolumesGetter VolumeTypesGetter } @@ -122,6 +123,10 @@ func (c *OpenstackV1alpha1Client) Subnets(namespace string) SubnetInterface { return newSubnets(c, namespace) } +func (c *OpenstackV1alpha1Client) Trunks(namespace string) TrunkInterface { + return newTrunks(c, namespace) +} + func (c *OpenstackV1alpha1Client) Volumes(namespace string) VolumeInterface { return newVolumes(c, namespace) } diff --git a/pkg/clients/clientset/clientset/typed/api/v1alpha1/fake/fake_api_client.go b/pkg/clients/clientset/clientset/typed/api/v1alpha1/fake/fake_api_client.go index 595446f05..81e95d4c9 100644 --- a/pkg/clients/clientset/clientset/typed/api/v1alpha1/fake/fake_api_client.go +++ b/pkg/clients/clientset/clientset/typed/api/v1alpha1/fake/fake_api_client.go @@ -96,6 +96,10 @@ func (c *FakeOpenstackV1alpha1) Subnets(namespace string) v1alpha1.SubnetInterfa return newFakeSubnets(c, namespace) } +func (c *FakeOpenstackV1alpha1) Trunks(namespace string) v1alpha1.TrunkInterface { + return newFakeTrunks(c, namespace) +} + func (c *FakeOpenstackV1alpha1) Volumes(namespace string) v1alpha1.VolumeInterface { return newFakeVolumes(c, namespace) } diff --git a/pkg/clients/clientset/clientset/typed/api/v1alpha1/fake/fake_trunk.go b/pkg/clients/clientset/clientset/typed/api/v1alpha1/fake/fake_trunk.go new file mode 100644 index 000000000..bc58f0e4d --- /dev/null +++ b/pkg/clients/clientset/clientset/typed/api/v1alpha1/fake/fake_trunk.go @@ -0,0 +1,49 @@ +/* +Copyright The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +// Code generated by client-gen. DO NOT EDIT. + +package fake + +import ( + v1alpha1 "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1" + apiv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/pkg/clients/applyconfiguration/api/v1alpha1" + typedapiv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/pkg/clients/clientset/clientset/typed/api/v1alpha1" + gentype "k8s.io/client-go/gentype" +) + +// fakeTrunks implements TrunkInterface +type fakeTrunks struct { + *gentype.FakeClientWithListAndApply[*v1alpha1.Trunk, *v1alpha1.TrunkList, *apiv1alpha1.TrunkApplyConfiguration] + Fake *FakeOpenstackV1alpha1 +} + +func newFakeTrunks(fake *FakeOpenstackV1alpha1, namespace string) typedapiv1alpha1.TrunkInterface { + return &fakeTrunks{ + gentype.NewFakeClientWithListAndApply[*v1alpha1.Trunk, *v1alpha1.TrunkList, *apiv1alpha1.TrunkApplyConfiguration]( + fake.Fake, + namespace, + v1alpha1.SchemeGroupVersion.WithResource("trunks"), + v1alpha1.SchemeGroupVersion.WithKind("Trunk"), + func() *v1alpha1.Trunk { return &v1alpha1.Trunk{} }, + func() *v1alpha1.TrunkList { return &v1alpha1.TrunkList{} }, + func(dst, src *v1alpha1.TrunkList) { dst.ListMeta = src.ListMeta }, + func(list *v1alpha1.TrunkList) []*v1alpha1.Trunk { return gentype.ToPointerSlice(list.Items) }, + func(list *v1alpha1.TrunkList, items []*v1alpha1.Trunk) { list.Items = gentype.FromPointerSlice(items) }, + ), + fake, + } +} diff --git a/pkg/clients/clientset/clientset/typed/api/v1alpha1/generated_expansion.go b/pkg/clients/clientset/clientset/typed/api/v1alpha1/generated_expansion.go index 558e399d0..ca41372ee 100644 --- a/pkg/clients/clientset/clientset/typed/api/v1alpha1/generated_expansion.go +++ b/pkg/clients/clientset/clientset/typed/api/v1alpha1/generated_expansion.go @@ -52,6 +52,8 @@ type ServiceExpansion interface{} type SubnetExpansion interface{} +type TrunkExpansion interface{} + type VolumeExpansion interface{} type VolumeTypeExpansion interface{} diff --git a/pkg/clients/clientset/clientset/typed/api/v1alpha1/trunk.go b/pkg/clients/clientset/clientset/typed/api/v1alpha1/trunk.go new file mode 100644 index 000000000..0a2dd9152 --- /dev/null +++ b/pkg/clients/clientset/clientset/typed/api/v1alpha1/trunk.go @@ -0,0 +1,74 @@ +/* +Copyright The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +// Code generated by client-gen. DO NOT EDIT. + +package v1alpha1 + +import ( + context "context" + + apiv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1" + applyconfigurationapiv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/pkg/clients/applyconfiguration/api/v1alpha1" + scheme "github.com/k-orc/openstack-resource-controller/v2/pkg/clients/clientset/clientset/scheme" + v1 "k8s.io/apimachinery/pkg/apis/meta/v1" + types "k8s.io/apimachinery/pkg/types" + watch "k8s.io/apimachinery/pkg/watch" + gentype "k8s.io/client-go/gentype" +) + +// TrunksGetter has a method to return a TrunkInterface. +// A group's client should implement this interface. +type TrunksGetter interface { + Trunks(namespace string) TrunkInterface +} + +// TrunkInterface has methods to work with Trunk resources. +type TrunkInterface interface { + Create(ctx context.Context, trunk *apiv1alpha1.Trunk, opts v1.CreateOptions) (*apiv1alpha1.Trunk, error) + Update(ctx context.Context, trunk *apiv1alpha1.Trunk, opts v1.UpdateOptions) (*apiv1alpha1.Trunk, error) + // Add a +genclient:noStatus comment above the type to avoid generating UpdateStatus(). + UpdateStatus(ctx context.Context, trunk *apiv1alpha1.Trunk, opts v1.UpdateOptions) (*apiv1alpha1.Trunk, error) + Delete(ctx context.Context, name string, opts v1.DeleteOptions) error + DeleteCollection(ctx context.Context, opts v1.DeleteOptions, listOpts v1.ListOptions) error + Get(ctx context.Context, name string, opts v1.GetOptions) (*apiv1alpha1.Trunk, error) + List(ctx context.Context, opts v1.ListOptions) (*apiv1alpha1.TrunkList, error) + Watch(ctx context.Context, opts v1.ListOptions) (watch.Interface, error) + Patch(ctx context.Context, name string, pt types.PatchType, data []byte, opts v1.PatchOptions, subresources ...string) (result *apiv1alpha1.Trunk, err error) + Apply(ctx context.Context, trunk *applyconfigurationapiv1alpha1.TrunkApplyConfiguration, opts v1.ApplyOptions) (result *apiv1alpha1.Trunk, err error) + // Add a +genclient:noStatus comment above the type to avoid generating ApplyStatus(). + ApplyStatus(ctx context.Context, trunk *applyconfigurationapiv1alpha1.TrunkApplyConfiguration, opts v1.ApplyOptions) (result *apiv1alpha1.Trunk, err error) + TrunkExpansion +} + +// trunks implements TrunkInterface +type trunks struct { + *gentype.ClientWithListAndApply[*apiv1alpha1.Trunk, *apiv1alpha1.TrunkList, *applyconfigurationapiv1alpha1.TrunkApplyConfiguration] +} + +// newTrunks returns a Trunks +func newTrunks(c *OpenstackV1alpha1Client, namespace string) *trunks { + return &trunks{ + gentype.NewClientWithListAndApply[*apiv1alpha1.Trunk, *apiv1alpha1.TrunkList, *applyconfigurationapiv1alpha1.TrunkApplyConfiguration]( + "trunks", + c.RESTClient(), + scheme.ParameterCodec, + namespace, + func() *apiv1alpha1.Trunk { return &apiv1alpha1.Trunk{} }, + func() *apiv1alpha1.TrunkList { return &apiv1alpha1.TrunkList{} }, + ), + } +} diff --git a/pkg/clients/informers/externalversions/api/v1alpha1/interface.go b/pkg/clients/informers/externalversions/api/v1alpha1/interface.go index 2e06781ab..28e76d19c 100644 --- a/pkg/clients/informers/externalversions/api/v1alpha1/interface.go +++ b/pkg/clients/informers/externalversions/api/v1alpha1/interface.go @@ -58,6 +58,8 @@ type Interface interface { Services() ServiceInformer // Subnets returns a SubnetInformer. Subnets() SubnetInformer + // Trunks returns a TrunkInformer. + Trunks() TrunkInformer // Volumes returns a VolumeInformer. Volumes() VolumeInformer // VolumeTypes returns a VolumeTypeInformer. @@ -160,6 +162,11 @@ func (v *version) Subnets() SubnetInformer { return &subnetInformer{factory: v.factory, namespace: v.namespace, tweakListOptions: v.tweakListOptions} } +// Trunks returns a TrunkInformer. +func (v *version) Trunks() TrunkInformer { + return &trunkInformer{factory: v.factory, namespace: v.namespace, tweakListOptions: v.tweakListOptions} +} + // Volumes returns a VolumeInformer. func (v *version) Volumes() VolumeInformer { return &volumeInformer{factory: v.factory, namespace: v.namespace, tweakListOptions: v.tweakListOptions} diff --git a/pkg/clients/informers/externalversions/api/v1alpha1/trunk.go b/pkg/clients/informers/externalversions/api/v1alpha1/trunk.go new file mode 100644 index 000000000..0f3eea4fd --- /dev/null +++ b/pkg/clients/informers/externalversions/api/v1alpha1/trunk.go @@ -0,0 +1,102 @@ +/* +Copyright The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +// Code generated by informer-gen. DO NOT EDIT. + +package v1alpha1 + +import ( + context "context" + time "time" + + v2apiv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1" + clientset "github.com/k-orc/openstack-resource-controller/v2/pkg/clients/clientset/clientset" + internalinterfaces "github.com/k-orc/openstack-resource-controller/v2/pkg/clients/informers/externalversions/internalinterfaces" + apiv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/pkg/clients/listers/api/v1alpha1" + v1 "k8s.io/apimachinery/pkg/apis/meta/v1" + runtime "k8s.io/apimachinery/pkg/runtime" + watch "k8s.io/apimachinery/pkg/watch" + cache "k8s.io/client-go/tools/cache" +) + +// TrunkInformer provides access to a shared informer and lister for +// Trunks. +type TrunkInformer interface { + Informer() cache.SharedIndexInformer + Lister() apiv1alpha1.TrunkLister +} + +type trunkInformer struct { + factory internalinterfaces.SharedInformerFactory + tweakListOptions internalinterfaces.TweakListOptionsFunc + namespace string +} + +// NewTrunkInformer constructs a new informer for Trunk type. +// Always prefer using an informer factory to get a shared informer instead of getting an independent +// one. This reduces memory footprint and number of connections to the server. +func NewTrunkInformer(client clientset.Interface, namespace string, resyncPeriod time.Duration, indexers cache.Indexers) cache.SharedIndexInformer { + return NewFilteredTrunkInformer(client, namespace, resyncPeriod, indexers, nil) +} + +// NewFilteredTrunkInformer constructs a new informer for Trunk type. +// Always prefer using an informer factory to get a shared informer instead of getting an independent +// one. This reduces memory footprint and number of connections to the server. +func NewFilteredTrunkInformer(client clientset.Interface, namespace string, resyncPeriod time.Duration, indexers cache.Indexers, tweakListOptions internalinterfaces.TweakListOptionsFunc) cache.SharedIndexInformer { + return cache.NewSharedIndexInformer( + &cache.ListWatch{ + ListFunc: func(options v1.ListOptions) (runtime.Object, error) { + if tweakListOptions != nil { + tweakListOptions(&options) + } + return client.OpenstackV1alpha1().Trunks(namespace).List(context.Background(), options) + }, + WatchFunc: func(options v1.ListOptions) (watch.Interface, error) { + if tweakListOptions != nil { + tweakListOptions(&options) + } + return client.OpenstackV1alpha1().Trunks(namespace).Watch(context.Background(), options) + }, + ListWithContextFunc: func(ctx context.Context, options v1.ListOptions) (runtime.Object, error) { + if tweakListOptions != nil { + tweakListOptions(&options) + } + return client.OpenstackV1alpha1().Trunks(namespace).List(ctx, options) + }, + WatchFuncWithContext: func(ctx context.Context, options v1.ListOptions) (watch.Interface, error) { + if tweakListOptions != nil { + tweakListOptions(&options) + } + return client.OpenstackV1alpha1().Trunks(namespace).Watch(ctx, options) + }, + }, + &v2apiv1alpha1.Trunk{}, + resyncPeriod, + indexers, + ) +} + +func (f *trunkInformer) defaultInformer(client clientset.Interface, resyncPeriod time.Duration) cache.SharedIndexInformer { + return NewFilteredTrunkInformer(client, f.namespace, resyncPeriod, cache.Indexers{cache.NamespaceIndex: cache.MetaNamespaceIndexFunc}, f.tweakListOptions) +} + +func (f *trunkInformer) Informer() cache.SharedIndexInformer { + return f.factory.InformerFor(&v2apiv1alpha1.Trunk{}, f.defaultInformer) +} + +func (f *trunkInformer) Lister() apiv1alpha1.TrunkLister { + return apiv1alpha1.NewTrunkLister(f.Informer().GetIndexer()) +} diff --git a/pkg/clients/informers/externalversions/generic.go b/pkg/clients/informers/externalversions/generic.go index 1bb2313e0..f83a355c4 100644 --- a/pkg/clients/informers/externalversions/generic.go +++ b/pkg/clients/informers/externalversions/generic.go @@ -87,6 +87,8 @@ func (f *sharedInformerFactory) ForResource(resource schema.GroupVersionResource return &genericInformer{resource: resource.GroupResource(), informer: f.Openstack().V1alpha1().Services().Informer()}, nil case v1alpha1.SchemeGroupVersion.WithResource("subnets"): return &genericInformer{resource: resource.GroupResource(), informer: f.Openstack().V1alpha1().Subnets().Informer()}, nil + case v1alpha1.SchemeGroupVersion.WithResource("trunks"): + return &genericInformer{resource: resource.GroupResource(), informer: f.Openstack().V1alpha1().Trunks().Informer()}, nil case v1alpha1.SchemeGroupVersion.WithResource("volumes"): return &genericInformer{resource: resource.GroupResource(), informer: f.Openstack().V1alpha1().Volumes().Informer()}, nil case v1alpha1.SchemeGroupVersion.WithResource("volumetypes"): diff --git a/pkg/clients/listers/api/v1alpha1/expansion_generated.go b/pkg/clients/listers/api/v1alpha1/expansion_generated.go index 1380d0372..722c92a5b 100644 --- a/pkg/clients/listers/api/v1alpha1/expansion_generated.go +++ b/pkg/clients/listers/api/v1alpha1/expansion_generated.go @@ -154,6 +154,14 @@ type SubnetListerExpansion interface{} // SubnetNamespaceLister. type SubnetNamespaceListerExpansion interface{} +// TrunkListerExpansion allows custom methods to be added to +// TrunkLister. +type TrunkListerExpansion interface{} + +// TrunkNamespaceListerExpansion allows custom methods to be added to +// TrunkNamespaceLister. +type TrunkNamespaceListerExpansion interface{} + // VolumeListerExpansion allows custom methods to be added to // VolumeLister. type VolumeListerExpansion interface{} diff --git a/pkg/clients/listers/api/v1alpha1/trunk.go b/pkg/clients/listers/api/v1alpha1/trunk.go new file mode 100644 index 000000000..bd1a34270 --- /dev/null +++ b/pkg/clients/listers/api/v1alpha1/trunk.go @@ -0,0 +1,70 @@ +/* +Copyright The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +// Code generated by lister-gen. DO NOT EDIT. + +package v1alpha1 + +import ( + apiv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1" + labels "k8s.io/apimachinery/pkg/labels" + listers "k8s.io/client-go/listers" + cache "k8s.io/client-go/tools/cache" +) + +// TrunkLister helps list Trunks. +// All objects returned here must be treated as read-only. +type TrunkLister interface { + // List lists all Trunks in the indexer. + // Objects returned here must be treated as read-only. + List(selector labels.Selector) (ret []*apiv1alpha1.Trunk, err error) + // Trunks returns an object that can list and get Trunks. + Trunks(namespace string) TrunkNamespaceLister + TrunkListerExpansion +} + +// trunkLister implements the TrunkLister interface. +type trunkLister struct { + listers.ResourceIndexer[*apiv1alpha1.Trunk] +} + +// NewTrunkLister returns a new TrunkLister. +func NewTrunkLister(indexer cache.Indexer) TrunkLister { + return &trunkLister{listers.New[*apiv1alpha1.Trunk](indexer, apiv1alpha1.Resource("trunk"))} +} + +// Trunks returns an object that can list and get Trunks. +func (s *trunkLister) Trunks(namespace string) TrunkNamespaceLister { + return trunkNamespaceLister{listers.NewNamespaced[*apiv1alpha1.Trunk](s.ResourceIndexer, namespace)} +} + +// TrunkNamespaceLister helps list and get Trunks. +// All objects returned here must be treated as read-only. +type TrunkNamespaceLister interface { + // List lists all Trunks in the indexer for a given namespace. + // Objects returned here must be treated as read-only. + List(selector labels.Selector) (ret []*apiv1alpha1.Trunk, err error) + // Get retrieves the Trunk from the indexer for a given namespace and name. + // Objects returned here must be treated as read-only. + Get(name string) (*apiv1alpha1.Trunk, error) + TrunkNamespaceListerExpansion +} + +// trunkNamespaceLister implements the TrunkNamespaceLister +// interface. +type trunkNamespaceLister struct { + listers.ResourceIndexer[*apiv1alpha1.Trunk] +} diff --git a/website/docs/crd-reference.md b/website/docs/crd-reference.md index da7cd698d..9cb4811e6 100644 --- a/website/docs/crd-reference.md +++ b/website/docs/crd-reference.md @@ -27,6 +27,7 @@ Package v1alpha1 contains API Schema definitions for the openstack v1alpha1 API - [ServerGroup](#servergroup) - [Service](#service) - [Subnet](#subnet) +- [Trunk](#trunk) - [Volume](#volume) - [VolumeType](#volumetype) @@ -179,6 +180,7 @@ _Appears in:_ - [ServerSpec](#serverspec) - [ServiceSpec](#servicespec) - [SubnetSpec](#subnetspec) +- [TrunkSpec](#trunkspec) - [VolumeSpec](#volumespec) - [VolumeTypeSpec](#volumetypespec) @@ -419,6 +421,7 @@ _Appears in:_ - [RouterFilter](#routerfilter) - [SecurityGroupFilter](#securitygroupfilter) - [SubnetFilter](#subnetfilter) +- [TrunkFilter](#trunkfilter) | Field | Description | Default | Validation | | --- | --- | --- | --- | @@ -1632,6 +1635,9 @@ _Appears in:_ - [ServerVolumeSpec](#servervolumespec) - [SubnetFilter](#subnetfilter) - [SubnetResourceSpec](#subnetresourcespec) +- [TrunkFilter](#trunkfilter) +- [TrunkResourceSpec](#trunkresourcespec) +- [TrunkSubportSpec](#trunksubportspec) - [UserDataSpec](#userdataspec) - [VolumeResourceSpec](#volumeresourcespec) @@ -1692,6 +1698,7 @@ _Appears in:_ - [ServerSpec](#serverspec) - [ServiceSpec](#servicespec) - [SubnetSpec](#subnetspec) +- [TrunkSpec](#trunkspec) - [VolumeSpec](#volumespec) - [VolumeTypeSpec](#volumetypespec) @@ -1726,6 +1733,7 @@ _Appears in:_ - [ServerSpec](#serverspec) - [ServiceSpec](#servicespec) - [SubnetSpec](#subnetspec) +- [TrunkSpec](#trunkspec) - [VolumeSpec](#volumespec) - [VolumeTypeSpec](#volumetypespec) @@ -1918,6 +1926,8 @@ _Appears in:_ - [SecurityGroupRule](#securitygrouprule) - [SubnetFilter](#subnetfilter) - [SubnetResourceSpec](#subnetresourcespec) +- [TrunkFilter](#trunkfilter) +- [TrunkResourceSpec](#trunkresourcespec) @@ -1935,6 +1945,7 @@ _Appears in:_ - [PortResourceStatus](#portresourcestatus) - [SecurityGroupResourceStatus](#securitygroupresourcestatus) - [SubnetResourceStatus](#subnetresourcestatus) +- [TrunkResourceStatus](#trunkresourcestatus) | Field | Description | Default | Validation | | --- | --- | --- | --- | @@ -1968,6 +1979,8 @@ _Appears in:_ - [SecurityGroupResourceSpec](#securitygroupresourcespec) - [SubnetFilter](#subnetfilter) - [SubnetResourceSpec](#subnetresourcespec) +- [TrunkFilter](#trunkfilter) +- [TrunkResourceSpec](#trunkresourcespec) @@ -2025,6 +2038,8 @@ _Appears in:_ - [ServiceResourceSpec](#serviceresourcespec) - [SubnetFilter](#subnetfilter) - [SubnetResourceSpec](#subnetresourcespec) +- [TrunkFilter](#trunkfilter) +- [TrunkResourceSpec](#trunkresourcespec) - [VolumeFilter](#volumefilter) - [VolumeResourceSpec](#volumeresourcespec) - [VolumeTypeFilter](#volumetypefilter) @@ -3781,6 +3796,196 @@ _Appears in:_ | `resource` _[SubnetResourceStatus](#subnetresourcestatus)_ | resource contains the observed state of the OpenStack resource. | | | +#### Trunk + + + +Trunk is the Schema for an ORC resource. + + + + + +| Field | Description | Default | Validation | +| --- | --- | --- | --- | +| `apiVersion` _string_ | `openstack.k-orc.cloud/v1alpha1` | | | +| `kind` _string_ | `Trunk` | | | +| `metadata` _[ObjectMeta](https://kubernetes.io/docs/reference/generated/kubernetes-api/v1.29/#objectmeta-v1-meta)_ | Refer to Kubernetes API documentation for fields of `metadata`. | | | +| `spec` _[TrunkSpec](#trunkspec)_ | spec specifies the desired state of the resource. | | | +| `status` _[TrunkStatus](#trunkstatus)_ | status defines the observed state of the resource. | | | + + +#### TrunkFilter + + + +TrunkFilter defines an existing resource by its properties + +_Validation:_ +- MinProperties: 1 + +_Appears in:_ +- [TrunkImport](#trunkimport) + +| Field | Description | Default | Validation | +| --- | --- | --- | --- | +| `name` _[OpenStackName](#openstackname)_ | name of the existing resource | | MaxLength: 255
MinLength: 1
Pattern: `^[^,]+$`
| +| `description` _[NeutronDescription](#neutrondescription)_ | description of the existing resource | | MaxLength: 255
MinLength: 1
| +| `portRef` _[KubernetesNameRef](#kubernetesnameref)_ | portRef is a reference to the ORC Port which this resource is associated with. | | MaxLength: 253
MinLength: 1
| +| `projectRef` _[KubernetesNameRef](#kubernetesnameref)_ | projectRef is a reference to the ORC Project which this resource is associated with. | | MaxLength: 253
MinLength: 1
| +| `status` _string_ | status indicates whether the trunk is currently operational. Possible values include
`ACTIVE', `DOWN', `BUILD', `DEGRADED' or `ERROR'. Plug-ins might define additional values. | | MaxLength: 1024
| +| `adminStateUp` _boolean_ | adminStateUp is the administrative state of the trunk. | | | +| `tags` _[NeutronTag](#neutrontag) array_ | tags is a list of tags to filter by. If specified, the resource must
have all of the tags specified to be included in the result. | | MaxItems: 64
MaxLength: 255
MinLength: 1
| +| `tagsAny` _[NeutronTag](#neutrontag) array_ | tagsAny is a list of tags to filter by. If specified, the resource
must have at least one of the tags specified to be included in the
result. | | MaxItems: 64
MaxLength: 255
MinLength: 1
| +| `notTags` _[NeutronTag](#neutrontag) array_ | notTags is a list of tags to filter by. If specified, resources which
contain all of the given tags will be excluded from the result. | | MaxItems: 64
MaxLength: 255
MinLength: 1
| +| `notTagsAny` _[NeutronTag](#neutrontag) array_ | notTagsAny is a list of tags to filter by. If specified, resources
which contain any of the given tags will be excluded from the result. | | MaxItems: 64
MaxLength: 255
MinLength: 1
| + + +#### TrunkImport + + + +TrunkImport specifies an existing resource which will be imported instead of +creating a new one + +_Validation:_ +- MaxProperties: 1 +- MinProperties: 1 + +_Appears in:_ +- [TrunkSpec](#trunkspec) + +| Field | Description | Default | Validation | +| --- | --- | --- | --- | +| `id` _string_ | id contains the unique identifier of an existing OpenStack resource. Note
that when specifying an import by ID, the resource MUST already exist.
The ORC object will enter an error state if the resource does not exist. | | Format: uuid
| +| `filter` _[TrunkFilter](#trunkfilter)_ | filter contains a resource query which is expected to return a single
result. The controller will continue to retry if filter returns no
results. If filter returns multiple results the controller will set an
error state and will not continue to retry. | | MinProperties: 1
| + + +#### TrunkResourceSpec + + + +TrunkResourceSpec contains the desired state of the resource. + + + +_Appears in:_ +- [TrunkSpec](#trunkspec) + +| Field | Description | Default | Validation | +| --- | --- | --- | --- | +| `name` _[OpenStackName](#openstackname)_ | name will be the name of the created resource. If not specified, the
name of the ORC object will be used. | | MaxLength: 255
MinLength: 1
Pattern: `^[^,]+$`
| +| `description` _[NeutronDescription](#neutrondescription)_ | description is a human-readable description for the resource. | | MaxLength: 255
MinLength: 1
| +| `portRef` _[KubernetesNameRef](#kubernetesnameref)_ | portRef is a reference to the ORC Port which this resource is associated with. | | MaxLength: 253
MinLength: 1
| +| `projectRef` _[KubernetesNameRef](#kubernetesnameref)_ | projectRef is a reference to the ORC Project which this resource is associated with. | | MaxLength: 253
MinLength: 1
| +| `adminStateUp` _boolean_ | adminStateUp is the administrative state of the trunk. If false (down),
the trunk does not forward packets. | | | +| `subports` _[TrunkSubportSpec](#trunksubportspec) array_ | subports is the list of ports to attach to the trunk. | | MaxItems: 1024
| +| `tags` _[NeutronTag](#neutrontag) array_ | tags is a list of Neutron tags to apply to the trunk. | | MaxItems: 64
MaxLength: 255
MinLength: 1
| + + +#### TrunkResourceStatus + + + +TrunkResourceStatus represents the observed state of the resource. + + + +_Appears in:_ +- [TrunkStatus](#trunkstatus) + +| Field | Description | Default | Validation | +| --- | --- | --- | --- | +| `name` _string_ | name is a Human-readable name for the resource. Might not be unique. | | MaxLength: 1024
| +| `description` _string_ | description is a human-readable description for the resource. | | MaxLength: 1024
| +| `portID` _string_ | portID is the ID of the Port to which the resource is associated. | | MaxLength: 1024
| +| `projectID` _string_ | projectID is the ID of the Project to which the resource is associated. | | MaxLength: 1024
| +| `tenantID` _string_ | tenantID is the project owner of the trunk (alias of projectID in some deployments). | | MaxLength: 1024
| +| `status` _string_ | status indicates whether the trunk is currently operational. | | MaxLength: 1024
| +| `tags` _string array_ | tags is the list of tags on the resource. | | MaxItems: 64
items:MaxLength: 1024
| +| `createdAt` _[Time](https://kubernetes.io/docs/reference/generated/kubernetes-api/v1.29/#time-v1-meta)_ | createdAt shows the date and time when the resource was created. The date and time stamp format is ISO 8601 | | | +| `updatedAt` _[Time](https://kubernetes.io/docs/reference/generated/kubernetes-api/v1.29/#time-v1-meta)_ | updatedAt shows the date and time when the resource was updated. The date and time stamp format is ISO 8601 | | | +| `revisionNumber` _integer_ | revisionNumber optionally set via extensions/standard-attr-revisions | | | +| `adminStateUp` _boolean_ | adminStateUp is the administrative state of the trunk. | | | +| `subports` _[TrunkSubportStatus](#trunksubportstatus) array_ | subports is a list of ports associated with the trunk. | | MaxItems: 1024
| + + +#### TrunkSpec + + + +TrunkSpec defines the desired state of an ORC object. + + + +_Appears in:_ +- [Trunk](#trunk) + +| Field | Description | Default | Validation | +| --- | --- | --- | --- | +| `import` _[TrunkImport](#trunkimport)_ | import refers to an existing OpenStack resource which will be imported instead of
creating a new one. | | MaxProperties: 1
MinProperties: 1
| +| `resource` _[TrunkResourceSpec](#trunkresourcespec)_ | resource specifies the desired state of the resource.
resource may not be specified if the management policy is `unmanaged`.
resource must be specified if the management policy is `managed`. | | | +| `managementPolicy` _[ManagementPolicy](#managementpolicy)_ | managementPolicy defines how ORC will treat the object. Valid values are
`managed`: ORC will create, update, and delete the resource; `unmanaged`:
ORC will import an existing resource, and will not apply updates to it or
delete it. | managed | Enum: [managed unmanaged]
| +| `managedOptions` _[ManagedOptions](#managedoptions)_ | managedOptions specifies options which may be applied to managed objects. | | | +| `cloudCredentialsRef` _[CloudCredentialsReference](#cloudcredentialsreference)_ | cloudCredentialsRef points to a secret containing OpenStack credentials | | | + + +#### TrunkStatus + + + +TrunkStatus defines the observed state of an ORC resource. + + + +_Appears in:_ +- [Trunk](#trunk) + +| Field | Description | Default | Validation | +| --- | --- | --- | --- | +| `conditions` _[Condition](https://kubernetes.io/docs/reference/generated/kubernetes-api/v1.29/#condition-v1-meta) array_ | conditions represents the observed status of the object.
Known .status.conditions.type are: "Available", "Progressing"
Available represents the availability of the OpenStack resource. If it is
true then the resource is ready for use.
Progressing indicates whether the controller is still attempting to
reconcile the current state of the OpenStack resource to the desired
state. Progressing will be False either because the desired state has
been achieved, or because some terminal error prevents it from ever being
achieved and the controller is no longer attempting to reconcile. If
Progressing is True, an observer waiting on the resource should continue
to wait. | | MaxItems: 32
| +| `id` _string_ | id is the unique identifier of the OpenStack resource. | | | +| `resource` _[TrunkResourceStatus](#trunkresourcestatus)_ | resource contains the observed state of the OpenStack resource. | | | + + +#### TrunkSubportSpec + + + +TrunkSubportSpec represents a subport to attach to a trunk. +It maps to gophercloud's trunks.Subport. + + + +_Appears in:_ +- [TrunkResourceSpec](#trunkresourcespec) + +| Field | Description | Default | Validation | +| --- | --- | --- | --- | +| `portRef` _[KubernetesNameRef](#kubernetesnameref)_ | portRef is a reference to the ORC Port that will be attached as a subport. | | MaxLength: 253
MinLength: 1
| +| `segmentationID` _integer_ | segmentationID is the segmentation ID for the subport (e.g. VLAN ID). | | Maximum: 4094
Minimum: 1
| +| `segmentationType` _string_ | segmentationType is the segmentation type for the subport (e.g. vlan). | | Enum: [inherit vlan]
MaxLength: 32
MinLength: 1
| + + +#### TrunkSubportStatus + + + +TrunkSubportStatus represents an attached subport on a trunk. +It maps to gophercloud's trunks.Subport. + + + +_Appears in:_ +- [TrunkResourceStatus](#trunkresourcestatus) + +| Field | Description | Default | Validation | +| --- | --- | --- | --- | +| `portID` _string_ | portID is the OpenStack ID of the Port attached as a subport. | | MaxLength: 1024
| +| `segmentationID` _integer_ | segmentationID is the segmentation ID for the subport (e.g. VLAN ID). | | | +| `segmentationType` _string_ | segmentationType is the segmentation type for the subport (e.g. vlan). | | MaxLength: 1024
| + + #### UserDataSpec diff --git a/website/docs/development/writing-tests.md b/website/docs/development/writing-tests.md index 0f8c0ccbd..0beeca6d8 100644 --- a/website/docs/development/writing-tests.md +++ b/website/docs/development/writing-tests.md @@ -36,7 +36,7 @@ can specify modules that you want to test by passing the package's path, separated by a blank space, for example: ```bash -TEST_PATHS="./internal/controller/server ./internal/controller/image" make test +TEST_PATHS="./internal/controllers/server ./internal/controllers/image" make test ``` ## E2E tests